Chainer Chemistry is a deep learning framework (based on Chainer) with
applications in Biology and Chemistry. It supports various state-of-the-art
models (especially GCNN - Graph Convolutional Neural Network) for chemical property prediction.
For more information, please refer to the [documentation](http://chainer-chemistry.readthedocs.io/en/latest/index.html).
Also, a quick introduction to deep learning for molecules and Chainer Chemistry
is available [here](https://www.slideshare.net/KentaOono/deep-learning-for-molecules-introduction-to-chainer-chemistry-93288837).
## Dependencies
Chainer Chemistry depends on the following packages:
- [`chainer`](https://docs.chainer.org/en/stable/index.html)
- [`pandas`](https://pandas.pydata.org)
- [`scikit-learn`](http://scikit-learn.org/stable/)
- [`tqdm`](https://pypi.python.org/pypi/tqdm)
- [`h5py`](https://pypi.python.org/pypi/h5py)
These are automatically added to the system when installing the library via the
`pip` command (see _Installation_). However, the following needs to be
installed manually:
- [`rdkit (release 2019.03.2.0)`](https://github.com/rdkit/rdkit)
Please refer to the RDKit [documentation](http://www.rdkit.org/docs/Install.html)
for more information regarding the installation steps.
Note that only the following versions of Chainer Chemistry's dependencies are
currently supported:
| Chainer Chemistry | Chainer | RDKit | Python |
| ------------------: | --------------: | -------------: | ---------------: |
| v0.1.0 ~ v0.3.0 | v2.0 ~ v3.0 | 2017.09.3.0 | 2.7, 3.5, 3.6 |
| v0.4.0 | v3.0 ~ v4.0 *1 | 2017.09.3.0 | 2.7, 3.5, 3.6 |
| v0.5.0 | v3.0 ~ v5.0 *2 | 2017.09.3.0 | 2.7, 3.5, 3.6 |
| v0.6.0 | v6.0 ~ *3 | 2017.09.3.0 | 2.7, 3.5, 3.6 |
| v0.7.0 ~ v0.7.1 | v7.0 ~ | 2019.03.2.0 | 3.6, 3.7 *4 |
| master branch *5 | v7.0 ~ | 2019.03.2.0 | 3.6, 3.7 |
[Footnote]
*1: We used `FunctionNode` in [this PR](https://github.com/pfnet-research/chainer-chemistry/pull/190),
which is introduced after chainer v3. See [this issue](https://github.com/pfnet-research/chainer-chemistry/issues/192) for details.
*2: Saliency modules only work after chainer v5.
*3: Chainer v6 is released and [ChainerX](https://chainer.org/announcement/2018/12/03/chainerx.html) is newly introduced.
In order to support this new feature & API, we broke backward compatibility for chainer chemistry v0.6.0 release.
See [ChainerX Documentation](https://chainer.org/announcement/2018/12/03/chainerx.html) for details.
*4: python 2.x support is dropped, following the same policy with `chainer` and `rdkit`.
*5: As [announced in chainer blog](https://chainer.org/announcement/2019/12/05/released-v7.html),
further development will be limited to only serious bug-fixes and maintenance.
## Installation
Chainer Chemistry can be installed using the `pip` command, as follows:
```
pip install chainer-chemistry
```
Example to install rdkit with conda:
```bash
# newer conda version is necessary to install rdkit 2019.03.2.0
conda install -n base conda==4.6.14
conda install -c rdkit rdkit==2019.03.2.0
```
If you would like to use the latest sources, please checkout the master branch
and install with the following commands:
```
git clone https://github.com/pfnet-research/chainer-chemistry.git
pip install -e chainer-chemistry
```
## Sample Code
Sample code is provided with this repository. This includes, but is not limited
to, the following:
- Training a new model on a given dataset
- Performing inference on a given dataset, using a pretrained model
- Evaluating and reporting performance metrics of different models on a given
dataset
Please refer to the `examples` directory for more information.
## Supported Models
The following graph convolutional neural networks are currently supported:
- NFP: Neural Fingerprint [2, 3]
- GGNN: Gated Graph Neural Network [4, 3]
- WeaveNet [5, 3]
- SchNet [6]
- RSGCN: Renormalized Spectral Graph Convolutional Network [10]
\* The name is not from the original paper - see [PR #89](https://github.com/pfnet-research/chainer-chemistry/pull/89) for the naming convention.
- RelGCN: Relational Graph Convolutional Network [14]
- GAT: Graph Attention Networks [15]
- GIN: Graph Isomorphism Networks [17]
- MPNN: Message Passing Neural Networks [3]
- Set2Set [19]
- GNN-FiLM: Graph Neural Networks with Feature-wise Linear Modulation [20]
- MEGNet: MatErials Graph Network [24]
- CGCNN: Crystal Graph Convolutional Neural Networks [25]
We test supporting the brand-new Graph Warp Module (GWM) [18]-attached models for:
- NFP ('nfp_gwm')
- GGNN ('ggnn_gwm')
- RSGCN ('rsgcn_gwm')
- GIN ('gin_gwm')
In the directory `examples/molnet_wle`, we have implemented the new preprocessing ''Weisfeiler-Lehman Embedding for Molecular Graph Neural Networks'' [26] for several GNN architectures. Please find the Readme in that directory for the usage and the details.
## Supported Datasets
The following datasets are currently supported:
### Chemical
- QM9 [7, 8]
- Tox21 [9]
- MoleculeNet [11]
- ZINC (only 250k dataset) [12, 13]
- User (own) dataset
### Network
- cora [21]
- citeseer [22]
- reddit [23]
## Research Projects
If you use Chainer Chemistry in your research, feel free to submit a
pull request and add the name of your project to this list:
- BayesGrad: Explaining Predictions of Graph Convolutional Networks ([paper](https://arxiv.org/abs/1807.01985), [code](https://github.com/pfnet-research/bayesgrad))
- Graph Warp Module: an Auxiliary Module for Boosting the Power of Graph Neural Networks ([paper](https://arxiv.org/abs/1902.01020), [code](https://github.com/k-ishiguro/chainer-chemistry/tree/gwm_for_CC))
- GraphNVP: An Invertible Flow Model for Generating Molecular Graphs ([paper](https://arxiv.org/abs/1905.11600), [code](https://github.com/pfnet-research/graph-nvp))
- Graph Residual Flow for Molecular Graph Generation ([paper](https://arxiv.org/abs/1909.13521))
## Useful Links
Chainer Chemistry:
- [Documentation](https://chainer-chemistry.readthedocs.io)
- [Research Blog](https://preferredresearch.jp/2017/12/18/chainer-chemistry-beta-release/)
Other Chainer frameworks:
- [Chainer: A Flexible Framework of Neural Networks for Deep Learning](https://chainer.org/)
- [ChainerRL: Deep Reinforcement Learning Library Built on Top of Chainer](https://github.com/chainer/chainerrl)
- [ChainerCV: A Library for Deep Learning in Computer Vision](https://github.com/chainer/chainercv)
- [ChainerMN: Scalable Distributed Deep Learning with Chainer](https://github.com/chainer/chainermn)
- [ChainerUI: User Interface for Chainer](https://github.com/chainer/chainerui)
## License
This project is released under the MIT License. Please refer to the
[this page](https://github.com/pfnet-research/chainer-chemistry/blob/master/LICENSE)
for more information.
Please note that Chainer Chemistry is still in experimental development.
We continuously strive to improve its functionality and performance, but at
this stage we cannot guarantee the reproducibility of any results published in
papers. Use the library at your own risk.
## References
[1] Seiya Tokui, Kenta Oono, Shohei Hido, and Justin Clayton. Chainer: a next-generation open source framework for deep learning. In *Proceedings of Workshop on Machine Learning Systems (LearningSys) in Advances in Neural Information Processing System (NIPS) 28*, 2015.
[2] David K Duvenaud, Dougal Maclaurin, Jorge Iparraguirre, Rafael Bombarell, Timothy Hirzel, Alan Aspuru-Guzik, and Ryan P Adams. Convolutional networks on graphs for learning molecular fingerprints. In C. Cortes, N. D. Lawrence, D. D. Lee, M. Sugiyama, and R. Garnett, editors, *Advances in Neural Information Processing Systems (NIPS) 28*, pages 2224–2232. Curran Asso- ciates, Inc., 2015.
[3] Justin Gilmer, Samuel S Schoenholz, Patrick F Riley, Oriol Vinyals, and George E Dahl. Neural message passing for quantum chemistry. *arXiv preprint arXiv:1704.01212*, 2017.
[4] Yujia Li, Daniel Tarlow, Marc Brockschmidt, and Richard Zemel. Gated graph sequence neural networks. *arXiv preprint arXiv:1511.05493*, 2015.
[5] Steven Kearnes, Kevin McCloskey, Marc Berndl, Vijay Pande, and Patrick Riley. Molecular graph convolutions: moving beyond fingerprints. *Journal of computer-aided molecular design*, 30(8):595–608, 2016.
[6] Kristof Schütt, Pieter-Jan Kindermans, Huziel Enoc Sauceda Felix, Stefan Chmiela, Alexandre Tkatchenko, and Klaus-Rober Müller. Schnet: A continuous-filter convolutional neural network for modeling quantum interactions. In I. Guyon, U. V. Luxburg, S. Bengio, H. Wallach, R. Fergus, S. Vishwanathan, and R. Garnett, editors, *Advances in Neural Information Processing Systems (NIPS) 30*, pages 992–1002. Curran Associates, Inc., 2017.
[7] Lars Ruddigkeit, Ruud Van Deursen, Lorenz C Blum, and Jean-Louis Reymond. Enumeration of 166 billion organic small molecules in the chemical universe database gdb-17. *Journal of chemical information and modeling*, 52(11):2864–2875, 2012.
[8] Raghunathan Ramakrishnan, Pavlo O Dral, Matthias Rupp, and O Anatole Von Lilienfeld. Quantum chemistry structures and properties of 134 kilo molecules. *Scientific data*, 1:140022, 2014.
[9] Ruili Huang, Menghang Xia, Dac-Trung Nguyen, Tongan Zhao, Srilatha Sakamuru, Jinghua Zhao, Sampada A Shahane, Anna Rossoshek, and Anton Simeonov. Tox21challenge to build predictive models of nuclear receptor and stress response pathways as mediated by exposure to environmental chemicals and drugs. *Frontiers in Environmental Science*, 3:85, 2016.
[10] Kipf, Thomas N. and Welling, Max. Semi-Supervised Classification with Graph Convolutional Networks. *International Conference on Learning Representations (ICLR)*, 2017.
[11] Zhenqin Wu, Bharath Ramsundar, Evan N. Feinberg, Joseph Gomes, Caleb Geniesse, Aneesh S. Pappu, Karl Leswing, Vijay Pande, MoleculeNet: A Benchmark for Molecular Machine Learning, arXiv preprint, arXiv: 1703.00564, 2017.
[12] J. J. Irwin, T. Sterling, M. M. Mysinger, E. S. Bolstad, and R. G. Coleman. Zinc: a free tool to discover chemistry for biology. *Journal of chemical information and modeling*, 52(7):1757–1768, 2012.
[13] Preprocessed csv file downloaded from https://raw.githubusercontent.com/aspuru-guzik-group/chemical_vae/master/models/zinc_properties/250k_rndm_zinc_drugs_clean_3.csv
[14] Michael Schlichtkrull, Thomas N. Kipf, Peter Bloem, Rianne van den Berg, Ivan Titov, Max Welling. Modeling Relational Data with Graph Convolutional Networks. *Extended Semantic Web Conference (ESWC)*, 2018.
[15] Veličković, P., Cucurull, G., Casanova, A., Romero, A., Liò, P., & Bengio, Y. (2017). Graph Attention Networks. arXiv preprint arXiv:1710.10903.
[16] Dan Busbridge, Dane Sherburn, Pietro Cavallo and Nils Y. Hammerla. (2019). Relational Graph Attention Networks. https://openreview.net/forum?id=Bklzkh0qFm
[17] Keyulu Xu, Weihua Hu, Jure Leskovec, Stefanie Jegelka, ``How Powerful are Graph Neural Networks?'', arXiv:1810.00826 [cs.LG], 2018 (to appear at ICLR19).
[18] K. Ishiguro, S. Maeda, and M. Koyama, ``Graph Warp Module: an Auxiliary Module for Boosting the Power of Graph Neural Networks'', arXiv:1902.01020 [cs.LG], 2019.
[19] Oriol Vinyals, Samy Bengio, Manjunath Kudlur. Order Matters: Sequence to sequence for sets. *arXiv preprint arXiv:1511.06391*, 2015.
[20] Marc Brockschmidt, ``GNN-FiLM: Graph Neural Networks with Feature-wise Linear Modulation'', arXiv:1906.12192 [cs.ML], 2019.
[21] McCallum, Andrew Kachites and Nigam, Kamal and Rennie, Jason and Seymore, Kristie, Automating the Construction of Internet Portals with Machine Learning. *Information Retrieval*, 2000.
[22] C. Lee Giles and Kurt D. Bollacker and Steve Lawrence, CiteSeer: An Automatic Citation Indexing System. *Proceedings of the Third ACM Conference on Digital Libraries*, 1998.
[23] William L. Hamilton and Zhitao Ying and Jure Leskovec, Inductive Representation Learning on Large Graphs. *Advances in Neural Information Processing Systems 30: Annual Conference on Neural Information Processing Systems 2017, 4-9 December 2017*
[24] Chi Chen, Weike Ye, Yunxing Zuo, Chen Zheng, and Shyue Ping Ong. Graph networks as a universal machine learning framework for molecules and crystals. *Chemistry of Materials*, 31(9):3564–3572, 2019.
[25] Tian Xie and Jeffrey C Grossman. Crystal graph convolutional neural networks for an accurate and interpretable prediction of material properties. *Physical review letters*, 120(14):145301, 2018.
[26] Katsuhiko Ishiguro, Kenta Oono, and Kohei Hayashi, "Weisfeiler-Lehman Embedding for Molecular Graph Neural Networks", arXiv: 2006.06909, 2020. [paper link](https://arxiv.org/abs/2006.06909)
================================================
FILE: chainer_chemistry/__init__.py
================================================
import warnings
from chainer_chemistry import dataset # NOQA
try:
from chainer_chemistry import datasets # NOQA
except ImportError as e:
if 'rdkit' in e.msg:
warnings.warn(
'A module chainer_chemistry.datasets was not imported, '
'probably because RDKit is not installed. '
'To install RDKit, please follow instruction in '
'https://github.com/pfnet-research/chainer-chemistry#installation.', # NOQA
UserWarning)
else:
raise(e)
from chainer_chemistry import functions # NOQA
from chainer_chemistry import links # NOQA
from chainer_chemistry import models # NOQA
from chainer_chemistry import training # NOQA
# --- config variable definitions ---
from chainer_chemistry.config import * # NOQA
from chainer_chemistry import _version # NOQA
__version__ = _version.__version__
================================================
FILE: chainer_chemistry/_version.py
================================================
__version__ = '0.7.1'
================================================
FILE: chainer_chemistry/config.py
================================================
# --- Configuration ---
# --- Constant definitions ---
# The maximum atomic number in rdkit
MAX_ATOMIC_NUM = 117
WEAVE_DEFAULT_NUM_MAX_ATOMS = 20 # 60 # paper
================================================
FILE: chainer_chemistry/dataset/__init__.py
================================================
from chainer_chemistry.dataset.indexer import BaseFeatureIndexer # NOQA
from chainer_chemistry.dataset.indexer import BaseIndexer # NOQA
================================================
FILE: chainer_chemistry/dataset/converters/__init__.py
================================================
from chainer_chemistry.dataset.converters.cgcnn_converter import cgcnn_converter # NOQA
from chainer_chemistry.dataset.converters.concat_mols import concat_mols # NOQA
from chainer_chemistry.dataset.converters.megnet_converter import megnet_converter # NOQA
converter_method_dict = {
'ecfp': concat_mols,
'nfp': concat_mols,
'nfp_gwm': concat_mols,
'ggnn': concat_mols,
'ggnn_gwm': concat_mols,
'gin': concat_mols,
'gin_gwm': concat_mols,
'schnet': concat_mols,
'weavenet': concat_mols,
'relgcn': concat_mols,
'rsgcn': concat_mols,
'rsgcn_gwm': concat_mols,
'relgat': concat_mols,
'gnnfilm': concat_mols,
'megnet': megnet_converter,
'cgcnn': cgcnn_converter
}
================================================
FILE: chainer_chemistry/dataset/converters/cgcnn_converter.py
================================================
import numpy
import chainer
from chainer.dataset.convert import to_device
from chainer import functions
@chainer.dataset.converter()
def cgcnn_converter(batch, device=None, padding=None):
"""CGCNN converter"""
if len(batch) == 0:
raise ValueError("batch is empty")
atom_feat, nbr_feat, nbr_idx = [], [], []
batch_atom_idx, target = [], []
current_idx = 0
xp = device.xp
for element in batch:
atom_feat.append(element[0])
nbr_feat.append(element[1])
nbr_idx.append(element[2] + current_idx)
target.append(element[3])
n_atom = element[0].shape[0]
atom_idx = numpy.arange(n_atom) + current_idx
batch_atom_idx.append(atom_idx)
current_idx += n_atom
atom_feat = to_device(device, functions.concat(atom_feat, axis=0).data)
nbr_feat = to_device(device, functions.concat(nbr_feat, axis=0).data)
# Always use numpy array for batch_atom_index
# this is list of variable length array
batch_atom_idx = numpy.array(batch_atom_idx)
nbr_idx = to_device(device, functions.concat(nbr_idx, axis=0).data)
target = to_device(device, xp.asarray(target))
result = (atom_feat, nbr_feat, batch_atom_idx, nbr_idx, target)
return result
================================================
FILE: chainer_chemistry/dataset/converters/concat_mols.py
================================================
import chainer
@chainer.dataset.converter()
def concat_mols(batch, device=None, padding=0):
"""Concatenates a list of molecules into array(s).
This function converts an "array of tuples" into a "tuple of arrays".
Specifically, given a list of examples each of which consists of
a list of elements, this function first makes an array
by taking the element in the same position from each example
and concatenates them along the newly-inserted first axis
(called `batch dimension`) into one array.
It repeats this for all positions and returns the resulting arrays.
The output type depends on the type of examples in ``batch``.
For instance, consider each example consists of two arrays ``(x, y)``.
Then, this function concatenates ``x`` 's into one array, and ``y`` 's
into another array, and returns a tuple of these two arrays. Another
example: consider each example is a dictionary of two entries whose keys
are ``'x'`` and ``'y'``, respectively, and values are arrays. Then, this
function concatenates ``x`` 's into one array, and ``y`` 's into another
array, and returns a dictionary with two entries ``x`` and ``y`` whose
values are the concatenated arrays.
When the arrays to concatenate have different shapes, the behavior depends
on the ``padding`` value. If ``padding`` is ``None``, it raises an error.
Otherwise, it builds an array of the minimum shape that the
contents of all arrays can be substituted to. The padding value is then
used to the extra elements of the resulting arrays.
The current implementation is identical to
:func:`~chainer.dataset.concat_examples` of Chainer, except the default
value of the ``padding`` option is changed to ``0``.
.. admonition:: Example
>>> import numpy
>>> from chainer_chemistry.dataset.converters import concat_mols
>>> x0 = numpy.array([1, 2])
>>> x1 = numpy.array([4, 5, 6])
>>> dataset = [x0, x1]
>>> results = concat_mols(dataset)
>>> print(results)
[[1 2 0]
[4 5 6]]
.. seealso:: :func:`chainer.dataset.concat_examples`
Args:
batch (list):
A list of examples. This is typically given by a dataset
iterator.
device (int):
Device ID to which each array is sent. Negative value
indicates the host memory (CPU). If it is omitted, all arrays are
left in the original device.
padding:
Scalar value for extra elements. If this is None (default),
an error is raised on shape mismatch. Otherwise, an array of
minimum dimensionalities that can accommodate all arrays is
created, and elements outside of the examples are padded by this
value.
Returns:
Array, a tuple of arrays, or a dictionary of arrays:
The type depends on the type of each example in the batch.
"""
return chainer.dataset.concat_examples(batch, device, padding=padding)
================================================
FILE: chainer_chemistry/dataset/converters/megnet_converter.py
================================================
import chainer
from chainer.dataset.convert import to_device
@chainer.dataset.converter()
def megnet_converter(batch, device=None, padding=0):
"""MEGNet converter"""
if len(batch) == 0:
raise ValueError("batch is empty")
atom_feat, pair_feat, global_feat, target = [], [], [], []
atom_idx, pair_idx, start_idx, end_idx = [], [], [], []
batch_size = len(batch)
current_atom_idx = 0
for i in range(batch_size):
element = batch[i]
n_atom = element[0].shape[0]
n_pair = element[1].shape[0]
atom_feat.extend(element[0])
pair_feat.extend(element[1])
global_feat.append(element[2])
atom_idx.extend([i]*n_atom)
pair_idx.extend([i]*n_pair)
start_idx.extend(element[3][0] + current_atom_idx)
end_idx.extend(element[3][1] + current_atom_idx)
target.append(element[4])
current_atom_idx += n_atom
xp = device.xp
atom_feat = to_device(device, xp.asarray(atom_feat))
pair_feat = to_device(device, xp.asarray(pair_feat))
global_feat = to_device(device, xp.asarray(global_feat))
atom_idx = to_device(device, xp.asarray(atom_idx))
pair_idx = to_device(device, xp.asarray(pair_idx))
start_idx = to_device(device, xp.asarray(start_idx))
end_idx = to_device(device, xp.asarray(end_idx))
target = to_device(device, xp.asarray(target))
result = (atom_feat, pair_feat, global_feat, atom_idx, pair_idx,
start_idx, end_idx, target)
return result
================================================
FILE: chainer_chemistry/dataset/graph_dataset/__init__.py
================================================
================================================
FILE: chainer_chemistry/dataset/graph_dataset/base_graph_data.py
================================================
import numpy
import chainer
class BaseGraphData(object):
"""Base class of graph data """
def __init__(self, *args, **kwargs):
for k, v in kwargs.items():
setattr(self, k, v)
def to_device(self, device):
"""Send self to `device`
Args:
device (chainer.backend.Device): device
Returns:
self sent to `device`
"""
for k, v in self.__dict__.items():
if isinstance(v, (numpy.ndarray)):
setattr(self, k, device.send(v))
elif isinstance(v, (chainer.utils.CooMatrix)):
data = device.send(v.data.array)
row = device.send(v.row)
col = device.send(v.col)
device_coo_matrix = chainer.utils.CooMatrix(
data, row, col, v.shape, order=v.order)
setattr(self, k, device_coo_matrix)
return self
class PaddingGraphData(BaseGraphData):
"""Graph data class for padding pattern
Args:
x (numpy.ndarray): input node feature
adj (numpy.ndarray): adjacency matrix
y (int or numpy.ndarray): graph or node label
"""
def __init__(self, x=None, adj=None, super_node=None, pos=None, y=None,
**kwargs):
self.x = x
self.adj = adj
self.super_node = super_node
self.pos = pos
self.y = y
self.n_nodes = x.shape[0]
super(PaddingGraphData, self).__init__(**kwargs)
class SparseGraphData(BaseGraphData):
"""Graph data class for sparse pattern
Args:
x (numpy.ndarray): input node feature
edge_index (numpy.ndarray): sources and destinations of edges
edge_attr (numpy.ndarray): attribution of edges
y (int or numpy.ndarray): graph or node label
"""
def __init__(self, x=None, edge_index=None, edge_attr=None,
pos=None, super_node=None, y=None, **kwargs):
self.x = x
self.edge_index = edge_index
self.edge_attr = edge_attr
self.pos = pos
self.super_node = super_node
self.y = y
self.n_nodes = x.shape[0]
super(SparseGraphData, self).__init__(**kwargs)
================================================
FILE: chainer_chemistry/dataset/graph_dataset/base_graph_dataset.py
================================================
import numpy
import chainer
from chainer._backend import Device
from chainer_chemistry.dataset.graph_dataset.base_graph_data import BaseGraphData # NOQA
from chainer_chemistry.dataset.graph_dataset.feature_converters \
import batch_with_padding, batch_without_padding, concat, shift_concat, \
concat_with_padding, shift_concat_with_padding # NOQA
class BaseGraphDataset(object):
"""Base class of graph dataset (list of graph data)"""
_pattern = ''
_feature_entries = []
_feature_batch_method = []
def __init__(self, data_list, *args, **kwargs):
self.data_list = data_list
def register_feature(self, key, batch_method, skip_if_none=True):
"""Register feature with batch method
Args:
key (str): name of the feature
batch_method (function): batch method
skip_if_none (bool, optional): If true, skip if `batch_method` is
None. Defaults to True.
"""
if skip_if_none and getattr(self.data_list[0], key, None) is None:
return
self._feature_entries.append(key)
self._feature_batch_method.append(batch_method)
def update_feature(self, key, batch_method):
"""Update batch method of the feature
Args:
key (str): name of the feature
batch_method (function): batch method
"""
index = self._feature_entries.index(key)
self._feature_batch_method[index] = batch_method
def __len__(self):
return len(self.data_list)
def __getitem__(self, item):
return self.data_list[item]
def converter(self, batch, device=None):
"""Converter
Args:
batch (list[BaseGraphData]): list of graph data
device (int, optional): specifier of device. Defaults to None.
Returns:
self sent to `device`
"""
if not isinstance(device, Device):
device = chainer.get_device(device)
batch = [method(name, batch, device=device) for name, method in
zip(self._feature_entries, self._feature_batch_method)]
data = BaseGraphData(
**{key: value for key, value in zip(self._feature_entries, batch)})
return data
class PaddingGraphDataset(BaseGraphDataset):
"""Graph dataset class for padding pattern"""
_pattern = 'padding'
def __init__(self, data_list):
super(PaddingGraphDataset, self).__init__(data_list)
self.register_feature('x', batch_with_padding)
self.register_feature('adj', batch_with_padding)
self.register_feature('super_node', batch_with_padding)
self.register_feature('pos', batch_with_padding)
self.register_feature('y', batch_without_padding)
self.register_feature('n_nodes', batch_without_padding)
class SparseGraphDataset(BaseGraphDataset):
"""Graph dataset class for sparse pattern"""
_pattern = 'sparse'
def __init__(self, data_list):
super(SparseGraphDataset, self).__init__(data_list)
self.register_feature('x', concat)
self.register_feature('edge_index', shift_concat)
self.register_feature('edge_attr', concat)
self.register_feature('super_node', concat)
self.register_feature('pos', concat)
self.register_feature('y', batch_without_padding)
self.register_feature('n_nodes', batch_without_padding)
def converter(self, batch, device=None):
"""Converter
add `self.batch`, which represents the index of the graph each node
belongs to.
Args:
batch (list[BaseGraphData]): list of graph data
device (int, optional): specifier of device. Defaults to None.
Returns:
self sent to `device`
"""
data = super(SparseGraphDataset, self).converter(batch, device=device)
if not isinstance(device, Device):
device = chainer.get_device(device)
data.batch = numpy.concatenate([
numpy.full((data.x.shape[0]), i, dtype=numpy.int)
for i, data in enumerate(batch)
])
data.batch = device.send(data.batch)
return data
# for experiment
# use converter for the normal use
def converter_with_padding(self, batch, device=None):
self.update_feature('x', concat_with_padding)
self.update_feature('edge_index', shift_concat_with_padding)
data = super(SparseGraphDataset, self).converter(batch, device=device)
if not isinstance(device, Device):
device = chainer.get_device(device)
max_n_nodes = max([data.x.shape[0] for data in batch])
data.batch = numpy.concatenate([
numpy.full((max_n_nodes), i, dtype=numpy.int)
for i, data in enumerate(batch)
])
data.batch = device.send(data.batch)
return data
================================================
FILE: chainer_chemistry/dataset/graph_dataset/feature_converters.py
================================================
import numpy
from chainer.dataset.convert import _concat_arrays
def batch_with_padding(name, batch, device=None, pad=0):
"""Batch with padding (increase ndim by 1)
Args:
name (str): propaty name of graph data
batch (list[BaseGraphData]): list of base graph data
device (chainer.backend.Device, optional): device. Defaults to None.
pad (int, optional): padding value. Defaults to 0.
Returns:
BaseGraphDataset: graph dataset sent to `device`
"""
feat = _concat_arrays(
[getattr(example, name) for example in batch], pad)
return device.send(feat)
def batch_without_padding(name, batch, device=None):
"""Batch without padding (increase ndim by 1)
Args:
name (str): propaty name of graph data
batch (list[BaseGraphData]): list of base graph data
device (chainer.backend.Device, optional): device. Defaults to None.
Returns:
BaseGraphDataset: graph dataset sent to `device`
"""
feat = _concat_arrays(
[getattr(example, name) for example in batch], None)
return device.send(feat)
def concat_with_padding(name, batch, device=None, pad=0):
"""Concat without padding (ndim does not increase)
Args:
name (str): propaty name of graph data
batch (list[BaseGraphData]): list of base graph data
device (chainer.backend.Device, optional): device. Defaults to None.
pad (int, optional): padding value. Defaults to 0.
Returns:
BaseGraphDataset: graph dataset sent to `device`
"""
feat = batch_with_padding(name, batch, device=device, pad=pad)
a, b = feat.shape
return feat.reshape((a * b))
def concat(name, batch, device=None, axis=0):
"""Concat with padding (ndim does not increase)
Args:
name (str): propaty name of graph data
batch (list[BaseGraphData]): list of base graph data
device (chainer.backend.Device, optional): device. Defaults to None.
pad (int, optional): padding value. Defaults to 0.
Returns:
BaseGraphDataset: graph dataset sent to `device`
"""
feat = numpy.concatenate([getattr(data, name) for data in batch],
axis=axis)
return device.send(feat)
def shift_concat(name, batch, device=None, shift_attr='x', shift_axis=1):
"""Concat with index shift (ndim does not increase)
Concatenate graphs into a big one.
Used for sparse pattern batching.
Args:
name (str): propaty name of graph data
batch (list[BaseGraphData]): list of base graph data
device (chainer.backend.Device, optional): device. Defaults to None.
Returns:
BaseGraphDataset: graph dataset sent to `device`
"""
shift_index_array = numpy.cumsum(
numpy.array([0] + [getattr(data, shift_attr).shape[0]
for data in batch]))
feat = numpy.concatenate([
getattr(data, name) + shift_index_array[i]
for i, data in enumerate(batch)], axis=shift_axis)
return device.send(feat)
def shift_concat_with_padding(name, batch, device=None, shift_attr='x',
shift_axis=1):
"""Concat with index shift and padding (ndim does not increase)
Concatenate graphs into a big one.
Used for sparse pattern batching.
Args:
name (str): propaty name of graph data
batch (list[BaseGraphData]): list of base graph data
device (chainer.backend.Device, optional): device. Defaults to None.
Returns:
BaseGraphDataset: graph dataset sent to `device`
"""
max_n_nodes = max([data.x.shape[0] for data in batch])
shift_index_array = numpy.arange(0, len(batch) * max_n_nodes, max_n_nodes)
feat = numpy.concatenate([
getattr(data, name) + shift_index_array[i]
for i, data in enumerate(batch)], axis=shift_axis)
return device.send(feat)
================================================
FILE: chainer_chemistry/dataset/indexer.py
================================================
import numpy
import six
class ExtractBySliceNotSupportedError(Exception):
pass
class BaseIndexer(object):
"""Base class for Indexer"""
def __getitem__(self, item):
raise NotImplementedError
class BaseFeatureIndexer(BaseIndexer):
"""Base class for FeatureIndexer
FeatureIndexer can be accessed by 2-dimensional indices, axis=0 is used for
dataset index and axis=1 is used for feature index.
For example, let `features` be the instance of `BaseFeatureIndexer`, then
`features[i, j]` returns `i`-th dataset of `j`-th feature.
`features[ind]` works same with `features[ind, :]`
Note that the returned value will be numpy array, even though the
dataset is initilized with other format (e.g. list).
"""
def __init__(self, dataset):
super(BaseFeatureIndexer, self).__init__()
self.dataset = dataset
def features_length(self):
"""Returns length of features
Returns (int): feature length
"""
raise NotImplementedError
@property
def dataset_length(self):
return len(self.dataset)
@property
def shape(self):
return self.dataset_length, self.features_length()
def extract_feature_by_slice(self, slice_index, j):
"""Extracts `slice_index`-th data's `j`-th feature.
Here, `slice_index` is indices of slice object.
This method may be override to support efficient feature extraction.
If not override, `ExtractBySliceNotSupportedError` is raised by
default, and in this case `extract_feature` is used instead.
Args:
slice_index (slice): slice of data index to be extracted
j (int): `j`-th feature to be extracted
Returns: feature
"""
raise ExtractBySliceNotSupportedError
def extract_feature(self, i, j):
"""Extracts `i`-th data's `j`-th feature
Args:
i (int): `i`-th data to be extracted
j (int): `j`-th feature to be extracted
Returns: feature
"""
raise NotImplementedError
def create_feature_index_list(self, feature_index):
if isinstance(feature_index, slice):
feature_index_list = numpy.arange(
*feature_index.indices(self.features_length())
)
elif isinstance(feature_index, (list, numpy.ndarray)):
if isinstance(feature_index[0],
(bool, numpy.bool, numpy.bool_)):
if len(feature_index) != self.features_length():
raise ValueError('Feature index wrong length {} instead of'
' {}'.format(len(feature_index),
self.features_length()))
feature_index_list = numpy.argwhere(feature_index
).ravel()
else:
feature_index_list = feature_index
else:
# assuming int type
feature_index_list = [feature_index]
return feature_index_list
def preprocess(self, item):
pass
def postprocess(self, item):
pass
def __getitem__(self, item):
self.preprocess(item)
if isinstance(item, tuple):
index_dim = len(item)
# multi dimensional access
if index_dim == 1:
# This is not unexpected case...
data_index = item[0]
feature_index_list = self.create_feature_index_list(
slice(None)
)
elif index_dim == 2:
data_index, feature_index = item
feature_index_list = self.create_feature_index_list(
feature_index
)
else:
raise IndexError('too many indices for features')
else:
data_index = item
feature_index_list = self.create_feature_index_list(slice(None))
if len(feature_index_list) == 1:
self._extract_single_feature = True
ret = self._extract_feature(data_index, feature_index_list[0])
else:
self._extract_single_feature = False
ret = tuple([self._extract_feature(data_index, j) for j in
feature_index_list])
self.postprocess(item)
return ret
def check_type_feature_index(self, j):
if j >= self.features_length():
raise IndexError('index {} is out of bounds for axis 1 with '
'size {}'.format(j, self.features_length()))
def _extract_feature(self, data_index, j):
"""Format `data_index` and call proper method to extract feature.
Args:
data_index (int, slice, list or numpy.ndarray):
j (int or key):
"""
self.check_type_feature_index(j)
if isinstance(data_index, slice):
try:
return self.extract_feature_by_slice(data_index, j)
except ExtractBySliceNotSupportedError:
# Accessing by each index, copy occurs
current, stop, step = data_index.indices(self.dataset_length)
res = [self.extract_feature(i, j) for i in
six.moves.range(current, stop, step)]
elif isinstance(data_index, (list, numpy.ndarray)):
if len(data_index) == 0:
try:
# HACKING
return self.extract_feature_by_slice(slice(0, 0, 1), j)
except ExtractBySliceNotSupportedError:
res = []
else:
if isinstance(data_index[0], (bool, numpy.bool, numpy.bool_)):
# Access by bool flag list
if len(data_index) != self.dataset_length:
raise ValueError(
'Feature index wrong length {} instead of'
' {}'.format(len(data_index),
self.dataset_length))
data_index = numpy.argwhere(data_index).ravel()
res = [self.extract_feature(i, j) for i in data_index]
else:
# `data_index` is expected to be `int`
return self.extract_feature(data_index, j)
try:
feature = numpy.asarray(res)
except ValueError:
feature = numpy.empty(len(res), dtype=object)
feature[:] = res[:]
return feature
================================================
FILE: chainer_chemistry/dataset/indexers/__init__.py
================================================
from chainer_chemistry.dataset.indexers.numpy_tuple_dataset_feature_indexer import NumpyTupleDatasetFeatureIndexer # NOQA
================================================
FILE: chainer_chemistry/dataset/indexers/numpy_tuple_dataset_feature_indexer.py
================================================
from chainer_chemistry.dataset.indexer import BaseFeatureIndexer
class NumpyTupleDatasetFeatureIndexer(BaseFeatureIndexer):
"""FeatureIndexer for NumpyTupleDataset
Args:
dataset (NumpyTupleDataset): dataset instance
"""
def __init__(self, dataset):
super(NumpyTupleDatasetFeatureIndexer, self).__init__(dataset)
self.datasets = dataset.get_datasets()
def features_length(self):
return len(self.datasets)
def extract_feature_by_slice(self, slice_index, j):
return self.datasets[j][slice_index]
def extract_feature(self, i, j):
return self.datasets[j][i]
================================================
FILE: chainer_chemistry/dataset/networkx_preprocessors/base_networkx.py
================================================
import networkx
import numpy
import chainer
from chainer_chemistry.dataset.graph_dataset.base_graph_dataset import PaddingGraphDataset, SparseGraphDataset # NOQA
from chainer_chemistry.dataset.graph_dataset.base_graph_data import PaddingGraphData, SparseGraphData # NOQA
from chainer_chemistry.dataset.graph_dataset.feature_converters import batch_without_padding # NOQA
class BaseNetworkxPreprocessor(object):
"""Base class to preprocess `Networkx::Graph` object"""
def __init__(self, *args, **kwargs):
pass
def get_x(self, graph):
if 'x' in graph.graph:
x = graph.graph['x']
else:
feature_dim, = graph.nodes[0]['x'].shape
x = numpy.empty((graph.number_of_nodes(), feature_dim),
dtype=numpy.float32)
for v, data in graph.nodes.data():
x[v] = data['x']
return x
def get_y(self, graph):
if 'y' in graph.graph:
y = graph.graph['y']
else:
y = numpy.empty(graph.number_of_nodes(), dtype=numpy.int32)
for v, data in graph.nodes.data():
y[v] = data['y']
return y
class BasePaddingNetworkxPreprocessor(BaseNetworkxPreprocessor):
"""Base class to preprocess `Networkx::Graph` into `PaddingGraphDataset`
""" # NOQA
def __init__(self, use_coo=False, *args, **kwargs):
self.use_coo = use_coo
def construct_data(self, graph):
"""Construct `PaddingGraphData` from `Networkx::Graph`
Args:
graph (Networkx::Graph): graph
Returns:
PaddingGraphData: graph data of padding pattern
"""
if not self.use_coo:
return PaddingGraphData(
x=self.get_x(graph),
adj=networkx.to_numpy_array(graph, dtype=numpy.float32),
y=self.get_y(graph),
label_num=graph.graph['label_num']
)
n_edges = graph.number_of_edges() * 2
row = numpy.empty((n_edges), dtype=numpy.int)
col = numpy.empty((n_edges), dtype=numpy.int)
data = numpy.ones((n_edges), dtype=numpy.float32)
for i, edge in enumerate(graph.edges):
row[2 * i] = edge[0]
row[2 * i + 1] = edge[1]
col[2 * i] = edge[1]
col[2 * i + 1] = edge[0]
# ensure row is sorted
if not numpy.all(row[:-1] <= row[1:]):
order = numpy.argsort(row)
row = row[order]
col = col[order]
assert numpy.all(row[:-1] <= row[1:])
adj = chainer.utils.CooMatrix(
data=data, row=row, col=col,
shape=(graph.number_of_nodes(), graph.number_of_nodes()),
order='C')
return PaddingGraphData(
x=self.get_x(graph),
adj=adj,
y=self.get_y(graph),
label_num=graph.graph['label_num']
)
def create_dataset(self, graph_list):
"""Create `PaddingGraphDataset` from list of `Networkx::Graph`
Args:
graph_list (list[Networkx::Graph]): list of graphs
Returns:
PaddingGraphDataset: graph dataset of padding pattern
"""
data_list = [
self.construct_data(graph) for graph in graph_list
]
dataset = PaddingGraphDataset(data_list)
dataset.register_feature('label_num', batch_without_padding)
return dataset
class BaseSparseNetworkxPreprocessor(BaseNetworkxPreprocessor):
"""Base class to preprocess `Networkx::Graph` into `SparseGraphDataset`
"""
def construct_data(self, graph):
"""Construct `SparseGraphData` from `Networkx::Graph`
Args:
graph (Networkx::Graph): graph
Returns:
SparseGraphData: graph data of sparse pattern
"""
edge_index = numpy.empty((2, graph.number_of_edges() * 2),
dtype=numpy.int)
for i, edge in enumerate(graph.edges):
edge_index[0][2 * i] = edge[0]
edge_index[0][2 * i + 1] = edge[1]
edge_index[1][2 * i] = edge[1]
edge_index[1][2 * i + 1] = edge[0]
return SparseGraphData(
x=self.get_x(graph),
edge_index=numpy.array(edge_index, dtype=numpy.int),
y=self.get_y(graph),
label_num=graph.graph['label_num']
)
def add_self_loop(self, graph):
for v in range(graph.number_of_nodes()):
graph.add_edge(v, v)
return graph
def create_dataset(self, graph_list):
"""Create `SparseGraphDataset` from list of `Networkx::Graph`
Args:
graph_list (list[Networkx::Graph]): list of graphs
Returns:
SparseGraphDataset: graph dataset of sparse pattern
"""
data_list = [
self.construct_data(graph) for graph in graph_list
]
dataset = SparseGraphDataset(data_list)
dataset.register_feature('label_num', batch_without_padding)
return dataset
================================================
FILE: chainer_chemistry/dataset/networkx_preprocessors/reddit_coo.py
================================================
import os
import numpy
import scipy
import chainer
from chainer_chemistry.dataset.graph_dataset.base_graph_data import PaddingGraphData # NOQA
def get_reddit_coo_data(dirpath):
"""Temporary function to obtain reddit coo data for GIN
(because it takes to much time to convert it to networkx)
Returns:
PaddingGraphData: `PaddingGraphData` of reddit
"""
print("Loading node feature and label")
reddit_data = numpy.load(os.path.join(dirpath, "reddit_data.npz"))
print("Loading edge data")
coo_adj = scipy.sparse.load_npz(os.path.join(dirpath, "reddit_graph.npz"))
row = coo_adj.row.astype(numpy.int32)
col = coo_adj.col.astype(numpy.int32)
data = coo_adj.data.astype(numpy.float32)
# ensure row is sorted
if not numpy.all(row[:-1] <= row[1:]):
order = numpy.argsort(row)
row = row[order]
col = col[order]
assert numpy.all(row[:-1] <= row[1:])
adj = chainer.utils.CooMatrix(
data=data, row=row, col=col,
shape=coo_adj.shape,
order='C')
return PaddingGraphData(
x=reddit_data['feature'].astype(numpy.float32),
adj=adj,
y=reddit_data['label'].astype(numpy.int32),
label_num=41
)
================================================
FILE: chainer_chemistry/dataset/parsers/__init__.py
================================================
from chainer_chemistry.dataset.parsers import base_parser # NOQA
from chainer_chemistry.dataset.parsers import csv_file_parser # NOQA
from chainer_chemistry.dataset.parsers import data_frame_parser # NOQA
from chainer_chemistry.dataset.parsers import sdf_file_parser # NOQA
from chainer_chemistry.dataset.parsers import smiles_parser # NOQA
from chainer_chemistry.dataset.parsers.base_parser import BaseFileParser # NOQA
from chainer_chemistry.dataset.parsers.base_parser import BaseParser # NOQA
from chainer_chemistry.dataset.parsers.csv_file_parser import CSVFileParser # NOQA
from chainer_chemistry.dataset.parsers.data_frame_parser import DataFrameParser # NOQA
from chainer_chemistry.dataset.parsers.sdf_file_parser import SDFFileParser # NOQA
from chainer_chemistry.dataset.parsers.smiles_parser import SmilesParser # NOQA
================================================
FILE: chainer_chemistry/dataset/parsers/base_parser.py
================================================
class BaseParser(object):
def __init__(self):
pass
class BaseFileParser(BaseParser):
"""base class for file parser"""
def __init__(self, preprocessor):
super(BaseFileParser, self).__init__()
self.preprocessor = preprocessor
def parse(self, filepath):
raise NotImplementedError
================================================
FILE: chainer_chemistry/dataset/parsers/csv_file_parser.py
================================================
import pandas
from chainer_chemistry.dataset.parsers.data_frame_parser import DataFrameParser
class CSVFileParser(DataFrameParser):
"""csv file parser
This FileParser parses .csv file.
It should contain column which contain SMILES as input, and
label column which is the target to predict.
Args:
preprocessor (BasePreprocessor): preprocessor instance
labels (str or list): labels column
smiles_col (str): smiles column
postprocess_label (Callable): post processing function if necessary
postprocess_fn (Callable): post processing function if necessary
logger:
"""
def __init__(self, preprocessor,
labels=None,
smiles_col='smiles',
postprocess_label=None, postprocess_fn=None,
logger=None):
super(CSVFileParser, self).__init__(
preprocessor, labels=labels, smiles_col=smiles_col,
postprocess_label=postprocess_label, postprocess_fn=postprocess_fn,
logger=logger)
def parse(self, filepath, return_smiles=False, target_index=None,
return_is_successful=False):
"""parse csv file using `preprocessor`
Label is extracted from `labels` columns and input features are
extracted from smiles information in `smiles` column.
Args:
filepath (str): file path to be parsed.
return_smiles (bool): If set to True, this function returns
preprocessed dataset and smiles list.
If set to False, this function returns preprocessed dataset and
`None`.
target_index (list or None): target index list to partially extract
dataset. If None (default), all examples are parsed.
return_is_successful (bool): If set to `True`, boolean list is
returned in the key 'is_successful'. It represents
preprocessing has succeeded or not for each SMILES.
If set to False, `None` is returned in the key 'is_success'.
Returns (dict): dictionary that contains Dataset, 1-d numpy array with
dtype=object(string) which is a vector of smiles for each example
or None.
"""
df = pandas.read_csv(filepath)
return super(CSVFileParser, self).parse(
df, return_smiles=return_smiles, target_index=target_index,
return_is_successful=return_is_successful)
def extract_total_num(self, filepath):
"""Extracts total number of data which can be parsed
We can use this method to determine the value fed to `target_index`
option of `parse` method. For example, if we want to extract input
feature from 10% of whole dataset, we need to know how many samples
are in a file. The returned value of this method may not to be same as
the final dataset size.
Args:
filepath (str): file path of to check the total number.
Returns (int): total number of dataset can be parsed.
"""
df = pandas.read_csv(filepath)
return len(df)
================================================
FILE: chainer_chemistry/dataset/parsers/data_frame_parser.py
================================================
from logging import getLogger
import numpy
from rdkit import Chem
from tqdm import tqdm
from chainer_chemistry.dataset.parsers.base_parser import BaseFileParser
from chainer_chemistry.dataset.preprocessors.common import MolFeatureExtractionError # NOQA
from chainer_chemistry.dataset.preprocessors.mol_preprocessor import MolPreprocessor # NOQA
import traceback
class DataFrameParser(BaseFileParser):
"""data frame parser
This FileParser parses pandas dataframe.
It should contain column which contain SMILES as input, and
label column which is the target to predict.
Args:
preprocessor (BasePreprocessor): preprocessor instance
labels (str or list or None): labels column
smiles_col (str): smiles column
postprocess_label (Callable): post processing function if necessary
postprocess_fn (Callable): post processing function if necessary
logger:
"""
def __init__(self, preprocessor,
labels=None,
smiles_col='smiles',
postprocess_label=None, postprocess_fn=None,
logger=None):
super(DataFrameParser, self).__init__(preprocessor)
if isinstance(labels, str):
labels = [labels, ]
self.labels = labels # type: list
self.smiles_col = smiles_col
self.postprocess_label = postprocess_label
self.postprocess_fn = postprocess_fn
self.logger = logger or getLogger(__name__)
def parse(self, df, return_smiles=False, target_index=None,
return_is_successful=False):
"""parse DataFrame using `preprocessor`
Label is extracted from `labels` columns and input features are
extracted from smiles information in `smiles` column.
Args:
df (pandas.DataFrame): dataframe to be parsed.
return_smiles (bool): If set to `True`, smiles list is returned in
the key 'smiles', it is a list of SMILES from which input
features are successfully made.
If set to `False`, `None` is returned in the key 'smiles'.
target_index (list or None): target index list to partially extract
dataset. If None (default), all examples are parsed.
return_is_successful (bool): If set to `True`, boolean list is
returned in the key 'is_successful'. It represents
preprocessing has succeeded or not for each SMILES.
If set to False, `None` is returned in the key 'is_success'.
Returns (dict): dictionary that contains Dataset, 1-d numpy array with
dtype=object(string) which is a vector of smiles for each example
or None.
"""
logger = self.logger
pp = self.preprocessor
smiles_list = []
is_successful_list = []
# counter = 0
if isinstance(pp, MolPreprocessor):
if target_index is not None:
df = df.iloc[target_index]
features = None
smiles_index = df.columns.get_loc(self.smiles_col)
if self.labels is None:
labels_index = [] # dummy list
else:
labels_index = [df.columns.get_loc(c) for c in self.labels]
total_count = df.shape[0]
fail_count = 0
success_count = 0
for row in tqdm(df.itertuples(index=False), total=df.shape[0]):
smiles = row[smiles_index]
# TODO(Nakago): Check.
# currently it assumes list
labels = [row[i] for i in labels_index]
try:
mol = Chem.MolFromSmiles(smiles)
if mol is None:
fail_count += 1
if return_is_successful:
is_successful_list.append(False)
continue
# Note that smiles expression is not unique.
# we obtain canonical smiles
canonical_smiles, mol = pp.prepare_smiles_and_mol(mol)
input_features = pp.get_input_features(mol)
# Extract label
if self.postprocess_label is not None:
labels = self.postprocess_label(labels)
if return_smiles:
smiles_list.append(canonical_smiles)
except MolFeatureExtractionError as e: # NOQA
# This is expected error that extracting feature failed,
# skip this molecule.
fail_count += 1
if return_is_successful:
is_successful_list.append(False)
continue
except Exception as e:
logger.warning('parse(), type: {}, {}'
.format(type(e).__name__, e.args))
logger.info(traceback.format_exc())
fail_count += 1
if return_is_successful:
is_successful_list.append(False)
continue
# Initialize features: list of list
if features is None:
if isinstance(input_features, tuple):
num_features = len(input_features)
else:
num_features = 1
if self.labels is not None:
num_features += 1
features = [[] for _ in range(num_features)]
if isinstance(input_features, tuple):
for i in range(len(input_features)):
features[i].append(input_features[i])
else:
features[0].append(input_features)
if self.labels is not None:
features[len(features) - 1].append(labels)
success_count += 1
if return_is_successful:
is_successful_list.append(True)
ret = []
for feature in features:
try:
feat_array = numpy.asarray(feature)
except ValueError:
# Temporal work around.
# See,
# https://stackoverflow.com/questions/26885508/why-do-i-get-error-trying-to-cast-np-arraysome-list-valueerror-could-not-broa
feat_array = numpy.empty(len(feature), dtype=numpy.ndarray)
feat_array[:] = feature[:]
ret.append(feat_array)
result = tuple(ret)
logger.info('Preprocess finished. FAIL {}, SUCCESS {}, TOTAL {}'
.format(fail_count, success_count, total_count))
else:
raise NotImplementedError
smileses = numpy.array(
smiles_list, dtype=object) if return_smiles else None
if return_is_successful:
is_successful = numpy.array(is_successful_list)
else:
is_successful = None
if isinstance(result, tuple):
if self.postprocess_fn is not None:
result = self.postprocess_fn(*result)
dataset = pp.create_dataset(*result)
else:
if self.postprocess_fn is not None:
result = self.postprocess_fn(result)
dataset = pp.create_dataset(*result)
return {"dataset": dataset,
"smiles": smileses,
"is_successful": is_successful}
def extract_total_num(self, df):
"""Extracts total number of data which can be parsed
We can use this method to determine the value fed to `target_index`
option of `parse` method. For example, if we want to extract input
feature from 10% of whole dataset, we need to know how many samples
are in a file. The returned value of this method may not to be same as
the final dataset size.
Args:
df (pandas.DataFrame): dataframe to be parsed.
Returns (int): total number of dataset can be parsed.
"""
return len(df)
================================================
FILE: chainer_chemistry/dataset/parsers/sdf_file_parser.py
================================================
from logging import getLogger
import numpy
from rdkit import Chem
from tqdm import tqdm
from chainer_chemistry.dataset.parsers.base_parser import BaseFileParser
from chainer_chemistry.dataset.preprocessors.common import MolFeatureExtractionError # NOQA
from chainer_chemistry.dataset.preprocessors.mol_preprocessor import MolPreprocessor # NOQA
class SDFFileParser(BaseFileParser):
"""sdf file parser
Args:
preprocessor (BasePreprocessor): preprocessor instance
labels (str or list): labels column
postprocess_label (Callable): post processing function if necessary
postprocess_fn (Callable): post processing function if necessary
logger:
"""
def __init__(self, preprocessor, labels=None, postprocess_label=None,
postprocess_fn=None, logger=None):
super(SDFFileParser, self).__init__(preprocessor)
self.labels = labels
self.postprocess_label = postprocess_label
self.postprocess_fn = postprocess_fn
self.logger = logger or getLogger(__name__)
def parse(self, filepath, return_smiles=False, target_index=None,
return_is_successful=False):
"""parse sdf file using `preprocessor`
Note that label is extracted from preprocessor's method.
Args:
filepath (str): file path to be parsed.
return_smiles (bool): If set to True, this function returns
preprocessed dataset and smiles list.
If set to False, this function returns preprocessed dataset and
`None`.
target_index (list or None): target index list to partially extract
dataset. If None (default), all examples are parsed.
return_is_successful (bool): If set to `True`, boolean list is
returned in the key 'is_successful'. It represents
preprocessing has succeeded or not for each SMILES.
If set to False, `None` is returned in the key 'is_success'.
Returns (dict): dictionary that contains Dataset, 1-d numpy array with
dtype=object(string) which is a vector of smiles for each example
or None.
"""
logger = self.logger
pp = self.preprocessor
smiles_list = []
is_successful_list = []
if isinstance(pp, MolPreprocessor):
mol_supplier = Chem.SDMolSupplier(filepath)
if target_index is None:
target_index = list(range(len(mol_supplier)))
features = None
total_count = len(mol_supplier)
fail_count = 0
success_count = 0
for index in tqdm(target_index):
# `mol_supplier` does not accept numpy.integer, we must use int
mol = mol_supplier[int(index)]
if mol is None:
fail_count += 1
if return_is_successful:
is_successful_list.append(False)
continue
try:
# Labels need to be extracted from `mol` before standardize
# smiles.
if self.labels is not None:
label = pp.get_label(mol, self.labels)
if self.postprocess_label is not None:
label = self.postprocess_label(label)
# Note that smiles expression is not unique.
# we obtain canonical smiles
smiles = Chem.MolToSmiles(mol)
mol = Chem.MolFromSmiles(smiles)
canonical_smiles, mol = pp.prepare_smiles_and_mol(mol)
input_features = pp.get_input_features(mol)
# Initialize features: list of list
if features is None:
if isinstance(input_features, tuple):
num_features = len(input_features)
else:
num_features = 1
if self.labels is not None:
num_features += 1
features = [[] for _ in range(num_features)]
if return_smiles:
smiles_list.append(canonical_smiles)
except MolFeatureExtractionError as e: # NOQA
# This is expected error that extracting feature failed,
# skip this molecule.
fail_count += 1
if return_is_successful:
is_successful_list.append(False)
continue
except Exception as e:
logger.warning('parse() error, type: {}, {}'
.format(type(e).__name__, e.args))
fail_count += 1
if return_is_successful:
is_successful_list.append(False)
continue
if isinstance(input_features, tuple):
for i in range(len(input_features)):
features[i].append(input_features[i])
else:
features[0].append(input_features)
if self.labels is not None:
features[len(features) - 1].append(label)
success_count += 1
if return_is_successful:
is_successful_list.append(True)
ret = []
for feature in features:
try:
feat_array = numpy.asarray(feature)
except ValueError:
# Temporal work around to convert object-type list into
# numpy array.
# See, https://goo.gl/kgJXwb
feat_array = numpy.empty(len(feature), dtype=numpy.ndarray)
feat_array[:] = feature[:]
ret.append(feat_array)
result = tuple(ret)
logger.info('Preprocess finished. FAIL {}, SUCCESS {}, TOTAL {}'
.format(fail_count, success_count, total_count))
else:
# Spec not finalized yet for general case
result = pp.process(filepath)
smileses = numpy.array(
smiles_list, dtype=object) if return_smiles else None
if return_is_successful:
is_successful = numpy.array(is_successful_list)
else:
is_successful = None
if isinstance(result, tuple):
if self.postprocess_fn is not None:
result = self.postprocess_fn(*result)
dataset = pp.create_dataset(*result)
else:
if self.postprocess_fn is not None:
result = self.postprocess_fn(result)
dataset = pp.create_dataset(*result)
return {"dataset": dataset,
"smiles": smileses,
"is_successful": is_successful}
def extract_total_num(self, filepath):
"""Extracts total number of data which can be parsed
We can use this method to determine the value fed to `target_index`
option of `parse` method. For example, if we want to extract input
feature from 10% of whole dataset, we need to know how many samples
are in a file. The returned value of this method may not to be same as
the final dataset size.
Args:
filepath (str): file path of to check the total number.
Returns (int): total number of dataset can be parsed.
"""
mol_supplier = Chem.SDMolSupplier(filepath)
return len(mol_supplier)
================================================
FILE: chainer_chemistry/dataset/parsers/smiles_parser.py
================================================
import pandas
from chainer_chemistry.dataset.parsers.data_frame_parser import DataFrameParser
class SmilesParser(DataFrameParser):
"""smiles parser
It parses `smiles_list`, which is a list of string of smiles.
Args:
preprocessor (BasePreprocessor): preprocessor instance
postprocess_label (Callable): post processing function if necessary
postprocess_fn (Callable): post processing function if necessary
logger:
"""
def __init__(self, preprocessor,
postprocess_label=None, postprocess_fn=None,
logger=None):
super(SmilesParser, self).__init__(
preprocessor, labels=None, smiles_col='smiles',
postprocess_label=postprocess_label, postprocess_fn=postprocess_fn,
logger=logger)
def parse(self, smiles_list, return_smiles=False, target_index=None,
return_is_successful=False):
"""parse `smiles_list` using `preprocessor`
Label is extracted from `labels` columns and input features are
extracted from smiles information in `smiles` column.
Args:
smiles_list (list): list of strings of smiles
return_smiles (bool): If set to True, this function returns
preprocessed dataset and smiles list.
If set to False, this function returns preprocessed dataset and
`None`.
target_index (list or None): target index list to partially extract
dataset. If None (default), all examples are parsed.
return_is_successful (bool): If set to `True`, boolean list is
returned in the key 'is_successful'. It represents
preprocessing has succeeded or not for each SMILES.
If set to False, `None` is returned in the key 'is_success'.
Returns (dict): dictionary that contains Dataset, 1-d numpy array with
dtype=object(string) which is a vector of smiles for each example
or None.
"""
df = pandas.DataFrame({'smiles': smiles_list})
return super(SmilesParser, self).parse(
df, return_smiles=return_smiles, target_index=target_index,
return_is_successful=return_is_successful)
def extract_total_num(self, smiles_list):
"""Extracts total number of data which can be parsed
We can use this method to determine the value fed to `target_index`
option of `parse` method. For example, if we want to extract input
feature from 10% of whole dataset, we need to know how many samples
are in a file. The returned value of this method may not to be same as
the final dataset size.
Args:
smiles_list (list): list of strings of smiles
Returns (int): total number of dataset can be parsed.
"""
return len(smiles_list)
================================================
FILE: chainer_chemistry/dataset/preprocessors/__init__.py
================================================
from chainer_chemistry.dataset.preprocessors.atomic_number_preprocessor import AtomicNumberPreprocessor # NOQA
from chainer_chemistry.dataset.preprocessors.base_preprocessor import BasePreprocessor # NOQA
from chainer_chemistry.dataset.preprocessors.cgcnn_preprocessor import CGCNNPreprocessor # NOQA
from chainer_chemistry.dataset.preprocessors.common import construct_adj_matrix # NOQA
from chainer_chemistry.dataset.preprocessors.common import construct_atomic_number_array # NOQA
from chainer_chemistry.dataset.preprocessors.common import construct_discrete_edge_matrix # NOQA
from chainer_chemistry.dataset.preprocessors.common import construct_supernode_feature # NOQA
from chainer_chemistry.dataset.preprocessors.common import MolFeatureExtractionError # NOQA
from chainer_chemistry.dataset.preprocessors.common import type_check_num_atoms # NOQA
from chainer_chemistry.dataset.preprocessors.ecfp_preprocessor import ECFPPreprocessor # NOQA
from chainer_chemistry.dataset.preprocessors.ggnn_preprocessor import GGNNPreprocessor # NOQA
from chainer_chemistry.dataset.preprocessors.gin_preprocessor import GINPreprocessor, GINSparsePreprocessor # NOQA
from chainer_chemistry.dataset.preprocessors.gnnfilm_preprocessor import GNNFiLMPreprocessor # NOQA
from chainer_chemistry.dataset.preprocessors.gwm_preprocessor import GGNNGWMPreprocessor # NOQA
from chainer_chemistry.dataset.preprocessors.gwm_preprocessor import GINGWMPreprocessor # NOQA
from chainer_chemistry.dataset.preprocessors.gwm_preprocessor import NFPGWMPreprocessor # NOQA
from chainer_chemistry.dataset.preprocessors.gwm_preprocessor import RSGCNGWMPreprocessor # NOQA
from chainer_chemistry.dataset.preprocessors.megnet_preprocessor import MEGNetPreprocessor # NOQA
from chainer_chemistry.dataset.preprocessors.mol_preprocessor import MolPreprocessor # NOQA
from chainer_chemistry.dataset.preprocessors.nfp_preprocessor import NFPPreprocessor # NOQA
from chainer_chemistry.dataset.preprocessors.relgat_preprocessor import RelGATPreprocessor # NOQA
from chainer_chemistry.dataset.preprocessors.relgcn_preprocessor import RelGCNPreprocessor, RelGCNSparsePreprocessor # NOQA
from chainer_chemistry.dataset.preprocessors.rsgcn_preprocessor import RSGCNPreprocessor # NOQA
from chainer_chemistry.dataset.preprocessors.schnet_preprocessor import SchNetPreprocessor # NOQA
from chainer_chemistry.dataset.preprocessors.weavenet_preprocessor import WeaveNetPreprocessor # NOQA
preprocess_method_dict = {
'ecfp': ECFPPreprocessor,
'nfp': NFPPreprocessor,
'nfp_gwm': NFPGWMPreprocessor,
'ggnn': GGNNPreprocessor,
'ggnn_gwm': GGNNGWMPreprocessor,
'gin': GINPreprocessor,
'gin_gwm': GINGWMPreprocessor,
'schnet': SchNetPreprocessor,
'weavenet': WeaveNetPreprocessor,
'relgcn': RelGCNPreprocessor,
'rsgcn': RSGCNPreprocessor,
'rsgcn_gwm': RSGCNGWMPreprocessor,
'relgat': RelGATPreprocessor,
'relgcn_sparse': RelGCNSparsePreprocessor,
'gin_sparse': GINSparsePreprocessor,
'gnnfilm': GNNFiLMPreprocessor,
'megnet': MEGNetPreprocessor,
'cgcnn': CGCNNPreprocessor
}
================================================
FILE: chainer_chemistry/dataset/preprocessors/atomic_number_preprocessor.py
================================================
from chainer_chemistry.dataset.preprocessors.common \
import construct_atomic_number_array
from chainer_chemistry.dataset.preprocessors.common import type_check_num_atoms
from chainer_chemistry.dataset.preprocessors.mol_preprocessor \
import MolPreprocessor
class AtomicNumberPreprocessor(MolPreprocessor):
"""Atomic number Preprocessor
Args:
max_atoms (int): Max number of atoms for each molecule, if the
number of atoms is more than this value, this data is simply
ignored.
Setting negative value indicates no limit for max atoms.
out_size (int): It specifies the size of array returned by
`get_input_features`.
If the number of atoms in the molecule is less than this value,
the returned arrays is padded to have fixed size.
Setting negative value indicates do not pad returned array.
"""
def __init__(self, max_atoms=-1, out_size=-1):
super(AtomicNumberPreprocessor, self).__init__()
if max_atoms >= 0 and out_size >= 0 and max_atoms > out_size:
raise ValueError('max_atoms {} must be less or equal to '
'out_size {}'.format(max_atoms, out_size))
self.max_atoms = max_atoms
self.out_size = out_size
def get_input_features(self, mol):
"""get input features
Args:
mol (Mol):
Returns:
"""
type_check_num_atoms(mol, self.max_atoms)
atom_array = construct_atomic_number_array(mol, out_size=self.out_size)
return atom_array
================================================
FILE: chainer_chemistry/dataset/preprocessors/base_preprocessor.py
================================================
"""
Preprocessor supports feature extraction for each model (network)
"""
class BasePreprocessor(object):
"""Base class for preprocessor"""
def __init__(self):
pass
def process(self, filepath):
pass
================================================
FILE: chainer_chemistry/dataset/preprocessors/cgcnn_preprocessor.py
================================================
from logging import getLogger
import numpy
import os
import shutil
from chainer.dataset import download
from chainer_chemistry.dataset.preprocessors.mol_preprocessor import MolPreprocessor # NOQA
from chainer_chemistry.dataset.utils import GaussianDistance
from chainer_chemistry.utils import load_json
download_url = 'https://raw.githubusercontent.com/txie-93/cgcnn/master/data/sample-regression/atom_init.json' # NOQA
file_name_atom_init_json = 'atom_init.json'
_root = 'pfnet/chainer/cgcnn'
def get_atom_init_json_filepath(download_if_not_exist=True):
"""Construct a filepath which stores atom_init_json
This method check whether the file exist or not, and downloaded it if
necessary.
Args:
download_if_not_exist (bool): If `True` download dataset
if it is not downloaded yet.
Returns (str): file path for atom_init_json
"""
cache_root = download.get_dataset_directory(_root)
cache_path = os.path.join(cache_root, file_name_atom_init_json)
if not os.path.exists(cache_path) and download_if_not_exist:
logger = getLogger(__name__)
logger.info('Downloading atom_init.json...')
download_file_path = download.cached_download(download_url)
shutil.copy(download_file_path, cache_path)
return cache_path
class CGCNNPreprocessor(MolPreprocessor):
"""CGCNNPreprocessor
Args:
For Molecule: TODO
"""
def __init__(self, max_num_nbr=12, max_radius=8, expand_dim=40):
super(CGCNNPreprocessor, self).__init__()
self.max_num_nbr = max_num_nbr
self.max_radius = max_radius
self.gdf = GaussianDistance(centers=numpy.linspace(0, 8, expand_dim))
feat_dict = load_json(get_atom_init_json_filepath())
self.atom_features = {int(key): numpy.array(value,
dtype=numpy.float32)
for key, value in feat_dict.items()}
def get_input_features(self, mol):
raise NotImplementedError()
================================================
FILE: chainer_chemistry/dataset/preprocessors/common.py
================================================
"""Common preprocess method is gethered in this file"""
import numpy
from rdkit import Chem
from rdkit.Chem import rdmolops
from chainer_chemistry.config import MAX_ATOMIC_NUM
class MolFeatureExtractionError(Exception):
pass
# --- Type check ---
def type_check_num_atoms(mol, num_max_atoms=-1):
"""Check number of atoms in `mol` does not exceed `num_max_atoms`
If number of atoms in `mol` exceeds the number `num_max_atoms`, it will
raise `MolFeatureExtractionError` exception.
Args:
mol (Mol):
num_max_atoms (int): If negative value is set, not check number of
atoms.
"""
num_atoms = mol.GetNumAtoms()
if num_max_atoms >= 0 and num_atoms > num_max_atoms:
# Skip extracting feature. ignore this case.
raise MolFeatureExtractionError(
'Number of atoms in mol {} exceeds num_max_atoms {}'
.format(num_atoms, num_max_atoms))
# --- Atom preprocessing ---
def construct_atomic_number_array(mol, out_size=-1):
"""Returns atomic numbers of atoms consisting a molecule.
Args:
mol (rdkit.Chem.Mol): Input molecule.
out_size (int): The size of returned array.
If this option is negative, it does not take any effect.
Otherwise, it must be larger than the number of atoms
in the input molecules. In that case, the tail of
the array is padded with zeros.
Returns:
numpy.ndarray: an array consisting of atomic numbers
of atoms in the molecule.
"""
atom_list = [a.GetAtomicNum() for a in mol.GetAtoms()]
n_atom = len(atom_list)
if out_size < 0:
return numpy.array(atom_list, dtype=numpy.int32)
elif out_size >= n_atom:
# 'empty' padding for atom_list
# 0 represents empty place for atom
atom_array = numpy.zeros(out_size, dtype=numpy.int32)
atom_array[:n_atom] = numpy.array(atom_list, dtype=numpy.int32)
return atom_array
else:
raise ValueError('`out_size` (={}) must be negative or '
'larger than or equal to the number '
'of atoms in the input molecules (={})'
'.'.format(out_size, n_atom))
# --- Adjacency matrix preprocessing ---
def construct_adj_matrix(mol, out_size=-1, self_connection=True):
"""Returns the adjacent matrix of the given molecule.
This function returns the adjacent matrix of the given molecule.
Contrary to the specification of
:func:`rdkit.Chem.rdmolops.GetAdjacencyMatrix`,
The diagonal entries of the returned matrix are all-one.
Args:
mol (rdkit.Chem.Mol): Input molecule.
out_size (int): The size of the returned matrix.
If this option is negative, it does not take any effect.
Otherwise, it must be larger than the number of atoms
in the input molecules. In that case, the adjacent
matrix is expanded and zeros are padded to right
columns and bottom rows.
self_connection (bool): Add self connection or not.
If True, diagonal element of adjacency matrix is filled with 1.
Returns:
adj_array (numpy.ndarray): The adjacent matrix of the input molecule.
It is 2-dimensional array with shape (atoms1, atoms2), where
atoms1 & atoms2 represent from and to of the edge respectively.
If ``out_size`` is non-negative, the returned
its size is equal to that value. Otherwise,
it is equal to the number of atoms in the the molecule.
"""
adj = rdmolops.GetAdjacencyMatrix(mol)
s0, s1 = adj.shape
if s0 != s1:
raise ValueError('The adjacent matrix of the input molecule'
'has an invalid shape: ({}, {}). '
'It must be square.'.format(s0, s1))
if self_connection:
adj = adj + numpy.eye(s0)
if out_size < 0:
adj_array = adj.astype(numpy.float32)
elif out_size >= s0:
adj_array = numpy.zeros((out_size, out_size),
dtype=numpy.float32)
adj_array[:s0, :s1] = adj
else:
raise ValueError(
'`out_size` (={}) must be negative or larger than or equal to the '
'number of atoms in the input molecules (={}).'
.format(out_size, s0))
return adj_array
def construct_discrete_edge_matrix(mol, out_size=-1,
add_self_connection_channel=False):
"""Returns the edge-type dependent adjacency matrix of the given molecule.
Args:
mol (rdkit.Chem.Mol): Input molecule.
out_size (int): The size of the returned matrix.
If this option is negative, it does not take any effect.
Otherwise, it must be larger than the number of atoms
in the input molecules. In that case, the adjacent
matrix is expanded and zeros are padded to right
columns and bottom rows.
add_self_connection_channel (bool): Add self connection or not.
If True, adjacency matrix whose diagonal element filled with 1
is added to last channel.
Returns:
adj_array (numpy.ndarray): The adjacent matrix of the input molecule.
It is 3-dimensional array with shape (edge_type, atoms1, atoms2),
where edge_type represents the bond type,
atoms1 & atoms2 represent from and to of the edge respectively.
If ``out_size`` is non-negative, its size is equal to that value.
Otherwise, it is equal to the number of atoms in the the molecule.
"""
if mol is None:
raise MolFeatureExtractionError('mol is None')
N = mol.GetNumAtoms()
if out_size < 0:
size = N
elif out_size >= N:
size = out_size
else:
raise ValueError(
'out_size {} is smaller than number of atoms in mol {}'
.format(out_size, N))
if add_self_connection_channel:
adjs = numpy.zeros((5, size, size), dtype=numpy.float32)
else:
adjs = numpy.zeros((4, size, size), dtype=numpy.float32)
bond_type_to_channel = {
Chem.BondType.SINGLE: 0,
Chem.BondType.DOUBLE: 1,
Chem.BondType.TRIPLE: 2,
Chem.BondType.AROMATIC: 3
}
for bond in mol.GetBonds():
bond_type = bond.GetBondType()
ch = bond_type_to_channel[bond_type]
i = bond.GetBeginAtomIdx()
j = bond.GetEndAtomIdx()
adjs[ch, i, j] = 1.0
adjs[ch, j, i] = 1.0
if add_self_connection_channel:
adjs[-1] = numpy.eye(N)
return adjs
def mol_basic_info_feature(mol, atom_array, adj):
n_atoms = mol.GetNumAtoms()
if n_atoms != len(atom_array):
raise ValueError("[ERROR] n_atoms {} != len(atom_array) {}"
.format(n_atoms, len(atom_array)))
# Note: this is actual number of edges * 2.
n_edges = adj.sum()
return numpy.asarray([n_atoms, n_edges])
def mol_atom_type_feature(mol, atom_array, adj):
atom_count = numpy.bincount(atom_array, minlength=MAX_ATOMIC_NUM + 1)
return (atom_count > 0).astype(numpy.float)[1:]
def mol_atom_freq_feature(mol, atom_array, adj):
atom_count = numpy.bincount(atom_array, minlength=MAX_ATOMIC_NUM + 1)
return (atom_count / len(atom_array))[1:]
def mol_bond_type_feature(mol, atom_array, adj):
if adj.ndim == 2:
adj = numpy.expand_dims(adj, axis=0)
adj = adj.reshape((adj.shape[0], -1))
return adj.max(axis=1)
def mol_bond_freq_feature(mol, atom_array, adj):
if adj.ndim == 2:
adj = numpy.expand_dims(adj, axis=0)
adj = adj.reshape((adj.shape[0], -1))
adj_sum = adj.sum()
if adj_sum == 0:
return adj.sum(axis=1)
else:
return adj.sum(axis=1) / adj_sum
def construct_supernode_feature(mol, atom_array, adj, feature_functions=None):
"""Construct an input feature x' for a supernode
`out_size` is automatically inferred by `atom_array` and `adj`
Args:
mol (rdkit.Chem.Mol): Input molecule
atom_array (numpy.ndarray) : array of atoms
adj (numpy.ndarray): N by N 2-way array, or |E| by N by N 3-way array
where |E| is the number of edgetypes.
feature_functions (None or list): list of callable
Returns:
super_node_x (numpy.ndarray); 1-way array, the supernode feature.
len(super_node_x) will be 2 + 2 + MAX_ATOMIC_NUM*2 for 2-way adjs,
2 + 4*2 + MAX_ATOMIC_NUM*2 for 3-way adjs
"""
if feature_functions is None:
feature_functions = [
mol_basic_info_feature, mol_bond_type_feature,
mol_bond_freq_feature, mol_atom_type_feature,
mol_atom_freq_feature]
super_node_x = numpy.concatenate(
[func(mol, atom_array, adj) for func in feature_functions])
super_node_x = super_node_x.astype(numpy.float32)
return super_node_x
================================================
FILE: chainer_chemistry/dataset/preprocessors/ecfp_preprocessor.py
================================================
from logging import getLogger
import numpy
from rdkit.Chem import rdMolDescriptors
from chainer_chemistry.dataset.preprocessors.common import MolFeatureExtractionError # NOQA
from chainer_chemistry.dataset.preprocessors.mol_preprocessor import MolPreprocessor # NOQA
class ECFPPreprocessor(MolPreprocessor):
def __init__(self, radius=2):
super(ECFPPreprocessor, self).__init__()
self.radius = radius
def get_input_features(self, mol):
try:
fp = rdMolDescriptors.GetMorganFingerprintAsBitVect(mol,
self.radius)
except Exception as e:
logger = getLogger(__name__)
logger.debug('exception caught at ECFPPreprocessor:', e)
# Extracting feature failed
raise MolFeatureExtractionError
# TODO(Nakago): Test it.
return numpy.asarray(fp, numpy.float32)
================================================
FILE: chainer_chemistry/dataset/preprocessors/ggnn_preprocessor.py
================================================
import numpy
from chainer_chemistry.dataset.graph_dataset.base_graph_data import SparseGraphData # NOQA
from chainer_chemistry.dataset.graph_dataset.base_graph_dataset import SparseGraphDataset # NOQA
from chainer_chemistry.dataset.preprocessors.common \
import construct_atomic_number_array, construct_discrete_edge_matrix # NOQA
from chainer_chemistry.dataset.preprocessors.common import type_check_num_atoms # NOQA
from chainer_chemistry.dataset.preprocessors.mol_preprocessor import MolPreprocessor # NOQA
class GGNNPreprocessor(MolPreprocessor):
"""GGNN Preprocessor
Args:
max_atoms (int): Max number of atoms for each molecule, if the
number of atoms is more than this value, this data is simply
ignored.
Setting negative value indicates no limit for max atoms.
out_size (int): It specifies the size of array returned by
`get_input_features`.
If the number of atoms in the molecule is less than this value,
the returned arrays is padded to have fixed size.
Setting negative value indicates do not pad returned array.
add_Hs (bool): If True, implicit Hs are added.
kekulize (bool): If True, Kekulizes the molecule.
"""
def __init__(self, max_atoms=-1, out_size=-1, add_Hs=False,
kekulize=False):
super(GGNNPreprocessor, self).__init__(
add_Hs=add_Hs, kekulize=kekulize)
if max_atoms >= 0 and out_size >= 0 and max_atoms > out_size:
raise ValueError('max_atoms {} must be less or equal to '
'out_size {}'.format(max_atoms, out_size))
self.max_atoms = max_atoms
self.out_size = out_size
def get_input_features(self, mol):
"""get input features
Args:
mol (Mol): Molecule input
Returns:
"""
type_check_num_atoms(mol, self.max_atoms)
atom_array = construct_atomic_number_array(mol, out_size=self.out_size)
adj_array = construct_discrete_edge_matrix(mol, out_size=self.out_size)
return atom_array, adj_array
class GGNNSparsePreprocessor(GGNNPreprocessor):
"""Sparse GGNN Preprocessor"""
def __init__(self, max_atoms=-1, out_size=-1, add_Hs=False,
kekulize=False):
super(GGNNSparsePreprocessor, self).__init__(
max_atoms=max_atoms, out_size=out_size, add_Hs=add_Hs,
kekulize=kekulize)
def construct_sparse_data(self, x, adj, y):
"""Construct `SparseGraphData` from `x`, `adj`, `y`
Args:
x (numpy.ndarray): input feature
adj (numpy.ndarray): adjacency matrix
y (numpy.ndarray): output label
Returns:
SparseGraphData: graph data object for sparse pattern
"""
edge_index = [[], []]
edge_attr = []
label_num, n, _ = adj.shape
for label in range(label_num):
for i in range(n):
for j in range(n):
if adj[label, i, j] != 0.:
edge_index[0].append(i)
edge_index[1].append(i)
edge_attr.append(label)
return SparseGraphData(
x=x,
edge_index=numpy.array(edge_index, dtype=numpy.int),
edge_attr=numpy.array(edge_attr, dtype=numpy.int),
y=y
)
def create_dataset(self, *args, **kwargs):
"""Create `SparseGraphData` from list of `(x, adj, y)`
Returns:
SparseGraphDataset: graph dataset object for sparse pattern
"""
# args: (atom_array, adj_array, label_array)
data_list = [
self.construct_sparse_data(x, adj, y) for (x, adj, y) in zip(*args)
]
return SparseGraphDataset(data_list)
================================================
FILE: chainer_chemistry/dataset/preprocessors/gin_preprocessor.py
================================================
import numpy
from chainer_chemistry.dataset.graph_dataset.base_graph_data import SparseGraphData # NOQA
from chainer_chemistry.dataset.graph_dataset.base_graph_dataset import SparseGraphDataset # NOQA
from chainer_chemistry.dataset.preprocessors.common \
import construct_atomic_number_array, construct_adj_matrix # NOQA
from chainer_chemistry.dataset.preprocessors.common import type_check_num_atoms
from chainer_chemistry.dataset.preprocessors.mol_preprocessor import MolPreprocessor # NOQA
class GINPreprocessor(MolPreprocessor):
"""GIN Preprocessor
"""
def __init__(self, max_atoms=-1, out_size=-1, add_Hs=False):
"""initialize the GIN Preprocessor.
Args:
max_atoms (int): Max number of atoms for each molecule,
if the number of atoms is more than this value,
this data is simply ignored.
Setting negative value indicates no limit for max atoms.
out_size (int): It specifies the size of array returned by
`get_input_features`.
If the number of atoms in the molecule is less than this value,
the returned arrays is padded to have fixed size.
Setting negative value indicates do not pad returned array.
add_Hs (bool): If true, add Hydrogens explicitly.
"""
super(GINPreprocessor, self).__init__(add_Hs=add_Hs)
if max_atoms >= 0 and out_size >= 0 and max_atoms > out_size:
raise ValueError('max_atoms {} must be less or equal to '
'out_size {}'.format(max_atoms, out_size))
self.max_atoms = max_atoms
self.out_size = out_size
def get_input_features(self, mol):
"""get input features
Args:
mol (Mol):
Returns:
"""
type_check_num_atoms(mol, self.max_atoms)
atom_array = construct_atomic_number_array(mol, out_size=self.out_size)
adj_array = construct_adj_matrix(mol, out_size=self.out_size)
return atom_array, adj_array
class GINSparsePreprocessor(MolPreprocessor):
"""Sparse GIN Preprocessor"""
def __init__(self, max_atoms=-1, out_size=-1, add_Hs=False):
super(GINSparsePreprocessor, self).__init__(add_Hs=add_Hs)
if max_atoms >= 0 and out_size >= 0 and max_atoms > out_size:
raise ValueError('max_atoms {} must be less or equal to '
'out_size {}'.format(max_atoms, out_size))
self.max_atoms = max_atoms
self.out_size = out_size
def get_input_features(self, mol):
type_check_num_atoms(mol, self.max_atoms)
atom_array = construct_atomic_number_array(mol, out_size=self.out_size)
adj_array = construct_adj_matrix(mol, out_size=self.out_size)
return atom_array, adj_array
def construct_sparse_data(self, x, adj, y):
"""Construct `SparseGraphData` from `x`, `adj`, `y`
Args:
x (numpy.ndarray): input feature
adj (numpy.ndarray): adjacency matrix
y (numpy.ndarray): output label
Returns:
SparseGraphData: graph data object for sparse pattern
"""
edge_index = [[], []]
n, _ = adj.shape
for i in range(n):
for j in range(n):
if adj[i, j] != 0.:
edge_index[0].append(i)
edge_index[1].append(j)
return SparseGraphData(
x=x,
edge_index=numpy.array(edge_index, dtype=numpy.int),
y=y
)
def create_dataset(self, *args, **kwargs):
"""Create `SparseGraphData` from list of `(x, adj, y)`
Returns:
SparseGraphDataset: graph dataset object for sparse pattern
"""
# args: (atom_array, adj_array, label_array)
data_list = [
self.construct_sparse_data(x, adj, y) for (x, adj, y) in zip(*args)
]
return SparseGraphDataset(data_list)
================================================
FILE: chainer_chemistry/dataset/preprocessors/gnnfilm_preprocessor.py
================================================
from chainer_chemistry.dataset.preprocessors.common \
import construct_atomic_number_array, construct_discrete_edge_matrix # NOQA
from chainer_chemistry.dataset.preprocessors.common import type_check_num_atoms # NOQA
from chainer_chemistry.dataset.preprocessors.mol_preprocessor import MolPreprocessor # NOQA
class GNNFiLMPreprocessor(MolPreprocessor):
"""GNNFiLM Preprocessor
Args:
max_atoms (int): Max number of atoms for each molecule, if the
number of atoms is more than this value, this data is simply
ignored.
Setting negative value indicates no limit for max atoms.
out_size (int): It specifies the size of array returned by
`get_input_features`.
If the number of atoms in the molecule is less than this value,
the returned arrays is padded to have fixed size.
Setting negative value indicates do not pad returned array.
add_Hs (bool): If True, implicit Hs are added.
kekulize (bool): If True, Kekulizes the molecule.
"""
def __init__(self, max_atoms=-1, out_size=-1, add_Hs=False,
kekulize=False):
super(GNNFiLMPreprocessor, self).__init__(
add_Hs=add_Hs, kekulize=kekulize)
if max_atoms >= 0 and out_size >= 0 and max_atoms > out_size:
raise ValueError('max_atoms {} must be less or equal to '
'out_size {}'.format(max_atoms, out_size))
self.max_atoms = max_atoms
self.out_size = out_size
def get_input_features(self, mol):
"""get input features
Args:
mol (Mol): Molecule input
Returns:
"""
type_check_num_atoms(mol, self.max_atoms)
atom_array = construct_atomic_number_array(mol, out_size=self.out_size)
adj_array = construct_discrete_edge_matrix(
mol, out_size=self.out_size, add_self_connection_channel=True)
return atom_array, adj_array
================================================
FILE: chainer_chemistry/dataset/preprocessors/gwm_preprocessor.py
================================================
from chainer_chemistry.dataset.preprocessors.common import construct_supernode_feature # NOQA
from chainer_chemistry.dataset.preprocessors.ggnn_preprocessor import GGNNPreprocessor # NOQA
from chainer_chemistry.dataset.preprocessors.gin_preprocessor import GINPreprocessor # NOQA
from chainer_chemistry.dataset.preprocessors.nfp_preprocessor import NFPPreprocessor # NOQA
from chainer_chemistry.dataset.preprocessors.rsgcn_preprocessor import RSGCNPreprocessor # NOQA
class NFPGWMPreprocessor(NFPPreprocessor):
def get_input_features(self, mol):
atom_array, adj_array = super(
NFPGWMPreprocessor, self).get_input_features(mol)
super_node_x = construct_supernode_feature(
mol, atom_array, adj_array)
return atom_array, adj_array, super_node_x
class GGNNGWMPreprocessor(GGNNPreprocessor):
def get_input_features(self, mol):
atom_array, adj_array = super(
GGNNGWMPreprocessor, self).get_input_features(mol)
super_node_x = construct_supernode_feature(
mol, atom_array, adj_array)
return atom_array, adj_array, super_node_x
class GINGWMPreprocessor(GINPreprocessor):
def get_input_features(self, mol):
atom_array, adj_array = super(
GINGWMPreprocessor, self).get_input_features(mol)
super_node_x = construct_supernode_feature(
mol, atom_array, adj_array)
return atom_array, adj_array, super_node_x
class RSGCNGWMPreprocessor(RSGCNPreprocessor):
def get_input_features(self, mol):
atom_array, adj_array = super(
RSGCNGWMPreprocessor, self).get_input_features(mol)
super_node_x = construct_supernode_feature(
mol, atom_array, adj_array)
return atom_array, adj_array, super_node_x
================================================
FILE: chainer_chemistry/dataset/preprocessors/megnet_preprocessor.py
================================================
from logging import getLogger
import os
import traceback
import numpy
from rdkit import Chem, RDConfig # NOQA
from rdkit.Chem import AllChem, ChemicalFeatures, Descriptors, rdmolops # NOQA
from chainer_chemistry.dataset.preprocessors.common import MolFeatureExtractionError # NOQA
from chainer_chemistry.dataset.preprocessors.common import type_check_num_atoms # NOQA
from chainer_chemistry.dataset.preprocessors.mol_preprocessor import MolPreprocessor # NOQA
from chainer_chemistry.dataset.utils import GaussianDistance
MAX_ATOM_ELEMENT = 94
ATOM = ['H', 'C', 'N', 'O', 'F']
# create singleton class
class ChemicalFeaturesFactory(object):
_instance = None
@classmethod
def get_instance(self):
if not self._instance:
fdefName = os.path.join(RDConfig.RDDataDir, 'BaseFeatures.fdef')
self._instance = ChemicalFeatures.BuildFeatureFactory(fdefName)
return self._instance
# --- atom feature extraction ---
def construct_atom_type_vec(mol, num_max_atoms, atom_list=None,
include_unknown_atom=False):
atom_list = atom_list or ATOM
if include_unknown_atom:
# all atom not in `atom_list` as considered as "unknown atom"
# and its index is `len(atom_list)`
n_atom_type = len(atom_list) + 1
else:
n_atom_type = len(atom_list)
atom_type_vec = numpy.zeros((num_max_atoms, n_atom_type),
dtype=numpy.float32)
for i in range(num_max_atoms):
a = mol.GetAtomWithIdx(i)
try:
atom_idx = atom_list.index(a.GetSymbol())
except ValueError as e:
if include_unknown_atom:
atom_idx = len(atom_list)
else:
raise MolFeatureExtractionError(e)
atom_type_vec[i, atom_idx] = 1.0
return atom_type_vec
def construct_atom_chirality_vec(mol, num_max_atoms):
chirality_vec = numpy.zeros((num_max_atoms, 2), dtype=numpy.float32)
# chiral_cc: (atom_index, chirality) : (1, 'S')
chiral_cc = Chem.FindMolChiralCenters(mol)
for chiral_dict in chiral_cc:
if chiral_dict[1] == 'R':
chirality_vec[chiral_dict[0]] = [1, 0]
if chiral_dict[1] == 'S':
chirality_vec[chiral_dict[0]] = [0, 1]
return chirality_vec
def construct_atom_ring_vec(mol, num_max_atoms):
sssr = Chem.GetSymmSSSR(mol)
ring_feature = numpy.zeros((num_max_atoms, 6,), dtype=numpy.float32)
for ring in sssr:
ring = list(ring)
for i in range(num_max_atoms):
if i in ring:
ring_size = len(ring)
if ring_size >= 3 and ring_size <= 8:
ring_feature[i, ring_size - 3] = 1.0
return ring_feature
def construct_hybridization_vec(mol, num_max_atoms):
hybridization_vec = numpy.zeros((num_max_atoms, 3), dtype=numpy.float32)
for i in range(num_max_atoms):
a = mol.GetAtomWithIdx(i)
hybridization_type = a.GetHybridization()
if hybridization_type is None:
continue
hybridization_type = str(hybridization_type)
if hybridization_type == 'SP1':
hybridization_vec[i, 0] = 1.0
elif hybridization_type == 'SP2':
hybridization_vec[i, 1] = 1.0
elif hybridization_type == 'SP3':
hybridization_vec[i, 2] = 1.0
return hybridization_vec
def construct_hydrogen_bonding(mol, num_max_atoms):
factory = ChemicalFeaturesFactory.get_instance()
feats = factory.GetFeaturesForMol(mol)
hydrogen_bonding_vec = numpy.zeros((num_max_atoms, 2), dtype=numpy.float32)
for f in feats:
atom_type = f.GetFamily()
if atom_type == 'Donor':
idx = f.GetAtomIds()[0]
hydrogen_bonding_vec[idx, 0] = 1.0
if atom_type == 'Acceptor':
idx = f.GetAtomIds()[0]
hydrogen_bonding_vec[idx, 1] = 1.0
return hydrogen_bonding_vec
def construct_aromaticity_vec(mol, num_max_atoms):
aromaticity_vec = numpy.zeros((num_max_atoms, 1), dtype=numpy.float32)
aromatix_atoms = mol.GetAromaticAtoms()
for a in aromatix_atoms:
aromaticity_vec[a.GetIdx()] = 1.0
return aromaticity_vec
def construct_atom_feature(mol, use_all_feature, atom_list=None,
include_unknown_atom=False):
"""construct atom feature
Args:
mol (Mol): mol instance
use_all_feature (bool):
If True, all atom features are extracted.
If False, a part of atom features is extracted.
You can confirm the detail in the paper.
atom_list (list): list of atoms to extract feature. If None, default
`ATOM` is used as `atom_list`
include_unknown_atom (bool): If False, when the `mol` includes atom
which is not in `atom_list`, it will raise
`MolFeatureExtractionError`.
If True, even the atom is not in `atom_list`, `atom_type` is set
as "unknown" atom.
Returns:
atom_feature (numpy.ndarray):
The shape is (num_nodes, num_node_features).
"""
num_max_atoms = mol.GetNumAtoms()
atom_type_vec = construct_atom_type_vec(
mol, num_max_atoms, atom_list=atom_list,
include_unknown_atom=include_unknown_atom)
atom_chirality_vec = construct_atom_chirality_vec(
mol, num_max_atoms=num_max_atoms)
atom_ring_vec = construct_atom_ring_vec(
mol, num_max_atoms=num_max_atoms)
hybridization_vec = construct_hybridization_vec(
mol, num_max_atoms=num_max_atoms)
hydrogen_bonding = construct_hydrogen_bonding(
mol, num_max_atoms=num_max_atoms)
aromaticity_vec = construct_aromaticity_vec(
mol, num_max_atoms=num_max_atoms)
if use_all_feature:
feature = numpy.hstack((atom_type_vec, atom_chirality_vec,
atom_ring_vec, hybridization_vec,
hydrogen_bonding, aromaticity_vec))
else:
feature = construct_atom_type_vec(
mol, num_max_atoms, atom_list=atom_list,
include_unknown_atom=include_unknown_atom)
return feature
# --- pair feature extraction ---
def construct_bond_vec(mol, i, j):
bond_feature_vec = numpy.zeros((4, ), dtype=numpy.float32)
k = mol.GetBondBetweenAtoms(i, j)
if k is not None:
bond_type = str(k.GetBondType())
if bond_type == 'SINGLE':
bond_feature_vec[0] = 1.0
elif bond_type == 'DOUBLE':
bond_feature_vec[1] = 1.0
elif bond_type == 'TRIPLE':
bond_feature_vec[2] = 1.0
elif bond_type == 'AROMATIC':
bond_feature_vec[3] = 1.0
else:
raise ValueError("Unknown bond type {}".format(bond_type))
return bond_feature_vec
def get_is_in_ring(mol):
"""create a cache about whether the atom is in a ring or not
Args:
mol (Mol): mol instance
Returns
is_in_ring (dict): key is the atom idx, value is the set()
"""
sssr = Chem.GetSymmSSSR(mol)
is_in_ring = {}
ring_idx = 0
for ring in sssr:
ring = list(ring)
for i in ring:
if i not in is_in_ring:
is_in_ring[i] = set()
is_in_ring[i].add(ring_idx)
ring_idx += 1
return is_in_ring
def construct_ring_feature_vec(is_in_ring, i, j):
ring_feature_vec = numpy.zeros((1, ), dtype=numpy.float32)
if i in is_in_ring and j in is_in_ring and is_in_ring[i] & is_in_ring[j]:
ring_feature_vec[0] = 1.0
return ring_feature_vec
def construct_expanded_distance_vec(distance_matrix_3d, converter, i, j):
# calculate the bond length
distance = distance_matrix_3d[i, j]
# convert from the bond length to vector
expanded_distance_vec = converter.expand(distance)
return expanded_distance_vec
def construct_pair_feature(mol, use_all_feature):
"""construct pair feature
Args:
mol (Mol): mol instance
use_all_feature (bool):
If True, all pair features are extracted.
If False, a part of pair features is extracted.
You can confirm the detail in the paper.
Returns:
features (numpy.ndarray): The shape is (num_edges, num_edge_features)
bond_idx (numpy.ndarray): The shape is (2, num_edges)
bond_idx[0] represents the list of StartNodeIdx and bond_idx[1]
represents the list of EndNodeIdx.
"""
converter = GaussianDistance()
# prepare the data for extracting the pair feature
bonds = mol.GetBonds()
# (n_nodes, n_nodes): distance in terms of the graph bond.
graph_distance_matrix = Chem.GetDistanceMatrix(mol)
is_in_ring = get_is_in_ring(mol)
confid = AllChem.EmbedMolecule(mol)
try:
distance_matrix_3d = rdmolops.Get3DDistanceMatrix(
mol, confId=confid)
except ValueError as e:
logger = getLogger(__name__)
logger.info('construct_distance_matrix failed, type: {}, {}'
.format(type(e).__name__, e.args))
logger.debug(traceback.format_exc())
raise MolFeatureExtractionError
feature = []
bond_idx = []
for bond in bonds:
start_node = bond.GetBeginAtomIdx()
end_node = bond.GetEndAtomIdx()
# create pair feature
distance_feature = numpy.array(
graph_distance_matrix[start_node][end_node], dtype=numpy.float32)
bond_feature = construct_bond_vec(mol, start_node, end_node)
ring_feature = construct_ring_feature_vec(
is_in_ring, start_node, end_node)
bond_idx.append((start_node, end_node))
if use_all_feature:
expanded_distance_feature = \
construct_expanded_distance_vec(
distance_matrix_3d, converter, start_node, end_node)
feature.append(numpy.hstack((bond_feature, ring_feature,
distance_feature,
expanded_distance_feature)))
else:
expanded_distance_feature = \
construct_expanded_distance_vec(
distance_matrix_3d, converter, start_node, end_node)
feature.append(expanded_distance_feature)
bond_idx = numpy.array(bond_idx).T
feature = numpy.array(feature)
return feature, bond_idx
def construct_global_state_feature(mol):
"""construct global state feature
Args:
mol (Mol): mol instance
Returns:
feature (numpy.ndarray): 1 dimensional array
"""
n_atom = mol.GetNumAtoms()
ave_mol_wt = Descriptors.MolWt(mol) / n_atom
ave_num_of_bonds = len(mol.GetBonds()) / n_atom
feature = numpy.array([ave_mol_wt, ave_num_of_bonds], dtype=numpy.float32)
return feature
class MEGNetPreprocessor(MolPreprocessor):
"""MEGNetPreprocessor
Args:
For Molecule
max_atoms (int): Max number of atoms for each molecule, if the
number of atoms is more than this value, this data is simply
ignored.
Setting negative value indicates no limit for max atoms.
add_Hs (bool): If True, implicit Hs are added.
use_all_feature (bool):
If True, all atom and pair features is extracted.
If it is False, a part of atom and pair features is extracted.
You can confirm the detail in the paper.
atom_list (list): list of atoms to extract feature. If None, default
`ATOM` is used as `atom_list`
include_unknown_atom (bool): If False, when the `mol` includes atom
which is not in `atom_list`, it will raise
`MolFeatureExtractionError`.
If True, even the atom is not in `atom_list`, `atom_type` is set
as "unknown" atom.
kekulize (bool): If True, Kekulizes the molecule.
"""
def __init__(self, max_atoms=-1, add_Hs=True,
use_all_feature=False, atom_list=None,
include_unknown_atom=False, kekulize=False,
max_num_nbr=12, max_radius=8, expand_dim=100):
super(MEGNetPreprocessor, self).__init__(
add_Hs=add_Hs, kekulize=kekulize)
self.max_atoms = max_atoms
self.add_Hs = add_Hs
self.use_all_feature = use_all_feature
self.atom_list = atom_list
self.include_unknown_atom = include_unknown_atom
self.max_num_nbr = max_num_nbr
self.max_radius = max_radius
self.expand_dim = expand_dim
self.gdf = GaussianDistance(centers=numpy.linspace(0, 5, expand_dim))
def get_input_features(self, mol):
"""get input features from mol object
Args:
mol (Mol):
"""
type_check_num_atoms(mol, self.max_atoms)
atom_feature = construct_atom_feature(mol, self.use_all_feature,
self.atom_list,
self.include_unknown_atom)
pair_feature, bond_idx = construct_pair_feature(mol,
self.use_all_feature)
global_feature = construct_global_state_feature(mol)
return atom_feature, pair_feature, global_feature, bond_idx
================================================
FILE: chainer_chemistry/dataset/preprocessors/mol_preprocessor.py
================================================
from rdkit import Chem
from chainer_chemistry.dataset.preprocessors.base_preprocessor import BasePreprocessor # NOQA
from chainer_chemistry.datasets.numpy_tuple_dataset import NumpyTupleDataset # NOQA
class MolPreprocessor(BasePreprocessor):
"""preprocessor class specified for rdkit mol instance
Args:
add_Hs (bool): If True, implicit Hs are added.
kekulize (bool): If True, Kekulizes the molecule.
"""
def __init__(self, add_Hs=False, kekulize=False):
super(MolPreprocessor, self).__init__()
self.add_Hs = add_Hs
self.kekulize = kekulize
def prepare_smiles_and_mol(self, mol):
"""Prepare `smiles` and `mol` used in following preprocessing.
This method is called before `get_input_features` is called, by parser
class.
This method may be overriden to support custom `smile`/`mol` extraction
Args:
mol (mol): mol instance
Returns (tuple): (`smiles`, `mol`)
"""
# Note that smiles expression is not unique.
# we obtain canonical smiles which is unique in `mol`
canonical_smiles = Chem.MolToSmiles(mol, isomericSmiles=False,
canonical=True)
mol = Chem.MolFromSmiles(canonical_smiles)
if self.add_Hs:
mol = Chem.AddHs(mol)
if self.kekulize:
Chem.Kekulize(mol)
return canonical_smiles, mol
def get_label(self, mol, label_names=None):
"""Extracts label information from a molecule.
This method extracts properties whose keys are
specified by ``label_names`` from a molecule ``mol``
and returns these values as a list.
The order of the values is same as that of ``label_names``.
If the molecule does not have a
property with some label, this function fills the corresponding
index of the returned list with ``None``.
Args:
mol (rdkit.Chem.Mol): molecule whose features to be extracted
label_names (None or iterable): list of label names.
Returns:
list of str: label information. Its length is equal to
that of ``label_names``. If ``label_names`` is ``None``,
this function returns an empty list.
"""
if label_names is None:
return []
label_list = []
for label_name in label_names:
if mol.HasProp(label_name):
label_list.append(mol.GetProp(label_name))
else:
label_list.append(None)
# TODO(Nakago): Review implementation
# Label -1 work in case of classification.
# However in regression, assign -1 is not a good strategy...
# label_list.append(-1)
# Failed to GetProp for label, skip this case.
# print('no label')
# raise MolFeatureExtractionError
return label_list
def get_input_features(self, mol):
"""get molecule's feature representation, descriptor.
Each subclass must override this method.
Args:
mol (Mol): molecule whose feature to be extracted.
`mol` is prepared by the method `prepare_smiles_and_mol`.
"""
raise NotImplementedError
def create_dataset(self, *args, **kwargs):
return NumpyTupleDataset(*args)
def process(self, filepath):
# Not used now...
pass
================================================
FILE: chainer_chemistry/dataset/preprocessors/nfp_preprocessor.py
================================================
from chainer_chemistry.dataset.preprocessors.common import construct_adj_matrix
from chainer_chemistry.dataset.preprocessors.common \
import construct_atomic_number_array
from chainer_chemistry.dataset.preprocessors.common import type_check_num_atoms
from chainer_chemistry.dataset.preprocessors.mol_preprocessor \
import MolPreprocessor
class NFPPreprocessor(MolPreprocessor):
"""NFP Preprocessor
Args:
max_atoms (int): Max number of atoms for each molecule, if the
number of atoms is more than this value, this data is simply
ignored.
Setting negative value indicates no limit for max atoms.
out_size (int): It specifies the size of array returned by
`get_input_features`.
If the number of atoms in the molecule is less than this value,
the returned arrays is padded to have fixed size.
Setting negative value indicates do not pad returned array.
add_Hs (bool): If True, implicit Hs are added.
kekulize (bool): If True, Kekulizes the molecule.
"""
def __init__(self, max_atoms=-1, out_size=-1, add_Hs=False,
kekulize=False):
super(NFPPreprocessor, self).__init__(
add_Hs=add_Hs, kekulize=kekulize)
if max_atoms >= 0 and out_size >= 0 and max_atoms > out_size:
raise ValueError('max_atoms {} must be less or equal to '
'out_size {}'.format(max_atoms, out_size))
self.max_atoms = max_atoms
self.out_size = out_size
def get_input_features(self, mol):
"""get input features
Args:
mol (Mol):
Returns:
"""
type_check_num_atoms(mol, self.max_atoms)
atom_array = construct_atomic_number_array(mol, out_size=self.out_size)
adj_array = construct_adj_matrix(mol, out_size=self.out_size)
return atom_array, adj_array
================================================
FILE: chainer_chemistry/dataset/preprocessors/relgat_preprocessor.py
================================================
from chainer_chemistry.dataset.preprocessors.common import construct_atomic_number_array # NOQA
from chainer_chemistry.dataset.preprocessors.common import construct_discrete_edge_matrix # NOQA
from chainer_chemistry.dataset.preprocessors.common import MolFeatureExtractionError # NOQA
from chainer_chemistry.dataset.preprocessors.common import type_check_num_atoms
from chainer_chemistry.dataset.preprocessors.mol_preprocessor import MolPreprocessor # NOQA
class RelGATPreprocessor(MolPreprocessor):
"""RelGAT Preprocessor
Args:
max_atoms (int): Max number of atoms for each molecule, if the
number of atoms is more than this value, this data is simply
ignored.
Setting negative value indicates no limit for max atoms.
out_size (int): It specifies the size of array returned by
`get_input_features`.
If the number of atoms in the molecule is less than this value,
the returned arrays is padded to have fixed size.
Setting negative value indicates do not pad returned array.
"""
def __init__(self, max_atoms=-1, out_size=-1, add_Hs=False):
super(RelGATPreprocessor, self).__init__(add_Hs=add_Hs)
if max_atoms >= 0 and out_size >= 0 and max_atoms > out_size:
raise ValueError('max_atoms {} must be less or equal to '
'out_size {}'.format(max_atoms, out_size))
self.max_atoms = max_atoms
self.out_size = out_size
def get_input_features(self, mol):
"""get input features
Args:
mol (Mol):
Returns:
"""
type_check_num_atoms(mol, self.max_atoms)
atom_array = construct_atomic_number_array(mol, out_size=self.out_size)
adj_array = construct_discrete_edge_matrix(mol, out_size=self.out_size)
return atom_array, adj_array
================================================
FILE: chainer_chemistry/dataset/preprocessors/relgcn_preprocessor.py
================================================
from chainer_chemistry.dataset.preprocessors.ggnn_preprocessor import GGNNPreprocessor, GGNNSparsePreprocessor # NOQA
class RelGCNPreprocessor(GGNNPreprocessor):
"""RelGCN Preprocessor
Args:
max_atoms (int): Max number of atoms for each molecule, if the
number of atoms is more than this value, this data is simply
ignored.
Setting negative value indicates no limit for max atoms.
out_size (int): It specifies the size of array returned by
`get_input_features`.
If the number of atoms in the molecule is less than this value,
the returned arrays is padded to have fixed size.
Setting negative value indicates do not pad returned array.
add_Hs (bool): If True, implicit Hs are added.
kekulize (bool): If True, Kekulizes the molecule.
"""
def __init__(self, max_atoms=-1, out_size=-1, add_Hs=False,
kekulize=False):
super(RelGCNPreprocessor, self).__init__(
max_atoms=max_atoms, out_size=out_size, add_Hs=add_Hs,
kekulize=kekulize)
def get_input_features(self, mol):
"""get input features
Args:
mol (Mol):
Returns:
"""
return super(RelGCNPreprocessor, self).get_input_features(mol)
class RelGCNSparsePreprocessor(GGNNSparsePreprocessor):
pass
================================================
FILE: chainer_chemistry/dataset/preprocessors/rsgcn_preprocessor.py
================================================
from chainer_chemistry.dataset.preprocessors.common import construct_adj_matrix # NOQA
from chainer_chemistry.dataset.preprocessors.common import construct_atomic_number_array # NOQA
from chainer_chemistry.dataset.preprocessors.common import type_check_num_atoms # NOQA
from chainer_chemistry.dataset.preprocessors.mol_preprocessor import MolPreprocessor # NOQA
import numpy
class RSGCNPreprocessor(MolPreprocessor):
"""RSGCN Preprocessor
Args:
max_atoms (int): Max number of atoms for each molecule, if the
number of atoms is more than this value, this data is simply
ignored.
Setting negative value indicates no limit for max atoms.
out_size (int): It specifies the size of array returned by
`get_input_features`.
If the number of atoms in the molecule is less than this value,
the returned arrays is padded to have fixed size.
Setting negative value indicates do not pad returned array.
add_Hs (bool): If True, implicit Hs are added.
kekulize (bool): If True, Kekulizes the molecule.
"""
def __init__(self, max_atoms=-1, out_size=-1, add_Hs=False,
kekulize=False):
super(RSGCNPreprocessor, self).__init__(
add_Hs=add_Hs, kekulize=kekulize)
if max_atoms >= 0 and out_size >= 0 and max_atoms > out_size:
raise ValueError('max_atoms {} must be less or equal to '
'out_size {}'.format(max_atoms, out_size))
self.max_atoms = max_atoms
self.out_size = out_size
def get_input_features(self, mol):
"""get input features
Args:
mol (Mol):
Returns:
"""
type_check_num_atoms(mol, self.max_atoms)
num_atoms = mol.GetNumAtoms()
# Construct the atom array and adjacency matrix.
atom_array = construct_atomic_number_array(mol, out_size=self.out_size)
adj_array = construct_adj_matrix(mol, out_size=self.out_size)
# Adjust the adjacency matrix.
degree_vec = numpy.sum(adj_array[:num_atoms], axis=1)
degree_sqrt_inv = 1. / numpy.sqrt(degree_vec)
adj_array[:num_atoms, :num_atoms] *= numpy.broadcast_to(
degree_sqrt_inv[:, None], (num_atoms, num_atoms))
adj_array[:num_atoms, :num_atoms] *= numpy.broadcast_to(
degree_sqrt_inv[None, :], (num_atoms, num_atoms))
return atom_array, adj_array
================================================
FILE: chainer_chemistry/dataset/preprocessors/schnet_preprocessor.py
================================================
from logging import getLogger
import traceback
import numpy
from rdkit.Chem import AllChem
from rdkit.Chem import rdmolops
from chainer_chemistry.dataset.preprocessors.common \
import construct_atomic_number_array
from chainer_chemistry.dataset.preprocessors.common import MolFeatureExtractionError # NOQA
from chainer_chemistry.dataset.preprocessors.common import type_check_num_atoms
from chainer_chemistry.dataset.preprocessors.mol_preprocessor \
import MolPreprocessor
def construct_distance_matrix(mol, out_size=-1, contain_Hs=False):
"""Construct distance matrix
Args:
mol (Chem.Mol):
out_size (int):
contain_Hs (bool):
Returns (numpy.ndarray): 2 dimensional array which represents distance
between atoms
"""
if mol is None:
raise MolFeatureExtractionError('mol is None')
N = mol.GetNumAtoms()
if out_size < 0:
size = N
elif out_size >= N:
size = out_size
else:
raise MolFeatureExtractionError('out_size {} is smaller than number '
'of atoms in mol {}'
.format(out_size, N))
if contain_Hs:
mol2 = mol
else:
mol2 = AllChem.AddHs(mol)
conf_id = AllChem.EmbedMolecule(mol2)
if not contain_Hs:
mol2 = AllChem.RemoveHs(mol2)
try:
dist_matrix = rdmolops.Get3DDistanceMatrix(mol2, confId=conf_id)
except ValueError as e:
logger = getLogger(__name__)
logger.info('construct_distance_matrix failed, type: {}, {}'
.format(type(e).__name__, e.args))
logger.debug(traceback.format_exc())
raise MolFeatureExtractionError
if size > N:
dists = numpy.zeros((size, size), dtype=numpy.float32)
a0, a1 = dist_matrix.shape
dists[:a0, :a1] = dist_matrix
else:
dists = dist_matrix
return dists.astype(numpy.float32)
class SchNetPreprocessor(MolPreprocessor):
"""SchNet Preprocessor
Args:
max_atoms (int): Max number of atoms for each molecule, if the
number of atoms is more than this value, this data is simply
ignored.
Setting negative value indicates no limit for max atoms.
out_size (int): It specifies the size of array returned by
`get_input_features`.
If the number of atoms in the molecule is less than this value,
the returned arrays is padded to have fixed size.
Setting negative value indicates do not pad returned array.
add_Hs (bool): If True, implicit Hs are added.
kekulize (bool): If True, Kekulizes the molecule.
"""
def __init__(self, max_atoms=-1, out_size=-1, add_Hs=False,
kekulize=False):
super(SchNetPreprocessor, self).__init__(
add_Hs=add_Hs, kekulize=kekulize)
if max_atoms >= 0 and out_size >= 0 and max_atoms > out_size:
raise ValueError('max_atoms {} must be less or equal to '
'out_size {}'.format(max_atoms, out_size))
self.max_atoms = max_atoms
self.out_size = out_size
def get_input_features(self, mol):
"""get input features
Args:
mol (Mol):
Returns:
"""
type_check_num_atoms(mol, self.max_atoms)
atom_array = construct_atomic_number_array(mol, out_size=self.out_size)
dist_array = construct_distance_matrix(mol, out_size=self.out_size,
contain_Hs=self.add_Hs)
return atom_array, dist_array
================================================
FILE: chainer_chemistry/dataset/preprocessors/weavenet_preprocessor.py
================================================
import os
import numpy
from rdkit import Chem
from rdkit.Chem import AllChem
from rdkit.Chem import ChemicalFeatures
from rdkit import RDConfig
from chainer_chemistry.config import WEAVE_DEFAULT_NUM_MAX_ATOMS
from chainer_chemistry.dataset.preprocessors.common \
import construct_atomic_number_array
from chainer_chemistry.dataset.preprocessors.common \
import MolFeatureExtractionError
from chainer_chemistry.dataset.preprocessors.common import type_check_num_atoms
from chainer_chemistry.dataset.preprocessors.mol_preprocessor \
import MolPreprocessor
ATOM = ['H', 'C', 'N', 'O', 'S', 'Cl', 'Br', 'F', 'P', 'I']
MAX_DISTANCE = 2 # 7
# --- Atom feature extraction ---
def construct_atom_type_vec(mol, num_max_atoms=WEAVE_DEFAULT_NUM_MAX_ATOMS,
atom_list=None, include_unknown_atom=False):
atom_list = atom_list or ATOM
if include_unknown_atom:
# all atom not in `atom_list` as considered as "unknown atom"
# and its index is `len(atom_list)`
n_atom_type = len(atom_list) + 1
else:
n_atom_type = len(atom_list)
n_atom = mol.GetNumAtoms()
atom_type_vec = numpy.zeros((num_max_atoms, n_atom_type),
dtype=numpy.float32)
for i in range(n_atom):
a = mol.GetAtomWithIdx(i)
try:
atom_idx = atom_list.index(a.GetSymbol())
except ValueError as e:
if include_unknown_atom:
atom_idx = len(atom_list)
else:
raise MolFeatureExtractionError(e)
atom_type_vec[i, atom_idx] = 1.0
return atom_type_vec
def construct_formal_charge_vec(mol,
num_max_atoms=WEAVE_DEFAULT_NUM_MAX_ATOMS):
n_atom = mol.GetNumAtoms()
formal_charge_vec = numpy.zeros((num_max_atoms, 1), dtype=numpy.float32)
for i in range(n_atom):
a = mol.GetAtomWithIdx(i)
formal_charge_vec[i, 0] = a.GetFormalCharge()
return formal_charge_vec
def construct_hybridization_vec(mol,
num_max_atoms=WEAVE_DEFAULT_NUM_MAX_ATOMS):
# TODO(Oono)
# Can we enhance preprocessing speed by making factory once
# prior to calling this function many times?
n_atom = mol.GetNumAtoms()
hybridization_vec = numpy.zeros((num_max_atoms, 3), dtype=numpy.float32)
for i in range(n_atom):
a = mol.GetAtomWithIdx(i)
if a.GetHybridization() is None:
continue
hybridization_type = str(a.GetHybridization())
if hybridization_type == 'SP1':
hybridization_vec[i, 0] = 1.0
elif hybridization_type == 'SP2':
hybridization_vec[i, 1] = 1.0
elif hybridization_type == 'SP3':
hybridization_vec[i, 2] = 1.0
return hybridization_vec
def construct_partial_charge_vec(
mol, num_max_atoms=WEAVE_DEFAULT_NUM_MAX_ATOMS):
AllChem.ComputeGasteigerCharges(mol)
n = mol.GetNumAtoms()
partial_charge_vec = numpy.zeros((num_max_atoms, 1), dtype=numpy.float32)
for i in range(n):
a = mol.GetAtomWithIdx(i)
partial_charge_vec[i, 0] = a.GetProp("_GasteigerCharge")
return partial_charge_vec
def construct_atom_ring_vec(mol, num_max_atoms=WEAVE_DEFAULT_NUM_MAX_ATOMS):
nAtom = mol.GetNumAtoms()
sssr = Chem.GetSymmSSSR(mol)
ring_feature = numpy.zeros((num_max_atoms, 6,), dtype=numpy.float32)
for ring in sssr:
ring = list(ring)
for i in range(nAtom):
if i in ring:
ring_size = len(ring)
if ring_size >= 3 and ring_size <= 8:
ring_feature[i, ring_size - 3] = 1.0
return ring_feature
def construct_hydrogen_bonding(mol, num_max_atoms=WEAVE_DEFAULT_NUM_MAX_ATOMS):
fdefName = os.path.join(RDConfig.RDDataDir, 'BaseFeatures.fdef')
factory = ChemicalFeatures.BuildFeatureFactory(fdefName)
feats = factory.GetFeaturesForMol(mol)
hydrogen_bonding_vec = numpy.zeros((num_max_atoms, 2), dtype=numpy.float32)
for f in feats:
if f.GetFamily() == 'Donor':
idx = f.GetAtomIds()[0]
hydrogen_bonding_vec[idx, 0] = 1.0
if f.GetFamily() == 'Acceptor':
idx = f.GetAtomIds()[0]
hydrogen_bonding_vec[idx, 1] = 1.0
return hydrogen_bonding_vec
def construct_num_hydrogens_vec(mol,
num_max_atoms=WEAVE_DEFAULT_NUM_MAX_ATOMS):
n_hydrogen_vec = numpy.zeros((num_max_atoms, 1), dtype=numpy.float32)
n_atom = mol.GetNumAtoms()
for i in range(n_atom):
n = 0
for j in range(n_atom):
if i == j:
continue
a = mol.GetAtomWithIdx(j)
if a.GetSymbol() != 'H':
continue
k = mol.GetBondBetweenAtoms(i, j)
if k is not None:
n += 1
n_hydrogen_vec[i, 0] = n
return n_hydrogen_vec
def construct_aromaticity_vec(mol, num_max_atoms=WEAVE_DEFAULT_NUM_MAX_ATOMS):
aromaticity_vec = numpy.zeros((num_max_atoms, 1), dtype=numpy.float32)
aromatix_atoms = mol.GetAromaticAtoms()
for a in aromatix_atoms:
aromaticity_vec[a.GetIdx()] = 1.0
return aromaticity_vec
def construct_atom_feature(mol, add_Hs,
num_max_atoms=WEAVE_DEFAULT_NUM_MAX_ATOMS,
atom_list=None, include_unknown_atom=False):
"""construct atom feature
Args:
mol (Mol): mol instance
add_Hs (bool): if the `mol` instance was added Hs, set True.
num_max_atoms (int): number of max atoms
atom_list (list): list of atoms to extract feature. If None, default
`ATOM` is used as `atom_list`
include_unknown_atom (bool): If False, when the `mol` includes atom
which is not in `atom_list`, it will raise
`MolFeatureExtractionError`.
If True, even the atom is not in `atom_list`, `atom_type` is set
as "unknown" atom.
Returns (numpy.ndarray): 2 dimensional array. First axis size is
`num_max_atoms`, representing each atom index.
Second axis for feature.
"""
atom_type_vec = construct_atom_type_vec(
mol, num_max_atoms, atom_list=atom_list,
include_unknown_atom=include_unknown_atom)
# TODO(nakago): Chilarity
formal_charge_vec = construct_formal_charge_vec(
mol, num_max_atoms=num_max_atoms)
partial_charge_vec = construct_partial_charge_vec(
mol, num_max_atoms=num_max_atoms)
atom_ring_vec = construct_atom_ring_vec(
mol, num_max_atoms=num_max_atoms)
hybridization_vec = construct_hybridization_vec(
mol, num_max_atoms=num_max_atoms)
hydrogen_bonding = construct_hydrogen_bonding(
mol, num_max_atoms=num_max_atoms)
aromaticity_vec = construct_aromaticity_vec(
mol, num_max_atoms=num_max_atoms)
if add_Hs:
num_hydrogens_vec = construct_num_hydrogens_vec(
mol, num_max_atoms=num_max_atoms)
feature = numpy.hstack((atom_type_vec, formal_charge_vec,
partial_charge_vec, atom_ring_vec,
hybridization_vec, hydrogen_bonding,
aromaticity_vec, num_hydrogens_vec))
else:
feature = numpy.hstack((atom_type_vec, formal_charge_vec,
partial_charge_vec, atom_ring_vec,
hybridization_vec, hydrogen_bonding,
aromaticity_vec))
return feature
# --- Pair feature extraction ---
def construct_bond_vec(mol, i, j):
bond_feature_vec = numpy.zeros((4, ), dtype=numpy.float32)
k = mol.GetBondBetweenAtoms(i, j)
if k is not None:
bond_type = str(k.GetBondType())
if bond_type == 'SINGLE':
bond_feature_vec[0] = 1.0
elif bond_type == 'DOUBLE':
bond_feature_vec[1] = 1.0
elif bond_type == 'TRIPLE':
bond_feature_vec[2] = 1.0
elif bond_type == 'AROMATIC':
bond_feature_vec[3] = 1.0
else:
raise ValueError("Unknown bond type {}".format(bond_type))
return bond_feature_vec
def construct_distance_vec(distance_matrix, i, j):
distance = min(MAX_DISTANCE, int(distance_matrix[i][j]))
distance_feature = numpy.zeros((MAX_DISTANCE, ), dtype=numpy.float32)
distance_feature[:distance] = 1.0
return distance_feature
def construct_ring_feature_vec(mol, num_max_atoms=WEAVE_DEFAULT_NUM_MAX_ATOMS):
n_atom = mol.GetNumAtoms()
sssr = Chem.GetSymmSSSR(mol)
ring_feature_vec = numpy.zeros(
(num_max_atoms ** 2, 1,), dtype=numpy.float32)
for ring in sssr:
ring = list(ring)
n_atom_in_ring = len(ring)
for i in range(n_atom_in_ring):
for j in range(n_atom_in_ring):
a0 = ring[i]
a1 = ring[j]
ring_feature_vec[a0 * n_atom + a1] = 1
return ring_feature_vec
def construct_pair_feature(mol, num_max_atoms=WEAVE_DEFAULT_NUM_MAX_ATOMS):
"""construct pair feature
Args:
mol (Mol): mol instance
num_max_atoms (int): number of max atoms
Returns (numpy.ndarray): 2 dimensional array. First axis size is
`num_max_atoms` ** 2, representing index of each atom pair.
Second axis for feature.
"""
n_atom = mol.GetNumAtoms()
distance_matrix = Chem.GetDistanceMatrix(mol)
distance_feature = numpy.zeros((num_max_atoms ** 2, MAX_DISTANCE,),
dtype=numpy.float32)
for i in range(n_atom):
for j in range(n_atom):
distance_feature[i * n_atom + j] = construct_distance_vec(
distance_matrix, i, j)
bond_feature = numpy.zeros((num_max_atoms ** 2, 4,), dtype=numpy.float32)
for i in range(n_atom):
for j in range(n_atom):
bond_feature[i * n_atom + j] = construct_bond_vec(mol, i, j)
ring_feature = construct_ring_feature_vec(mol, num_max_atoms=num_max_atoms)
feature = numpy.hstack((distance_feature, bond_feature, ring_feature))
return feature
class WeaveNetPreprocessor(MolPreprocessor):
"""WeaveNetPreprocessor
WeaveNet must have fixed-size atom list for now, zero_padding option
is always set to True.
Args:
max_atoms (int): Max number of atoms for each molecule, if the
number of atoms is more than this value, this data is simply
ignored.
Setting negative value indicates no limit for max atoms.
add_Hs (bool): If True, implicit Hs are added.
use_fixed_atom_feature (bool):
If True, atom feature is extracted used in original paper.
If it is False, atomic number is used instead.
atom_list (list): list of atoms to extract feature. If None, default
`ATOM` is used as `atom_list`
include_unknown_atom (bool): If False, when the `mol` includes atom
which is not in `atom_list`, it will raise
`MolFeatureExtractionError`.
If True, even the atom is not in `atom_list`, `atom_type` is set
as "unknown" atom.
kekulize (bool): If True, Kekulizes the molecule.
"""
def __init__(self, max_atoms=WEAVE_DEFAULT_NUM_MAX_ATOMS, add_Hs=True,
use_fixed_atom_feature=False, atom_list=None,
include_unknown_atom=False, kekulize=False):
super(WeaveNetPreprocessor, self).__init__(
add_Hs=add_Hs, kekulize=kekulize)
zero_padding = True
if zero_padding and max_atoms <= 0:
raise ValueError('max_atoms must be set to positive value when '
'zero_padding is True')
self.max_atoms = max_atoms
self.add_Hs = add_Hs
self.zero_padding = zero_padding
self.use_fixed_atom_feature = use_fixed_atom_feature
self.atom_list = atom_list
self.include_unknown_atom = include_unknown_atom
def get_input_features(self, mol):
"""get input features for WeaveNet
WeaveNetPreprocessor automatically add `H` to `mol`
Args:
mol (Mol):
"""
type_check_num_atoms(mol, self.max_atoms)
if self.use_fixed_atom_feature:
# original paper feature extraction
atom_array = construct_atom_feature(mol, self.add_Hs,
self.max_atoms, self.atom_list,
self.include_unknown_atom)
else:
# embed id of atomic numbers
atom_array = construct_atomic_number_array(mol, self.max_atoms)
pair_feature = construct_pair_feature(mol,
num_max_atoms=self.max_atoms)
return atom_array, pair_feature
================================================
FILE: chainer_chemistry/dataset/preprocessors/wle.py
================================================
import collections
import numpy as np
from chainer_chemistry.dataset.preprocessors import wle_io
from chainer_chemistry.dataset.preprocessors import wle_atom_array_update as wle_update
DEBUG = False
def apply_wle_for_datasets(datasets, cutoff=0, k=1):
"""
Apply label Weisfeiler--Lehman Embedding for the tuple of datasets.
Args:
datasets: tuple of dataset (usually, train/val/test),
each dataset consists of atom_array and
adj_array and teach_signal
cutoff: int, if more than 0, the expanded labels
whose freq <= cutoff will be removed.
k: int, the number of iterations of neighborhood
aggregation.
Returns:
- tuple of dataset (usually, train/val/test),
each dataest consists of atom_number_array and
adj_tensor with expanded labels
- list of all labels, used in the dataset parts.
- dictionary of label frequencies key:label valeu:frequency count
"""
atom_arrays, adj_arrays, teach_signals = wle_io.load_dataset_elements(datasets)
for _ in range(k):
atom_arrays, labels_frequencies = wle_update.update_atom_arrays(
atom_arrays, adj_arrays, cutoff)
datasets_expanded = wle_io.create_datasets(atom_arrays, adj_arrays, teach_signals)
expanded_labels = list(labels_frequencies.keys())
return tuple(datasets_expanded), expanded_labels, labels_frequencies
def apply_cwle_for_datasets(datasets, k=1):
"""
Apply Concatenated Weisfeiler--Lehman embedding for the tuple of datasets.
This also applicalbe for the Gated-sum Weisfeiler--Lehman embedding.
Args:
datasets: tuple of dataset (usually, train/val/test),
each dataset consists of atom_array and
adj_array and teach_signal
k: int, the number of iterations of neighborhood
aggregation.
Returns:
- tuple of dataset (usually, train/val/test),
each dataest consists of atom_number_array,
expanded_label_array, and adj_tensor
- list of all expanded labels, used in the dataset parts.
- dictionary of label frequencies key:label valeu:frequency count
"""
if k <= 0:
raise ValueError('Iterations should be a positive integer. '
'Found k={}'.format(k))
atom_arrays, adj_arrays, teach_signals = wle_io.load_dataset_elements(datasets)
for i in range(k):
if i != k - 1:
atom_arrays, labels_frequencies = wle_update.update_atom_arrays(
atom_arrays, adj_arrays, 0)
else:
wle_arrays, labels_frequencies = wle_update.update_atom_arrays(
atom_arrays, adj_arrays, 0, False)
datasets_expanded = wle_io.create_datasets(
atom_arrays, adj_arrays, teach_signals, wle_arrays)
expanded_labels = list(labels_frequencies.keys())
return tuple(datasets_expanded), expanded_labels, labels_frequencies
def _findmaxidx(datasets, idx):
atom_data_size = len(datasets[0][0])
if atom_data_size <= idx:
raise ValueError(
'data index is out of index. '
'atom_data size={} <= idx={}'.format(
atom_data_size, idx))
max_idx = -1
for dataset in datasets:
for mol_data in dataset:
atom_array = mol_data[idx]
max_atom_idx = np.max(atom_array)
if max_atom_idx > max_idx:
max_idx = max_atom_idx
return max_idx + 1 # 0-origin
def findmaxidx(datasets, target='atom_label'):
"""
Retruns the maximum number of the symbol index in an atom array,
throughout the datasets.
Args:
datasets: dataset entity
target: choice of 'atom_label' of 'wle_label'
Returns:
_findmaxidx(datasets, 0/2)
"""
if target == 'atom_label':
return _findmaxidx(datasets, 0)
elif target == 'wle_label':
return _findmaxidx(datasets, 2)
================================================
FILE: chainer_chemistry/dataset/preprocessors/wle_atom_array_update.py
================================================
import collections
import numpy as np
from chainer_chemistry.dataset.preprocessors import wle_util
def update_atom_arrays(atom_arrays, adj_arrays, cutoff, with_focus_atom=True):
expanded_atom_lists, labels_frequencies = list_all_expanded_labels(
atom_arrays, adj_arrays, with_focus_atom)
if cutoff > 0:
expanded_atom_lists, labels_frequencies = shrink_expanded_labels(
expanded_atom_lists, labels_frequencies, cutoff)
expanded_labels = list(labels_frequencies.keys())
atom_arrays = [wle_util.to_index(l, expanded_labels)
for l in expanded_atom_lists]
return atom_arrays, labels_frequencies
def shrink_expanded_labels(expanded_atom_lists,
labels_frequencies,
cutoff):
"""
Cut off the few-appearance expanded labels
Args:
expanded_atom_lists: tuple of list of expanded labels
labels_frequencies: list of label apperacne frequencies
cutoff: int, frequency cut of expanded labels
Returns:
- 3 (train/val/test) tuple of expanded atom arrays
(all nodes are associated with string representations of expanded signals)
- dictionary of frequencies all labels (key: label, value: frequency)
"""
# atom_array values are expanded label "STRING", not numbers
new_expanded_atom_lists = []
new_labels_frequencies = collections.defaultdict(lambda: 0)
# for each train/val/test, do
for set_expanded_atom_list in expanded_atom_lists:
# for each molecule sample, do
new_set_expanded_atom_list = []
for expanded_atom_list in set_expanded_atom_list:
mol_expanded_atom_list = []
# for each node i in the molecule,
# get the neighbor's atom label (number index)
for expanded_label in expanded_atom_list:
freq = labels_frequencies[expanded_label]
# check frequency here
if freq > cutoff:
label = expanded_label
else:
label = wle_util.get_focus_node_label(expanded_label)
mol_expanded_atom_list.append(label)
new_labels_frequencies[label] = new_labels_frequencies[label] + 1
# end cutoff-ifelse
# end i-for
new_set_expanded_atom_list.append(mol_expanded_atom_list)
# end zip(atom_arrays, adj_array)-for
new_expanded_atom_lists.append(new_set_expanded_atom_list)
# end zip(atom_arrays, adj_array)-for
return new_expanded_atom_lists, dict(new_labels_frequencies)
def list_all_expanded_labels(atom_arrays, adj_arrays, with_focus_atom=True):
"""
Exapnd all nodes into WLE representation. At the same time, return the list of all labels after expansion
Args:
atom_arrays: 3 (train/val/test) tuple of atom arrays
adj_arrays: 3 (train/val/test) tuple of adj.arrays
with_focus_atom: bool, if True, the expanded label starts from the original atom label ("C-ON-OFN")
if False, the exnapndd label do not include the original atom albel("-CN-OFN")
Returns:
- 3 (train/val/test) tuple of expanded atom arrays
(all nodes are associated with string representations of expanded signals)
- list of all labels appeared in the expanded atom arrays.
- dictionary of frequencies all labels (key: label, value: frequency)
"""
expanded_atom_lists = [] # atom_array values are expanded label "STRING", not numbers
labels_frequencies = collections.defaultdict(lambda: 0)
# for each train/val/test, do
for set_atom_arrays, set_adj_arrays in zip(atom_arrays, adj_arrays):
# for each molecule sample, do
set_expanded_atom_list = []
for atom_array, adj_array in zip(set_atom_arrays, set_adj_arrays):
N = len(atom_array) # number of molecules
# atom_array: N by F
# adj_array: N by N or N by R by N
# compress the relation axis
adj_array = wle_util.compress_relation_axis(adj_array)
assert adj_array.shape == (N, N)
# find neighbors
# array[0]: row index array[1]: column index
neighbors = np.nonzero(adj_array)
mol_expanded_atom_list = []
# for each node i in the molecule,
# get the neighbor's atom label (number index)
for i in range(N):
expanded_label = wle_util.get_neighbor_representation(
i, atom_array, neighbors, with_focus_atom)
mol_expanded_atom_list.append(expanded_label)
labels_frequencies[expanded_label] = labels_frequencies[expanded_label] + 1
# end i-for
set_expanded_atom_list.append(mol_expanded_atom_list)
# end zip(atom_arrays, adj_array)-for
expanded_atom_lists.append(set_expanded_atom_list)
# end zip(atom_arrays, adj_array)-for
# Convert to a normal dictionary because
# we cannot pickle defaultdicts with lambdas.
return expanded_atom_lists, dict(labels_frequencies)
================================================
FILE: chainer_chemistry/dataset/preprocessors/wle_io.py
================================================
import numpy as np
from chainer_chemistry.datasets.numpy_tuple_dataset import NumpyTupleDataset
DEBUG = False
def create_datasets(atom_arrays, adj_arrays, teach_signals, wle_arrays=None):
"""
Expand the atomic_num_arrays with the expanded labels,
then return valid datasets (tuple of NumpyTupleDataset)
Args:
atom_arrays: 3-tuple of list of lists.
atom_arrays[i][j][k] is the id of an atom
i: train/val/test
j: index of a sample (i.e. molcule)
k: index of an atom
adj_arrays: list of list of numpy.array, all mol's adjacnecy tensors
teach_signals: list of list of numpy.array,
all teacher (supervision) signals
wle_arrays: None (for WLE) or 3-tuple of list of lists (for CWLE and GWLE).
Returns: 3 tuple of valid datasets (train/vel/test) in NumpyTuppleDataset
"""
output_datasets = []
# ToDo: try another indexing: e.g. orignal node label + extneions
assert len(atom_arrays) == len(adj_arrays) == len(teach_signals)
if wle_arrays is not None:
assert len(atom_arrays) == len(wle_arrays)
for i in range(len(atom_arrays)):
# We have swaped the axes 0 and 1 for adj-arrays. re-swap
set_adj_arrays = np.array(adj_arrays[i])
for m in range(len(set_adj_arrays)):
set_adj_arrays[m] = np.swapaxes(set_adj_arrays[m], 0, 1)
if wle_arrays is None:
dataset = NumpyTupleDataset(np.array(atom_arrays[i]),
set_adj_arrays,
np.array(teach_signals[i]))
else:
dataset = NumpyTupleDataset(np.array(atom_arrays[i]),
set_adj_arrays,
np.array(wle_arrays[i]),
np.array(teach_signals[i]))
output_datasets.append(dataset)
# end expanded-for
return output_datasets
def load_dataset_elements(datasets):
"""
Load all dataset tuples: atom array, adj. array, and teacher signals.
Args:
datasets: tuple of NumpyTupleDataset
Returns:
- tuple of lists of atom arrays, adj.arrays, and teacher signals.
"""
if DEBUG:
print('type(datasets)', type(datasets)) # tuple
atom_arrays = [] # 3 by num_mols by N by F
adj_arrays = [] # 3 by num_mols by N by N, or 3 by N by R by N by N by N
teach_signals = [] # 3 by num_mols by N by (data-dependent)
for dataset in datasets:
if DEBUG:
print('type(dataset)', type(dataset)) # NumpyTupleDataset
set_atom_arrays = [] # Mol by N
set_adj_arrays = [] # Mol by N by N or N by R by N by N
set_teach_signals = [] # Mol by (data-dependent)
for mol_data in dataset:
atom_array = mol_data[0]
adj_array = mol_data[1]
teach_signal = mol_data[2]
if DEBUG:
print("type(mol_data)=", type(mol_data)) # tuple
print("type(atom_arrray)=", type(atom_array)) # ndarray
print("type(adj_arrray)=", type(adj_array)) # ndarray
print("type(teach_signal)=", type(teach_signal)) # ndarray
set_atom_arrays.append(atom_array)
# for 3-D tensor, we swap axis here
set_adj_arrays.append(adj_array.swapaxes(0, 1))
set_teach_signals.append(teach_signal)
# end dataset-for
atom_arrays.append(set_atom_arrays)
adj_arrays.append(set_adj_arrays)
teach_signals.append(set_teach_signals)
# end datasets-for
return atom_arrays, adj_arrays, teach_signals
================================================
FILE: chainer_chemistry/dataset/preprocessors/wle_util.py
================================================
import numpy as np
DEBUG = False
def _index(atom, values):
idx = values.index(atom)
if DEBUG:
print("idx=", idx)
print("expanded_label=", atom)
return idx
def to_index(mols, values):
return np.array([np.array([_index(atom, values) for atom in mol],
dtype=np.int32)
for mol in mols])
def compress_relation_axis(adj_array):
ndim = adj_array.ndim
if ndim == 2:
return adj_array
elif ndim == 3:
return np.sum(adj_array, axis=1, keepdims=False)
else:
raise ValueError(
'ndim of adjacency matrix should be 2 or 3. '
'Found ndim={}.'.format(ndim))
def _to_string(atom_label, neighbor_labels, with_focus_atom):
expanded_label = ".".join(map(str, neighbor_labels))
if with_focus_atom:
expanded_label = str(atom_label) + "-" + expanded_label
if DEBUG:
print("expanded_label=" + expanded_label)
return expanded_label
def get_neighbor_representation(idx, atom_array, neighbors, with_focus_atom):
atom_label = atom_array[idx]
neighbor = neighbors[1][np.where(neighbors[0] == idx)]
if DEBUG:
print(neighbor)
print("len(neighbor_i)=", len(neighbor))
neighbor_labels = np.sort([atom_array[x] for x in neighbor if x != idx])
return _to_string(
atom_label, neighbor_labels, with_focus_atom)
def get_focus_node_label(expanded_label):
tokens = expanded_label.split('-')
if len(tokens) != 2:
raise ValueError(
'Invalid label={}'.format(expanded_label))
return tokens[0]
================================================
FILE: chainer_chemistry/dataset/splitters/__init__.py
================================================
from chainer_chemistry.dataset.splitters import base_splitter # NOQA
from chainer_chemistry.dataset.splitters import random_splitter # NOQA
from chainer_chemistry.dataset.splitters import scaffold_splitter # NOQA
from chainer_chemistry.dataset.splitters import deepchem_scaffold_splitter # NOQA
from chainer_chemistry.dataset.splitters import stratified_splitter # NOQA
from chainer_chemistry.dataset.splitters import time_splitter # NOQA
from chainer_chemistry.dataset.splitters.base_splitter import BaseSplitter # NOQA
from chainer_chemistry.dataset.splitters.random_splitter import RandomSplitter # NOQA
from chainer_chemistry.dataset.splitters.scaffold_splitter import ScaffoldSplitter # NOQA
from chainer_chemistry.dataset.splitters.deepchem_scaffold_splitter import DeepChemScaffoldSplitter # NOQA
from chainer_chemistry.dataset.splitters.stratified_splitter import StratifiedSplitter # NOQA
from chainer_chemistry.dataset.splitters.time_splitter import TimeSplitter # NOQA
split_method_dict = {
'random': RandomSplitter,
'stratified': StratifiedSplitter,
'scaffold': ScaffoldSplitter,
'dc_scaffold': DeepChemScaffoldSplitter,
'time': TimeSplitter,
}
================================================
FILE: chainer_chemistry/dataset/splitters/base_splitter.py
================================================
from chainer_chemistry.datasets.numpy_tuple_dataset import NumpyTupleDataset
def converter_default(dataset, indices):
return dataset[indices]
def converter_numpy_tuple_dataset(dataset, indices):
return NumpyTupleDataset(*dataset.features[indices])
converter_dict = {
NumpyTupleDataset: converter_numpy_tuple_dataset
}
class BaseSplitter(object):
def k_fold_split(self, dataset, k):
raise NotImplementedError
def _split(self, dataset, **kwargs):
raise NotImplementedError
def train_valid_test_split(self, dataset, frac_train=0.8, frac_valid=0.1,
frac_test=0.1, converter=None,
return_index=True, **kwargs):
if converter is None:
converter = converter_dict.get(type(dataset), converter_default)
train_inds, valid_inds, test_inds = self._split(dataset, frac_train,
frac_valid, frac_test,
**kwargs)
if return_index:
return train_inds, valid_inds, test_inds
else:
train = converter(dataset, train_inds)
valid = converter(dataset, valid_inds)
test = converter(dataset, test_inds)
return train, valid, test,
def train_valid_split(self, dataset, frac_train=0.9, frac_valid=0.1,
converter=None, return_index=True, **kwargs):
train_inds, valid_inds, test_inds = self._split(dataset, frac_train,
frac_valid, 0.,
**kwargs)
assert len(test_inds) == 0
if converter is None:
converter = converter_dict.get(type(dataset), converter_default)
if return_index:
return train_inds, valid_inds
else:
train = converter(dataset, train_inds)
valid = converter(dataset, valid_inds)
return train, valid,
================================================
FILE: chainer_chemistry/dataset/splitters/deepchem_scaffold_splitter.py
================================================
from collections import defaultdict
import numpy
from rdkit import Chem
from rdkit.Chem.Scaffolds import MurckoScaffold
from chainer_chemistry.dataset.splitters.base_splitter import BaseSplitter
def generate_scaffold(smiles, include_chirality=False):
"""return scaffold string of target molecule"""
mol = Chem.MolFromSmiles(smiles)
scaffold = MurckoScaffold\
.MurckoScaffoldSmiles(mol=mol, includeChirality=include_chirality)
return scaffold
class DeepChemScaffoldSplitter(BaseSplitter):
"""Class for doing data splits by chemical scaffold.
Referred Deepchem for the implementation, https://github.com/deepchem/deepchem/blob/master/deepchem/splits/splitters.py
"""
def _split(self, dataset, frac_train=0.8, frac_valid=0.1, frac_test=0.1,
**kwargs):
print("Using DeepChem Scaffold")
numpy.testing.assert_almost_equal(frac_train + frac_valid + frac_test,
1.)
seed = kwargs.get('seed', None)
smiles_list = kwargs.get('smiles_list')
include_chirality = kwargs.get('include_chirality')
if len(dataset) != len(smiles_list):
raise ValueError("The lengths of dataset and smiles_list are "
"different")
rng = numpy.random.RandomState(seed)
scaffolds = {}
data_len = len(dataset)
for ind, smiles in enumerate(smiles_list):
scaffold = generate_scaffold(smiles, include_chirality)
if scaffold not in scaffolds:
scaffolds[scaffold] = [ind]
else:
scaffolds[scaffold].append(ind)
# Sort from largest to smallest scaffold sets
scaffolds = {key: sorted(value) for key, value in scaffolds.items()}
scaffold_sets = [ scaffold_set for (scaffold, scaffold_set) in sorted(scaffolds.items(), key=lambda x: (len(x[1]), x[1][0]), reverse=True) ]
train_cutoff = frac_train * len(dataset)
valid_cutoff = (frac_train + frac_valid) * len(dataset)
train_inds, valid_inds, test_inds = [], [], []
for scaffold_set in scaffold_sets:
if len(train_inds) + len(scaffold_set) > train_cutoff:
if len(train_inds) + len(valid_inds) + len(scaffold_set) > valid_cutoff:
test_inds += scaffold_set
else:
valid_inds += scaffold_set
else:
train_inds += scaffold_set
return numpy.array(train_inds), numpy.array(valid_inds),\
numpy.array(test_inds),\
def train_valid_test_split(self, dataset, smiles_list, frac_train=0.8,
frac_valid=0.1, frac_test=0.1, converter=None,
return_index=True, seed=None,
include_chirality=False, **kwargs):
"""Split dataset into train, valid and test set.
Split indices are generated by splitting based on the scaffold of small
molecules.
Args:
dataset(NumpyTupleDataset, numpy.ndarray):
Dataset.
smiles_list(list):
SMILES list corresponding to datset.
seed (int):
Random seed.
frac_train(float):
Fraction of dataset put into training data.
frac_valid(float):
Fraction of dataset put into validation data.
converter(callable):
return_index(bool):
If `True`, this function returns only indices. If `False`, this
function returns splitted dataset.
Returns:
SplittedDataset(tuple): splitted dataset or indices
"""
return super(DeepChemScaffoldSplitter, self)\
.train_valid_test_split(dataset, frac_train, frac_valid, frac_test,
converter, return_index, seed=seed,
smiles_list=smiles_list,
include_chirality=include_chirality,
**kwargs)
def train_valid_split(self, dataset, smiles_list, frac_train=0.9,
frac_valid=0.1, converter=None, return_index=True,
seed=None, include_chirality=False, **kwargs):
"""Split dataset into train and valid set.
Split indices are generated by splitting based on the scaffold of small
molecules.
Args:
dataset(NumpyTupleDataset, numpy.ndarray):
Dataset.
smiles_list(list):
SMILES list corresponding to datset.
seed (int):
Random seed.
frac_train(float):
Fraction of dataset put into training data.
frac_valid(float):
Fraction of dataset put into validation data.
converter(callable):
return_index(bool):
If `True`, this function returns only indices. If `False`, this
function returns splitted dataset.
Returns:
SplittedDataset(tuple): splitted dataset or indices
"""
return super(DeepChemScaffoldSplitter, self)\
.train_valid_split(dataset, frac_train, frac_valid, converter,
return_index, seed=seed,
smiles_list=smiles_list,
include_chirality=include_chirality, **kwargs)
================================================
FILE: chainer_chemistry/dataset/splitters/random_splitter.py
================================================
import numpy
from chainer_chemistry.dataset.splitters.base_splitter import BaseSplitter
class RandomSplitter(BaseSplitter):
"""Class for doing random data splits."""
def _split(self, dataset, frac_train=0.8, frac_valid=0.1, frac_test=0.1,
**kwargs):
seed = kwargs.get('seed')
numpy.testing.assert_almost_equal(frac_train + frac_valid + frac_test,
1.)
if seed is not None:
perm = numpy.random.RandomState(seed).permutation(len(dataset))
else:
perm = numpy.random.permutation(len(dataset))
train_data_size = int(len(dataset) * frac_train)
valid_data_size = int(len(dataset) * frac_valid)
return (perm[:train_data_size],
perm[train_data_size:train_data_size + valid_data_size],
perm[train_data_size + valid_data_size:])
def train_valid_test_split(self, dataset, frac_train=0.8, frac_valid=0.1,
frac_test=0.1, converter=None,
return_index=True, seed=None, **kwargs):
"""Generate indices to split data into train, valid and test set.
Args:
dataset(NumpyTupleDataset, numpy.ndarray):
Dataset.
seed (int):
Random seed.
frac_train(float):
Fraction of dataset put into training data.
frac_valid(float):
Fraction of dataset put into validation data.
frac_test(float):
Fraction of dataset put into test data.
converter(callable):
return_index(bool):
If `True`, this function returns only indexes. If `False`, this
function returns splitted dataset.
Returns:
SplittedDataset(tuple):
splitted dataset or indexes
.. admonition:: Example
>>> from chainer_chemistry.datasets import NumpyTupleDataset
>>> from chainer_chemistry.dataset.splitters import RandomSplitter
>>> a = numpy.random.random((10, 10))
>>> b = numpy.random.random((10, 8))
>>> c = numpy.random.random((10, 1))
>>> d = NumpyTupleDataset(a, b, c)
>>> splitter = RandomSplitter()
>>> train, valid, test =
splitter.train_valid_test_split(dataset,
return_index=False)
>>> print(len(train), len(valid), len(test))
8, 1, 1
"""
return super(RandomSplitter, self).train_valid_test_split(dataset,
frac_train,
frac_valid,
frac_test,
converter,
return_index,
seed=seed,
**kwargs)
def train_valid_split(self, dataset, frac_train=0.9, frac_valid=0.1,
converter=None, return_index=True, seed=None,
**kwargs):
"""Generate indices to split data into train and valid set.
Args:
dataset(NumpyTupleDataset, numpy.ndarray):
Dataset.
seed (int):
Random seed.
frac_train(float):
Fraction of dataset put into training data.
frac_valid(float):
Fraction of dataset put into validation data.
converter(callable):
return_index(bool):
If `True`, this function returns only indexes. If `False`, this
function returns splitted dataset.
Returns:
SplittedDataset(tuple):
splitted dataset or indexes
.. admonition:: Example
>>> from chainer_chemistry.datasets import NumpyTupleDataset
>>> from chainer_chemistry.dataset.splitters import RandomSplitter
>>> a = numpy.random.random((10, 10))
>>> b = numpy.random.random((10, 8))
>>> c = numpy.random.random((10, 1))
>>> d = NumpyTupleDataset(a, b, c)
>>> splitter = RandomSplitter()
>>> train, valid =
splitter.train_valid_split(dataset, return_index=False)
>>> print(len(train), len(valid))
9, 1
"""
return super(RandomSplitter, self).train_valid_split(dataset,
frac_train,
frac_valid,
converter,
return_index,
seed=seed,
**kwargs)
================================================
FILE: chainer_chemistry/dataset/splitters/scaffold_splitter.py
================================================
from collections import defaultdict
import numpy
from rdkit import Chem
from rdkit.Chem.Scaffolds import MurckoScaffold
from chainer_chemistry.dataset.splitters.base_splitter import BaseSplitter
def generate_scaffold(smiles, include_chirality=False):
"""return scaffold string of target molecule"""
mol = Chem.MolFromSmiles(smiles)
scaffold = MurckoScaffold\
.MurckoScaffoldSmiles(mol=mol, includeChirality=include_chirality)
return scaffold
class ScaffoldSplitter(BaseSplitter):
"""Class for doing data splits by chemical scaffold.
Referred Deepchem for the implementation, https://git.io/fXzF4
"""
def _split(self, dataset, frac_train=0.8, frac_valid=0.1, frac_test=0.1,
**kwargs):
numpy.testing.assert_almost_equal(frac_train + frac_valid + frac_test,
1.)
seed = kwargs.get('seed', None)
smiles_list = kwargs.get('smiles_list')
include_chirality = kwargs.get('include_chirality')
if len(dataset) != len(smiles_list):
raise ValueError("The lengths of dataset and smiles_list are "
"different")
rng = numpy.random.RandomState(seed)
scaffolds = defaultdict(list)
for ind, smiles in enumerate(smiles_list):
scaffold = generate_scaffold(smiles, include_chirality)
scaffolds[scaffold].append(ind)
scaffold_sets = rng.permutation(list(scaffolds.values()))
n_total_valid = int(numpy.floor(frac_valid * len(dataset)))
n_total_test = int(numpy.floor(frac_test * len(dataset)))
train_index = []
valid_index = []
test_index = []
for scaffold_set in scaffold_sets:
if len(valid_index) + len(scaffold_set) <= n_total_valid:
valid_index.extend(scaffold_set)
elif len(test_index) + len(scaffold_set) <= n_total_test:
test_index.extend(scaffold_set)
else:
train_index.extend(scaffold_set)
return numpy.array(train_index), numpy.array(valid_index),\
numpy.array(test_index),\
def train_valid_test_split(self, dataset, smiles_list, frac_train=0.8,
frac_valid=0.1, frac_test=0.1, converter=None,
return_index=True, seed=None,
include_chirality=False, **kwargs):
"""Split dataset into train, valid and test set.
Split indices are generated by splitting based on the scaffold of small
molecules.
Args:
dataset(NumpyTupleDataset, numpy.ndarray):
Dataset.
smiles_list(list):
SMILES list corresponding to datset.
seed (int):
Random seed.
frac_train(float):
Fraction of dataset put into training data.
frac_valid(float):
Fraction of dataset put into validation data.
converter(callable):
return_index(bool):
If `True`, this function returns only indices. If `False`, this
function returns splitted dataset.
Returns:
SplittedDataset(tuple): splitted dataset or indices
"""
return super(ScaffoldSplitter, self)\
.train_valid_test_split(dataset, frac_train, frac_valid, frac_test,
converter, return_index, seed=seed,
smiles_list=smiles_list,
include_chirality=include_chirality,
**kwargs)
def train_valid_split(self, dataset, smiles_list, frac_train=0.9,
frac_valid=0.1, converter=None, return_index=True,
seed=None, include_chirality=False, **kwargs):
"""Split dataset into train and valid set.
Split indices are generated by splitting based on the scaffold of small
molecules.
Args:
dataset(NumpyTupleDataset, numpy.ndarray):
Dataset.
smiles_list(list):
SMILES list corresponding to datset.
seed (int):
Random seed.
frac_train(float):
Fraction of dataset put into training data.
frac_valid(float):
Fraction of dataset put into validation data.
converter(callable):
return_index(bool):
If `True`, this function returns only indices. If `False`, this
function returns splitted dataset.
Returns:
SplittedDataset(tuple): splitted dataset or indices
"""
return super(ScaffoldSplitter, self)\
.train_valid_split(dataset, frac_train, frac_valid, converter,
return_index, seed=seed,
smiles_list=smiles_list,
include_chirality=include_chirality, **kwargs)
================================================
FILE: chainer_chemistry/dataset/splitters/stratified_splitter.py
================================================
import numpy
import pandas
from chainer_chemistry.dataset.splitters.base_splitter import BaseSplitter
from chainer_chemistry.datasets.numpy_tuple_dataset import NumpyTupleDataset
def _approximate_mode(class_counts, n_draws):
"""Referred scikit-learn, https://git.io/fPMmB"""
n_class = len(class_counts)
continuous = class_counts * n_draws / class_counts.sum()
floored = numpy.floor(continuous)
assert n_draws // n_class == floored.sum() // n_class
n_remainder = int(n_draws - floored.sum())
remainder = continuous - floored
inds = numpy.argsort(remainder)[::-1]
inds = inds[:n_remainder]
floored[inds] += 1
assert n_draws == floored.sum()
return floored.astype(numpy.int)
class StratifiedSplitter(BaseSplitter):
"""Class for doing stratified data splits."""
def _split(self, dataset, frac_train=0.8, frac_valid=0.1, frac_test=0.1,
labels=None, **kwargs):
numpy.testing.assert_almost_equal(frac_train + frac_valid + frac_test,
1.)
seed = kwargs.get('seed', None)
label_axis = kwargs.get('label_axis', -1)
task_index = kwargs.get('task_index', 0)
n_bin = kwargs.get('n_bin', 10)
task_type = kwargs.get('task_type', 'auto')
if task_type not in ['classification', 'regression', 'auto']:
raise ValueError("{} is invalid. Please use 'classification',"
"'regression' or 'auto'".format(task_type))
rng = numpy.random.RandomState(seed)
if isinstance(labels, list):
labels = numpy.array(labels)
elif labels is None:
if not isinstance(dataset, NumpyTupleDataset):
raise ValueError("Please assign label dataset.")
labels = dataset.features[:, label_axis]
if labels.ndim == 1:
labels = labels
else:
labels = labels[:, task_index]
if task_type == 'auto':
if labels.dtype.kind == 'i':
task_type = 'classification'
elif labels.dtype.kind == 'f':
task_type = 'regression'
else:
raise ValueError
if task_type == 'classification':
classes, labels = numpy.unique(labels, return_inverse=True)
elif task_type == 'regression':
classes = numpy.arange(n_bin)
labels = pandas.qcut(labels, n_bin, labels=False)
else:
raise ValueError
n_classes = classes.shape[0]
n_total_valid = int(numpy.floor(frac_valid * len(dataset)))
n_total_test = int(numpy.floor(frac_test * len(dataset)))
class_counts = numpy.bincount(labels)
class_indices = numpy.split(numpy.argsort(labels,
kind='mergesort'),
numpy.cumsum(class_counts)[:-1])
# n_total_train is the remainder: n - n_total_valid - n_total_test
n_valid_samples = _approximate_mode(class_counts, n_total_valid)
class_counts = class_counts - n_valid_samples
n_test_samples = _approximate_mode(class_counts, n_total_test)
train_index = []
valid_index = []
test_index = []
for i in range(n_classes):
n_valid = n_valid_samples[i]
n_test = n_test_samples[i]
perm = rng.permutation(len(class_indices[i]))
class_perm_index = class_indices[i][perm]
class_valid_index = class_perm_index[:n_valid]
class_test_index = class_perm_index[n_valid:n_valid+n_test]
class_train_index = class_perm_index[n_valid+n_test:]
train_index.extend(class_train_index)
valid_index.extend(class_valid_index)
test_index.extend(class_test_index)
assert n_total_valid == len(valid_index)
assert n_total_test == len(test_index)
return numpy.array(train_index), numpy.array(valid_index),\
numpy.array(test_index),
def train_valid_test_split(self, dataset, labels=None, label_axis=-1,
task_index=0, frac_train=0.8, frac_valid=0.1,
frac_test=0.1, converter=None,
return_index=True, seed=None, task_type='auto',
n_bin=10, **kwargs):
"""Split dataset into train, valid and test set.
Split indices are generated by stratified splitting of labels.
Args:
dataset(NumpyTupleDataset, numpy.ndarray):
Dataset.
labels(numpy.ndarray):
Target label. If `None`, this function assumes that dataset is
an instance of `NumpyTupleDataset`.
labels_axis(int):
Dataset feature axis in NumpyTupleDataset.
task_index(int):
Target task index in dataset for stratification.
seed (int):
Random seed.
frac_train(float):
Fraction of dataset put into training data.
frac_valid(float):
Fraction of dataset put into validation data.
return_index(bool):
If `True`, this function returns only indexes. If `False`, this
function returns splitted dataset.
Returns:
SplittedDataset(tuple):
splitted dataset or indexes
.. admonition:: Example
>>> from chainer_chemistry.datasets import NumpyTupleDataset
>>> from chainer_chemistry.dataset.splitters import StratifiedSplitter # NOQA
>>>
>>> a = numpy.random.random((10, 10))
>>> b = numpy.random.random((10, 8))
>>> c = numpy.random.random((10, 1))
>>> d = NumpyTupleDataset(a, b, c)
>>> splitter = StratifiedSplitter()
>>> train, valid, test =
splitter.train_valid_test_split(dataset, return_index=False)
>>> print(len(train), len(valid))
8, 1, 1
"""
return super(StratifiedSplitter, self)\
.train_valid_test_split(dataset, frac_train, frac_valid, frac_test,
converter, return_index, seed=seed,
label_axis=label_axis, task_type=task_type,
task_index=task_index, n_bin=n_bin,
labels=labels, **kwargs)
def train_valid_split(self, dataset, labels=None, label_axis=-1,
task_index=0, frac_train=0.9, frac_valid=0.1,
converter=None, return_index=True, seed=None,
task_type='auto', n_bin=10, **kwargs):
"""Split dataset into train and valid set.
Split indices are generated by stratified splitting of labels.
Args:
dataset(NumpyTupleDataset, numpy.ndarray):
Dataset.
labels(numpy.ndarray):
Target label. If `None`, this function assumes that dataset is
an instance of `NumpyTupleDataset`.
labels_axis(int):
Dataset feature axis in NumpyTupleDataset.
task_index(int):
Target task index in dataset for stratification.
seed (int):
Random seed.
frac_train(float):
Fraction of dataset put into training data.
frac_valid(float):
Fraction of dataset put into validation data.
return_index(bool):
If `True`, this function returns only indexes. If `False`, this
function returns splitted dataset.
Returns:
SplittedDataset(tuple):
splitted dataset or indexes
.. admonition:: Example
>>> from chainer_chemistry.datasets import NumpyTupleDataset
>>> from chainer_chemistry.dataset.splitters \
>>> import StratifiedSplitter
>>> a = numpy.random.random((10, 10))
>>> b = numpy.random.random((10, 8))
>>> c = numpy.random.random((10, 1))
>>> d = NumpyTupleDataset(a, b, c)
>>> splitter = StratifiedSplitter()
>>> train, valid =
splitter.train_valid_split(dataset, return_index=False)
>>> print(len(train), len(valid))
9, 1
"""
return super(StratifiedSplitter, self)\
.train_valid_split(dataset, frac_train, frac_valid, converter,
return_index, seed=seed, label_axis=label_axis,
task_type=task_type, task_index=task_index,
n_bin=n_bin, labels=labels, **kwargs)
================================================
FILE: chainer_chemistry/dataset/splitters/time_splitter.py
================================================
import numpy
from chainer_chemistry.dataset.splitters.base_splitter import BaseSplitter
class TimeSplitter(BaseSplitter):
"""Class for doing time order splits."""
def _split(self, dataset, frac_train=0.8, frac_valid=0.1, frac_test=0.1,
**kwargs):
numpy.testing.assert_almost_equal(
frac_train + frac_valid + frac_test, 1.)
time_list = kwargs.get('time_list')
train_cutoff = int(frac_train * len(dataset))
valid_cutoff = int((frac_train + frac_valid) * len(dataset))
index = [idx for idx, _ in sorted(
enumerate(time_list), key=lambda x: x[1])][:len(dataset)]
train_index = index[:train_cutoff]
valid_index = index[train_cutoff:valid_cutoff]
test_index = index[valid_cutoff:]
return numpy.array(train_index), numpy.array(valid_index), \
numpy.array(test_index)
def train_valid_test_split(self, dataset, time_list=None, frac_train=0.8,
frac_valid=0.1, frac_test=0.1, converter=None,
return_index=True, **kwargs):
"""Split dataset into train, valid and test set.
Split indices are generated by splitting based on time order.
Args:
dataset(NumpyTupleDataset, numpy.ndarray):
Dataset.
time_list(list):
Time list corresponding to dataset.
frac_train(float):
Fraction of dataset put into training data.
frac_valid(float):
Fraction of dataset put into validation data.
frac_test(float):
Fraction of dataset put into test data.
converter(callable):
return_index(bool):
If `True`, this function returns only indexes. If `False`, this
function returns splitted dataset.
Returns:
SplittedDataset(tuple): splitted dataset or indices
.. admonition:: Example
>>> from chainer_chemistry.datasets import NumpyTupleDataset
>>> from chainer_chemistry.dataset.splitters import TimeSplitter
>>> a = numpy.random.random((10, 10))
>>> b = numpy.random.random((10, 8))
>>> c = numpy.random.random((10, 1))
>>> d = NumpyTupleDataset(a, b, c)
>>> splitter = TimeSplitter()
>>> train, valid, test =
splitter.train_valid_test_split(dataset,
return_index=False)
>>> print(len(train), len(valid))
8, 1, 1
"""
return super(TimeSplitter, self).train_valid_test_split(
dataset, frac_train, frac_valid, frac_test, converter,
return_index, time_list=time_list, **kwargs)
def train_valid_split(self, dataset, time_list=None, frac_train=0.9,
frac_valid=0.1, converter=None, return_index=True,
**kwargs):
"""Split dataset into train and valid set.
Split indices are generated by splitting based on time order.
Args:
dataset(NumpyTupleDataset, numpy.ndarray):
Dataset.
time_list(list):
Time list corresponding to dataset.
frac_train(float):
Fraction of dataset put into training data.
frac_valid(float):
Fraction of dataset put into validation data.
converter(callable):
return_index(bool):
If `True`, this function returns only indexes. If `False`, this
function returns splitted dataset.
Returns:
SplittedDataset(tuple):
splitted dataset or indexes
.. admonition:: Example
>>> from chainer_chemistry.datasets import NumpyTupleDataset
>>> from chainer_chemistry.dataset.splitters import TimeSplitter
>>> a = numpy.random.random((10, 10))
>>> b = numpy.random.random((10, 8))
>>> c = numpy.random.random((10, 1))
>>> d = NumpyTupleDataset(a, b, c)
>>> splitter = TimeSplitter()
>>> train, valid =
splitter.train_valid_split(dataset, return_index=False)
>>> print(len(train), len(valid))
9, 1
"""
return super(TimeSplitter, self).train_valid_split(
dataset, frac_train, frac_valid, converter, return_index,
time_list=time_list, **kwargs)
================================================
FILE: chainer_chemistry/dataset/utils.py
================================================
import numpy
class GaussianDistance(object):
"""Expand distance with Gaussian basis sit at centers and with width 0.5.
Args:
centers (numpy.ndarray): 1 dimensional array.
The positions of the center of the peak in a gaussian function.
width (float): Normal distribution in a gaussian function.
"""
def __init__(self, centers=None, width=0.5):
if centers is None:
centers = numpy.linspace(0, 4, 20)
self.centers = centers
self.width = width
def expand(self, d):
"""Expand distance with given parameters.
Args:
d (float): distance
Returns
expanded_distance (numpy.1darray):
M dimension with M the length of centers
"""
return numpy.exp(-(d-self.centers)**2 / self.width**2,
dtype=numpy.float32)
def expand_from_distances(self, distances):
"""Expand distances with given parameters.
The original implemantation is below.
https://github.com/txie-93/cgcnn/blob/fdcd7eec8771e223e60e1b0abf7e6c7bc7d006bf/cgcnn/data.py#L152
Args:
distances (numpy.ndarray): 1 dimensional array.
Returns
expanded_distances (numpy.ndarray): 2 dimensional array.
First axis size is the number of distance,
Second axis size is M dimension with M the length of centers
"""
return numpy.exp(-(distances[..., numpy.newaxis] - self.centers)**2
/ self.width**2, dtype=numpy.float32)
================================================
FILE: chainer_chemistry/datasets/__init__.py
================================================
from chainer_chemistry.datasets import molnet # NOQA
from chainer_chemistry.datasets import qm9 # NOQA
from chainer_chemistry.datasets import tox21 # NOQA
from chainer_chemistry.datasets import zinc # NOQA
# import class and function
from chainer_chemistry.datasets.numpy_tuple_dataset import NumpyTupleDataset # NOQA
from chainer_chemistry.datasets.qm9 import get_qm9 # NOQA
from chainer_chemistry.datasets.qm9 import get_qm9_filepath # NOQA
from chainer_chemistry.datasets.qm9 import get_qm9_label_names # NOQA
from chainer_chemistry.datasets.tox21 import get_tox21 # NOQA
from chainer_chemistry.datasets.tox21 import get_tox21_filepath # NOQA
from chainer_chemistry.datasets.tox21 import get_tox21_label_names # NOQA
from chainer_chemistry.datasets.zinc import get_zinc250k # NOQA
from chainer_chemistry.datasets.zinc import get_zinc250k_filepath # NOQA
from chainer_chemistry.datasets.zinc import get_zinc250k_label_names # NOQA
================================================
FILE: chainer_chemistry/datasets/citation_network/citation.py
================================================
import os
import networkx as nx
import numpy
from tqdm import tqdm
def citation_to_networkx(dirpath, name):
G = nx.Graph()
# node feature, node label
with open(os.path.join(dirpath, "{}.content".format(name))) as f:
lines = f.readlines()
compressor = {}
acc = 0
for line in tqdm(lines):
lis = line.split()
key, val = lis[0], lis[-1]
if val in compressor:
val = compressor[val]
else:
compressor[val] = acc
val = acc
acc += 1
G.add_node(key,
x=numpy.array(lis[1:-1], dtype=numpy.float32),
y=val)
G.graph['label_num'] = acc
# edge
with open(os.path.join(dirpath, "{}.cites".format(name))) as f:
lines = f.readlines()
for line in tqdm(lines):
u, v = line.split()
if u not in G.nodes.keys():
print("Warning: {} does not appear in {}{}.content".format(
u, dirpath, name))
elif v not in G.nodes.keys():
print("Warning: {} does not appear in {}{}.content".format(
v, dirpath, name))
else:
G.add_edge(u, v)
G = nx.convert_node_labels_to_integers(G)
print("Finished loading graph: {}".format(dirpath))
print("number of nodes: {}, number of edges: {}".format(
G.number_of_nodes(), G.number_of_edges()
))
return G
================================================
FILE: chainer_chemistry/datasets/citation_network/citeseer.py
================================================
from logging import getLogger
import os
import tarfile
from typing import List, Tuple # NOQA
from chainer.dataset import download
download_url = 'https://linqs-data.soe.ucsc.edu/public/lbc/citeseer.tgz'
feat_file_name = 'citeseer.content'
edge_file_name = 'citeseer.cites'
_root = 'pfnet/chainer/citeseer'
_label_names = ['Agents', 'AI', 'DB', 'IR', 'ML', 'HCI']
def get_citeseer_label_names():
# type: () -> List[str]
"""Return label names of Cora dataset."""
return _label_names
def get_citeseer_dirpath(download_if_not_exist=True):
# type: (bool) -> str
"""Construct a dirpath which stores citeseer dataset.
This method check whether the file exist or not, and downloaded it
if necessary.
Args:
download_if_not_exist (bool): If ``True``, download dataset
if it is not downloaded yet.
Returns:
dirpath (str): directory path for citeseer dataset.
"""
feat_cache_path, edge_cache_path = get_citeseer_filepath(
download_if_not_exist=download_if_not_exist)
dirpath = os.path.dirname(feat_cache_path)
dirpath2 = os.path.dirname(edge_cache_path)
assert dirpath == dirpath2
return dirpath
def get_citeseer_filepath(download_if_not_exist=True):
# type: (bool) -> Tuple[str, str]
"""Construct a filepath which stores citeseer dataset.
This method check whether the file exist or not, and downloaded it
if necessary.
Args:
download_if_not_exist (bool): If ``True``, download dataset
if it is not downloaded yet.
Returns:
feat_cache_path (str): file path for citeseer dataset (features).
edge_cache_path (str): file path for citeseer dataset (edge index).
"""
feat_cache_path, edge_cache_path = _get_citeseer_filepath()
if not os.path.exists(feat_cache_path):
if download_if_not_exist:
is_successful = download_and_extract_citeseer(
save_dirpath=os.path.dirname(feat_cache_path))
if not is_successful:
logger = getLogger(__name__)
logger.warning('Download failed.')
return feat_cache_path, edge_cache_path
def _get_citeseer_filepath():
# type: () -> Tuple[str, str]
"""Construct a filepath which stores citeseer dataset.
This method does not check if the file is already downloaded or not.
Returns:
feat_cache_path (str): file path for citeseer dataset (features).
edge_cache_path (str): file path for citeseer dataset (edge index).
"""
cache_root = download.get_dataset_directory(_root)
feat_cache_path = os.path.join(cache_root, feat_file_name)
edge_cache_path = os.path.join(cache_root, edge_file_name)
return feat_cache_path, edge_cache_path
def download_and_extract_citeseer(save_dirpath):
# type: (str) -> bool
print('downloading citeseer dataset...')
download_file_path = download.cached_download(download_url)
print('extracting citeseer dataset...')
tf = tarfile.open(download_file_path, 'r')
tf.extractall(os.path.dirname(save_dirpath))
return True
================================================
FILE: chainer_chemistry/datasets/citation_network/cora.py
================================================
from logging import getLogger
import os
import tarfile
from typing import List, Tuple # NOQA
from chainer.dataset import download
download_url = 'https://linqs-data.soe.ucsc.edu/public/lbc/cora.tgz'
feat_file_name = 'cora.content'
edge_file_name = 'cora.cites'
_root = 'pfnet/chainer/cora'
_label_names = [
'Case_Based', 'Genetic_Algorithms', 'Neural_Networks',
'Probabilistic_Methods', 'Reinforcement_Learning', 'Rule_Learning',
'Theory'
]
def get_cora_label_names():
# type: () -> List[str]
"""Return label names of Cora dataset."""
return _label_names
def get_cora_dirpath(download_if_not_exist=True):
# type: (bool) -> str
"""Construct a dirpath which stores Cora dataset.
This method check whether the file exist or not, and downloaded it
if necessary.
Args:
download_if_not_exist (bool): If ``True``, download dataset
if it is not downloaded yet.
Returns:
dirpath (str): directory path for Cora dataset.
"""
feat_cache_path, edge_cache_path = get_cora_filepath(
download_if_not_exist=download_if_not_exist)
dirpath = os.path.dirname(feat_cache_path)
dirpath2 = os.path.dirname(edge_cache_path)
assert dirpath == dirpath2
return dirpath
def get_cora_filepath(download_if_not_exist=True):
# type: (bool) -> Tuple[str, str]
"""Construct a filepath which stores Cora dataset.
This method check whether the file exist or not, and downloaded it
if necessary.
Args:
download_if_not_exist (bool): If ``True``, download dataset
if it is not downloaded yet.
Returns:
feat_cache_path (str): file path for Cora dataset (features).
edge_cache_path (str): file path for Cora dataset (edge index).
"""
feat_cache_path, edge_cache_path = _get_cora_filepath()
if not os.path.exists(feat_cache_path):
if download_if_not_exist:
is_successful = download_and_extract_cora(
save_dirpath=os.path.dirname(feat_cache_path))
if not is_successful:
logger = getLogger(__name__)
logger.warning('Download failed.')
return feat_cache_path, edge_cache_path
def _get_cora_filepath():
# type: () -> Tuple[str, str]
"""Construct a filepath which stores Cora dataset.
This method does not check if the file is already downloaded or not.
Returns:
feat_cache_path (str): file path for Cora dataset (features).
edge_cache_path (str): file path for Cora dataset (edge index).
"""
cache_root = download.get_dataset_directory(_root)
feat_cache_path = os.path.join(cache_root, feat_file_name)
edge_cache_path = os.path.join(cache_root, edge_file_name)
return feat_cache_path, edge_cache_path
def download_and_extract_cora(save_dirpath):
# type: (str) -> bool
print('downloading cora dataset...')
download_file_path = download.cached_download(download_url)
print('extracting cora dataset...')
tf = tarfile.open(download_file_path, 'r')
tf.extractall(os.path.dirname(save_dirpath))
return True
================================================
FILE: chainer_chemistry/datasets/molnet/__init__.py
================================================
from chainer_chemistry.datasets.molnet import chembl_tasks # NOQA
from chainer_chemistry.datasets.molnet import molnet # NOQA
from chainer_chemistry.datasets.molnet import molnet_config # NOQA
from chainer_chemistry.datasets.molnet import pdbbind_time # NOQA
from chainer_chemistry.datasets.molnet import toxcast_tasks # NOQA
from chainer_chemistry.datasets.molnet.molnet import get_grid_featurized_pdbbind_dataset # NOQA
from chainer_chemistry.datasets.molnet.molnet import get_molnet_dataframe # NOQA
from chainer_chemistry.datasets.molnet.molnet import get_molnet_dataset # NOQA
from chainer_chemistry.datasets.molnet.molnet import get_molnet_filepath # NOQA
from chainer_chemistry.datasets.molnet.molnet_config import molnet_default_config # NOQA
================================================
FILE: chainer_chemistry/datasets/molnet/chembl_tasks.py
================================================
# flake8: noqa
chembl_tasks = [
'CHEMBL1075104', 'CHEMBL1075228', 'CHEMBL1075284', 'CHEMBL1163101',
'CHEMBL1163125', 'CHEMBL1255149', 'CHEMBL1293289', 'CHEMBL1741186',
'CHEMBL1790', 'CHEMBL1792', 'CHEMBL1801', 'CHEMBL1804',
'CHEMBL1811', 'CHEMBL1821', 'CHEMBL1824', 'CHEMBL1827',
'CHEMBL1829', 'CHEMBL1833', 'CHEMBL1836', 'CHEMBL1844',
'CHEMBL1850', 'CHEMBL1853', 'CHEMBL1862', 'CHEMBL1865',
'CHEMBL1867', 'CHEMBL1868', 'CHEMBL1871', 'CHEMBL1873',
'CHEMBL1875', 'CHEMBL1881', 'CHEMBL1889', 'CHEMBL1898',
'CHEMBL1899', 'CHEMBL1900', 'CHEMBL1901', 'CHEMBL1906',
'CHEMBL1908', 'CHEMBL1913', 'CHEMBL1914', 'CHEMBL1916',
'CHEMBL1917', 'CHEMBL1921', 'CHEMBL1926', 'CHEMBL1936',
'CHEMBL1937', 'CHEMBL1941', 'CHEMBL1942', 'CHEMBL1951',
'CHEMBL1952', 'CHEMBL1955', 'CHEMBL1957', 'CHEMBL1968',
'CHEMBL1974', 'CHEMBL1977', 'CHEMBL1978', 'CHEMBL1980',
'CHEMBL1981', 'CHEMBL1983', 'CHEMBL1991', 'CHEMBL1994',
'CHEMBL1995', 'CHEMBL2000', 'CHEMBL2007', 'CHEMBL2014',
'CHEMBL2016', 'CHEMBL202', 'CHEMBL2028', 'CHEMBL203',
'CHEMBL2034', 'CHEMBL2035', 'CHEMBL2039', 'CHEMBL204',
'CHEMBL2041', 'CHEMBL2047', 'CHEMBL2049', 'CHEMBL205',
'CHEMBL2056', 'CHEMBL206', 'CHEMBL2069', 'CHEMBL208',
'CHEMBL209', 'CHEMBL210', 'CHEMBL211', 'CHEMBL213',
'CHEMBL214', 'CHEMBL2147', 'CHEMBL2148', 'CHEMBL215',
'CHEMBL216', 'CHEMBL217', 'CHEMBL218', 'CHEMBL2185',
'CHEMBL219', 'CHEMBL220', 'CHEMBL2208', 'CHEMBL221',
'CHEMBL222', 'CHEMBL223', 'CHEMBL224', 'CHEMBL2243',
'CHEMBL225', 'CHEMBL226', 'CHEMBL2265', 'CHEMBL2274',
'CHEMBL2276', 'CHEMBL228', 'CHEMBL2285', 'CHEMBL229',
'CHEMBL2292', 'CHEMBL230', 'CHEMBL2304402', 'CHEMBL2304404',
'CHEMBL231', 'CHEMBL2318', 'CHEMBL232', 'CHEMBL2326',
'CHEMBL2327', 'CHEMBL2329', 'CHEMBL233', 'CHEMBL2334',
'CHEMBL2335', 'CHEMBL2337', 'CHEMBL234', 'CHEMBL2345',
'CHEMBL235', 'CHEMBL236', 'CHEMBL2363', 'CHEMBL2366505',
'CHEMBL2366516', 'CHEMBL237', 'CHEMBL238', 'CHEMBL239',
'CHEMBL2391', 'CHEMBL2397', 'CHEMBL240', 'CHEMBL2409',
'CHEMBL241', 'CHEMBL242', 'CHEMBL2425', 'CHEMBL2431',
'CHEMBL244', 'CHEMBL245', 'CHEMBL246', 'CHEMBL247',
'CHEMBL2470', 'CHEMBL248', 'CHEMBL2487', 'CHEMBL2488',
'CHEMBL2489', 'CHEMBL249', 'CHEMBL2492', 'CHEMBL2499',
'CHEMBL251', 'CHEMBL2525', 'CHEMBL2527', 'CHEMBL253',
'CHEMBL2534', 'CHEMBL254', 'CHEMBL255', 'CHEMBL256',
'CHEMBL2563', 'CHEMBL2564', 'CHEMBL2575', 'CHEMBL258',
'CHEMBL2581', 'CHEMBL259', 'CHEMBL2599', 'CHEMBL260',
'CHEMBL261', 'CHEMBL262', 'CHEMBL2622', 'CHEMBL2637',
'CHEMBL264', 'CHEMBL265', 'CHEMBL2652', 'CHEMBL267',
'CHEMBL268', 'CHEMBL269', 'CHEMBL2695', 'CHEMBL270',
'CHEMBL2716', 'CHEMBL2722', 'CHEMBL273', 'CHEMBL274',
'CHEMBL2742', 'CHEMBL2749', 'CHEMBL275', 'CHEMBL276',
'CHEMBL2782', 'CHEMBL2789', 'CHEMBL279', 'CHEMBL280',
'CHEMBL2803', 'CHEMBL2808', 'CHEMBL2815', 'CHEMBL2820',
'CHEMBL2828', 'CHEMBL283', 'CHEMBL2835', 'CHEMBL284',
'CHEMBL2842', 'CHEMBL2858', 'CHEMBL286', 'CHEMBL2868',
'CHEMBL287', 'CHEMBL2871', 'CHEMBL288', 'CHEMBL2882',
'CHEMBL2885', 'CHEMBL2902', 'CHEMBL2903', 'CHEMBL2949',
'CHEMBL2954', 'CHEMBL2959', 'CHEMBL2971', 'CHEMBL2973',
'CHEMBL298', 'CHEMBL299', 'CHEMBL2993', 'CHEMBL2996',
'CHEMBL301', 'CHEMBL3012', 'CHEMBL3018', 'CHEMBL302',
'CHEMBL3024', 'CHEMBL3025', 'CHEMBL3037', 'CHEMBL304',
'CHEMBL3045', 'CHEMBL3048', 'CHEMBL3060', 'CHEMBL3072',
'CHEMBL308', 'CHEMBL309', 'CHEMBL3105', 'CHEMBL3116',
'CHEMBL312', 'CHEMBL313', 'CHEMBL3130', 'CHEMBL3138',
'CHEMBL3142', 'CHEMBL3145', 'CHEMBL3155', 'CHEMBL3166',
'CHEMBL318', 'CHEMBL3180', 'CHEMBL3181', 'CHEMBL319',
'CHEMBL3192', 'CHEMBL3199', 'CHEMBL3202', 'CHEMBL321',
'CHEMBL322', 'CHEMBL3222', 'CHEMBL3223', 'CHEMBL3227',
'CHEMBL3229', 'CHEMBL3230', 'CHEMBL3231', 'CHEMBL324',
'CHEMBL3242', 'CHEMBL325', 'CHEMBL326', 'CHEMBL3267',
'CHEMBL3286', 'CHEMBL3305', 'CHEMBL331', 'CHEMBL3310',
'CHEMBL332', 'CHEMBL333', 'CHEMBL3332', 'CHEMBL335',
'CHEMBL3351', 'CHEMBL3358', 'CHEMBL3360', 'CHEMBL3361',
'CHEMBL3371', 'CHEMBL338', 'CHEMBL339', 'CHEMBL3403',
'CHEMBL3426', 'CHEMBL3438', 'CHEMBL344', 'CHEMBL3464',
'CHEMBL3468', 'CHEMBL3471', 'CHEMBL3473', 'CHEMBL3476',
'CHEMBL3510', 'CHEMBL3522', 'CHEMBL3524', 'CHEMBL3553',
'CHEMBL3563', 'CHEMBL3568', 'CHEMBL3571', 'CHEMBL3582',
'CHEMBL3587', 'CHEMBL3594', 'CHEMBL3602', 'CHEMBL3614',
'CHEMBL3629', 'CHEMBL3650', 'CHEMBL3687', 'CHEMBL3699',
'CHEMBL3706', 'CHEMBL3710', 'CHEMBL3717', 'CHEMBL3729',
'CHEMBL3746', 'CHEMBL3759', 'CHEMBL3766', 'CHEMBL3769',
'CHEMBL3772', 'CHEMBL3775', 'CHEMBL3776', 'CHEMBL3778',
'CHEMBL3788', 'CHEMBL3795', 'CHEMBL3807', 'CHEMBL3836',
'CHEMBL3837', 'CHEMBL3864', 'CHEMBL3869', 'CHEMBL3892',
'CHEMBL3910', 'CHEMBL3912', 'CHEMBL3920', 'CHEMBL3943',
'CHEMBL3952', 'CHEMBL3969', 'CHEMBL3976', 'CHEMBL3979',
'CHEMBL3983', 'CHEMBL3991', 'CHEMBL3996', 'CHEMBL4005',
'CHEMBL4040', 'CHEMBL4072', 'CHEMBL4073', 'CHEMBL4077',
'CHEMBL4078', 'CHEMBL4093', 'CHEMBL4102', 'CHEMBL4124',
'CHEMBL4128', 'CHEMBL4140', 'CHEMBL4142', 'CHEMBL4145',
'CHEMBL4150', 'CHEMBL4153', 'CHEMBL4179', 'CHEMBL4188',
'CHEMBL4191', 'CHEMBL4203', 'CHEMBL4204', 'CHEMBL4224',
'CHEMBL4235', 'CHEMBL4247', 'CHEMBL4282', 'CHEMBL4296',
'CHEMBL4302', 'CHEMBL4321', 'CHEMBL4333', 'CHEMBL4336',
'CHEMBL4354', 'CHEMBL4361', 'CHEMBL4372', 'CHEMBL4393',
'CHEMBL4409', 'CHEMBL4414', 'CHEMBL4427', 'CHEMBL4429',
'CHEMBL4439', 'CHEMBL4465', 'CHEMBL4471', 'CHEMBL4477',
'CHEMBL4481', 'CHEMBL4482', 'CHEMBL4501', 'CHEMBL4523',
'CHEMBL4561', 'CHEMBL4586', 'CHEMBL4588', 'CHEMBL4599',
'CHEMBL4600', 'CHEMBL4608', 'CHEMBL4618', 'CHEMBL4625',
'CHEMBL4630', 'CHEMBL4644', 'CHEMBL4653', 'CHEMBL4657',
'CHEMBL4662', 'CHEMBL4681', 'CHEMBL4683', 'CHEMBL4687',
'CHEMBL4696', 'CHEMBL4722', 'CHEMBL4768', 'CHEMBL4777',
'CHEMBL4779', 'CHEMBL4780', 'CHEMBL4789', 'CHEMBL4792',
'CHEMBL4793', 'CHEMBL4794', 'CHEMBL4801', 'CHEMBL4802',
'CHEMBL4803', 'CHEMBL4804', 'CHEMBL4816', 'CHEMBL4822',
'CHEMBL4828', 'CHEMBL4829', 'CHEMBL4860', 'CHEMBL4895',
'CHEMBL4899', 'CHEMBL4975', 'CHEMBL4980', 'CHEMBL5017',
'CHEMBL5024', 'CHEMBL5067', 'CHEMBL5071', 'CHEMBL5076',
'CHEMBL5077', 'CHEMBL5103', 'CHEMBL5113', 'CHEMBL5122',
'CHEMBL5145', 'CHEMBL5147', 'CHEMBL5160', 'CHEMBL5205',
'CHEMBL5251', 'CHEMBL5314', 'CHEMBL5328', 'CHEMBL5331',
'CHEMBL5373', 'CHEMBL5407', 'CHEMBL5414', 'CHEMBL5441',
'CHEMBL5445', 'CHEMBL5457', 'CHEMBL5491', 'CHEMBL5508',
'CHEMBL5543', 'CHEMBL5570', 'CHEMBL5631', 'CHEMBL5658',
'CHEMBL5669', 'CHEMBL5763', 'CHEMBL5800', 'CHEMBL5847',
'CHEMBL5932', 'CHEMBL6007', 'CHEMBL6009', 'CHEMBL6137',
'CHEMBL6140', 'CHEMBL6154', 'CHEMBL6164', 'CHEMBL6166',
'CHEMBL6184']
================================================
FILE: chainer_chemistry/datasets/molnet/molnet.py
================================================
import joblib
from logging import getLogger
import os
import shutil
import tarfile
import numpy
import pandas
from chainer.dataset import download
from chainer_chemistry.dataset.parsers.csv_file_parser import CSVFileParser
from chainer_chemistry.dataset.preprocessors.atomic_number_preprocessor import AtomicNumberPreprocessor # NOQA
from chainer_chemistry.dataset.splitters.base_splitter import BaseSplitter
from chainer_chemistry.dataset.splitters.scaffold_splitter import ScaffoldSplitter # NOQA
from chainer_chemistry.dataset.splitters.deepchem_scaffold_splitter import DeepChemScaffoldSplitter # NOQA
from chainer_chemistry.dataset.splitters import split_method_dict
from chainer_chemistry.datasets.molnet.molnet_config import molnet_default_config # NOQA
from chainer_chemistry.datasets.molnet.pdbbind_time import get_pdbbind_time
from chainer_chemistry.datasets.numpy_tuple_dataset import NumpyTupleDataset
_root = 'pfnet/chainer/molnet'
def get_molnet_dataset(dataset_name, preprocessor=None, labels=None,
split=None, frac_train=.8, frac_valid=.1,
frac_test=.1, seed=777, return_smiles=False,
return_pdb_id=False, target_index=None, task_index=0,
**kwargs):
"""Downloads, caches and preprocess MoleculeNet dataset.
Args:
dataset_name (str): MoleculeNet dataset name. If you want to know the
detail of MoleculeNet, please refer to
`official site `_
If you would like to know what dataset_name is available for
chainer_chemistry, please refer to `molnet_config.py`.
preprocessor (BasePreprocessor): Preprocessor.
It should be chosen based on the network to be trained.
If it is None, default `AtomicNumberPreprocessor` is used.
labels (str or list): List of target labels.
split (str or BaseSplitter or None): How to split dataset into train,
validation and test. If `None`, this functions use the splitter
that is recommended by MoleculeNet. Additionally You can use an
instance of BaseSplitter or choose it from 'random', 'stratified'
and 'scaffold'.
return_smiles (bool): If set to ``True``,
smiles array is also returned.
return_pdb_id (bool): If set to ``True``,
PDB ID array is also returned.
This argument is only used when you select 'pdbbind_smiles'.
target_index (list or None): target index list to partially extract
dataset. If `None` (default), all examples are parsed.
task_index (int): Target task index in dataset for stratification.
(Stratified Splitter only)
Returns (dict):
Dictionary that contains dataset that is already split into train,
valid and test dataset and 1-d numpy array with dtype=object(string)
which is a vector of smiles for each example or `None`.
"""
if dataset_name not in molnet_default_config:
raise ValueError("We don't support {} dataset. Please choose from {}".
format(dataset_name,
list(molnet_default_config.keys())))
if dataset_name == 'pdbbind_grid':
pdbbind_subset = kwargs.get('pdbbind_subset')
return get_pdbbind_grid(pdbbind_subset, split=split,
frac_train=frac_train, frac_valid=frac_valid,
frac_test=frac_test, task_index=task_index)
if dataset_name == 'pdbbind_smiles':
pdbbind_subset = kwargs.get('pdbbind_subset')
time_list = kwargs.get('time_list')
return get_pdbbind_smiles(pdbbind_subset, preprocessor=preprocessor,
labels=labels, split=split,
frac_train=frac_train, frac_valid=frac_valid,
frac_test=frac_test,
return_smiles=return_smiles,
return_pdb_id=return_pdb_id,
target_index=target_index,
task_index=task_index,
time_list=time_list)
dataset_config = molnet_default_config[dataset_name]
labels = labels or dataset_config['tasks']
if isinstance(labels, str):
labels = [labels, ]
if preprocessor is None:
preprocessor = AtomicNumberPreprocessor()
if dataset_config['task_type'] == 'regression':
def postprocess_label(label_list):
return numpy.asarray(label_list, dtype=numpy.float32)
elif dataset_config['task_type'] == 'classification':
def postprocess_label(label_list):
label_list = numpy.asarray(label_list)
label_list[numpy.isnan(label_list)] = -1
return label_list.astype(numpy.int32)
parser = CSVFileParser(preprocessor, labels=labels,
smiles_col=dataset_config['smiles_columns'],
postprocess_label=postprocess_label)
if dataset_config['dataset_type'] == 'one_file_csv':
split = dataset_config['split'] if split is None else split
if isinstance(split, str):
splitter = split_method_dict[split]()
elif isinstance(split, BaseSplitter):
splitter = split
else:
raise TypeError("split must be None, str or instance of"
" BaseSplitter, but got {}".format(type(split)))
if isinstance(splitter, (ScaffoldSplitter, DeepChemScaffoldSplitter)):
get_smiles = True
else:
get_smiles = return_smiles
result = parser.parse(get_molnet_filepath(dataset_name),
return_smiles=get_smiles,
target_index=target_index, **kwargs)
dataset = result['dataset']
smiles = result['smiles']
train_ind, valid_ind, test_ind = \
splitter.train_valid_test_split(dataset, smiles_list=smiles,
task_index=task_index,
frac_train=frac_train,
frac_valid=frac_valid,
frac_test=frac_test, **kwargs)
train = NumpyTupleDataset(*dataset.features[train_ind])
valid = NumpyTupleDataset(*dataset.features[valid_ind])
test = NumpyTupleDataset(*dataset.features[test_ind])
result['dataset'] = (train, valid, test)
if return_smiles:
train_smiles = smiles[train_ind]
valid_smiles = smiles[valid_ind]
test_smiles = smiles[test_ind]
result['smiles'] = (train_smiles, valid_smiles, test_smiles)
else:
result['smiles'] = None
elif dataset_config['dataset_type'] == 'separate_csv':
result = {}
train_result = parser.parse(get_molnet_filepath(dataset_name, 'train'),
return_smiles=return_smiles,
target_index=target_index)
valid_result = parser.parse(get_molnet_filepath(dataset_name, 'valid'),
return_smiles=return_smiles,
target_index=target_index)
test_result = parser.parse(get_molnet_filepath(dataset_name, 'test'),
return_smiles=return_smiles,
target_index=target_index)
result['dataset'] = (train_result['dataset'], valid_result['dataset'],
test_result['dataset'])
result['smiles'] = (train_result['smiles'], valid_result['smiles'],
test_result['smiles'])
else:
raise ValueError('dataset_type={} is not supported'
.format(dataset_config['dataset_type']))
return result
def get_molnet_dataframe(dataset_name, pdbbind_subset=None):
"""Downloads, caches and get the dataframe of MoleculeNet dataset.
Args:
dataset_name (str): MoleculeNet dataset name. If you want to know the
detail of MoleculeNet, please refer to
`official site `_
If you would like to know what dataset_name is available for
chainer_chemistry, please refer to `molnet_config.py`.
pdbbind_subset (str): PDBbind dataset subset name. If you want to know
the detail of subset, please refer to `official site
`
Returns (pandas.DataFrame or tuple):
DataFrame of dataset without any preprocessing. When the files of
dataset are seprated, this function returns multiple DataFrame.
"""
if dataset_name not in molnet_default_config:
raise ValueError("We don't support {} dataset. Please choose from {}".
format(dataset_name,
list(molnet_default_config.keys())))
if dataset_name == 'pdbbind_grid':
raise ValueError('pdbbind_grid dataset is not supported. Please ',
'choose pdbbind_smiles dataset.')
dataset_config = molnet_default_config[dataset_name]
if dataset_config['dataset_type'] == 'one_file_csv':
df = pandas.read_csv(get_molnet_filepath(
dataset_name, pdbbind_subset=pdbbind_subset))
return df
elif dataset_config['dataset_type'] == 'separate_csv':
train_df = pandas.read_csv(get_molnet_filepath(dataset_name, 'train'))
valid_df = pandas.read_csv(get_molnet_filepath(dataset_name, 'valid'))
test_df = pandas.read_csv(get_molnet_filepath(dataset_name, 'test'))
return train_df, valid_df, test_df
else:
raise ValueError('dataset_type={} is not supported'
.format(dataset_config['dataset_type']))
def get_molnet_filepath(dataset_name, filetype='onefile',
download_if_not_exist=True, pdbbind_subset=None):
"""Construct a file path which stores MoleculeNet dataset.
This method check whether the file exist or not, and downloaded it if
necessary.
Args:
dataset_name (str): MoleculeNet dataset name.
file_type (str): either 'onefile', 'train', 'valid', 'test'
download_if_not_exist (bool): Download a file if it does not exist.
Returns (str): filepath for specific MoleculeNet dataset
"""
filetype_supported = ['onefile', 'train', 'valid', 'test']
if filetype not in filetype_supported:
raise ValueError("filetype {} not supported, please choose filetype "
"from {}".format(filetype, filetype_supported))
if filetype == 'onefile':
url_key = 'url'
else:
url_key = filetype + '_url'
if dataset_name == 'pdbbind_smiles':
file_url = molnet_default_config[dataset_name][url_key][pdbbind_subset]
else:
file_url = molnet_default_config[dataset_name][url_key]
file_name = file_url.split('/')[-1]
cache_path = _get_molnet_filepath(file_name)
if not os.path.exists(cache_path):
if download_if_not_exist:
is_successful = download_dataset(file_url,
save_filepath=cache_path)
if not is_successful:
logger = getLogger(__name__)
logger.warning('Download failed.')
return cache_path
def _get_molnet_filepath(file_name):
"""Construct a filepath which stores MoleculeNet dataset in csv
This method does not check if the file is already downloaded or not.
Args:
file_name (str): file name of MoleculeNet dataset
Returns (str): filepath for one of MoleculeNet dataset
"""
cache_root = download.get_dataset_directory(_root)
cache_path = os.path.join(cache_root, file_name)
return cache_path
def download_dataset(dataset_url, save_filepath):
"""Download and caches MoleculeNet Dataset
Args:
dataset_url (str): URL of dataset
save_filepath (str): filepath for dataset
Returns (bool): If success downloading, returning `True`.
"""
logger = getLogger(__name__)
logger.warning('Downloading {} dataset, it takes time...'
.format(dataset_url.split('/')[-1]))
download_file_path = download.cached_download(dataset_url)
shutil.move(download_file_path, save_filepath)
# pandas can load gzipped or tarball csv file
return True
def get_pdbbind_smiles(pdbbind_subset, preprocessor=None, labels=None,
split=None, frac_train=.8, frac_valid=.1,
frac_test=.1, return_smiles=False, return_pdb_id=True,
target_index=None, task_index=0, time_list=None,
**kwargs):
"""Downloads, caches and preprocess PDBbind dataset.
Args:
pdbbind_subset (str): PDBbind dataset subset name. If you want to know
the detail of subset, please refer to `official site
`
preprocessor (BasePreprocessor): Preprocessor.
It should be chosen based on the network to be trained.
If it is None, default `AtomicNumberPreprocessor` is used.
labels (str or list): List of target labels.
split (str or BaseSplitter or None): How to split dataset into train,
validation and test. If `None`, this functions use the splitter
that is recommended by MoleculeNet. Additionally You can use an
instance of BaseSplitter or choose it from 'random', 'stratified'
and 'scaffold'.
return_smiles (bool): If set to ``True``,
smiles array is also returned.
return_pdb_id (bool): If set to ``True``,
PDB ID array is also returned.
This argument is only used when you select 'pdbbind_smiles'.
target_index (list or None): target index list to partially extract
dataset. If `None` (default), all examples are parsed.
task_index (int): Target task index in dataset for stratification.
(Stratified Splitter only)
Returns (dict):
Dictionary that contains dataset that is already split into train,
valid and test dataset and 1-d numpy arrays with dtype=object(string)
which are vectors of smiles and pdb_id for each example or `None`.
"""
config = molnet_default_config['pdbbind_smiles']
labels = labels or config['tasks']
if isinstance(labels, str):
labels = [labels, ]
if preprocessor is None:
preprocessor = AtomicNumberPreprocessor()
def postprocess_label(label_list):
return numpy.asarray(label_list, dtype=numpy.float32)
parser = CSVFileParser(preprocessor, labels=labels,
smiles_col=config['smiles_columns'],
postprocess_label=postprocess_label)
split = config['split'] if split is None else split
if isinstance(split, str):
splitter = split_method_dict[split]()
elif isinstance(split, BaseSplitter):
splitter = split
else:
raise TypeError("split must be None, str or instance of"
" BaseSplitter, but got {}".format(type(split)))
result = parser.parse(get_molnet_filepath('pdbbind_smiles',
pdbbind_subset=pdbbind_subset),
return_smiles=return_smiles,
return_is_successful=True,
target_index=target_index)
dataset = result['dataset']
smiles = result['smiles']
is_successful = result['is_successful']
if return_pdb_id:
df = pandas.read_csv(
get_molnet_filepath('pdbbind_smiles',
pdbbind_subset=pdbbind_subset))
pdb_id = df['id'][is_successful]
else:
pdb_id = None
train_ind, valid_ind, test_ind = \
splitter.train_valid_test_split(dataset, time_list=time_list,
smiles_list=smiles,
task_index=task_index,
frac_train=frac_train,
frac_valid=frac_valid,
frac_test=frac_test, **kwargs)
train = NumpyTupleDataset(*dataset.features[train_ind])
valid = NumpyTupleDataset(*dataset.features[valid_ind])
test = NumpyTupleDataset(*dataset.features[test_ind])
result['dataset'] = (train, valid, test)
if return_smiles:
train_smiles = smiles[train_ind]
valid_smiles = smiles[valid_ind]
test_smiles = smiles[test_ind]
result['smiles'] = (train_smiles, valid_smiles, test_smiles)
else:
result['smiles'] = None
if return_pdb_id:
train_pdb_id = pdb_id[train_ind]
valid_pdb_id = pdb_id[valid_ind]
test_pdb_id = pdb_id[test_ind]
result['pdb_id'] = (train_pdb_id, valid_pdb_id, test_pdb_id)
else:
result['pdb_id'] = None
return result
def get_pdbbind_grid(pdbbind_subset, split=None, frac_train=.8, frac_valid=.1,
frac_test=.1, task_index=0, **kwargs):
"""Downloads, caches and grid-featurize PDBbind dataset.
Args:
pdbbind_subset (str): PDBbind dataset subset name. If you want to know
the detail of subset, please refer to `official site
`
split (str or BaseSplitter or None): How to split dataset into train,
validation and test. If `None`, this functions use the splitter
that is recommended by MoleculeNet. Additionally You can use an
instance of BaseSplitter or choose it from 'random', 'stratified'
and 'scaffold'.
task_index (int): Target task index in dataset for stratification.
(Stratified Splitter only)
Returns (dict):
Dictionary that contains dataset that is already split into train,
valid and test dataset and 1-d numpy arrays with dtype=object(string)
which are vectors of smiles and pdb_id for each example or `None`.
"""
result = {}
dataset = get_grid_featurized_pdbbind_dataset(pdbbind_subset)
if split is None:
split = molnet_default_config['pdbbind_grid']['split']
if isinstance(split, str):
splitter = split_method_dict[split]()
elif isinstance(split, BaseSplitter):
splitter = split
else:
raise TypeError("split must be None, str, or instance of"
" BaseSplitter, but got {}".format(type(split)))
time_list = get_pdbbind_time()
train_ind, valid_ind, test_ind = \
splitter.train_valid_test_split(dataset, time_list=time_list,
smiles_list=None,
task_index=task_index,
frac_train=frac_train,
frac_valid=frac_valid,
frac_test=frac_test, **kwargs)
train = NumpyTupleDataset(*dataset.features[train_ind])
valid = NumpyTupleDataset(*dataset.features[valid_ind])
test = NumpyTupleDataset(*dataset.features[test_ind])
result['dataset'] = (train, valid, test)
result['smiles'] = None
return result
def get_grid_featurized_pdbbind_dataset(subset):
"""Downloads and caches grid featurized PDBBind dataset.
Args:
subset (str): subset name of PDBBind dataset.
Returns (NumpyTupleDataset):
grid featurized PDBBind dataset.
"""
x_path, y_path = get_grid_featurized_pdbbind_filepath(subset)
x = joblib.load(x_path).astype('i')
y = joblib.load(y_path).astype('f')
dataset = NumpyTupleDataset(x, y)
return dataset
def get_grid_featurized_pdbbind_dirpath(subset, download_if_not_exist=True):
"""Construct a directory path which stores grid featurized PDBBind dataset.
This method check whether the file exist or not, and downloaded it if
necessary.
Args:
subset (str): subset name of PDBBind dataset.
download_if_not_exist (bool): Download a file if it does not exist.
Returns (str): directory path for specific subset of PDBBind dataset.
"""
subset_supported = ['core', 'full', 'refined']
if subset not in subset_supported:
raise ValueError("subset {} not supported, please choose filetype "
"from {}".format(subset, subset_supported))
file_url = \
molnet_default_config['pdbbind_grid']['url'][subset]
file_name = file_url.split('/')[-1]
cache_path = _get_molnet_filepath(file_name)
if not os.path.exists(cache_path):
if download_if_not_exist:
is_successful = download_dataset(file_url,
save_filepath=cache_path)
if not is_successful:
logger = getLogger(__name__)
logger.warning('Download failed.')
return cache_path
def get_grid_featurized_pdbbind_filepath(subset):
"""Construct a filepath which stores featurized PDBBind dataset in joblib
This method does not check if the file is already downloaded or not.
Args:
subset (str): subset name of PDBBind dataset
Returns:
x_path (str): filepath for feature vectors
y_path (str): filepath for -logKd/Ki
"""
dirpath = get_grid_featurized_pdbbind_dirpath(subset=subset)
savedir = '/'.join(dirpath.split('/')[:-1]) + '/'
with tarfile.open(dirpath, 'r:gz') as tar:
tar.extractall(savedir)
x_path = savedir + subset + '_grid/shard-0-X.joblib'
y_path = savedir + subset + '_grid/shard-0-y.joblib'
return x_path, y_path
================================================
FILE: chainer_chemistry/datasets/molnet/molnet_config.py
================================================
import chainer.functions as F
import chainer_chemistry
from chainer_chemistry.datasets.molnet.chembl_tasks import chembl_tasks
from chainer_chemistry.datasets.molnet.toxcast_tasks import toxcast_tasks
from chainer_chemistry.functions import mean_absolute_error
from chainer_chemistry.functions import mean_squared_error
from chainer_chemistry.training.extensions.prc_auc_evaluator import PRCAUCEvaluator # NOQA
from chainer_chemistry.training.extensions.roc_auc_evaluator import ROCAUCEvaluator # NOQA
molnet_base = 'http://deepchem.io.s3-website-us-west-1.amazonaws.com/datasets/'
featurized_base = 'http://deepchem.io.s3-website-us-west-1.amazonaws.com/' \
+ 'featurized_datasets/'
def mae(x, t):
return mean_absolute_error(x, t, ignore_nan=True)
def mse(x, t):
return mean_squared_error(x, t, ignore_nan=True)
def rmse(x, t):
return F.sqrt(mse(x, t))
def r2_score(x, t):
return chainer_chemistry.functions.r2_score(x, t, ignore_nan=True)
molnet_default_config = {
"bace_Class": {
"dataset_type": 'one_file_csv',
"loss": F.sigmoid_cross_entropy,
"metrics": {'binary_accuracy': F.binary_accuracy,
'roc_auc': ROCAUCEvaluator},
"smiles_columns": 'mol',
"split": 'random',
"task_type": 'classification',
"tasks": ["Class"],
"url": molnet_base + 'bace.csv',
},
"bace_pIC50": {
"dataset_type": 'one_file_csv',
"loss": mse,
"metrics": {'MAE': mae},
"smiles_columns": 'mol',
"split": 'random',
"task_type": 'regression',
"tasks": ["pIC50"],
"url": molnet_base + 'bace.csv',
},
"bbbp": {
"dataset_type": 'one_file_csv',
"loss": F.sigmoid_cross_entropy,
"metrics": {'binary_accuracy': F.binary_accuracy,
'roc_auc': ROCAUCEvaluator},
"smiles_columns": 'smiles',
"split": 'scaffold',
"task_type": 'classification',
"tasks": ["p_np"],
"url": molnet_base + 'BBBP.csv',
},
# TODO(mottodora): There are many separating ways for chembl dataset
# TODO(mottodora): only use 5thresh dataset(sparse dataset is not used.)
# TODO(mottodora): support mix dataset type in example
"chembl": {
"dataset_type": 'one_file_csv',
"loss": mse,
"smiles_columns": 'smiles',
"split": 'random',
"task_type": 'mix',
"tasks": chembl_tasks,
"url": molnet_base + 'chembl_5thresh.csv.gz',
},
"clearance": {
"dataset_type": 'one_file_csv',
"loss": mse,
"metrics": {'RMSE': rmse},
"smiles_columns": 'smile',
"split": 'random',
"task_type": 'regression',
"tasks": ["target"],
"url": molnet_base + 'clearance.csv',
},
"clintox": {
"dataset_type": 'one_file_csv',
"loss": F.sigmoid_cross_entropy,
"metrics": {'binary_accuracy': F.binary_accuracy,
'roc_auc': ROCAUCEvaluator},
"smiles_columns": 'smiles',
"split": 'random',
"task_type": 'classification',
"tasks": ["FDA_APPROVED", "CT_TOX"],
"url": molnet_base + 'clintox.csv.gz',
},
"delaney": {
"dataset_type": 'one_file_csv',
"loss": mse,
"metrics": {'RMSE': rmse},
"smiles_columns": 'smiles',
"split": 'random',
"task_type": 'regression',
"tasks": ['measured log solubility in mols per litre'],
"url": molnet_base + 'delaney-processed.csv',
},
"HIV": {
"dataset_type": 'one_file_csv',
"loss": F.sigmoid_cross_entropy,
"metrics": {'binary_accuracy': F.binary_accuracy,
'roc_auc': ROCAUCEvaluator},
"smiles_columns": 'smiles',
"split": 'scaffold',
"task_type": 'classification',
"tasks": ["HIV_active"],
"url": molnet_base + 'HIV.csv',
},
"hopv": {
"dataset_type": 'one_file_csv',
"loss": mse,
"metrics": {'RMSE': rmse},
"smiles_columns": 'hopv.csv',
"split": 'random',
"task_type": 'regression',
"tasks": ['HOMO', 'LUMO', 'electrochemical_gap', 'optical_gap',
'PCE', 'V_OC', 'J_SC', 'fill_factor'],
"url": molnet_base + 'hopv.tar.gz',
},
"kaggle": {
"dataset_type": 'separate_csv',
"loss": mse,
"metrics": {'RMSE': rmse},
"smiles_columns": 'smiles',
"split": 'random',
"task_type": 'regression',
"tasks": ['3A4', 'CB1', 'DPP4', 'HIVINT', 'HIV_PROT', 'LOGD', 'METAB',
'NK1', 'OX1', 'OX2', 'PGP', 'PPB', 'RAT_F', 'TDI', 'THROMBIN'
],
"test_url": molnet_base + 'KAGGLE_test2_'
'disguised_combined_full.csv.gz',
"train_url": molnet_base + 'KAGGLE_training_'
'disguised_combined_full.csv.gz',
"valid_url": molnet_base + 'KAGGLE_test1_'
'disguised_combined_full.csv.gz',
},
"lipo": {
"dataset_type": 'one_file_csv',
"loss": mse,
"metrics": {'RMSE': rmse},
"smiles_columns": 'smiles',
"split": 'random',
"task_type": 'regression',
"tasks": ['exp'],
"url": molnet_base + 'Lipophilicity.csv',
},
"muv": {
"dataset_type": 'one_file_csv',
"loss": F.sigmoid_cross_entropy,
"metrics": {'binary_accuracy': F.binary_accuracy,
'prc_auc': PRCAUCEvaluator},
"smiles_columns": 'smiles',
"split": 'random',
"task_type": 'classification',
"tasks": ['MUV-692', 'MUV-689', 'MUV-846', 'MUV-859', 'MUV-644',
'MUV-548', 'MUV-852', 'MUV-600', 'MUV-810', 'MUV-712',
'MUV-737', 'MUV-858', 'MUV-713', 'MUV-733', 'MUV-652',
'MUV-466', 'MUV-832'],
"url": molnet_base + 'muv.csv.gz',
},
"nci": {
"dataset_type": 'one_file_csv',
"loss": mse,
"metrics": {'RMSE': rmse},
"smiles_columns": 'smiles',
"split": 'random',
"task_type": 'regression',
"tasks": ['CCRF-CEM', 'HL-60(TB)', 'K-562', 'MOLT-4', 'RPMI-8226',
'SR', 'A549/ATCC', 'EKVX', 'HOP-62', 'HOP-92', 'NCI-H226',
'NCI-H23', 'NCI-H322M', 'NCI-H460', 'NCI-H522', 'COLO 205',
'HCC-2998', 'HCT-116', 'HCT-15', 'HT29', 'KM12', 'SW-620',
'SF-268', 'SF-295', 'SF-539', 'SNB-19', 'SNB-75', 'U251',
'LOX IMVI', 'MALME-3M', 'M14', 'MDA-MB-435', 'SK-MEL-2',
'SK-MEL-28', 'SK-MEL-5', 'UACC-257', 'UACC-62', 'IGR-OV1',
'OVCAR-3', 'OVCAR-4', 'OVCAR-5', 'OVCAR-8', 'NCI/ADR-RES',
'SK-OV-3', '786-0', 'A498', 'ACHN', 'CAKI-1', 'RXF 393',
'SN12C', 'TK-10', 'UO-31', 'PC-3', 'DU-145', 'MCF7',
'MDA-MB-231/ATCC', 'MDA-MB-468', 'HS 578T', 'BT-549', 'T-47D'
],
"url": molnet_base + 'nci_unique.csv',
},
"pcba": {
"dataset_type": 'one_file_csv',
"loss": F.sigmoid_cross_entropy,
"metrics": {'binary_accuracy': F.binary_accuracy,
'prc_auc': PRCAUCEvaluator},
"smiles_columns": 'smiles',
"split": 'random',
"task_type": 'classification',
"tasks":
['PCBA-1030', 'PCBA-1379', 'PCBA-1452', 'PCBA-1454', 'PCBA-1457',
'PCBA-1458', 'PCBA-1460', 'PCBA-1461', 'PCBA-1468', 'PCBA-1469',
'PCBA-1471', 'PCBA-1479', 'PCBA-1631', 'PCBA-1634', 'PCBA-1688',
'PCBA-1721', 'PCBA-2100', 'PCBA-2101', 'PCBA-2147', 'PCBA-2242',
'PCBA-2326', 'PCBA-2451', 'PCBA-2517', 'PCBA-2528', 'PCBA-2546',
'PCBA-2549', 'PCBA-2551', 'PCBA-2662', 'PCBA-2675', 'PCBA-2676',
'PCBA-411', 'PCBA-463254', 'PCBA-485281', 'PCBA-485290',
'PCBA-485294', 'PCBA-485297', 'PCBA-485313', 'PCBA-485314',
'PCBA-485341', 'PCBA-485349', 'PCBA-485353', 'PCBA-485360',
'PCBA-485364', 'PCBA-485367', 'PCBA-492947', 'PCBA-493208',
'PCBA-504327', 'PCBA-504332', 'PCBA-504333', 'PCBA-504339',
'PCBA-504444', 'PCBA-504466', 'PCBA-504467', 'PCBA-504706',
'PCBA-504842', 'PCBA-504845', 'PCBA-504847', 'PCBA-504891',
'PCBA-540276', 'PCBA-540317', 'PCBA-588342', 'PCBA-588453',
'PCBA-588456', 'PCBA-588579', 'PCBA-588590', 'PCBA-588591',
'PCBA-588795', 'PCBA-588855', 'PCBA-602179', 'PCBA-602233',
'PCBA-602310', 'PCBA-602313', 'PCBA-602332', 'PCBA-624170',
'PCBA-624171', 'PCBA-624173', 'PCBA-624202', 'PCBA-624246',
'PCBA-624287', 'PCBA-624288', 'PCBA-624291', 'PCBA-624296',
'PCBA-624297', 'PCBA-624417', 'PCBA-651635', 'PCBA-651644',
'PCBA-651768', 'PCBA-651965', 'PCBA-652025', 'PCBA-652104',
'PCBA-652105', 'PCBA-652106', 'PCBA-686970', 'PCBA-686978',
'PCBA-686979', 'PCBA-720504', 'PCBA-720532', 'PCBA-720542',
'PCBA-720551', 'PCBA-720553', 'PCBA-720579', 'PCBA-720580',
'PCBA-720707', 'PCBA-720708', 'PCBA-720709', 'PCBA-720711',
'PCBA-743255', 'PCBA-743266', 'PCBA-875', 'PCBA-881', 'PCBA-883',
'PCBA-884', 'PCBA-885', 'PCBA-887', 'PCBA-891', 'PCBA-899',
'PCBA-902', 'PCBA-903', 'PCBA-904', 'PCBA-912', 'PCBA-914',
'PCBA-915', 'PCBA-924', 'PCBA-925', 'PCBA-926', 'PCBA-927',
'PCBA-938', 'PCBA-995'],
"url": molnet_base + 'pcba.csv.gz',
},
"pdbbind_smiles": {
"subset": ["core", "full", "refined"],
"dataset_type": 'one_file_csv',
"url": {'core': molnet_base + 'core_smiles_labels.csv',
'full': molnet_base + 'full_smiles_labels.csv',
'refined': molnet_base + 'refined_smiles_labels.csv'},
"smiles_columns": 'smiles',
"metrics": {'R2': r2_score},
"split": 'time',
"task_type": 'regression',
"tasks": ["-logKd/Ki"],
},
"pdbbind_grid": {
"pdbbind_subset": ["core", "full", "refined"],
"dataset_type": 'joblib',
"url": {'core': featurized_base + 'core_grid.tar.gz',
'full': featurized_base + 'full_grid.tar.gz',
'refined': featurized_base + 'refined_grid.tar.gz'},
"smiles_columns": '',
"metrics": {'R2': r2_score},
"split": 'time',
"task_type": 'regression',
"tasks": ["-logKd/Ki"],
},
"ppb": {
"dataset_type": 'one_file_csv',
"loss": mse,
"metrics": {'RMSE': rmse},
"smiles_columns": 'smiles',
"split": 'random',
"task_type": 'regression',
"tasks": ["exp"],
"url": molnet_base + 'PPB.csv',
},
# TODO(motoki): there are multiple data types in qm7 dataset.
"qm7": {
"dataset_type": 'one_file_csv',
"loss": mse,
"metrics": {'MAE': mae},
"smiles_columns": 'smiles',
"split": 'stratified',
"task_type": 'regression',
"tasks": ["u0_atom"],
"url": molnet_base + 'qm7.csv',
},
# TODO(motoki): there are sdf data types in qm8 dataset.
"qm8": {
"dataset_type": 'one_file_csv',
"loss": mse,
"metrics": {'MAE': mae},
"smiles_columns": 'smiles',
"split": 'random',
"task_type": 'regression',
"tasks": ["E1-CC2", "E2-CC2", "f1-CC2", "f2-CC2", "E1-PBE0", "E2-PBE0",
"f1-PBE0", "f2-PBE0", "E1-PBE0", "E2-PBE0", "f1-PBE0",
"f2-PBE0", "E1-CAM", "E2-CAM", "f1-CAM", "f2-CAM"],
"url": molnet_base + 'qm8.csv',
},
# TODO(motoki): there are sdf data types in qm9 dataset.
"qm9": {
"dataset_type": 'one_file_csv',
"loss": mse,
"metrics": {'MAE': mae},
"smiles_columns": 'smiles',
"split": 'random',
"task_type": 'regression',
"tasks": ["mu", "alpha", "homo", "lumo", "gap", "r2", "zpve", "cv",
"u0", "u298", "h298", "g298"],
"url": molnet_base + 'qm9.csv',
},
"SAMPL": {
"dataset_type": 'one_file_csv',
"loss": mse,
"metrics": {'RMSE': rmse},
"smiles_columns": 'smiles',
"split": 'random',
"task_type": 'regression',
"tasks": ["expt"],
"url": molnet_base + 'SAMPL.csv',
},
"sider": {
"dataset_type": 'one_file_csv',
"loss": F.sigmoid_cross_entropy,
"metrics": {'binary_accuracy': F.binary_accuracy,
'roc_auc': ROCAUCEvaluator},
"smiles_columns": 'smiles',
"split": 'random',
"task_type": 'classification',
"tasks": ['Hepatobiliary disorders',
'Metabolism and nutrition disorders', 'Product issues',
'Eye disorders', 'Investigations',
'Musculoskeletal and connective tissue disorders',
'Gastrointestinal disorders', 'Social circumstances',
'Immune system disorders',
'Reproductive system and breast disorders',
'Neoplasms benign, malignant and unspecified '
'(incl cysts and polyps)',
'General disorders and administration site conditions',
'Endocrine disorders', 'Surgical and medical procedures',
'Vascular disorders', 'Blood and lymphatic system disorders',
'Skin and subcutaneous tissue disorders',
'Congenital, familial and genetic disorders',
'Infections and infestations',
'Respiratory, thoracic and mediastinal disorders',
'Psychiatric disorders', 'Renal and urinary disorders',
'Pregnancy, puerperium and perinatal conditions',
'Ear and labyrinth disorders', 'Cardiac disorders',
'Nervous system disorders',
'Injury, poisoning and procedural complications'],
"url": molnet_base + 'sider.csv.gz',
},
"tox21": {
"dataset_type": 'one_file_csv',
"loss": F.sigmoid_cross_entropy,
"metrics": {'binary_accuracy': F.binary_accuracy,
'roc_auc': ROCAUCEvaluator},
"smiles_columns": 'smiles',
"split": 'random',
"task_type": 'classification',
"tasks": ['NR-AR', 'NR-AR-LBD', 'NR-AhR', 'NR-Aromatase', 'NR-ER',
'NR-ER-LBD', 'NR-PPAR-gamma', 'SR-ARE', 'SR-ATAD5', 'SR-HSE',
'SR-MMP', 'SR-p53'],
"url": molnet_base + 'tox21.csv.gz',
},
"toxcast": {
"dataset_type": 'one_file_csv',
"loss": F.sigmoid_cross_entropy,
"metrics": {'binary_accuracy': F.binary_accuracy,
'roc_auc': ROCAUCEvaluator},
"smiles_columns": 'smiles',
"split": 'random',
"task_type": 'classification',
"tasks": toxcast_tasks,
"url": molnet_base + 'toxcast_data.csv.gz',
},
}
================================================
FILE: chainer_chemistry/datasets/molnet/pdbbind_time.py
================================================
from logging import getLogger
import os
import shutil
import pandas
from chainer.dataset import download
def get_pdbbind_time():
"""Get time list for PDBbind dataset.
Args:
Returns(list):
Time list for PDBbind dataset.
"""
df = pandas.read_csv(get_pdbbind_time_filepath(), header=None)
time_list = df[1].values.tolist()
return time_list
def get_pdbbind_time_filepath(download_if_not_exist=True):
"""Construct a file path which stores year table of PDBbind.
This method check whether the file exist or not, and download it if
necessary.
Args:
download_if_not_exist(bool): Download a file if it does not exist.
Returns(str): filepath for year table
"""
url = 'http://deepchem.io.s3-website-us-west-1.amazonaws.com/datasets/' \
'pdbbind_year.csv'
file_name = url.split('/')[-1]
cache_path = _get_pdbbind_time_filepath(file_name)
if not os.path.exists(cache_path):
if download_if_not_exist:
is_successful = download_pdbbind_time(url,
save_filepath=cache_path)
if not is_successful:
logger = getLogger(__name__)
logger.warning('Download failed.')
return cache_path
def _get_pdbbind_time_filepath(file_name):
"""Construct a filepath which stores year table in csv.
This method does not check if the file is already downloaded or not.
Args:
file_name(str): file name of year table
Returns(str): filepath for one of year table
"""
cache_root = download.get_dataset_directory('pfnet/chainer/molnet')
cache_path = os.path.join(cache_root, file_name)
return cache_path
def download_pdbbind_time(url, save_filepath):
"""Download and caches PDBBind year table.
Args:
url(str): URL of year table
save_filepath(str): filepath for year table
Returns(bool): If success downloading, returning `True`.
"""
download_file_path = download.cached_download(url)
shutil.move(download_file_path, save_filepath)
return True
================================================
FILE: chainer_chemistry/datasets/molnet/toxcast_tasks.py
================================================
# flake8: noqa
toxcast_tasks = ['ACEA_T47D_80hr_Negative', 'ACEA_T47D_80hr_Positive',
'APR_HepG2_CellCycleArrest_24h_dn',
'APR_HepG2_CellCycleArrest_24h_up',
'APR_HepG2_CellCycleArrest_72h_dn', 'APR_HepG2_CellLoss_24h_dn',
'APR_HepG2_CellLoss_72h_dn', 'APR_HepG2_MicrotubuleCSK_24h_dn',
'APR_HepG2_MicrotubuleCSK_24h_up',
'APR_HepG2_MicrotubuleCSK_72h_dn',
'APR_HepG2_MicrotubuleCSK_72h_up', 'APR_HepG2_MitoMass_24h_dn',
'APR_HepG2_MitoMass_24h_up', 'APR_HepG2_MitoMass_72h_dn',
'APR_HepG2_MitoMass_72h_up', 'APR_HepG2_MitoMembPot_1h_dn',
'APR_HepG2_MitoMembPot_24h_dn', 'APR_HepG2_MitoMembPot_72h_dn',
'APR_HepG2_MitoticArrest_24h_up', 'APR_HepG2_MitoticArrest_72h_up',
'APR_HepG2_NuclearSize_24h_dn', 'APR_HepG2_NuclearSize_72h_dn',
'APR_HepG2_NuclearSize_72h_up', 'APR_HepG2_OxidativeStress_24h_up',
'APR_HepG2_OxidativeStress_72h_up', 'APR_HepG2_StressKinase_1h_up',
'APR_HepG2_StressKinase_24h_up', 'APR_HepG2_StressKinase_72h_up',
'APR_HepG2_p53Act_24h_up', 'APR_HepG2_p53Act_72h_up',
'APR_Hepat_Apoptosis_24hr_up', 'APR_Hepat_Apoptosis_48hr_up',
'APR_Hepat_CellLoss_24hr_dn', 'APR_Hepat_CellLoss_48hr_dn',
'APR_Hepat_DNADamage_24hr_up', 'APR_Hepat_DNADamage_48hr_up',
'APR_Hepat_DNATexture_24hr_up', 'APR_Hepat_DNATexture_48hr_up',
'APR_Hepat_MitoFxnI_1hr_dn', 'APR_Hepat_MitoFxnI_24hr_dn',
'APR_Hepat_MitoFxnI_48hr_dn', 'APR_Hepat_NuclearSize_24hr_dn',
'APR_Hepat_NuclearSize_48hr_dn', 'APR_Hepat_Steatosis_24hr_up',
'APR_Hepat_Steatosis_48hr_up', 'ATG_AP_1_CIS_dn', 'ATG_AP_1_CIS_up',
'ATG_AP_2_CIS_dn', 'ATG_AP_2_CIS_up', 'ATG_AR_TRANS_dn',
'ATG_AR_TRANS_up', 'ATG_Ahr_CIS_dn', 'ATG_Ahr_CIS_up',
'ATG_BRE_CIS_dn', 'ATG_BRE_CIS_up', 'ATG_CAR_TRANS_dn',
'ATG_CAR_TRANS_up', 'ATG_CMV_CIS_dn', 'ATG_CMV_CIS_up',
'ATG_CRE_CIS_dn', 'ATG_CRE_CIS_up', 'ATG_C_EBP_CIS_dn',
'ATG_C_EBP_CIS_up', 'ATG_DR4_LXR_CIS_dn', 'ATG_DR4_LXR_CIS_up',
'ATG_DR5_CIS_dn', 'ATG_DR5_CIS_up', 'ATG_E2F_CIS_dn',
'ATG_E2F_CIS_up', 'ATG_EGR_CIS_up', 'ATG_ERE_CIS_dn',
'ATG_ERE_CIS_up', 'ATG_ERRa_TRANS_dn', 'ATG_ERRg_TRANS_dn',
'ATG_ERRg_TRANS_up', 'ATG_ERa_TRANS_up', 'ATG_E_Box_CIS_dn',
'ATG_E_Box_CIS_up', 'ATG_Ets_CIS_dn', 'ATG_Ets_CIS_up',
'ATG_FXR_TRANS_up', 'ATG_FoxA2_CIS_dn', 'ATG_FoxA2_CIS_up',
'ATG_FoxO_CIS_dn', 'ATG_FoxO_CIS_up', 'ATG_GAL4_TRANS_dn',
'ATG_GATA_CIS_dn', 'ATG_GATA_CIS_up', 'ATG_GLI_CIS_dn',
'ATG_GLI_CIS_up', 'ATG_GRE_CIS_dn', 'ATG_GRE_CIS_up',
'ATG_GR_TRANS_dn', 'ATG_GR_TRANS_up', 'ATG_HIF1a_CIS_dn',
'ATG_HIF1a_CIS_up', 'ATG_HNF4a_TRANS_dn', 'ATG_HNF4a_TRANS_up',
'ATG_HNF6_CIS_dn', 'ATG_HNF6_CIS_up', 'ATG_HSE_CIS_dn',
'ATG_HSE_CIS_up', 'ATG_IR1_CIS_dn', 'ATG_IR1_CIS_up',
'ATG_ISRE_CIS_dn', 'ATG_ISRE_CIS_up', 'ATG_LXRa_TRANS_dn',
'ATG_LXRa_TRANS_up', 'ATG_LXRb_TRANS_dn', 'ATG_LXRb_TRANS_up',
'ATG_MRE_CIS_up', 'ATG_M_06_TRANS_up', 'ATG_M_19_CIS_dn',
'ATG_M_19_TRANS_dn', 'ATG_M_19_TRANS_up', 'ATG_M_32_CIS_dn',
'ATG_M_32_CIS_up', 'ATG_M_32_TRANS_dn', 'ATG_M_32_TRANS_up',
'ATG_M_61_TRANS_up', 'ATG_Myb_CIS_dn', 'ATG_Myb_CIS_up',
'ATG_Myc_CIS_dn', 'ATG_Myc_CIS_up', 'ATG_NFI_CIS_dn',
'ATG_NFI_CIS_up', 'ATG_NF_kB_CIS_dn', 'ATG_NF_kB_CIS_up',
'ATG_NRF1_CIS_dn', 'ATG_NRF1_CIS_up', 'ATG_NRF2_ARE_CIS_dn',
'ATG_NRF2_ARE_CIS_up', 'ATG_NURR1_TRANS_dn', 'ATG_NURR1_TRANS_up',
'ATG_Oct_MLP_CIS_dn', 'ATG_Oct_MLP_CIS_up', 'ATG_PBREM_CIS_dn',
'ATG_PBREM_CIS_up', 'ATG_PPARa_TRANS_dn', 'ATG_PPARa_TRANS_up',
'ATG_PPARd_TRANS_up', 'ATG_PPARg_TRANS_up', 'ATG_PPRE_CIS_dn',
'ATG_PPRE_CIS_up', 'ATG_PXRE_CIS_dn', 'ATG_PXRE_CIS_up',
'ATG_PXR_TRANS_dn', 'ATG_PXR_TRANS_up', 'ATG_Pax6_CIS_up',
'ATG_RARa_TRANS_dn', 'ATG_RARa_TRANS_up', 'ATG_RARb_TRANS_dn',
'ATG_RARb_TRANS_up', 'ATG_RARg_TRANS_dn', 'ATG_RARg_TRANS_up',
'ATG_RORE_CIS_dn', 'ATG_RORE_CIS_up', 'ATG_RORb_TRANS_dn',
'ATG_RORg_TRANS_dn', 'ATG_RORg_TRANS_up', 'ATG_RXRa_TRANS_dn',
'ATG_RXRa_TRANS_up', 'ATG_RXRb_TRANS_dn', 'ATG_RXRb_TRANS_up',
'ATG_SREBP_CIS_dn', 'ATG_SREBP_CIS_up', 'ATG_STAT3_CIS_dn',
'ATG_STAT3_CIS_up', 'ATG_Sox_CIS_dn', 'ATG_Sox_CIS_up',
'ATG_Sp1_CIS_dn', 'ATG_Sp1_CIS_up', 'ATG_TAL_CIS_dn',
'ATG_TAL_CIS_up', 'ATG_TA_CIS_dn', 'ATG_TA_CIS_up',
'ATG_TCF_b_cat_CIS_dn', 'ATG_TCF_b_cat_CIS_up', 'ATG_TGFb_CIS_dn',
'ATG_TGFb_CIS_up', 'ATG_THRa1_TRANS_dn', 'ATG_THRa1_TRANS_up',
'ATG_VDRE_CIS_dn', 'ATG_VDRE_CIS_up', 'ATG_VDR_TRANS_dn',
'ATG_VDR_TRANS_up', 'ATG_XTT_Cytotoxicity_up', 'ATG_Xbp1_CIS_dn',
'ATG_Xbp1_CIS_up', 'ATG_p53_CIS_dn', 'ATG_p53_CIS_up',
'BSK_3C_Eselectin_down', 'BSK_3C_HLADR_down', 'BSK_3C_ICAM1_down',
'BSK_3C_IL8_down', 'BSK_3C_MCP1_down', 'BSK_3C_MIG_down',
'BSK_3C_Proliferation_down', 'BSK_3C_SRB_down',
'BSK_3C_Thrombomodulin_down', 'BSK_3C_Thrombomodulin_up',
'BSK_3C_TissueFactor_down', 'BSK_3C_TissueFactor_up',
'BSK_3C_VCAM1_down', 'BSK_3C_Vis_down', 'BSK_3C_uPAR_down',
'BSK_4H_Eotaxin3_down', 'BSK_4H_MCP1_down', 'BSK_4H_Pselectin_down',
'BSK_4H_Pselectin_up', 'BSK_4H_SRB_down', 'BSK_4H_VCAM1_down',
'BSK_4H_VEGFRII_down', 'BSK_4H_uPAR_down', 'BSK_4H_uPAR_up',
'BSK_BE3C_HLADR_down', 'BSK_BE3C_IL1a_down', 'BSK_BE3C_IP10_down',
'BSK_BE3C_MIG_down', 'BSK_BE3C_MMP1_down', 'BSK_BE3C_MMP1_up',
'BSK_BE3C_PAI1_down', 'BSK_BE3C_SRB_down', 'BSK_BE3C_TGFb1_down',
'BSK_BE3C_tPA_down', 'BSK_BE3C_uPAR_down', 'BSK_BE3C_uPAR_up',
'BSK_BE3C_uPA_down', 'BSK_CASM3C_HLADR_down', 'BSK_CASM3C_IL6_down',
'BSK_CASM3C_IL6_up', 'BSK_CASM3C_IL8_down', 'BSK_CASM3C_LDLR_down',
'BSK_CASM3C_LDLR_up', 'BSK_CASM3C_MCP1_down', 'BSK_CASM3C_MCP1_up',
'BSK_CASM3C_MCSF_down', 'BSK_CASM3C_MCSF_up', 'BSK_CASM3C_MIG_down',
'BSK_CASM3C_Proliferation_down', 'BSK_CASM3C_Proliferation_up',
'BSK_CASM3C_SAA_down', 'BSK_CASM3C_SAA_up', 'BSK_CASM3C_SRB_down',
'BSK_CASM3C_Thrombomodulin_down', 'BSK_CASM3C_Thrombomodulin_up',
'BSK_CASM3C_TissueFactor_down', 'BSK_CASM3C_VCAM1_down',
'BSK_CASM3C_VCAM1_up', 'BSK_CASM3C_uPAR_down', 'BSK_CASM3C_uPAR_up',
'BSK_KF3CT_ICAM1_down', 'BSK_KF3CT_IL1a_down',
'BSK_KF3CT_IP10_down', 'BSK_KF3CT_IP10_up', 'BSK_KF3CT_MCP1_down',
'BSK_KF3CT_MCP1_up', 'BSK_KF3CT_MMP9_down', 'BSK_KF3CT_SRB_down',
'BSK_KF3CT_TGFb1_down', 'BSK_KF3CT_TIMP2_down',
'BSK_KF3CT_uPA_down', 'BSK_LPS_CD40_down', 'BSK_LPS_Eselectin_down',
'BSK_LPS_Eselectin_up', 'BSK_LPS_IL1a_down', 'BSK_LPS_IL1a_up',
'BSK_LPS_IL8_down', 'BSK_LPS_IL8_up', 'BSK_LPS_MCP1_down',
'BSK_LPS_MCSF_down', 'BSK_LPS_PGE2_down', 'BSK_LPS_PGE2_up',
'BSK_LPS_SRB_down', 'BSK_LPS_TNFa_down', 'BSK_LPS_TNFa_up',
'BSK_LPS_TissueFactor_down', 'BSK_LPS_TissueFactor_up',
'BSK_LPS_VCAM1_down', 'BSK_SAg_CD38_down', 'BSK_SAg_CD40_down',
'BSK_SAg_CD69_down', 'BSK_SAg_Eselectin_down',
'BSK_SAg_Eselectin_up', 'BSK_SAg_IL8_down', 'BSK_SAg_IL8_up',
'BSK_SAg_MCP1_down', 'BSK_SAg_MIG_down',
'BSK_SAg_PBMCCytotoxicity_down', 'BSK_SAg_PBMCCytotoxicity_up',
'BSK_SAg_Proliferation_down', 'BSK_SAg_SRB_down',
'BSK_hDFCGF_CollagenIII_down', 'BSK_hDFCGF_EGFR_down',
'BSK_hDFCGF_EGFR_up', 'BSK_hDFCGF_IL8_down', 'BSK_hDFCGF_IP10_down',
'BSK_hDFCGF_MCSF_down', 'BSK_hDFCGF_MIG_down',
'BSK_hDFCGF_MMP1_down', 'BSK_hDFCGF_MMP1_up',
'BSK_hDFCGF_PAI1_down', 'BSK_hDFCGF_Proliferation_down',
'BSK_hDFCGF_SRB_down', 'BSK_hDFCGF_TIMP1_down',
'BSK_hDFCGF_VCAM1_down', 'CEETOX_H295R_11DCORT_dn',
'CEETOX_H295R_ANDR_dn', 'CEETOX_H295R_CORTISOL_dn',
'CEETOX_H295R_DOC_dn', 'CEETOX_H295R_DOC_up',
'CEETOX_H295R_ESTRADIOL_dn', 'CEETOX_H295R_ESTRADIOL_up',
'CEETOX_H295R_ESTRONE_dn', 'CEETOX_H295R_ESTRONE_up',
'CEETOX_H295R_OHPREG_up', 'CEETOX_H295R_OHPROG_dn',
'CEETOX_H295R_OHPROG_up', 'CEETOX_H295R_PROG_up',
'CEETOX_H295R_TESTO_dn', 'CLD_ABCB1_48hr', 'CLD_ABCG2_48hr',
'CLD_CYP1A1_24hr', 'CLD_CYP1A1_48hr', 'CLD_CYP1A1_6hr',
'CLD_CYP1A2_24hr', 'CLD_CYP1A2_48hr', 'CLD_CYP1A2_6hr',
'CLD_CYP2B6_24hr', 'CLD_CYP2B6_48hr', 'CLD_CYP2B6_6hr',
'CLD_CYP3A4_24hr', 'CLD_CYP3A4_48hr', 'CLD_CYP3A4_6hr',
'CLD_GSTA2_48hr', 'CLD_SULT2A_24hr', 'CLD_SULT2A_48hr',
'CLD_UGT1A1_24hr', 'CLD_UGT1A1_48hr', 'NCCT_HEK293T_CellTiterGLO',
'NCCT_QuantiLum_inhib_2_dn', 'NCCT_QuantiLum_inhib_dn',
'NCCT_TPO_AUR_dn', 'NCCT_TPO_GUA_dn',
'NHEERL_ZF_144hpf_TERATOSCORE_up', 'NVS_ADME_hCYP19A1',
'NVS_ADME_hCYP1A1', 'NVS_ADME_hCYP1A2', 'NVS_ADME_hCYP2A6',
'NVS_ADME_hCYP2B6', 'NVS_ADME_hCYP2C19', 'NVS_ADME_hCYP2C9',
'NVS_ADME_hCYP2D6', 'NVS_ADME_hCYP3A4', 'NVS_ADME_hCYP4F12',
'NVS_ADME_rCYP2C12', 'NVS_ENZ_hAChE', 'NVS_ENZ_hAMPKa1',
'NVS_ENZ_hAurA', 'NVS_ENZ_hBACE', 'NVS_ENZ_hCASP5', 'NVS_ENZ_hCK1D',
'NVS_ENZ_hDUSP3', 'NVS_ENZ_hES', 'NVS_ENZ_hElastase',
'NVS_ENZ_hFGFR1', 'NVS_ENZ_hGSK3b', 'NVS_ENZ_hMMP1',
'NVS_ENZ_hMMP13', 'NVS_ENZ_hMMP2', 'NVS_ENZ_hMMP3', 'NVS_ENZ_hMMP7',
'NVS_ENZ_hMMP9', 'NVS_ENZ_hPDE10', 'NVS_ENZ_hPDE4A1',
'NVS_ENZ_hPDE5', 'NVS_ENZ_hPI3Ka', 'NVS_ENZ_hPTEN',
'NVS_ENZ_hPTPN11', 'NVS_ENZ_hPTPN12', 'NVS_ENZ_hPTPN13',
'NVS_ENZ_hPTPN9', 'NVS_ENZ_hPTPRC', 'NVS_ENZ_hSIRT1',
'NVS_ENZ_hSIRT2', 'NVS_ENZ_hTrkA', 'NVS_ENZ_hVEGFR2',
'NVS_ENZ_oCOX1', 'NVS_ENZ_oCOX2', 'NVS_ENZ_rAChE', 'NVS_ENZ_rCNOS',
'NVS_ENZ_rMAOAC', 'NVS_ENZ_rMAOAP', 'NVS_ENZ_rMAOBC',
'NVS_ENZ_rMAOBP', 'NVS_ENZ_rabI2C', 'NVS_GPCR_bAdoR_NonSelective',
'NVS_GPCR_bDR_NonSelective', 'NVS_GPCR_g5HT4', 'NVS_GPCR_gH2',
'NVS_GPCR_gLTB4', 'NVS_GPCR_gLTD4',
'NVS_GPCR_gMPeripheral_NonSelective', 'NVS_GPCR_gOpiateK',
'NVS_GPCR_h5HT2A', 'NVS_GPCR_h5HT5A', 'NVS_GPCR_h5HT6',
'NVS_GPCR_h5HT7', 'NVS_GPCR_hAT1', 'NVS_GPCR_hAdoRA1',
'NVS_GPCR_hAdoRA2a', 'NVS_GPCR_hAdra2A', 'NVS_GPCR_hAdra2C',
'NVS_GPCR_hAdrb1', 'NVS_GPCR_hAdrb2', 'NVS_GPCR_hAdrb3',
'NVS_GPCR_hDRD1', 'NVS_GPCR_hDRD2s', 'NVS_GPCR_hDRD4.4',
'NVS_GPCR_hH1', 'NVS_GPCR_hLTB4_BLT1', 'NVS_GPCR_hM1',
'NVS_GPCR_hM2', 'NVS_GPCR_hM3', 'NVS_GPCR_hM4', 'NVS_GPCR_hNK2',
'NVS_GPCR_hOpiate_D1', 'NVS_GPCR_hOpiate_mu', 'NVS_GPCR_hTXA2',
'NVS_GPCR_p5HT2C', 'NVS_GPCR_r5HT1_NonSelective',
'NVS_GPCR_r5HT_NonSelective', 'NVS_GPCR_rAdra1B',
'NVS_GPCR_rAdra1_NonSelective', 'NVS_GPCR_rAdra2_NonSelective',
'NVS_GPCR_rAdrb_NonSelective', 'NVS_GPCR_rNK1', 'NVS_GPCR_rNK3',
'NVS_GPCR_rOpiate_NonSelective', 'NVS_GPCR_rOpiate_NonSelectiveNa',
'NVS_GPCR_rSST', 'NVS_GPCR_rTRH', 'NVS_GPCR_rV1', 'NVS_GPCR_rabPAF',
'NVS_GPCR_rmAdra2B', 'NVS_IC_hKhERGCh', 'NVS_IC_rCaBTZCHL',
'NVS_IC_rCaDHPRCh_L', 'NVS_IC_rNaCh_site2', 'NVS_LGIC_bGABARa1',
'NVS_LGIC_h5HT3', 'NVS_LGIC_hNNR_NBungSens',
'NVS_LGIC_rGABAR_NonSelective', 'NVS_LGIC_rNNR_BungSens',
'NVS_MP_hPBR', 'NVS_MP_rPBR', 'NVS_NR_bER', 'NVS_NR_bPR',
'NVS_NR_cAR', 'NVS_NR_hAR', 'NVS_NR_hCAR_Antagonist', 'NVS_NR_hER',
'NVS_NR_hFXR_Agonist', 'NVS_NR_hFXR_Antagonist', 'NVS_NR_hGR',
'NVS_NR_hPPARa', 'NVS_NR_hPPARg', 'NVS_NR_hPR', 'NVS_NR_hPXR',
'NVS_NR_hRAR_Antagonist', 'NVS_NR_hRARa_Agonist',
'NVS_NR_hTRa_Antagonist', 'NVS_NR_mERa', 'NVS_NR_rAR', 'NVS_NR_rMR',
'NVS_OR_gSIGMA_NonSelective', 'NVS_TR_gDAT', 'NVS_TR_hAdoT',
'NVS_TR_hDAT', 'NVS_TR_hNET', 'NVS_TR_hSERT', 'NVS_TR_rNET',
'NVS_TR_rSERT', 'NVS_TR_rVMAT2', 'OT_AR_ARELUC_AG_1440',
'OT_AR_ARSRC1_0480', 'OT_AR_ARSRC1_0960', 'OT_ER_ERaERa_0480',
'OT_ER_ERaERa_1440', 'OT_ER_ERaERb_0480', 'OT_ER_ERaERb_1440',
'OT_ER_ERbERb_0480', 'OT_ER_ERbERb_1440', 'OT_ERa_EREGFP_0120',
'OT_ERa_EREGFP_0480', 'OT_FXR_FXRSRC1_0480', 'OT_FXR_FXRSRC1_1440',
'OT_NURR1_NURR1RXRa_0480', 'OT_NURR1_NURR1RXRa_1440',
'TOX21_ARE_BLA_Agonist_ch1', 'TOX21_ARE_BLA_Agonist_ch2',
'TOX21_ARE_BLA_agonist_ratio', 'TOX21_ARE_BLA_agonist_viability',
'TOX21_AR_BLA_Agonist_ch1', 'TOX21_AR_BLA_Agonist_ch2',
'TOX21_AR_BLA_Agonist_ratio', 'TOX21_AR_BLA_Antagonist_ch1',
'TOX21_AR_BLA_Antagonist_ch2', 'TOX21_AR_BLA_Antagonist_ratio',
'TOX21_AR_BLA_Antagonist_viability', 'TOX21_AR_LUC_MDAKB2_Agonist',
'TOX21_AR_LUC_MDAKB2_Antagonist', 'TOX21_AR_LUC_MDAKB2_Antagonist2',
'TOX21_AhR_LUC_Agonist', 'TOX21_Aromatase_Inhibition',
'TOX21_AutoFluor_HEK293_Cell_blue',
'TOX21_AutoFluor_HEK293_Media_blue',
'TOX21_AutoFluor_HEPG2_Cell_blue',
'TOX21_AutoFluor_HEPG2_Cell_green',
'TOX21_AutoFluor_HEPG2_Media_blue',
'TOX21_AutoFluor_HEPG2_Media_green', 'TOX21_ELG1_LUC_Agonist',
'TOX21_ERa_BLA_Agonist_ch1', 'TOX21_ERa_BLA_Agonist_ch2',
'TOX21_ERa_BLA_Agonist_ratio', 'TOX21_ERa_BLA_Antagonist_ch1',
'TOX21_ERa_BLA_Antagonist_ch2', 'TOX21_ERa_BLA_Antagonist_ratio',
'TOX21_ERa_BLA_Antagonist_viability', 'TOX21_ERa_LUC_BG1_Agonist',
'TOX21_ERa_LUC_BG1_Antagonist', 'TOX21_ESRE_BLA_ch1',
'TOX21_ESRE_BLA_ch2', 'TOX21_ESRE_BLA_ratio',
'TOX21_ESRE_BLA_viability', 'TOX21_FXR_BLA_Antagonist_ch1',
'TOX21_FXR_BLA_Antagonist_ch2', 'TOX21_FXR_BLA_agonist_ch2',
'TOX21_FXR_BLA_agonist_ratio', 'TOX21_FXR_BLA_antagonist_ratio',
'TOX21_FXR_BLA_antagonist_viability', 'TOX21_GR_BLA_Agonist_ch1',
'TOX21_GR_BLA_Agonist_ch2', 'TOX21_GR_BLA_Agonist_ratio',
'TOX21_GR_BLA_Antagonist_ch2', 'TOX21_GR_BLA_Antagonist_ratio',
'TOX21_GR_BLA_Antagonist_viability', 'TOX21_HSE_BLA_agonist_ch1',
'TOX21_HSE_BLA_agonist_ch2', 'TOX21_HSE_BLA_agonist_ratio',
'TOX21_HSE_BLA_agonist_viability', 'TOX21_MMP_ratio_down',
'TOX21_MMP_ratio_up', 'TOX21_MMP_viability',
'TOX21_NFkB_BLA_agonist_ch1', 'TOX21_NFkB_BLA_agonist_ch2',
'TOX21_NFkB_BLA_agonist_ratio', 'TOX21_NFkB_BLA_agonist_viability',
'TOX21_PPARd_BLA_Agonist_viability',
'TOX21_PPARd_BLA_Antagonist_ch1', 'TOX21_PPARd_BLA_agonist_ch1',
'TOX21_PPARd_BLA_agonist_ch2', 'TOX21_PPARd_BLA_agonist_ratio',
'TOX21_PPARd_BLA_antagonist_ratio',
'TOX21_PPARd_BLA_antagonist_viability',
'TOX21_PPARg_BLA_Agonist_ch1', 'TOX21_PPARg_BLA_Agonist_ch2',
'TOX21_PPARg_BLA_Agonist_ratio', 'TOX21_PPARg_BLA_Antagonist_ch1',
'TOX21_PPARg_BLA_antagonist_ratio',
'TOX21_PPARg_BLA_antagonist_viability', 'TOX21_TR_LUC_GH3_Agonist',
'TOX21_TR_LUC_GH3_Antagonist', 'TOX21_VDR_BLA_Agonist_viability',
'TOX21_VDR_BLA_Antagonist_ch1', 'TOX21_VDR_BLA_agonist_ch2',
'TOX21_VDR_BLA_agonist_ratio', 'TOX21_VDR_BLA_antagonist_ratio',
'TOX21_VDR_BLA_antagonist_viability', 'TOX21_p53_BLA_p1_ch1',
'TOX21_p53_BLA_p1_ch2', 'TOX21_p53_BLA_p1_ratio',
'TOX21_p53_BLA_p1_viability', 'TOX21_p53_BLA_p2_ch1',
'TOX21_p53_BLA_p2_ch2', 'TOX21_p53_BLA_p2_ratio',
'TOX21_p53_BLA_p2_viability', 'TOX21_p53_BLA_p3_ch1',
'TOX21_p53_BLA_p3_ch2', 'TOX21_p53_BLA_p3_ratio',
'TOX21_p53_BLA_p3_viability', 'TOX21_p53_BLA_p4_ch1',
'TOX21_p53_BLA_p4_ch2', 'TOX21_p53_BLA_p4_ratio',
'TOX21_p53_BLA_p4_viability', 'TOX21_p53_BLA_p5_ch1',
'TOX21_p53_BLA_p5_ch2', 'TOX21_p53_BLA_p5_ratio',
'TOX21_p53_BLA_p5_viability', 'Tanguay_ZF_120hpf_AXIS_up',
'Tanguay_ZF_120hpf_ActivityScore', 'Tanguay_ZF_120hpf_BRAI_up',
'Tanguay_ZF_120hpf_CFIN_up', 'Tanguay_ZF_120hpf_CIRC_up',
'Tanguay_ZF_120hpf_EYE_up', 'Tanguay_ZF_120hpf_JAW_up',
'Tanguay_ZF_120hpf_MORT_up', 'Tanguay_ZF_120hpf_OTIC_up',
'Tanguay_ZF_120hpf_PE_up', 'Tanguay_ZF_120hpf_PFIN_up',
'Tanguay_ZF_120hpf_PIG_up', 'Tanguay_ZF_120hpf_SNOU_up',
'Tanguay_ZF_120hpf_SOMI_up', 'Tanguay_ZF_120hpf_SWIM_up',
'Tanguay_ZF_120hpf_TRUN_up', 'Tanguay_ZF_120hpf_TR_up',
'Tanguay_ZF_120hpf_YSE_up']
================================================
FILE: chainer_chemistry/datasets/numpy_tuple_dataset.py
================================================
import os
import six
import numpy
from chainer_chemistry.dataset.converters import concat_mols
from chainer_chemistry.dataset.indexers.numpy_tuple_dataset_feature_indexer import NumpyTupleDatasetFeatureIndexer # NOQA
class NumpyTupleDataset(object):
"""Dataset of a tuple of datasets.
It combines multiple datasets into one dataset. Each example is represented
by a tuple whose ``i``-th item corresponds to the i-th dataset.
And each ``i``-th dataset is expected to be an instance of numpy.ndarray.
Args:
datasets: Underlying datasets. The ``i``-th one is used for the
``i``-th item of each example. All datasets must have the same
length.
"""
def __init__(self, *datasets):
if not datasets:
raise ValueError('no datasets are given')
length = len(datasets[0])
for i, dataset in enumerate(datasets):
if len(dataset) != length:
raise ValueError(
'dataset of the index {} has a wrong length'.format(i))
self._datasets = datasets
self._length = length
self._features_indexer = NumpyTupleDatasetFeatureIndexer(self)
def __getitem__(self, index):
batches = [dataset[index] for dataset in self._datasets]
if isinstance(index, (slice, list, numpy.ndarray)):
length = len(batches[0])
return [tuple([batch[i] for batch in batches])
for i in six.moves.range(length)]
else:
return tuple(batches)
def __len__(self):
return self._length
def get_datasets(self):
return self._datasets
@property
def converter(self):
return concat_mols
@property
def features(self):
"""Extract features according to the specified index.
- axis 0 is used to specify dataset id (`i`-th dataset)
- axis 1 is used to specify feature index
.. admonition:: Example
>>> import numpy
>>> from chainer_chemistry.datasets import NumpyTupleDataset
>>> x = numpy.array([0, 1, 2], dtype=numpy.float32)
>>> t = x * x
>>> numpy_tuple_dataset = NumpyTupleDataset(x, t)
>>> targets = numpy_tuple_dataset.features[:, 1]
>>> print('targets', targets) # We can extract only target value
targets [0, 1, 4]
"""
return self._features_indexer
@classmethod
def save(cls, filepath, numpy_tuple_dataset):
"""save the dataset to filepath in npz format
Args:
filepath (str): filepath to save dataset. It is recommended to end
with '.npz' extension.
numpy_tuple_dataset (NumpyTupleDataset): dataset instance
"""
if not isinstance(numpy_tuple_dataset, NumpyTupleDataset):
raise TypeError('numpy_tuple_dataset is not instance of '
'NumpyTupleDataset, got {}'
.format(type(numpy_tuple_dataset)))
numpy.savez(filepath, *numpy_tuple_dataset._datasets)
@classmethod
def load(cls, filepath, allow_pickle=True):
if not os.path.exists(filepath):
return None
load_data = numpy.load(filepath, allow_pickle=allow_pickle)
result = []
i = 0
while True:
key = 'arr_{}'.format(i)
if key in load_data.keys():
result.append(load_data[key])
i += 1
else:
break
return NumpyTupleDataset(*result)
================================================
FILE: chainer_chemistry/datasets/qm9.py
================================================
import glob
from logging import getLogger
import os
import shutil
import tarfile
import tempfile
from chainer.dataset import download
import numpy
import pandas
from tqdm import tqdm
from chainer_chemistry.dataset.parsers.csv_file_parser import CSVFileParser
from chainer_chemistry.dataset.preprocessors.atomic_number_preprocessor import AtomicNumberPreprocessor # NOQA
download_url = 'https://ndownloader.figshare.com/files/3195389'
file_name = 'qm9.csv'
_root = 'pfnet/chainer/qm9'
_label_names = ['A', 'B', 'C', 'mu', 'alpha', 'homo', 'lumo', 'gap', 'r2',
'zpve', 'U0', 'U', 'H', 'G', 'Cv']
_smiles_column_names = ['SMILES1', 'SMILES2']
def get_qm9_label_names():
"""Returns label names of QM9 datasets."""
return _label_names
def get_qm9(preprocessor=None, labels=None, return_smiles=False,
target_index=None):
"""Downloads, caches and preprocesses QM9 dataset.
Args:
preprocessor (BasePreprocessor): Preprocessor.
This should be chosen based on the network to be trained.
If it is None, default `AtomicNumberPreprocessor` is used.
labels (str or list): List of target labels.
return_smiles (bool): If set to ``True``,
smiles array is also returned.
target_index (list or None): target index list to partially extract
dataset. If None (default), all examples are parsed.
Returns:
dataset, which is composed of `features`, which depends on
`preprocess_method`.
"""
labels = labels or get_qm9_label_names()
if isinstance(labels, str):
labels = [labels, ]
def postprocess_label(label_list):
# This is regression task, cast to float value.
return numpy.asarray(label_list, dtype=numpy.float32)
if preprocessor is None:
preprocessor = AtomicNumberPreprocessor()
parser = CSVFileParser(preprocessor, postprocess_label=postprocess_label,
labels=labels, smiles_col='SMILES1')
result = parser.parse(get_qm9_filepath(), return_smiles=return_smiles,
target_index=target_index)
if return_smiles:
return result['dataset'], result['smiles']
else:
return result['dataset']
def get_qm9_filepath(download_if_not_exist=True):
"""Construct a filepath which stores qm9 dataset for config_name
This method check whether the file exist or not, and downloaded it if
necessary.
Args:
download_if_not_exist (bool): If `True` download dataset
if it is not downloaded yet.
Returns (str): file path for qm9 dataset (formatted to csv)
"""
cache_path = _get_qm9_filepath()
if not os.path.exists(cache_path):
if download_if_not_exist:
is_successful = download_and_extract_qm9(save_filepath=cache_path)
if not is_successful:
logger = getLogger(__name__)
logger.warning('Download failed.')
return cache_path
def _get_qm9_filepath():
"""Construct a filepath which stores QM9 dataset in csv
This method does not check if the file is already downloaded or not.
Returns (str): filepath for qm9 dataset
"""
cache_root = download.get_dataset_directory(_root)
cache_path = os.path.join(cache_root, file_name)
return cache_path
def download_and_extract_qm9(save_filepath):
logger = getLogger(__name__)
logger.warning('Extracting QM9 dataset, it takes time...')
download_file_path = download.cached_download(download_url)
tf = tarfile.open(download_file_path, 'r')
temp_dir = tempfile.mkdtemp()
tf.extractall(temp_dir)
file_re = os.path.join(temp_dir, '*.xyz')
file_pathes = glob.glob(file_re)
# Make sure the order is sorted
file_pathes.sort()
ls = []
for path in tqdm(file_pathes):
with open(path, 'r') as f:
data = [line.strip() for line in f]
num_atom = int(data[0])
properties = list(map(float, data[1].split('\t')[1:]))
smiles = data[3 + num_atom].split('\t')
new_ls = smiles + properties
ls.append(new_ls)
df = pandas.DataFrame(ls, columns=_smiles_column_names + _label_names)
df.to_csv(save_filepath)
shutil.rmtree(temp_dir)
return True
================================================
FILE: chainer_chemistry/datasets/reddit/reddit.py
================================================
from logging import getLogger
import os
from zipfile import ZipFile
import networkx as nx
import numpy
import scipy
from chainer.dataset import download
download_url = 'https://s3.us-east-2.amazonaws.com/dgl.ai/dataset/reddit.zip'
feat_file_name = 'reddit_data.npz'
edge_file_name = 'reddit_graph.npz'
_root = 'pfnet/chainer/reddit'
def reddit_to_networkx(dirpath):
print("Loading graph data")
coo_adj = scipy.sparse.load_npz(os.path.join(dirpath, edge_file_name))
G = nx.from_scipy_sparse_matrix(coo_adj)
print("Loading node feature and label")
# node feature, edge label
reddit_data = numpy.load(os.path.join(dirpath, feat_file_name))
G.graph['x'] = reddit_data['feature'].astype(numpy.float32)
G.graph['y'] = reddit_data['label'].astype(numpy.int32)
G.graph['label_num'] = 41
# G = nx.convert_node_labels_to_integers(G)
print("Finish loading graph: {}".format(dirpath))
return G
def get_reddit_dirpath(download_if_not_exist=True):
# type: (bool) -> str
"""Construct a dirpath which stores reddit dataset.
This method check whether the file exist or not, and downloaded it
if necessary.
Args:
download_if_not_exist (bool): If ``True``, download dataset
if it is not downloaded yet.
Returns:
dirpath (str): directory path for reddit dataset.
"""
feat_cache_path, edge_cache_path = get_reddit_filepath(
download_if_not_exist=download_if_not_exist)
dirpath = os.path.dirname(feat_cache_path)
dirpath2 = os.path.dirname(edge_cache_path)
assert dirpath == dirpath2
return dirpath
def get_reddit_filepath(download_if_not_exist=True):
# type: (bool) -> Tuple[str, str]
"""Construct a filepath which stores reddit dataset.
This method check whether the file exist or not, and downloaded it
if necessary.
Args:
download_if_not_exist (bool): If ``True``, download dataset
if it is not downloaded yet.
Returns:
feat_cache_path (str): file path for reddit dataset (features).
edge_cache_path (str): file path for reddit dataset (edge index).
"""
feat_cache_path, edge_cache_path = _get_reddit_filepath()
if not os.path.exists(feat_cache_path):
if download_if_not_exist:
is_successful = download_and_extract_reddit(
save_dirpath=os.path.dirname(feat_cache_path))
if not is_successful:
logger = getLogger(__name__)
logger.warning('Download failed.')
return feat_cache_path, edge_cache_path
def _get_reddit_filepath():
# type: () -> Tuple[str, str]
"""Construct a filepath which stores reddit dataset.
This method does not check if the file is already downloaded or not.
Returns:
feat_cache_path (str): file path for reddit dataset (features).
edge_cache_path (str): file path for reddit dataset (edge index).
"""
cache_root = download.get_dataset_directory(_root)
feat_cache_path = os.path.join(cache_root, feat_file_name)
edge_cache_path = os.path.join(cache_root, edge_file_name)
return feat_cache_path, edge_cache_path
def download_and_extract_reddit(save_dirpath):
# type: (str) -> bool
print('downloading reddit dataset...')
download_file_path = download.cached_download(download_url)
print('extracting reddit dataset...')
zip = ZipFile(download_file_path, 'r')
zip.extractall(save_dirpath)
return True
================================================
FILE: chainer_chemistry/datasets/tox21.py
================================================
from logging import getLogger
import os
import shutil
import zipfile
from chainer.dataset import download
import numpy
from chainer_chemistry.dataset.parsers.sdf_file_parser import SDFFileParser
from chainer_chemistry.dataset.preprocessors.atomic_number_preprocessor import AtomicNumberPreprocessor # NOQA
_config = {
'train': {
'url': 'https://tripod.nih.gov/tox21/challenge/download?'
'id=tox21_10k_data_allsdf',
'filename': 'tox21_10k_data_all.sdf'
},
'val': {
'url': 'https://tripod.nih.gov/tox21/challenge/download?'
'id=tox21_10k_challenge_testsdf',
'filename': 'tox21_10k_challenge_test.sdf'
},
'test': {
'url': 'https://tripod.nih.gov/tox21/challenge/download?'
'id=tox21_10k_challenge_scoresdf',
'filename': 'tox21_10k_challenge_score.sdf'
}
}
_root = 'pfnet/chainer/tox21'
_label_names = ['NR-AR', 'NR-AR-LBD', 'NR-AhR', 'NR-Aromatase', 'NR-ER',
'NR-ER-LBD', 'NR-PPAR-gamma', 'SR-ARE', 'SR-ATAD5',
'SR-HSE', 'SR-MMP', 'SR-p53']
def get_tox21_label_names():
"""Returns label names of Tox21 datasets."""
return _label_names
def get_tox21(preprocessor=None, labels=None, return_smiles=False,
train_target_index=None, val_target_index=None,
test_target_index=None):
"""Downloads, caches and preprocesses Tox21 dataset.
Args:
preprocesssor (BasePreprocessor): Preprocessor.
This should be chosen based on the network to be trained.
If it is None, default `AtomicNumberPreprocessor` is used.
labels (str or list): List of target labels.
return_smiles (bool): If set to True, smiles array is also returned.
train_target_index (list or None): target index list to partially
extract train dataset. If None (default), all examples are parsed.
val_target_index (list or None): target index list to partially
extract val dataset. If None (default), all examples are parsed.
test_target_index (list or None): target index list to partially
extract test dataset. If None (default), all examples are parsed.
Returns:
The 3-tuple consisting of train, validation and test
datasets, respectively. Each dataset is composed of `features`,
which depends on `preprocess_method`.
"""
labels = labels or get_tox21_label_names()
if isinstance(labels, str):
labels = [labels, ]
def postprocess_label(label_list):
# Set -1 to the place where the label is not found,
# this corresponds to not calculate loss with `sigmoid_cross_entropy`
t = numpy.array([-1 if label is None else label for label in
label_list], dtype=numpy.int32)
return t
if preprocessor is None:
preprocessor = AtomicNumberPreprocessor()
parser = SDFFileParser(preprocessor,
postprocess_label=postprocess_label,
labels=labels)
train_result = parser.parse(
get_tox21_filepath('train'), return_smiles=return_smiles,
target_index=train_target_index
)
val_result = parser.parse(
get_tox21_filepath('val'), return_smiles=return_smiles,
target_index=val_target_index
)
test_result = parser.parse(
get_tox21_filepath('test'), return_smiles=return_smiles,
target_index=test_target_index
)
if return_smiles:
train, train_smiles = train_result['dataset'], train_result['smiles']
val, val_smiles = val_result['dataset'], val_result['smiles']
test, test_smiles = test_result['dataset'], test_result['smiles']
return train, val, test, train_smiles, val_smiles, test_smiles
else:
train = train_result['dataset']
val = val_result['dataset']
test = test_result['dataset']
return train, val, test
def _get_tox21_filepath(dataset_type):
"""Returns a file path in which the tox21 dataset is cached.
This function returns a file path in which `dataset_type`
of the tox21 dataset is cached.
Note that this function does not check if the dataset has actually
been downloaded or not.
Args:
dataset_type(str): Name of the target dataset type.
Either 'train', 'val', or 'test'.
Returns (str): file path for the tox21 dataset
"""
if dataset_type not in _config.keys():
raise ValueError("Invalid dataset type '{}'. Accepted values are "
"'train', 'val' or 'test'.".format(dataset_type))
c = _config[dataset_type]
sdffile = c['filename']
cache_root = download.get_dataset_directory(_root)
cache_path = os.path.join(cache_root, sdffile)
return cache_path
def get_tox21_filepath(dataset_type, download_if_not_exist=True):
"""Returns a file path in which the tox21 dataset is cached.
This function returns a file path in which `dataset_type`
of the tox21 dataset is or will be cached.
If the dataset is not cached and if ``download_if_not_exist``
is ``True``, this function also downloads the dataset.
Args:
dataset_type: Name of the target dataset type.
Either 'train', 'val', or 'test'
download_if_not_exist (bool): If `True` download dataset
if it is not downloaded yet.
Returns (str): file path for tox21 dataset
"""
cache_filepath = _get_tox21_filepath(dataset_type)
if not os.path.exists(cache_filepath):
if download_if_not_exist:
is_successful = _download_and_extract_tox21(dataset_type,
cache_filepath)
if not is_successful:
logger = getLogger(__name__)
logger.warning('Download failed.')
return cache_filepath
def _download_and_extract_tox21(config_name, save_filepath):
is_successful = False
c = _config[config_name]
url = c['url']
sdffile = c['filename']
# Download tox21 dataset
download_file_path = download.cached_download(url)
# Extract zipfile to get sdffile
with zipfile.ZipFile(download_file_path, 'r') as z:
z.extract(sdffile)
shutil.move(sdffile, save_filepath)
is_successful = True
return is_successful
def download_and_extract_tox21():
"""Downloads and extracts Tox21 dataset.
Returns: None
"""
for config in ['train', 'val', 'test']:
_download_and_extract_tox21(config, _get_tox21_filepath(config))
================================================
FILE: chainer_chemistry/datasets/zinc.py
================================================
from logging import getLogger
import os
from chainer.dataset import download
import numpy
import pandas
from chainer_chemistry.dataset.parsers.csv_file_parser import CSVFileParser
from chainer_chemistry.dataset.preprocessors.atomic_number_preprocessor import AtomicNumberPreprocessor # NOQA
download_url = 'https://raw.githubusercontent.com/aspuru-guzik-group/chemical_vae/master/models/zinc_properties/250k_rndm_zinc_drugs_clean_3.csv' # NOQA
file_name_250k = 'zinc250k.csv'
_root = 'pfnet/chainer/zinc'
_label_names = ['logP', 'qed', 'SAS']
_smiles_column_names = ['smiles']
def get_zinc250k_label_names():
"""Returns label names of ZINC250k datasets."""
return _label_names
def get_zinc250k(preprocessor=None, labels=None, return_smiles=False,
target_index=None):
"""Downloads, caches and preprocesses Zinc 250K dataset.
Args:
preprocessor (BasePreprocessor): Preprocessor.
This should be chosen based on the network to be trained.
If it is None, default `AtomicNumberPreprocessor` is used.
labels (str or list): List of target labels.
return_smiles (bool): If set to ``True``,
smiles array is also returned.
target_index (list or None): target index list to partially extract
dataset. If None (default), all examples are parsed.
Returns:
dataset, which is composed of `features`, which depends on
`preprocess_method`.
"""
labels = labels or get_zinc250k_label_names()
if isinstance(labels, str):
labels = [labels, ]
def postprocess_label(label_list):
# This is regression task, cast to float value.
return numpy.asarray(label_list, dtype=numpy.float32)
if preprocessor is None:
preprocessor = AtomicNumberPreprocessor()
parser = CSVFileParser(preprocessor, postprocess_label=postprocess_label,
labels=labels, smiles_col='smiles')
result = parser.parse(get_zinc250k_filepath(), return_smiles=return_smiles,
target_index=target_index)
if return_smiles:
return result['dataset'], result['smiles']
else:
return result['dataset']
def get_zinc250k_filepath(download_if_not_exist=True):
"""Construct a filepath which stores ZINC250k dataset for config_name
This method check whether the file exist or not, and downloaded it if
necessary.
Args:
download_if_not_exist (bool): If `True` download dataset
if it is not downloaded yet.
Returns (str): file path for ZINC250k dataset (csv format)
"""
cache_path = _get_zinc250k_filepath()
if not os.path.exists(cache_path):
if download_if_not_exist:
is_successful = download_and_extract_zinc250k(
save_filepath=cache_path)
if not is_successful:
logger = getLogger(__name__)
logger.warning('Download failed.')
return cache_path
def _get_zinc250k_filepath():
"""Construct a filepath which stores ZINC250k dataset in csv
This method does not check if the file is already downloaded or not.
Returns (str): filepath for ZINC250k dataset
"""
cache_root = download.get_dataset_directory(_root)
cache_path = os.path.join(cache_root, file_name_250k)
return cache_path
def _remove_new_line(s):
return s.replace('\n', '')
def download_and_extract_zinc250k(save_filepath):
logger = getLogger(__name__)
logger.info('Extracting ZINC250k dataset...')
download_file_path = download.cached_download(download_url)
df = pandas.read_csv(download_file_path)
# 'smiles' column contains '\n', need to remove it.
df['smiles'] = df['smiles'].apply(_remove_new_line)
df.to_csv(save_filepath, columns=_smiles_column_names + _label_names)
return True
================================================
FILE: chainer_chemistry/functions/__init__.py
================================================
from chainer_chemistry.functions.activation.megnet_softplus import megnet_softplus # NOQA
from chainer_chemistry.functions.activation.shifted_softplus import shifted_softplus # NOQA
from chainer_chemistry.functions.activation.softmax import softmax # NOQA
from chainer_chemistry.functions.evaluation.r2_score import r2_score # NOQA
from chainer_chemistry.functions.evaluation.r2_score import R2Score # NOQA
from chainer_chemistry.functions.loss.mean_absolute_error import mean_absolute_error # NOQA
from chainer_chemistry.functions.loss.mean_absolute_error import MeanAbsoluteError # NOQA
from chainer_chemistry.functions.loss.mean_squared_error import mean_squared_error # NOQA
from chainer_chemistry.functions.loss.mean_squared_error import MeanSquaredError # NOQA
from chainer_chemistry.functions.math.matmul import matmul # NOQA
================================================
FILE: chainer_chemistry/functions/activation/__init__.py
================================================
================================================
FILE: chainer_chemistry/functions/activation/megnet_softplus.py
================================================
from chainer import functions
def megnet_softplus(x):
"""Modified softplus function used by MEGNet
The original implemantation is below.
https://github.com/materialsvirtuallab/megnet/blob/f91773f0f3fa8402b494638af9ef2ed2807fcba7/megnet/activations.py#L6
Args:
x (Variable): Input variable
Returns:
output (Variable): Output variable whose shape is same with `x`
"""
return functions.relu(x) + \
functions.log(0.5 * functions.exp(-functions.absolute(x)) + 0.5)
================================================
FILE: chainer_chemistry/functions/activation/shifted_softplus.py
================================================
import chainer
from chainer import functions
def shifted_softplus(x, beta=1, shift=0.5, threshold=20):
"""shifted softplus function, which holds f(0)=0.
Args:
x (Variable): Input variable
beta (float): Parameter :math:`\\beta`.
shift (float): Shift Parameter
threshold (float): threshold to avoid overflow
Returns:
output (Variable): Output variable whose shape is same with `x`
"""
xp = chainer.cuda.get_array_module(x)
cond = chainer.as_variable(x).array > threshold
x = functions.where(cond, x,
functions.softplus(x, beta=beta))
x += xp.log(shift)
return x
================================================
FILE: chainer_chemistry/functions/activation/softmax.py
================================================
from chainer import functions
def softmax(x, axis=1, mask=None, mask_value=1e10):
"""softmax function, which supports `mask`.
Args:
x (Variable): Input variable
axis (int): The axis along which the softmax is to be computed.
mask (Variable or None):
Default value is `None` which does not use mask,
this case the result is same with original `softmax` computation.
When `mask` is not `None`, it is assumed to have value 1 or 0.
1 indicates actual feature, and 0 indicates virtual feature to be
masked.
mask_value (int): The value used for masking.
Returns:
output (Variable): Output variable whose shape is same with `x`
"""
if mask is None:
h = x
else:
if x.shape != mask.shape:
raise ValueError("x.shape={} and mask.shape={} must be same!"
.format(x.shape, mask.shape))
h = x + (mask - 1.) * mask_value
return functions.softmax(h, axis=axis)
================================================
FILE: chainer_chemistry/functions/evaluation/__init__.py
================================================
================================================
FILE: chainer_chemistry/functions/evaluation/r2_score.py
================================================
from chainer.backends import cuda
from chainer import function
from chainer.utils import type_check
class R2Score(function.Function):
def __init__(self, sample_weight, multioutput, ignore_nan=False):
if sample_weight is not None:
raise NotImplementedError()
if multioutput in ['uniform_average', 'raw_values']:
self.multioutput = multioutput
else:
raise ValueError("invalid multioutput argument")
self.ignore_nan = ignore_nan
def check_type_forward(self, in_types):
type_check.expect(in_types.size() == 2)
pred_type, true_type = in_types
type_check.expect(
pred_type.dtype.kind == 'f',
true_type.dtype.kind == 'f'
)
type_check.expect(
pred_type.shape == true_type.shape,
)
def forward(self, inputs):
xp = cuda.get_array_module(*inputs)
pred, true = inputs
diff = pred - true
dev = true - xp.mean(true, axis=0)
if self.ignore_nan:
diff[xp.isnan(diff)] = 0.
dev[xp.isnan(dev)] = 0.
SS_res = xp.asarray(
xp.sum(diff ** 2, axis=0))
SS_tot = xp.asarray(
xp.sum(dev ** 2, axis=0))
SS_tot_iszero = SS_tot == 0
SS_tot[SS_tot_iszero] = 1 # Assign dummy value to avoid zero-division
ret = xp.where(
SS_tot_iszero, 0.0, 1 - SS_res / SS_tot).astype(pred.dtype)
if self.multioutput == 'uniform_average':
return xp.asarray(ret.mean()),
elif self.multioutput == 'raw_values':
return ret,
def r2_score(pred, true, sample_weight=None, multioutput='uniform_average',
ignore_nan=False):
"""Computes R^2(coefficient of determination) regression score function.
Args:
pred(Variable): Variable holding a vector, matrix or tensor of
estimated target values.
true(Variable): Variable holding a vector, matrix or tensor of
correct target values.
sample_weight: This argument is for compatibility with scikit-learn's
implementation of r2_score. Current implementation admits None
only.
multioutput(string): ['uniform_average', 'raw_values']. if
'uniform_average', this function returns an average of R^2
score of multiple output. If 'raw_average', this function
return a set of R^2 score of multiple output.
Returns:
Variable: A Variable holding a scalar array of the R^2 score if
'multioutput' is 'uniform_average' or a vector of R^2 scores if
'multioutput' is 'raw_values'.
.. note:: This function is non-differentiable.
"""
return R2Score(sample_weight=sample_weight,
multioutput=multioutput, ignore_nan=ignore_nan)(pred, true)
================================================
FILE: chainer_chemistry/functions/loss/__init__.py
================================================
================================================
FILE: chainer_chemistry/functions/loss/mean_absolute_error.py
================================================
import numpy
import chainer
from chainer.backends import cuda
from chainer import function_node
from chainer.utils import type_check
class MeanAbsoluteError(function_node.FunctionNode):
"""Mean absolute error function."""
def __init__(self, ignore_nan=False):
# TODO(mottodora): implement task weight calculation
self.ignore_nan = ignore_nan
def check_type_forward(self, in_types):
type_check.expect(in_types.size() == 2)
type_check.expect(
in_types[0].dtype == numpy.float32,
in_types[1].dtype == numpy.float32,
in_types[0].shape == in_types[1].shape
)
def forward_cpu(self, inputs):
self.retain_inputs((0, 1))
x0, x1 = inputs
diff = (inputs[0] - inputs[1]).ravel()
# TODO(mottodora): add reduce option
if self.ignore_nan:
diff[numpy.isnan(diff)] = 0.
return numpy.array(abs(diff).sum() / diff.size, dtype=diff.dtype),
def forward_gpu(self, inputs):
self.retain_inputs((0, 1))
cupy = cuda.cupy
diff = (inputs[0] - inputs[1]).ravel()
if self.ignore_nan:
diff[cupy.isnan(diff)] = 0.
return abs(diff).sum() / diff.dtype.type(diff.size),
def backward(self, indexes, gy):
x0, x1 = self.get_retained_inputs()
xp = cuda.get_array_module(x0)
diff = x0 - x1
if self.ignore_nan:
diff = chainer.functions.where(xp.isnan(diff.array),
xp.zeros_like(diff.array), diff)
gy0 = chainer.functions.broadcast_to(gy[0], diff.shape)
gx0 = gy0 * chainer.functions.sign(diff) * 1. / diff.size
return gx0, -gx0
def mean_absolute_error(x0, x1, ignore_nan=False):
"""Mean absolute error function.
This function computes mean absolute error between two variables. The mean
is taken over the minibatch.
Args:
x0 (:class:`~chainer.Variable` or :class:`numpy.ndarray` or \
:class:`cupy.ndarray`): Input variable.
x1 (:class:`~chainer.Variable` or :class:`numpy.ndarray` or \
:class:`cupy.ndarray`): Input variable.
ignore_nan (bool): If `True`, this function compute mean absolute error
ignoring NaNs. The arithmetic mean is the sum of the non-NaN
elements along the axis divided by the number of whole elements.
Returns:
~chainer.Variable:
A variable holding an array representing the mean absolute
error of two inputs.
"""
return MeanAbsoluteError(ignore_nan).apply((x0, x1))[0]
================================================
FILE: chainer_chemistry/functions/loss/mean_squared_error.py
================================================
import numpy
from chainer import cuda
from chainer import function_node
import chainer.functions
from chainer.utils import type_check
class MeanSquaredError(function_node.FunctionNode):
"""Mean squared error (a.k.a. Euclidean loss) function."""
def __init__(self, ignore_nan=False):
# TODO(mottodora): implement task weight calculation
self.ignore_nan = ignore_nan
def check_type_forward(self, in_types):
type_check.expect(in_types.size() == 2)
type_check.expect(
in_types[0].dtype == numpy.float32,
in_types[1].dtype == numpy.float32,
in_types[0].shape == in_types[1].shape
)
def forward_cpu(self, inputs):
self.retain_inputs((0, 1))
diff = (inputs[0] - inputs[1]).ravel()
# TODO(mottodora): add reduce option
if self.ignore_nan:
diff[numpy.isnan(diff)] = 0.
return numpy.array(diff.dot(diff) / diff.size, dtype=diff.dtype),
def forward_gpu(self, inputs):
cupy = cuda.cupy
self.retain_inputs((0, 1))
diff = (inputs[0] - inputs[1]).ravel()
# TODO(mottodora): add reduce option
if self.ignore_nan:
diff[cupy.isnan(diff)] = 0.
return diff.dot(diff) / diff.dtype.type(diff.size),
def backward(self, indexes, gy):
x0, x1 = self.get_retained_inputs()
xp = cuda.get_array_module(x0)
ret = []
diff = x0 - x1
if self.ignore_nan:
diff = chainer.functions.where(xp.isnan(diff.array),
xp.zeros_like(diff.array), diff)
gy0 = chainer.functions.broadcast_to(gy[0], diff.shape)
gx0 = gy0 * diff * (2. / diff.size)
if 0 in indexes:
ret.append(gx0)
if 1 in indexes:
ret.append(-gx0)
return ret
def mean_squared_error(x0, x1, ignore_nan=False):
"""Mean squared error function.
This function computes mean squared error between two variables. The mean
is taken over the minibatch. Note that the error is not scaled by 1/2.
Args:
x0 (:class:`~chainer.Variable` or :class:`numpy.ndarray` or \
:class:`cupy.ndarray`): Input variable.
x1 (:class:`~chainer.Variable` or :class:`numpy.ndarray` or \
:class:`cupy.ndarray`): Input variable.
ignore_nan (bool): If `True`, this function compute mean squared error
ignoring NaNs. The arithmetic mean is the sum of the non-NaN
elements along the axis divided by the number of whole elements.
Returns:
~chainer.Variable:
A variable holding an array representing the mean squared
error of two inputs.
"""
return MeanSquaredError(ignore_nan).apply((x0, x1))[0]
================================================
FILE: chainer_chemistry/functions/math/__init__.py
================================================
================================================
FILE: chainer_chemistry/functions/math/matmul.py
================================================
import chainer
if int(chainer.__version__[0]) >= 3:
_matmul_fn = chainer.functions.matmul
else:
_matmul_fn = chainer.functions.batch_matmul
def matmul(a, b, transa=False, transb=False):
"""Computes the matrix multiplication of two arrays.
Args:
a (Variable): The left operand of the matrix multiplication.
If ``a`` and ``b`` are both 1-D arrays, ``matmul`` returns a dot
product of vector `a` and vector `b`. If 2-D arrays, ``matmul``
returns matrix product of ``a`` and ``b``. If arrays' dimension is
larger than 2, they are treated as a stack of matrices residing in
the last two indexes. ``matmul`` returns a stack of each two
arrays. ``a`` and ``b`` must have the same dimension.
b (Variable): The right operand of the matrix multiplication.
Its array is treated as a matrix in the same way as ``a``'s array.
transa (bool): If ``True``, each matrices in ``a`` will be transposed.
If ``a.ndim == 1``, do nothing.
transb (bool): If ``True``, each matrices in ``b`` will be transposed.
If ``b.ndim == 1``, do nothing.
Returns:
~chainer.Variable: The result of the matrix multiplication.
.. admonition:: Example
>>> a = np.array([[1, 0], [0, 1]], 'f')
>>> b = np.array([[4, 1], [2, 2]], 'f')
>>> F.matmul(a, b).data
array([[ 4., 1.],
[ 2., 2.]], dtype=float32)
"""
return _matmul_fn(a, b, transa=transa, transb=transb)
================================================
FILE: chainer_chemistry/iterators/__init__.py
================================================
from chainer_chemistry.iterators.balanced_serial_iterator import BalancedSerialIterator # NOQA
from chainer_chemistry.iterators.index_iterator import IndexIterator # NOQA
================================================
FILE: chainer_chemistry/iterators/balanced_serial_iterator.py
================================================
from __future__ import division
from logging import getLogger
from chainer.dataset import iterator
import numpy
from chainer_chemistry.iterators.index_iterator import IndexIterator
class BalancedSerialIterator(iterator.Iterator):
"""Dataset iterator that serially reads the examples with balancing label.
Args:
dataset: Dataset to iterate.
batch_size (int): Number of examples within each minibatch.
labels (list or numpy.ndarray): 1d array which specifies label feature
of `dataset`. Its size must be same as the length of `dataset`.
repeat (bool): If ``True``, it infinitely loops over the dataset.
Otherwise, it stops iteration at the end of the first epoch.
shuffle (bool): If ``True``, the order of examples is shuffled at the
beginning of each epoch.
Otherwise, the order is permanently same as that of `dataset`.
batch_balancing (bool): If ``True``, examples are sampled in the way
that each label examples are roughly evenly sampled in each
minibatch. Otherwise, the iterator only guarantees that total
numbers of examples are same among label features.
ignore_labels (int or list or None): Labels to be ignored.
If not ``None``, the example whose label is in `ignore_labels`
are not sampled by this iterator.
"""
def __init__(self, dataset, batch_size, labels, repeat=True, shuffle=True,
batch_balancing=False, ignore_labels=None,
logger=getLogger(__name__)):
assert len(dataset) == len(labels)
labels = numpy.asarray(labels)
if len(dataset) != labels.size:
raise ValueError('dataset length {} and labels size {} must be '
'same!'.format(len(dataset), labels.size))
labels = numpy.ravel(labels)
self.dataset = dataset
self.batch_size = batch_size
self.labels = labels
self.logger = logger
if ignore_labels is None:
ignore_labels = []
elif isinstance(ignore_labels, int):
ignore_labels = [ignore_labels, ]
self.ignore_labels = list(ignore_labels)
self._repeat = repeat
self._shuffle = shuffle
self._batch_balancing = batch_balancing
self.labels_iterator_dict = {}
max_label_count = -1
include_label_count = 0
for label in numpy.unique(labels):
label_index = numpy.argwhere(labels == label).ravel()
label_count = len(label_index)
ii = IndexIterator(label_index, shuffle=shuffle)
self.labels_iterator_dict[label] = ii
if label in self.ignore_labels:
continue
if max_label_count < label_count:
max_label_count = label_count
include_label_count += 1
self.max_label_count = max_label_count
self.N_augmented = max_label_count * include_label_count
self.reset()
def __next__(self):
if not self._repeat and self.epoch > 0:
raise StopIteration
self._previous_epoch_detail = self.epoch_detail
i = self.current_position
i_end = i + self.batch_size
N = self.N_augmented
batch = [self.dataset[index] for index in self._order[i:i_end]]
if i_end >= N:
if self._repeat:
rest = i_end - N
self._update_order()
if rest > 0:
batch.extend([self.dataset[index]
for index in self._order[:rest]])
self.current_position = rest
else:
self.current_position = 0
self.epoch += 1
self.is_new_epoch = True
else:
self.is_new_epoch = False
self.current_position = i_end
return batch
next = __next__
@property
def epoch_detail(self):
return self.epoch + self.current_position / self.N_augmented
@property
def previous_epoch_detail(self):
# This iterator saves ``-1`` as _previous_epoch_detail instead of
# ``None`` because some serializers do not support ``None``.
if self._previous_epoch_detail < 0:
return None
return self._previous_epoch_detail
def serialize(self, serializer):
self.current_position = serializer('current_position',
self.current_position)
self.epoch = serializer('epoch', self.epoch)
self.is_new_epoch = serializer('is_new_epoch', self.is_new_epoch)
if self._order is not None:
serializer('order', self._order)
self._previous_epoch_detail = serializer(
'previous_epoch_detail', self._previous_epoch_detail)
for label, index_iterator in self.labels_iterator_dict.items():
self.labels_iterator_dict[label].serialize(
serializer['index_iterator_{}'.format(label)])
def _update_order(self):
indices_list = []
for label, index_iterator in self.labels_iterator_dict.items():
if label in self.ignore_labels:
# Not include index of ignore_labels
continue
indices_list.append(index_iterator.get_next_indices(
self.max_label_count))
if self._batch_balancing:
# `indices_list` contains same number of indices of each label.
# we can `transpose` and `ravel` it to get each label's index in
# sequence, which guarantees that label in each batch is balanced.
indices = numpy.array(indices_list).transpose().ravel()
self._order = indices
else:
indices = numpy.array(indices_list).ravel()
self._order = numpy.random.permutation(indices)
def reset(self):
self._update_order()
self.current_position = 0
self.epoch = 0
self.is_new_epoch = False
# use -1 instead of None internally.
self._previous_epoch_detail = -1.
def show_label_stats(self):
self.logger.warning(' label count rate status')
total = 0
for label, index_iterator in self.labels_iterator_dict.items():
count = len(index_iterator.index_list)
total += count
for label, index_iterator in self.labels_iterator_dict.items():
count = len(index_iterator.index_list)
rate = count / len(self.dataset)
status = 'ignored' if label in self.ignore_labels else 'included'
self.logger.warning('{:>8} {:>8} {:>8.4f} {:>10}'
.format(label, count, rate, status))
================================================
FILE: chainer_chemistry/iterators/index_iterator.py
================================================
import numpy
from chainer.dataset import iterator
class IndexIterator(iterator.Iterator):
"""Index iterator
IndexIterator is used internally in `BalancedSerialIterator`, as each
label's index iterator
Args:
index_list (list): list of int which represents indices.
shuffle (bool): shuffle flag. If True, indices specified by
``index_list`` will be randomly shuffled.
num (int): number of indices to be extracted when ``___next___`` is
called.
"""
def __init__(self, index_list, shuffle=True, num=0):
self.index_list = numpy.asarray(index_list)
assert self.index_list.ndim == 1
self.index_length = len(index_list)
self.current_index_list = None
self.current_pos = 0
self.shuffle = shuffle
self.num = num
self.update_current_index_list()
def update_current_index_list(self):
if self.shuffle:
self.current_index_list = numpy.random.permutation(self.index_list)
else:
self.current_index_list = self.index_list
def __next__(self):
return self.get_next_indices(self.num)
def get_next_indices(self, num):
"""get next indices
Args:
num (int): number for indices to extract.
Returns (numpy.ndarray): 1d array of indices
.. admonition:: Example
>>> ii = IndexIterator([1, 3, 5, 10], shuffle=True)
>>> print(ii.get_next_indices(5))
[ 5 1 10 3 10]
>>> print(ii.get_next_indices(5))
[ 3 1 5 10 1]
"""
indices = []
if self.current_pos + num < self.index_length:
indices.append(self.current_index_list[
self.current_pos: self.current_pos + num])
self.current_pos += num
else:
indices.append(self.current_index_list[self.current_pos:])
num -= (self.index_length - self.current_pos)
# When `num` is twice bigger than `self.index_length`, `index_list`
# is repeated `q` times to get desired length of `indices`.
q, r = divmod(num, self.index_length)
if self.shuffle:
for _ in range(q):
indices.append(numpy.random.permutation(self.index_list))
else:
indices.append(numpy.tile(self.index_list, q))
self.update_current_index_list()
indices.append(self.current_index_list[:r])
self.current_pos = r
return numpy.concatenate(indices).ravel()
def serialize(self, serializer):
self.current_index_list = serializer('current_index_list',
self.current_index_list)
self.current_pos = serializer('current_pos', self.current_pos)
================================================
FILE: chainer_chemistry/link_hooks/__init__.py
================================================
try:
from chainer_chemistry.link_hooks import variable_monitor_link_hook # NOQA
from chainer_chemistry.link_hooks.variable_monitor_link_hook import VariableMonitorLinkHook # NOQA
is_link_hooks_available = True
except ImportError:
import warnings
warnings.warn('link_hooks failed to import, you need to upgrade chainer '
'version to use link_hooks feature')
is_link_hooks_available = False
================================================
FILE: chainer_chemistry/link_hooks/variable_monitor_link_hook.py
================================================
from collections import OrderedDict
from logging import getLogger
import chainer
from chainer.link_hook import _ForwardPostprocessCallbackArgs, _ForwardPreprocessCallbackArgs # NOQA
def _default_extract_pre(hook, args):
"""Default extract_fn when `timing='pre`
Args:
hook (VariableMonitorLinkHook):
args (_ForwardPreprocessCallbackArgs):
Returns (chainer.Variable): First input variable to the link.
"""
return args.args[0]
def _default_extract_post(hook, args):
"""Default extract_fn when `timing='post`
Args:
hook (VariableMonitorLinkHook):
args (_ForwardPostprocessCallbackArgs):
Returns (chainer.Variable): Output variable to the link.
"""
return args.out
class VariableMonitorLinkHook(chainer.LinkHook):
"""Monitor Variable of specific link input/output
Args:
target_link (chainer.Link): target link to monitor variable.
name (str): name of this link hook
timing (str): timing of this link hook to monitor. 'pre' or 'post'.
If 'pre', the input of `target_link` is monitored.
If 'post', the output of `target_link` is monitored.
extract_fn (callable): Specify custom method to extract target variable
Default behavior is to extract first input when `timing='pre'`,
or extract output when `timing='post'`.
It takes `hook, args` as argument.
logger:
.. admonition:: Example
>>> import numpy
>>> from chainer import cuda, links, functions # NOQA
>>> from chainer_chemistry.link_hooks.variable_monitor_link_hook import VariableMonitorLinkHook # NOQA
>>> class DummyModel(chainer.Chain):
>>> def __init__(self):
>>> super(DummyModel, self).__init__()
>>> with self.init_scope():
>>> self.l1 = links.Linear(None, 1)
>>> self.h = None
>>>
>>> def forward(self, x):
>>> h = self.l1(x)
>>> out = functions.sigmoid(h)
>>> return out
>>> model = DummyModel()
>>> hook = VariableMonitorLinkHook(model.l1, timing='post')
>>> x = numpy.array([1, 2, 3])
>>> # Example 1. `get_variable` of `target_link`.
>>> with hook:
>>> out = model(x)
>>> # You can extract `h`, which is output of `model.l1` as follows.
>>> var_h = hook.get_variable()
>>> # Example 2. `add_process` to override value of target variable.
>>> def _process_zeros(hook, args, target_var):
>>> xp = cuda.get_array_module(target_var.array)
>>> target_var.array = xp.zeros(target_var.array.shape)
>>> hook.add_process('_process_zeros', _process_zeros)
>>> with hook:
>>> # During the forward, `h` is overriden to value 0.
>>> out = model(x)
>>> # Remove _process_zeros method
>>> hook.delete_process('_process_zeros')
"""
def __init__(self, target_link, name='VariableMonitorLinkHook',
timing='post', extract_fn=None, logger=None):
if not isinstance(target_link, chainer.Link):
raise TypeError('target_link must be instance of chainer.Link!'
'actual {}'.format(type(target_link)))
if timing not in ['pre', 'post']:
raise ValueError(
"Unexpected value timing={}, "
"must be either pre or post"
.format(timing))
super(VariableMonitorLinkHook, self).__init__()
self.target_link = target_link
# This LinkHook maybe instantiated multiple times.
# So it is allowed to change name by argument.
self.name = name
self.logger = logger or getLogger(__name__)
if extract_fn is None:
if timing == 'pre':
extract_fn = _default_extract_pre
elif timing == 'post':
extract_fn = _default_extract_post
else:
raise ValueError("Unexpected value timing={}"
.format(timing))
self.extract_fn = extract_fn
self.process_fns = OrderedDict() # Additional process, if necessary
self.timing = timing
self.result = None
def add_process(self, key, fn):
"""Add additional process for target variable
Args:
key (str): id for this process, you may remove added process by
`delete_process` with this key.
fn (callable): function which takes `hook, args, target_var` as
arguments.
"""
if not isinstance(key, str):
raise TypeError('key must be str, actual {}'.format(type(key)))
if not callable(fn):
raise TypeError('fn must be callable')
self.process_fns[key] = fn
def delete_process(self, key):
"""Delete process added at `add_process`
Args:
key (str): id for the process, named at `add_process`.
"""
if not isinstance(key, str):
raise TypeError('key must be str, actual {}'.format(type(key)))
if key in self.process_fns.keys():
del self.process_fns[key]
else:
# Nothing to delete
self.logger.warning('{} is not in process_fns, skip delete_process'
.format(key))
def get_variable(self):
"""Get target variable, which is input or output of `target_link`.
Returns (chainer.Variable): target variable
"""
return self.result
def forward_preprocess(self, args):
if self.timing == 'pre' and args.link is self.target_link:
self.result = self.extract_fn(self, args)
if self.process_fns is not None:
for key, fn in self.process_fns.items():
fn(self, args, self.result)
def forward_postprocess(self, args):
if self.timing == 'post' and args.link is self.target_link:
self.result = self.extract_fn(self, args)
if self.process_fns is not None:
for key, fn in self.process_fns.items():
fn(self, args, self.result)
================================================
FILE: chainer_chemistry/links/__init__.py
================================================
from chainer_chemistry.links.connection.embed_atom_id import EmbedAtomID # NOQA
from chainer_chemistry.links.connection.graph_linear import GraphLinear # NOQA
from chainer_chemistry.links.connection.graph_mlp import GraphMLP # NOQA
from chainer_chemistry.links.normalization.graph_batch_normalization import GraphBatchNormalization # NOQA
from chainer_chemistry.links.readout.general_readout import GeneralReadout # NOQA
from chainer_chemistry.links.readout.ggnn_readout import GGNNReadout # NOQA
from chainer_chemistry.links.readout.mpnn_readout import MPNNReadout # NOQA
from chainer_chemistry.links.readout.nfp_readout import NFPReadout # NOQA
from chainer_chemistry.links.readout.schnet_readout import SchNetReadout # NOQA
from chainer_chemistry.links.readout.set2set import Set2Set # NOQA
from chainer_chemistry.links.scaler.flow_scaler import FlowScaler # NOQA
from chainer_chemistry.links.scaler.standard_scaler import StandardScaler # NOQA
from chainer_chemistry.links.update.ggnn_update import GGNNUpdate # NOQA
from chainer_chemistry.links.update.gin_update import GINUpdate # NOQA
from chainer_chemistry.links.update.mpnn_update import EdgeNet # NOQA
from chainer_chemistry.links.update.mpnn_update import MPNNUpdate # NOQA
from chainer_chemistry.links.update.nfp_update import NFPUpdate # NOQA
from chainer_chemistry.links.update.relgat_update import RelGATUpdate # NOQA
from chainer_chemistry.links.update.relgcn_update import RelGCNUpdate # NOQA
from chainer_chemistry.links.update.rsgcn_update import RSGCNUpdate # NOQA
from chainer_chemistry.links.update.schnet_update import SchNetUpdate # NOQA
================================================
FILE: chainer_chemistry/links/array/__init__.py
================================================
================================================
FILE: chainer_chemistry/links/array/shape_transformer_to_2d.py
================================================
import chainer
from chainer import functions
class ShapeTransformerTo2D(chainer.Link):
"""Transforms input array `x` to 2-dim and reverts.
It converts array to be 2-dim, where 1th axis is `axis` and the rest is
gathered to 0th axis.
Note that this class does not have any parameters
but behaves as "function wrapper" which has internal attribute to
`transform` and `inverse_transform`.
Args:
axis (int): feature axis, which will be 1st axis.
"""
def __init__(self, axis=1):
super(ShapeTransformerTo2D, self).__init__()
self.original_shape = None
self.transpose_order = None
self.axis = axis
def transform(self, x):
self.original_shape = x.shape
axis = self.axis
if axis < 0:
axis += x.ndim
transpose_order = [i for i in range(x.ndim)]
transpose_order.pop(axis)
transpose_order = transpose_order + [axis]
x = functions.transpose(x, tuple(transpose_order))
x = functions.reshape(x, (-1, self.original_shape[axis]))
self.transpose_order = transpose_order
return x
def inverse_transform(self, x):
if x.ndim != 2:
raise ValueError(
"[ERROR] Unexpected value x.shape={}, 2-dim array is expected"
.format(x.shape))
if self.original_shape is None:
raise AttributeError(
'[Error] original_shape is None, call transform beforehand!')
ndim = len(self.original_shape)
axis = self.axis
if axis < 0:
axis += ndim
inverse_transpose_order = [i for i in range(ndim - 1)]
inverse_transpose_order.insert(axis, ndim-1)
x = functions.reshape(x, tuple([self.original_shape[i]
for i in self.transpose_order]))
x = functions.transpose(x, tuple(inverse_transpose_order))
return x
================================================
FILE: chainer_chemistry/links/connection/__init__.py
================================================
================================================
FILE: chainer_chemistry/links/connection/embed_atom_id.py
================================================
import chainer
from chainer_chemistry.config import MAX_ATOMIC_NUM
class EmbedAtomID(chainer.links.EmbedID):
"""Embeddning specialized to atoms.
This is a chain in the sense of Chainer that converts
an atom, represented by a sequence of molecule IDs,
to a sequence of embedding vectors of molecules.
The operation is done in a minibatch manner, as most chains do.
The forward propagation of link consists of ID embedding,
which converts the input `x` into vector embedding `h` where
its shape represents (minibatch, atom, channel)
.. seealso:: :class:`chainer.links.EmbedID`
"""
def __init__(self, out_size, in_size=MAX_ATOMIC_NUM, initialW=None,
ignore_label=None):
super(EmbedAtomID, self).__init__(
in_size=in_size, out_size=out_size, initialW=initialW,
ignore_label=ignore_label)
def __call__(self, x):
"""Forward propagaion.
Args:
x (:class:`chainer.Variable`, or :class:`numpy.ndarray` \
or :class:`cupy.ndarray`):
Input array that should be an integer array
whose ``ndim`` is 2. This method treats the array
as a minibatch of atoms, each of which consists
of a sequence of molecules represented by integer IDs.
The first axis should be an index of atoms
(i.e. minibatch dimension) and the second one be an
index of molecules.
Returns:
:class:`chainer.Variable`:
A 3-dimensional array consisting of embedded vectors of atoms,
representing (minibatch, atom, channel).
"""
h = super(EmbedAtomID, self).__call__(x)
return h
================================================
FILE: chainer_chemistry/links/connection/graph_linear.py
================================================
import chainer
class GraphLinear(chainer.links.Linear):
"""Graph Linear layer.
This function assumes its input is 3-dimensional.
Differently from :class:`chainer.functions.linear`, it applies an affine
transformation to the third axis of input `x`.
.. seealso:: :class:`chainer.links.Linear`
"""
def __call__(self, x):
"""Forward propagation.
Args:
x (:class:`chainer.Variable`, or :class:`numpy.ndarray`\
or :class:`cupy.ndarray`):
Input array that should be a float array whose ``ndim`` is 3.
It represents a minibatch of atoms, each of which consists
of a sequence of molecules. Each molecule is represented
by integer IDs. The first axis is an index of atoms
(i.e. minibatch dimension) and the second one an index
of molecules.
Returns:
:class:`chainer.Variable`:
A 3-dimeisional array.
"""
h = x
# (minibatch, atom, ch)
s0, s1, s2 = h.shape
h = chainer.functions.reshape(h, (s0 * s1, s2))
h = super(GraphLinear, self).__call__(h)
h = chainer.functions.reshape(h, (s0, s1, self.out_size))
return h
================================================
FILE: chainer_chemistry/links/connection/graph_mlp.py
================================================
import numpy
import chainer
from chainer.functions import relu
from chainer_chemistry.links.connection.graph_linear import GraphLinear
class GraphMLP(chainer.Chain):
"""Graph MLP layer
Args:
channels (list or numpy.ndarray): list of int, representing each
layer's hidden dim. e.g., if [32, 16], it will construct 2-layer
MLP with hidden dim 32 and output dim 16.
in_channels (int or None): input channel size.
activation (chainer.functions): activation function
"""
def __init__(self, channels, in_channels=None, activation=relu):
super(GraphMLP, self).__init__()
if not isinstance(channels, (list, numpy.ndarray)):
raise TypeError('channels {} is expected to be list, actual {}'
.format(channels, type(channels)))
channels_list = [in_channels] + list(channels)
layers = [GraphLinear(channels_list[i], channels_list[i+1])
for i in range(len(channels_list) - 1)]
with self.init_scope():
self.layers = chainer.ChainList(*layers)
self.activation = activation
def __call__(self, x):
h = x
for l in self.layers[:-1]:
h = self.activation(l(h))
h = self.layers[-1](h)
return h
================================================
FILE: chainer_chemistry/links/normalization/__init__.py
================================================
================================================
FILE: chainer_chemistry/links/normalization/graph_batch_normalization.py
================================================
import chainer
class GraphBatchNormalization(chainer.links.BatchNormalization):
"""Graph Batch Normalization layer.
.. seealso:: :class:`chainer.links.BatchNormalization`
"""
def __call__(self, x):
"""Forward propagation.
Args:
x (:class:`chainer.Variable`, or :class:`numpy.ndarray`\
or :class:`cupy.ndarray`):
Input array that should be a float array whose ``ndim`` is 3.
It represents a minibatch of atoms, each of which consists
of a sequence of molecules. Each molecule is represented
by integer IDs. The first axis is an index of atoms
(i.e. minibatch dimension) and the second one an index
of molecules.
Returns:
:class:`chainer.Variable`:
A 3-dimeisional array.
"""
h = x
# (minibatch, atom, ch)
# The implemenataion of batch normalization for graph convolution below
# is rather naive. To be precise, it is necessary to consider the
# difference in the number of atoms for each graph. However, the
# implementation below does not take it into account, and assumes
# that all graphs have the same number of atoms, hence extra numbers
# of zero are included when average is computed. In other word, the
# results of batch normalization below is biased.
s0, s1, s2 = h.shape
h = chainer.functions.reshape(h, (s0 * s1, s2))
h = super(GraphBatchNormalization, self).__call__(h)
h = chainer.functions.reshape(h, (s0, s1, s2))
return h
================================================
FILE: chainer_chemistry/links/readout/__init__.py
================================================
================================================
FILE: chainer_chemistry/links/readout/cgcnn_readout.py
================================================
import chainer
from chainer import functions, links # NOQA
class CGCNNReadout(chainer.Chain):
"""CGCNN submodule for readout part.
Args:
out_dim (int): dimension of output feature vector
"""
def __init__(self, out_dim=128):
super(CGCNNReadout, self).__init__()
with self.init_scope():
self.linear = links.Linear(None, out_dim)
def __call__(self, atom_feat, atom_idx):
average_pool = [functions.mean(atom_feat[idx], axis=0, keepdims=True)
for idx in atom_idx]
h = functions.concat(average_pool, axis=0)
h = self.linear(h)
h = functions.softplus(h)
return h
================================================
FILE: chainer_chemistry/links/readout/general_readout.py
================================================
import chainer
from chainer import functions
class GeneralReadout(chainer.Link):
"""General submodule for readout part.
This class can be used for `rsgcn` and `weavenet`.
Note that this class has no learnable parameter,
even though this is subclass of `chainer.Link`.
This class is under `links` module for consistency
with other readout module.
Args:
mode (str):
activation (callable): activation function
"""
def __init__(self, mode='sum', activation=None, **kwargs):
super(GeneralReadout, self).__init__()
self.mode = mode
self.activation = activation
def __call__(self, h, axis=1, **kwargs):
if self.activation is not None:
h = self.activation(h)
else:
h = h
if self.mode == 'sum':
y = functions.sum(h, axis=axis)
elif self.mode == 'max':
y = functions.max(h, axis=axis)
elif self.mode == 'summax':
h_sum = functions.sum(h, axis=axis)
h_max = functions.max(h, axis=axis)
y = functions.concat((h_sum, h_max), axis=axis)
else:
raise ValueError('mode {} is not supported'.format(self.mode))
return y
class ScatterGeneralReadout(chainer.Link):
"""General submodule for readout part by scatter operation.
This class is used in sparse pattern.
Args:
mode (str):
activation (callable): activation function
"""
def __init__(self, mode='sum', activation=None, **kwargs):
super(ScatterGeneralReadout, self).__init__()
self.mode = mode
self.activation = activation
def __call__(self, h, batch, **kwargs):
if self.activation is not None:
h = self.activation(h)
else:
h = h
if self.mode == 'sum':
y = self.xp.zeros((batch[-1] + 1, h.shape[1]),
dtype=self.xp.float32)
y = functions.scatter_add(y, batch, h)
else:
raise ValueError('mode {} is not supported'.format(self.mode))
return y
================================================
FILE: chainer_chemistry/links/readout/ggnn_readout.py
================================================
import chainer
from chainer import functions
from chainer_chemistry.links.connection.graph_linear import GraphLinear
class GGNNReadout(chainer.Chain):
"""GGNN submodule for readout part.
Args:
out_dim (int): dimension of output feature vector
in_channels (int or None): dimension of feature vector associated to
each node. `in_channels` is the total dimension of `h` and `h0`.
nobias (bool): If ``True``, then this function does not use
the bias
activation (~chainer.Function or ~chainer.FunctionNode):
activate function for node representation
`functions.tanh` was suggested in original paper.
activation_agg (~chainer.Function or ~chainer.FunctionNode):
activate function for aggregation
`functions.tanh` was suggested in original paper.
"""
def __init__(self, out_dim, in_channels=None, nobias=False,
activation=functions.identity,
activation_agg=functions.identity):
super(GGNNReadout, self).__init__()
with self.init_scope():
self.i_layer = GraphLinear(in_channels, out_dim, nobias=nobias)
self.j_layer = GraphLinear(in_channels, out_dim, nobias=nobias)
self.out_dim = out_dim
self.in_channels = in_channels
self.nobias = nobias
self.activation = activation
self.activation_agg = activation_agg
def __call__(self, h, h0=None, is_real_node=None):
# --- Readout part ---
# h, h0: (minibatch, node, ch)
# is_real_node: (minibatch, node)
h1 = functions.concat((h, h0), axis=2) if h0 is not None else h
g1 = functions.sigmoid(self.i_layer(h1))
g2 = self.activation(self.j_layer(h1))
g = g1 * g2
if is_real_node is not None:
# mask virtual node feature to be 0
mask = self.xp.broadcast_to(
is_real_node[:, :, None], g.shape)
g = g * mask
# sum along node axis
g = self.activation_agg(functions.sum(g, axis=1))
return g
================================================
FILE: chainer_chemistry/links/readout/megnet_readout.py
================================================
import chainer
from chainer import functions, links # NOQA
from chainer_chemistry.functions import megnet_softplus
from chainer_chemistry.links.readout.set2set import Set2Set
class MEGNetReadout(chainer.Chain):
"""MEGNet submodule for readout part.
Args:
out_dim (int): dimension of output feature vector
in_channels (int): dimension of feature vector associated to
each node. Must not be `None`.
n_layers (int): number of LSTM layers for set2set
processing_steps (int): number of processing for set2set
dropout_ratio (float): ratio of dropout
activation (~chainer.Function or ~chainer.FunctionNode):
activate function for megnet model
`megnet_softplus` was used in original paper.
"""
def __init__(self, out_dim=32, in_channels=32, n_layers=1,
processing_steps=3, dropout_ratio=-1,
activation=megnet_softplus):
super(MEGNetReadout, self).__init__()
if processing_steps <= 0:
raise ValueError("[ERROR] Unexpected value processing_steps={}"
.format(processing_steps))
self.processing_steps = processing_steps
self.dropout_ratio = dropout_ratio
self.activation = activation
with self.init_scope():
self.set2set_for_atom = Set2Set(
in_channels=in_channels, n_layers=n_layers)
self.set2set_for_pair = Set2Set(
in_channels=in_channels, n_layers=n_layers)
self.linear = links.Linear(None, out_dim)
def __call__(self, atoms_feat, pair_feat, global_feat):
a_f = atoms_feat
p_f = pair_feat
g_f = global_feat
# readout for atom and pair feature
self.set2set_for_atom.reset_state()
self.set2set_for_pair.reset_state()
for i in range(self.processing_steps):
a_f_r = self.set2set_for_atom(a_f)
p_f_r = self.set2set_for_pair(p_f)
# concating all features
h = functions.concat((a_f_r, p_f_r, g_f), axis=1)
if self.dropout_ratio > 0.0:
h = functions.dropout(h, ratio=self.dropout_ratio)
out = self.activation(self.linear(h))
return out
================================================
FILE: chainer_chemistry/links/readout/mpnn_readout.py
================================================
import chainer
from chainer import functions
from chainer import links
from chainer_chemistry.links.readout.set2set import Set2Set
class MPNNReadout(chainer.Chain):
"""MPNN submodule for readout part.
Args:
out_dim (int): dimension of output feature vector
in_channels (int): dimension of feature vector associated to
each node. Must not be `None`.
n_layers (int): number of LSTM layers for set2set
processing_steps (int): number of processing for set2set
"""
def __init__(self, out_dim, in_channels, n_layers=1, processing_steps=3):
# type: (int, int, int, int) -> None
super(MPNNReadout, self).__init__()
if processing_steps <= 0:
raise ValueError("[ERROR] Unexpected value processing_steps={}"
.format(processing_steps))
with self.init_scope():
self.set2set = Set2Set(in_channels=in_channels, n_layers=n_layers)
self.linear1 = links.Linear(in_channels * 2, in_channels)
self.linear2 = links.Linear(in_channels, out_dim)
self.out_dim = out_dim
self.in_channels = in_channels
self.n_layers = n_layers
self.processing_steps = processing_steps
def __call__(self, h, **kwargs):
# type: (chainer.Variable) -> chainer.Variable
# h: (mb, node, ch)
self.set2set.reset_state()
for i in range(self.processing_steps):
g = self.set2set(h) # g: (mb, ch * 2)
g = functions.relu(self.linear1(g)) # g: (mb, ch)
g = self.linear2(g) # g: (mb, out_dim)
return g
================================================
FILE: chainer_chemistry/links/readout/nfp_readout.py
================================================
import chainer
from chainer import functions
from chainer_chemistry.links.connection.graph_linear import GraphLinear
class NFPReadout(chainer.Chain):
"""NFP submodule for readout part.
Args:
out_dim (int): output dimension of feature vector associated
to each graph
in_channels (int or None): dimension of feature vector associated to
each node
"""
def __init__(self, out_dim, in_channels):
super(NFPReadout, self).__init__()
with self.init_scope():
self.output_weight = GraphLinear(in_channels, out_dim)
self.in_channels = in_channels
self.out_dim = out_dim
def __call__(self, h, is_real_node=None, **kwargs):
# h: (minibatch, node, ch)
# is_real_node: (minibatch, node)
# ---Readout part ---
i = self.output_weight(h)
i = functions.softmax(i, axis=2) # softmax along channel axis
if is_real_node is not None:
# mask virtual node feature to be 0
mask = self.xp.broadcast_to(
is_real_node[:, :, None], i.shape)
i = i * mask
i = functions.sum(i, axis=1) # sum along atom's axis
return i
================================================
FILE: chainer_chemistry/links/readout/scatter_ggnn_readout.py
================================================
import numpy
import chainer
from chainer import functions
class ScatterGGNNReadout(chainer.Chain):
"""GGNN submodule for readout part using scatter operation.
Args:
out_dim (int): dimension of output feature vector
in_channels (int or None): dimension of feature vector associated to
each node. `in_channels` is the total dimension of `h` and `h0`.
nobias (bool): If ``True``, then this function does not use
the bias
activation (~chainer.Function or ~chainer.FunctionNode):
activate function for node representation
`functions.tanh` was suggested in original paper.
activation_agg (~chainer.Function or ~chainer.FunctionNode):
activate function for aggregation
`functions.tanh` was suggested in original paper.
concat_n_info (bool): If ``True``, node information is concated
to the result.
"""
def __init__(self, out_dim, in_channels=None, nobias=False,
activation=functions.identity,
activation_agg=functions.identity,
concat_n_info=False):
super(ScatterGGNNReadout, self).__init__()
self.concat_n_info = concat_n_info
if self.concat_n_info:
out_dim -= 1
with self.init_scope():
self.i_layer = chainer.links.Linear(
in_channels, out_dim, nobias=nobias)
self.j_layer = chainer.links.Linear(
in_channels, out_dim, nobias=nobias)
self.out_dim = out_dim
self.in_channels = in_channels
self.nobias = nobias
self.activation = activation
self.activation_agg = activation_agg
def __call__(self, h, batch, h0=None, is_real_node=None):
# --- Readout part ---
h1 = functions.concat((h, h0), axis=1) if h0 is not None else h
g1 = functions.sigmoid(self.i_layer(h1))
g2 = self.activation(self.j_layer(h1))
g = g1 * g2
# sum along node axis
y = self.xp.zeros((int(batch[-1]) + 1, self.out_dim),
dtype=numpy.float32)
y = functions.scatter_add(y, batch, g)
y = self.activation_agg(y)
if self.concat_n_info:
n_nodes = self.xp.zeros(y.shape[0], dtype=self.xp.float32)
n_nodes = functions.scatter_add(n_nodes, batch,
self.xp.ones(batch.shape[0]))
y = functions.concat((y, n_nodes.reshape((-1, 1))))
return y
================================================
FILE: chainer_chemistry/links/readout/schnet_readout.py
================================================
import chainer
from chainer import functions
from chainer_chemistry.functions import shifted_softplus
from chainer_chemistry.links.connection.graph_linear import GraphLinear
class SchNetReadout(chainer.Chain):
"""SchNet submodule for readout part.
Args:
out_dim (int): dimension of output feature vector
in_channels (int or None): dimension of feature vector for each node
hidden_channels (int): dimension of feature vector for each node
"""
def __init__(self, out_dim=1, in_channels=None,
hidden_channels=32):
super(SchNetReadout, self).__init__()
with self.init_scope():
self.linear1 = GraphLinear(in_channels, hidden_channels)
self.linear2 = GraphLinear(hidden_channels, out_dim)
self.out_dim = out_dim
self.hidden_dim = in_channels
def __call__(self, h, **kwargs):
h = self.linear1(h)
h = shifted_softplus(h)
h = self.linear2(h)
h = functions.sum(h, axis=1)
return h
================================================
FILE: chainer_chemistry/links/readout/set2set.py
================================================
from typing import List, Optional # NOQA
import chainer
from chainer import cuda
from chainer import functions
from chainer import links
import numpy # NOQA
class Set2Set(chainer.Chain):
r"""MPNN subsubmodule for readout part.
See: Oriol Vinyals+, \
Order Matters: Sequence to sequence for sets. November 2015.
`arXiv:1511.06391 `
Args:
in_channels (int): dimension of input feature vector
n_layers (int): number of LSTM layers
Returns (chainer.Variable):
Output feature vector: (minibatch, in_channels * 2)
"""
def __init__(self, in_channels, n_layers=1):
# type: (int, int) -> None
super(Set2Set, self).__init__()
with self.init_scope():
self.lstm_layer = links.NStepLSTM(
n_layers=n_layers,
in_size=in_channels * 2,
out_size=in_channels,
dropout=0)
self.in_channels = in_channels
self.n_layers = n_layers
self.hx = None # type: Optional[chainer.Variable]
self.cx = None # type: Optional[chainer.Variable]
self.q_star = None # type: Optional[List]
def __call__(self, h):
# type: (chainer.Variable) -> chainer.Variable
xp = cuda.get_array_module(h)
mb, node, ch = h.shape # type: int, int, int
if self.q_star is None:
self.q_star = [
xp.zeros((1, self.in_channels * 2)).astype('f')
for _ in range(mb)
]
self.hx, self.cx, q = self.lstm_layer(self.hx, self.cx, self.q_star)
# self.hx: (mb, mb, ch)
# self.cx: (mb, mb, ch)
# q: List[(1, ch) * mb]
q = functions.stack(q) # q: (mb, 1, ch)
q_ = functions.transpose(q, axes=(0, 2, 1)) # q_: (mb, ch, 1)
e = functions.matmul(h, q_) # e: (mb, node, 1)
a = functions.softmax(e) # a: (mb, node, 1)
a = functions.broadcast_to(a, h.shape) # a: (mb, node, ch)
r = functions.sum((a * h), axis=1, keepdims=True) # r: (mb, 1, ch)
q_star_ = functions.concat((q, r), axis=2) # q_star_: (mb, 1, ch*2)
self.q_star = functions.separate(q_star_)
return functions.reshape(q_star_, (mb, ch * 2))
def reset_state(self):
# type: () -> None
self.hx = None
self.cx = None
self.q_star = None
================================================
FILE: chainer_chemistry/links/scaler/__init__.py
================================================
================================================
FILE: chainer_chemistry/links/scaler/base.py
================================================
import chainer
def to_array(x):
"""Convert x into numpy.ndarray or cupy.ndarray"""
if isinstance(x, chainer.Variable):
x = x.data
return x
class BaseScaler(chainer.Link):
"""Base class for scaler.
x maybe array or Variable
"""
def fit(self, x, **kwargs):
"""fit parameter from given input `x`.
It should return self after fitting parameters.
"""
raise NotImplementedError
def transform(self, x, **kwargs):
"""transform input `x` using fitted parameters.
This method should be called after `fit` is called.
"""
raise NotImplementedError
def inverse_transform(self, x, **kwargs):
"""inverse operation of `transform`.
This method should be called after `fit` is called.
"""
raise NotImplementedError
def fit_transform(self, x, **kwargs):
return self.fit(x, **kwargs).transform(x)
# `__call__` method invokes `forward` method.
def forward(self, x, **kwargs):
return self.transform(x, **kwargs)
================================================
FILE: chainer_chemistry/links/scaler/flow_scaler.py
================================================
import numpy
import chainer
from chainer_chemistry.links.scaler.base import BaseScaler, to_array # NOQA
def _sigmoid_derivative(x):
h = chainer.functions.sigmoid(x)
return chainer.grad([h], [x], enable_double_backprop=True)[0]
def format_x(x):
"""x may be array or Variable"""
# currently, only consider the case x is 2-dim, (batchsize, feature)
if x.ndim == 1:
# Deal with as 1 feature with several samples.
x = x[:, None]
if x.ndim != 2:
raise ValueError(
"Unexpected value x.shape={}, only x.ndim=2 is supported."
.format(x.shape))
return x
class FlowScaler(BaseScaler):
"""Flow Scaler.
Flow Scaler is a Scaler that scale data into the normal distribution.
This scaler uses a technique named "flow". By using this technique,
parametrized bijective function is learned to scale data that distributes
arbitrary continuous distribution into specified continuous distribution.
In this scaler, multi-layer perceptron whose weight is restricted into
positive range is used as parametrized bijective function.
Args:
hidden_num(int): number of units in hidden layer of multi-layer
perceptron.
"""
def __init__(self, hidden_num=20):
super(FlowScaler, self).__init__()
self.hidden_num = hidden_num
self.mean = None
self.register_persistent('mean')
self.std = None
self.register_persistent('std')
self.eps = numpy.float32(1e-6)
W_initializer = chainer.initializers.Normal(0.1)
with self.init_scope():
self.W1_ = chainer.Parameter(W_initializer)
self.b1 = chainer.Parameter(0)
self.W2_ = chainer.Parameter(W_initializer)
self.b2 = chainer.Parameter(0)
def _initialize_params(self, in_size):
self.W1_.initialize((self.hidden_num, in_size, 1, 1, 1, 1))
self.b1.initialize((self.hidden_num, in_size, 1))
self.W2_.initialize((1, in_size, 1, self.hidden_num, 1, 1))
self.b2.initialize((1, in_size, 1))
@property
def W1(self):
return chainer.functions.softplus(self.W1_)
@property
def W2(self):
return chainer.functions.softplus(self.W2_)
def _forward(self, x):
x = chainer.functions.expand_dims(x, axis=1)
x = chainer.functions.expand_dims(x, axis=3)
h = chainer.functions.local_convolution_2d(x, self.W1, self.b1)
h = chainer.functions.sigmoid(h)
h = chainer.functions.local_convolution_2d(h, self.W2, self.b2)
h = h[:, 0, :, 0]
return h
def _derivative(self, x):
x = chainer.functions.expand_dims(x, axis=1)
x = chainer.functions.expand_dims(x, axis=3)
h = chainer.functions.local_convolution_2d(x, self.W1, self.b1)
h = _sigmoid_derivative(h)
h = h * chainer.functions.expand_dims(self.W1[:, :, 0, 0, 0], axis=0)
h = chainer.functions.local_convolution_2d(h, self.W2)
h = h[:, 0, :, 0]
return h
def _loss(self, x):
# loss = -log(p(f(x))) - log|f'(x)|
x_nan = self.xp.isnan(x)
x_not_nan = self.xp.logical_not(x_nan)
x = self.xp.nan_to_num(x)
if not isinstance(x, chainer.Variable):
x = chainer.Variable(x.astype(numpy.float32))
y = self._forward(x)
gy = self._derivative(x)
# gy, = chainer.grad([y], [x], enable_double_backprop=True)
std_gaussian = chainer.distributions.Normal(
self.xp.zeros(shape=x.shape, dtype=numpy.float32),
self.xp.ones(shape=x.shape, dtype=numpy.float32))
loss = -std_gaussian.log_prob(y)
loss -= chainer.functions.log(abs(gy) + self.eps)
loss = chainer.functions.sum(loss[x_not_nan]) / x_not_nan.sum()
chainer.reporter.report({'loss': loss}, self)
return loss
def fit(self, x, batch_size=100, iteration=3000):
"""Fitting parameter.
Args:
x(:class:`~chainer.Variable` or :ref:`ndarray`): data for learning.
batch_size(int): size of batch used for learning multi-layer
perceptron.
iteration(int): number of iteration.
Returns:
self (FlowScaler): this instance.
"""
if isinstance(x, chainer.Variable):
x = x.array
x = format_x(x)
self._initialize_params(x.shape[1])
xp = self.xp
if xp is numpy:
self.mean = xp.nanmean(x, axis=0)
self.std = xp.nanstd(x, axis=0)
else:
if int(xp.sum(xp.isnan(x))) > 0:
raise NotImplementedError(
"FlowScaling with nan value on GPU is not supported.")
# cupy.nanmean, cupy.nanstd is not implemented yet.
self.mean = xp.mean(x, axis=0)
self.std = xp.std(x, axis=0)
x = (x - self.mean) / (self.std + self.eps)
optimizer = chainer.optimizers.Adam(0.3)
optimizer.setup(self)
train = chainer.datasets.TupleDataset(x)
train_iter = chainer.iterators.SerialIterator(train, batch_size)
updater = chainer.training.updaters.StandardUpdater(
train_iter, optimizer, loss_func=self._loss)
trainer = chainer.training.Trainer(
updater, (iteration, 'iteration'))
trainer.extend(chainer.training.extensions.LogReport(
trigger=(100, 'iteration')))
trainer.extend(chainer.training.extensions.PrintReport(
['epoch', 'iteration', 'main/loss', 'elapsed_time']))
trainer.run()
return self
def transform(self, x, batch_size=100):
"""Transform.
Args:
x(:class:`~chainer.Variable` or :ref:`ndarray`): data.
batch_size(int): size of batch used for learning multi-layer
perceptron.
Returns:
scaled_x(:class:`~chainer.Variable` or :ref:`ndarray`):
transformed data.
"""
if self.mean is None:
raise AttributeError('[Error] mean is None, call fit beforehand!')
x_ = format_x(x)
x_ = (x_ - self.mean) / (self.std + self.eps)
y = []
for i in range((len(x) - 1) // batch_size + 1):
y.append(self._forward(
x_[i*batch_size: (i+1)*batch_size]))
y = chainer.functions.concat(y, axis=0)
if x.ndim == 1:
y = y[:, 0]
if isinstance(x_, chainer.Variable):
return y
else:
return y.data
================================================
FILE: chainer_chemistry/links/scaler/max_abs_scaler.py
================================================
from logging import getLogger
import numpy
from chainer import cuda, Variable # NOQA
from chainer_chemistry.links.scaler.base import BaseScaler, to_array # NOQA
from chainer_chemistry.links.array.shape_transformer_to_2d import ShapeTransformerTo2D # NOQA
def format_x(x):
"""x may be array or Variable."""
# currently, only consider the case x is 2-dim, (batchsize, feature)
if x.ndim == 1:
# Deal with as 1 feature with several samples.
x = x[:, None]
return x
class MaxAbsScaler(BaseScaler):
def __init__(self):
super(MaxAbsScaler, self).__init__()
self.indices = None
self.register_persistent('indices')
self.max_abs = None
self.register_persistent('max_abs')
def fit(self, x, indices=None, axis=1):
"""Fitting parameter.
Args:
x (numpy.ndarray or cupy.ndarray or Variable):
indices (list or tuple or None):
indices for applying standard scaling.
axis (int): axis to calculate mean & std.
Returns:
self (StandardScaler): this instance.
"""
x = to_array(x)
x = format_x(x)
x = ShapeTransformerTo2D(axis=axis).transform(x).array
if indices is None:
pass
elif isinstance(indices, (list, tuple)):
indices = numpy.asarray(indices)
self.indices = indices
if self.indices is not None:
x = x[:, self.indices]
xp = self.xp
if xp is numpy:
x = cuda.to_cpu(x)
else:
x = cuda.to_gpu(x)
self.max_abs = xp.nanmax(xp.abs(x), axis=0)
# result consistency check
if xp.sum(self.max_abs == 0) > 0:
logger = getLogger(__name__)
ind = numpy.argwhere(cuda.to_cpu(self.max_abs) == 0)[:, 0]
logger.warning('fit: max_abs was 0 at indices {}'.format(ind))
return self
def _compute_max_abs_all(self, input_dim):
if self.indices is None:
max_abs_all = self.xp.ones(input_dim, dtype=self.xp.float32)
max_abs_all[self.max_abs != 0] = self.max_abs[self.max_abs != 0]
return max_abs_all
else:
max_abs_all = self.xp.ones(input_dim, dtype=self.xp.float32)
non_zero_indices = self.indices[self.max_abs != 0]
max_abs_all[non_zero_indices] = self.max_abs[self.max_abs != 0]
return max_abs_all
def transform(self, x, axis=1):
is_array = not isinstance(x, Variable)
if self.max_abs is None:
raise AttributeError(
'[Error] max_abs is None, call fit beforehand!')
x = format_x(x)
shape_transformer = ShapeTransformerTo2D(axis=axis)
x = shape_transformer.transform(x)
max_abs_all = self._compute_max_abs_all(x.shape[1])
x = x / max_abs_all[None, :]
x = shape_transformer.inverse_transform(x)
if is_array:
x = x.array
return x
def inverse_transform(self, x, axis=1):
is_array = not isinstance(x, Variable)
if self.max_abs is None:
raise AttributeError(
'[Error] max_abs is None, call fit beforehand!')
x = format_x(x)
shape_transformer = ShapeTransformerTo2D(axis=axis)
x = shape_transformer.transform(x)
max_abs_all = self._compute_max_abs_all(x.shape[1])
x = x * max_abs_all[None, :]
x = shape_transformer.inverse_transform(x)
if is_array:
x = x.array
return x
================================================
FILE: chainer_chemistry/links/scaler/min_max_scaler.py
================================================
from logging import getLogger
import numpy
from chainer import cuda, Variable # NOQA
from chainer_chemistry.links.scaler.base import BaseScaler, to_array # NOQA
from chainer_chemistry.links.array.shape_transformer_to_2d import ShapeTransformerTo2D # NOQA
def format_x(x):
"""x may be array or Variable."""
# currently, only consider the case x is 2-dim, (batchsize, feature)
if x.ndim == 1:
# Deal with as 1 feature with several samples.
x = x[:, None]
return x
class MinMaxScaler(BaseScaler):
def __init__(self):
super(MinMaxScaler, self).__init__()
self.indices = None
self.register_persistent('indices')
self.min = None
self.register_persistent('min')
self.max = None
self.register_persistent('max')
def fit(self, x, indices=None, axis=1):
"""Fitting parameter.
Args:
x (numpy.ndarray or cupy.ndarray or Variable):
indices (list or tuple or None):
indices for applying standard scaling.
axis (int): axis to calculate min & max.
Returns:
self (MinMaxScaler): this instance.
"""
x = to_array(x)
x = format_x(x)
x = ShapeTransformerTo2D(axis=axis).transform(x).array
if indices is None:
pass
elif isinstance(indices, (list, tuple)):
indices = numpy.asarray(indices)
self.indices = indices
if self.indices is not None:
x = x[:, self.indices]
xp = self.xp
if xp is numpy:
x = cuda.to_cpu(x)
else:
x = cuda.to_gpu(x)
self.min = xp.nanmin(x, axis=0)
self.max = xp.nanmax(x, axis=0)
# result consistency check
if xp.sum(self.max - self.min == 0) > 0:
logger = getLogger(__name__)
ind = numpy.argwhere(cuda.to_cpu(self.max-self.min) == 0)[:, 0]
logger.warning('fit: max-min was 0 at indices {}'.format(ind))
return self
def _compute_min_diff_all(self, input_dim):
diff = self.max - self.min
diff_nonzero_indices = diff != 0
if self.indices is None:
diff_all = self.xp.ones(input_dim, dtype=self.xp.float32)
diff_all[diff_nonzero_indices] = diff[diff_nonzero_indices]
return self.min, diff_all
else:
min_all = self.xp.zeros(input_dim, dtype=self.xp.float32)
min_all[self.indices] = self.min
diff_all = self.xp.ones(input_dim, dtype=self.xp.float32)
non_zero_indices = self.indices[diff_nonzero_indices]
diff_all[non_zero_indices] = diff[diff_nonzero_indices]
return min_all, diff_all
def transform(self, x, axis=1):
is_array = not isinstance(x, Variable)
if self.min is None:
raise AttributeError(
'[Error] min is None, call fit beforehand!')
x = format_x(x)
shape_transformer = ShapeTransformerTo2D(axis=axis)
x = shape_transformer.transform(x)
min_all, diff_all = self._compute_min_diff_all(x.shape[1])
x = (x - min_all[None, :]) / diff_all[None, :]
x = shape_transformer.inverse_transform(x)
if is_array:
x = x.array
return x
def inverse_transform(self, x, axis=1):
is_array = not isinstance(x, Variable)
if self.min is None:
raise AttributeError(
'[Error] min is None, call fit beforehand!')
x = format_x(x)
shape_transformer = ShapeTransformerTo2D(axis=axis)
x = shape_transformer.transform(x)
min_all, diff_all = self._compute_min_diff_all(x.shape[1])
x = x * diff_all[None, :] + min_all[None, :]
x = shape_transformer.inverse_transform(x)
if is_array:
x = x.array
return x
================================================
FILE: chainer_chemistry/links/scaler/standard_scaler.py
================================================
from logging import getLogger
import numpy
from chainer import cuda, Variable # NOQA
from chainer_chemistry.links.scaler.base import BaseScaler, to_array # NOQA
from chainer_chemistry.links.array.shape_transformer_to_2d import ShapeTransformerTo2D # NOQA
def format_x(x):
"""x may be array or Variable."""
# currently, only consider the case x is 2-dim, (batchsize, feature)
if x.ndim == 1:
# Deal with as 1 feature with several samples.
x = x[:, None]
return x
class StandardScaler(BaseScaler):
def __init__(self):
super(StandardScaler, self).__init__()
self.indices = None
self.register_persistent('indices')
self.mean = None
self.register_persistent('mean')
self.std = None
self.register_persistent('std')
def fit(self, x, indices=None, axis=1):
"""Fitting parameter.
Args:
x (numpy.ndarray or cupy.ndarray or Variable):
indices (list or tuple or None):
indices for applying standard scaling.
axis (int): axis to calculate mean & std.
Returns:
self (StandardScaler): this instance.
"""
x = to_array(x)
x = format_x(x)
x = ShapeTransformerTo2D(axis=axis).transform(x).array
if indices is None:
pass
elif isinstance(indices, (list, tuple)):
indices = numpy.asarray(indices)
self.indices = indices
if self.indices is not None:
x = x[:, self.indices]
xp = self.xp
if xp is numpy:
x = cuda.to_cpu(x)
self.mean = xp.nanmean(x, axis=0)
self.std = xp.nanstd(x, axis=0)
else:
x = cuda.to_gpu(x)
if int(xp.sum(xp.isnan(x))) > 0:
raise NotImplementedError(
"StandardScaling with nan value on GPU is not supported.")
# cupy.nanmean, cupy.nanstd is not implemented yet.
self.mean = xp.mean(x, axis=0)
self.std = xp.std(x, axis=0)
# result consistency check
if xp.sum(self.std == 0) > 0:
logger = getLogger(__name__)
ind = numpy.argwhere(cuda.to_cpu(self.std) == 0)[:, 0]
logger.warning('fit: std was 0 at indices {}'.format(ind))
return self
def _compute_mean_std_all(self, input_dim):
if self.indices is None:
std_all = self.xp.ones(input_dim, dtype=self.xp.float32)
std_all[self.std != 0] = self.std[self.std != 0]
return self.mean, std_all
else:
mean_all = self.xp.zeros(input_dim, dtype=self.xp.float32)
mean_all[self.indices] = self.mean
std_all = self.xp.ones(input_dim, dtype=self.xp.float32)
non_zero_indices = self.indices[self.std != 0]
std_all[non_zero_indices] = self.std[self.std != 0]
return mean_all, std_all
def transform(self, x, axis=1):
is_array = not isinstance(x, Variable)
if self.mean is None:
raise AttributeError('[Error] mean is None, call fit beforehand!')
x = format_x(x)
shape_transformer = ShapeTransformerTo2D(axis=axis)
x = shape_transformer.transform(x)
mean_all, std_all = self._compute_mean_std_all(x.shape[1])
x = (x - mean_all[None, :]) / std_all[None, :]
x = shape_transformer.inverse_transform(x)
if is_array:
x = x.array
return x
def inverse_transform(self, x, axis=1):
is_array = not isinstance(x, Variable)
if self.mean is None:
raise AttributeError('[Error] mean is None, call fit beforehand!')
x = format_x(x)
shape_transformer = ShapeTransformerTo2D(axis=axis)
x = shape_transformer.transform(x)
mean_all, std_all = self._compute_mean_std_all(x.shape[1])
x = x * std_all[None, :] + mean_all[None, :]
x = shape_transformer.inverse_transform(x)
if is_array:
x = x.array
return x
================================================
FILE: chainer_chemistry/links/update/__init__.py
================================================
================================================
FILE: chainer_chemistry/links/update/cgcnn_update.py
================================================
import chainer
from chainer import links, functions # NOQA
class CGCNNUpdate(chainer.Chain):
"""Update submodule for CGCNN
Args:
n_site_features (int): hidden dimension of atom feature vector.
This value must be the same as n_site_feat.
"""
def __init__(self, n_site_features=64):
super(CGCNNUpdate, self).__init__()
with self.init_scope():
self.fc = links.Linear(None, 2*n_site_features)
self.bn1 = links.BatchNormalization(2*n_site_features)
self.bn2 = links.BatchNormalization(n_site_features)
def __call__(self, site_feat, nbr_feat, nbr_feat_idx):
n_site, n_nbr, n_nbr_feat = nbr_feat.shape
_, n_site_feat = site_feat.shape
site_nbr_feat = site_feat[nbr_feat_idx]
total_feat = functions.concat([
functions.broadcast_to(site_feat[:, None, :],
(n_site, n_nbr, n_site_feat)),
site_nbr_feat,
nbr_feat
], axis=2)
total_feat = self.fc(total_feat.reshape(
n_site*n_nbr, 2*n_site_feat+n_nbr_feat))
total_feat = self.bn1(total_feat).reshape(n_site, n_nbr, 2*n_site_feat)
feat_gate, feat_core = functions.split_axis(total_feat, 2, axis=-1)
feat_gate = functions.sigmoid(feat_gate)
feat_core = functions.softplus(feat_core)
feat_sum = functions.sum(feat_gate * feat_core, axis=1)
feat_sum = self.bn2(feat_sum)
out = functions.softplus(site_feat + feat_sum)
return out
================================================
FILE: chainer_chemistry/links/update/ggnn_update.py
================================================
import chainer
from chainer import functions
from chainer import links
import chainer_chemistry
from chainer_chemistry.links.connection.graph_linear import GraphLinear
from chainer_chemistry.utils import is_sparse
class GGNNUpdate(chainer.Chain):
"""GGNN submodule for update part.
Args:
in_channels (int or None): input dim of feature vector for each node
hidden_channels (int): dimension of feature vector for each node
out_channels (int or None): output dime of feature vector for each node
When `None`, `hidden_channels` is used.
n_edge_types (int): number of types of edge
"""
def __init__(self, in_channels=None, hidden_channels=16,
out_channels=None, n_edge_types=4, **kwargs):
if out_channels is None:
out_channels = hidden_channels
super(GGNNUpdate, self).__init__()
if in_channels is None:
gru_in_channels = None
else:
gru_in_channels = in_channels + hidden_channels
with self.init_scope():
self.graph_linear = GraphLinear(
in_channels, n_edge_types * hidden_channels)
self.update_layer = links.GRU(gru_in_channels, out_channels)
self.n_edge_types = n_edge_types
self.in_channels = in_channels
self.hidden_channels = hidden_channels
self.out_channels = out_channels
def __call__(self, h, adj, **kwargs):
hidden_ch = self.hidden_channels
# --- Message part ---
mb, atom, in_ch = h.shape
m = functions.reshape(self.graph_linear(h),
(mb, atom, hidden_ch, self.n_edge_types))
# m: (minibatch, atom, ch, edge_type)
# Transpose
m = functions.transpose(m, (0, 3, 1, 2))
# m: (minibatch, edge_type, atom, ch)
# (minibatch * edge_type, atom, out_ch)
m = functions.reshape(m, (mb * self.n_edge_types, atom, hidden_ch))
if is_sparse(adj):
m = functions.sparse_matmul(adj, m)
else:
adj = functions.reshape(adj, (mb * self.n_edge_types, atom, atom))
m = chainer_chemistry.functions.matmul(adj, m)
# (minibatch * edge_type, atom, out_ch)
m = functions.reshape(m, (mb, self.n_edge_types, atom, hidden_ch))
m = functions.sum(m, axis=1)
# (minibatch, atom, out_ch)
# --- Update part ---
# Contraction
h = functions.reshape(h, (mb * atom, in_ch))
# Contraction
m = functions.reshape(m, (mb * atom, hidden_ch))
out_h = self.update_layer(functions.concat((h, m), axis=1))
# Expansion
out_h = functions.reshape(out_h, (mb, atom, self.out_channels))
return out_h
def reset_state(self):
self.update_layer.reset_state()
================================================
FILE: chainer_chemistry/links/update/gin_update.py
================================================
import chainer
from chainer import functions
import chainer_chemistry
from chainer_chemistry.links import GraphMLP
class GINUpdate(chainer.Chain):
r"""GIN submodule for update part.
Simplest implementation of Graph Isomorphism Network (GIN):
N-layered MLP + ReLU
No learnable epsilon
Batch Normalization is not implemented. instead we use dropout
# TODO: implement Batch Normalization inside GraphMLP
# Linear -> BN -> relu is used.
See: Xu, Hu, Leskovec, and Jegelka, \
"How powerful are graph neural networks?", in ICLR 2019.
Args:
in_channels (int or None): input dim of feature vector for each node
hidden_channels (int): dimension of feature vector for each node
out_channels (int or None): output dime of feature vector for each node
When `None`, `hidden_channels` is used.
dropout_ratio (float): ratio of dropout, instead of batch normalization
n_layers (int): layers used in `GraphMLP`
"""
def __init__(self, in_channels=None, hidden_channels=16, out_channels=None,
dropout_ratio=0.5, n_layers=2, **kwargs):
if out_channels is None:
out_channels = hidden_channels
super(GINUpdate, self).__init__()
channels = [hidden_channels] * (n_layers - 1) + [out_channels]
with self.init_scope():
# two Linear + RELU
self.graph_mlp = GraphMLP(
channels=channels, in_channels=in_channels,
activation=functions.relu)
self.dropout_ratio = dropout_ratio
def __call__(self, h, adj, **kwargs):
"""Describing a layer.
Args:
h (numpy.ndarray): minibatch by num_nodes by hidden_dim
numpy array. local node hidden states
adj (numpy.ndarray): minibatch by num_nodes by num_nodes 1/0 array.
Adjacency matrices over several bond types
Returns:
updated h
"""
# Support for one graph (node classification task)
if h.ndim == 2:
h = h[None]
# (minibatch, atom, ch)
mb, atom, ch = h.shape
# --- Message part ---
if isinstance(adj, chainer.utils.CooMatrix):
# coo pattern
# Support for one graph
if adj.data.ndim == 1:
adj.data = adj.data[None]
adj.col = adj.col[None]
adj.row = adj.row[None]
fv = functions.sparse_matmul(adj, h)
else:
# padding pattern
# adj (mb, atom, atom)
# fv (minibatch, atom, ch)
fv = chainer_chemistry.functions.matmul(adj, h)
assert (fv.shape == (mb, atom, ch))
# sum myself
sum_h = fv + h
assert (sum_h.shape == (mb, atom, ch))
# apply MLP
new_h = self.graph_mlp(sum_h)
new_h = functions.relu(new_h)
if self.dropout_ratio > 0.0:
new_h = functions.dropout(new_h, ratio=self.dropout_ratio)
return new_h
class GINSparseUpdate(chainer.Chain):
"""sparse GIN submodule for update part"""
def __init__(self, in_channels=None, hidden_channels=16, out_channels=None,
dropout_ratio=0.5, n_layers=2, **kwargs):
# To avoid circular reference
from chainer_chemistry.models.mlp import MLP
if out_channels is None:
out_channels = hidden_channels
super(GINSparseUpdate, self).__init__()
with self.init_scope():
self.mlp = MLP(
out_dim=out_channels, hidden_dim=hidden_channels,
n_layers=n_layers, activation=functions.relu
)
self.dropout_ratio = dropout_ratio
def __call__(self, h, edge_index):
# add self node feature
new_h = h
messages = h[edge_index[0]]
new_h = functions.scatter_add(new_h, edge_index[1], messages)
# apply MLP
new_h = self.mlp(new_h)
if self.dropout_ratio > 0.0:
new_h = functions.dropout(new_h, ratio=self.dropout_ratio)
return new_h
================================================
FILE: chainer_chemistry/links/update/gnn_film_update.py
================================================
import chainer
from chainer import functions
from chainer import links
from chainer_chemistry.links.connection.graph_linear import GraphLinear
class GNNFiLMUpdate(chainer.Chain):
"""GNNFiLM submodule for update part.
Args:
hidden_channels (int): dimension of feature vector associated to
each atom
n_edge_types (int): number of types of edge
"""
def __init__(self, hidden_channels=16, n_edge_types=5,
activation=functions.relu):
super(GNNFiLMUpdate, self).__init__()
self.n_edge_types = n_edge_types
self.activation = activation
with self.init_scope():
self.W_linear = GraphLinear(
in_size=None, out_size=self.n_edge_types * hidden_channels,
nobias=True) # W_l in eq. (6)
self.W_g = GraphLinear(
in_size=None, out_size=self.n_edge_types * hidden_channels * 2,
nobias=True) # g in eq. (6)
self.norm_layer = links.LayerNormalization() # l in eq. (6)
def forward(self, h, adj):
# --- Message part ---
xp = self.xp
mb, atom, ch = h.shape
newshape = adj.shape + (ch, )
adj = functions.broadcast_to(adj[:, :, :, :, xp.newaxis], newshape)
messages = functions.reshape(self.W_linear(h),
(mb, atom, ch, self.n_edge_types))
messages = functions.transpose(messages, (3, 0, 1, 2))
film_weights = functions.reshape(self.W_g(h),
(mb, atom, 2 * ch, self.n_edge_types))
film_weights = functions.transpose(film_weights, (3, 0, 1, 2))
# (n_edge_types, minibatch, atom, out_ch)
gamma = film_weights[:, :, :, :ch]
# (n_edge_types, minibatch, atom, out_ch)
beta = film_weights[:, :, :, ch:]
# --- Update part ---
messages = functions.expand_dims(
gamma, axis=3) * functions.expand_dims(
messages, axis=2) + functions.expand_dims(beta, axis=3)
messages = self.activation(messages)
# (minibatch, n_edge_types, atom, atom, out_ch)
messages = functions.transpose(messages, (1, 0, 2, 3, 4))
messages = adj * messages
messages = functions.sum(messages, axis=3) # sum across atoms
messages = functions.sum(messages, axis=1) # sum across n_edge_types
messages = functions.reshape(messages, (mb * atom, ch))
messages = self.norm_layer(messages)
messages = functions.reshape(messages, (mb, atom, ch))
return messages
================================================
FILE: chainer_chemistry/links/update/megnet_update.py
================================================
import chainer
from chainer import functions, links # NOQA
from chainer_chemistry.functions import megnet_softplus
class DenseLayer(chainer.Chain):
def __init__(self, hidden_dim=[64, 32], activation=megnet_softplus):
super(DenseLayer, self).__init__()
self.n_layers = len(hidden_dim)
self.activation = activation
with self.init_scope():
self.update_layer = chainer.ChainList(
*[links.Linear(None, hidden_dim[i])
for i in range(self.n_layers)])
def __call__(self, v):
for i in range(self.n_layers):
v = self.activation(self.update_layer[i](v))
return v
class UpdateLayer(chainer.Chain):
def __init__(self, hidden_dim=[64, 64, 32], activation=megnet_softplus):
super(UpdateLayer, self).__init__()
self.n_layers = len(hidden_dim)
self.activation = activation
with self.init_scope():
self.update_layer = chainer.ChainList(
*[links.Linear(None, hidden_dim[i])
for i in range(self.n_layers)])
def __call__(self, v):
for i in range(self.n_layers):
v = self.update_layer[i](v)
# doesn't pass the activation at the last layer
if i != (self.n_layers-1):
v = self.activation(v)
return v
def get_mean_feat(feat, idx, out_shape, xp):
"""Return mean node or edge feature in each graph.
This method is the same as average pooling
about node or edge feature in each graph.
"""
zero = xp.zeros(out_shape, dtype=xp.float32)
sum_vec = functions.scatter_add(zero, idx, feat)
one = xp.ones(feat.shape, dtype=xp.float32)
degree = functions.scatter_add(zero, idx, one)
return sum_vec / degree
class MEGNetUpdate(chainer.Chain):
"""Update submodule for MEGNet
Args:
dim_for_dense (list): dimension list of dense layer
dim_for_update (list): dimension list of update layer
dropout_ratio (float): ratio of dropout
activation (~chainer.Function or ~chainer.FunctionNode):
activate function for megnet model
`megnet_softplus` was used in original paper.
skip_intermediate (bool): When `True`, intermediate feature after dense
calculation is used for skip connection. When `False`, input
feature is used for skip connection.
It is `True` for first layer, and `False` for other layer in the
original paper.
"""
def __init__(self, dim_for_dense=[64, 32], dim_for_update=[64, 64, 32],
dropout_ratio=-1, activation=megnet_softplus,
skip_intermediate=True):
super(MEGNetUpdate, self).__init__()
if len(dim_for_dense) != 2:
raise ValueError('dim_for_dense must have 2 elements')
if len(dim_for_update) != 3:
raise ValueError('dim_for_update must have 3 elements')
self.dropout_ratio = dropout_ratio
with self.init_scope():
# for dense layer
self.dense_for_atom = DenseLayer(dim_for_dense, activation)
self.dense_for_pair = DenseLayer(dim_for_dense, activation)
self.dense_for_global = DenseLayer(dim_for_dense, activation)
# for update layer
self.update_for_atom = UpdateLayer(dim_for_update, activation)
self.update_for_pair = UpdateLayer(dim_for_update, activation)
self.update_for_global = UpdateLayer(dim_for_update, activation)
self.skip_intermediate = skip_intermediate
def __call__(self, atoms_feat, pair_feat, global_feat,
atom_idx, pair_idx, start_idx, end_idx):
# 1) Pass the Dense layer
a_f_d = self.dense_for_atom(atoms_feat)
p_f_d = self.dense_for_pair(pair_feat)
g_f_d = self.dense_for_global(global_feat)
# 2) Update the edge vector
start_node = a_f_d[start_idx]
end_node = a_f_d[end_idx]
g_f_extend_with_pair_idx = g_f_d[pair_idx]
concat_p_v = functions.concat((p_f_d, start_node, end_node,
g_f_extend_with_pair_idx))
update_p = self.update_for_pair(concat_p_v)
# 3) Update the node vector
# 1. get sum edge feature of all nodes using scatter_add method
zero = self.xp.zeros(a_f_d.shape, dtype=self.xp.float32)
sum_edeg_vec = functions.scatter_add(zero, start_idx, update_p) + \
functions.scatter_add(zero, end_idx, update_p)
# 2. get degree of all nodes using scatter_add method
one = self.xp.ones(p_f_d.shape, dtype=self.xp.float32)
degree = functions.scatter_add(zero, start_idx, one) + \
functions.scatter_add(zero, end_idx, one)
# 3. get mean edge feature of all nodes
mean_edge_vec = sum_edeg_vec / degree
# 4. concating
g_f_extend_with_atom_idx = g_f_d[atom_idx]
concat_a_v = functions.concat((a_f_d, mean_edge_vec,
g_f_extend_with_atom_idx))
update_a = self.update_for_atom(concat_a_v)
# 4) Update the global vector
out_shape = g_f_d.shape
ave_p = get_mean_feat(update_p, pair_idx, out_shape, self.xp)
ave_a = get_mean_feat(update_a, atom_idx, out_shape, self.xp)
concat_g_v = functions.concat((ave_a, ave_p, g_f_d), axis=1)
update_g = self.update_for_global(concat_g_v)
# 5) Skip connection
if self.skip_intermediate:
# Skip intermediate feature, used for first layer.
new_a_f = update_a + a_f_d
new_p_f = update_p + p_f_d
new_g_f = update_g + g_f_d
else:
# Skip input feature, used all layer except first layer.
# input feature must be same dimension with updated feature.
new_a_f = update_a + atoms_feat
new_p_f = update_p + pair_feat
new_g_f = update_g + global_feat
# 6) dropout
if self.dropout_ratio > 0.0:
new_a_f = functions.dropout(new_a_f, ratio=self.dropout_ratio)
new_p_f = functions.dropout(new_p_f, ratio=self.dropout_ratio)
new_g_f = functions.dropout(new_g_f, ratio=self.dropout_ratio)
return new_a_f, new_p_f, new_g_f
================================================
FILE: chainer_chemistry/links/update/mpnn_update.py
================================================
import chainer
from chainer import functions
from chainer import links
import chainer_chemistry
class MPNNUpdate(chainer.Chain):
r"""MPNN submodule for update part.
See: Justin Gilmer+, \
Neural Message Passing for Quantum Chemistry. April 2017.
`arXiv:1704.01212 `
Args:
in_channels (int or None): input dim of feature vector for each node
hidden_channels (int): dimension of feature vector for each node
out_channels (int or None): output dime of feature vector for each node
When `None`, `hidden_channels` is used.
nn (~chainer.Link):
"""
def __init__(self, in_channels=None, hidden_channels=16, out_channels=None,
nn=None, **kwargs):
if out_channels is None:
out_channels = hidden_channels
if in_channels is None:
# Current `EdgeNet` hidden_channels must be same with input `h` dim
in_channels = out_channels
super(MPNNUpdate, self).__init__()
with self.init_scope():
self.message_layer = EdgeNet(out_channels=hidden_channels, nn=nn)
self.update_layer = links.GRU(2 * hidden_channels, out_channels)
self.in_channels = in_channels # currently it is not used...
self.hidden_channels = hidden_channels
self.out_channels = out_channels
self.nn = nn
def __call__(self, h, adj, **kwargs):
# type: (chainer.Variable, chainer.Variable) -> chainer.Variable
# adj: (mb, edge_type, node, node)
mb, node, ch = h.shape
h = self.message_layer(h, adj) # h: (mb, node, hidden_dim*2)
h = functions.reshape(h, (mb * node, self.hidden_channels * 2))
h = self.update_layer(h) # h: (mb*node, hidden_dim)
h = functions.reshape(h, (mb, node, self.out_channels))
return h
def reset_state(self):
self.update_layer.reset_state()
class EdgeNet(chainer.Chain):
"""MPNN submodule for message part.
Edge Network expands edge vector dimension to (d x d) matrix.
If undirected graph, adj_in and adj_out are same.
Args:
out_channels (int): dimension of output feature vector
Currently, it must be same with input dimension.
nn (~chainer.Link):
"""
def __init__(self, out_channels, nn=None):
# type: (int, chainer.Link) -> None
super(EdgeNet, self).__init__()
if nn is None:
from chainer_chemistry.models.mlp import MLP
nn = MLP(out_dim=out_channels**2, hidden_dim=16)
if not isinstance(nn, chainer.Link):
raise ValueError('nn {} must be chainer.Link'.format(nn))
with self.init_scope():
self.nn_layer_in = nn
self.nn_layer_out = nn
self.out_channels = out_channels
def __call__(self, h, adj):
# type: (chainer.Variable, chainer.Variable) -> chainer.Variable
mb, node, ch = h.shape
if ch != self.out_channels:
raise ValueError('hidden_channels must be equal to dimension '
'of feature vector associated to each atom, '
'{}, but it was set to {}'.format(
ch, self.out_channels))
# adj: (mb, edge_type, node, node)
edge_type = adj.shape[1]
adj_in = adj
adj_out = functions.transpose(adj, axes=(0, 1, 3, 2))
# expand edge vector to matrix
adj_in = functions.reshape(adj_in, (-1, edge_type))
# adj_in: (mb*node*node, edge_type)
adj_in = self.nn_layer_in(adj_in)
# adj_in: (mb*node*node, out_ch*out_ch)
adj_in = functions.reshape(adj_in, (mb, node, node, ch, ch))
adj_in = functions.reshape(
functions.transpose(adj_in, axes=(0, 1, 3, 2, 4)),
(mb, node * ch, node * ch))
adj_out = functions.reshape(adj_out, (-1, edge_type))
# adj_out: (mb*node*node, edge_type)
adj_out = self.nn_layer_out(adj_out)
# adj_out: (mb*node*node, out_ch*out_ch)
adj_out = functions.reshape(adj_out, (mb, node, node, ch, ch))
adj_out = functions.reshape(
functions.transpose(adj_out, axes=(0, 1, 3, 2, 4)),
(mb, node * ch, node * ch))
# calculate message
h = functions.reshape(h, (mb, node * ch, 1))
message_in = chainer_chemistry.functions.matmul(adj_in, h)
# message_in: (mb, node*ch, 1)
message_in = functions.reshape(message_in, (mb, node, ch))
# message_in: (mb, node, out_ch)
message_out = chainer_chemistry.functions.matmul(adj_out, h)
# message_out: (mb, node*ch, 1)
message_out = functions.reshape(message_out, (mb, node, ch))
message = functions.concat([message_in, message_out], axis=2)
return message # message: (mb, node, out_ch * 2)
================================================
FILE: chainer_chemistry/links/update/nfp_update.py
================================================
import chainer
from chainer import functions
import numpy
import chainer_chemistry
from chainer_chemistry.links.connection.graph_linear import GraphLinear
class NFPUpdate(chainer.Chain):
"""NFP submodule for update part.
Args:
in_channels (int or None): input channel dimension
out_channels (int): output channel dimension
max_degree (int): max degree of edge
"""
def __init__(self, in_channels, out_channels, max_degree=6,
**kwargs):
super(NFPUpdate, self).__init__()
num_degree_type = max_degree + 1
with self.init_scope():
self.graph_linears = chainer.ChainList(
*[GraphLinear(in_channels, out_channels)
for _ in range(num_degree_type)])
self.max_degree = max_degree
self.in_channels = in_channels
self.out_channels = out_channels
def __call__(self, h, adj, deg_conds):
# h: (minibatch, atom, ch)
# h encodes each atom's info in ch axis of size hidden_dim
# adjs: (minibatch, atom, atom)
# --- Message part ---
# Take sum along adjacent atoms
# fv: (minibatch, atom, ch)
fv = chainer_chemistry.functions.matmul(adj, h)
# --- Update part ---
# TODO(nakago): self.xp is chainerx
if self.xp is numpy:
zero_array = numpy.zeros(fv.shape, dtype=numpy.float32)
else:
zero_array = self.xp.zeros_like(fv.array)
fvds = [functions.where(cond, fv, zero_array) for cond in deg_conds]
out_h = 0
for graph_linear, fvd in zip(self.graph_linears, fvds):
out_h = out_h + graph_linear(fvd)
# out_h shape (minibatch, max_num_atoms, hidden_dim)
out_h = functions.sigmoid(out_h)
return out_h
================================================
FILE: chainer_chemistry/links/update/relgat_update.py
================================================
import chainer
from chainer import functions
from chainer_chemistry.links.connection.graph_linear import GraphLinear
class RelGATUpdate(chainer.Chain):
"""RelGAT submodule for update part.
Args:
in_channels (int or None): dimension of input feature vector
out_channels (int): dimension of output feature vector
n_heads (int): number of multi-head-attentions.
n_edge_types (int): number of edge types.
dropout_ratio (float): dropout ratio of the normalized attention
coefficients
negative_slope (float): LeakyRELU angle of the negative slope
softmax_mode (str): take the softmax over the logits 'across' or
'within' relation. If you would like to know the detail discussion,
please refer Relational GAT paper.
concat_heads (bool) : Whether to concat or average multi-head
attentions
"""
def __init__(self, in_channels, out_channels, n_heads=3, n_edge_types=4,
dropout_ratio=-1., negative_slope=0.2, softmax_mode='across',
concat_heads=False):
super(RelGATUpdate, self).__init__()
with self.init_scope():
self.message_layer = GraphLinear(
in_channels, out_channels * n_edge_types * n_heads)
self.attention_layer = GraphLinear(out_channels * 2, 1)
self.in_channels = in_channels
self.out_channels = out_channels
self.n_heads = n_heads
self.n_edge_types = n_edge_types
self.dropout_ratio = dropout_ratio
self.softmax_mode = softmax_mode
self.concat_heads = concat_heads
self.negative_slope = negative_slope
def __call__(self, h, adj, **kwargs):
xp = self.xp
# (minibatch, atom, channel)
mb, atom, ch = h.shape
# (minibatch, atom, EDGE_TYPE * heads * out_dim)
h = self.message_layer(h)
# (minibatch, atom, EDGE_TYPE, heads, out_dim)
h = functions.reshape(h, (mb, atom, self.n_edge_types, self.n_heads,
self.out_channels))
# concat all pairs of atom
# (minibatch, 1, atom, heads, out_dim)
h_i = functions.reshape(h, (mb, 1, atom, self.n_edge_types,
self.n_heads, self.out_channels))
# (minibatch, atom, atom, heads, out_dim)
h_i = functions.broadcast_to(h_i, (mb, atom, atom, self.n_edge_types,
self.n_heads, self.out_channels))
# (minibatch, atom, 1, EDGE_TYPE, heads, out_dim)
h_j = functions.reshape(h, (mb, atom, 1, self.n_edge_types,
self.n_heads, self.out_channels))
# (minibatch, atom, atom, EDGE_TYPE, heads, out_dim)
h_j = functions.broadcast_to(h_j, (mb, atom, atom, self.n_edge_types,
self.n_heads, self.out_channels))
# (minibatch, atom, atom, EDGE_TYPE, heads, out_dim * 2)
e = functions.concat([h_i, h_j], axis=5)
# (minibatch, EDGE_TYPE, heads, atom, atom, out_dim * 2)
e = functions.transpose(e, (0, 3, 4, 1, 2, 5))
# (minibatch * EDGE_TYPE * heads, atom * atom, out_dim * 2)
e = functions.reshape(e, (mb * self.n_edge_types * self.n_heads,
atom * atom, self.out_channels * 2))
# (minibatch * EDGE_TYPE * heads, atom * atom, 1)
e = self.attention_layer(e)
# (minibatch, EDGE_TYPE, heads, atom, atom)
e = functions.reshape(e, (mb, self.n_edge_types, self.n_heads, atom,
atom))
e = functions.leaky_relu(e, self.negative_slope)
# (minibatch, EDGE_TYPE, atom, atom)
if isinstance(adj, chainer.Variable):
cond = adj.array.astype(xp.bool)
else:
cond = adj.astype(xp.bool)
# (minibatch, EDGE_TYPE, 1, atom, atom)
cond = xp.reshape(cond, (mb, self.n_edge_types, 1, atom, atom))
# (minibatch, EDGE_TYPE, heads, atom, atom)
cond = xp.broadcast_to(cond, e.array.shape)
# TODO(mottodora): find better way to ignore non connected
e = functions.where(cond, e,
xp.broadcast_to(xp.array(-10000), e.array.shape)
.astype(xp.float32))
# In Relational Graph Attention Networks eq.(7)
# ARGAT: take the softmax over the logits across node neighborhoods
# irrespective of relation
if self.softmax_mode == 'across':
# (minibatch, heads, atom, EDGE_TYPE, atom)
e = functions.transpose(e, (0, 2, 3, 1, 4))
# (minibatch, heads, atom, EDGE_TYPE * atom)
e = functions.reshape(e, (mb, self.n_heads, atom,
self.n_edge_types * atom))
# (minibatch, heads, atom, EDGE_TYPE * atom)
alpha = functions.softmax(e, axis=3)
if self.dropout_ratio >= 0:
alpha = functions.dropout(alpha, ratio=self.dropout_ratio)
# (minibatch, heads, atom, EDGE_TYPE, atom)
alpha = functions.reshape(alpha, (mb, self.n_heads, atom,
self.n_edge_types, atom))
# (minibatch, EDGE_TYPE, heads, atom, atom)
alpha = functions.transpose(alpha, (0, 3, 1, 2, 4))
# In Relational Graph Attention Networks eq.(6)
# WIRGAT: take the softmax over the logits independently for each
# relation
elif self.softmax_mode == 'within':
alpha = functions.softmax(e, axis=4)
if self.dropout_ratio >= 0:
alpha = functions.dropout(alpha, ratio=self.dropout_ratio)
else:
raise ValueError("{} is invalid. Please use 'across' or 'within'"
.format(self.softmax_mode))
# before: (minibatch, atom, EDGE_TYPE, heads, out_dim)
# after: (minibatch, EDGE_TYPE, heads, atom, out_dim)
h = functions.transpose(h, (0, 2, 3, 1, 4))
# (minibatch, EDGE_TYPE, heads, atom, out_dim)
h_new = functions.matmul(alpha, h)
# (minibatch, heads, atom, out_dim)
h_new = functions.sum(h_new, axis=1)
if self.concat_heads:
# -> (minibatch, atom, heads, out_dim)
h_new = functions.transpose(h_new, (0, 2, 1, 3))
bs, n_nodes, n_heads, outdim = h_new.shape
# (minibatch, atom, heads * out_dim)
h_new = functions.reshape(h_new, (bs, n_nodes, n_heads * outdim))
else:
# (minibatch, atom, out_dim)
h_new = functions.mean(h_new, axis=1)
return h_new
================================================
FILE: chainer_chemistry/links/update/relgcn_update.py
================================================
import chainer
from chainer import functions
from chainer_chemistry.links.connection.graph_linear import GraphLinear
class RelGCNUpdate(chainer.Chain):
"""RelGUN submodule for update part.
Args:
in_channels (int or None): input channel dimension
out_channels (int): output channel dimension
num_edge_type (int): number of types of edge
"""
def __init__(self, in_channels, out_channels, n_edge_types=4,
**kwargs):
super(RelGCNUpdate, self).__init__()
with self.init_scope():
self.graph_linear_self = GraphLinear(in_channels, out_channels)
self.graph_linear_edge = GraphLinear(
in_channels, out_channels * n_edge_types)
self.n_edge_types = n_edge_types
self.in_channels = in_channels
self.out_channels = out_channels
def __call__(self, h, adj, **kwargs):
"""main calculation
Args:
h: (batchsize, num_nodes, in_channels)
adj: (batchsize, num_edge_type, num_nodes, num_nodes)
Returns:
(batchsize, num_nodes, ch)
"""
mb, node, ch = h.shape
# --- self connection, apply linear function ---
hs = self.graph_linear_self(h)
# --- relational feature, from neighbor connection ---
# Expected number of neighbors of a vertex
# Since you have to divide by it, if its 0, you need to
# arbitrarily set it to 1
m = self.graph_linear_edge(h)
m = functions.reshape(
m, (mb, node, self.out_channels, self.n_edge_types))
m = functions.transpose(m, (0, 3, 1, 2))
# m: (batchsize, edge_type, node, ch)
# hrL (batchsize, edge_type, node, ch)
hr = functions.matmul(adj, m)
# hr: (batchsize, node, ch)
hr = functions.sum(hr, axis=1)
return hs + hr
class RelGCNSparseUpdate(chainer.Chain):
"""sparse RelGCN submodule for update part"""
def __init__(self, in_channels, out_channels, n_edge_types):
super(RelGCNSparseUpdate, self).__init__()
self.out_channels = out_channels
self.n_edge_types = n_edge_types
with self.init_scope():
self.root_weight = chainer.links.Linear(in_channels, out_channels)
self.edge_weight = chainer.links.Linear(
in_channels, n_edge_types * out_channels)
def __call__(self, h, edge_index, edge_attr):
next_h = self.root_weight(h)
features = self.edge_weight(
h) .reshape(-1, self.n_edge_types, self.out_channels)
messages = features[edge_index[0], edge_attr, :]
return functions.scatter_add(next_h, edge_index[1], messages)
================================================
FILE: chainer_chemistry/links/update/rsgcn_update.py
================================================
import chainer
import chainer_chemistry
from chainer_chemistry.links.connection.graph_linear import GraphLinear
class RSGCNUpdate(chainer.Chain):
"""RSGCN submodule for message and update part.
Args:
in_channels (int or None): input channel dimension
out_channels (int): output channel dimension
"""
def __init__(self, in_channels, out_channels, **kwargs):
super(RSGCNUpdate, self).__init__()
with self.init_scope():
self.graph_linear = GraphLinear(
in_channels, out_channels, nobias=True)
self.in_channels = in_channels
self.out_channels = out_channels
def __call__(self, h, adj, **kwargs):
# --- Message part ---
h = chainer_chemistry.functions.matmul(adj, h)
# --- Update part ---
h = self.graph_linear(h)
return h
================================================
FILE: chainer_chemistry/links/update/schnet_update.py
================================================
"""
Chainer implementation of CFConv.
SchNet: A continuous-filter convolutional neural network for modeling
quantum interactions
Kristof et al.
See: https://arxiv.org/abs/1706.08566
"""
import chainer
from chainer import functions
from chainer import links
from chainer_chemistry.functions import shifted_softplus
from chainer_chemistry.links.connection.graph_linear import GraphLinear
class CFConv(chainer.Chain):
"""CFConv
Args:
num_rbf (int): Number of RBF kernel
radius_resolution (float): resolution of radius.
Roughly `num_rbf * radius_resolution` ball is convolved in 1 step.
gamma (float): coefficient to apply kernel.
hidden_dim (int): hidden dim
"""
def __init__(self, num_rbf=300, radius_resolution=0.1, gamma=10.0,
hidden_dim=64):
super(CFConv, self).__init__()
with self.init_scope():
self.dense1 = links.Linear(num_rbf, hidden_dim)
self.dense2 = links.Linear(hidden_dim)
self.hidden_dim = hidden_dim
self.num_rbf = num_rbf
self.radius_resolution = radius_resolution
self.gamma = gamma
def __call__(self, h, dist):
"""main calculation
Args:
h (numpy.ndarray): axis 0 represents minibatch index,
axis 1 represents atom_index and axis2 represents
feature dimension.
dist (numpy.ndarray): axis 0 represents minibatch index,
axis 1 and 2 represent distance between atoms.
"""
mb, atom, ch = h.shape
if ch != self.hidden_dim:
raise ValueError('h.shape[2] {} and hidden_dim {} must be same!'
.format(ch, self.hidden_dim))
embedlist = self.xp.arange(
self.num_rbf).astype('f') * self.radius_resolution
dist = functions.reshape(dist, (mb, atom, atom, 1))
dist = functions.broadcast_to(dist, (mb, atom, atom, self.num_rbf))
dist = functions.exp(- self.gamma * (dist - embedlist) ** 2)
dist = functions.reshape(dist, (-1, self.num_rbf))
dist = self.dense1(dist)
dist = shifted_softplus(dist)
dist = self.dense2(dist)
dist = shifted_softplus(dist)
dist = functions.reshape(dist, (mb, atom, atom, self.hidden_dim))
h = functions.reshape(h, (mb, atom, 1, self.hidden_dim))
h = functions.broadcast_to(h, (mb, atom, atom, self.hidden_dim))
h = functions.sum(h * dist, axis=1)
return h
class SchNetUpdate(chainer.Chain):
"""Update submodule for SchNet
`in_channels` and `hidden_channels` must be same with `hidden_channels` in
this module.
Args:
hidden_channels (int):
num_rbf (int):
radius_resolution (float):
gamma (float):
"""
def __init__(self, hidden_channels=64, num_rbf=300,
radius_resolution=0.1, gamma=10.0):
super(SchNetUpdate, self).__init__()
with self.init_scope():
self.linear = chainer.ChainList(
*[GraphLinear(None, hidden_channels) for _ in range(3)])
self.cfconv = CFConv(
num_rbf=num_rbf, radius_resolution=radius_resolution,
gamma=gamma, hidden_dim=hidden_channels)
self.hidden_channels = hidden_channels
def __call__(self, h, adj, **kwargs):
v = self.linear[0](h)
v = self.cfconv(v, adj)
v = self.linear[1](v)
v = shifted_softplus(v)
v = self.linear[2](v)
return h + v
================================================
FILE: chainer_chemistry/models/__init__.py
================================================
from chainer_chemistry.models import ggnn # NOQA
from chainer_chemistry.models import gin # NOQA
from chainer_chemistry.models import gwm # NOQA
from chainer_chemistry.models import mlp # NOQA
from chainer_chemistry.models import mpnn # NOQA
from chainer_chemistry.models import nfp # NOQA
from chainer_chemistry.models import prediction # NOQA
from chainer_chemistry.models import relgat # NOQA
from chainer_chemistry.models import relgcn # NOQA
from chainer_chemistry.models import rsgcn # NOQA
from chainer_chemistry.models import schnet # NOQA
from chainer_chemistry.models import weavenet # NOQA
from chainer_chemistry.models.ggnn import GGNN # NOQA
from chainer_chemistry.models.ggnn import SparseGGNN # NOQA
from chainer_chemistry.models.gin import GIN # NOQA
from chainer_chemistry.models.gnn_film import GNNFiLM # NOQA
from chainer_chemistry.models.mlp import MLP # NOQA
from chainer_chemistry.models.mpnn import MPNN # NOQA
from chainer_chemistry.models.nfp import NFP # NOQA
from chainer_chemistry.models.relgat import RelGAT # NOQA
from chainer_chemistry.models.relgcn import RelGCN # NOQA
from chainer_chemistry.models.rsgcn import RSGCN # NOQA
from chainer_chemistry.models.schnet import SchNet # NOQA
from chainer_chemistry.models.weavenet import WeaveNet # NOQA
from chainer_chemistry.models.gwm.gwm_net import GGNN_GWM # NOQA
from chainer_chemistry.models.gwm.gwm_net import GIN_GWM # NOQA
from chainer_chemistry.models.gwm.gwm_net import NFP_GWM # NOQA
from chainer_chemistry.models.gwm.gwm_net import RSGCN_GWM # NOQA
from chainer_chemistry.models.cwle.cwle_net import GGNN_CWLE # NOQA
from chainer_chemistry.models.cwle.cwle_net import RelGAT_CWLE # NOQA
from chainer_chemistry.models.cwle.cwle_net import RelGCN_CWLE # NOQA
from chainer_chemistry.models.cwle.cwle_net import GIN_CWLE # NOQA
from chainer_chemistry.models.cwle.cwle_net import NFP_CWLE # NOQA
from chainer_chemistry.models.cwle.cwle_net import RSGCN_CWLE # NOQA
from chainer_chemistry.models.gwle.gwle_net import GGNN_GWLE # NOQA
from chainer_chemistry.models.gwle.gwle_net import RelGAT_GWLE # NOQA
from chainer_chemistry.models.gwle.gwle_net import RelGCN_GWLE # NOQA
from chainer_chemistry.models.gwle.gwle_net import GIN_GWLE # NOQA
from chainer_chemistry.models.gwle.gwle_net import NFP_GWLE # NOQA
from chainer_chemistry.models.gwle.gwle_net import RSGCN_GWLE # NOQA
from chainer_chemistry.models.prediction.base import BaseForwardModel # NOQA
from chainer_chemistry.models.prediction.classifier import Classifier # NOQA
from chainer_chemistry.models.prediction.graph_conv_predictor import GraphConvPredictor # NOQA
from chainer_chemistry.models.prediction.regressor import Regressor # NOQA
from chainer_chemistry.models.prediction.set_up_predictor import set_up_predictor # NOQA
================================================
FILE: chainer_chemistry/models/cgcnn.py
================================================
import chainer
from chainer import links
from chainer_chemistry.links.readout.cgcnn_readout import CGCNNReadout
from chainer_chemistry.links.update.cgcnn_update import CGCNNUpdate
class CGCNN(chainer.Chain):
"""CGCNN
See Tian Xie et al, \
Crystal Graph Convolutional Neural Networks for an Accurate and
Interpretable Prediction of Material Properties. \
`arXiv:1710.10324 `_
Args:
out_dim (int): dimension of output feature vector
n_update_layers (int): number of CGCNNUpdate layers
n_atom_features (int): hidden dimension of atom feature vector
"""
def __init__(self, out_dim=128, n_update_layers=3, n_atom_features=64):
super(CGCNN, self).__init__()
with self.init_scope():
self.atom_feature_embedding = links.Linear(None, n_atom_features)
self.crystal_convs = chainer.ChainList(
*[CGCNNUpdate(n_atom_features) for _ in range(n_update_layers)]
)
self.readout = CGCNNReadout(out_dim=out_dim)
def __call__(self, atom_feat, nbr_feat, atom_idx, feat_idx):
# atom feature embedding
atom_feat = self.atom_feature_embedding(atom_feat)
# --- CGCNN update ---
for conv_layer in self.crystal_convs:
atom_feat = conv_layer(atom_feat, nbr_feat, feat_idx)
# --- CGCNN readout ---
pool = self.readout(atom_feat, atom_idx)
return pool
================================================
FILE: chainer_chemistry/models/cwle/__init__.py
================================================
#from chainer_chemistry.models.cwle import cwle
from chainer_chemistry.models.cwle import cwle_graph_conv_model
from chainer_chemistry.models.cwle import cwle_net
#from chainer_chemistry.models.cwle.gwm import GWM
from chainer_chemistry.models.cwle.cwle_graph_conv_model import CWLEGraphConvModel # NOQA
from chainer_chemistry.models.cwle.cwle_net import GGNN_CWLE # NOQA
from chainer_chemistry.models.cwle.cwle_net import RelGAT_CWLE # NOQA
from chainer_chemistry.models.cwle.cwle_net import RelGCN_CWLE # NOQA
from chainer_chemistry.models.cwle.cwle_net import GIN_CWLE # NOQA
from chainer_chemistry.models.cwle.cwle_net import NFP_CWLE # NOQA
from chainer_chemistry.models.cwle.cwle_net import RSGCN_CWLE # NOQA
================================================
FILE: chainer_chemistry/models/cwle/cwle_graph_conv_model.py
================================================
import chainer
from chainer import cuda
from chainer import links
from chainer import functions
from chainer_chemistry.links.connection.embed_atom_id import EmbedAtomID
from chainer_chemistry.links.connection.graph_linear import GraphLinear
from chainer_chemistry.links.normalization.graph_batch_normalization import GraphBatchNormalization # NOQA
from chainer_chemistry.links.readout.general_readout import GeneralReadout
from chainer_chemistry.config import MAX_ATOMIC_NUM
#from chainer_chemistry.models.gwm.gwm import GWM
from chainer_chemistry.models.relgcn import rescale_adj
MAX_WLE_NUM = 800
def to_array(x):
"""Convert x into numpy.ndarray or cupy.ndarray"""
if isinstance(x, chainer.Variable):
x = x.array
return x
class CWLEGraphConvModel(chainer.Chain):
"""Unified module of Graph Convolution Model with CWLE
Note that this module is experimental, all update_layer and
readout_layer combination is not supported.
Please refer `test_gwm_graph_conv_model.py` for tested combinations.
This module might not be maintained in the future.
Args:
hidden_channels (int or list): hidden channels for update
out_dim (int): output dim
update_layer (chainer.links.Link):
readout_layer (chainer.links.Link):
n_update_layers (int or None):
out_channels (None or lsit):
wle_dim (int):
n_atom_types (int):
n_edge_types (int):
dropout_ratio (float):
with_wle (bool): enabler for Combined NLE
concat_hidden (bool):
sum_hidden (bool):
weight_tying (bool):
scale_adj (bool):
activation (callable):
use_batchnorm (bool):
n_activation (int or None):
update_kwargs (dict or None):
readout_kwargs (dict or None):
wle_kwargs (dict or None):
n_wle_types (string):
"""
def __init__(self, hidden_channels, out_dim, update_layer, readout_layer,
n_update_layers=None, out_channels=None, wle_dim=None,
n_atom_types=MAX_ATOMIC_NUM, n_edge_types=4,
dropout_ratio=-1.0, with_wle=True,
concat_hidden=False, sum_hidden=False, weight_tying=False,
scale_adj=False, activation=None, use_batchnorm=False,
n_activation=None, update_kwargs=None, readout_kwargs=None,
wle_kwargs=None, n_wle_types=MAX_WLE_NUM):
super(CWLEGraphConvModel, self).__init__()
# General: length of hidden_channels must be n_layers + 1
if isinstance(hidden_channels, int):
if n_update_layers is None:
raise ValueError('n_update_layers is None')
else:
hidden_channels = [hidden_channels
for _ in range(n_update_layers + 1)]
elif isinstance(hidden_channels, list):
if out_channels is None:
n_update_layers = len(hidden_channels) - 1
else:
n_update_layers = len(hidden_channels)
else:
raise TypeError('Unexpected value for hidden_channels {}'
.format(hidden_channels))
if readout_layer == GeneralReadout and hidden_channels[-1] != out_dim:
# When use GWM, hidden channels must be same. But GeneralReadout
# cannot change the dimension. So when use General Readout and GWM,
# hidden channel and out_dim should be same.
if with_wle:
raise ValueError('Unsupported combination.')
else:
hidden_channels[-1] = out_dim
# When use with_gwm, concat_hidden, sum_hidden and weight_tying option,
# hidden_channels must be same
if with_wle or concat_hidden or sum_hidden or weight_tying:
if not all([in_dim == hidden_channels[0]
for in_dim in hidden_channels]):
raise ValueError(
'hidden_channels must be same but different {}'
.format(hidden_channels))
if with_wle and wle_dim is None:
print('[WARNING] wle_dim is None, set to {}'
.format(hidden_channels[0]))
wle_dim = hidden_channels[0]
if out_channels is None:
in_channels_list = hidden_channels[:-1]
out_channels_list = hidden_channels[1:]
else:
# For RelGAT concat_heads option
in_channels_list = hidden_channels
out_channels_list = out_channels
assert len(in_channels_list) == n_update_layers
assert len(out_channels_list) == n_update_layers
n_use_update_layers = 1 if weight_tying else n_update_layers
n_readout_layers = n_use_update_layers if concat_hidden or sum_hidden else 1
n_activation = n_use_update_layers if n_activation is None else n_activation
if update_kwargs is None:
update_kwargs = {}
if readout_kwargs is None:
readout_kwargs = {}
if wle_kwargs is None:
wle_kwargs = {}
with self.init_scope():
self.embed = EmbedAtomID(out_size=hidden_channels[0],
in_size=n_atom_types) # +1 for label 0
self.update_layers = chainer.ChainList(
*[update_layer(in_channels=in_channels_list[i],
out_channels=out_channels_list[i],
n_edge_types=n_edge_types, **update_kwargs)
for i in range(n_use_update_layers)])
# when use weight_tying option, hidden_channels must be same. So we can use -1 index
self.readout_layers = chainer.ChainList(
*[readout_layer(out_dim=out_dim,
# in_channels=hidden_channels[-1],
in_channels=None,
**readout_kwargs)
for _ in range(n_readout_layers)])
if with_wle:
self.embed_wle = links.EmbedID(out_size=wle_dim, in_size=n_wle_types)
self.linear_for_concat_wle = GraphLinear(in_size=wle_dim + hidden_channels[0],
out_size=hidden_channels[0])
if use_batchnorm:
self.bnorms = chainer.ChainList(
*[GraphBatchNormalization(
out_channels_list[i]) for i in range(n_use_update_layers)])
self.readout_layer = readout_layer
self.update_layer = update_layer
self.weight_tying = weight_tying
self.with_wle = with_wle
self.concat_hidden = concat_hidden
self.sum_hidden = sum_hidden
self.scale_adj = scale_adj
self.activation = activation
self.dropout_ratio = dropout_ratio
self.use_batchnorm = use_batchnorm
self.n_activation = n_activation
self.n_update_layers = n_update_layers
self.n_edge_types = n_edge_types
def __call__(self, atom_array, adj, wle_array=None, is_real_node=None):
self.reset_state()
if atom_array.dtype == self.xp.int32:
h = self.embed(atom_array)
else:
# TODO: GraphLinear or GraphMLP can be used.
h = atom_array
h0 = functions.copy(h, cuda.get_device_from_array(h.data).id)
# all Combined NLE processes are done here.
if self.with_wle:
h_s = self.embed_wle(wle_array)
h_h_s = functions.concat( (h, h_s), axis=2 )
h = self.linear_for_concat_wle(h_h_s)
additional_kwargs = self.preprocess_addtional_kwargs(
atom_array, adj, wle_array=wle_array, is_real_node=is_real_node)
if self.scale_adj:
adj = rescale_adj(adj)
g_list = []
for step in range(self.n_update_layers):
update_layer_index = 0 if self.weight_tying else step
h = self.update_layers[update_layer_index](
h=h, adj=adj, **additional_kwargs)
if self.use_batchnorm:
h = self.bnorms[update_layer_index](h)
if self.dropout_ratio > 0.:
h = functions.dropout(h, ratio=self.dropout_ratio)
if self.activation is not None and step < self.n_activation:
h = self.activation(h)
if self.concat_hidden or self.sum_hidden:
g = self.readout_layers[step](
h=h, h0=h0, is_real_node=is_real_node, **additional_kwargs)
g_list.append(g)
if self.concat_hidden:
return functions.concat(g_list, axis=1)
else:
if self.sum_hidden:
g = functions.sum(functions.stack(g_list), axis=0)
else:
g = self.readout_layers[0](
h=h, h0=h0, is_real_node=is_real_node)
return g
def reset_state(self):
if hasattr(self.update_layers[0], 'reset_state'):
[update_layer.reset_state() for update_layer in self.update_layers]
def preprocess_addtional_kwargs(self, *args, **kwargs):
return {}
================================================
FILE: chainer_chemistry/models/cwle/cwle_net.py
================================================
from chainer import functions
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links import GINUpdate, NFPReadout, NFPUpdate, \
RSGCNUpdate, GeneralReadout # NOQA
from chainer_chemistry.links.readout.ggnn_readout import GGNNReadout
from chainer_chemistry.links.update.ggnn_update import GGNNUpdate
from chainer_chemistry.links.update.relgat_update import RelGATUpdate
from chainer_chemistry.links.update.relgcn_update \
import RelGCNUpdate, RelGCNSparseUpdate
from chainer_chemistry.models.cwle.cwle_graph_conv_model import CWLEGraphConvModel # NOQA
from chainer_chemistry.models.cwle.cwle_graph_conv_model import to_array
from chainer_chemistry.models.cwle.cwle_graph_conv_model import MAX_WLE_NUM
class GGNN_CWLE(CWLEGraphConvModel):
def __init__(self, out_dim, hidden_channels=16, n_update_layers=4,
n_atom_types=MAX_ATOMIC_NUM, concat_hidden=False,
weight_tying=True, activation=functions.identity,
n_edge_types=4, with_wle=True, n_wle_types=MAX_WLE_NUM):
readout_kwargs = {'activation': activation,
'activation_agg': activation}
super(GGNN_CWLE, self).__init__(
update_layer=GGNNUpdate, readout_layer=GGNNReadout,
out_dim=out_dim, hidden_channels=hidden_channels,
n_update_layers=n_update_layers,
n_atom_types=n_atom_types, concat_hidden=concat_hidden,
weight_tying=weight_tying, n_edge_types=n_edge_types,
with_wle=with_wle, readout_kwargs=readout_kwargs,
n_wle_types=n_wle_types)
class RelGCN_CWLE(CWLEGraphConvModel):
def __init__(self, out_dim, hidden_channels=16, n_update_layers=4,
n_atom_types=MAX_ATOMIC_NUM, concat_hidden=False,
weight_tying=True, activation=functions.identity,
n_edge_types=4, with_wle=True, n_wle_types=MAX_WLE_NUM):
readout_kwargs = {'activation': activation,
'activation_agg': activation}
super(RelGCN_CWLE, self).__init__(
update_layer=RelGCNUpdate, readout_layer=GGNNReadout,
out_dim=out_dim, hidden_channels=hidden_channels,
n_update_layers=n_update_layers,
n_atom_types=n_atom_types, concat_hidden=concat_hidden,
weight_tying=weight_tying, n_edge_types=n_edge_types,
with_wle=with_wle, readout_kwargs=readout_kwargs,
n_wle_types=n_wle_types)
class RelGAT_CWLE(CWLEGraphConvModel):
def __init__(self, out_dim, hidden_channels=16, n_update_layers=4,
n_atom_types=MAX_ATOMIC_NUM, concat_hidden=False,
weight_tying=True, activation=functions.identity,
n_edge_types=4, with_wle=True, n_wle_types=MAX_WLE_NUM):
readout_kwargs = {'activation': activation,
'activation_agg': activation}
super(RelGAT_CWLE, self).__init__(
update_layer=RelGATUpdate, readout_layer=GGNNReadout,
out_dim=out_dim, hidden_channels=hidden_channels,
n_update_layers=n_update_layers,
n_atom_types=n_atom_types, concat_hidden=concat_hidden,
weight_tying=weight_tying, n_edge_types=n_edge_types,
with_wle=with_wle, readout_kwargs=readout_kwargs,
n_wle_types=n_wle_types)
class GIN_CWLE(CWLEGraphConvModel):
def __init__(self, out_dim, hidden_channels=16,
n_update_layers=4, n_atom_types=MAX_ATOMIC_NUM,
dropout_ratio=0.5, concat_hidden=False,
weight_tying=True, activation=functions.identity,
n_edge_types=4, with_wle=True, n_wle_types=MAX_WLE_NUM):
update_kwargs = {'dropout_ratio': dropout_ratio}
readout_kwargs = {'activation': activation,
'activation_agg': activation}
super(GIN_CWLE, self).__init__(
update_layer=GINUpdate, readout_layer=GGNNReadout,
out_dim=out_dim, hidden_channels=hidden_channels,
n_update_layers=n_update_layers, n_atom_types=n_atom_types,
concat_hidden=concat_hidden, weight_tying=weight_tying,
n_edge_types=n_edge_types, with_wle=with_wle,
update_kwargs=update_kwargs, readout_kwargs=readout_kwargs,
n_wle_types=n_wle_types)
class NFP_CWLE(CWLEGraphConvModel):
def __init__(self, out_dim, hidden_channels=16, n_update_layers=4,
max_degree=6, n_atom_types=MAX_ATOMIC_NUM,
concat_hidden=False, with_wle=True, n_wle_types=MAX_WLE_NUM):
update_kwargs = {'max_degree': max_degree}
super(NFP_CWLE, self).__init__(
update_layer=NFPUpdate, readout_layer=NFPReadout,
out_dim=out_dim, hidden_channels=hidden_channels,
n_update_layers=n_update_layers,
n_atom_types=n_atom_types, concat_hidden=concat_hidden,
sum_hidden=True, with_wle=with_wle, update_kwargs=update_kwargs,
n_wle_types=n_wle_types)
self.max_degree = max_degree
self.n_degree_type = max_degree + 1
self.ch0 = hidden_channels
def preprocess_addtional_kwargs(self, *args, **kwargs):
atom_array, adj = args[:2]
bs, num_node = atom_array.shape[:2]
# For NFP Update
if adj.ndim == 4:
degree_mat = self.xp.sum(to_array(adj), axis=(1, 2))
elif adj.ndim == 3:
degree_mat = self.xp.sum(to_array(adj), axis=1)
else:
raise ValueError('Unexpected value adj '
.format(adj.shape))
# deg_conds: (minibatch, atom, ch)
deg_conds = [self.xp.broadcast_to(
((degree_mat - degree) == 0)[:, :, None],
(bs, num_node, self.ch0))
for degree in range(1, self.n_degree_type + 1)]
return {'deg_conds': deg_conds}
class RSGCN_CWLE(CWLEGraphConvModel):
def __init__(self, out_dim, hidden_channels=32, n_update_layers=4,
n_atom_types=MAX_ATOMIC_NUM,
use_batch_norm=False, readout=None, dropout_ratio=0.5,
with_wle=True, n_wle_types=MAX_WLE_NUM):
if readout is None:
readout = GeneralReadout
super(RSGCN_CWLE, self).__init__(
update_layer=RSGCNUpdate, readout_layer=readout,
out_dim=out_dim, hidden_channels=hidden_channels,
n_update_layers=n_update_layers, n_atom_types=n_atom_types,
use_batchnorm=use_batch_norm, activation=functions.relu,
n_activation=n_update_layers-1, dropout_ratio=dropout_ratio,
with_wle=with_wle, n_wle_types=n_wle_types)
================================================
FILE: chainer_chemistry/models/ggnn.py
================================================
import chainer
from chainer import functions, cuda # NOQA
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links import EmbedAtomID
from chainer_chemistry.links.readout.ggnn_readout import GGNNReadout
from chainer_chemistry.links.update.ggnn_update import GGNNUpdate
from chainer_chemistry.utils import convert_sparse_with_edge_type
class GGNN(chainer.Chain):
"""Gated Graph Neural Networks (GGNN)
See: Li, Y., Tarlow, D., Brockschmidt, M., & Zemel, R. (2015).\
Gated graph sequence neural networks. \
`arXiv:1511.05493 `_
Args:
out_dim (int): dimension of output feature vector
hidden_channels (int): dimension of feature vector for each node
n_update_layers (int): number of layers
n_atom_types (int): number of types of atoms
concat_hidden (bool): If set to True, readout is executed in each layer
and the result is concatenated
weight_tying (bool): enable weight_tying or not
activation (~chainer.Function or ~chainer.FunctionNode):
activate function
n_edge_types (int): number of edge type.
Defaults to 4 for single, double, triple and aromatic bond.
"""
def __init__(self, out_dim, hidden_channels=16, n_update_layers=4,
n_atom_types=MAX_ATOMIC_NUM, concat_hidden=False,
weight_tying=True, activation=functions.identity,
n_edge_types=4):
super(GGNN, self).__init__()
n_readout_layer = n_update_layers if concat_hidden else 1
n_message_layer = 1 if weight_tying else n_update_layers
with self.init_scope():
# Update
self.embed = EmbedAtomID(
out_size=hidden_channels, in_size=n_atom_types)
self.update_layers = chainer.ChainList(*[GGNNUpdate(
hidden_channels=hidden_channels, n_edge_types=n_edge_types)
for _ in range(n_message_layer)])
# Readout
self.readout_layers = chainer.ChainList(*[GGNNReadout(
out_dim=out_dim, in_channels=hidden_channels * 2,
activation=activation, activation_agg=activation)
for _ in range(n_readout_layer)])
self.out_dim = out_dim
self.hidden_channels = hidden_channels
self.n_update_layers = n_update_layers
self.n_edge_types = n_edge_types
self.activation = activation
self.concat_hidden = concat_hidden
self.weight_tying = weight_tying
def __call__(self, atom_array, adj, is_real_node=None):
"""Forward propagation
Args:
atom_array (numpy.ndarray): minibatch of molecular which is
represented with atom IDs (representing C, O, S, ...)
`atom_array[mol_index, atom_index]` represents `mol_index`-th
molecule's `atom_index`-th atomic number
adj (numpy.ndarray): minibatch of adjancency matrix with edge-type
information
is_real_node (numpy.ndarray): 2-dim array (minibatch, num_nodes).
1 for real node, 0 for virtual node.
If `None`, all node is considered as real node.
Returns:
~chainer.Variable: minibatch of fingerprint
"""
# reset state
self.reset_state()
if atom_array.dtype == self.xp.int32:
h = self.embed(atom_array) # (minibatch, max_num_atoms)
else:
h = atom_array
h0 = functions.copy(h, cuda.get_device_from_array(h.data).id)
g_list = []
for step in range(self.n_update_layers):
message_layer_index = 0 if self.weight_tying else step
h = self.update_layers[message_layer_index](h, adj)
if self.concat_hidden:
g = self.readout_layers[step](h, h0, is_real_node)
g_list.append(g)
if self.concat_hidden:
return functions.concat(g_list, axis=1)
else:
g = self.readout_layers[0](h, h0, is_real_node)
return g
def reset_state(self):
[update_layer.reset_state() for update_layer in self.update_layers]
class SparseGGNN(GGNN):
"""GGNN model for sparse matrix inputs.
The constructor of this model is the same with that of GGNN.
See the documentation of GGNN for the detail.
"""
def __init__(self, *args, **kwargs):
super(SparseGGNN, self).__init__(*args, **kwargs)
def __call__(self, atom_array, data, row, col, edge_type,
is_real_node=None):
"""Forward propagation
Args:
atom_array (numpy.ndarray): minibatch of molecular which is
represented with atom IDs (representing C, O, S, ...)
`atom_array[mol_index, atom_index]` represents `mol_index`-th
molecule's `atom_index`-th atomic number
data (numpy.ndarray): the entries of the batched sparse matrix.
row (numpy.ndarray): the row indices of the matrix entries.
col (numpy.ndarray): the column indices of the matrix entries.
edge_type (numpy.ndarray): edge type information of edges.
is_real_node (numpy.ndarray): 2-dim array (minibatch, num_nodes).
1 for real node, 0 for virtual node.
If `None`, all node is considered as real node.
Returns:
~chainer.Variable: minibatch of fingerprint
"""
num_nodes = atom_array.shape[1]
adj = convert_sparse_with_edge_type(
data, row, col, num_nodes, edge_type, self.n_edge_types)
return super(SparseGGNN, self).__call__(
atom_array, adj, is_real_node=is_real_node)
================================================
FILE: chainer_chemistry/models/gin.py
================================================
import chainer
from chainer import functions, cuda # NOQA
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links import EmbedAtomID
from chainer_chemistry.links.readout.ggnn_readout import GGNNReadout
from chainer_chemistry.links.readout.scatter_ggnn_readout import ScatterGGNNReadout # NOQA
from chainer_chemistry.links.update.gin_update import GINUpdate, GINSparseUpdate # NOQA
class GIN(chainer.Chain):
"""Simple implementation of Graph Isomorphism Network (GIN)
See: Xu, Hu, Leskovec, and Jegelka, \
"How powerful are graph neural networks?", in ICLR 2019.
Args:
out_dim (int): dimension of output feature vector
hidden_channels (int): dimension of feature vector for each node
n_update_layers (int): number of layers
n_atom_types (int): number of types of atoms
concat_hidden (bool): If set to True, readout is executed in each layer
and the result is concatenated
dropout_ratio (float): dropout ratio. Negative value indicates not
apply dropout
weight_tying (bool): enable weight_tying or not
activation (~chainer.Function or ~chainer.FunctionNode):
activate function
n_edge_types (int): number of edge type.
Defaults to 4 for single, double, triple and aromatic bond.
"""
def __init__(self, out_dim, node_embedding=False, hidden_channels=16,
out_channels=None,
n_update_layers=4, n_atom_types=MAX_ATOMIC_NUM,
dropout_ratio=0.5, concat_hidden=False,
weight_tying=False, activation=functions.identity,
n_edge_types=4):
super(GIN, self).__init__()
n_message_layer = 1 if weight_tying else n_update_layers
n_readout_layer = n_update_layers if concat_hidden else 1
with self.init_scope():
# embedding
self.embed = EmbedAtomID(out_size=hidden_channels,
in_size=n_atom_types)
self.first_mlp = GINUpdate(
hidden_channels=hidden_channels, dropout_ratio=dropout_ratio,
out_channels=hidden_channels).graph_mlp
# two non-linear MLP part
if out_channels is None:
out_channels = hidden_channels
self.update_layers = chainer.ChainList(*[GINUpdate(
hidden_channels=hidden_channels, dropout_ratio=dropout_ratio,
out_channels=(out_channels if i == n_message_layer - 1 else
hidden_channels))
for i in range(n_message_layer)])
# Readout
self.readout_layers = chainer.ChainList(*[GGNNReadout(
out_dim=out_dim, in_channels=hidden_channels * 2,
activation=activation, activation_agg=activation)
for _ in range(n_readout_layer)])
# end with
self.node_embedding = node_embedding
self.out_dim = out_dim
self.hidden_channels = hidden_channels
self.n_update_layers = n_update_layers
self.n_message_layers = n_message_layer
self.n_readout_layer = n_readout_layer
self.dropout_ratio = dropout_ratio
self.concat_hidden = concat_hidden
self.weight_tying = weight_tying
self.n_edge_types = n_edge_types
def __call__(self, atom_array, adj, is_real_node=None):
"""forward propagation
Args:
atom_array (numpy.ndarray): mol-minibatch by node numpy.ndarray,
minibatch of molecular which is represented with atom IDs
(representing C, O, S, ...) atom_array[m, i] = a represents
m-th molecule's i-th node is value a (atomic number)
adj (numpy.ndarray): mol-minibatch by relation-types by node by
node numpy.ndarray,
minibatch of multple relational adjancency matrix with
edge-type information adj[i, j] = b represents
m-th molecule's edge from node i to node j has value b
is_real_node:
Returns:
numpy.ndarray: final molecule representation
"""
if atom_array.dtype == self.xp.int32:
h = self.embed(atom_array) # (minibatch, max_num_atoms)
else:
h = atom_array
h0 = functions.copy(h, cuda.get_device_from_array(h.data).id)
g_list = []
for step in range(self.n_update_layers):
message_layer_index = 0 if self.weight_tying else step
h = self.update_layers[message_layer_index](h, adj)
if step != self.n_message_layers - 1:
h = functions.relu(h)
if self.concat_hidden:
g = self.readout_layers[step](h, h0, is_real_node)
g_list.append(g)
if self.node_embedding:
return h
if self.concat_hidden:
return functions.concat(g_list, axis=1)
else:
g = self.readout_layers[0](h, h0, is_real_node)
return g
class GINSparse(chainer.Chain):
"""Simple implementation of sparseGraph Isomorphism Network (GIN)"""
def __init__(self, out_dim, node_embedding=False, hidden_channels=16,
out_channels=None,
n_update_layers=4, n_atom_types=MAX_ATOMIC_NUM,
dropout_ratio=0.5, concat_hidden=False,
weight_tying=False, activation=functions.identity,
n_edge_types=4):
super(GINSparse, self).__init__()
n_message_layer = 1 if weight_tying else n_update_layers
n_readout_layer = n_update_layers if concat_hidden else 1
with self.init_scope():
# embedding
self.embed = EmbedAtomID(out_size=hidden_channels,
in_size=n_atom_types)
self.first_mlp = GINSparseUpdate(
hidden_channels=hidden_channels, dropout_ratio=dropout_ratio,
out_channels=hidden_channels).mlp
# two non-linear MLP part
if out_channels is None:
out_channels = hidden_channels
self.update_layers = chainer.ChainList(*[GINSparseUpdate(
hidden_channels=hidden_channels, dropout_ratio=dropout_ratio,
out_channels=(out_channels if i == n_message_layer - 1 else
hidden_channels))
for i in range(n_message_layer)])
# Readout
self.readout_layers = chainer.ChainList(*[ScatterGGNNReadout(
out_dim=out_dim, in_channels=hidden_channels * 2,
activation=activation, activation_agg=activation)
for _ in range(n_readout_layer)])
# end with
self.node_embedding = node_embedding
self.out_dim = out_dim
self.hidden_channels = hidden_channels
self.n_message_layers = n_message_layer
self.n_readout_layer = n_readout_layer
self.dropout_ratio = dropout_ratio
self.concat_hidden = concat_hidden
self.weight_tying = weight_tying
self.n_edge_types = n_edge_types
def __call__(self, sparse_batch, is_real_node=None):
if sparse_batch.x.dtype == self.xp.int32:
h = self.embed(sparse_batch.x) # (minibatch, max_num_atoms)
else:
h = self.first_mlp(sparse_batch.x)
h0 = functions.copy(h, cuda.get_device_from_array(h.data).id)
g_list = []
for step in range(self.n_message_layers):
message_layer_index = 0 if self.weight_tying else step
h = self.update_layers[message_layer_index](
h, sparse_batch.edge_index)
if step != self.n_message_layers - 1:
h = functions.relu(h)
if self.concat_hidden:
g = self.readout_layers[step](h, h0, is_real_node)
g_list.append(g)
if self.node_embedding:
return h
if self.concat_hidden:
return functions.concat(g_list, axis=1)
else:
g = self.readout_layers[0](h, sparse_batch.batch, h0, is_real_node)
return g
================================================
FILE: chainer_chemistry/models/gnn_film.py
================================================
import chainer
from chainer import cuda
from chainer import functions
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links.connection.embed_atom_id import EmbedAtomID
from chainer_chemistry.links.readout.ggnn_readout import GGNNReadout
from chainer_chemistry.links.update.gnn_film_update import GNNFiLMUpdate
class GNNFiLM(chainer.Chain):
"""Graph Neural Networks with Feature-wise Linear Modulation (GNN_FiLM)
Marc Brockschmidt (2019).\
GNN-FiLM: Graph Neural Networks with Feature-wise Linear Modulation \
`arXiv:1906.12192 `_
Args:
out_dim (int): dimension of output feature vector
hidden_channels (int): dimension of feature vector
associated to each atom
n_update_layers (int): number of layers
n_atom_types (int): number of types of atoms
concat_hidden (bool): If set to True, readout is executed in each layer
and the result is concatenated
weight_tying (bool): enable weight_tying or not
activation (~chainer.Function or ~chainer.FunctionNode):
activate function
n_edge_types (int): number of edge type.
Defaults to 5 for single, double, triple, aromatic bond
and self-connection.
"""
def __init__(self, out_dim, hidden_channels=16, n_update_layers=4,
n_atom_types=MAX_ATOMIC_NUM, concat_hidden=False,
weight_tying=True, activation=functions.identity,
n_edge_types=5):
super(GNNFiLM, self).__init__()
n_readout_layer = n_update_layers if concat_hidden else 1
n_message_layer = 1 if weight_tying else n_update_layers
with self.init_scope():
# Update
self.embed = EmbedAtomID(out_size=hidden_channels,
in_size=n_atom_types)
self.update_layers = chainer.ChainList(*[GNNFiLMUpdate(
hidden_channels=hidden_channels, n_edge_types=n_edge_types)
for _ in range(n_message_layer)])
# Readout
# self.readout_layers = chainer.ChainList(*[GeneralReadout(
# out_dim=out_dim, hidden_channels=hidden_channels,
# activation=activation, activation_agg=activation)
# for _ in range(n_readout_layer)])
self.readout_layers = chainer.ChainList(*[GGNNReadout(
out_dim=out_dim, in_channels=hidden_channels * 2,
activation=activation, activation_agg=activation)
for _ in range(n_readout_layer)])
self.out_dim = out_dim
self.hidden_channels = hidden_channels
self.n_update_layers = n_update_layers
self.n_edge_types = n_edge_types
self.activation = activation
self.concat_hidden = concat_hidden
self.weight_tying = weight_tying
def __call__(self, atom_array, adj, is_real_node=None):
"""Forward propagation
Args:
atom_array (numpy.ndarray): minibatch of molecular which is
represented with atom IDs (representing C, O, S, ...)
`atom_array[mol_index, atom_index]` represents `mol_index`-th
molecule's `atom_index`-th atomic number
adj (numpy.ndarray): minibatch of adjancency matrix with edge-type
information
is_real_node (numpy.ndarray): 2-dim array (minibatch, num_nodes).
1 for real node, 0 for virtual node.
If `None`, all node is considered as real node.
Returns:
~chainer.Variable: minibatch of fingerprint
"""
# reset state
# self.reset_state()
if atom_array.dtype == self.xp.int32:
h = self.embed(atom_array) # (minibatch, max_num_atoms)
else:
h = atom_array
h0 = functions.copy(h, cuda.get_device_from_array(h.data).id)
g_list = []
for step in range(self.n_update_layers):
message_layer_index = 0 if self.weight_tying else step
h = self.update_layers[message_layer_index](h, adj)
if self.concat_hidden:
g = self.readout_layers[step](h, h0, is_real_node)
g_list.append(g)
if self.concat_hidden:
return functions.concat(g_list, axis=1)
else:
g = self.readout_layers[0](h, h0, is_real_node)
return g
def reset_state(self):
[update_layer.reset_state() for update_layer in self.update_layers]
================================================
FILE: chainer_chemistry/models/gwle/__init__.py
================================================
#from chainer_chemistry.models.cwle import cwle
from chainer_chemistry.models.gwle import gwle_graph_conv_model
from chainer_chemistry.models.gwle import gwle_net
from chainer_chemistry.models.gwle.gwle_net import GGNN_GWLE # NOQA
from chainer_chemistry.models.gwle.gwle_net import RelGAT_GWLE # NOQA
from chainer_chemistry.models.gwle.gwle_net import RelGCN_GWLE # NOQA
from chainer_chemistry.models.gwle.gwle_net import GIN_GWLE # NOQA
from chainer_chemistry.models.gwle.gwle_net import NFP_GWLE # NOQA
from chainer_chemistry.models.gwle.gwle_net import RSGCN_GWLE # NOQA
================================================
FILE: chainer_chemistry/models/gwle/gwle_graph_conv_model.py
================================================
import chainer
from chainer import cuda
from chainer import links
from chainer import functions
from chainer_chemistry.links.connection.embed_atom_id import EmbedAtomID
from chainer_chemistry.links.connection.graph_linear import GraphLinear
from chainer_chemistry.links.normalization.graph_batch_normalization import GraphBatchNormalization # NOQA
from chainer_chemistry.links.readout.general_readout import GeneralReadout
from chainer_chemistry.config import MAX_ATOMIC_NUM
#from chainer_chemistry.models.gwm.gwm import GWM
from chainer_chemistry.models.relgcn import rescale_adj
MAX_WLE_NUM = 800
def to_array(x):
"""Convert x into numpy.ndarray or cupy.ndarray"""
if isinstance(x, chainer.Variable):
x = x.array
return x
class GWLEGraphConvModel(chainer.Chain):
"""Unified module of Graph Convolution Model with GWLE
Note that this module is experimental, all update_layer and
readout_layer combination is not supported.
Please refer `test_gwm_graph_conv_model.py` for tested combinations.
This module might not be maintained in the future.
Args:
hidden_channels (int or list): hidden channels for update
out_dim (int): output dim
update_layer (chainer.links.Link):
readout_layer (chainer.links.Link):
n_update_layers (int or None):
out_channels (None or lsit):
wle_dim (int):
n_atom_types (int):
n_edge_types (int):
dropout_ratio (float):
with_wle (bool): enabler for Combined NLE
concat_hidden (bool):
sum_hidden (bool):
weight_tying (bool):
scale_adj (bool):
activation (callable):
use_batchnorm (bool):
n_activation (int or None):
update_kwargs (dict or None):
readout_kwargs (dict or None):
wle_kwargs (dict or None):
n_wle_types (int):
"""
def __init__(self, hidden_channels, out_dim, update_layer, readout_layer,
n_update_layers=None, out_channels=None, wle_dim=None,
n_atom_types=MAX_ATOMIC_NUM, n_edge_types=4,
dropout_ratio=-1.0, with_wle=True,
concat_hidden=False, sum_hidden=False, weight_tying=False,
scale_adj=False, activation=None, use_batchnorm=False,
n_activation=None, update_kwargs=None, readout_kwargs=None,
wle_kwargs=None, n_wle_types=MAX_WLE_NUM):
super(GWLEGraphConvModel, self).__init__()
# General: length of hidden_channels must be n_layers + 1
if isinstance(hidden_channels, int):
if n_update_layers is None:
raise ValueError('n_update_layers is None')
else:
hidden_channels = [hidden_channels
for _ in range(n_update_layers + 1)]
elif isinstance(hidden_channels, list):
if out_channels is None:
n_update_layers = len(hidden_channels) - 1
else:
n_update_layers = len(hidden_channels)
else:
raise TypeError('Unexpected value for hidden_channels {}'
.format(hidden_channels))
if readout_layer == GeneralReadout and hidden_channels[-1] != out_dim:
# When use GWM, hidden channels must be same. But GeneralReadout
# cannot change the dimension. So when use General Readout and GWM,
# hidden channel and out_dim should be same.
if with_wle:
raise ValueError('Unsupported combination.')
else:
hidden_channels[-1] = out_dim
# When use with_gwm, concat_hidden, sum_hidden and weight_tying option,
# hidden_channels must be same
if with_wle or concat_hidden or sum_hidden or weight_tying:
if not all([in_dim == hidden_channels[0]
for in_dim in hidden_channels]):
raise ValueError(
'hidden_channels must be same but different {}'
.format(hidden_channels))
if with_wle and wle_dim is None:
print('[WARNING] wle_dim is None, set to {}'
.format(hidden_channels[0]))
wle_dim = hidden_channels[0]
if out_channels is None:
in_channels_list = hidden_channels[:-1]
out_channels_list = hidden_channels[1:]
else:
# For RelGAT concat_heads option
in_channels_list = hidden_channels
out_channels_list = out_channels
assert len(in_channels_list) == n_update_layers
assert len(out_channels_list) == n_update_layers
n_use_update_layers = 1 if weight_tying else n_update_layers
n_readout_layers = n_use_update_layers if concat_hidden or sum_hidden else 1
n_activation = n_use_update_layers if n_activation is None else n_activation
if update_kwargs is None:
update_kwargs = {}
if readout_kwargs is None:
readout_kwargs = {}
if wle_kwargs is None:
wle_kwargs = {}
with self.init_scope():
self.embed = EmbedAtomID(out_size=hidden_channels[0],
in_size=n_atom_types) # +1 for label 0
self.update_layers = chainer.ChainList(
*[update_layer(in_channels=in_channels_list[i],
out_channels=out_channels_list[i],
n_edge_types=n_edge_types, **update_kwargs)
for i in range(n_use_update_layers)])
# when use weight_tying option, hidden_channels must be same. So we can use -1 index
self.readout_layers = chainer.ChainList(
*[readout_layer(out_dim=out_dim,
# in_channels=hidden_channels[-1],
in_channels=None,
**readout_kwargs)
for _ in range(n_readout_layers)])
if with_wle:
self.embed_wle = links.EmbedID(out_size=wle_dim, in_size=n_wle_types)
# Gates
self.gate_W1 = GraphLinear(in_size=hidden_channels[0], out_size=hidden_channels[0])
self.gate_W2 = GraphLinear(in_size=wle_dim, out_size=hidden_channels[0])
if use_batchnorm:
self.bnorms = chainer.ChainList(
*[GraphBatchNormalization(
out_channels_list[i]) for i in range(n_use_update_layers)])
self.readout_layer = readout_layer
self.update_layer = update_layer
self.weight_tying = weight_tying
self.with_wle = with_wle
self.concat_hidden = concat_hidden
self.sum_hidden = sum_hidden
self.scale_adj = scale_adj
self.activation = activation
self.dropout_ratio = dropout_ratio
self.use_batchnorm = use_batchnorm
self.n_activation = n_activation
self.n_update_layers = n_update_layers
self.n_edge_types = n_edge_types
def __call__(self, atom_array, adj, wle_array=None, is_real_node=None):
self.reset_state()
if atom_array.dtype == self.xp.int32:
h = self.embed(atom_array)
else:
# TODO: GraphLinear or GraphMLP can be used.
h = atom_array
h0 = functions.copy(h, cuda.get_device_from_array(h.data).id)
# all Combined NLE processes are done here.
if self.with_wle:
h_s = self.embed_wle(wle_array)
# gated sum
gate_input = self.gate_W1(h) + self.gate_W2(h_s)
gate_coefff = functions.sigmoid(gate_input)
h = (1.0 - gate_coefff) * h + gate_coefff * h_s
additional_kwargs = self.preprocess_addtional_kwargs(
atom_array, adj, wle_array=wle_array, is_real_node=is_real_node)
if self.scale_adj:
adj = rescale_adj(adj)
g_list = []
for step in range(self.n_update_layers):
update_layer_index = 0 if self.weight_tying else step
h = self.update_layers[update_layer_index](
h=h, adj=adj, **additional_kwargs)
if self.use_batchnorm:
h = self.bnorms[update_layer_index](h)
if self.dropout_ratio > 0.:
h = functions.dropout(h, ratio=self.dropout_ratio)
if self.activation is not None and step < self.n_activation:
h = self.activation(h)
if self.concat_hidden or self.sum_hidden:
g = self.readout_layers[step](
h=h, h0=h0, is_real_node=is_real_node, **additional_kwargs)
g_list.append(g)
if self.concat_hidden:
return functions.concat(g_list, axis=1)
else:
if self.sum_hidden:
g = functions.sum(functions.stack(g_list), axis=0)
else:
g = self.readout_layers[0](
h=h, h0=h0, is_real_node=is_real_node)
return g
def reset_state(self):
if hasattr(self.update_layers[0], 'reset_state'):
[update_layer.reset_state() for update_layer in self.update_layers]
def preprocess_addtional_kwargs(self, *args, **kwargs):
return {}
================================================
FILE: chainer_chemistry/models/gwle/gwle_net.py
================================================
from chainer import functions
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links import GINUpdate, NFPReadout, NFPUpdate, \
RSGCNUpdate, GeneralReadout # NOQA
from chainer_chemistry.links.readout.ggnn_readout import GGNNReadout
from chainer_chemistry.links.update.ggnn_update import GGNNUpdate
from chainer_chemistry.links.update.relgat_update import RelGATUpdate
from chainer_chemistry.links.update.relgcn_update \
import RelGCNUpdate, RelGCNSparseUpdate
from chainer_chemistry.models.gwle.gwle_graph_conv_model import GWLEGraphConvModel # NOQA
from chainer_chemistry.models.cwle.cwle_graph_conv_model import to_array
from chainer_chemistry.models.cwle.cwle_graph_conv_model import MAX_WLE_NUM
class GGNN_GWLE(GWLEGraphConvModel):
def __init__(self, out_dim, hidden_channels=16, n_update_layers=4,
n_atom_types=MAX_ATOMIC_NUM, concat_hidden=False,
weight_tying=True, activation=functions.identity,
n_edge_types=4, with_wle=True, n_wle_types=MAX_WLE_NUM):
readout_kwargs = {'activation': activation,
'activation_agg': activation}
super(GGNN_GWLE, self).__init__(
update_layer=GGNNUpdate, readout_layer=GGNNReadout,
out_dim=out_dim, hidden_channels=hidden_channels,
n_update_layers=n_update_layers,
n_atom_types=n_atom_types, concat_hidden=concat_hidden,
weight_tying=weight_tying, n_edge_types=n_edge_types,
with_wle=with_wle, readout_kwargs=readout_kwargs,
n_wle_types=n_wle_types)
class RelGCN_GWLE(GWLEGraphConvModel):
def __init__(self, out_dim, hidden_channels=16, n_update_layers=4,
n_atom_types=MAX_ATOMIC_NUM, concat_hidden=False,
weight_tying=True, activation=functions.identity,
n_edge_types=4, with_wle=True, n_wle_types=MAX_WLE_NUM):
readout_kwargs = {'activation': activation,
'activation_agg': activation}
super(RelGCN_GWLE, self).__init__(
update_layer=RelGCNUpdate, readout_layer=GGNNReadout,
out_dim=out_dim, hidden_channels=hidden_channels,
n_update_layers=n_update_layers,
n_atom_types=n_atom_types, concat_hidden=concat_hidden,
weight_tying=weight_tying, n_edge_types=n_edge_types,
with_wle=with_wle, readout_kwargs=readout_kwargs,
n_wle_types=n_wle_types)
class RelGAT_GWLE(GWLEGraphConvModel):
def __init__(self, out_dim, hidden_channels=16, n_update_layers=4,
n_atom_types=MAX_ATOMIC_NUM, concat_hidden=False,
weight_tying=True, activation=functions.identity,
n_edge_types=4, with_wle=True, n_wle_types=MAX_WLE_NUM):
readout_kwargs = {'activation': activation,
'activation_agg': activation}
super(RelGAT_GWLE, self).__init__(
update_layer=RelGATUpdate, readout_layer=GGNNReadout,
out_dim=out_dim, hidden_channels=hidden_channels,
n_update_layers=n_update_layers,
n_atom_types=n_atom_types, concat_hidden=concat_hidden,
weight_tying=weight_tying, n_edge_types=n_edge_types,
with_wle=with_wle, readout_kwargs=readout_kwargs,
n_wle_types=n_wle_types)
class GIN_GWLE(GWLEGraphConvModel):
def __init__(self, out_dim, hidden_channels=16,
n_update_layers=4, n_atom_types=MAX_ATOMIC_NUM,
dropout_ratio=0.5, concat_hidden=False,
weight_tying=True, activation=functions.identity,
n_edge_types=4, with_wle=True, n_wle_types=MAX_WLE_NUM):
update_kwargs = {'dropout_ratio': dropout_ratio}
readout_kwargs = {'activation': activation,
'activation_agg': activation}
super(GIN_GWLE, self).__init__(
update_layer=GINUpdate, readout_layer=GGNNReadout,
out_dim=out_dim, hidden_channels=hidden_channels,
n_update_layers=n_update_layers, n_atom_types=n_atom_types,
concat_hidden=concat_hidden, weight_tying=weight_tying,
n_edge_types=n_edge_types, with_wle=with_wle,
update_kwargs=update_kwargs, readout_kwargs=readout_kwargs,
n_wle_types=n_wle_types)
class NFP_GWLE(GWLEGraphConvModel):
def __init__(self, out_dim, hidden_channels=16, n_update_layers=4,
max_degree=6, n_atom_types=MAX_ATOMIC_NUM,
concat_hidden=False, with_wle=True, n_wle_types=MAX_WLE_NUM):
update_kwargs = {'max_degree': max_degree}
super(NFP_GWLE, self).__init__(
update_layer=NFPUpdate, readout_layer=NFPReadout,
out_dim=out_dim, hidden_channels=hidden_channels,
n_update_layers=n_update_layers,
n_atom_types=n_atom_types, concat_hidden=concat_hidden,
sum_hidden=True, with_wle=with_wle, update_kwargs=update_kwargs,
n_wle_types=n_wle_types)
self.max_degree = max_degree
self.n_degree_type = max_degree + 1
self.ch0 = hidden_channels
def preprocess_addtional_kwargs(self, *args, **kwargs):
atom_array, adj = args[:2]
bs, num_node = atom_array.shape[:2]
# For NFP Update
if adj.ndim == 4:
degree_mat = self.xp.sum(to_array(adj), axis=(1, 2))
elif adj.ndim == 3:
degree_mat = self.xp.sum(to_array(adj), axis=1)
else:
raise ValueError('Unexpected value adj '
.format(adj.shape))
# deg_conds: (minibatch, atom, ch)
deg_conds = [self.xp.broadcast_to(
((degree_mat - degree) == 0)[:, :, None],
(bs, num_node, self.ch0))
for degree in range(1, self.n_degree_type + 1)]
return {'deg_conds': deg_conds}
class RSGCN_GWLE(GWLEGraphConvModel):
def __init__(self, out_dim, hidden_channels=32, n_update_layers=4,
n_atom_types=MAX_ATOMIC_NUM,
use_batch_norm=False, readout=None, dropout_ratio=0.5,
with_wle=True, n_wle_types=MAX_WLE_NUM):
if readout is None:
readout = GeneralReadout
super(RSGCN_GWLE, self).__init__(
update_layer=RSGCNUpdate, readout_layer=readout,
out_dim=out_dim, hidden_channels=hidden_channels,
n_update_layers=n_update_layers, n_atom_types=n_atom_types,
use_batchnorm=use_batch_norm, activation=functions.relu,
n_activation=n_update_layers-1, dropout_ratio=dropout_ratio,
with_wle=with_wle, n_wle_types=n_wle_types)
================================================
FILE: chainer_chemistry/models/gwm/__init__.py
================================================
from chainer_chemistry.models.gwm import gwm # NOQA
from chainer_chemistry.models.gwm import gwm_graph_conv_model # NOQA
from chainer_chemistry.models.gwm import gwm_net # NOQA
from chainer_chemistry.models.gwm.gwm import GWM # NOQA
from chainer_chemistry.models.gwm.gwm_graph_conv_model import GWMGraphConvModel # NOQA
from chainer_chemistry.models.gwm.gwm_net import GGNN_GWM # NOQA
from chainer_chemistry.models.gwm.gwm_net import GIN_GWM # NOQA
from chainer_chemistry.models.gwm.gwm_net import NFP_GWM # NOQA
from chainer_chemistry.models.gwm.gwm_net import RSGCN_GWM # NOQA
================================================
FILE: chainer_chemistry/models/gwm/gwm.py
================================================
import chainer
from chainer import functions
from chainer import links
from chainer_chemistry.links import GraphLinear
class WarpGateUnit(chainer.Chain):
"""WarpGateUnit
It computes gated-sum mixing `merged` feature from normal node feature `h`
and super node feature `g`,
See Section "3.4 Warp Gate" of the paper.
Args:
output_type (str): supported type as below.
graph:
super:
hidden_dim (int): hidden dim
dropout_ratio (float): negative value indicates to not apply dropout.
activation (callable):
"""
def __init__(self, output_type='graph', hidden_dim=16,
dropout_ratio=-1, activation=functions.sigmoid):
super(WarpGateUnit, self).__init__()
if output_type == 'graph':
LinearLink = GraphLinear
elif output_type == 'super':
LinearLink = links.Linear
else:
raise ValueError(
'output_type = {} is unexpected. graph or super is supported.'
.format(output_type))
with self.init_scope():
self.H = LinearLink(in_size=hidden_dim, out_size=hidden_dim)
self.G = LinearLink(in_size=hidden_dim, out_size=hidden_dim)
self.hidden_dim = hidden_dim
self.dropout_ratio = dropout_ratio
self.output_type = output_type
self.activation = activation
def __call__(self, h, g):
# TODO(nakago): more efficient computation. Maybe we can calculate
# self.G(g) as Linear layer followed by broadcast to each atom.
z = self.H(h) + self.G(g)
if self.dropout_ratio > 0.0:
z = functions.dropout(z, ratio=self.dropout_ratio)
z = self.activation(z)
merged = (1 - z) * h + z * g
return merged
class SuperNodeTransmitterUnit(chainer.Chain):
"""SuperNodeTransmitterUnit
It calculates message from super node to normal node.
Args:
hidden_dim_super (int):
hidden_dim (int): hiddem dim for
dropout_ratio (float): negative value indicates to not apply dropout.
"""
def __init__(self, hidden_dim_super=16, hidden_dim=16, dropout_ratio=-1):
super(SuperNodeTransmitterUnit, self).__init__()
with self.init_scope():
self.F_super = links.Linear(in_size=hidden_dim_super,
out_size=hidden_dim)
self.hidden_dim = hidden_dim
self.hidden_dim_super = hidden_dim_super
self.dropout_ratio = dropout_ratio
def __call__(self, g, n_nodes):
"""main calculation
Args:
g: super node feature. shape (bs, hidden_dim_super)
n_nodes (int): number of nodes
Returns:
g_trans: super --> original transmission
"""
mb = len(g)
# for local updates
g_trans = self.F_super(g)
# intermediate_h_super.shape == (mb, self.hidden_dim)
g_trans = functions.tanh(g_trans)
# intermediate_h_super.shape == (mb, 1, self.hidden_dim)
g_trans = functions.expand_dims(g_trans, 1)
# intermediate_h_super.shape == (mb, atom, self.hidden_dim)
g_trans = functions.broadcast_to(g_trans,
(mb, n_nodes, self.hidden_dim))
return g_trans
class GraphTransmitterUnit(chainer.Chain):
"""GraphTransmitterUnit
It calculates message from normal node to super node.
Args:
hidden_dim_super (int):
hidden_dim (int):
n_heads (int):
dropout_ratio (float):
activation (callable):
"""
def __init__(self, hidden_dim_super=16, hidden_dim=16, n_heads=8,
dropout_ratio=-1, activation=functions.tanh):
super(GraphTransmitterUnit, self).__init__()
hdim_n = hidden_dim * n_heads
with self.init_scope():
self.V_super = GraphLinear(hidden_dim, hdim_n)
self.W_super = links.Linear(hdim_n, hidden_dim_super)
self.B = GraphLinear(hidden_dim, n_heads * hidden_dim_super)
self.hidden_dim = hidden_dim
self.hidden_dim_super = hidden_dim_super
self.dropout_ratio = dropout_ratio
self.n_heads = n_heads
self.activation = activation
def __call__(self, h, g, step=0):
mb, atom, ch = h.shape
h_j = self.V_super(h)
h_j = functions.reshape(h_j, (mb, atom, self.n_heads, ch))
# h_j (mb, atom, self.n_heads, ch)
h_j = functions.transpose(h_j, (0, 2, 1, 3))
# expand h_super
# g_extend.shape (mb, 1, self.hidden_dim_super)
g_extend = functions.expand_dims(g, 1)
# g_extend.shape == (mb, self.n_heads, self.hidden_dim_super)
g_extend = functions.broadcast_to(g_extend, (mb, self.n_heads,
self.hidden_dim_super))
# g_extend.shape == (mb, self.n_heads, 1, self.hidden_dim_super)
g_extend = functions.expand_dims(g_extend, 2)
# update for attention-message B h_i
# h (mb, atom, ch)
# Bh_i.shape == (mb, atom, self.n_heads * self.hidden_dim_super)
Bh_i = self.B(h)
# Bh_i.shpae == (mb, atom, num_head, ch)
Bh_i = functions.reshape(Bh_i, (mb, atom, self.n_heads,
self.hidden_dim_super))
# Bh_i.shape == (mb, num_head, atom, ch)
Bh_i = functions.transpose(Bh_i, [0, 2, 1, 3])
# take g^{T} * B * h_i
# indexed by i
# mb, self.n_haeds atom(i)
# b_hi.shape == (mb, self.n_heads, 1, atom)
# This will reduce the last hidden_dim_super axis
b_hi = functions.matmul(g_extend, Bh_i, transb=True)
# softmax. sum/normalize over the last axis.
# mb, self.n_heda, atom(i-normzlied)
# attention_i.shape == (mb, self.n_heads, 1, atom)
attention_i = functions.softmax(b_hi, axis=3)
if self.dropout_ratio > 0.0:
attention_i = functions.dropout(attention_i,
ratio=self.dropout_ratio)
# element-wise product --> sum over i
# mb, num_head, hidden_dim_super
# attention_sum.shape == (mb, self.n_heads, 1, ch)
attention_sum = functions.matmul(attention_i, h_j)
# attention_sum.shape == (mb, self.n_heads * ch)
attention_sum = functions.reshape(attention_sum,
(mb, self.n_heads * ch))
# weighting h for different heads
# intermediate_h.shape == (mb, self.n_heads * ch)
# compress heads
h_trans = self.W_super(attention_sum)
# intermediate_h.shape == (mb, self.hidden_dim_super)
h_trans = self.activation(h_trans)
return h_trans
class GWM(chainer.Chain):
"""Graph Warping Module (GWM)
Module for a single layer update.
See: Ishiguro, Maeda, and Koyama. "Graph Warp Module: an Auxiliary Module
for Boosting the Power of Graph NeuralNetworks", arXiv, 2019.
Args:
hidden_dim (int): dimension of hidden vectors
associated to each atom (local node)
hidden_dim_super (int); dimension of super-node hidden vector
n_layers (int): number of layers
n_heads (int): number of heads
dropout_ratio (float): dropout ratio.
Negative value indicates to not apply dropout.
tying_flag (bool): enable if you want to share params across layers.
activation (callable):
wgu_activation (callable):
gtu_activation (callable):
"""
def __init__(self, hidden_dim=16, hidden_dim_super=16, n_layers=4,
n_heads=8, dropout_ratio=-1,
tying_flag=False, activation=functions.relu,
wgu_activation=functions.sigmoid,
gtu_activation=functions.tanh):
super(GWM, self).__init__()
n_use_layers = 1 if tying_flag else n_layers
with self.init_scope():
self.update_super = chainer.ChainList(
*[links.Linear(in_size=hidden_dim_super,
out_size=hidden_dim_super)
for _ in range(n_use_layers)]
)
# for Transmitter unit
self.super_transmitter = chainer.ChainList(
*[SuperNodeTransmitterUnit(
hidden_dim=hidden_dim, hidden_dim_super=hidden_dim_super,
dropout_ratio=dropout_ratio) for _ in range(n_use_layers)])
self.graph_transmitter = chainer.ChainList(
*[GraphTransmitterUnit(
hidden_dim=hidden_dim, hidden_dim_super=hidden_dim_super,
n_heads=n_heads, dropout_ratio=dropout_ratio,
activation=gtu_activation) for _ in range(n_use_layers)])
# for Warp Gate unit
self.wgu_local = chainer.ChainList(
*[WarpGateUnit(
output_type='graph', hidden_dim=hidden_dim,
dropout_ratio=dropout_ratio, activation=wgu_activation)
for _ in range(n_use_layers)])
self.wgu_super = chainer.ChainList(
*[WarpGateUnit(
output_type='super', hidden_dim=hidden_dim_super,
dropout_ratio=dropout_ratio, activation=wgu_activation)
for _ in range(n_use_layers)])
# Weight tying: not layer-wise but recurrent through layers
self.GRU_local = links.GRU(in_size=hidden_dim, out_size=hidden_dim)
self.GRU_super = links.GRU(in_size=hidden_dim_super,
out_size=hidden_dim_super)
# end init_scope-with
self.hidden_dim = hidden_dim
self.hidden_dim_super = hidden_dim_super
self.n_layers = n_layers
self.n_heads = n_heads
self.dropout_ratio = dropout_ratio
self.tying_flag = tying_flag
self.activation = activation
self.wgu_activation = wgu_activation
def __call__(self, h, h_new, g, step=0):
"""main calculation
Note: Do not forget to reset GRU for each batch.
Args:
h: Minibatch by num_nodes by hidden_dim numpy array.
current local node hidden states as input of the vanilla GNN
h_new: Minibatch by num_nodes by hidden_dim numpy array.
updated local node hidden states as output from the vanilla GNN
g: Minibatch by bond_types by num_nodes by num_nodes 1/0
array. Adjacency matrices over several bond types
step: Minibatch by hidden_dim_super numpy array.
current super node hiddden state
Returns: Updated h and g
"""
# (minibatch, atom, ch)
mb, n_nodes, ch = h.shape
# non linear update of the super node
g_new = self.activation(self.update_super[step](g))
# Transmitter unit: inter-module message passing
# original --> super transmission
h_trans = self.graph_transmitter[step](h, g)
# g_trans: super --> original transmission
g_trans = self.super_transmitter[step](g, n_nodes)
# Warp Gate unit
merged_h = self.wgu_local[step](h_new, g_trans)
merged_g = self.wgu_super[step](h_trans, g_new)
# Self recurrent
out_h = functions.reshape(merged_h, (mb * n_nodes, self.hidden_dim))
out_h = self.GRU_local(out_h)
out_h = functions.reshape(out_h, (mb, n_nodes, self.hidden_dim))
out_g = self.GRU_super(merged_g)
return out_h, out_g
def reset_state(self):
self.GRU_local.reset_state()
self.GRU_super.reset_state()
================================================
FILE: chainer_chemistry/models/gwm/gwm_graph_conv_model.py
================================================
import chainer
from chainer import cuda
from chainer import functions
from chainer import links
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links.connection.embed_atom_id import EmbedAtomID
from chainer_chemistry.links.normalization.graph_batch_normalization import GraphBatchNormalization # NOQA
from chainer_chemistry.links.readout.general_readout import GeneralReadout
from chainer_chemistry.models.gwm.gwm import GWM
from chainer_chemistry.models.relgcn import rescale_adj
def to_array(x):
"""Convert x into numpy.ndarray or cupy.ndarray"""
if isinstance(x, chainer.Variable):
x = x.array
return x
class GWMGraphConvModel(chainer.Chain):
"""Unified module of Graph Convolution Model with GWM
Note that this module is experimental, all update_layer and
readout_layer combination is not supported.
Please refer `test_gwm_graph_conv_model.py` for tested combinations.
This module might not be maintained in the future.
Args:
hidden_channels (int or list): hidden channels for update
out_dim (int): output dim
update_layer (chainer.links.Link):
readout_layer (chainer.links.Link):
n_update_layers (int or None):
out_channels (None or lsit):
super_node_dim (int):
n_atom_types (int):
n_edge_types (int):
dropout_ratio (float):
with_gwm (bool):
concat_hidden (bool):
sum_hidden (bool):
weight_tying (bool):
scale_adj (bool):
activation (callable):
use_batchnorm (bool):
n_activation (int or None):
update_kwargs (dict or None):
readout_kwargs (dict or None):
gwm_kwargs (dict or None):
"""
def __init__(self, hidden_channels, out_dim, update_layer, readout_layer,
n_update_layers=None, out_channels=None, super_node_dim=None,
n_atom_types=MAX_ATOMIC_NUM, n_edge_types=4,
dropout_ratio=-1.0, with_gwm=True,
concat_hidden=False, sum_hidden=False, weight_tying=False,
scale_adj=False, activation=None, use_batchnorm=False,
n_activation=None, update_kwargs=None, readout_kwargs=None,
gwm_kwargs=None):
super(GWMGraphConvModel, self).__init__()
# General: length of hidden_channels must be n_layers + 1
if isinstance(hidden_channels, int):
if n_update_layers is None:
raise ValueError('n_update_layers is None')
else:
hidden_channels = [hidden_channels
for _ in range(n_update_layers + 1)]
elif isinstance(hidden_channels, list):
if out_channels is None:
n_update_layers = len(hidden_channels) - 1
else:
n_update_layers = len(hidden_channels)
else:
raise TypeError('Unexpected value for hidden_channels {}'
.format(hidden_channels))
if readout_layer == GeneralReadout and hidden_channels[-1] != out_dim:
# When use GWM, hidden channels must be same. But GeneralReadout
# cannot change the dimension. So when use General Readout and GWM,
# hidden channel and out_dim should be same.
if with_gwm:
raise ValueError('Unsupported combination.')
else:
hidden_channels[-1] = out_dim
# When use with_gwm, concat_hidden, sum_hidden and weight_tying option,
# hidden_channels must be same
if with_gwm or concat_hidden or sum_hidden or weight_tying:
if not all([in_dim == hidden_channels[0]
for in_dim in hidden_channels]):
raise ValueError(
'hidden_channels must be same but different {}'
.format(hidden_channels))
if with_gwm and super_node_dim is None:
print('[WARNING] super_node_dim is None, set to {}'
.format(hidden_channels[0]))
super_node_dim = hidden_channels[0]
if out_channels is None:
in_channels_list = hidden_channels[:-1]
out_channels_list = hidden_channels[1:]
else:
# For RelGAT concat_heads option
in_channels_list = hidden_channels
out_channels_list = out_channels
assert len(in_channels_list) == n_update_layers
assert len(out_channels_list) == n_update_layers
n_use_update_layers = 1 if weight_tying else n_update_layers
n_readout_layers = n_use_update_layers if concat_hidden or sum_hidden else 1 # NOQA
n_activation = n_use_update_layers if n_activation is None else n_activation # NOQA
if update_kwargs is None:
update_kwargs = {}
if readout_kwargs is None:
readout_kwargs = {}
if gwm_kwargs is None:
gwm_kwargs = {}
with self.init_scope():
self.embed = EmbedAtomID(out_size=hidden_channels[0],
in_size=n_atom_types)
self.update_layers = chainer.ChainList(
*[update_layer(in_channels=in_channels_list[i],
out_channels=out_channels_list[i],
n_edge_types=n_edge_types, **update_kwargs)
for i in range(n_use_update_layers)])
# when use weight_tying option, hidden_channels must be same.
# So we can use -1 index
self.readout_layers = chainer.ChainList(
*[readout_layer(out_dim=out_dim,
# in_channels=hidden_channels[-1],
in_channels=None,
**readout_kwargs)
for _ in range(n_readout_layers)])
if with_gwm:
self.gwm = GWM(hidden_dim=hidden_channels[0],
hidden_dim_super=super_node_dim,
n_layers=n_use_update_layers, **gwm_kwargs)
self.embed_super = links.Linear(None, out_size=super_node_dim)
self.linear_for_concat_super = links.Linear(in_size=None,
out_size=out_dim)
if use_batchnorm:
self.bnorms = chainer.ChainList(
*[GraphBatchNormalization(
out_channels_list[i]) for i in
range(n_use_update_layers)])
self.readout_layer = readout_layer
self.update_layer = update_layer
self.weight_tying = weight_tying
self.with_gwm = with_gwm
self.concat_hidden = concat_hidden
self.sum_hidden = sum_hidden
self.scale_adj = scale_adj
self.activation = activation
self.dropout_ratio = dropout_ratio
self.use_batchnorm = use_batchnorm
self.n_activation = n_activation
self.n_update_layers = n_update_layers
self.n_edge_types = n_edge_types
def __call__(self, atom_array, adj, super_node=None, is_real_node=None):
self.reset_state()
if atom_array.dtype == self.xp.int32:
h = self.embed(atom_array)
else:
# TODO(nakago): GraphLinear or GraphMLP can be used.
h = atom_array
h0 = functions.copy(h, cuda.get_device_from_array(h.data).id)
if self.with_gwm:
h_s = self.embed_super(super_node)
additional_kwargs = self.preprocess_addtional_kwargs(
atom_array, adj, super_node=super_node, is_real_node=is_real_node)
if self.scale_adj:
adj = rescale_adj(adj)
g_list = []
for step in range(self.n_update_layers):
update_layer_index = 0 if self.weight_tying else step
h_new = self.update_layers[update_layer_index](
h=h, adj=adj, **additional_kwargs)
if self.with_gwm:
h_new, h_s = self.gwm(h, h_new, h_s, update_layer_index)
h = h_new
if self.use_batchnorm:
h = self.bnorms[update_layer_index](h)
if self.dropout_ratio > 0.:
h = functions.dropout(h, ratio=self.dropout_ratio)
if self.activation is not None and step < self.n_activation:
h = self.activation(h)
if self.concat_hidden or self.sum_hidden:
g = self.readout_layers[step](
h=h, h0=h0, is_real_node=is_real_node, **additional_kwargs)
g_list.append(g)
if self.concat_hidden:
return functions.concat(g_list, axis=1)
else:
if self.sum_hidden:
g = functions.sum(functions.stack(g_list), axis=0)
else:
g = self.readout_layers[0](
h=h, h0=h0, is_real_node=is_real_node)
if self.with_gwm:
g = functions.concat((g, h_s), axis=1)
g = functions.relu(self.linear_for_concat_super(g))
return g
def reset_state(self):
if hasattr(self.update_layers[0], 'reset_state'):
[update_layer.reset_state() for update_layer in self.update_layers]
if self.with_gwm:
self.gwm.reset_state()
def preprocess_addtional_kwargs(self, *args, **kwargs):
return {}
================================================
FILE: chainer_chemistry/models/gwm/gwm_net.py
================================================
from chainer import functions
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links import GINUpdate, NFPReadout, NFPUpdate, \
RSGCNUpdate, GeneralReadout # NOQA
from chainer_chemistry.links.readout.ggnn_readout import GGNNReadout
from chainer_chemistry.links.update.ggnn_update import GGNNUpdate
from chainer_chemistry.models.gwm.gwm_graph_conv_model import GWMGraphConvModel, to_array # NOQA
class GGNN_GWM(GWMGraphConvModel):
def __init__(self, out_dim, hidden_channels=16, n_update_layers=4,
n_atom_types=MAX_ATOMIC_NUM, concat_hidden=False,
weight_tying=True, activation=functions.identity,
n_edge_types=4, with_gwm=True):
readout_kwargs = {'activation': activation,
'activation_agg': activation}
super(GGNN_GWM, self).__init__(
update_layer=GGNNUpdate, readout_layer=GGNNReadout,
out_dim=out_dim, hidden_channels=hidden_channels,
n_update_layers=n_update_layers,
n_atom_types=n_atom_types, concat_hidden=concat_hidden,
weight_tying=weight_tying, n_edge_types=n_edge_types,
with_gwm=with_gwm, readout_kwargs=readout_kwargs)
class GIN_GWM(GWMGraphConvModel):
def __init__(self, out_dim, hidden_channels=16,
n_update_layers=4, n_atom_types=MAX_ATOMIC_NUM,
dropout_ratio=0.5, concat_hidden=False,
weight_tying=True, activation=functions.identity,
n_edge_types=4, with_gwm=True):
update_kwargs = {'dropout_ratio': dropout_ratio}
readout_kwargs = {'activation': activation,
'activation_agg': activation}
super(GIN_GWM, self).__init__(
update_layer=GINUpdate, readout_layer=GGNNReadout,
out_dim=out_dim, hidden_channels=hidden_channels,
n_update_layers=n_update_layers, n_atom_types=n_atom_types,
concat_hidden=concat_hidden, weight_tying=weight_tying,
n_edge_types=n_edge_types, with_gwm=with_gwm,
update_kwargs=update_kwargs, readout_kwargs=readout_kwargs
)
class NFP_GWM(GWMGraphConvModel):
def __init__(self, out_dim, hidden_channels=16, n_update_layers=4,
max_degree=6, n_atom_types=MAX_ATOMIC_NUM,
concat_hidden=False, with_gwm=True):
update_kwargs = {'max_degree': max_degree}
super(NFP_GWM, self).__init__(
update_layer=NFPUpdate, readout_layer=NFPReadout,
out_dim=out_dim, hidden_channels=hidden_channels,
n_update_layers=n_update_layers,
n_atom_types=n_atom_types, concat_hidden=concat_hidden,
sum_hidden=True, with_gwm=with_gwm, update_kwargs=update_kwargs
)
self.max_degree = max_degree
self.n_degree_type = max_degree + 1
self.ch0 = hidden_channels
def preprocess_addtional_kwargs(self, *args, **kwargs):
atom_array, adj = args[:2]
bs, num_node = atom_array.shape[:2]
# For NFP Update
if adj.ndim == 4:
degree_mat = self.xp.sum(to_array(adj), axis=(1, 2))
elif adj.ndim == 3:
degree_mat = self.xp.sum(to_array(adj), axis=1)
else:
raise ValueError('Unexpected value adj '
.format(adj.shape))
# deg_conds: (minibatch, atom, ch)
deg_conds = [self.xp.broadcast_to(
((degree_mat - degree) == 0)[:, :, None],
(bs, num_node, self.ch0))
for degree in range(1, self.n_degree_type + 1)]
return {'deg_conds': deg_conds}
class RSGCN_GWM(GWMGraphConvModel):
def __init__(self, out_dim, hidden_channels=32, n_update_layers=4,
n_atom_types=MAX_ATOMIC_NUM,
use_batch_norm=False, readout=None, dropout_ratio=0.5,
with_gwm=True):
if readout is None:
readout = GeneralReadout
super(RSGCN_GWM, self).__init__(
update_layer=RSGCNUpdate, readout_layer=readout,
out_dim=out_dim, hidden_channels=hidden_channels,
n_update_layers=n_update_layers, n_atom_types=n_atom_types,
use_batchnorm=use_batch_norm, activation=functions.relu,
n_activation=n_update_layers-1, dropout_ratio=dropout_ratio,
with_gwm=with_gwm)
================================================
FILE: chainer_chemistry/models/megnet.py
================================================
import chainer
from chainer.backend import get_array_module
from chainer import functions
from chainer_chemistry.functions import megnet_softplus
from chainer_chemistry.links.readout.megnet_readout import MEGNetReadout
from chainer_chemistry.links.update.megnet_update import MEGNetUpdate
def reshaped_feat(feat, idx):
"""Convert node stack pattern into pad pattern
This method is converting from node stack pattern to pad pattern
about node and edge feature. This is because the current set2set
implementation is only focus on pad pattern feature.
"""
xp = get_array_module(idx)
max_idx = int(xp.max(idx))
vec_list = [feat[idx == i] for i in range(max_idx+1)]
return functions.pad_sequence(vec_list)
class MEGNet(chainer.Chain):
"""MEGNet
See Chi Chen et al, \
Graph Networks as a Universal Machine Learning Framework for Molecules
and Crystals. \
`arXiv:1812.05055 `_
Args:
out_dim (int): dimension of output feature vector
n_update_layers (int): the number of MEGNetUpdate layers
dropout_ratio (float): ratio of dropout
activation (~chainer.Function or ~chainer.FunctionNode):
activate function for megnet model
`megnet_softplus` was used in original paper.
"""
def __init__(self, out_dim=32, n_update_layers=3, dropout_ratio=-1,
activation=megnet_softplus):
super(MEGNet, self).__init__()
if n_update_layers <= 0:
raise ValueError('n_update_layers must be a positive integer, '
'but it was set to {}'.format(n_update_layers))
self.n_update_layers = n_update_layers
with self.init_scope():
self.update_layers = chainer.ChainList(
*[MEGNetUpdate(
dim_for_dense=[64, 32], dim_for_update=[64, 64, 32],
dropout_ratio=dropout_ratio, activation=activation,
skip_intermediate=(i == 0)
) for i in range(n_update_layers)])
self.readout = MEGNetReadout(out_dim=out_dim, in_channels=32,
n_layers=1, processing_steps=3,
dropout_ratio=dropout_ratio,
activation=activation)
def __call__(self, atoms_feat, pair_feat, global_feat, *args):
a_f = atoms_feat
p_f = pair_feat
g_f = global_feat
# --- MGENet update ---
for i in range(self.n_update_layers):
a_f, p_f, g_f = self.update_layers[i](a_f, p_f, g_f, *args)
# --- reshape ---
atom_idx = args[0]
pair_idx = args[1]
a_f = reshaped_feat(a_f, atom_idx)
p_f = reshaped_feat(p_f, pair_idx)
# --- MGENet readout ---
out = self.readout(a_f, p_f, g_f)
return out
================================================
FILE: chainer_chemistry/models/mlp.py
================================================
import chainer
from chainer.functions import relu
from chainer import links
class MLP(chainer.Chain):
"""Basic implementation for MLP
Args:
out_dim (int): dimension of output feature vector
hidden_dim (int): dimension of feature vector
associated to each atom
n_layers (int): number of layers
activation (chainer.functions): activation function
"""
def __init__(self, out_dim, hidden_dim=16, n_layers=2, activation=relu):
super(MLP, self).__init__()
if n_layers <= 0:
raise ValueError('n_layers must be a positive integer, but it was '
'set to {}'.format(n_layers))
layers = [links.Linear(None, hidden_dim) for i in range(n_layers - 1)]
with self.init_scope():
self.layers = chainer.ChainList(*layers)
self.l_out = links.Linear(None, out_dim)
self.activation = activation
def __call__(self, x):
h = x
for l in self.layers:
h = self.activation(l(h))
h = self.l_out(h)
return h
================================================
FILE: chainer_chemistry/models/mpnn.py
================================================
from functools import partial
from typing import Optional # NOQA
import chainer
from chainer import cuda, functions # NOQA
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links import EmbedAtomID
from chainer_chemistry.links.readout.ggnn_readout import GGNNReadout
from chainer_chemistry.links.readout.mpnn_readout import MPNNReadout
from chainer_chemistry.links.update.ggnn_update import GGNNUpdate
from chainer_chemistry.links.update.mpnn_update import MPNNUpdate
class MPNN(chainer.Chain):
"""Message Passing Neural Networks (MPNN).
Args:
out_dim (int): dimension of output feature vector
hidden_channels (int): dimension of feature vector for each node
n_update_layers (int): number of update layers
n_atom_types (int): number of types of atoms
concat_hidden (bool): If set to True, readout is executed in
each layer and the result is concatenated
weight_tying (bool): enable weight_tying or not
n_edge_types (int): number of edge type.
Defaults to 4 for single, double, triple and aromatic bond.
nn (~chainer.Link): Neural Networks for expanding edge vector
dimension
message_func (str): message function. 'edgenet' and 'ggnn' are
supported.
readout_func (str): readout function. 'set2set' and 'ggnn' are
supported.
"""
def __init__(
self,
out_dim, # type: int
hidden_channels=16, # type: int
n_update_layers=4, # type: int
n_atom_types=MAX_ATOMIC_NUM, # type: int
concat_hidden=False, # type: bool
weight_tying=True, # type: bool
n_edge_types=4, # type: int
nn=None, # type: Optional[chainer.Link]
message_func='edgenet', # type: str
readout_func='set2set', # type: str
):
# type: (...) -> None
super(MPNN, self).__init__()
if message_func not in ('edgenet', 'ggnn'):
raise ValueError(
'Invalid message function: {}'.format(message_func))
if readout_func not in ('set2set', 'ggnn'):
raise ValueError(
'Invalid readout function: {}'.format(readout_func))
n_readout_layer = n_update_layers if concat_hidden else 1
n_message_layer = 1 if weight_tying else n_update_layers
with self.init_scope():
# Update
self.embed = EmbedAtomID(out_size=hidden_channels,
in_size=n_atom_types)
if message_func == 'ggnn':
self.update_layers = chainer.ChainList(*[
GGNNUpdate(
hidden_channels=hidden_channels,
n_edge_types=n_edge_types)
for _ in range(n_message_layer)
])
else:
self.update_layers = chainer.ChainList(*[
MPNNUpdate(hidden_channels=hidden_channels, nn=nn)
for _ in range(n_message_layer)
])
# Readout
if readout_func == 'ggnn':
self.readout_layers = chainer.ChainList(*[
GGNNReadout(out_dim=out_dim,
in_channels=hidden_channels * 2)
for _ in range(n_readout_layer)
])
else:
self.readout_layers = chainer.ChainList(*[
MPNNReadout(
out_dim=out_dim, in_channels=hidden_channels,
n_layers=1)
for _ in range(n_readout_layer)
])
self.out_dim = out_dim
self.hidden_channels = hidden_channels
self.n_update_layers = n_update_layers
self.n_edge_types = n_edge_types
self.concat_hidden = concat_hidden
self.weight_tying = weight_tying
self.message_func = message_func
self.readout_func = readout_func
def __call__(self, atom_array, adj):
# type: (numpy.ndarray, numpy.ndarray) -> chainer.Variable
"""Forward propagation.
Args:
atom_array (numpy.ndarray): minibatch of molecular which is
represented with atom IDs (representing C, O, S, ...)
`atom_array[mol_index, atom_index]` represents `mol_index`-th
molecule's `atom_index`-th atomic number
adj (numpy.ndarray): minibatch of adjancency matrix with edge-type
information
Returns:
~chainer.Variable: minibatch of fingerprint
"""
# reset state
self.reset_state()
if atom_array.dtype == self.xp.int32:
h = self.embed(atom_array)
else:
h = atom_array
if self.readout_func == 'ggnn':
h0 = functions.copy(h, cuda.get_device_from_array(h.data).id)
readout_layers = [
partial(readout_layer, h0=h0)
for readout_layer in self.readout_layers
]
else:
readout_layers = self.readout_layers
g_list = []
for step in range(self.n_update_layers):
message_layer_index = 0 if self.weight_tying else step
h = self.update_layers[message_layer_index](h, adj)
if self.concat_hidden:
g = readout_layers[step](h)
g_list.append(g)
if self.concat_hidden:
return functions.concat(g_list, axis=1)
else:
g = readout_layers[0](h)
return g
def reset_state(self):
# type: () -> None
[update_layer.reset_state() for update_layer in self.update_layers]
================================================
FILE: chainer_chemistry/models/nfp.py
================================================
import chainer
from chainer import Variable, functions # NOQA
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links import EmbedAtomID
from chainer_chemistry.links.readout.nfp_readout import NFPReadout
from chainer_chemistry.links.update.nfp_update import NFPUpdate
class NFP(chainer.Chain):
"""Neural Finger Print (NFP)
See: David K Duvenaud, Dougal Maclaurin, Jorge Iparraguirre, Rafael
Bombarell, Timothy Hirzel, Alan Aspuru-Guzik, and Ryan P Adams (2015).
Convolutional networks on graphs for learning molecular fingerprints.
*Advances in Neural Information Processing Systems (NIPS) 28*,
Args:
out_dim (int): dimension of output feature vector
hidden_channels (int): dimension of feature vector for each node
n_update_layers (int): number of layers
max_degree (int): max degree of atoms
when molecules are regarded as graphs
n_atom_types (int): number of types of atoms
concat_hidden (bool): If set to True, readout is executed in each layer
and the result is concatenated
"""
def __init__(self, out_dim, hidden_channels=16, n_update_layers=4,
max_degree=6, n_atom_types=MAX_ATOMIC_NUM,
concat_hidden=False):
super(NFP, self).__init__()
n_degree_types = max_degree + 1
with self.init_scope():
self.embed = EmbedAtomID(in_size=n_atom_types,
out_size=hidden_channels)
self.layers = chainer.ChainList(
*[NFPUpdate(hidden_channels, hidden_channels,
max_degree=max_degree)
for _ in range(n_update_layers)])
self.readout_layers = chainer.ChainList(
*[NFPReadout(out_dim=out_dim, in_channels=hidden_channels)
for _ in range(n_update_layers)])
self.out_dim = out_dim
self.hidden_channels = hidden_channels
self.max_degree = max_degree
self.n_degree_types = n_degree_types
self.n_update_layers = n_update_layers
self.concat_hidden = concat_hidden
def __call__(self, atom_array, adj, is_real_node=None):
"""Forward propagation
Args:
atom_array (numpy.ndarray): minibatch of molecular which is
represented with atom IDs (representing C, O, S, ...)
`atom_array[mol_index, atom_index]` represents `mol_index`-th
molecule's `atom_index`-th atomic number
adj (numpy.ndarray): minibatch of adjancency matrix
`adj[mol_index]` represents `mol_index`-th molecule's
adjacency matrix
is_real_node (numpy.ndarray): 2-dim array (minibatch, num_nodes).
1 for real node, 0 for virtual node.
If `None`, all node is considered as real node.
Returns:
~chainer.Variable: minibatch of fingerprint
"""
if atom_array.dtype == self.xp.int32:
# atom_array: (minibatch, atom)
h = self.embed(atom_array)
else:
h = atom_array
# h: (minibatch, atom, ch)
g = 0
# --- NFP update & readout ---
# degree_mat: (minibatch, max_num_atoms)
if isinstance(adj, Variable):
adj_array = adj.data
else:
adj_array = adj
degree_mat = self.xp.sum(adj_array, axis=1)
# deg_conds: (minibatch, atom, ch)
deg_conds = [self.xp.broadcast_to(
((degree_mat - degree) == 0)[:, :, None], h.shape)
for degree in range(1, self.n_degree_types + 1)]
g_list = []
for update, readout in zip(self.layers, self.readout_layers):
h = update(h, adj, deg_conds)
dg = readout(h, is_real_node)
g = g + dg
if self.concat_hidden:
g_list.append(g)
if self.concat_hidden:
return functions.concat(g_list, axis=2)
else:
return g
================================================
FILE: chainer_chemistry/models/prediction/__init__.py
================================================
from chainer_chemistry.models.prediction import base # NOQA
from chainer_chemistry.models.prediction import classifier # NOQA
from chainer_chemistry.models.prediction import graph_conv_predictor # NOQA
from chainer_chemistry.models.prediction import regressor # NOQA
from chainer_chemistry.models.prediction.base import BaseForwardModel # NOQA
from chainer_chemistry.models.prediction.classifier import Classifier # NOQA
from chainer_chemistry.models.prediction.graph_conv_predictor import GraphConvPredictor # NOQA
from chainer_chemistry.models.prediction.regressor import Regressor # NOQA
from chainer_chemistry.models.prediction.set_up_predictor import set_up_predictor # NOQA
================================================
FILE: chainer_chemistry/models/prediction/base.py
================================================
import pickle
import numpy
import chainer
from chainer import cuda
from chainer.dataset.convert import concat_examples
from chainer.iterators import SerialIterator
from chainer import link
import chainerx # NOQA
def _to_tuple(x):
if not isinstance(x, tuple):
x = (x,)
return x
def _extract_numpy(x):
if isinstance(x, chainer.Variable):
x = x.data
return cuda.to_cpu(x)
class BaseForwardModel(link.Chain):
"""A base model which supports forward functionality.
It also supports pickle save/load functionality.
"""
def __init__(self):
super(BaseForwardModel, self).__init__()
self.inputs = None
def initialize(self, device=-1):
"""Initialization of the model.
It must be executed **after** the link registration
(often done by `with self.init_scope()` finished.
Args:
device (int or chainer._backend.Device):
GPU device id of this model to be used.
-1 indicates to use in CPU.
"""
self.update_device(device=device)
def update_device(self, device=-1):
if not isinstance(device, chainer._backend.Device):
device = chainer.get_device(device) # type: chainerx.Device
if self.device != device:
device.use()
# reset current state
self.to_cpu()
# update the model to specified device
self.to_device(device)
def _forward(self, data, fn, batchsize=16,
converter=concat_examples, retain_inputs=False,
preprocess_fn=None, postprocess_fn=None):
"""Forward data by iterating with batch
Args:
data: "train_x array" or "chainer dataset"
fn (Callable): Main function to forward. Its input argument is
either Variable, cupy.ndarray or numpy.ndarray, and returns
Variable.
batchsize (int): batch size
converter (Callable): convert from `data` to `inputs`
retain_inputs (bool): If True, this instance keeps inputs in
`self.inputs` or not.
preprocess_fn (Callable): Its input is numpy.ndarray or
cupy.ndarray, it can return either Variable, cupy.ndarray or
numpy.ndarray
postprocess_fn (Callable): Its input argument is Variable,
but this method may return either Variable, cupy.ndarray or
numpy.ndarray.
Returns (tuple or numpy.ndarray): forward result
"""
input_list = None
output_list = None
it = SerialIterator(data, batch_size=batchsize, repeat=False,
shuffle=False)
for batch in it:
inputs = converter(batch, self.device)
inputs = _to_tuple(inputs)
if preprocess_fn:
inputs = preprocess_fn(*inputs)
inputs = _to_tuple(inputs)
outputs = fn(*inputs)
outputs = _to_tuple(outputs)
# Init
if retain_inputs:
if input_list is None:
input_list = [[] for _ in range(len(inputs))]
for j, input in enumerate(inputs):
input_list[j].append(cuda.to_cpu(input))
if output_list is None:
output_list = [[] for _ in range(len(outputs))]
if postprocess_fn:
outputs = postprocess_fn(*outputs)
outputs = _to_tuple(outputs)
for j, output in enumerate(outputs):
output_list[j].append(_extract_numpy(output))
if retain_inputs:
self.inputs = [numpy.concatenate(
in_array) for in_array in input_list]
result = [numpy.concatenate(output) for output in output_list]
if len(result) == 1:
return result[0]
else:
return result
def save_pickle(self, filepath, protocol=None):
"""Save the model to `filepath` as a pickle file
This function send the parameters to CPU before saving the model so
that the pickled file can be loaded with in CPU-only environment.
After the model is saved, it is sent back to the original device.
Saved pickle file can be loaded with `load_pickle` static method.
Note that the transportability of the saved file follows the
specification of `pickle` module, namely serialized data depends on the
specific class or attribute structure when saved. The file may not be
loaded in different environment (version of python or dependent
libraries), or after large refactoring of the pickled object class.
If you want to avoid it, use `chainer.serializers.save_npz`
method instead to save only model parameters.
.. admonition:: Example
>>> from chainer_chemistry.models import BaseForwardModel
>>> class DummyForwardModel(BaseForwardModel):
>>>
>>> def __init__(self, device=-1):
>>> super(DummyForwardModel, self).__init__()
>>> with self.init_scope():
>>> self.l = chainer.links.Linear(3, 10)
>>> self.initialize(device)
>>>
>>> def __call__(self, x):
>>> return self.l(x)
>>>
>>> model = DummyForwardModel()
>>> filepath = 'model.pkl'
>>> model.save_pickle(filepath)
Args:
filepath (str): file path of pickle file.
protocol (int or None): protocol version used in `pickle`.
Use 2 if you need python2/python3 compatibility.
3 or higher is used for python3.
Please refer the official document [1] for more details.
[1]: https://docs.python.org/3.6/library/pickle.html#module-interface
""" # NOQA
current_device = self.device
# --- Move the model to CPU for saving ---
self.update_device(-1)
with open(filepath, mode='wb') as f:
pickle.dump(self, f, protocol=protocol)
# --- Revert the model to original device ---
self.update_device(current_device)
@staticmethod
def load_pickle(filepath, device=-1):
"""Load the model from `filepath` of pickle file, and send to `device`
The file saved by `save_pickle` method can be loaded, but it may fail
to load when loading from different develop environment or after
updating library version.
See `save_pickle` method for the transportability of the saved file.
.. admonition:: Example
>>> from chainer_chemistry.models import BaseForwardModel
>>> filepath = 'model.pkl'
>>> # `load_pickle` is static method, call from Class to get an instance
>>> model = BaseForwardModel.load_pickle(filepath)
Args:
filepath (str): file path of pickle file.
device (int or chainerx.Device): GPU device id of this model to be
used. -1 indicates to use in CPU.
"""
with open(filepath, mode='rb') as f:
model = pickle.load(f)
if not isinstance(model, BaseForwardModel):
raise TypeError('Unexpected type {}'.format(type(model)))
# --- Revert the model to specified device ---
model.initialize(device)
return model
================================================
FILE: chainer_chemistry/models/prediction/classifier.py
================================================
import warnings
import numpy
import chainer
from chainer.dataset.convert import concat_examples
from chainer.functions.evaluation import accuracy
from chainer.functions.loss import softmax_cross_entropy
from chainer import cuda, Variable # NOQA
from chainer import reporter
from chainer_chemistry.models.prediction.base import BaseForwardModel
def _argmax(*args):
x = args[0]
return chainer.functions.argmax(x, axis=1)
class Classifier(BaseForwardModel):
"""A simple classifier model.
This is an example of chain that wraps another chain. It computes the
loss and accuracy based on a given input/label pair.
Args:
predictor (~chainer.Link): Predictor network.
lossfun (function): Loss function.
accfun (function): DEPRECATED. Please use `metrics_fun` instead.
metrics_fun (function or dict or None): Function that computes metrics.
label_key (int or str): Key to specify label variable from arguments.
When it is ``int``, a variable in positional arguments is used.
And when it is ``str``, a variable in keyword arguments is used.
device (int or chainer._backend.Device):
GPU device id of this Regressor to be used.
-1 indicates to use in CPU.
Attributes:
predictor (~chainer.Link): Predictor network.
lossfun (function): Loss function.
accfun (function): DEPRECATED. Please use `metrics_fun` instead.
y (~chainer.Variable): Prediction for the last minibatch.
loss (~chainer.Variable): Loss value for the last minibatch.
metrics (dict): Metrics computed in last minibatch
compute_metrics (bool): If ``True``, compute metrics on the forward
computation. The default value is ``True``.
.. note::
The differences between original `Classifier` class in chainer and
chainer chemistry are as follows.
1. `predict` and `predict_proba` methods are supported.
2. `device` can be managed internally by the `Classifier`
3. `accfun` is deprecated, `metrics_fun` is used instead.
4. `metrics_fun` can be `dict` which specifies the metrics name as key
and function as value.
.. note::
This link uses :func:`chainer.softmax_cross_entropy` with
default arguments as a loss function (specified by ``lossfun``),
if users do not explicitly change it. In particular, the loss function
does not support double backpropagation.
If you need second or higher order differentiation, you need to turn
it on with ``enable_double_backprop=True``:
>>> import chainer.functions as F
>>> import chainer.links as L
>>>
>>> def lossfun(x, t):
... return F.softmax_cross_entropy(
... x, t, enable_double_backprop=True)
>>>
>>> predictor = L.Linear(10)
>>> model = L.Classifier(predictor, lossfun=lossfun)
"""
compute_metrics = True
def __init__(self, predictor,
lossfun=softmax_cross_entropy.softmax_cross_entropy,
accfun=None, metrics_fun=accuracy.accuracy,
label_key=-1, device=-1):
if not (isinstance(label_key, (int, str))):
raise TypeError('label_key must be int or str, but is %s' %
type(label_key))
if accfun is not None:
warnings.warn(
'accfun is deprecated, please use metrics_fun instead')
warnings.warn('overriding metrics by accfun...')
# override metrics by accfun
metrics_fun = accfun
super(Classifier, self).__init__()
self.lossfun = lossfun
if metrics_fun is None:
self.compute_metrics = False
self.metrics_fun = {}
elif callable(metrics_fun):
self.metrics_fun = {'accuracy': metrics_fun}
elif isinstance(metrics_fun, dict):
self.metrics_fun = metrics_fun
else:
raise TypeError('Unexpected type metrics_fun must be None or '
'Callable or dict. actual {}'.format(type(accfun)))
self.y = None
self.loss = None
self.metrics = None
self.label_key = label_key
with self.init_scope():
self.predictor = predictor
# `initialize` must be called after `init_scope`.
self.initialize(device)
def _convert_to_scalar(self, value):
"""Converts an input value to a scalar if its type is a Variable,
numpy or cupy array, otherwise it returns the value as it is.
"""
if isinstance(value, Variable):
value = value.array
if numpy.isscalar(value):
return value
if type(value) is not numpy.array:
value = cuda.to_cpu(value)
return numpy.asscalar(value)
def __call__(self, *args, **kwargs):
"""Computes the loss value for an input and label pair.
It also computes accuracy and stores it to the attribute.
Args:
args (list of ~chainer.Variable): Input minibatch.
kwargs (dict of ~chainer.Variable): Input minibatch.
When ``label_key`` is ``int``, the correpoding element in ``args``
is treated as ground truth labels. And when it is ``str``, the
element in ``kwargs`` is used.
The all elements of ``args`` and ``kwargs`` except the ground trush
labels are features.
It feeds features to the predictor and compare the result
with ground truth labels.
Returns:
~chainer.Variable: Loss value.
"""
# --- Separate `args` and `t` ---
if isinstance(self.label_key, int):
if not (-len(args) <= self.label_key < len(args)):
msg = 'Label key %d is out of bounds' % self.label_key
raise ValueError(msg)
t = args[self.label_key]
if self.label_key == -1:
args = args[:-1]
else:
args = args[:self.label_key] + args[self.label_key + 1:]
elif isinstance(self.label_key, str):
if self.label_key not in kwargs:
msg = 'Label key "%s" is not found' % self.label_key
raise ValueError(msg)
t = kwargs[self.label_key]
del kwargs[self.label_key]
else:
raise TypeError('Label key type {} not supported'
.format(type(self.label_key)))
self.y = None
self.loss = None
self.metrics = None
self.y = self.predictor(*args, **kwargs)
self.loss = self.lossfun(self.y, t)
reporter.report(
{'loss': self._convert_to_scalar(self.loss)}, self)
if self.compute_metrics:
# Note: self.accuracy is `dict`, which is different from original
# chainer implementation
self.metrics = {key: self._convert_to_scalar(value(self.y, t))
for key, value in self.metrics_fun.items()}
reporter.report(self.metrics, self)
return self.loss
def predict_proba(
self, data, batchsize=16, converter=concat_examples,
retain_inputs=False, preprocess_fn=None,
postprocess_fn=chainer.functions.softmax):
"""Calculate probability of each category.
Args:
data: "train_x array" or "chainer dataset"
fn (Callable): Main function to forward. Its input argument is
either Variable, cupy.ndarray or numpy.ndarray, and returns
Variable.
batchsize (int): batch size
converter (Callable): convert from `data` to `inputs`
preprocess_fn (Callable): Its input is numpy.ndarray or
cupy.ndarray, it can return either Variable, cupy.ndarray or
numpy.ndarray
postprocess_fn (Callable): Its input argument is Variable,
but this method may return either Variable, cupy.ndarray or
numpy.ndarray.
retain_inputs (bool): If True, this instance keeps inputs in
`self.inputs` or not.
Returns (tuple or numpy.ndarray): Typically, it is 2-dimensional float
array with shape (batchsize, number of category) which represents
each examples probability to be each category.
"""
with chainer.no_backprop_mode(), chainer.using_config('train', False):
proba = self._forward(
data, fn=self.predictor, batchsize=batchsize,
converter=converter, retain_inputs=retain_inputs,
preprocess_fn=preprocess_fn, postprocess_fn=postprocess_fn)
return proba
def predict(
self, data, batchsize=16, converter=concat_examples,
retain_inputs=False, preprocess_fn=None, postprocess_fn=_argmax):
"""Predict label of each category by taking .
Args:
data: input data
batchsize (int): batch size
converter (Callable): convert from `data` to `inputs`
preprocess_fn (Callable): Its input is numpy.ndarray or
cupy.ndarray, it can return either Variable, cupy.ndarray or
numpy.ndarray
postprocess_fn (Callable): Its input argument is Variable,
but this method may return either Variable, cupy.ndarray or
numpy.ndarray.
retain_inputs (bool): If True, this instance keeps inputs in
`self.inputs` or not.
Returns (tuple or numpy.ndarray): Typically, it is 1-dimensional int
array with shape (batchsize, ) which represents each examples
category prediction.
"""
with chainer.no_backprop_mode(), chainer.using_config('train', False):
predict_labels = self._forward(
data, fn=self.predictor, batchsize=batchsize,
converter=converter, retain_inputs=retain_inputs,
preprocess_fn=preprocess_fn, postprocess_fn=postprocess_fn)
return predict_labels
# --- For backward compatibility ---
@property
def compute_accuracy(self):
warnings.warn('compute_accuracy is deprecated,'
'please use compute_metrics instead')
return self.compute_metrics
@compute_accuracy.setter
def compute_accuracy(self, value):
warnings.warn('compute_accuracy is deprecated,'
'please use compute_metrics instead')
self.compute_metrics = value
@property
def accuracy(self):
warnings.warn('accuracy is deprecated,'
'please use metrics instead')
return self.metrics
@accuracy.setter
def accuracy(self, value):
warnings.warn('accuracy is deprecated,'
'please use metrics instead')
self.metrics = value
@property
def accfun(self):
warnings.warn('accfun is deprecated,'
'please use metrics_fun instead')
return self.metrics_fun
@accfun.setter
def accfun(self, value):
warnings.warn('accfun is deprecated,'
'please use metrics_fun instead')
self.metrics_fun = value
================================================
FILE: chainer_chemistry/models/prediction/graph_conv_predictor.py
================================================
from typing import Optional # NOQA
import chainer
import numpy # NOQA
class GraphConvPredictor(chainer.Chain):
"""Wrapper class that combines a graph convolution and MLP."""
def __init__(
self,
graph_conv, # type: chainer.Link
mlp=None, # type: Optional[chainer.Link]
label_scaler=None, # type: Optional[chainer.Link]
postprocess_fn=None # type: Optional[chainer.FunctionNode]
):
# type: (...) -> None
"""Initialize the graph convolution predictor.
Args:
graph_conv (chainer.Chain): The graph convolution network
required to obtain molecule feature representation.
mlp (chainer.Chain or None): Multi layer perceptron;
used as the final fully connected layer. Set it to
`None` if no operation is necessary after the
`graph_conv` calculation.
label_scaler (chainer.Link or None): scaler link
postprocess_fn (chainer.FunctionNode or None):
postprocess function for prediction.
"""
super(GraphConvPredictor, self).__init__()
with self.init_scope():
self.graph_conv = graph_conv
if isinstance(mlp, chainer.Link):
self.mlp = mlp
if isinstance(label_scaler, chainer.Link):
self.label_scaler = label_scaler
if not isinstance(mlp, chainer.Link):
self.mlp = mlp
if not isinstance(label_scaler, chainer.Link):
self.label_scaler = label_scaler
self.postprocess_fn = postprocess_fn or chainer.functions.identity
def __call__(self, *args, **kwargs):
x = self.graph_conv(*args, **kwargs)
if self.mlp:
x = self.mlp(x)
if self.label_scaler is not None:
x = self.label_scaler.inverse_transform(x)
return x
def predict(self, atoms, adjs):
# type: (numpy.ndarray, numpy.ndarray) -> chainer.Variable
# TODO(nakago): support super_node & is_real_node args.
with chainer.no_backprop_mode(), chainer.using_config('train', False):
x = self.__call__(atoms, adjs)
return self.postprocess_fn(x)
================================================
FILE: chainer_chemistry/models/prediction/node_classifier.py
================================================
from chainer import reporter
from chainer_chemistry.models.prediction.classifier import Classifier
class NodeClassifier(Classifier):
"""A simple node classifier model."""
def __call__(self, data, train_mask, valid_mask, *args, **kwargs):
"""Computes the loss value for an input and label pair."""
self.metrics = None
self.y = self.predictor(data)
# Support for padding pattern
if self.y.ndim == 3:
assert self.y.shape[0] == 1
self.y = self.y[0]
self.train_loss = self.lossfun(self.y[train_mask], data.y[train_mask])
self.valid_loss = self.lossfun(self.y[valid_mask], data.y[valid_mask])
reporter.report(
{'loss(train)': self._convert_to_scalar(self.train_loss)}, self)
reporter.report(
{'loss(valid)': self._convert_to_scalar(self.valid_loss)}, self)
if self.compute_metrics:
# Note: self.accuracy is `dict`, which is different from original
# chainer implementation
self.train_metrics = {key + "(train)":
self._convert_to_scalar(
value(self.y[train_mask],
data.y[train_mask]))
for key, value in self.metrics_fun.items()}
self.valid_metrics = {key + "(valid)":
self._convert_to_scalar(
value(self.y[valid_mask],
data.y[valid_mask]))
for key, value in self.metrics_fun.items()}
reporter.report(self.train_metrics, self)
reporter.report(self.valid_metrics, self)
return self.train_loss
================================================
FILE: chainer_chemistry/models/prediction/regressor.py
================================================
import numpy
import chainer
from chainer.dataset.convert import concat_examples
from chainer import cuda, Variable # NOQA
from chainer import reporter
from chainer_chemistry.dataset.graph_dataset.base_graph_data import BaseGraphData # NOQA
from chainer_chemistry.models.prediction.base import BaseForwardModel
class Regressor(BaseForwardModel):
"""A simple regressor model.
This is an example of chain that wraps another chain. It computes the
loss and metrics based on a given input/label pair.
Args:
predictor (~chainer.Link): Predictor network.
lossfun (function): Loss function.
metrics_fun (function or dict or None): Function that computes metrics.
label_key (int or str): Key to specify label variable from arguments.
When it is ``int``, a variable in positional arguments is used.
And when it is ``str``, a variable in keyword arguments is used.
device (int or chainer._backend.Device):
GPU device id of this Regressor to be used.
-1 indicates to use in CPU.
Attributes:
predictor (~chainer.Link): Predictor network.
lossfun (function): Loss function.
y (~chainer.Variable): Prediction for the last minibatch.
loss (~chainer.Variable): Loss value for the last minibatch.
metrics (dict): Metrics computed in last minibatch
compute_metrics (bool): If ``True``, compute metrics on the forward
computation. The default value is ``True``.
"""
compute_metrics = True
def __init__(self, predictor,
lossfun=chainer.functions.mean_squared_error,
metrics_fun=None, label_key=-1, device=-1):
if not (isinstance(label_key, (int, str))):
raise TypeError('label_key must be int or str, but is %s' %
type(label_key))
super(Regressor, self).__init__()
self.lossfun = lossfun
if metrics_fun is None:
self.compute_metrics = False
self.metrics_fun = {}
elif callable(metrics_fun):
self.metrics_fun = {'metrics': metrics_fun}
elif isinstance(metrics_fun, dict):
self.metrics_fun = metrics_fun
else:
raise TypeError('Unexpected type metrics_fun must be None or '
'Callable or dict. actual {}'
.format(type(metrics_fun)))
self.y = None
self.loss = None
self.metrics = None
self.label_key = label_key
with self.init_scope():
self.predictor = predictor
# `initialize` must be called after `init_scope`.
self.initialize(device)
def _convert_to_scalar(self, value):
"""Converts an input value to a scalar if its type is a Variable,
numpy or cupy array, otherwise it returns the value as it is.
"""
if isinstance(value, Variable):
value = value.array
if numpy.isscalar(value):
return value
if type(value) is not numpy.array:
value = cuda.to_cpu(value)
return numpy.asscalar(value)
def __call__(self, *args, **kwargs):
"""Computes the loss value for an input and label pair.
It also computes metrics and stores it to the attribute.
Args:
args (list of ~chainer.Variable): Input minibatch.
kwargs (dict of ~chainer.Variable): Input minibatch.
When ``label_key`` is ``int``, the correpoding element in ``args``
is treated as ground truth labels. And when it is ``str``, the
element in ``kwargs`` is used.
The all elements of ``args`` and ``kwargs`` except the ground trush
labels are features.
It feeds features to the predictor and compare the result
with ground truth labels.
Returns:
~chainer.Variable: Loss value.
"""
# --- Separate `args` and `t` ---
if isinstance(args[0], BaseGraphData):
# for graph dataset
t = args[0].y
elif isinstance(self.label_key, int):
if not (-len(args) <= self.label_key < len(args)):
msg = 'Label key %d is out of bounds' % self.label_key
raise ValueError(msg)
t = args[self.label_key]
if self.label_key == -1:
args = args[:-1]
else:
args = args[:self.label_key] + args[self.label_key + 1:]
elif isinstance(self.label_key, str):
if self.label_key not in kwargs:
msg = 'Label key "%s" is not found' % self.label_key
raise ValueError(msg)
t = kwargs[self.label_key]
del kwargs[self.label_key]
else:
raise TypeError('Label key type {} not supported'
.format(type(self.label_key)))
self.y = None
self.loss = None
self.metrics = None
self.y = self.predictor(*args, **kwargs)
self.loss = self.lossfun(self.y, t)
# When the reported data is a numpy array, the loss and metrics values
# are scalars. When the reported data is a cupy array, sometimes the
# same values become arrays instead. This seems to be a bug inside the
# reporter class, which needs to be addressed and fixed. Until then,
# the reported values will be converted to numpy arrays.
reporter.report(
{'loss': self._convert_to_scalar(self.loss)}, self)
if self.compute_metrics:
# Note: self.metrics_fun is `dict`,
# which is different from original chainer implementation
self.metrics = {key: self._convert_to_scalar(value(self.y, t))
for key, value in self.metrics_fun.items()}
reporter.report(self.metrics, self)
return self.loss
def predict(
self, data, batchsize=16, converter=concat_examples,
retain_inputs=False, preprocess_fn=None, postprocess_fn=None):
"""Predict label of each category by taking .
Args:
data: input data
batchsize (int): batch size
converter (Callable): convert from `data` to `inputs`
preprocess_fn (Callable): Its input is numpy.ndarray or
cupy.ndarray, it can return either Variable, cupy.ndarray or
numpy.ndarray
postprocess_fn (Callable): Its input argument is Variable,
but this method may return either Variable, cupy.ndarray or
numpy.ndarray.
retain_inputs (bool): If True, this instance keeps inputs in
`self.inputs` or not.
Returns (tuple or numpy.ndarray): Typically, it is 1-dimensional int
array with shape (batchsize, ) which represents each examples
category prediction.
"""
with chainer.no_backprop_mode(), chainer.using_config('train', False):
predict_labels = self._forward(
data, fn=self.predictor, batchsize=batchsize,
converter=converter, retain_inputs=retain_inputs,
preprocess_fn=preprocess_fn, postprocess_fn=postprocess_fn)
return predict_labels
================================================
FILE: chainer_chemistry/models/prediction/set_up_predictor.py
================================================
from typing import Any # NOQA
from typing import Dict # NOQA
from typing import Optional # NOQA
import chainer # NOQA
from chainer_chemistry.models.cgcnn import CGCNN
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.models.ggnn import GGNN
from chainer_chemistry.models.gin import GIN, GINSparse # NOQA
from chainer_chemistry.models.gnn_film import GNNFiLM
from chainer_chemistry.models.megnet import MEGNet
from chainer_chemistry.models.mlp import MLP
from chainer_chemistry.models.nfp import NFP
from chainer_chemistry.models.prediction.graph_conv_predictor import GraphConvPredictor # NOQA
from chainer_chemistry.models.relgat import RelGAT
from chainer_chemistry.models.relgcn import RelGCN, RelGCNSparse # NOQA
from chainer_chemistry.models.rsgcn import RSGCN
from chainer_chemistry.models.schnet import SchNet
from chainer_chemistry.models.weavenet import WeaveNet
from chainer_chemistry.models.gwm.gwm_net import GGNN_GWM # NOQA
from chainer_chemistry.models.gwm.gwm_net import GIN_GWM # NOQA
from chainer_chemistry.models.gwm.gwm_net import NFP_GWM # NOQA
from chainer_chemistry.models.gwm.gwm_net import RSGCN_GWM # NOQA
from chainer_chemistry.models.cwle.cwle_net import GGNN_CWLE # NOQA
from chainer_chemistry.models.cwle.cwle_net import RelGAT_CWLE # NOQA
from chainer_chemistry.models.cwle.cwle_net import RelGCN_CWLE # NOQA
from chainer_chemistry.models.cwle.cwle_net import GIN_CWLE # NOQA
from chainer_chemistry.models.cwle.cwle_net import NFP_CWLE # NOQA
from chainer_chemistry.models.cwle.cwle_net import RSGCN_CWLE # NOQA
from chainer_chemistry.models.gwle.gwle_net import GGNN_GWLE # NOQA
from chainer_chemistry.models.gwle.gwle_net import RelGAT_GWLE # NOQA
from chainer_chemistry.models.gwle.gwle_net import RelGCN_GWLE # NOQA
from chainer_chemistry.models.gwle.gwle_net import GIN_GWLE # NOQA
from chainer_chemistry.models.gwle.gwle_net import NFP_GWLE # NOQA
from chainer_chemistry.models.gwle.gwle_net import RSGCN_GWLE # NOQA
from chainer_chemistry.models.cwle.cwle_graph_conv_model import MAX_WLE_NUM
def set_up_predictor(
method, # type: str
n_unit, # type: int
conv_layers, # type: int
class_num, # type: int
label_scaler=None, # type: Optional[chainer.Link]
postprocess_fn=None, # type: Optional[chainer.FunctionNode]
n_atom_types=MAX_ATOMIC_NUM,
conv_kwargs=None, # type: Optional[Dict[str, Any]]
n_wle_types=MAX_WLE_NUM # type: int
):
# type: (...) -> GraphConvPredictor
"""Set up the predictor, consisting of a GCN and a MLP.
Args:
method (str): Method name.
n_unit (int): Number of hidden units.
conv_layers (int): Number of convolutional layers for the graph
convolution network.
class_num (int): Number of output classes.
label_scaler (chainer.Link or None): scaler link
postprocess_fn (chainer.FunctionNode or None):
postprocess function for prediction.
conv_kwargs (dict): keyword args for GraphConvolution model.
"""
mlp = MLP(out_dim=class_num, hidden_dim=n_unit) # type: Optional[MLP]
if conv_kwargs is None:
conv_kwargs = {}
if method == 'nfp' or method == 'nfp_wle':
print('Set up NFP predictor...')
conv = NFP(
out_dim=n_unit,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_atom_types=n_atom_types,
**conv_kwargs)
elif method == 'ggnn' or method == 'ggnn_wle':
print('Set up GGNN predictor...')
conv = GGNN(
out_dim=n_unit,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_atom_types=n_atom_types,
**conv_kwargs)
elif method == 'schnet':
print('Set up SchNet predictor...')
conv = SchNet(
out_dim=class_num,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_atom_types=n_atom_types,
**conv_kwargs)
mlp = None
elif method == 'weavenet':
print('Set up WeaveNet predictor...')
conv = WeaveNet(hidden_dim=n_unit, n_atom_types=n_atom_types, **conv_kwargs)
elif method == 'rsgcn' or method == 'rsgcn_wle':
print('Set up RSGCN predictor...')
conv = RSGCN(out_dim=n_unit,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_atom_types=n_atom_types,
**conv_kwargs)
elif method == 'relgcn' or method == 'relgcn_wle':
print('Set up Relational GCN predictor...')
num_edge_type = 4
conv = RelGCN(
out_dim=n_unit,
n_edge_types=num_edge_type,
scale_adj=True,
n_atom_types=n_atom_types,
**conv_kwargs)
elif method == 'relgat' or method == 'relgat_wle':
print('Set up Relational GAT predictor...')
conv = RelGAT(
out_dim=n_unit,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_atom_types=n_atom_types,
**conv_kwargs)
elif method == 'gin' or method == 'gin_wle':
print('Set up GIN predictor...')
conv = GIN(
out_dim=n_unit,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_atom_types=n_atom_types,
**conv_kwargs)
elif method == 'nfp_gwm':
print('Set up NFP_GWM predictor...')
conv = NFP_GWM(
out_dim=n_unit,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_atom_types=n_atom_types,
**conv_kwargs)
elif method == 'ggnn_gwm':
print('Set up GGNN_GWM predictor...')
conv = GGNN_GWM(
out_dim=n_unit,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_atom_types=n_atom_types,
**conv_kwargs)
elif method == 'rsgcn_gwm':
print('Set up RSGCN_GWM predictor...')
conv = RSGCN_GWM(
out_dim=n_unit,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_atom_types=n_atom_types,
**conv_kwargs)
elif method == 'gin_gwm':
print('Set up GIN_GWM predictor...')
conv = GIN_GWM(
out_dim=n_unit,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_atom_types=n_atom_types,
**conv_kwargs)
elif method == 'nfp_cwle':
print('Set up NFP_CWLE predictor...')
conv = NFP_CWLE(
out_dim=n_unit,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_atom_types=n_atom_types,
n_wle_types=n_wle_types,
**conv_kwargs)
elif method == 'ggnn_cwle':
print('Set up GGNN_CWLE predictor...')
conv = GGNN_CWLE(
out_dim=n_unit,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_atom_types=n_atom_types,
n_wle_types=n_wle_types,
**conv_kwargs)
elif method == 'relgat_cwle':
print('Set up RelGAT_CWLE predictor...')
conv = RelGAT_CWLE(
out_dim=n_unit,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_atom_types=n_atom_types,
n_wle_types=n_wle_types,
**conv_kwargs)
elif method == 'relgcn_cwle':
print('Set up RelGCN_CWLE predictor...')
conv = RelGCN_CWLE(
out_dim=n_unit,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_atom_types=n_atom_types,
n_wle_types=n_wle_types,
**conv_kwargs)
elif method == 'rsgcn_cwle':
print('Set up RSGCN_CWLE predictor...')
conv = RSGCN_CWLE(
out_dim=n_unit,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_atom_types=n_atom_types,
n_wle_types=n_wle_types,
**conv_kwargs)
elif method == 'gin_cwle':
print('Set up GIN_CWLE predictor...')
conv = GIN_CWLE(
out_dim=n_unit,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_atom_types=n_atom_types,
n_wle_types=n_wle_types,
**conv_kwargs)
elif method == 'nfp_gwle':
print('Set up NFP_GWLE predictor...')
conv = NFP_GWLE(
out_dim=n_unit,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_atom_types=n_atom_types,
n_wle_types=n_wle_types,
**conv_kwargs)
elif method == 'ggnn_gwle':
print('Set up GGNN_GWLE predictor...')
conv = GGNN_GWLE(
out_dim=n_unit,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_atom_types=n_atom_types,
n_wle_types=n_wle_types,
**conv_kwargs)
elif method == 'relgat_gwle':
print('Set up RelGAT_GWLE predictor...')
conv = RelGAT_GWLE(
out_dim=n_unit,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_atom_types=n_atom_types,
n_wle_types=n_wle_types,
**conv_kwargs)
elif method == 'relgcn_gwle':
print('Set up RelGCN_GWLE predictor...')
conv = RelGCN_GWLE(
out_dim=n_unit,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_atom_types=n_atom_types,
n_wle_types=n_wle_types,
**conv_kwargs)
elif method == 'rsgcn_gwle':
print('Set up RSGCN_GWLE predictor...')
conv = RSGCN_GWLE(
out_dim=n_unit,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_atom_types=n_atom_types,
n_wle_types=n_wle_types,
**conv_kwargs)
elif method == 'gin_cwle':
print('Set up GIN_CWLE predictor...')
conv = GIN_CWLE(
out_dim=n_unit,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_atom_types=n_atom_types,
n_wle_types=n_wle_types,
**conv_kwargs)
elif method == 'gin_gwle':
print('Set up GIN_gWLE predictor...')
conv = GIN_GWLE(
out_dim=n_unit,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_atom_types=n_atom_types,
n_wle_types=n_wle_types,
**conv_kwargs)
elif method == 'relgcn_sparse':
print('Set up RelGCNSparse predictor...')
conv = RelGCNSparse(
out_dim=n_unit,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_atom_types=n_atom_types,
**conv_kwargs)
elif method == 'gin_sparse':
print('Set up GIN predictor...')
conv = GINSparse(
out_dim=n_unit,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_atom_types=n_atom_types,
**conv_kwargs)
elif method == 'gnnfilm':
print('Training a GNN_FiLM predictor...')
conv = GNNFiLM(
out_dim=n_unit,
hidden_channels=n_unit,
n_update_layers=conv_layers,
n_edge_types=5,
n_atom_types=n_atom_types,
**conv_kwargs)
elif method == 'megnet':
print('Set up MEGNet predictor...')
conv = MEGNet(
out_dim=n_unit,
n_update_layers=conv_layers,
**conv_kwargs)
elif method == 'cgcnn':
print('Set up CGCNN predictor...')
conv = CGCNN(
out_dim=n_unit,
n_update_layers=conv_layers,
**conv_kwargs)
else:
raise ValueError('[ERROR] Invalid method: {}'.format(method))
predictor = GraphConvPredictor(conv, mlp, label_scaler, postprocess_fn)
return predictor
================================================
FILE: chainer_chemistry/models/relgat.py
================================================
# -*- coding: utf-8 -*-
import chainer
from chainer import functions, cuda # NOQA
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links import EmbedAtomID
from chainer_chemistry.links.readout.ggnn_readout import GGNNReadout
from chainer_chemistry.links.update.relgat_update import RelGATUpdate
class RelGAT(chainer.Chain):
"""Relational Graph Attention Networks (GAT)
See: Veličković, Petar, et al. (2017).\
Graph Attention Networks.\
`arXiv:1701.10903 `\
Dan Busbridge, et al. (2018).\
Relational Graph Attention Networks
``\
Args:
out_dim (int): dimension of output feature vector
hidden_channels (int): dimension of feature vector for each node
n_update_layers (int): number of layers
n_atom_types (int): number of types of atoms
concat_hidden (bool): If set to True, readout is executed in each layer
and the result is concatenated
dropout_ratio (float): dropout ratio of the normalized attention
coefficients
weight_tying (bool): enable weight_tying or not
activation (~chainer.Function or ~chainer.FunctionNode):
activate function
n_edge_types (int): number of edge type.
Defaults to 4 for single, double, triple and aromatic bond.
n_heads (int): number of multi-head-attentions.
negative_slope (float): LeakyRELU angle of the negative slope
softmax_mode (str): take the softmax over the logits 'across' or
'within' relation. If you would like to know the detail discussion,
please refer Relational GAT paper.
concat_heads (bool) : Whether to concat or average multi-head
attentions
"""
def __init__(self, out_dim, hidden_channels=16, n_update_layers=4,
n_atom_types=MAX_ATOMIC_NUM, concat_hidden=False,
dropout_ratio=-1., weight_tying=False,
activation=functions.identity, n_edge_types=4,
n_heads=3, negative_slope=0.2,
softmax_mode='across', concat_heads=False):
super(RelGAT, self).__init__()
n_readout_layer = n_update_layers if concat_hidden else 1
n_message_layer = n_update_layers
with self.init_scope():
self.embed = EmbedAtomID(out_size=hidden_channels,
in_size=n_atom_types)
update_layers = []
for i in range(n_message_layer):
if i > 0 and concat_heads:
input_dim = hidden_channels * n_heads
else:
input_dim = hidden_channels
update_layers.append(
RelGATUpdate(input_dim, hidden_channels, n_heads=n_heads,
n_edge_types=n_edge_types,
dropout_ratio=dropout_ratio,
negative_slope=negative_slope,
softmax_mode=softmax_mode,
concat_heads=concat_heads))
self.update_layers = chainer.ChainList(*update_layers)
if concat_heads:
in_channels = hidden_channels * (n_heads + 1)
else:
in_channels = hidden_channels * 2
self.readout_layers = chainer.ChainList(*[GGNNReadout(
out_dim=out_dim, in_channels=in_channels,
activation=activation, activation_agg=activation)
for _ in range(n_readout_layer)])
self.out_dim = out_dim
self.n_heads = n_heads
self.hidden_channels = hidden_channels
self.n_update_layers = n_update_layers
self.concat_hidden = concat_hidden
self.concat_heads = concat_heads
self.weight_tying = weight_tying
self.negative_slope = negative_slope
self.n_edge_types = n_edge_types
self.dropout_ratio = dropout_ratio
def __call__(self, atom_array, adj):
"""Forward propagation
Args:
atom_array (numpy.ndarray): minibatch of molecular which is
represented with atom IDs (representing C, O, S, ...)
`atom_array[mol_index, atom_index]` represents `mol_index`-th
molecule's `atom_index`-th atomic number
adj (numpy.ndarray): minibatch of adjancency matrix with edge-type
information
Returns:
~chainer.Variable: minibatch of fingerprint
"""
# reset state
if atom_array.dtype == self.xp.int32:
h = self.embed(atom_array) # (minibatch, max_num_atoms)
else:
h = atom_array
h0 = functions.copy(h, cuda.get_device_from_array(h.data).id)
g_list = []
for step in range(self.n_update_layers):
message_layer_index = 0 if self.weight_tying else step
h = self.update_layers[message_layer_index](h, adj)
if self.concat_hidden:
g = self.readout_layers[step](h, h0)
g_list.append(g)
if self.concat_hidden:
return functions.concat(g_list, axis=1)
else:
g = self.readout_layers[0](h, h0)
return g
================================================
FILE: chainer_chemistry/models/relgcn.py
================================================
import chainer
from chainer import functions, cuda # NOQA
from chainer.links import Linear
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links.readout.scatter_ggnn_readout import ScatterGGNNReadout # NOQA
from chainer_chemistry.links import EmbedAtomID, GraphLinear # NOQA
from chainer_chemistry.links.readout.ggnn_readout import GGNNReadout
from chainer_chemistry.links.update.relgcn_update import RelGCNUpdate, RelGCNSparseUpdate # NOQA
def rescale_adj(adj):
"""Normalize adjacency matrix
It ensures that activations are on a similar scale irrespective of
the number of neighbors
Args:
adj (:class:`chainer.Variable`, or :class:`numpy.ndarray` \
or :class:`cupy.ndarray`):
adjacency matrix
Returns:
:class:`chainer.Variable`: normalized adjacency matrix
"""
xp = cuda.get_array_module(adj)
num_neighbors = functions.sum(adj, axis=(1, 2))
base = xp.ones(num_neighbors.shape, dtype=xp.float32)
cond = num_neighbors.data != 0
num_neighbors_inv = 1 / functions.where(cond, num_neighbors, base)
return adj * functions.broadcast_to(
num_neighbors_inv[:, None, None, :], adj.shape)
class RelGCN(chainer.Chain):
"""Relational GCN (RelGCN)
See: Michael Schlichtkrull+, \
Modeling Relational Data with Graph Convolutional Networks. \
March 2017. \
`arXiv:1703.06103 `
Args:
out_dim (int): dimension of output feature vector
hidden_channels (None or int or list):
dimension of feature vector for each node
n_update_layers (int): number of layers
n_atom_types (int): number of types of atoms
n_edge_types (int): number of edge type.
Defaults to 4 for single, double, triple and aromatic bond.
scale_adj (bool): If ``True``, then this network normalizes
adjacency matrix
"""
def __init__(self, out_dim=64, hidden_channels=None, n_update_layers=None,
n_atom_types=MAX_ATOMIC_NUM, n_edge_types=4, input_type='int',
scale_adj=False):
super(RelGCN, self).__init__()
if hidden_channels is None:
hidden_channels = [16, 128, 64]
elif isinstance(hidden_channels, int):
if not isinstance(n_update_layers, int):
raise ValueError(
'Must specify n_update_layers when hidden_channels is int')
hidden_channels = [hidden_channels] * n_update_layers
with self.init_scope():
if input_type == 'int':
self.embed = EmbedAtomID(out_size=hidden_channels[0],
in_size=n_atom_types)
elif input_type == 'float':
self.embed = GraphLinear(None, hidden_channels[0])
else:
raise ValueError("[ERROR] Unexpected value input_type={}"
.format(input_type))
self.rgcn_convs = chainer.ChainList(*[
RelGCNUpdate(hidden_channels[i], hidden_channels[i + 1],
n_edge_types)
for i in range(len(hidden_channels) - 1)])
self.rgcn_readout = GGNNReadout(
out_dim=out_dim, in_channels=hidden_channels[-1],
nobias=True, activation=functions.tanh)
# self.num_relations = num_edge_type
self.input_type = input_type
self.scale_adj = scale_adj
def __call__(self, x, adj):
"""main calculation
Args:
x: (batchsize, num_nodes, in_channels)
adj: (batchsize, num_edge_type, num_nodes, num_nodes)
Returns: (batchsize, hidden_channels)
"""
if x.dtype == self.xp.int32:
assert self.input_type == 'int'
else:
assert self.input_type == 'float'
h = self.embed(x) # (minibatch, max_num_atoms)
if self.scale_adj:
adj = rescale_adj(adj)
for rgcn_conv in self.rgcn_convs:
h = functions.tanh(rgcn_conv(h, adj))
h = self.rgcn_readout(h)
return h
class RelGCNSparse(chainer.Chain):
"""Relational GCN (RelGCN) Sparse Pattern
See: Michael Schlichtkrull+, \
Modeling Relational Data with Graph Convolutional Networks. \
March 2017. \
`arXiv:1703.06103 `
Args:
out_dim (int): dimension of output feature vector
hidden_channels (None or int or list):
dimension of feature vector for each node
n_update_layers (int): number of layers
n_atom_types (int): number of types of atoms
n_edge_types (int): number of edge type.
Defaults to 4 for single, double, triple and aromatic bond.
scale_adj (bool): If ``True``, then this network normalizes
adjacency matrix
"""
def __init__(self, out_dim=64, hidden_channels=None, n_update_layers=None,
n_atom_types=MAX_ATOMIC_NUM, n_edge_types=4, input_type='int',
scale_adj=False):
super(RelGCNSparse, self).__init__()
if hidden_channels is None:
hidden_channels = [16, 128, 64]
elif isinstance(hidden_channels, int):
if not isinstance(n_update_layers, int):
raise ValueError(
'Must specify n_update_layers when hidden_channels is int')
hidden_channels = [hidden_channels] * n_update_layers
with self.init_scope():
if input_type == 'int':
self.embed = EmbedAtomID(out_size=hidden_channels[0],
in_size=n_atom_types)
elif input_type == 'float':
self.embed = Linear(None, hidden_channels[0])
else:
raise ValueError("[ERROR] Unexpected value input_type={}"
.format(input_type))
self.rgcn_convs = chainer.ChainList(*[
RelGCNSparseUpdate(hidden_channels[i], hidden_channels[i + 1],
n_edge_types)
for i in range(len(hidden_channels) - 1)])
self.rgcn_readout = ScatterGGNNReadout(
out_dim=out_dim, in_channels=hidden_channels[-1],
nobias=True, activation=functions.tanh)
# self.num_relations = num_edge_type
self.input_type = input_type
self.scale_adj = scale_adj
def __call__(self, sparse_batch):
"""main calculation
Args:
x: (batchsize, num_nodes, in_channels)
adj: (batchsize, num_edge_type, num_nodes, num_nodes)
Returns: (batchsize, hidden_channels)
"""
if sparse_batch.x.dtype == self.xp.int32:
assert self.input_type == 'int'
else:
assert self.input_type == 'float'
h = self.embed(sparse_batch.x) # (minibatch, max_num_atoms)
if self.scale_adj:
raise NotImplementedError
for rgcn_conv in self.rgcn_convs:
h = functions.tanh(rgcn_conv(
h, sparse_batch.edge_index, sparse_batch.edge_attr))
h = self.rgcn_readout(h, sparse_batch.batch)
return h
================================================
FILE: chainer_chemistry/models/rsgcn.py
================================================
import chainer
from chainer import functions, Variable # NOQA
import chainer_chemistry
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links.readout.general_readout import GeneralReadout
from chainer_chemistry.links.update.rsgcn_update import RSGCNUpdate
class RSGCN(chainer.Chain):
"""Renormalized Spectral Graph Convolutional Network (RSGCN)
See: Thomas N. Kipf and Max Welling, \
Semi-Supervised Classification with Graph Convolutional Networks. \
September 2016. \
`arXiv:1609.02907 `_
The name of this model "Renormalized Spectral Graph Convolutional Network
(RSGCN)" is named by us rather than the authors of the paper above.
The authors call this model just "Graph Convolution Network (GCN)", but
we think that "GCN" is bit too general and may cause namespace issue.
That is why we did not name this model as GCN.
Args:
out_dim (int): dimension of output feature vector
hidden_channels (int): dimension of feature vector for each node
n_update_layers (int): number of layers
n_atom_types (int): number of types of atoms
use_batch_norm (bool): If True, batch normalization is applied after
graph convolution.
readout (Callable): readout function. If None,
`GeneralReadout(mode='sum)` is used.
To the best of our knowledge, the paper of RSGCN model does
not give any suggestion on readout.
dropout_ratio (float): ratio used in dropout function.
If 0 or negative value is set, dropout function is skipped.
"""
def __init__(self, out_dim, hidden_channels=32, n_update_layers=4,
n_atom_types=MAX_ATOMIC_NUM,
use_batch_norm=False, readout=None, dropout_ratio=0.5):
super(RSGCN, self).__init__()
in_dims = [hidden_channels for _ in range(n_update_layers)]
out_dims = [hidden_channels for _ in range(n_update_layers)]
out_dims[n_update_layers - 1] = out_dim
if readout is None:
readout = GeneralReadout()
with self.init_scope():
self.embed = chainer_chemistry.links.EmbedAtomID(out_size=hidden_channels, in_size=n_atom_types)
self.gconvs = chainer.ChainList(
*[RSGCNUpdate(in_dims[i], out_dims[i])
for i in range(n_update_layers)])
if use_batch_norm:
self.bnorms = chainer.ChainList(
*[chainer_chemistry.links.GraphBatchNormalization(
out_dims[i]) for i in range(n_update_layers)])
else:
self.bnorms = [None for _ in range(n_update_layers)]
if isinstance(readout, chainer.Link):
self.readout = readout
if not isinstance(readout, chainer.Link):
self.readout = readout
self.out_dim = out_dim
self.hidden_channels = hidden_channels
self.n_update_layers = n_update_layers
self.dropout_ratio = dropout_ratio
def __call__(self, atom_array, adj, **kwargs):
"""Forward propagation
Args:
atom_array (numpy.ndarray): minibatch of molecular which is
represented with atom IDs (representing C, O, S, ...)
`atom_array[mol_index, atom_index]` represents `mol_index`-th
molecule's `atom_index`-th atomic number
adj (numpy.ndarray): minibatch of adjancency matrix
`adj[mol_index]` represents `mol_index`-th molecule's
adjacency matrix
Returns:
~chainer.Variable: minibatch of fingerprint
"""
if atom_array.dtype == self.xp.int32:
# atom_array: (minibatch, nodes)
h = self.embed(atom_array)
else:
h = atom_array
# h: (minibatch, nodes, ch)
if isinstance(adj, Variable):
w_adj = adj.data
else:
w_adj = adj
w_adj = Variable(w_adj, requires_grad=False)
# --- RSGCN update ---
for i, (gconv, bnorm) in enumerate(zip(self.gconvs,
self.bnorms)):
#print(h.shape)
h = gconv(h, w_adj)
if bnorm is not None:
h = bnorm(h)
if self.dropout_ratio > 0.:
h = functions.dropout(h, ratio=self.dropout_ratio)
if i < self.n_update_layers - 1:
h = functions.relu(h)
# --- readout ---
y = self.readout(h)
return y
================================================
FILE: chainer_chemistry/models/schnet.py
================================================
import chainer
from chainer import functions
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links import EmbedAtomID
from chainer_chemistry.links.readout.schnet_readout import SchNetReadout
from chainer_chemistry.links.update.schnet_update import SchNetUpdate
class SchNet(chainer.Chain):
"""SchNet
See Kristof et al, \
SchNet: A continuous-filter convolutional neural network for modeling
quantum interactions. \
`arXiv:1706.08566 `_
Args:
out_dim (int): dimension of output feature vector
hidden_channels (int): dimension of feature vector for each node
n_update_layers (int): number of layers
readout_hidden_dim (int): dimension of feature vector
associated to each molecule
n_atom_types (int): number of types of atoms
concat_hidden (bool): If set to True, readout is executed in each layer
and the result is concatenated
num_rbf (int): Number of RDF kernels used in `CFConv`.
radius_resolution (float): Resolution of radius.
The range (radius_resolution * 1 ~ radius_resolution * num_rbf)
are taken inside `CFConv`.
gamma (float): exponential factor of `CFConv`'s radius kernel.
"""
def __init__(self, out_dim=1, hidden_channels=64, n_update_layers=3,
readout_hidden_dim=32, n_atom_types=MAX_ATOMIC_NUM,
concat_hidden=False, num_rbf=300, radius_resolution=0.1,
gamma=10.0):
super(SchNet, self).__init__()
with self.init_scope():
self.embed = EmbedAtomID(out_size=hidden_channels,
in_size=n_atom_types)
self.update_layers = chainer.ChainList(
*[SchNetUpdate(
hidden_channels,
num_rbf=num_rbf, radius_resolution=radius_resolution,
gamma=gamma) for _ in range(n_update_layers)])
self.readout_layer = SchNetReadout(
out_dim, in_channels=None, hidden_channels=readout_hidden_dim)
self.out_dim = out_dim
self.hidden_channels = hidden_channels
self.readout_hidden_dim = readout_hidden_dim
self.n_update_layers = n_update_layers
self.concat_hidden = concat_hidden
def __call__(self, atom_features, dist_features):
x = self.embed(atom_features)
h = []
# --- update part ---
for i in range(self.n_update_layers):
x = self.update_layers[i](x, dist_features)
if self.concat_hidden:
h.append(x)
# --- readout part ---
if self.concat_hidden:
x = functions.concat(h, axis=2)
x = self.readout_layer(x)
return x
================================================
FILE: chainer_chemistry/models/weavenet.py
================================================
import chainer
from chainer import functions
from chainer import links
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.config import WEAVE_DEFAULT_NUM_MAX_ATOMS
from chainer_chemistry.links.connection.embed_atom_id import EmbedAtomID
from chainer_chemistry.links.readout.general_readout import GeneralReadout
WEAVENET_DEFAULT_WEAVE_CHANNELS = [50, ]
class LinearLayer(chainer.Chain):
def __init__(self, n_channel, n_layer):
super(LinearLayer, self).__init__()
with self.init_scope():
self.layers = chainer.ChainList(
*[links.Linear(None, n_channel) for _ in range(n_layer)]
)
self.n_output_channel = n_channel
def forward(self, x):
n_batch, n_atom, n_channel = x.shape
x = functions.reshape(x, (n_batch * n_atom, n_channel))
for l in self.layers:
x = l(x)
x = functions.relu(x)
x = functions.reshape(x, (n_batch, n_atom, self.n_output_channel))
return x
class AtomToPair(chainer.Chain):
def __init__(self, n_channel, n_layer, n_atom):
super(AtomToPair, self).__init__()
with self.init_scope():
self.linear_layers = chainer.ChainList(
*[links.Linear(None, n_channel) for _ in range(n_layer)]
)
self.n_atom = n_atom
self.n_channel = n_channel
def forward(self, x):
n_batch, n_atom, n_feature = x.shape
atom_repeat = functions.reshape(x, (n_batch, 1, n_atom, n_feature))
atom_repeat = functions.broadcast_to(
atom_repeat, (n_batch, n_atom, n_atom, n_feature))
atom_repeat = functions.reshape(atom_repeat,
(n_batch, n_atom * n_atom, n_feature))
atom_tile = functions.reshape(x, (n_batch, n_atom, 1, n_feature))
atom_tile = functions.broadcast_to(
atom_tile, (n_batch, n_atom, n_atom, n_feature))
atom_tile = functions.reshape(atom_tile,
(n_batch, n_atom * n_atom, n_feature))
pair_x0 = functions.concat((atom_tile, atom_repeat), axis=2)
pair_x0 = functions.reshape(pair_x0,
(n_batch * n_atom * n_atom, n_feature * 2))
for l in self.linear_layers:
pair_x0 = l(pair_x0)
pair_x0 = functions.relu(pair_x0)
pair_x0 = functions.reshape(pair_x0,
(n_batch, n_atom * n_atom, self.n_channel))
pair_x1 = functions.concat((atom_repeat, atom_tile), axis=2)
pair_x1 = functions.reshape(pair_x1,
(n_batch * n_atom * n_atom, n_feature * 2))
for l in self.linear_layers:
pair_x1 = l(pair_x1)
pair_x1 = functions.relu(pair_x1)
pair_x1 = functions.reshape(pair_x1,
(n_batch, n_atom * n_atom, self.n_channel))
return pair_x0 + pair_x1
class PairToAtom(chainer.Chain):
def __init__(self, n_channel, n_layer, n_atom, mode='sum'):
super(PairToAtom, self).__init__()
with self.init_scope():
self.linearLayer = chainer.ChainList(
*[links.Linear(None, n_channel) for _ in range(n_layer)]
)
self.readout = GeneralReadout(mode=mode)
self.n_atom = n_atom
self.n_channel = n_channel
self.mode = mode
def forward(self, x):
n_batch, n_pair, n_feature = x.shape
a = functions.reshape(
x, (n_batch * (self.n_atom * self.n_atom), n_feature))
for l in self.linearLayer:
a = l(a)
a = functions.relu(a)
a = functions.reshape(a, (n_batch, self.n_atom, self.n_atom,
self.n_channel))
a = self.readout(a, axis=2)
return a
class WeaveModule(chainer.Chain):
def __init__(self, n_atom, output_channel, n_sub_layer,
readout_mode='sum'):
super(WeaveModule, self).__init__()
with self.init_scope():
self.atom_layer = LinearLayer(output_channel, n_sub_layer)
self.pair_layer = LinearLayer(output_channel, n_sub_layer)
self.atom_to_atom = LinearLayer(output_channel, n_sub_layer)
self.pair_to_pair = LinearLayer(output_channel, n_sub_layer)
self.atom_to_pair = AtomToPair(output_channel, n_sub_layer, n_atom)
self.pair_to_atom = PairToAtom(output_channel, n_sub_layer, n_atom,
mode=readout_mode)
self.n_atom = n_atom
self.n_channel = output_channel
self.readout_mode = readout_mode
def forward(self, atom_x, pair_x, atom_only=False):
a0 = self.atom_to_atom.forward(atom_x)
a1 = self.pair_to_atom.forward(pair_x)
a = functions.concat([a0, a1], axis=2)
next_atom = self.atom_layer.forward(a)
next_atom = functions.relu(next_atom)
if atom_only:
return next_atom
p0 = self.atom_to_pair.forward(atom_x)
p1 = self.pair_to_pair.forward(pair_x)
p = functions.concat([p0, p1], axis=2)
next_pair = self.pair_layer.forward(p)
next_pair = functions.relu(next_pair)
return next_atom, next_pair
class WeaveNet(chainer.Chain):
"""WeaveNet implementation
Args:
weave_channels (list): list of int, output dimension for each weave
module
hidden_dim (int): hidden dim
n_atom (int): number of atom of input array
n_sub_layer (int): number of layer for each `AtomToPair`, `PairToAtom`
layer
n_atom_types (int): number of atom id
readout_mode (str): 'sum' or 'max' or 'summax'
"""
def __init__(self, weave_channels=None, hidden_dim=16,
n_atom=WEAVE_DEFAULT_NUM_MAX_ATOMS,
n_sub_layer=1, n_atom_types=MAX_ATOMIC_NUM,
readout_mode='sum'):
weave_channels = weave_channels or WEAVENET_DEFAULT_WEAVE_CHANNELS
weave_module = [
WeaveModule(n_atom, c, n_sub_layer, readout_mode=readout_mode)
for c in weave_channels
]
super(WeaveNet, self).__init__()
with self.init_scope():
self.embed = EmbedAtomID(out_size=hidden_dim, in_size=n_atom_types)
self.weave_module = chainer.ChainList(*weave_module)
self.readout = GeneralReadout(mode=readout_mode)
self.readout_mode = readout_mode
def __call__(self, atom_x, pair_x, train=True):
if atom_x.dtype == self.xp.int32:
# atom_array: (minibatch, atom)
atom_x = self.embed(atom_x)
for i in range(len(self.weave_module)):
if i == len(self.weave_module) - 1:
# last layer, only `atom_x` is needed.
atom_x = self.weave_module[i].forward(atom_x, pair_x,
atom_only=True)
else:
# not last layer, both `atom_x` and `pair_x` are needed
atom_x, pair_x = self.weave_module[i].forward(atom_x, pair_x)
x = self.readout(atom_x, axis=1)
return x
================================================
FILE: chainer_chemistry/saliency/__init__.py
================================================
from chainer_chemistry.saliency import calculator # NOQA
from chainer_chemistry.saliency import visualizer # NOQA
================================================
FILE: chainer_chemistry/saliency/calculator/__init__.py
================================================
from chainer_chemistry.saliency.calculator import base_calculator # NOQA
from chainer_chemistry.saliency.calculator import calculator_utils # NOQA
from chainer_chemistry.saliency.calculator import gradient_calculator # NOQA
from chainer_chemistry.saliency.calculator import integrated_gradients_calculator # NOQA
from chainer_chemistry.saliency.calculator import occlusion_calculator # NOQA
from chainer_chemistry.saliency.calculator.base_calculator import BaseCalculator # NOQA
from chainer_chemistry.saliency.calculator.gradient_calculator import GradientCalculator # NOQA
from chainer_chemistry.saliency.calculator.integrated_gradients_calculator import IntegratedGradientsCalculator # NOQA
from chainer_chemistry.saliency.calculator.occlusion_calculator import OcclusionCalculator # NOQA
from chainer_chemistry.saliency.calculator.calculator_utils import GaussianNoiseSampler # NOQA
================================================
FILE: chainer_chemistry/saliency/calculator/base_calculator.py
================================================
from logging import getLogger
import numpy
import chainer
from chainer import cuda
from chainer.dataset.convert import concat_examples, _concat_arrays_with_padding # NOQA
from chainer.iterators import SerialIterator
from chainer_chemistry.link_hooks import is_link_hooks_available
from tqdm import tqdm
if is_link_hooks_available:
from chainer import LinkHook
from chainer_chemistry.link_hooks import VariableMonitorLinkHook
_sampling_axis = 0
def _to_tuple(x):
if not isinstance(x, tuple):
x = (x,)
return x
def _to_variable(x):
if not isinstance(x, chainer.Variable):
x = chainer.Variable(x)
return x
def _extract_numpy(x):
if isinstance(x, chainer.Variable):
x = x.data
return cuda.to_cpu(x)
def _concat(batch_list):
try:
return numpy.concatenate(batch_list)
except Exception as e: # NOQA
# Thre is a case that each input has different shape,
# we cannot concatenate into array in this case.
elem_list = [elem for batch in batch_list for elem in batch]
return _concat_arrays_with_padding(elem_list, padding=0)
def add_linkhook(linkhook, prefix='', logger=None):
link_hooks = chainer._get_link_hooks()
name = prefix + linkhook.name
if name in link_hooks:
logger = logger or getLogger(__name__)
logger.warning('hook {} already exists, overwrite.'.format(name))
pass # skip this case...
# raise KeyError('hook %s already exists' % name)
link_hooks[name] = linkhook
linkhook.added(None)
return linkhook
def delete_linkhook(linkhook, prefix='', logger=None):
name = prefix + linkhook.name
link_hooks = chainer._get_link_hooks()
if name not in link_hooks.keys():
logger = logger or getLogger(__name__)
logger.warning('linkhook {} is not registered'.format(name))
return
link_hooks[name].deleted(None)
del link_hooks[name]
class BaseCalculator(object):
"""Base class for saliency calculator
Use `compute`, `aggregate` method to calculate saliency.
This base class supports to calculate SmoothGrad[1] and BayesGrad[2] of
concrete subclass.
See: Daniel Smilkov, Nikhil Thorat, Been Kim, Fernanda Viegas, and Martin
Wattenberg. SmoothGrad: removing noise by adding noise.
`arXiv:1706.03825 `_
See: Akita, Hirotaka and Nakago, Kosuke and Komatsu, Tomoki and Sugawara,
Yohei and Maeda, Shin-ichi and Baba, Yukino and Kashima, Hisashi
BayesGrad: Explaining Predictions of Graph Convolutional Networks
`arXiv:1807.01985 `_
Args:
model (chainer.Chain): target model to calculate saliency.
target_extractor (VariableMonitorLinkHook or None):
It determines `target_var`, target variable to calculate saliency.
If `None`, first argument of input to the model is treated as
`target_var`.
output_extractor (VariableMonitorLinkHook or None):
It determines `output_var`, output variable to calculate saliency.
If `None`, output of the model is treated as `output_var`.
device (int or None): device id to calculate saliency.
If `None`, device id is inferred automatically from `model`.
logger:
"""
def __init__(self, model, target_extractor=None, output_extractor=None,
device=None, logger=None):
self.model = model # type: chainer.Chain
if device is not None:
self._device = device
else:
self._device = cuda.get_device_from_array(*model.params()).id
self.target_extractor = target_extractor
self.output_extractor = output_extractor
self.logger = logger or getLogger(__name__)
def compute(self, data, M=1, batchsize=16,
converter=concat_examples, retain_inputs=False,
preprocess_fn=None, postprocess_fn=None, train=False,
noise_sampler=None, show_progress=True):
"""computes saliency_samples
Args:
data: dataset to calculate saliency
M (int): sampling size. `M > 1` may be set with SmoothGrad or
BayesGrad configuration. See `train` and `noise_sampler`
description.
batchsize (int): batch size
converter (function): converter to make batch from `data`
retain_inputs (bool): retain input flag
preprocess_fn (function or None): preprocess function
postprocess_fn (function or None): postprocess function
train (bool): chainer.config.train flag. When the `model` contains
`dropout` (or other stochastic) function, `train=True`
corresponds to calculate BayesGrad.
noise_sampler: noise sampler class with `sample` method.
If this is set, noise is added to `target_var`. It can be
used to calculate SmoothGrad.
If `None`, noise is not sampled.
show_progress (bool): Show progress bar or not.
Returns:
saliency_samples (numpy.ndarray): M samples of saliency array.
Its shape is (M,) + target_var.shape, i.e., sampling axis is
added to the first axis.
"""
saliency_list = []
for _ in tqdm(range(M), disable=not show_progress):
with chainer.using_config('train', train):
saliency = self._forward(
data, batchsize=batchsize,
converter=converter,
retain_inputs=retain_inputs, preprocess_fn=preprocess_fn,
postprocess_fn=postprocess_fn, noise_sampler=noise_sampler)
saliency_array = cuda.to_cpu(saliency)
saliency_list.append(saliency_array)
return numpy.stack(saliency_list, axis=_sampling_axis)
def aggregate(self, saliency_arrays, method='raw', ch_axis=None):
"""Aggregate saliency samples into one saliency score.
Args:
saliency_arrays (numpy.ndarray): M samples of saliency array
calculated by `compute` method.
method (str): It supports following methods for aggregation.
raw: simply take mean of samples.
absolute: calc absolute mean of samples.
square: calc squared mean of samples.
ch_axis (int, tuple or None): channel axis. The ch_axis is
considered as reduced axis for saliency calculation.
Returns:
saliency (numpy.ndarray): saliency score
"""
if method == 'raw':
h = saliency_arrays # do nothing
elif method == 'abs':
h = numpy.abs(saliency_arrays)
elif method == 'square':
h = saliency_arrays ** 2
else:
raise ValueError("[ERROR] Unexpected value method={}"
.format(method))
if ch_axis is not None:
h = numpy.sum(h, axis=ch_axis)
sampling_axis = _sampling_axis
return numpy.mean(h, axis=sampling_axis)
def _compute_core(self, *inputs):
"""Core computation routine
Each concrete subclass should implement this method
"""
raise NotImplementedError
def get_target_var(self, inputs):
if isinstance(self.target_extractor, VariableMonitorLinkHook):
target_var = self.target_extractor.get_variable()
else:
if isinstance(inputs, tuple):
target_var = inputs[0]
else:
target_var = inputs
if target_var is None:
self.logger.warning(
'target_var is None. This may be caused because "model" is not'
' forwarded in advance or "model" does not implement "forward"'
' method and LinkHook is not triggered.')
return target_var
def get_output_var(self, outputs):
if isinstance(self.output_extractor, VariableMonitorLinkHook):
output_var = self.output_extractor.get_variable()
else:
output_var = outputs
if output_var is None:
self.logger.warning(
'output_var is None. This may be caused because "model" is not'
' forwarded in advance or "model" does not implement "forward"'
' method and LinkHook is not triggered.')
return output_var
def _forward(self, data, batchsize=16,
converter=concat_examples, retain_inputs=False,
preprocess_fn=None, postprocess_fn=None, noise_sampler=None):
"""Forward data by iterating with batch
Args:
data: "train_x array" or "chainer dataset"
batchsize (int): batch size
converter (Callable): convert from `data` to `inputs`
retain_inputs (bool): If True, this instance keeps inputs in
`self.inputs` or not.
preprocess_fn (Callable): Its input is numpy.ndarray or
cupy.ndarray, it can return either Variable, cupy.ndarray or
numpy.ndarray
postprocess_fn (Callable): Its input argument is Variable,
but this method may return either Variable, cupy.ndarray or
numpy.ndarray.
Returns (tuple or numpy.ndarray): forward result
"""
input_list = None
output_list = None
it = SerialIterator(data, batch_size=batchsize, repeat=False,
shuffle=False)
if isinstance(self.target_extractor, LinkHook):
add_linkhook(self.target_extractor, prefix='/saliency/target/',
logger=self.logger)
if isinstance(self.output_extractor, LinkHook):
add_linkhook(self.output_extractor, prefix='/saliency/output/',
logger=self.logger)
for batch in it:
inputs = converter(batch, self._device)
inputs = _to_tuple(inputs)
if preprocess_fn:
inputs = preprocess_fn(*inputs)
inputs = _to_tuple(inputs)
inputs = [_to_variable(x) for x in inputs]
# --- Main saliency computation ----
if noise_sampler is None:
# VanillaGrad computation
outputs = self._compute_core(*inputs)
else:
# SmoothGrad computation
if self.target_extractor is None:
# inputs[0] is considered as "target_var"
noise = noise_sampler.sample(inputs[0].array)
inputs[0].array += noise
outputs = self._compute_core(*inputs)
else:
# Add process to LinkHook
def add_noise(hook, args, target_var):
noise = noise_sampler.sample(target_var.array)
target_var.array += noise
self.target_extractor.add_process('/saliency/add_noise',
add_noise)
outputs = self._compute_core(*inputs)
self.target_extractor.delete_process('/saliency/add_noise')
# --- Main saliency computation end ---
# Init
if retain_inputs:
if input_list is None:
input_list = [[] for _ in range(len(inputs))]
for j, input in enumerate(inputs):
input_list[j].append(cuda.to_cpu(input))
if output_list is None:
output_list = [[] for _ in range(len(outputs))]
if postprocess_fn:
outputs = postprocess_fn(*outputs)
outputs = _to_tuple(outputs)
for j, output in enumerate(outputs):
output_list[j].append(_extract_numpy(output))
if isinstance(self.target_extractor, LinkHook):
delete_linkhook(self.target_extractor, prefix='/saliency/target/',
logger=self.logger)
if isinstance(self.output_extractor, LinkHook):
delete_linkhook(self.output_extractor, prefix='/saliency/output/',
logger=self.logger)
if retain_inputs:
self.inputs = [numpy.concatenate(
in_array) for in_array in input_list]
result = [_concat(output) for output in output_list]
if len(result) == 1:
return result[0]
else:
self.logger.error('return multiple result handling is not '
'implemented yet and not supported.')
return result
================================================
FILE: chainer_chemistry/saliency/calculator/calculator_utils.py
================================================
from chainer import cuda
class GaussianNoiseSampler(object):
"""Default noise sampler class to calculate SmoothGrad"""
def __init__(self, mode='relative', scale=0.15):
self.mode = mode
self.scale = scale
def sample(self, target_array):
xp = cuda.get_array_module(target_array)
noise = xp.random.normal(
0, self.scale, target_array.shape)
if self.mode == 'absolute':
# `scale` is used as is
pass
elif self.mode == 'relative':
# `scale_axis` is used to calculate `max` and `min` of target_array
# As default, all axes except batch axis are used.
scale_axis = tuple(range(1, target_array.ndim))
vmax = xp.max(target_array, axis=scale_axis, keepdims=True)
vmin = xp.min(target_array, axis=scale_axis, keepdims=True)
noise = noise * (vmax - vmin)
else:
raise ValueError("[ERROR] Unexpected value mode={}"
.format(self.mode))
return noise
================================================
FILE: chainer_chemistry/saliency/calculator/gradient_calculator.py
================================================
import chainer # NOQA
from chainer import functions
from chainer_chemistry.saliency.calculator.base_calculator import BaseCalculator # NOQA
class GradientCalculator(BaseCalculator):
"""Gradient saliency calculator
Use `compute`, `aggregate` method to calculate saliency.
See: Dumitru Erhan, Yoshua Bengio, Aaron Courville, Pascal Vincent (2009).
Visualizing Higher-Layer Features of a Deep Network.
See: Karen Simonyan, Andrea Vedaldi, and Andrew Zisserman.
Deep inside convolutional networks: Visualising image classication
models and saliency maps.
`arXiv:1312.6034 `_
Args:
model (chainer.Chain): target model to calculate saliency.
target_extractor (VariableMonitorLinkHook or None):
It determines `target_var`, target variable to calculate saliency.
If `None`, first argument of input to the model is treated as
`target_var`.
output_extractor (VariableMonitorLinkHook or None):
It determines `output_var`, output variable to calculate saliency.
If `None`, output of the model is treated as `output_var`.
eval_fun (callable): If
multiply_target (bool):
If `False`, return value is `target_var.grad`.
If `True`, return value is `target_var.grad * target_var`.
device (int or None): device id to calculate saliency.
If `None`, device id is inferred automatically from `model`.
"""
def __init__(self, model, target_extractor=None, output_extractor=None,
eval_fun=None, multiply_target=False, device=None):
super(GradientCalculator, self).__init__(
model, target_extractor=target_extractor,
output_extractor=output_extractor, device=device)
self.eval_fun = eval_fun or model.__call__
self.multiply_target = multiply_target
def _compute_core(self, *inputs):
self.model.cleargrads()
outputs = self.eval_fun(*inputs)
target_var = self.get_target_var(inputs)
target_var.grad = None # Need to reset grad beforehand of backward.
output_var = self.get_output_var(outputs)
# --- type check for output_var ---
if output_var.size != 1:
self.logger.warning(
'output_var.size is not 1, calculate scalar value. '
'functions.sum is applied.')
output_var = functions.sum(output_var)
output_var.backward(retain_grad=True)
saliency = target_var.grad
if self.multiply_target:
saliency *= target_var.data
outputs = (saliency,)
return outputs
================================================
FILE: chainer_chemistry/saliency/calculator/integrated_gradients_calculator.py
================================================
import numpy
from chainer_chemistry.saliency.calculator.gradient_calculator import GradientCalculator # NOQA
class IntegratedGradientsCalculator(GradientCalculator):
"""Integrated gradient saliency calculator
Use `compute`, `aggregate` method to calculate saliency.
See: Mukund Sundararajan, Ankur Taly, and Qiqi Yan (2017).
Axiomatic attribution for deep networks. PMLR.
URL http://proceedings.mlr.press/v70/sundararajan17a.html.
Args:
model (chainer.Chain): target model to calculate saliency.
target_extractor (VariableMonitorLinkHook or None):
It determines `target_var`, target variable to calculate saliency.
If `None`, first argument of input to the model is treated as
`target_var`.
output_extractor (VariableMonitorLinkHook or None):
It determines `output_var`, output variable to calculate saliency.
If `None`, output of the model is treated as `output_var`.
eval_fun (callable): If
baseline (numpy.ndarray or None):
If `None`, baseline is set as 0.
steps (int): Number of separation to calculate integrated gradient.
device (int or None): device id to calculate saliency.
If `None`, device id is inferred automatically from `model`.
"""
def __init__(self, model, target_extractor=None, output_extractor=None,
eval_fun=None, baseline=None, steps=25, device=None):
super(IntegratedGradientsCalculator, self).__init__(
model, target_extractor=target_extractor,
output_extractor=output_extractor, multiply_target=False,
eval_fun=eval_fun, device=device)
self.baseline = baseline or 0.
self.steps = steps
def _compute_core(self, *inputs):
total_grads = 0.
self.model.cleargrads()
# Need to forward once to get target_var
outputs = self.eval_fun(*inputs) # NOQA
target_var = self.get_target_var(inputs)
# output_var = self.get_output_var(outputs)
base = self.baseline
diff = target_var.array - base
for alpha in numpy.linspace(0., 1., self.steps):
if self.target_extractor is None:
interpolated_inputs = base + alpha * diff
inputs[0].array = interpolated_inputs
total_grads += super(
IntegratedGradientsCalculator, self)._compute_core(
*inputs)[0]
else:
def interpolate_target_var(hook, args, _target_var):
interpolated_inputs = base + alpha * diff
_target_var.array[:] = interpolated_inputs
self.target_extractor.add_process(
'/saliency/interpolate_target_var', interpolate_target_var)
total_grads += super(
IntegratedGradientsCalculator, self)._compute_core(
*inputs)[0]
self.target_extractor.delete_process(
'/saliency/interpolate_target_var')
saliency = total_grads * diff / self.steps
return saliency,
================================================
FILE: chainer_chemistry/saliency/calculator/occlusion_calculator.py
================================================
import itertools
import six
import chainer
from chainer import cuda
from chainer_chemistry.saliency.calculator.base_calculator import BaseCalculator # NOQA
def _to_tuple(x):
if isinstance(x, int):
x = (x,)
elif isinstance(x, (list, tuple)):
x = tuple(x)
else:
raise TypeError('Unexpected type {}'.format(type(x)))
return x
class OcclusionCalculator(BaseCalculator):
"""Occlusion saliency calculator
Use `compute`, `aggregate` method to calculate saliency.
See: Matthew D Zeiler and Rob Fergus (2014).
Visualizing and understanding convolutional networks.
In European conference on computer vision, pp. 818-833. Springer.
Args:
model (chainer.Chain): target model to calculate saliency.
target_extractor (VariableMonitorLinkHook or None):
It determines `target_var`, target variable to calculate saliency.
If `None`, first argument of input to the model is treated as
`target_var`.
output_extractor (VariableMonitorLinkHook or None):
It determines `output_var`, output variable to calculate saliency.
If `None`, output of the model is treated as `output_var`.
eval_fun (callable): If
enable_backprop (bool): chainer.config.enable_backprop option.
size (int or tuple): occlusion window size.
If `int`, window has same size along `slide_axis`.
If `tuple`, its length must be same with `slide_axis`.
slide_axis (int or tuple): slide axis which occlusion window moves.
device (int or None): device id to calculate saliency.
If `None`, device id is inferred automatically from `model`.
"""
def __init__(self, model, target_extractor=None, output_extractor=None,
eval_fun=None, device=None,
enable_backprop=False, size=1, slide_axis=(2, 3)):
super(OcclusionCalculator, self).__init__(
model, target_extractor=target_extractor,
output_extractor=output_extractor, device=device)
self.eval_fun = eval_fun or model.__call__
self.enable_backprop = enable_backprop
self.slide_axis = _to_tuple(slide_axis)
size = _to_tuple(size)
if len(self.slide_axis) != size:
size = size * len(self.slide_axis)
self.size = size
def _compute_core(self, *inputs):
# Usually, backward() is not necessary for calculating occlusion
with chainer.using_config('enable_backprop', self.enable_backprop):
original_result = self.eval_fun(*inputs)
target_var = self.get_target_var(inputs)
original_target_array = target_var.array.copy()
original_score = self.get_output_var(original_result)
xp = cuda.get_array_module(target_var.array)
value = 0.
# fill with `value`
target_dim = target_var.ndim
batch_size = target_var.shape[0]
occlusion_window_shape = [1] * target_dim
occlusion_window_shape[0] = batch_size
for axis, size in zip(self.slide_axis, self.size):
occlusion_window_shape[axis] = size
occlusion_scores_shape = [1] * target_dim
occlusion_scores_shape[0] = batch_size
for axis, size in zip(self.slide_axis, self.size):
occlusion_scores_shape[axis] = target_var.shape[axis]
occlusion_window = xp.ones(occlusion_window_shape,
dtype=target_var.dtype) * value
occlusion_scores = xp.zeros(occlusion_scores_shape, dtype=xp.float32)
def _extract_index(slide_axis, size, start_indices):
colon = slice(None)
index = [colon] * target_dim
for axis, size, start in zip(slide_axis, size, start_indices):
index[axis] = slice(start, start + size, 1)
return tuple(index)
end_list = [target_var.data.shape[axis] - size + 1 for axis, size
in zip(self.slide_axis, self.size)]
for start in itertools.product(*[six.moves.range(end)
for end in end_list]):
occlude_index = _extract_index(self.slide_axis, self.size, start)
if self.target_extractor is None:
inputs[0].array = original_target_array.copy()
inputs[0].array[occlude_index] = occlusion_window
with chainer.using_config('enable_backprop',
self.enable_backprop):
occluded_result = self.eval_fun(*inputs)
else:
def mask_target_var(hook, args, _target_var):
_target_var.array = original_target_array.copy()
_target_var.array[occlude_index] = occlusion_window
self.target_extractor.add_process(
'/saliency/mask_target_var', mask_target_var)
with chainer.using_config('enable_backprop',
self.enable_backprop):
occluded_result = self.eval_fun(*inputs)
self.target_extractor.delete_process(
'/saliency/mask_target_var')
occluded_score = self.get_output_var(occluded_result)
score_diff_var = original_score - occluded_score # (bs, 1)
# expand_dim for ch_axis
score_diff = xp.reshape(score_diff_var.array,
occlusion_window_shape)
occlusion_scores[occlude_index] += score_diff
outputs = (occlusion_scores,)
return outputs
================================================
FILE: chainer_chemistry/saliency/visualizer/__init__.py
================================================
from chainer_chemistry.saliency.visualizer import base_visualizer # NOQA
from chainer_chemistry.saliency.visualizer import image_visualizer # NOQA
from chainer_chemistry.saliency.visualizer import mol_visualizer # NOQA
from chainer_chemistry.saliency.visualizer import table_visualizer # NOQA
from chainer_chemistry.saliency.visualizer import visualizer_utils # NOQA
from chainer_chemistry.saliency.visualizer.base_visualizer import BaseVisualizer # NOQA
from chainer_chemistry.saliency.visualizer.image_visualizer import ImageVisualizer # NOQA
from chainer_chemistry.saliency.visualizer.mol_visualizer import MolVisualizer # NOQA
from chainer_chemistry.saliency.visualizer.mol_visualizer import SmilesVisualizer # NOQA
from chainer_chemistry.saliency.visualizer.table_visualizer import TableVisualizer # NOQA
from chainer_chemistry.saliency.visualizer.visualizer_utils import abs_max_scaler # NOQA
from chainer_chemistry.saliency.visualizer.visualizer_utils import min_max_scaler # NOQA
from chainer_chemistry.saliency.visualizer.visualizer_utils import normalize_scaler # NOQA
from chainer_chemistry.saliency.visualizer.visualizer_utils import red_blue_cmap # NOQA
================================================
FILE: chainer_chemistry/saliency/visualizer/base_visualizer.py
================================================
class BaseVisualizer(object):
"""Base saliency visualizer"""
def visualize(self, *args, **kwargs):
"""Main visualization routine
Each concrete subclass should implement this method
"""
raise NotImplementedError
================================================
FILE: chainer_chemistry/saliency/visualizer/image_visualizer.py
================================================
from logging import getLogger
import matplotlib.cm as cm
import matplotlib.pyplot as plt
import numpy
from chainer import cuda
from chainer_chemistry.saliency.visualizer.base_visualizer import BaseVisualizer # NOQA
from chainer_chemistry.saliency.visualizer.visualizer_utils import abs_max_scaler # NOQA
class ImageVisualizer(BaseVisualizer):
"""Saliency visualizer for image data
Args:
logger:
"""
def __init__(self, logger=None):
self.logger = logger or getLogger(__name__)
def visualize(self, saliency, image=None, save_filepath=None,
scaler=abs_max_scaler, title='Image saliency map',
cmap=cm.jet, alpha=0.5, show_colorbar=False,
bbox_inches='tight'):
"""Visualize or save `saliency` of image.
Args:
saliency (numpy.ndarray): Saliency array. Must be either
2-dim (h, w) or 3-dim (ch, h, w).
image (numpy.ndarray or PIL.Image or None): If set, image is drawn
in background, and saliency is shown in foreground.
If numpy array, must be in the order of 2-dim (h, w) or
3-dim (ch, h, w).
save_filepath (str or None): If specified, file is saved to path.
scaler (callable): function which takes `x` as input and outputs
scaled `x`, for plotting.
title (str or None): title of plot
cmap: color map used to plot saliency
alpha (float): alpha value of fore ground saliency. This option is
used only when `image` is set.
show_colorbar (bool): show colorbar in plot or not.
bbox_inches (str or Bbox or None): used for `plt.savefig` option.
"""
# --- type check ---
if saliency.ndim == 3:
# (ch, h, w) -> (h, w, ch)
saliency = cuda.to_cpu(saliency)
saliency_image = numpy.transpose(saliency, (1, 2, 0))
elif saliency.ndim == 2:
# (h, w)
saliency_image = saliency
else:
raise ValueError("[ERROR] Unexpected value saliency.shape={}"
.format(saliency.shape))
if image is not None:
# If `image` is PIL Image, convert to numpy array
image = numpy.asarray(image)
if image.ndim == 3:
# Convert to (h, w, ch) order
if image.shape[0] == 3 or image.shape[0] == 4:
# Assume (ch, h, w) order -> (h, w, ch)
image = numpy.transpose(image, (1, 2, 0))
elif image.ndim == 2:
# (h, w) order
pass
else:
raise ValueError("[ERROR] Unexpected value image.shape={}"
.format(image.shape))
if image.shape[:2] != saliency_image.shape[:2]:
self.logger.warning(
'saliency and image height or width is different\n'
'saliency_image.shape {}, image.shape [}'
.format(saliency_image.shape, image.shape))
# Normalize to [-1, 1] or [0, 1]
if scaler is not None:
saliency_image = scaler(saliency_image)
fig = plt.figure()
plt.clf()
if title is not None:
plt.title(title)
if image is None:
# Only show saliency image, not set alpha
im = plt.imshow(saliency_image, cmap=cmap)
else:
# Show original image, and overlay saliency image with alpha
plt.imshow(image)
im = plt.imshow(saliency_image, alpha=alpha, cmap=cmap)
if show_colorbar:
fig.colorbar(im)
if save_filepath:
plt.savefig(save_filepath, bbox_inches=bbox_inches)
else:
plt.show()
================================================
FILE: chainer_chemistry/saliency/visualizer/mol_visualizer.py
================================================
from logging import getLogger
import numpy
from rdkit import Chem
from rdkit.Chem.Draw import rdMolDraw2D
from rdkit.Chem import rdDepictor
from chainer_chemistry.saliency.visualizer.base_visualizer import BaseVisualizer # NOQA
from chainer_chemistry.saliency.visualizer.visualizer_utils import red_blue_cmap, abs_max_scaler # NOQA
def _convert_to_2d(axes, nrows, ncols):
if nrows == 1 and ncols == 1:
axes = numpy.array([[axes]])
elif nrows == 1:
axes = axes[None, :]
elif ncols == 1:
axes = axes[:, None]
else:
pass
assert axes.ndim == 2
return axes
def is_visible(begin, end):
if begin <= 0 or end <= 0:
return 0
elif begin >= 1 or end >= 1:
return 1
else:
return (begin + end) * 0.5
class MolVisualizer(BaseVisualizer):
"""Saliency visualizer for mol data
Args:
logger:
"""
def __init__(self, logger=None):
self.logger = logger or getLogger(__name__)
def visualize(self, saliency, mol, save_filepath=None,
visualize_ratio=1.0, color_fn=red_blue_cmap,
scaler=abs_max_scaler, legend='', raise_import_error=False
):
"""Visualize or save `saliency` with molecule
returned value can be used for visualization.
.. admonition:: Example
>>> svg = visualizer.visualize(saliency, mol)
>>>
>>> # For a Jupyter user, it will show figure on notebook.
>>> from IPython.core.display import SVG
>>> SVG(svg.replace('svg:', ''))
>>>
>>> # For a user who want to save a file as png
>>> import cairosvg
>>> cairosvg.svg2png(bytestring=svg, write_to="foo.png")
Args:
saliency (numpy.ndarray): 1-dim saliency array (num_node,)
mol (Chem.Mol): mol instance of this saliency
save_filepath (str or None): If specified, file is saved to path.
visualize_ratio (float): If set, only plot saliency color of top-X
atoms.
color_fn (callable): color function to show saliency
scaler (callable): function which takes `x` as input and outputs
scaled `x`, for plotting.
legend (str): legend for the plot
raise_import_error (bool): raise error when `ImportError` is raised
Returns:
svg (str): drawed svg text.
"""
rdDepictor.Compute2DCoords(mol)
Chem.SanitizeMol(mol)
Chem.Kekulize(mol)
num_atoms = mol.GetNumAtoms()
# --- type check ---
if saliency.ndim != 1:
raise ValueError("Unexpected value saliency.shape={}"
.format(saliency.shape))
# Cut saliency array for unnecessary tail part
saliency = saliency[:num_atoms]
if scaler is not None:
# Normalize to [-1, 1] or [0, 1]
saliency = scaler(saliency)
abs_saliency = numpy.abs(saliency)
if visualize_ratio < 1.0:
threshold_index = int(num_atoms * visualize_ratio)
idx = numpy.argsort(abs_saliency)
idx = numpy.flip(idx, axis=0)
# set threshold to top `visualize_ratio` saliency
threshold = abs_saliency[idx[threshold_index]]
saliency = numpy.where(abs_saliency < threshold, 0., saliency)
else:
threshold = numpy.min(saliency)
highlight_atoms = list(map(lambda g: g.__int__(), numpy.where(
abs_saliency >= threshold)[0]))
atom_colors = {i: color_fn(e) for i, e in enumerate(saliency)}
bondlist = [bond.GetIdx() for bond in mol.GetBonds()]
def color_bond(bond):
begin = saliency[bond.GetBeginAtomIdx()]
end = saliency[bond.GetEndAtomIdx()]
return color_fn(is_visible(begin, end))
bondcolorlist = {i: color_bond(bond)
for i, bond in enumerate(mol.GetBonds())}
drawer = rdMolDraw2D.MolDraw2DSVG(500, 375)
drawer.DrawMolecule(
mol, highlightAtoms=highlight_atoms,
highlightAtomColors=atom_colors, highlightBonds=bondlist,
highlightBondColors=bondcolorlist, legend=legend)
drawer.FinishDrawing()
svg = drawer.GetDrawingText()
if save_filepath:
extention = save_filepath.split('.')[-1]
if extention == 'svg':
with open(save_filepath, 'w') as f:
f.write(svg)
elif extention == 'png':
# TODO(nakago): check it is possible without cairosvg or not
try:
import cairosvg
cairosvg.svg2png(bytestring=svg, write_to=save_filepath)
except ImportError as e:
self.logger.error(
'cairosvg is not installed! '
'Please install cairosvg to save by png format.\n'
'pip install cairosvg')
if raise_import_error:
raise e
else:
raise ValueError(
'Unsupported extention {} for save_filepath {}'
.format(extention, save_filepath))
return svg
class SmilesVisualizer(MolVisualizer):
def visualize(self, saliency, smiles, save_filepath=None,
visualize_ratio=1.0, color_fn=red_blue_cmap,
scaler=abs_max_scaler, legend='', add_Hs=False,
use_canonical_smiles=True, raise_import_error=False):
"""Visualize or save `saliency` with molecule
See parent `MolVisualizer` class for further usage.
Args:
saliency (numpy.ndarray): 1-dim saliency array (num_node,)
smiles (str): smiles of the molecule.
save_filepath (str or None): If specified, file is saved to path.
visualize_ratio (float): If set, only plot saliency color of top-X
atoms.
color_fn (callable): color function to show saliency
scaler (callable): function which takes `x` as input and outputs
scaled `x`, for plotting.
legend (str): legend for the plot
add_Hs (bool): Add explicit H or not
use_canonical_smiles (bool): If `True`, smiles are converted to
canonical smiles before constructing `mol`
raise_import_error (bool): raise error when `ImportError` is raised
Returns:
svg (str): drawed svg text.
"""
mol = Chem.MolFromSmiles(smiles)
if use_canonical_smiles:
smiles = Chem.MolToSmiles(mol, canonical=True)
mol = Chem.MolFromSmiles(smiles)
if add_Hs:
mol = Chem.AddHs(mol)
return super(SmilesVisualizer, self).visualize(
saliency, mol, save_filepath=save_filepath,
visualize_ratio=visualize_ratio, color_fn=color_fn, scaler=scaler,
legend=legend, raise_import_error=raise_import_error)
================================================
FILE: chainer_chemistry/saliency/visualizer/table_visualizer.py
================================================
import matplotlib.pyplot as plt
import numpy
from chainer_chemistry.saliency.visualizer.base_visualizer import BaseVisualizer # NOQA
from chainer_chemistry.saliency.visualizer.visualizer_utils import abs_max_scaler # NOQA
class TableVisualizer(BaseVisualizer):
"""Saliency visualizer for table data"""
def visualize(self, saliency, feature_names=None, save_filepath=None,
num_visualize=-1, scaler=abs_max_scaler,
sort='descending', title='Feature Importance', color='b',
xlabel='Importance', bbox_inches='tight'):
"""Visualize or save `saliency` in bar plot.
Args:
saliency (numpy.ndarray): 1-dim saliency array (num_feature,)
feature_names (list or numpy.ndarray): Feature names of `saliency`
save_filepath (str or None): If specified, file is saved to path.
num_visualize (int): If positive value is set, only plot specified
number of features.
scaler (callable): function which takes `x` as input and outputs
scaled `x`, for plotting.
sort (str): Below sort options are supported.
none: not sort
ascending: plot in ascending order
descending: plot in descending order
title (str or None): title of plot
color (str): color of bar in plot
xlabel (str): x label legend
bbox_inches (str or Bbox or None): used for `plt.savefig` option.
"""
# --- type check ---
if saliency.ndim != 1:
raise ValueError("[ERROR] Unexpected value saliency.shape={}"
.format(saliency.shape))
num_total_feat = saliency.shape[0]
if feature_names is not None:
# type check
if len(feature_names) != num_total_feat:
raise ValueError(
"feature_names={} must have same length with `saliency`"
.format(feature_names))
else:
feature_names = numpy.arange(num_total_feat)
if sort == 'none':
indices = numpy.arange(num_total_feat)
elif sort == 'ascending':
indices = numpy.argsort(saliency)[::-1]
elif sort == 'descending':
indices = numpy.argsort(saliency)
else:
raise ValueError("[ERROR] Unexpected value sort={}".format(sort))
saliency = saliency[indices]
feature_names = numpy.asarray(feature_names)[indices]
if scaler is not None:
# Normalize to [-1, 1] or [0, 1]
saliency = scaler(saliency)
if num_visualize > 0:
saliency = saliency[:num_visualize]
if feature_names is not None:
feature_names = feature_names[:num_visualize]
else:
num_visualize = num_total_feat
plt.figure()
plt.clf()
if title is not None:
plt.title(title)
plt.barh(range(num_visualize), saliency, color=color, align='center')
plt.yticks(range(num_visualize), feature_names)
plt.xlabel(xlabel)
if save_filepath:
plt.savefig(save_filepath, bbox_inches=bbox_inches)
else:
plt.show()
================================================
FILE: chainer_chemistry/saliency/visualizer/visualizer_utils.py
================================================
from logging import getLogger
import numpy # NOQA
from chainer import cuda
def red_blue_cmap(x):
"""Red to Blue color map
Args:
x (float): value between -1 ~ 1, represents normalized saliency score
Returns (tuple): tuple of 3 float values representing R, G, B.
"""
if x > 0:
# Red for positive value
# x=0 -> 1, 1, 1 (white)
# x=1 -> 1, 0, 0 (red)
return 1., 1. - x, 1. - x
else:
# Blue for negative value
x *= -1
return 1. - x, 1. - x, 1.
def min_max_scaler(saliency, logger=None):
"""Normalize saliency to value 0~1
Args:
saliency (numpy.ndarray or cupy.ndarray): saliency array
logger:
Returns (numpy.ndarray or cupy.ndarray): normalized saliency array
"""
xp = cuda.get_array_module(saliency)
maxv = xp.max(saliency)
minv = xp.min(saliency)
if maxv == minv:
logger = logger or getLogger(__name__)
logger.info('All saliency value is 0')
saliency = xp.zeros_like(saliency)
else:
saliency = (saliency - minv) / (maxv - minv)
return saliency
def abs_max_scaler(saliency, logger=None):
"""Normalize saliency to value -1~1
Args:
saliency (numpy.ndarray or cupy.ndarray): saliency array
logger:
Returns (numpy.ndarray or cupy.ndarray): normalized saliency array
"""
xp = cuda.get_array_module(saliency)
maxv = xp.max(xp.abs(saliency))
if maxv <= 0:
logger = logger or getLogger(__name__)
logger.info('All saliency value is 0')
return xp.zeros_like(saliency)
else:
return saliency / maxv
def normalize_scaler(saliency, axis=None, logger=None):
"""Normalize saliency to be sum=1
Args:
saliency (numpy.ndarray or cupy.ndarray): saliency array.
axis (int): axis to take sum for normalization.
logger:
Returns (numpy.ndarray or cupy.ndarray): normalized saliency array
"""
xp = cuda.get_array_module(saliency)
if xp.sum(saliency < 0) > 0:
logger = logger or getLogger(__name__)
logger.warning('saliency array contains negative number, '
'which is unexpected!')
vsum = xp.sum(xp.abs(saliency), axis=axis, keepdims=True)
if vsum <= 0:
logger = logger or getLogger(__name__)
logger.info('All saliency value is 0')
return xp.zeros_like(saliency)
else:
return saliency / vsum
================================================
FILE: chainer_chemistry/training/__init__.py
================================================
from chainer_chemistry.training import extensions # NOQA
================================================
FILE: chainer_chemistry/training/extensions/__init__.py
================================================
from chainer_chemistry.training.extensions import batch_evaluator # NOQA
from chainer_chemistry.training.extensions import r2_score_evaluator # NOQA
from chainer_chemistry.training.extensions import roc_auc_evaluator # NOQA
# import class and function
from chainer_chemistry.training.extensions.batch_evaluator import BatchEvaluator # NOQA
from chainer_chemistry.training.extensions.r2_score_evaluator import R2ScoreEvaluator # NOQA
from chainer_chemistry.training.extensions.roc_auc_evaluator import ROCAUCEvaluator # NOQA
================================================
FILE: chainer_chemistry/training/extensions/auto_print_report.py
================================================
from copy import deepcopy
import os
import sys
from chainer.training import extension
from chainer.training.extensions import log_report as log_report_module
from chainer.training.extensions import util
def create_header_and_templates(entries):
# format information
entry_widths = [max(10, len(s)) for s in entries]
header = ' '.join(('{:%d}' % w for w in entry_widths)).format(
*entries) + '\n'
templates = []
for entry, w in zip(entries, entry_widths):
templates.append((entry, '{:<%dg} ' % w, ' ' * (w + 2)))
return header, templates
def filter_and_sort_entries(all_entries, unit='epoch'):
entries = deepcopy(all_entries)
# TODO(nakago): sort other entries if necessary
if 'iteration' in entries:
# move iteration to head
entries.pop(entries.index('iteration'))
if unit == 'iteration':
entries = ['iteration'] + entries
if 'epoch' in entries:
# move epoch to head
entries.pop(entries.index('epoch'))
if unit == 'epoch':
entries = ['epoch'] + entries
if 'elapsed_time' in entries:
# move elapsed_time to tail
entries.pop(entries.index('elapsed_time'))
entries.append('elapsed_time')
return entries
class AutoPrintReport(extension.Extension):
"""`PrintReport` with auto `entries` detection.
This extension uses the log accumulated by a :class:`LogReport` extension
to print specified entries of the log in a human-readable format.
Args:
log_report (str or LogReport): Log report to accumulate the
observations. This is either the name of a LogReport extensions
registered to the trainer, or a LogReport instance to use
internally.
out: Stream to print the bar. Standard output is used by default.
"""
def __init__(self, log_report='LogReport', out=sys.stdout):
self._entries = []
self._log_report = log_report
self._out = out
self._log_len = 0 # number of observations already printed
header, templates = create_header_and_templates([])
self._header = header # printed at the first call
self._templates = templates
self._all_entries = []
def get_log_report(self, trainer):
log_report = self._log_report
if isinstance(log_report, str):
log_report = trainer.get_extension(log_report)
elif isinstance(log_report, log_report_module.LogReport):
log_report(trainer) # update the log report
else:
raise TypeError('log report has a wrong type %s' %
type(log_report))
return log_report
def __call__(self, trainer):
# --- update entries ---
log_report = self.get_log_report(trainer)
log = log_report.log
updated_flag = False
aggregate_entries = log[self._log_len:]
for obs in aggregate_entries:
for entry in obs.keys():
if entry not in self._all_entries:
self._all_entries.append(entry)
updated_flag = True
if updated_flag:
if hasattr(log_report, '_trigger') and hasattr(log_report._trigger,
'unit'):
unit = log_report._trigger.unit
else:
# Failed to infer `unit`, use epoch as default
unit = 'epoch'
entries = filter_and_sort_entries(self._all_entries, unit=unit)
self._entries = entries
header, templates = create_header_and_templates(entries)
self._header = header # printed at the first call
self._templates = templates
out = self._out
if self._header:
out.write(self._header)
self._header = None
log_len = self._log_len
while len(log) > log_len:
# delete the printed contents from the current cursor
if os.name == 'nt':
util.erase_console(0, 0)
else:
out.write('\033[J')
self._print(log[log_len])
log_len += 1
self._log_len = log_len
def serialize(self, serializer):
log_report = self._log_report
if isinstance(log_report, log_report_module.LogReport):
log_report.serialize(serializer['_log_report'])
def _print(self, observation):
out = self._out
for entry, template, empty in self._templates:
if entry in observation:
out.write(template.format(observation[entry]))
else:
out.write(empty)
out.write('\n')
if hasattr(out, 'flush'):
out.flush()
================================================
FILE: chainer_chemistry/training/extensions/batch_evaluator.py
================================================
import copy
from logging import getLogger
import numpy
import chainer
from chainer import cuda
from chainer.dataset import convert
from chainer import reporter
from chainer.training.extensions import Evaluator
def _get_1d_numpy_array(v):
"""Convert array or Variable to 1d numpy array
Args:
v (numpy.ndarray or cupy.ndarray or chainer.Variable): array to be
converted to 1d numpy array
Returns (numpy.ndarray): Raveled 1d numpy array
"""
if isinstance(v, chainer.Variable):
v = v.data
return cuda.to_cpu(v).ravel()
class BatchEvaluator(Evaluator):
def __init__(self, iterator, target, converter=convert.concat_examples,
device=None, eval_hook=None, eval_func=None, metrics_fun=None,
name=None, logger=None):
super(BatchEvaluator, self).__init__(
iterator, target, converter=converter, device=device,
eval_hook=eval_hook, eval_func=eval_func)
self.name = name
self.logger = logger or getLogger()
if callable(metrics_fun):
# TODO(mottodora): use better name or infer
self.metrics_fun = {"evaluation": metrics_fun}
elif isinstance(metrics_fun, dict):
self.metrics_fun = metrics_fun
else:
raise TypeError('Unexpected type metrics_fun must be Callable or '
'dict.')
def evaluate(self):
iterator = self._iterators['main']
eval_func = self.eval_func or self._targets['main']
if self.eval_hook:
self.eval_hook(self)
if hasattr(iterator, 'reset'):
iterator.reset()
it = iterator
else:
it = copy.copy(iterator)
y_total = []
t_total = []
for batch in it:
in_arrays = self.converter(batch, self.device)
with chainer.no_backprop_mode(), chainer.using_config('train',
False):
y = eval_func(*in_arrays[:-1])
t = in_arrays[-1]
y_data = _get_1d_numpy_array(y)
t_data = _get_1d_numpy_array(t)
y_total.append(y_data)
t_total.append(t_data)
y_total = numpy.concatenate(y_total).ravel()
t_total = numpy.concatenate(t_total).ravel()
# metrics_value = self.metrics_fun(y_total, t_total)
metrics = {key: metric_fun(y_total, t_total) for key, metric_fun in
self.metrics_fun.items()}
observation = {}
with reporter.report_scope(observation):
reporter.report(metrics, self._targets['main'])
return observation
================================================
FILE: chainer_chemistry/training/extensions/prc_auc_evaluator.py
================================================
import numpy
from chainer.dataset import convert
from sklearn import metrics
from chainer_chemistry.training.extensions.batch_evaluator import BatchEvaluator # NOQA
def _to_list(a):
"""convert value `a` to list
Args:
a: value to be convert to `list`
Returns (list):
"""
if isinstance(a, (int, float)):
return [a, ]
else:
# expected to be list or some iterable class
return a
class PRCAUCEvaluator(BatchEvaluator):
"""Evaluator which calculates PRC AUC score
Note that this Evaluator is only applicable to binary classification task.
Args:
iterator: Dataset iterator for the dataset to calculate PRC AUC score.
It can also be a dictionary of iterators. If this is just an
iterator, the iterator is registered by the name ``'main'``.
target: Link object or a dictionary of links to evaluate. If this is
just a link object, the link is registered by the name ``'main'``.
converter: Converter function to build input arrays and true label.
:func:`~chainer.dataset.concat_examples` is used by default.
It is expected to return input arrays of the form
`[x_0, ..., x_n, t]`, where `x_0, ..., x_n` are the inputs to
the evaluation function and `t` is the true label.
device: Device to which the training data is sent. Negative value
indicates the host memory (CPU).
eval_hook: Function to prepare for each evaluation process. It is
called at the beginning of the evaluation. The evaluator extension
object is passed at each call.
eval_func: Evaluation function called at each iteration. The target
link to evaluate as a callable is used by default.
name (str): name of this extension. When `name` is None,
`default_name='validation'` which is defined in super class
`Evaluator` is used as extension name. This name affects to the
reported key name.
pos_labels (int or list): labels of the positive class, other classes
are considered as negative.
ignore_labels (int or list or None): labels to be ignored.
`None` is used to not ignore all labels.
raise_value_error (bool): If `False`, `ValueError` caused by
`roc_auc_score` calculation is suppressed and ignored with a
warning message.
logger:
Attributes:
converter: Converter function.
device: Device to which the training data is sent.
eval_hook: Function to prepare for each evaluation process.
eval_func: Evaluation function called at each iteration.
pos_labels (list): labels of the positive class
ignore_labels (list): labels to be ignored.
"""
def __init__(self, iterator, target, converter=convert.concat_examples,
device=None, eval_hook=None, eval_func=None, name=None,
pos_labels=1, ignore_labels=None, raise_value_error=True,
logger=None):
metrics_fun = {'prc_auc': self.prc_auc_score}
super(PRCAUCEvaluator, self).__init__(
iterator, target, converter=converter, device=device,
eval_hook=eval_hook, eval_func=eval_func, metrics_fun=metrics_fun,
name=name, logger=logger)
self.pos_labels = _to_list(pos_labels)
self.ignore_labels = _to_list(ignore_labels)
self.raise_value_error = raise_value_error
def prc_auc_score(self, y_total, t_total):
# --- ignore labels if specified ---
if self.ignore_labels:
valid_ind = numpy.in1d(t_total, self.ignore_labels, invert=True)
y_total = y_total[valid_ind]
t_total = t_total[valid_ind]
# --- set positive labels to 1, negative labels to 0 ---
pos_indices = numpy.in1d(t_total, self.pos_labels)
t_total = numpy.where(pos_indices, 1, 0)
if len(numpy.unique(t_total)) != 2:
if self.raise_value_error:
raise ValueError("Only one class present in y_true. PRC AUC "
"score is not defined in that case.")
else:
return numpy.nan
precision, recall, _ = metrics.precision_recall_curve(t_total, y_total)
prc_auc = metrics.auc(recall, precision)
return prc_auc
================================================
FILE: chainer_chemistry/training/extensions/r2_score_evaluator.py
================================================
from chainer.backends import cuda
from chainer.dataset import convert
from chainer_chemistry.training.extensions.batch_evaluator import BatchEvaluator # NOQA
class R2ScoreEvaluator(BatchEvaluator):
"""Evaluator with calculates R^2 (coefficient of determination)
regression score.
Args:
iterator: Dataset iterator for the dataset to calculate
R^2(coefficient of determination) regression score.
It can also be a dictionary of iterators. If this is just an
iterator, the iterator is registered by the name ``'main'``.
target: Link object or a dictionary of links to evaluate. If this is
just a link object, the link is registered by the name ``'main'``.
converter: Converter function to build input arrays and true label.
:func:`~chainer.dataset.concat_examples` is used by default.
It is expected to return input arrays of the form
`[x_0, ..., x_n, t]`, where `x_0, ..., x_n` are the inputs to
the evaluation function and `t` is the true label.
device: Device to which the training data is sent. Negative value
indicates the host memory (CPU).
eval_hook: Function to prepare for each evaluation process. It is
called at the beginning of the evaluation. The evaluator extension
object is passed at each call.
eval_func: Evaluation function called at each iteration. The target
link to evaluate as a callable is used by default.
name (str): name of this extension. When `name` is None,
`default_name='validation'` which is defined in super class
`Evaluator` is used as extension name. This name affects to the
reported key name.
pos_labels (int or list): labels of the positive class, other classes
are considered as negative.
ignore_labels (int or list or None): labels to be ignored.
`None` is used to not ignore all labels.
raise_value_error (bool): If `False`, `ValueError` caused by
`roc_auc_score` calculation is suppressed and ignored with a
warning message.
logger:
sample_weight: This argument is for compatibility with
scikit-learn's implementation of r2_score. Current
implementation admits None only.
multioutput (str): If 'uniform_average', this function returns an
average of R^2 score of multiple output. If 'raw_average', this
function return a set of R^2 score of multiple output.
Attributes:
converter: Converter function.
device: Device to which the training data is sent.
eval_hook: Function to prepare for each evaluation process.
eval_func: Evaluation function called at each iteration.
pos_labels (list): labels of the positive class
ignore_labels (list): labels to be ignored.
"""
def __init__(self, iterator, target, converter=convert.concat_examples,
device=None, eval_hook=None, eval_func=None, name=None,
pos_label=1, ignore_labels=None, raise_value_error=True,
logger=None, sample_weight=None,
multioutput='uniform_average', ignore_nan=False):
metrics_fun = {'r2_score': self.r2_score}
super(R2ScoreEvaluator, self).__init__(
iterator, target, converter=converter, device=device,
eval_hook=eval_hook, eval_func=eval_func, metrics_fun=metrics_fun,
name=name, logger=logger)
self.pos_label = pos_label
self.ignore_labels = ignore_labels
self.raise_value_error = raise_value_error
self.sample_weight = sample_weight
self.multioutput = multioutput
self.ignore_nan = ignore_nan
def r2_score(self, pred, true, sample_weight=None,
multioutput='uniform_average', ignore_nan=False):
if self.sample_weight is not None:
raise NotImplementedError()
if self.multioutput not in ['uniform_average', 'raw_values']:
raise ValueError('invalid multioutput argument')
xp = cuda.get_array_module(pred)
diff = pred - true
dev = true - xp.mean(true, axis=0)
if self.ignore_nan:
diff[xp.isnan(diff)] = 0.
dev[xp.isnan(dev)] = 0.
SS_res = xp.asarray(xp.sum(diff ** 2, axis=0))
SS_tot = xp.asarray(xp.sum(dev ** 2, axis=0))
SS_tot_iszero = SS_tot == 0
SS_tot[SS_tot_iszero] = 1 # Assign dummy value to avoid zero-division
ret = xp.where(
SS_tot_iszero, 0.0, 1 - SS_res / SS_tot).astype(pred.dtype)
if self.multioutput == 'uniform_average':
return xp.asarray(ret.mean())
elif self.multioutput == 'raw_values':
return ret
================================================
FILE: chainer_chemistry/training/extensions/roc_auc_evaluator.py
================================================
import numpy
from chainer.dataset import convert
from sklearn import metrics
from chainer_chemistry.training.extensions.batch_evaluator import BatchEvaluator # NOQA
def _to_list(a):
"""convert value `a` to list
Args:
a: value to be convert to `list`
Returns (list):
"""
if isinstance(a, (int, float)):
return [a, ]
else:
# expected to be list or some iterable class
return a
class ROCAUCEvaluator(BatchEvaluator):
"""Evaluator which calculates ROC AUC score
Note that this Evaluator is only applicable to binary classification task.
Args:
iterator: Dataset iterator for the dataset to calculate ROC AUC score.
It can also be a dictionary of iterators. If this is just an
iterator, the iterator is registered by the name ``'main'``.
target: Link object or a dictionary of links to evaluate. If this is
just a link object, the link is registered by the name ``'main'``.
converter: Converter function to build input arrays and true label.
:func:`~chainer.dataset.concat_examples` is used by default.
It is expected to return input arrays of the form
`[x_0, ..., x_n, t]`, where `x_0, ..., x_n` are the inputs to
the evaluation function and `t` is the true label.
device: Device to which the training data is sent. Negative value
indicates the host memory (CPU).
eval_hook: Function to prepare for each evaluation process. It is
called at the beginning of the evaluation. The evaluator extension
object is passed at each call.
eval_func: Evaluation function called at each iteration. The target
link to evaluate as a callable is used by default.
name (str): name of this extension. When `name` is None,
`default_name='validation'` which is defined in super class
`Evaluator` is used as extension name. This name affects to the
reported key name.
pos_labels (int or list): labels of the positive class, other classes
are considered as negative.
ignore_labels (int or list or None): labels to be ignored.
`None` is used to not ignore all labels.
raise_value_error (bool): If `False`, `ValueError` caused by
`roc_auc_score` calculation is suppressed and ignored with a
warning message.
logger:
Attributes:
converter: Converter function.
device: Device to which the training data is sent.
eval_hook: Function to prepare for each evaluation process.
eval_func: Evaluation function called at each iteration.
pos_labels (list): labels of the positive class
ignore_labels (list): labels to be ignored.
"""
def __init__(self, iterator, target, converter=convert.concat_examples,
device=None, eval_hook=None, eval_func=None, name=None,
pos_labels=1, ignore_labels=None, raise_value_error=True,
logger=None):
metrics_fun = {'roc_auc': self.roc_auc_score}
super(ROCAUCEvaluator, self).__init__(
iterator, target, converter=converter, device=device,
eval_hook=eval_hook, eval_func=eval_func, metrics_fun=metrics_fun,
name=name, logger=logger)
self.pos_labels = _to_list(pos_labels)
self.ignore_labels = _to_list(ignore_labels)
self.raise_value_error = raise_value_error
def roc_auc_score(self, y_total, t_total):
# --- ignore labels if specified ---
if self.ignore_labels:
valid_ind = numpy.in1d(t_total, self.ignore_labels, invert=True)
y_total = y_total[valid_ind]
t_total = t_total[valid_ind]
# --- set positive labels to 1, negative labels to 0 ---
pos_indices = numpy.in1d(t_total, self.pos_labels)
t_total = numpy.where(pos_indices, 1, 0)
try:
roc_auc = metrics.roc_auc_score(t_total, y_total)
except ValueError as e:
# When only one class present in `y_true`, `ValueError` is raised.
# ROC AUC score is not defined in that case.
if self.raise_value_error:
raise e
else:
self.logger.warning(
'ValueError detected during roc_auc_score calculation. {}'
.format(e.args))
roc_auc = numpy.nan
return roc_auc
================================================
FILE: chainer_chemistry/utils/__init__.py
================================================
from chainer_chemistry.utils.json_utils import load_json # NOQA
from chainer_chemistry.utils.json_utils import save_json # NOQA
from chainer_chemistry.utils.sparse_utils import convert_sparse_with_edge_type # NOQA
from chainer_chemistry.utils.sparse_utils import is_sparse # NOQA
from chainer_chemistry.utils.train_utils import run_train # NOQA
================================================
FILE: chainer_chemistry/utils/extend.py
================================================
from collections import Iterable
from logging import getLogger
import six
from chainer import cuda
def _to_list(a):
if isinstance(a, Iterable):
a = list(a)
else:
a = [a]
return a
def extend_node(node, out_size, axis=-1, value=0):
"""Extend size of `node` array
For now, this function works same with `extend_array` method,
this is just an alias function.
Args:
node (numpy.ndarray): the array whose `axis` to be extended.
first axis is considered as "batch" axis.
out_size (int): target output size for specified `axis`.
axis (int): node feature axis to be extended.
Default is `axis=-1`, which extends only last axis.
value (int or float): value to be filled for extended place.
Returns (numpy.ndarray): extended `node` array, extended place is filled
with `value`
"""
return extend_arrays_to_size(
node, out_size=out_size, axis=axis, value=value)
def extend_adj(adj, out_size, axis=None, value=0):
"""Extend size of `adj` array
For now, this function only differs default `axis` value from
`extend_array` method, this is an alias function.
Args:
adj (numpy.ndarray): the array whose `axis` to be extended.
first axis is considered as "batch" axis.
out_size (int): target output size for specified `axis`.
axis (list or None): node feature axis to be extended. Default is None,
in this case `axis=[-1, -2]` is used to extend last 2 axes.
value (int or float): value to be filled for extended place.
Returns (numpy.ndarray): extended `adj` array, extended place is filled
with `value`
"""
axis = axis or [-1, -2]
return extend_arrays_to_size(
adj, out_size=out_size, axis=axis, value=value)
def extend_arrays_to_size(arrays, out_size, axis=-1, value=0):
"""Extend size of `arrays` array
Args:
arrays (numpy.ndarray): the array whose `axis` to be extended.
first axis is considered as "batch" axis.
out_size (int): target output size for specified `axis`.
axis (int or list): node feature axis to be extended.
value (int or float): value to be filled for extended place.
Returns (numpy.ndarray): extended array, extended place is filled
with `value`
"""
batch_size = len(arrays)
in_shape = _to_list(arrays[0].shape)
out_shape = [batch_size] + in_shape
axis = _to_list(axis)
for ax in axis:
if ax == 0:
logger = getLogger(__name__)
logger.warning('axis 0 detected, but axis=0 is expected to be '
'batch size dimension.')
if out_shape[ax] > out_size:
raise ValueError(
'current size={} is larger than out_size={} at axis={}'
.format(out_shape[ax], out_size, ax))
out_shape[ax] = out_size
return extend_arrays_to_shape(arrays, out_shape, value=value)
def extend_arrays_to_shape(arrays, out_shape, value=0):
# Ref: `_concat_arrays_with_padding` method in chainer convert.py
# https://github.com/chainer/chainer/blob/master/chainer/dataset/convert.py
xp = cuda.get_array_module(arrays[0])
with cuda.get_device_from_array(arrays[0]):
result = xp.full(out_shape, value, dtype=arrays[0].dtype)
for i in six.moves.range(len(arrays)):
src = arrays[i]
slices = tuple(slice(dim) for dim in src.shape)
result[(i,) + slices] = src
return result
================================================
FILE: chainer_chemistry/utils/json_utils.py
================================================
import json
from logging import getLogger
import numpy
try:
from pathlib import PurePath
_is_pathlib_available = True
except ImportError:
_is_pathlib_available = False
from chainer import cuda
class JSONEncoderEX(json.JSONEncoder):
"""Encoder class used for `json.dump`"""
def default(self, obj):
if isinstance(obj, numpy.integer):
return int(obj)
elif isinstance(obj, numpy.floating):
return float(obj)
elif isinstance(obj, numpy.ndarray):
return obj.tolist()
elif isinstance(obj, cuda.ndarray):
return cuda.to_cpu(obj).tolist()
elif _is_pathlib_available and isinstance(obj, PurePath):
# save as str representation
# convert windows path separator to linux format
return str(obj).replace('\\', '/')
else:
return super(JSONEncoderEX, self).default(obj)
def save_json(filepath, params, ignore_error=False, indent=4, logger=None):
"""Save `params` to `filepath` in json format.
It also supports `numpy` & `cupy` array serialization by converting them to
`list` format.
Args:
filepath (str): filepath to save args
params (dict or list): parameters to be saved.
ignore_error (bool): If `True`, it will ignore exception with printing
error logs, which prevents to stop.
indent (int): Indent for saved file.
logger:
"""
try:
with open(filepath, 'w') as f:
json.dump(params, f, indent=indent, cls=JSONEncoderEX)
except Exception as e:
if not ignore_error:
raise e
else:
logger = logger or getLogger(__name__)
logger.warning('Error occurred at save_json, but ignoring...')
logger.warning('The file {} may not be saved or corrupted.'
.format(filepath))
logger.warning(e)
def load_json(filepath):
"""Load params, which is stored in json format.
Args:
filepath (str): filepath to json file to load.
Returns (dict or list): params
"""
with open(filepath, 'r') as f:
params = json.load(f)
return params
================================================
FILE: chainer_chemistry/utils/permutation.py
================================================
import numpy
def permute_node(node, permutation_index, axis=-1):
"""Permute index of `node` array
Args:
node (numpy.ndarray): the array whose `axis` to be permuted.
permutation_index (numpy.ndarray): 1d numpy array whose size should be
same as permutation axis of `node`.
axis (int): permutation axis.
Returns (numpy.ndarray): permutated `node` array.
"""
if node.shape[axis] != len(permutation_index):
raise ValueError(
'node.shape[{}] = {} and len(permutation_index) = {} do not match!'
.format(axis, node.shape[axis], len(permutation_index)))
out_node = numpy.take(node, permutation_index, axis=axis).copy()
return out_node
def permute_adj(adj, permutation_index, axis=None):
"""Permute index of adjacency matrix array
Args:
adj (numpy.ndarray): the array whose `axis` to be permuted.
It is considered as adjacency matrix.
permutation_index (numpy.ndarray): 1d numpy array whose size should be
same as permutation axis of `node`.
axis (list or tuple or None): list of 2d int, indicates the permutation
axis. When None is passed (default), it uses -1 and -2 as `axis`,
it means that last 2 axis are considered to be permuted.
Returns (numpy.ndarray): permutated `adj` array.
"""
if axis is not None:
if not isinstance(axis, (list, tuple)):
raise TypeError('axis must be list or tuple, got {}'
.format(type(axis)))
if len(axis) != 2:
raise ValueError('axis length must 2, got {}'.format(len(axis)))
else:
axis = [-1, -2] # default value is to use last 2 axis
num_node = len(permutation_index)
for ax in axis:
if adj.shape[ax] != len(permutation_index):
raise ValueError(
'adj.shape[{}] = {} and len(permutation_index) = {} do not '
'match!'.format(axis, adj.shape[axis], len(permutation_index)))
out_adj = numpy.zeros_like(adj)
ndim = adj.ndim
for i in range(num_node):
for j in range(num_node):
in_indices = [slice(None)] * ndim
out_indices = [slice(None)] * ndim
in_indices[axis[0]] = i
in_indices[axis[1]] = j
out_indices[axis[0]] = permutation_index[i]
out_indices[axis[1]] = permutation_index[j]
out_adj[tuple(in_indices)] = adj[tuple(out_indices)]
return out_adj
================================================
FILE: chainer_chemistry/utils/sparse_utils.py
================================================
import chainer
from chainer import cuda
import numpy as np
try:
from chainer.utils import CooMatrix
_coomatrix_imported = True
except Exception:
_coomatrix_imported = False
def _flatten(x):
if isinstance(x, chainer.Variable):
x = x.data
x = chainer.backends.cuda.to_cpu(x)
return x.flatten()
def sparse_utils_available():
from distutils.version import StrictVersion
return _coomatrix_imported and\
StrictVersion(np.__version__) >= StrictVersion('1.16')
def is_sparse(x):
if _coomatrix_imported and isinstance(x, CooMatrix):
return True
else:
return False
def convert_sparse_with_edge_type(data, row, col, num_nodes,
edge_type, num_edge_type):
"""Convert a sparse matrix with edge type to a regular COO matrix.
Args:
data (numpy.ndarray): the entries of the batched sparse matrix.
row (numpy.ndarray): the row indices of the matrix entries.
col (numpy.ndarray): the column indices of the matrix entries.
num_nodes (int): the number of nodes in the batched graph.
edge_type (numpy.ndarray): edge type information of edges.
num_edge_type (int): number of edge type.
Returns (chainer.utils.CooMatrix): new sparse COO matrix whose minibatch
size is equal to ((original minibatch size) * num_edge_type).
"""
assert len(data.shape) == 2
assert row.shape == data.shape
assert col.shape == data.shape
assert edge_type.shape == data.shape
mb, length = data.shape
xp = cuda.get_array_module(data)
data = _flatten(data)
row = _flatten(row)
col = _flatten(col)
edge_type = _flatten(edge_type)
# From now on, suppose that
# edge_type = [[1, 1, 3, 1], [0, 2, 1, 0]] as example.
# Then,
# pos_mb = [1, 1, 3, 1, 4, 6, 5, 4].
pos_mb = np.repeat(np.arange(mb), length) * num_edge_type + edge_type
# argsort = [0, 1, 3, 2, 4, 7, 6, 5]
# sorted_pos = [1, 1, 1, 3, 4, 4, 5, 6]
argsort = pos_mb.argsort()
sorted_pos = pos_mb[argsort]
# df = [0, 0, 0, 1, 1, 0, 1, 1]
df = np.diff(sorted_pos, prepend=sorted_pos[0]) != 0
# extract = [3, 4, 6, 7]
extract = np.arange(mb * length)[df]
# d_extract = [3, 1, 2, 1]
d_extract = np.diff(extract, prepend=0)
# p = [0, 0, 0, 3, 1, 0, 2, 1]
p = np.zeros(mb * length, dtype=np.int32)
p[df] = d_extract
# pos_i_perm = [0, 1, 2, 0, 0, 1, 0, 0]
pos_i_perm = np.arange(mb * length) - p.cumsum()
# pos_i = [0, 1, 0, 2, 0, 0, 0, 1]
pos_i = np.zeros_like(pos_i_perm)
pos_i[argsort] = pos_i_perm
# new_length = 3
new_length = pos_i.max() + 1
new_mb = mb * num_edge_type
new_data = xp.zeros((new_mb, new_length), dtype=data.dtype)
new_data[pos_mb, pos_i] = data
new_row = xp.zeros((new_mb, new_length), dtype=np.int32)
new_row[pos_mb, pos_i] = row
new_col = xp.zeros((new_mb, new_length), dtype=np.int32)
new_col[pos_mb, pos_i] = col
new_shape = (num_nodes, num_nodes)
return chainer.utils.CooMatrix(new_data, new_row, new_col, new_shape)
def _convert_to_sparse(dense_adj):
# naive conversion function mainly for testing
xp = cuda.get_array_module(dense_adj)
dense_adj = cuda.to_cpu(dense_adj)
batch_size, num_edge_type, atom_size = dense_adj.shape[:3]
data = []
row = []
col = []
edge_type = []
for mb in range(batch_size):
data.append([])
row.append([])
col.append([])
edge_type.append([])
for e in range(num_edge_type):
for i in range(atom_size):
for j in range(atom_size):
data[-1].append(dense_adj[mb, e, i, j])
row[-1].append(i)
col[-1].append(j)
edge_type[-1].append(e)
data = xp.array(data, dtype=dense_adj.dtype)
row = xp.array(row, dtype=xp.int32)
col = xp.array(col, dtype=xp.int32)
edge_type = xp.array(edge_type, dtype=xp.int32)
return data, row, col, edge_type
================================================
FILE: chainer_chemistry/utils/train_utils.py
================================================
import chainer
from chainer import optimizers, training, Optimizer # NOQA
from chainer._backend import Device
from chainer.dataset import convert, Iterator # NOQA
from chainer.iterators import SerialIterator
from chainer.training import extensions
from chainer_chemistry.training.extensions.auto_print_report import AutoPrintReport # NOQA
def run_train(model, train, valid=None,
batch_size=16, epoch=10,
optimizer=None,
out='result',
extensions_list=None,
device=-1,
converter=convert.concat_examples,
use_default_extensions=True,
resume_path=None):
"""Util function to train chainer's model with StandardUpdater.
Typical Regression/Classification tasks suffices to use this method to
train chainer model.
Args:
model (chainer.Chain): model to train
train (dataset or Iterator): training dataset or train iterator
valid (dataset or Iterator): validation dataset or valid iterator
batch_size (int): batch size for training
epoch (int): epoch for training
optimizer (Optimizer):
out (str): path for `trainer`'s out directory
extensions_list (None or list): list of extensions to add to `trainer`
device (Device): chainer Device
converter (callable):
use_default_extensions (bool): If `True`, default extensions are added
to `trainer`.
resume_path (None or str): If specified, `trainer` is resumed with this
serialized file.
"""
if optimizer is None:
# Use Adam optimizer as default
optimizer = optimizers.Adam()
elif not isinstance(optimizer, Optimizer):
raise ValueError("[ERROR] optimizer must be instance of Optimizer, "
"but passed {}".format(type(Optimizer)))
optimizer.setup(model)
if isinstance(train, Iterator):
train_iter = train
else:
# Assume `train` as training dataset, Use SerialIterator as default.
train_iter = SerialIterator(train, batch_size=batch_size)
updater = training.StandardUpdater(
train_iter, optimizer, device=device, converter=converter)
trainer = training.Trainer(updater, (epoch, 'epoch'), out=out)
if use_default_extensions:
if valid is not None:
if isinstance(valid, Iterator):
valid_iter = valid
else:
# Assume `valid` as validation dataset,
# Use SerialIterator as default.
valid_iter = SerialIterator(valid, batch_size=batch_size,
shuffle=False, repeat=False)
trainer.extend(extensions.Evaluator(
valid_iter, model, device=device, converter=converter))
trainer.extend(extensions.LogReport())
trainer.extend(AutoPrintReport())
trainer.extend(extensions.ProgressBar(update_interval=10))
# TODO(nakago): consider to include snapshot as default extension.
# trainer.extend(extensions.snapshot(), trigger=(frequency, 'epoch'))
if extensions_list is not None:
for e in extensions_list:
trainer.extend(e)
if resume_path:
chainer.serializers.load_npz(resume_path, trainer)
trainer.run()
return
def run_node_classification_train(model, data,
train_mask, valid_mask,
epoch=10,
optimizer=None,
out='result',
extensions_list=None,
device=-1,
converter=None,
use_default_extensions=True,
resume_path=None):
if optimizer is None:
# Use Adam optimizer as default
optimizer = optimizers.Adam()
elif not isinstance(optimizer, Optimizer):
raise ValueError("[ERROR] optimizer must be instance of Optimizer, "
"but passed {}".format(type(Optimizer)))
optimizer.setup(model)
def one_batch_converter(batch, device):
if not isinstance(device, Device):
device = chainer.get_device(device)
data, train_mask, valid_mask = batch[0]
return (data.to_device(device),
device.send(train_mask), device.send(valid_mask))
data_iter = SerialIterator([(data, train_mask, valid_mask)], batch_size=1)
updater = training.StandardUpdater(
data_iter, optimizer, device=device,
converter=one_batch_converter)
trainer = training.Trainer(updater, (epoch, 'epoch'), out=out)
if use_default_extensions:
trainer.extend(extensions.LogReport())
trainer.extend(AutoPrintReport())
trainer.extend(extensions.ProgressBar(update_interval=10))
# TODO(nakago): consider to include snapshot as default extension.
# trainer.extend(extensions.snapshot(), trigger=(frequency, 'epoch'))
if extensions_list is not None:
for e in extensions_list:
trainer.extend(e)
if resume_path:
chainer.serializers.load_npz(resume_path, trainer)
trainer.run()
return
================================================
FILE: docker/conda/python36/Dockerfile
================================================
FROM nvidia/cuda:10.1-cudnn7-devel
RUN apt-get update -y && \
apt-get install -y --no-install-recommends \
git \
wget \
bzip2 \
ca-certificates \
curl \
cmake \
libblas3 \
libblas-dev \
libxext6 \
libgl1-mesa-glx \
libxrender-dev \
&& \
rm -rf /var/lib/apt/lists/* /var/cache/apt/archives/*
ENV LANG=C.UTF-8 LC_ALL=C.UTF-8
ENV PATH /opt/conda/bin:$PATH
RUN wget --quiet https://repo.anaconda.com/miniconda/Miniconda3-4.5.11-Linux-x86_64.sh -O ~/miniconda.sh && \
/bin/bash ~/miniconda.sh -b -p /opt/conda && \
rm ~/miniconda.sh && \
/opt/conda/bin/conda clean -tipsy && \
ln -s /opt/conda/etc/profile.d/conda.sh /etc/profile.d/conda.sh && \
echo ". /opt/conda/etc/profile.d/conda.sh" >> ~/.bashrc && \
echo "conda activate base" >> ~/.bashrc
RUN conda update -n base -c defaults conda
RUN conda create -n py36 python=3.6 conda && \
. /opt/conda/etc/profile.d/conda.sh && \
conda init bash && \
conda activate py36 && \
conda install -c rdkit rdkit && \
pip install pytest mock
ADD conda-entrypoint.sh /conda-entrypoint.sh
ENTRYPOINT [ "/conda-entrypoint.sh" ]
================================================
FILE: docker/conda/python36/conda-entrypoint.sh
================================================
#!/bin/bash
. /opt/conda/etc/profile.d/conda.sh
conda activate py36
exec "$@"
================================================
FILE: docker/conda/python37/Dockerfile
================================================
FROM nvidia/cuda:10.1-cudnn7-devel
RUN apt-get update -y && \
apt-get install -y --no-install-recommends \
git \
wget \
bzip2 \
ca-certificates \
curl \
cmake \
libblas3 \
libblas-dev \
libxext6 \
libgl1-mesa-glx \
libxrender-dev \
&& \
rm -rf /var/lib/apt/lists/* /var/cache/apt/archives/*
ENV LANG=C.UTF-8 LC_ALL=C.UTF-8
ENV PATH /opt/conda/bin:$PATH
RUN wget --quiet https://repo.anaconda.com/miniconda/Miniconda3-4.5.11-Linux-x86_64.sh -O ~/miniconda.sh && \
/bin/bash ~/miniconda.sh -b -p /opt/conda && \
rm ~/miniconda.sh && \
/opt/conda/bin/conda clean -tipsy && \
ln -s /opt/conda/etc/profile.d/conda.sh /etc/profile.d/conda.sh && \
echo ". /opt/conda/etc/profile.d/conda.sh" >> ~/.bashrc && \
echo "conda activate base" >> ~/.bashrc
RUN conda update -n base -c defaults conda
RUN conda create -n py37 python=3.7 conda && \
. /opt/conda/etc/profile.d/conda.sh && \
conda init bash && \
conda activate py37 && \
conda install -c rdkit rdkit && \
pip install pytest mock
ADD conda-entrypoint.sh /conda-entrypoint.sh
ENTRYPOINT [ "/conda-entrypoint.sh" ]
================================================
FILE: docker/conda/python37/conda-entrypoint.sh
================================================
#!/bin/bash
. /opt/conda/etc/profile.d/conda.sh
conda activate py37
exec "$@"
================================================
FILE: docker/conda/python37-chainerx-cpu-base/Dockerfile
================================================
FROM nvidia/cuda:10.1-cudnn7-devel
RUN apt-get update -y && \
apt-get install -y --no-install-recommends \
git \
wget \
bzip2 \
ca-certificates \
curl \
cmake \
libblas3 \
libblas-dev \
libxext6 \
libgl1-mesa-glx \
libxrender-dev \
&& \
rm -rf /var/lib/apt/lists/* /var/cache/apt/archives/*
ENV LANG=C.UTF-8 LC_ALL=C.UTF-8
ENV PATH /opt/conda/bin:$PATH
RUN wget --quiet https://repo.anaconda.com/miniconda/Miniconda3-4.5.11-Linux-x86_64.sh -O ~/miniconda.sh && \
/bin/bash ~/miniconda.sh -b -p /opt/conda && \
rm ~/miniconda.sh && \
/opt/conda/bin/conda clean -tipsy && \
ln -s /opt/conda/etc/profile.d/conda.sh /etc/profile.d/conda.sh && \
echo ". /opt/conda/etc/profile.d/conda.sh" >> ~/.bashrc && \
echo "conda activate base" >> ~/.bashrc
RUN conda update -n base -c defaults conda
ENV MAKEFLAGS -j4
RUN conda create -n py37 python=3.7 conda && \
. /opt/conda/etc/profile.d/conda.sh && \
conda init bash && \
conda activate py37 && \
CHAINER_BUILD_CHAINERX=1 pip install -vvvv --no-cache-dir chainer==6.0.0 && \
conda install -c rdkit rdkit==2019.03.4.0
ADD conda-entrypoint.sh /conda-entrypoint.sh
ENTRYPOINT [ "/conda-entrypoint.sh" ]
================================================
FILE: docker/conda/python37-chainerx-cpu-base/conda-entrypoint.sh
================================================
#!/bin/bash
. /opt/conda/etc/profile.d/conda.sh
conda activate py37
exec "$@"
================================================
FILE: docker/conda/python37-chainerx-cpu-latest/Dockerfile
================================================
FROM nvidia/cuda:10.1-cudnn7-devel
RUN apt-get update -y && \
apt-get install -y --no-install-recommends \
git \
wget \
bzip2 \
ca-certificates \
curl \
cmake \
libblas3 \
libblas-dev \
libxext6 \
libgl1-mesa-glx \
libxrender-dev \
&& \
rm -rf /var/lib/apt/lists/* /var/cache/apt/archives/*
ENV LANG=C.UTF-8 LC_ALL=C.UTF-8
ENV PATH /opt/conda/bin:$PATH
RUN wget --quiet https://repo.anaconda.com/miniconda/Miniconda3-4.5.11-Linux-x86_64.sh -O ~/miniconda.sh && \
/bin/bash ~/miniconda.sh -b -p /opt/conda && \
rm ~/miniconda.sh && \
/opt/conda/bin/conda clean -tipsy && \
ln -s /opt/conda/etc/profile.d/conda.sh /etc/profile.d/conda.sh && \
echo ". /opt/conda/etc/profile.d/conda.sh" >> ~/.bashrc && \
echo "conda activate base" >> ~/.bashrc
RUN conda update -n base -c defaults conda
ENV MAKEFLAGS -j4
RUN conda create -n py37 python=3.7 conda && \
. /opt/conda/etc/profile.d/conda.sh && \
conda init bash && \
conda activate py37 && \
CHAINER_BUILD_CHAINERX=1 pip install -vvvv --no-cache-dir chainer==7.0.0b2 && \
conda install -c rdkit rdkit==2019.03.4.0
ADD conda-entrypoint.sh /conda-entrypoint.sh
ENTRYPOINT [ "/conda-entrypoint.sh" ]
================================================
FILE: docker/conda/python37-chainerx-cpu-latest/conda-entrypoint.sh
================================================
#!/bin/bash
. /opt/conda/etc/profile.d/conda.sh
conda activate py37
exec "$@"
================================================
FILE: docker/conda/python37-chainerx-cpu-stable/Dockerfile
================================================
FROM nvidia/cuda:10.1-cudnn7-devel
RUN apt-get update -y && \
apt-get install -y --no-install-recommends \
git \
wget \
bzip2 \
ca-certificates \
curl \
cmake \
libblas3 \
libblas-dev \
libxext6 \
libgl1-mesa-glx \
libxrender-dev \
&& \
rm -rf /var/lib/apt/lists/* /var/cache/apt/archives/*
ENV LANG=C.UTF-8 LC_ALL=C.UTF-8
ENV PATH /opt/conda/bin:$PATH
RUN wget --quiet https://repo.anaconda.com/miniconda/Miniconda3-4.5.11-Linux-x86_64.sh -O ~/miniconda.sh && \
/bin/bash ~/miniconda.sh -b -p /opt/conda && \
rm ~/miniconda.sh && \
/opt/conda/bin/conda clean -tipsy && \
ln -s /opt/conda/etc/profile.d/conda.sh /etc/profile.d/conda.sh && \
echo ". /opt/conda/etc/profile.d/conda.sh" >> ~/.bashrc && \
echo "conda activate base" >> ~/.bashrc
RUN conda update -n base -c defaults conda
ENV MAKEFLAGS -j4
RUN conda create -n py37 python=3.7 conda && \
. /opt/conda/etc/profile.d/conda.sh && \
conda init bash && \
conda activate py37 && \
CHAINER_BUILD_CHAINERX=1 pip install -vvvv --no-cache-dir chainer==6.2.0 && \
conda install -c rdkit rdkit==2019.03.4.0
ADD conda-entrypoint.sh /conda-entrypoint.sh
ENTRYPOINT [ "/conda-entrypoint.sh" ]
================================================
FILE: docker/conda/python37-chainerx-cpu-stable/conda-entrypoint.sh
================================================
#!/bin/bash
. /opt/conda/etc/profile.d/conda.sh
conda activate py37
exec "$@"
================================================
FILE: docker/conda/python37-chainerx-gpu-base/Dockerfile
================================================
FROM nvidia/cuda:10.1-cudnn7-devel
RUN apt-get update -y && \
apt-get install -y --no-install-recommends \
git \
wget \
bzip2 \
ca-certificates \
curl \
cmake \
libblas3 \
libblas-dev \
libxext6 \
libgl1-mesa-glx \
libxrender-dev \
&& \
rm -rf /var/lib/apt/lists/* /var/cache/apt/archives/*
ENV LANG=C.UTF-8 LC_ALL=C.UTF-8
ENV PATH /opt/conda/bin:$PATH
RUN wget --quiet https://repo.anaconda.com/miniconda/Miniconda3-4.5.11-Linux-x86_64.sh -O ~/miniconda.sh && \
/bin/bash ~/miniconda.sh -b -p /opt/conda && \
rm ~/miniconda.sh && \
/opt/conda/bin/conda clean -tipsy && \
ln -s /opt/conda/etc/profile.d/conda.sh /etc/profile.d/conda.sh && \
echo ". /opt/conda/etc/profile.d/conda.sh" >> ~/.bashrc && \
echo "conda activate base" >> ~/.bashrc
RUN conda update -n base -c defaults conda
ENV MAKEFLAGS -j4
RUN conda create -n py37 python=3.7 conda && \
. /opt/conda/etc/profile.d/conda.sh && \
conda init bash && \
conda activate py37 && \
CHAINER_BUILD_CHAINERX=1 CHAINERX_BUILD_CUDA=1 pip install -vvvv --no-cache-dir cupy-cuda101==6.0.0 chainer==6.0.0 && \
conda install -c rdkit rdkit==2019.03.4.0
ADD conda-entrypoint.sh /conda-entrypoint.sh
ENTRYPOINT [ "/conda-entrypoint.sh" ]
================================================
FILE: docker/conda/python37-chainerx-gpu-base/conda-entrypoint.sh
================================================
#!/bin/bash
. /opt/conda/etc/profile.d/conda.sh
conda activate py37
exec "$@"
================================================
FILE: docker/conda/python37-chainerx-gpu-latest/Dockerfile
================================================
FROM nvidia/cuda:10.1-cudnn7-devel
RUN apt-get update -y && \
apt-get install -y --no-install-recommends \
git \
wget \
bzip2 \
ca-certificates \
curl \
cmake \
libblas3 \
libblas-dev \
libxext6 \
libgl1-mesa-glx \
libxrender-dev \
&& \
rm -rf /var/lib/apt/lists/* /var/cache/apt/archives/*
ENV LANG=C.UTF-8 LC_ALL=C.UTF-8
ENV PATH /opt/conda/bin:$PATH
RUN wget --quiet https://repo.anaconda.com/miniconda/Miniconda3-4.5.11-Linux-x86_64.sh -O ~/miniconda.sh && \
/bin/bash ~/miniconda.sh -b -p /opt/conda && \
rm ~/miniconda.sh && \
/opt/conda/bin/conda clean -tipsy && \
ln -s /opt/conda/etc/profile.d/conda.sh /etc/profile.d/conda.sh && \
echo ". /opt/conda/etc/profile.d/conda.sh" >> ~/.bashrc && \
echo "conda activate base" >> ~/.bashrc
RUN conda update -n base -c defaults conda
ENV MAKEFLAGS -j4
RUN conda create -n py37 python=3.7 conda && \
. /opt/conda/etc/profile.d/conda.sh && \
conda init bash && \
conda activate py37 && \
CHAINER_BUILD_CHAINERX=1 CHAINERX_BUILD_CUDA=1 pip install -vvvv --no-cache-dir cupy-cuda101==7.0.0b2 chainer==7.0.0b2 && \
conda install -c rdkit rdkit==2019.03.4.0
ADD conda-entrypoint.sh /conda-entrypoint.sh
ENTRYPOINT [ "/conda-entrypoint.sh" ]
================================================
FILE: docker/conda/python37-chainerx-gpu-latest/conda-entrypoint.sh
================================================
#!/bin/bash
. /opt/conda/etc/profile.d/conda.sh
conda activate py37
exec "$@"
================================================
FILE: docker/conda/python37-chainerx-gpu-stable/Dockerfile
================================================
FROM nvidia/cuda:10.1-cudnn7-devel
RUN apt-get update -y && \
apt-get install -y --no-install-recommends \
git \
wget \
bzip2 \
ca-certificates \
curl \
cmake \
libblas3 \
libblas-dev \
libxext6 \
libgl1-mesa-glx \
libxrender-dev \
&& \
rm -rf /var/lib/apt/lists/* /var/cache/apt/archives/*
ENV LANG=C.UTF-8 LC_ALL=C.UTF-8
ENV PATH /opt/conda/bin:$PATH
RUN wget --quiet https://repo.anaconda.com/miniconda/Miniconda3-4.5.11-Linux-x86_64.sh -O ~/miniconda.sh && \
/bin/bash ~/miniconda.sh -b -p /opt/conda && \
rm ~/miniconda.sh && \
/opt/conda/bin/conda clean -tipsy && \
ln -s /opt/conda/etc/profile.d/conda.sh /etc/profile.d/conda.sh && \
echo ". /opt/conda/etc/profile.d/conda.sh" >> ~/.bashrc && \
echo "conda activate base" >> ~/.bashrc
RUN conda update -n base -c defaults conda
ENV MAKEFLAGS -j4
RUN conda create -n py37 python=3.7 conda && \
. /opt/conda/etc/profile.d/conda.sh && \
conda init bash && \
conda activate py37 && \
CHAINER_BUILD_CHAINERX=1 CHAINERX_BUILD_CUDA=1 pip install -vvvv --no-cache-dir cupy-cuda101==6.2.0 chainer==6.2.0 && \
conda install -c rdkit rdkit==2019.03.4.0
ADD conda-entrypoint.sh /conda-entrypoint.sh
ENTRYPOINT [ "/conda-entrypoint.sh" ]
================================================
FILE: docker/conda/python37-chainerx-gpu-stable/conda-entrypoint.sh
================================================
#!/bin/bash
. /opt/conda/etc/profile.d/conda.sh
conda activate py37
exec "$@"
================================================
FILE: docker/python3/Dockerfile
================================================
FROM chainer/chainer:v6.1.0-python3
RUN apt-get update -y && \
apt-get install -y --no-install-recommends \
curl ca-certificates \
libboost-dev \
libboost-python-dev \
libboost-serialization-dev \
libboost-iostreams-dev \
libboost-thread-dev \
libboost-system-dev \
libeigen3-dev && \
apt-get clean && \
rm -rf /var/lib/apt/lists/*
# build & install rdkit
ARG RDKIT_VERSION=Release_2017_09_3
RUN curl -sLo ${RDKIT_VERSION}.tar.gz https://github.com/rdkit/rdkit/archive/${RDKIT_VERSION}.tar.gz && \
tar xf ${RDKIT_VERSION}.tar.gz && \
mkdir -p rdkit-${RDKIT_VERSION}/build && \
base_dir=$(pwd) && \
cd rdkit-${RDKIT_VERSION}/build && \
cmake \
-D RDK_BUILD_SWIG_SUPPORT=OFF \
-D RDK_BUILD_PYTHON_WRAPPERS=ON \
-D RDK_BUILD_COMPRESSED_SUPPLIERS=ON \
-D RDK_BUILD_INCHI_SUPPORT=ON \
-D RDK_BUILD_AVALON_SUPPORT=ON \
-D RDK_BUILD_CPP_TESTS=OFF \
-D RDK_INSTALL_INTREE=OFF \
-D RDK_INSTALL_STATIC_LIBS=OFF \
-D PYTHON_EXECUTABLE=/usr/bin/python3.5 \
-D PYTHON_NUMPY_INCLUDE_PATH=/usr/local/lib/python3.5/dist-packages/numpy/core/include \
-D PYTHON_INSTDIR=/usr/local/lib/python3.5/dist-packages \
-D Python_ADDITIONAL_VERSIONS=3.5 \
-D CMAKE_BUILD_TYPE=Release \
-D CMAKE_INSTALL_PREFIX=/usr/local \
.. && \
make -j $(nproc) && \
make install && \
cd "$base_dir" && \
rm -rf rdkit-${RDKIT_VERSION} ${RDKIT_VERSION}.tar.gz && \
ldconfig
# install chainer-chemistry
# matplotlib >= 3.1 requires upgrade of pip
# pandas >= 0.25 doesn't support python3.5.2 which is installed for ubuntu16.04
RUN pip3 install --no-cache-dir matplotlib==3.0 pandas==0.24 chainer-chemistry
================================================
FILE: docs/Makefile
================================================
# Minimal makefile for Sphinx documentation
#
# You can set these variables from the command line.
SPHINXOPTS =
SPHINXBUILD = sphinx-build
SPHINXPROJ = Chainer-Chemistry
SOURCEDIR = source
BUILDDIR = build
# Put it first so that "make" without argument is like "make help".
help:
@$(SPHINXBUILD) -M help "$(SOURCEDIR)" "$(BUILDDIR)" $(SPHINXOPTS) $(O)
.PHONY: help Makefile
# Catch-all target: route all unknown targets to Sphinx using the new
# "make mode" option. $(O) is meant as a shortcut for $(SPHINXOPTS).
%: Makefile
@$(SPHINXBUILD) -M $@ "$(SOURCEDIR)" "$(BUILDDIR)" $(SPHINXOPTS) $(O)
================================================
FILE: docs/source/_autosummary_check.py
================================================
import inspect
import os
import types
import chainer_chemistry.functions
import chainer_chemistry.links
import chainer_chemistry.models
def _is_rst_exists(entity):
return os.path.exists('source/generated/{}.rst'.format(entity))
def check(app, exception):
missing_entities = []
missing_entities += [
name for name in _list_chainer_functions()
if not _is_rst_exists(name)]
missing_entities += [
name for name in _list_chainer_links()
if not _is_rst_exists(name)]
missing_entities += [
name for name in _list_chainer_models()
if not _is_rst_exists(name)]
if len(missing_entities) != 0:
app.warn('\n'.join([
'Undocumented entities found.',
'',
] + missing_entities))
def _list_chainer_functions():
# List exported functions under chainer.functions.
return ['chainer_chemistry.functions.{}'.format(name)
for (name, func) in chainer_chemistry.functions.__dict__.items()
if isinstance(func, types.FunctionType)]
def _list_chainer_links():
# List exported classes under chainer.links.
return ['chainer_chemistry.links.{}'.format(name)
for (name, link) in chainer_chemistry.links.__dict__.items()
if inspect.isclass(link)]
def _list_chainer_models():
# List exported classes under chainer.links.
return ['chainer_chemistry.models.{}'.format(name)
for (name, model) in chainer_chemistry.models.__dict__.items()
if inspect.isclass(model)]
================================================
FILE: docs/source/conf.py
================================================
#!/usr/bin/env python3
# -*- coding: utf-8 -*-
#
# This file is execfile()d with the current directory set to its
# containing dir.
#
# Note that not all possible configuration values are present in this
# autogenerated file.
#
# All configuration values have a default; values that are commented out
# serve to show the default.
# If extensions (or modules to document with autodoc) are in another directory,
# add these directories to sys.path here. If the directory is relative to the
# documentation root, use os.path.abspath to make it absolute, like shown here.
#
import os
import pkg_resources
import sys
sys.path.insert(0, os.path.abspath(os.path.dirname(__file__)))
import sphinx_rtd_theme
import _autosummary_check
__version__ = pkg_resources.get_distribution('chainer-chemistry').version
# -- General configuration ------------------------------------------------
# If your documentation needs a minimal Sphinx version, state it here.
#
# needs_sphinx = '1.0'
# Add any Sphinx extension module names here, as strings. They can be
# extensions coming with Sphinx (named 'sphinx.ext.*') or your custom
# ones.
extensions = ['sphinx.ext.autodoc',
'sphinx.ext.doctest',
'sphinx.ext.intersphinx',
'sphinx.ext.todo',
'sphinx.ext.coverage',
'sphinx.ext.mathjax',
'sphinx.ext.ifconfig',
'sphinx.ext.viewcode',
'sphinx.ext.autosummary',
'sphinx.ext.napoleon']
autosummary_generate = True
# Add any paths that contain templates here, relative to this directory.
templates_path = ['_templates']
# The suffix(es) of source filenames.
# You can specify multiple suffix as a list of string:
#
# source_suffix = ['.rst', '.md']
source_suffix = '.rst'
# The master toctree document.
master_doc = 'index'
# General information about the project.
project = 'Chainer Chemistry'
copyright = '2017, Preferred Networks, Inc.'
author = 'Preferred Networks, Inc.'
# The version info for the project you're documenting, acts as replacement for
# |version| and |release|, also used in various other places throughout the
# built documents.
#
# The short X.Y version.
version = __version__
# The full version, including alpha/beta/rc tags.
release = __version__
# The language for content autogenerated by Sphinx. Refer to documentation
# for a list of supported languages.
#
# This is also used if you do content translation via gettext catalogs.
# Usually you set "language" from the command line for these cases.
language = None
# List of patterns, relative to source directory, that match files and
# directories to ignore when looking for source files.
# This patterns also effect to html_static_path and html_extra_path
exclude_patterns = []
# The name of the Pygments (syntax highlighting) style to use.
pygments_style = 'sphinx'
# If true, `todo` and `todoList` produce output, else they produce nothing.
todo_include_todos = True
# -- Options for HTML output ----------------------------------------------
# The theme to use for HTML and HTML Help pages. See the documentation for
# a list of builtin themes.
#
html_theme = "sphinx_rtd_theme"
html_theme_path = [sphinx_rtd_theme.get_html_theme_path()]
# Theme options are theme-specific and customize the look and feel of a theme
# further. For a list of options available for each theme, see the
# documentation.
#
# html_theme_options = {}
# Add any paths that contain custom static files (such as style sheets) here,
# relative to this directory. They are copied after the builtin static files,
# so a file named "default.css" will overwrite the builtin "default.css".
html_static_path = ['_static']
# Custom sidebar templates, must be a dictionary that maps document names
# to template names.
#
# This is required for the alabaster theme
# refs: http://alabaster.readthedocs.io/en/latest/installation.html#sidebars
html_sidebars = {
'**': [
'relations.html', # needs 'show_related': True theme option to display
'searchbox.html',
]
}
# -- Options for HTMLHelp output ------------------------------------------
# Output file base name for HTML help builder.
htmlhelp_basename = 'Chainer-Chemistrydoc'
# -- Options for LaTeX output ---------------------------------------------
latex_elements = {
# The paper size ('letterpaper' or 'a4paper').
#
# 'papersize': 'letterpaper',
# The font size ('10pt', '11pt' or '12pt').
#
# 'pointsize': '10pt',
# Additional stuff for the LaTeX preamble.
#
# 'preamble': '',
# Latex figure (float) alignment
#
# 'figure_align': 'htbp',
}
# Grouping the document tree into LaTeX files. List of tuples
# (source start file, target name, title,
# author, documentclass [howto, manual, or own class]).
latex_documents = [
(master_doc, 'Chainer-Chemistry.tex', 'Chainer Chemistry Documentation',
'Preferred Networks, Inc.', 'manual'),
]
# -- Options for manual page output ---------------------------------------
# One entry per manual page. List of tuples
# (source start file, name, description, authors, manual section).
man_pages = [
(master_doc, 'chainer-chemistry', 'Chainer Chemistry Documentation',
[author], 1)
]
# -- Options for Texinfo output -------------------------------------------
# Grouping the document tree into Texinfo files. List of tuples
# (source start file, target name, title, author,
# dir menu entry, description, category)
texinfo_documents = [
(master_doc, 'Chainer Chemistry', 'Chainer Chemistry Documentation',
author, 'Chainer Chemistry', 'One line description of project.',
'Miscellaneous'),
]
# Example configuration for intersphinx: refer to the Python standard library.
intersphinx_mapping = {'https://docs.python.org/': None}
def setup(app):
app.connect('build-finished', _build_finished)
def _build_finished(app, exception):
if exception is None:
_autosummary_check.check(app, exception)
================================================
FILE: docs/source/contribution.rst
================================================
==================
Contribution guide
==================
We welcome any type of contribution that helps to improve and promote Chainer Chemistry.
Typical contribution includes:
* Send pull requests (PRs) to the `repository `_ (We recommend developers making PRs to read the :ref:`development-policy` before starting to implement).
* Report bugs or problems as `issues `_.
* Send questions to developer community sites like `Stackoverflow `_ or Chainer Slack (`en `_, `jp `_).
* Write a blog post about Chainer Chemistry or its use case.
================================================
FILE: docs/source/dataset.rst
================================================
=======
Dataset
=======
Converters
==========
.. autosummary::
:toctree: generated/
:nosignatures:
chainer_chemistry.dataset.converters.concat_mols
Indexers
========
.. autosummary::
:toctree: generated/
:nosignatures:
chainer_chemistry.dataset.indexer.BaseIndexer
chainer_chemistry.dataset.indexer.BaseFeatureIndexer
chainer_chemistry.dataset.indexers.NumpyTupleDatasetFeatureIndexer
Parsers
=======
.. autosummary::
:toctree: generated/
:nosignatures:
chainer_chemistry.dataset.parsers.BaseParser
chainer_chemistry.dataset.parsers.CSVFileParser
chainer_chemistry.dataset.parsers.SDFFileParser
chainer_chemistry.dataset.parsers.DataFrameParser
chainer_chemistry.dataset.parsers.SmilesParser
Preprocessors
=============
Base preprocessors
------------------
.. autosummary::
:toctree: generated/
:nosignatures:
chainer_chemistry.dataset.preprocessors.BasePreprocessor
chainer_chemistry.dataset.preprocessors.MolPreprocessor
Concrete preprocessors
----------------------
.. autosummary::
:toctree: generated/
:nosignatures:
chainer_chemistry.dataset.preprocessors.AtomicNumberPreprocessor
chainer_chemistry.dataset.preprocessors.ECFPPreprocessor
chainer_chemistry.dataset.preprocessors.GGNNPreprocessor
chainer_chemistry.dataset.preprocessors.NFPPreprocessor
chainer_chemistry.dataset.preprocessors.SchNetPreprocessor
chainer_chemistry.dataset.preprocessors.WeaveNetPreprocessor
chainer_chemistry.dataset.preprocessors.RelGATPreprocessor
chainer_chemistry.dataset.preprocessors.RelGCNPreprocessor
chainer_chemistry.dataset.preprocessors.RSGCNPreprocessor
Utilities
---------
.. autosummary::
:toctree: generated/
:nosignatures:
chainer_chemistry.dataset.preprocessors.MolFeatureExtractionError
chainer_chemistry.dataset.preprocessors.type_check_num_atoms
chainer_chemistry.dataset.preprocessors.construct_atomic_number_array
chainer_chemistry.dataset.preprocessors.construct_adj_matrix
Splitters
==========
.. autosummary::
:toctree: generated/
:nosignatures:
chainer_chemistry.dataset.splitters.RandomSplitter
chainer_chemistry.dataset.splitters.StratifiedSplitter
chainer_chemistry.dataset.splitters.ScaffoldSplitter
================================================
FILE: docs/source/datasets.rst
================================================
========
Datasets
========
Dataset implementations
=======================
.. autosummary::
:toctree: generated/
:nosignatures:
chainer_chemistry.datasets.NumpyTupleDataset
Dataset loaders
===============
.. autosummary::
:toctree: generated/
:nosignatures:
chainer_chemistry.datasets.tox21.get_tox21
chainer_chemistry.datasets.qm9.get_qm9
chainer_chemistry.datasets.molnet.get_molnet_dataset
chainer_chemistry.datasets.molnet.get_molnet_dataframe
================================================
FILE: docs/source/development.rst
================================================
.. _development-policy:
==================
Development policy
==================
In this section, we describe the development policy that the core developers follow.
Developers who are thinking to send PRs to the repository are encouraged to read the following sections
before starting implementation.
Versioning policy
=================
Basically, we follow the `semantic versioning v2.0.0 `_.
In Chainer Chemistry, *public APIs* in the sense of semantic versioning are ones in `the document `_.
We follow these rules about versioning during the major version zero in addition to ones described in the the semantic versioning:
* We do not plan any scheduled releases.
* We do not plan any pre releases.
* We release the minor version when the core development team agrees. Typically, we do so when (1) sufficient number of features are added since the last minor release (2) the latest release cannot run the example code in the master branch of the repository (3) critical bugs are found. But we are not restricted to them.
* If we find critical bugs, we should release a patch version or a minor version that fixes them. The core development team will determine which version to release.
We do not have a concrete plan about versioning strategy after v1.0.0.
Compatibiity policy
===================
As an immediate consequence of the semantic versioning, we may break compatibility of public APIs including addition, deletion, and changes in their semantics anytime in the major version zero.
Since APIs of Chainer Chemistry are still immature and unstable, we expect introduction of new features can sometime involve compatibility break.
If we are faced with a dilemma between cost for backward compatibility and benefit of new features, we are likely to give up the former because we want to place importance on introducing new features as soon as possible. Of course, we care backward compatibility whenever it is easy and low-cost.
Like `ChainerCV `_, Chainer Chemistry provides several off-the-shelf deep learning models (e.g. Neural Finger Print) whose papers are available in such as arXiv or conferences related to machine learning.
Although, most of published papers reports evaluation results of the models with publicly available datasets, we do *NOT* guarantee the reproducibility of experiments in the papers.
At some point, coding examples in the master branch of the official repository may not work even with the latest release. In that case, users are recommended to either use the example code of the latest release or update the library code to the master branch.
As of v0.3.0, we have introduced `BaseForwardModel`, which provides methods for serializing itself to and loading from a file.
As these methods intenally use `pickle `_, portability of the class depends on that of pickling.
Especially, serialized instances of `BaseForwardModel` made with older Chainer Chemistry may not be loaded with newer one, partly because we may change their internal structures for refactoring, performance improvement, and so on.
See the document of `BaseForwardModel` and their subclasses (e.g. `Classifier`, `Regressor`).
Branch strategy
===============
The official repository of Chainer Chemistry is https://github.com/pfnet-research/chainer-chemistry.
We use the *master* branch of the repository for development. Therefore, developer who makes PRs should send them to the master branch.
During major version zero, we do not maintain any released versions.
When a bug is found, changes for the bug should be merged to the next version (either minor or patch). If the bug is critical, we will release the next version as soon as possible.
Coding guideline
================
We basically adopt `PEP8 _` as a style guide.
You can check it with `flake8`, which we can install by::
$ pip install flake8
and run with ``flake8`` command.
In addition to PEP8, we use upper camel case (e.g. ``FooBar``) for class names and snake case (e.g. ``foo_bar``) for function, method, variable and package names.
Although we recommend developers to follow these rules as well, they are not mandatory.
For documents, we follow the `Google Python Style Guide `_
and compile it with `Napoleon `_,
which is an extension of `Sphinx `_.
Testing guideline
=================
Chainer Chemistry uses `pytest `_ as a unit-test framework.
All unit tests are located in ``tests/`` directory. We can run tests with normal usage of pytest.
For example, the following command runs all unit tests::
$ pytest tests
Some unit tests require GPUs, which are annotated with ``@pytest.mark.gpu``.
Therefore, you can skip them with ``-m`` option::
$ pytest -m "not gpu" tests
If a develop who write a unit test that uses GPUs, you must anotate it with ``@pytest.mark.gpu``.
Similarly, some unit tests take long time to complete.
We annotated them with ``@pytest.mark.slow`` and can skip them with ``-m`` option::
$ pytest -m "not slow" tests
Any unit test that uses GPUs muct be annotated with ``@pytest.mark.slow``.
We can skip both GPU and slow tests with the following command::
$ pytest -m "not (gpu or slow)" tests
Terminology
===========
In the context of machine learning, especially chemoinformatics, we use several terms such as feature, feature vectors, descriptor and so on
to indicate representation of inputs. To avoid disambiguity and align naming convention within the library code, we use these terms in the following way:
* *Feature* is a representation of a sample of interest (typically molecules in Chainer Chemistry).
* *Label* is a target value of we want to predict.
* *Input feature* is a representation of a sample from which we want to predict the target value.
For example, consider a suepervised learning task whose dataset consisting of input-output pairs ``((x_1, y_1), ..., (x_N, y_N))``, where ``N`` is the number of samples.
In Chainer Chemistry ``x_i` and ``y_i`` are called input feature and label, respectively and a pair of ``(x_i, y_i)`` is feature for each ``i``.
Relation to Chainer
===================
`Chainer `_ is a deep learning framework written in Python that features dynamic
computational graph construction (the "define-by-run" paradigm) for flexible and intuitive model development.
As the name indicates, Chainer Chemistry is an extension library of Chainer built on top of it.
The core development team members of Chainer and that of Chainer Chemistry work together tightly.
================================================
FILE: docs/source/environment.yml
================================================
name: chainer-chemistry
channels: !!python/tuple
- defaults
dependencies:
- rdkit::boost=1.63.0=py36_1
- rdkit::rdkit=2017.09.1=py36_1
================================================
FILE: docs/source/functions.rst
================================================
=========
Functions
=========
Function implementations
========================
.. autosummary::
:toctree: generated/
:nosignatures:
chainer_chemistry.functions.matmul
chainer_chemistry.functions.mean_squared_error
chainer_chemistry.functions.mean_absolute_error
chainer_chemistry.functions.r2_score
================================================
FILE: docs/source/index.rst
================================================
Chainer Chemistry: Chainer extension library for Biology and Chemistry
======================================================================
`Chainer Chemistry `_ is a collection of tools to train and run neural networks for tasks in biology and chemistry using `Chainer `_ .
Features
--------
* State-of-the-art deep learning neural network models (especially graph convolutions) for chemical molecules (NFP, GGNN, Weave, SchNet etc.)
* Preprocessors of molecules tailored for these models
* Parsers for several standard file formats (CSV, SDF etc.)
* Loaders for several well-known datasets (QM9, Tox21 etc.)
Introductory to deep learning for molecules and Chainer Chemistry is also available `here (SlideShare) `_.
.. toctree::
:maxdepth: 1
:caption: Contents
install
tutorial
contribution
development
reference
================================================
FILE: docs/source/install.rst
================================================
============
Installation
============
Dependency
========================
Following packages are required to install Chainer Chemistry and are automatically
installed when you install the library by `pip` command.
* `chainer `_
* `pandas `_
* `scikit-learn `_
* `tqdm `_
Also, it uses following library, which you need to manually install.
* `rdkit `_
See the `official document `_ for installation.
If you have setup ``anaconda``, you may install ``rdkit`` by following command::
$ conda install -c rdkit rdkit
Install via pip
========================
It can be installed by ``pip`` command::
$ pip install chainer-chemistry
Install from source
========================
The tarball of the source tree is available via ``pip download chainer-chemistry``.
You can use ``setup.py`` to install Chainer Chemistry from the tarball::
$ tar zxf chainer-chemistry-x.x.x.tar.gz
$ cd chainer-chemistry-x.x.x
$ python setup.py install
Install from the latest source from the master branch::
$ git clone https://github.com/pfnet-research/chainer-chemistry.git
$ pip install -e chainer-chemistry
Run example training code
=========================
`The official repository `_ provides examples
of training several graph convolution networks. The code can be obtained by cloning the repository::
$ git clone https://github.com/pfnet-research/chainer-chemistry.git
The following code is how to train Neural Fingerprint (NFP) with the Tox21 dataset on CPU::
$ cd chainer-chemistry/examples/tox21
$ python train_tox21.py --method=nfp --gpu=-1 # set --gpu=0 if you have GPU
================================================
FILE: docs/source/iterators.rst
================================================
=========
Iterators
=========
Iterator Implementations
========================
.. autosummary::
:toctree: generated/
:nosignatures:
chainer_chemistry.iterators.BalancedSerialIterator
chainer_chemistry.iterators.IndexIterator
================================================
FILE: docs/source/links.rst
================================================
=====
Links
=====
Link implementations
====================
.. autosummary::
:toctree: generated/
:nosignatures:
chainer_chemistry.links.EmbedAtomID
chainer_chemistry.links.GraphLinear
chainer_chemistry.links.GraphBatchNormalization
Scaler implementations
======================
.. autosummary::
:toctree: generated/
:nosignatures:
chainer_chemistry.links.StandardScaler
Update implementations
======================
.. autosummary::
:toctree: generated/
:nosignatures:
chainer_chemistry.links.GGNNUpdate
chainer_chemistry.links.NFPUpdate
chainer_chemistry.links.RelGATUpdate
chainer_chemistry.links.RelGCNUpdate
chainer_chemistry.links.RSGCNUpdate
chainer_chemistry.links.SchNetUpdate
Readout implementations
=======================
.. autosummary::
:toctree: generated/
:nosignatures:
chainer_chemistry.links.GeneralReadout
chainer_chemistry.links.GGNNReadout
chainer_chemistry.links.NFPReadout
chainer_chemistry.links.SchNetReadout
================================================
FILE: docs/source/models.rst
================================================
======
Models
======
Model implementations
=====================
.. autosummary::
:toctree: generated/
:nosignatures:
chainer_chemistry.models.NFP
chainer_chemistry.models.GGNN
chainer_chemistry.models.MLP
chainer_chemistry.models.SchNet
chainer_chemistry.models.WeaveNet
chainer_chemistry.models.RelGAT
chainer_chemistry.models.RelGCN
chainer_chemistry.models.RSGCN
Wrapper models
==============
.. autosummary::
:toctree: generated/
:nosignatures:
chainer_chemistry.models.BaseForwardModel
chainer_chemistry.models.Classifier
chainer_chemistry.models.Regressor
================================================
FILE: docs/source/reference.rst
================================================
=============
API Reference
=============
.. toctree::
:maxdepth: 1
dataset
datasets
functions
iterators
links
models
utils
training
================================================
FILE: docs/source/requirements.txt
================================================
chainer
scipy
scikit-learn
pandas
tqdm
================================================
FILE: docs/source/training.rst
================================================
=========
Training
=========
Extensions
==========
.. autosummary::
:toctree: generated/
:nosignatures:
chainer_chemistry.training.extensions.batch_evaluator.BatchEvaluator
chainer_chemistry.training.extensions.roc_auc_evaluator.ROCAUCEvaluator
chainer_chemistry.training.extensions.prc_auc_evaluator.PRCAUCEvaluator
================================================
FILE: docs/source/tutorial.rst
================================================
============
Tutorial
============
Abstract
========================
In this tutorial, we predict Highest Occupied Molecular Orbital (HOMO) level of the molecules in `QM9 dataset `_ [1][2] by `Neural Finger Print (NFP) `_ [3][4].
We concentrate on exaplaining usage of Chainer Chemistry briefly and do not look over the detail of NFP implementation.
.. _environment:
Tested Environment
========================
- Chainer Chemistry >= 0.0.1 (See :doc:`install`)
- Chainer >= 2.0.2
- CUDA == 8.0, CuPy >= 1.0.3 (Required only when using GPU)
- For CUDA 9.0, CuPy >= 2.0.0 is required
- sklearn >= 0.17.1 (Only for preprocessing)
QM9 Dataset
========================
QM9 is a publicly available dataset of small organic molecule structures and their simulated properties for data driven researches of material property prediction and chemical space exploration.
It contains 133,885 stable small organic molecules made up of CHONF.
The available properties are geometric, energetic, electronic, and thermodynamic ones.
In this tutorial, we predict HOMO level in the properties.
Physically, we need quantum chemical calculations to compute HOMO level.
From mathematical viewpoint it requires a solution of an internal eigenvalue problem for a Hamiltonian matrix.
It is a big challenge to predict HOMO level accurately by a neural network,
because the network should approximate both calculating the Hamiltonian matrix and solving the internal eigenvalue problem.
HOMO prediction by NFP
========================
At first you should clone the library repository from `GitHub `_.
There is a Python script ``examples/qm9/train_qm9.py`` in the repository.
It executes a whole training procedure, that is, downloads QM9 dataset, preprocess it, define an NFP model and run trainning on them.
Execute the following commands on a machine satisfying the tested environment in :ref:`environment`.
.. code-block:: shell
~$ git clone git@github.com:pfnet-research/chainer-chemistry.git
~$ cd chainer-chemistry/examples/qm9/
Hereafter all shell commands should be executed in this directory.
If you are a beginner for Chainer, `Chainer handson `_ will greatly help you.
Especially the explanation of inclusion relationship of Chainer classes in Sec. 4 in `Chap. 2 `_ is helpful when you read the sample script.
Next the dataset preparation part and the model definition part in ``train_qm9.py`` are explained.
If you are not interested in them, skip :ref:`dataset-preparation` and :ref:`model-definition`, and jump to :ref:`run`.
.. _dataset-preparation:
Dataset Preparation
------------------------
Chainer Chemistry accepts the same dataset type with Chainer, such as ``chainer.datasets.SubDataset``.
In this section we learn how to download QM9 dataset and use it as a Chainer dataset.
The following Python script downloads and saves the dataset in ``.npz`` format.
.. code-block:: python
#!/usr/bin/env python
from chainer_chemistry import datasets as D
from chainer_chemistry.dataset.preprocessors import preprocess_method_dict
from chainer_chemistry.datasets import NumpyTupleDataset
preprocessor = preprocess_method_dict['nfp']()
dataset = D.get_qm9(preprocessor, labels='homo')
cache_dir = 'input/nfp_homo/'
os.makedirs(cache_dir)
NumpyTupleDataset.save(cache_dir + 'data.npz', dataset)
The last two lines save the dataset to ``input/nfp_homo/data.npz`` and we need not to download the dataset next time.
The following Python script read the dataset from the saved ``.npz`` file and split the data points into training and validation sets.
.. code-block:: python
#!/usr/bin/env python
from chainer.datasets import split_dataset_random
from chainer_chemistry import datasets as D
from chainer_chemistry.dataset.preprocessors import preprocess_method_dict
from chainer_chemistry.datasets import NumpyTupleDataset
cache_dir = 'input/nfp_homo/'
dataset = NumpyTupleDataset.load(cache_dir + 'data.npz')
train_data_ratio = 0.7
train_data_size = int(len(dataset) * train_data_ratio)
train, val = split_dataset_random(dataset, train_data_size, 777)
print('train dataset size:', len(train))
print('validation dataset size:', len(val))
The function ``split_dataset_random()`` returns a tuple of two ``chainer.datasets.SubDataset`` objects (training and validation set).
Now you have prepared training and validation data points and you can construct ``chainer.iterator.Iterator`` objects, needed for updaters in Chainer.
.. _model-definition:
Model Definition
------------------------
In Chainer, a neural network model is defined as a ``chainer.Chain`` object.
Graph convolutional networks such as NFP are generally connection of graph convolution layers and multi perceptron layers.
Therefore it is convenient to define a class which inherits ``chainer.Chain`` and compose two ``chainer.Chain`` objects corresponding to the two kind of layers.
Execute the following Python script and check you can define such a class.
``NFP`` and ``MLP`` are already defined ``chainer.Chain`` classes.
.. code-block:: python
#!/usr/bin/env python
import chainer
from chainer_chemistry.models import MLP, NFP
class GraphConvPredictor(chainer.Chain):
def __init__(self, graph_conv, mlp):
super(GraphConvPredictor, self).__init__()
with self.init_scope():
self.graph_conv = graph_conv
self.mlp = mlp
def __call__(self, atoms, adjs):
x = self.graph_conv(atoms, adjs)
x = self.mlp(x)
return x
n_unit = 16
conv_layers = 4
model = GraphConvPredictor(NFP(n_unit, n_unit, conv_layers),
MLP(n_unit, 1))
.. _run:
Run
------------------------
You have defined the dataset and the NFP model on Chainer.
There are no other procedures specific to Chainer Chemistry.
Hereafter you should just follow the usual procedures in Chainer to execute training.
The sample script ``examples/qm9/train_qm9.py`` contains all the procedures and you can execute training just by invoking the script.
The following command starts training for 20 epochs and reports loss and accuracy during training.
They are reported for each of ``main`` (dataset for training) and ``validation`` (dataset for validation).
The ``--gpu 0`` option is to utilize a GPU with device id = 0.
If you do not have a GPU, set ``--gpu -1`` or just drop ``--gpu 0`` to use CPU for all the calculation.
In most cases, calculation with GPU is much faster than that only with CPU.
.. code-block:: shell
~/chainer-chemistry/examples/qm9$ python train_qm9.py --method nfp --label homo --gpu 0 # If GPU is unavailable, set --gpu -1
Train NFP model...
epoch main/loss main/accuracy validation/main/loss validation/main/accuracy elapsed_time
1 0.746135 0.0336724 0.680088 0.0322597 58.4605
2 0.642823 0.0311715 0.622942 0.0307055 113.748
(...)
19 0.540646 0.0277585 0.532406 0.0276445 1052.41
20 0.537062 0.0276631 0.551695 0.0277499 1107.29
After finished, you will find ``log`` file in ``result/`` directory.
Evaluation
------------------------
In the loss and accuracy report, we are mainly interested in ``validation/main/accuracy``.
Although it decreases during training, the ``accuracy`` field is actually mean absolute error.
The unit is Hartree.
Therefore the last line means validation mean absolute error is 0.0277499 Hartree.
See ``scaled_abs_error()`` function in ``train_qm9.py`` for the detailed definition of mean absolute error.
.. 1 kcal/mol = 0.0016 Hartree = 0.043 eV = 500 K
.. 17.4133 kcal/mol = 0.0277499 Hartree = 0.755114 eV = 8762.78 K
.. DFT error of HOMO level reported in https://arxiv.org/pdf/1702.05532.pdf is 2.0 eV = 0.073 Hartree.
You can also train other type models like GGNN, SchNet or WeaveNet, and other target values like LUMO, dipole moment and internal energy, just by changing ``--model`` and ``--label`` options, respectively.
See output of ``python train_qm9.py --help``.
Using your own dataset
========================
You can use your own dataset in Chainer Chemistry.
`example/own_dataset `_ shows an example.
Reference
========================
[1] L. Ruddigkeit, R. van Deursen, L. C. Blum, J.-L. Reymond, Enumeration of 166 billion organic small molecules in the chemical universe database GDB-17, J. Chem. Inf. Model. 52, 2864–2875, 2012.
[2] R. Ramakrishnan, P. O. Dral, M. Rupp, O. A. von Lilienfeld, Quantum chemistry structures and properties of 134 kilo molecules, Scientific Data 1, 140022, 2014.
[3] Duvenaud, D. K., Maclaurin, D., Iparraguirre, J., Bombarell, R., Hirzel, T., Aspuru-Guzik, A., & Adams, R. P. (2015). Convolutional networks on graphs for learning molecular fingerprints. In Advances in neural information processing systems (pp. 2224-2232).
[4] Gilmer, J., Schoenholz, S. S., Riley, P. F., Vinyals, O., & Dahl, G. E. (2017). Neural message passing for quantum chemistry. arXiv preprint arXiv:1704.01212.
================================================
FILE: docs/source/utils.rst
================================================
=========
Utilities
=========
================================================
FILE: examples/.gitignore
================================================
result/
================================================
FILE: examples/README.md
================================================
# Chainer Chemistry examples
These examples are implemented to train the model.
* Tox21: 12 types of toxity classification
* QM9: Chemical property regression
* Own dataset: Own dataset (prepared in csv format) regression
* Molcule Net: Various dataset for both classification and regression
## Test
To test code of all examples, run
```
bash -x test_examples.sh -1 # for CPU
bash -x test_examples.sh 0 # for GPU
```
If you encounter errors, please report them to
[Github issues](https://github.com/pfnet-research/chainer-chemistry/issues)
along with error logs. We appreciate your help.
================================================
FILE: examples/molnet/README.md
================================================
# MoleculeNet
[MoleculeNet](http://moleculenet.ai/) provides various dataset, which ranges
Physics, Chemistry, Bio and Physiology.
You can specify dataset type, and train the model for the dataset.
## How to run the code
### Train the model by specifying dataset
You can specify dataset type by `--dataset` option.
Please refer [molnet_config.py](https://github.com/pfnet-research/chainer-chemistry/blob/master/chainer_chemistry/datasets/molnet/molnet_config.py)
for the list of available dataset in Chainer Chemistry.
For example, if you want to train "bbbp" dataset,
With CPU:
```angular2html
python train_molnet.py --dataset=bbbp
```
With GPU:
```angular2html
python train_molnet.py --dataset=bbbp -g 0
```
================================================
FILE: examples/molnet/evaluate_models_molnet.sh
================================================
#!/usr/bin/env bash
set -e
# List of available datasets.
# TODO: Investigate why training on `clearance` fails.
datasets=(bace_Class bace_pIC50 bbbp clintox delaney HIV hopv lipo \
muv nci pcba ppb qm7 qm8 qm9 SAMPL sider tox21 toxcast)
methods=(relgcn)
# device identifier; set it to -1 to train on the CPU (default).
device=${1:--1}
# Remove directories with previously trained models.
[ -d result ] && rm -rf result
for dataset in ${datasets[@]}; do
for method in ${methods[@]}; do
python train_molnet.py \
--dataset ${dataset} \
--method ${method} \
--device ${device} \
--epoch 1 \
--unit-num 10 \
--conv-layers 1 \
--num-data 100 \
--out result
python predict_molnet.py \
--dataset ${dataset} \
--method ${method} \
--in-dir result \
--device ${device} \
--num-data 100
done
done
================================================
FILE: examples/molnet/predict_molnet.py
================================================
#!/usr/bin/env python
from __future__ import print_function
import argparse
import os
import chainer
from chainer.iterators import SerialIterator
from chainer.training.extensions import Evaluator
from chainer_chemistry.training.extensions.roc_auc_evaluator import ROCAUCEvaluator # NOQA
# Proposed by Ishiguro
# ToDo: consider go/no-go with following modification
# Re-load the best-validation score snapshot using serializers
# from chainer import serializers
from chainer_chemistry.dataset.converters import converter_method_dict
from chainer_chemistry.datasets import NumpyTupleDataset
from chainer_chemistry.datasets.molnet.molnet_config import molnet_default_config # NOQA
from chainer_chemistry.models.prediction import Classifier
from chainer_chemistry.models.prediction import Regressor
from chainer_chemistry.utils import save_json
# These import is necessary for pickle to work
from chainer_chemistry.links.scaler.standard_scaler import StandardScaler # NOQA
from chainer_chemistry.models.prediction.graph_conv_predictor import GraphConvPredictor # NOQA
from train_molnet import dataset_part_filename
from train_molnet import download_entire_dataset
def parse_arguments():
# Lists of supported preprocessing methods/models.
method_list = ['nfp', 'ggnn', 'schnet', 'weavenet', 'rsgcn', 'relgcn',
'relgat', 'gin', 'gnnfilm', 'megnet',
'nfp_gwm', 'ggnn_gwm', 'rsgcn_gwm', 'gin_gwm']
# scale_list = ['standardize', 'none']
dataset_names = list(molnet_default_config.keys())
# Set up the argument parser.
parser = argparse.ArgumentParser(description='Prediction on Molnet.')
parser.add_argument('--dataset', '-d', type=str, choices=dataset_names,
default='bbbp',
help='name of the dataset that training is run on')
parser.add_argument('--method', '-m', type=str, choices=method_list,
help='method name', default='nfp')
parser.add_argument('--label', '-l', type=str, default='',
help='target label for regression; empty string means '
'predicting all properties at once')
# parser.add_argument('--scale', type=str, choices=scale_list,
# help='label scaling method', default='standardize')
parser.add_argument(
'--device', type=str, default='-1',
help='Device specifier. Either ChainerX device specifier or an '
'integer. If non-negative integer, CuPy arrays with specified '
'device id are used. If negative integer, NumPy arrays are used')
parser.add_argument('--in-dir', '-i', type=str, default='result',
help='directory to load model data from')
parser.add_argument('--num-data', type=int, default=-1,
help='amount of data to be parsed; -1 indicates '
'parsing all data.')
return parser.parse_args()
def main():
args = parse_arguments()
# Set up some useful variables that will be used later on.
dataset_name = args.dataset
method = args.method
num_data = args.num_data
if args.label:
labels = args.label
cache_dir = os.path.join('input', '{}_{}_{}'.format(dataset_name,
method, labels))
else:
labels = None
cache_dir = os.path.join('input', '{}_{}_all'.format(dataset_name,
method))
# Load the cached dataset.
filename = dataset_part_filename('test', num_data)
path = os.path.join(cache_dir, filename)
if os.path.exists(path):
print('Loading cached dataset from {}.'.format(path))
test = NumpyTupleDataset.load(path)
else:
_, _, test = download_entire_dataset(dataset_name, num_data, labels,
method, cache_dir)
# Model-related data is stored this directory.
model_dir = os.path.join(args.in_dir, os.path.basename(cache_dir))
model_filename = {'classification': 'classifier.pkl',
'regression': 'regressor.pkl'}
task_type = molnet_default_config[dataset_name]['task_type']
model_path = os.path.join(model_dir, model_filename[task_type])
print("model_path=" + model_path)
print('Loading model weights from {}...'.format(model_path))
device = chainer.get_device(args.device)
if task_type == 'classification':
model = Classifier.load_pickle(model_path, device=device)
elif task_type == 'regression':
model = Regressor.load_pickle(model_path, device=device)
else:
raise ValueError('Invalid task type ({}) encountered when processing '
'dataset ({}).'.format(task_type, dataset_name))
# Re-load the best-validation score snapshot
# serializers.load_npz(os.path.join(
# model_dir, "best_val_" + model_filename[task_type]), model)
# Run an evaluator on the test dataset.
print('Evaluating...')
converter = converter_method_dict[method]
test_iterator = SerialIterator(test, 16, repeat=False, shuffle=False)
eval_result = Evaluator(test_iterator, model, converter=converter,
device=device)()
print('Evaluation result: ', eval_result)
# Add more stats
if task_type == 'regression':
# loss = cuda.to_cpu(numpy.array(eval_result['main/loss']))
# eval_result['main/loss'] = loss
# convert to native values..
for k, v in eval_result.items():
eval_result[k] = float(v)
elif task_type == "classification":
# For Classifier, we do not equip the model with ROC-AUC evalation
# function. use separate ROC-AUC Evaluator
rocauc_result = ROCAUCEvaluator(
test_iterator, model, converter=converter, device=device,
eval_func=model.predictor, name='test', ignore_labels=-1)()
print('ROCAUC Evaluation result: ', rocauc_result)
save_json(os.path.join(model_dir, 'rocauc_result.json'), rocauc_result)
else:
print('[WARNING] unknown task_type {}.'.format(task_type))
# Save the evaluation results.
save_json(os.path.join(model_dir, 'eval_result.json'), eval_result)
if __name__ == '__main__':
main()
================================================
FILE: examples/molnet/summary_eval_molnet.py
================================================
#! -*- coding: utf-8 -*-
import argparse
import json
import matplotlib
matplotlib.use('Agg')
import matplotlib.pyplot as plt
import os
import seaborn as sns
import numpy as np
from chainer_chemistry.datasets.molnet.molnet_config import molnet_default_config # NOQA
from pandas import DataFrame
def save_evaluation_plot(x, y_mean, metric, dataset_name, filename):
plt.figure()
sns.set()
ax = sns.barplot(y=x, x=y_mean)
# If "text" does not work, change the attribute name to "s"
for n, (label, _y) in enumerate(zip(x, y_mean)):
ax.annotate(
s='{:.3f}'.format(abs(_y)),
xy=(_y, n),
ha='right',
va='center',
xytext=(-5, 0),
textcoords='offset points',
color='white')
plt.title('Performance on ' + dataset_name)
plt.xlabel(metric)
plt.savefig(filename)
def main():
parser = argparse.ArgumentParser()
parser.add_argument('--prefix', required=True)
parser.add_argument('--methods', nargs='+', required=True)
parser.add_argument('--dataset', required=True)
parser.add_argument('--runs', type=int, required=True)
parser.add_argument('--out_prefix', default="result_")
args = parser.parse_args()
#
# load the config file in the designated directory
#
dataset_name = args.dataset
task_type = molnet_default_config[dataset_name]['task_type']
print('task type=\'' + str(task_type) + "\'")
if task_type=='regression':
metrics = ['main/MAE', 'main/RMSE']
elif task_type=='classification':
metrics = ['test/main/roc_auc']
x = args.methods
for metric in metrics:
y = np.zeros( (len(args.methods), args.runs) )
for m, method in enumerate(args.methods):
for run in range(0, args.runs):
#for run in range(1, args.runs+1):
with open(os.path.join(args.prefix + "_" + method + "_" + str(run), 'eval_result.json')) as f:
result = json.load(f)
y[m, run-1,] = result[metric]
# end with
# end run-for
# end method-for
metric_lastslash = metric.rindex("/")
metric_name = metric[metric_lastslash+1:]
# draw figure
save_evaluation_plot(x, np.mean(y, axis=1), metric, dataset_name, args.out_prefix + metric_name + '.png')
save_evaluation_plot(x, np.mean(y, axis=1), metric, dataset_name, args.out_prefix + metric_name + '.pdf')
# output as text. mean/std
y_mean = np.mean(y, axis=1)
y_std = np.std(y, axis=1)
with open(args.out_prefix + "_summary_" + metric_name + ".tsv", "w") as fout:
for m, method in enumerate(args.methods):
fout.write(method + "\t" + str(y_mean[m]) + "\t" + str(y_std[m]) + "\n")
# end-for
# end with
# end metric-for
if __name__ == "__main__":
main()
================================================
FILE: examples/molnet/test_molnet.sh
================================================
#!/usr/bin/env bash
set -e
# List of available datasets.
# TODO: Investigate why training on `clearance` fails.
datasets=(bace_Class bace_pIC50 bbbp clintox delaney HIV hopv lipo \
muv nci pcba ppb qm7 qm8 qm9 SAMPL sider tox21 toxcast)
# device identifier; set it to -1 to train on the CPU (default).
device=${1:--1}
# Remove directories with previously trained models.
[ -d input ] && rm -rf input
for dataset in ${datasets[@]}
do
# Run the training script for the current dataset.
python train_molnet.py \
--dataset $dataset \
--method nfp \
--conv-layers 1 \
--device ${device} \
--epoch 1 \
--unit-num 10 \
--out nfp_${dataset} \
--batchsize 32 \
--num-data=100
done
================================================
FILE: examples/molnet/train_molnet.py
================================================
#!/usr/bin/env python
from __future__ import print_function
import argparse
import numpy
import os
import types
import chainer
from chainer import iterators
from chainer import optimizers
from chainer import training
from chainer.training import extensions as E
from chainer_chemistry.dataset.converters import converter_method_dict
from chainer_chemistry.dataset.preprocessors import preprocess_method_dict
from chainer_chemistry import datasets as D
from chainer_chemistry.datasets.molnet.molnet_config import molnet_default_config # NOQA
from chainer_chemistry.datasets import NumpyTupleDataset
from chainer_chemistry.links import StandardScaler
from chainer_chemistry.models.prediction import Classifier
from chainer_chemistry.models.prediction import Regressor
from chainer_chemistry.models.prediction import set_up_predictor
from chainer_chemistry.training.extensions import BatchEvaluator, ROCAUCEvaluator # NOQA
from chainer_chemistry.training.extensions.auto_print_report import AutoPrintReport # NOQA
from chainer_chemistry.utils import save_json
def parse_arguments():
# Lists of supported preprocessing methods/models and datasets.
method_list = ['nfp', 'ggnn', 'schnet', 'weavenet', 'rsgcn', 'relgcn',
'relgat', 'gin', 'gnnfilm', 'megnet',
'nfp_gwm', 'ggnn_gwm', 'rsgcn_gwm', 'gin_gwm']
dataset_names = list(molnet_default_config.keys())
scale_list = ['standardize', 'none']
parser = argparse.ArgumentParser(description='molnet example')
parser.add_argument('--method', '-m', type=str, choices=method_list,
help='method name', default='nfp')
parser.add_argument('--label', '-l', type=str, default='',
help='target label for regression; empty string means '
'predicting all properties at once')
parser.add_argument('--conv-layers', '-c', type=int, default=4,
help='number of convolution layers')
parser.add_argument('--batchsize', '-b', type=int, default=32,
help='batch size')
parser.add_argument(
'--device', type=str, default='-1',
help='Device specifier. Either ChainerX device specifier or an '
'integer. If non-negative integer, CuPy arrays with specified '
'device id are used. If negative integer, NumPy arrays are used')
parser.add_argument('--out', '-o', type=str, default='result',
help='path to save the computed model to')
parser.add_argument('--epoch', '-e', type=int, default=20,
help='number of epochs')
parser.add_argument('--unit-num', '-u', type=int, default=16,
help='number of units in one layer of the model')
parser.add_argument('--dataset', '-d', type=str, choices=dataset_names,
default='bbbp',
help='name of the dataset that training is run on')
parser.add_argument('--protocol', type=int, default=2,
help='pickle protocol version')
parser.add_argument('--num-data', type=int, default=-1,
help='amount of data to be parsed; -1 indicates '
'parsing all data.')
parser.add_argument('--scale', type=str, choices=scale_list,
help='label scaling method', default='standardize')
return parser.parse_args()
def dataset_part_filename(dataset_part, num_data):
"""Returns the filename corresponding to a train/valid/test parts of a
dataset, based on the amount of data samples that need to be parsed.
Args:
dataset_part: String containing any of the following 'train', 'valid'
or 'test'.
num_data: Amount of data samples to be parsed from the dataset.
"""
if num_data >= 0:
return '{}_data_{}.npz'.format(dataset_part, str(num_data))
return '{}_data.npz'.format(dataset_part)
def download_entire_dataset(dataset_name, num_data, labels, method, cache_dir):
"""Downloads the train/valid/test parts of a dataset and stores them in the
cache directory.
Args:
dataset_name: Dataset to be downloaded.
num_data: Amount of data samples to be parsed from the dataset.
labels: Target labels for regression.
method: Method name. See `parse_arguments`.
cache_dir: Directory to store the dataset to.
"""
print('Downloading {}...'.format(dataset_name))
preprocessor = preprocess_method_dict[method]()
# Select the first `num_data` samples from the dataset.
target_index = numpy.arange(num_data) if num_data >= 0 else None
dataset_parts = D.molnet.get_molnet_dataset(dataset_name, preprocessor,
labels=labels,
target_index=target_index)
dataset_parts = dataset_parts['dataset']
# Cache the downloaded dataset.
if not os.path.exists(cache_dir):
os.makedirs(cache_dir)
for i, part in enumerate(['train', 'valid', 'test']):
filename = dataset_part_filename(part, num_data)
path = os.path.join(cache_dir, filename)
NumpyTupleDataset.save(path, dataset_parts[i])
return dataset_parts
def fit_scaler(datasets):
"""Standardizes (scales) the dataset labels.
Args:
datasets: Tuple containing the datasets.
Returns:
Datasets with standardized labels and the scaler object.
"""
scaler = StandardScaler()
# Collect all labels in order to apply scaling over the entire dataset.
labels = None
offsets = []
for dataset in datasets:
if labels is None:
labels = dataset.get_datasets()[-1]
else:
labels = numpy.vstack([labels, dataset.get_datasets()[-1]])
offsets.append(len(labels))
scaler.fit(labels)
return scaler
def main():
args = parse_arguments()
# Set up some useful variables that will be used later on.
dataset_name = args.dataset
method = args.method
num_data = args.num_data
n_unit = args.unit_num
conv_layers = args.conv_layers
task_type = molnet_default_config[dataset_name]['task_type']
model_filename = {'classification': 'classifier.pkl',
'regression': 'regressor.pkl'}
print('Using dataset: {}...'.format(dataset_name))
# Set up some useful variables that will be used later on.
if args.label:
labels = args.label
cache_dir = os.path.join('input', '{}_{}_{}'.format(dataset_name,
method, labels))
class_num = len(labels) if isinstance(labels, list) else 1
else:
labels = None
cache_dir = os.path.join('input', '{}_{}_all'.format(dataset_name,
method))
class_num = len(molnet_default_config[args.dataset]['tasks'])
# Load the train and validation parts of the dataset.
filenames = [dataset_part_filename(p, num_data)
for p in ['train', 'valid']]
paths = [os.path.join(cache_dir, f) for f in filenames]
if all([os.path.exists(path) for path in paths]):
dataset_parts = []
for path in paths:
print('Loading cached dataset from {}.'.format(path))
dataset_parts.append(NumpyTupleDataset.load(path))
else:
dataset_parts = download_entire_dataset(dataset_name, num_data, labels,
method, cache_dir)
train, valid = dataset_parts[0], dataset_parts[1]
# Scale the label values, if necessary.
scaler = None
if args.scale == 'standardize':
if task_type == 'regression':
print('Applying standard scaling to the labels.')
scaler = fit_scaler(dataset_parts)
else:
print('Label scaling is not available for classification tasks.')
else:
print('No label scaling was selected.')
# Set up the predictor.
predictor = set_up_predictor(method, n_unit, conv_layers, class_num,
label_scaler=scaler)
# Set up the iterators.
train_iter = iterators.SerialIterator(train, args.batchsize)
valid_iter = iterators.SerialIterator(valid, args.batchsize, repeat=False,
shuffle=False)
# Load metrics for the current dataset.
metrics = molnet_default_config[dataset_name]['metrics']
metrics_fun = {k: v for k, v in metrics.items()
if isinstance(v, types.FunctionType)}
loss_fun = molnet_default_config[dataset_name]['loss']
device = chainer.get_device(args.device)
if task_type == 'regression':
model = Regressor(predictor, lossfun=loss_fun,
metrics_fun=metrics_fun, device=device)
elif task_type == 'classification':
model = Classifier(predictor, lossfun=loss_fun,
metrics_fun=metrics_fun, device=device)
else:
raise ValueError('Invalid task type ({}) encountered when processing '
'dataset ({}).'.format(task_type, dataset_name))
# Set up the optimizer.
optimizer = optimizers.Adam()
optimizer.setup(model)
# Save model-related output to this directory.
if not os.path.exists(args.out):
os.makedirs(args.out)
save_json(os.path.join(args.out, 'args.json'), vars(args))
model_dir = os.path.join(args.out, os.path.basename(cache_dir))
if not os.path.exists(model_dir):
os.makedirs(model_dir)
# Set up the updater.
converter = converter_method_dict[method]
updater = training.StandardUpdater(train_iter, optimizer, device=device,
converter=converter)
# Set up the trainer.
trainer = training.Trainer(updater, (args.epoch, 'epoch'), out=model_dir)
trainer.extend(E.Evaluator(valid_iter, model, device=device,
converter=converter))
trainer.extend(E.snapshot(), trigger=(args.epoch, 'epoch'))
trainer.extend(E.LogReport())
# TODO: consider go/no-go of the following block
# # (i) more reporting for val/evalutaion
# # (ii) best validation score snapshot
# if task_type == 'regression':
# metric_name_list = list(metrics.keys())
# if 'RMSE' in metric_name_list:
# trainer.extend(E.snapshot_object(model, "best_val_" + model_filename[task_type]),
# trigger=training.triggers.MinValueTrigger('validation/main/RMSE'))
# elif 'MAE' in metric_name_list:
# trainer.extend(E.snapshot_object(model, "best_val_" + model_filename[task_type]),
# trigger=training.triggers.MinValueTrigger('validation/main/MAE'))
# else:
# print("[WARNING] No validation metric defined?")
#
# elif task_type == 'classification':
# train_eval_iter = iterators.SerialIterator(
# train, args.batchsize, repeat=False, shuffle=False)
# trainer.extend(ROCAUCEvaluator(
# train_eval_iter, predictor, eval_func=predictor,
# device=args.gpu, converter=concat_mols, name='train',
# pos_labels=1, ignore_labels=-1, raise_value_error=False))
# # extension name='validation' is already used by `Evaluator`,
# # instead extension name `val` is used.
# trainer.extend(ROCAUCEvaluator(
# valid_iter, predictor, eval_func=predictor,
# device=args.gpu, converter=concat_mols, name='val',
# pos_labels=1, ignore_labels=-1, raise_value_error=False))
#
# trainer.extend(E.snapshot_object(
# model, "best_val_" + model_filename[task_type]),
# trigger=training.triggers.MaxValueTrigger('val/main/roc_auc'))
# else:
# raise NotImplementedError(
# 'Not implemented task_type = {}'.format(task_type))
trainer.extend(AutoPrintReport())
trainer.extend(E.ProgressBar())
trainer.run()
# Save the model's parameters.
model_path = os.path.join(model_dir, model_filename[task_type])
print('Saving the trained model to {}...'.format(model_path))
model.save_pickle(model_path, protocol=args.protocol)
if __name__ == '__main__':
main()
================================================
FILE: examples/molnet_wle/README.md
================================================
# Weisfeiler-Lehman Embedding preprocessor implementations
In this directory, we provide an implementaion of [Weisfeiler-Lehman Embedding (WLE)](https://arxiv.org/abs/2006.06909) [1] preprocessor for ChainerChemistry GNN models.
## How to run the code
### Test run command
```bash
# Training tox21 dataset using RSGCN-CWLE model. Short 3 epoch for testing.
python train_molnet_wle.py --dataset tox21 --method rsgcn_cwle --epoch 3 --device 0
# Prediction with trained model
python predict_molnet_wle.py --dataset tox21 --method rsgcn_cwle --in-dir result --device 0
```
### Train the model by specifying dataset
Basically, no changes from the original molnet examples (examples/molnet/train_molnet.py).
The main difference is the choice of '--method' option.
To test WLE, choose one of 'xxx_wle', 'xxx_cwle', and 'xxx_gwle' where 'xxx' is a GNN architecture identifier (e.g. 'rsgcn', 'relgat').
- xxx_wle: apply the naive WLE to the GNN 'xxx'
- xxx_cwle (recommended): apply the Concat WLE to the GNN 'xxx'
- xxx_gwle: apply the Gated-sum WLE to the GNN 'xxx'
#### Additional options
Introducing the WLE, we have some more additional options.
In general you do not need to specify these options (use the default values!).
## Performance
The paper [1] shows that the use of (C)WLE consistently improves the generalization (test) performance of the several GNN architectures (if hyperparameters are optimized by a Black-box optimizer such as [Optuna] (https://preferred.jp/ja/projects/optuna/).
## References
[1] Katsuhiko Ishiguro, Kenta Oono, and Kohei Hayashi, "Weisfeiler-Lehman Embedding for Molecular Graph Neural Networks", arXiv: 2006.06909, 2020. [paper link](https://arxiv.org/abs/2006.06909)
================================================
FILE: examples/molnet_wle/predict_molnet_wle.py
================================================
#!/usr/bin/env python
from __future__ import print_function
import argparse
import os
import chainer
from chainer.iterators import SerialIterator
from chainer.training.extensions import Evaluator
from chainer_chemistry.training.extensions.roc_auc_evaluator import ROCAUCEvaluator # NOQA
# Proposed by Ishiguro
# ToDo: consider go/no-go with following modification
# Re-load the best-validation score snapshot using serializers
from chainer import serializers
from chainer_chemistry.dataset.converters import concat_mols
from chainer_chemistry.datasets import NumpyTupleDataset
from chainer_chemistry.datasets.molnet.molnet_config import molnet_default_config # NOQA
from chainer_chemistry.models.prediction import Classifier
from chainer_chemistry.models.prediction import Regressor
from chainer_chemistry.utils import save_json
# These import is necessary for pickle to work
from chainer import functions as F
from chainer_chemistry.links.scaler.standard_scaler import StandardScaler # NOQA
from chainer_chemistry.models.prediction.graph_conv_predictor import GraphConvPredictor # NOQA
from train_molnet_wle import dict_for_wles
from train_molnet_wle import dataset_part_filename
from train_molnet_wle import download_entire_dataset
dict_for_wles()
def parse_arguments():
# Lists of supported preprocessing methods/models.
method_list = ['nfp', 'ggnn', 'schnet', 'weavenet', 'rsgcn', 'relgcn',
'relgat', 'gin', 'gnnfilm',
'nfp_gwm', 'ggnn_gwm', 'rsgcn_gwm', 'gin_gwm',
'nfp_wle', 'ggnn_wle', 'relgat_wle', 'relgcn_wle', 'rsgcn_wle', 'gin_wle',
'nfp_cwle', 'ggnn_cwle', 'relgat_cwle', 'relgcn_cwle', 'rsgcn_cwle', 'gin_cwle',
'nfp_gwle', 'ggnn_gwle', 'relgat_gwle', 'relgcn_gwle', 'rsgcn_gwle', 'gin_gwle']
# scale_list = ['standardize', 'none']
dataset_names = list(molnet_default_config.keys())
# Set up the argument parser.
parser = argparse.ArgumentParser(description='Prediction on Molnet.')
parser.add_argument('--dataset', '-d', type=str, choices=dataset_names,
default='bbbp',
help='name of the dataset that training is run on')
parser.add_argument('--method', '-m', type=str, choices=method_list,
help='method name', default='nfp')
parser.add_argument('--label', '-l', type=str, default='',
help='target label for regression; empty string means '
'predicting all properties at once')
# parser.add_argument('--scale', type=str, choices=scale_list,
# help='label scaling method', default='standardize')
parser.add_argument(
'--device', type=str, default='-1',
help='Device specifier. Either ChainerX device specifier or an '
'integer. If non-negative integer, CuPy arrays with specified '
'device id are used. If negative integer, NumPy arrays are used')
parser.add_argument('--in-dir', '-i', type=str, default='result',
help='directory to load model data from')
parser.add_argument('--num-data', type=int, default=-1,
help='amount of data to be parsed; -1 indicates '
'parsing all data.')
return parser.parse_args()
def main():
args = parse_arguments()
# Set up some useful variables that will be used later on.
dataset_name = args.dataset
method = args.method
num_data = args.num_data
if args.label:
labels = args.label
cache_dir = os.path.join('input', '{}_{}_{}'.format(dataset_name,
method, labels))
else:
labels = None
cache_dir = os.path.join('input', '{}_{}_all'.format(dataset_name,
method))
# Load the cached dataset.
filename = dataset_part_filename('test', num_data)
path = os.path.join(cache_dir, filename)
if os.path.exists(path):
print('Loading cached dataset from {}.'.format(path))
test = NumpyTupleDataset.load(path)
else:
_, _, test = download_entire_dataset(dataset_name, num_data, labels,
method, cache_dir)
# Model-related data is stored this directory.
model_dir = os.path.join(args.in_dir, os.path.basename(cache_dir))
model_filename = {'classification': 'classifier.pkl',
'regression': 'regressor.pkl'}
task_type = molnet_default_config[dataset_name]['task_type']
model_path = os.path.join(model_dir, model_filename[task_type])
print("model_path=" + model_path)
print('Loading model weights from {}...'.format(model_path))
device = chainer.get_device(args.device)
if task_type == 'classification':
model = Classifier.load_pickle(model_path, device=device)
elif task_type == 'regression':
model = Regressor.load_pickle(model_path, device=device)
else:
raise ValueError('Invalid task type ({}) encountered when processing '
'dataset ({}).'.format(task_type, dataset_name))
# Re-load the best-validation score snapshot
# serializers.load_npz(os.path.join(
# model_dir, "best_val_" + model_filename[task_type]), model)
# Run an evaluator on the test dataset.
print('Evaluating...')
test_iterator = SerialIterator(test, 16, repeat=False, shuffle=False)
eval_result = Evaluator(test_iterator, model, converter=concat_mols,
device=device)()
print('Evaluation result: ', eval_result)
# Add more stats
if task_type == 'regression':
# loss = cuda.to_cpu(numpy.array(eval_result['main/loss']))
# eval_result['main/loss'] = loss
# convert to native values..
for k, v in eval_result.items():
eval_result[k] = float(v)
elif task_type == "classification":
# For Classifier, we do not equip the model with ROC-AUC evalation
# function. use separate ROC-AUC Evaluator
rocauc_result = ROCAUCEvaluator(
test_iterator, model, converter=concat_mols, device=device,
eval_func=model.predictor, name='test', ignore_labels=-1)()
print('ROCAUC Evaluation result: ', rocauc_result)
# add
for k, v in rocauc_result.items():
eval_result[k] = float(v)
#save_json(os.path.join(model_dir, 'rocauc_result.json'), rocauc_result)
else:
print('[WARNING] unknown task_type {}.'.format(task_type))
# Save the evaluation results.
save_json(os.path.join(model_dir, 'eval_result.json'), eval_result)
if __name__ == '__main__':
main()
================================================
FILE: examples/molnet_wle/train_molnet_wle.py
================================================
#!/usr/bin/env python
from __future__ import print_function
import argparse
import numpy
import os
import types
import pickle
import chainer
from chainer import iterators
from chainer import optimizers
from chainer import training
from chainer.training import extensions as E
from chainer_chemistry.dataset.converters import converter_method_dict
from chainer_chemistry.dataset.preprocessors import preprocess_method_dict, wle
from chainer_chemistry import datasets as D
from chainer_chemistry.datasets.molnet.molnet_config import molnet_default_config # NOQA
from chainer_chemistry.datasets import NumpyTupleDataset
from chainer_chemistry.dataset.splitters.deepchem_scaffold_splitter import DeepChemScaffoldSplitter # NOQA
from chainer_chemistry.links import StandardScaler
from chainer_chemistry.models.prediction import Classifier
from chainer_chemistry.models.prediction import Regressor
from chainer_chemistry.models.prediction import set_up_predictor
from chainer_chemistry.training.extensions.auto_print_report import AutoPrintReport # NOQA
from chainer_chemistry.utils import save_json
from chainer_chemistry.models.cwle.cwle_graph_conv_model import MAX_WLE_NUM
def dict_for_wles():
wle_keys = ['nfp_wle', 'ggnn_wle', 'relgat_wle', 'relgcn_wle', 'rsgcn_wle', 'gin_wle',
'nfp_cwle', 'ggnn_cwle', 'relgat_cwle', 'relgcn_cwle', 'rsgcn_cwle', 'gin_cwle',
'nfp_gwle', 'ggnn_gwle', 'relgat_gwle', 'relgcn_gwle', 'rsgcn_gwle', 'gin_gwle']
from chainer_chemistry.dataset.converters.concat_mols import concat_mols
from chainer_chemistry.dataset.preprocessors.nfp_preprocessor import NFPPreprocessor
from chainer_chemistry.dataset.preprocessors.ggnn_preprocessor import GGNNPreprocessor
from chainer_chemistry.dataset.preprocessors.gin_preprocessor import GINPreprocessor
from chainer_chemistry.dataset.preprocessors.relgat_preprocessor import RelGATPreprocessor
from chainer_chemistry.dataset.preprocessors.relgcn_preprocessor import RelGCNPreprocessor
from chainer_chemistry.dataset.preprocessors.rsgcn_preprocessor import RSGCNPreprocessor
for key in wle_keys:
converter_method_dict[key] = concat_mols
if key.startswith('nfp'):
preprocess_method_dict[key] = NFPPreprocessor
elif key.startswith('ggnn'):
preprocess_method_dict[key] = GGNNPreprocessor
elif key.startswith('gin'):
preprocess_method_dict[key] = GINPreprocessor
elif key.startswith('relgcn'):
preprocess_method_dict[key] = RelGCNPreprocessor
elif key.startswith('rsgcn'):
preprocess_method_dict[key] = RSGCNPreprocessor
elif key.startswith('relgat'):
preprocess_method_dict[key] = RelGATPreprocessor
else:
assert key in wle_keys # should be die
dict_for_wles()
def parse_arguments():
# Lists of supported preprocessing methods/models and datasets.
method_list = ['nfp', 'ggnn', 'schnet', 'weavenet', 'rsgcn', 'relgcn',
'relgat', 'gin', 'gnnfilm',
'nfp_gwm', 'ggnn_gwm', 'rsgcn_gwm', 'gin_gwm',
'nfp_wle', 'ggnn_wle', 'relgat_wle', 'relgcn_wle', 'rsgcn_wle', 'gin_wle',
'nfp_cwle', 'ggnn_cwle', 'relgat_cwle', 'relgcn_cwle', 'rsgcn_cwle', 'gin_cwle',
'nfp_gwle', 'ggnn_gwle', 'relgat_gwle', 'relgcn_gwle', 'rsgcn_gwle', 'gin_gwle']
dataset_names = list(molnet_default_config.keys())
scale_list = ['standardize', 'none']
parser = argparse.ArgumentParser(description='molnet example')
parser.add_argument('--method', '-m', type=str, choices=method_list,
help='method name', default='nfp')
parser.add_argument('--label', '-l', type=str, default='',
help='target label for regression; empty string means '
'predicting all properties at once')
parser.add_argument('--conv-layers', '-c', type=int, default=4,
help='number of convolution layers')
parser.add_argument('--batchsize', '-b', type=int, default=32,
help='batch size')
parser.add_argument(
'--device', type=str, default='-1',
help='Device specifier. Either ChainerX device specifier or an '
'integer. If non-negative integer, CuPy arrays with specified '
'device id are used. If negative integer, NumPy arrays are used')
parser.add_argument('--out', '-o', type=str, default='result',
help='path to save the computed model to')
parser.add_argument('--epoch', '-e', type=int, default=20,
help='number of epochs')
parser.add_argument('--unit-num', '-u', type=int, default=16,
help='number of units in one layer of the model')
parser.add_argument('--dataset', '-d', type=str, choices=dataset_names,
default='bbbp',
help='name of the dataset that training is run on')
parser.add_argument('--protocol', type=int, default=2,
help='pickle protocol version')
parser.add_argument('--num-data', type=int, default=-1,
help='amount of data to be parsed; -1 indicates '
'parsing all data.')
parser.add_argument('--scale', type=str, choices=scale_list,
help='label scaling method', default='standardize')
parser.add_argument('--adam-alpha', type=float, help='alpha of adam', default=0.001)
# WLE options
parser.add_argument('--cutoff-wle', type=int, default=0, help="set more than zero to cut-off WL expanded labels")
parser.add_argument('--hop-num', '-k', type=int, default=1, help="The number of iterations of WLs")
return parser.parse_args()
def dataset_part_filename(dataset_part, num_data):
"""Returns the filename corresponding to a train/valid/test parts of a
dataset, based on the amount of data samples that need to be parsed.
Args:
dataset_part: String containing any of the following 'train', 'valid'
or 'test'.
num_data: Amount of data samples to be parsed from the dataset.
"""
if num_data >= 0:
return '{}_data_{}.npz'.format(dataset_part, str(num_data))
return '{}_data.npz'.format(dataset_part)
def download_entire_dataset(dataset_name, num_data, labels, method, cache_dir, apply_wle_flag=False, cutoff_wle=0, apply_cwle_flag=False, apply_gwle_flag=False, n_hop=1):
"""Downloads the train/valid/test parts of a dataset and stores them in the
cache directory.
Args:
dataset_name: Dataset to be downloaded.
num_data: Amount of data samples to be parsed from the dataset.
labels: Target labels for regression.
method: Method name. See `parse_arguments`.
cache_dir: Directory to store the dataset to.
apply_wle_flag: boolean, set True if you apply the naive WL embeddding
cutoff_wle: int set more than zero to cut off WEEs
apply_cwle_flag: boolean, set True if you apply Concatenating WLE (CWLE)
apply_gwle_flag: boolean, set True if you apply Gated-sum WLE (GWLE)
"""
print('Downloading {}...'.format(dataset_name))
preprocessor = preprocess_method_dict[method]()
# Select the first `num_data` samples from the dataset.
target_index = numpy.arange(num_data) if num_data >= 0 else None
# To force DeepChem scaffold split
dc_scaffold_splitter = DeepChemScaffoldSplitter()
dataset_parts = D.molnet.get_molnet_dataset(dataset_name, preprocessor,
labels=labels,
split=dc_scaffold_splitter,
target_index=target_index)
dataset_parts = dataset_parts['dataset']
# Cache the downloaded dataset.
if not os.path.exists(cache_dir):
os.makedirs(cache_dir)
# apply Neighboring Label Expansion
if apply_wle_flag:
dataset_parts_expand, labels_expanded, labels_frequency = wle.apply_wle_for_datasets(dataset_parts, cutoff_wle, n_hop)
dataset_parts = dataset_parts_expand
num_expanded_symbols = len(labels_expanded)
print("WLE Expanded Labels Applied to datasets: vocab=", num_expanded_symbols)
print(labels_expanded)
# save in text
file_name = "WLE_labels.dat"
path = os.path.join(cache_dir, file_name)
with open(path, "w") as fout:
for label in labels_expanded:
fout.write(label + " " + str(labels_frequency[label]) + "\n")
# save binaries
file_name = "WLE_labels.pkl"
outfile = cache_dir + "/" + file_name
with open(outfile, "wb") as fout:
pickle.dump( (labels_expanded, labels_frequency), fout)
elif apply_cwle_flag:
dataset_parts_expand, labels_expanded, labels_frequency = wle.apply_cwle_for_datasets(dataset_parts, n_hop)
dataset_parts = dataset_parts_expand
num_expanded_symbols = len(labels_expanded)
print("Concatenating WLE Expanded Labels Applied to datasets: vocab=", num_expanded_symbols)
print(labels_expanded)
# save in text
file_name = "CWLE_labels.dat"
path = os.path.join(cache_dir, file_name)
with open(path, "w") as fout:
for label in labels_expanded:
fout.write(label + " " + str(labels_frequency[label]) + "\n")
# save binaries
file_name = "CWLE_labels.pkl"
outfile = cache_dir + "/" + file_name
with open(outfile, "wb") as fout:
pickle.dump( (labels_expanded, labels_frequency), fout)
elif apply_gwle_flag:
dataset_parts_expand, labels_expanded, labels_frequency = wle.apply_cwle_for_datasets(dataset_parts, n_hop)
dataset_parts = dataset_parts_expand
num_expanded_symbols = len(labels_expanded)
print("Gated-sum WLE Expanded Labels Applied to datasets: vocab=", num_expanded_symbols)
print(labels_expanded)
# save in text
file_name = "GWLE_labels.dat"
path = os.path.join(cache_dir, file_name)
with open(path, "w") as fout:
for label in labels_expanded:
fout.write(label + " " + str(labels_frequency[label]) + "\n")
# save binaries
file_name = "GWLE_labels.pkl"
outfile = cache_dir + "/" + file_name
with open(outfile, "wb") as fout:
pickle.dump( (labels_expanded, labels_frequency), fout)
else:
labels_expanded = []
# ToDO: scaler should be placed here
# ToDo: fit the scaler
# ToDo: transform dataset_parts[0-2]
for i, part in enumerate(['train', 'valid', 'test']):
filename = dataset_part_filename(part, num_data)
path = os.path.join(cache_dir, filename)
if False:
print(type(dataset_parts[i]))
print(type(dataset_parts[i][0]))
print(type(dataset_parts[i][0][0]))
print(type(dataset_parts[i][0][1]))
print(type(dataset_parts[i][0][2]))
print(dataset_parts[i][0][0].shape)
print(dataset_parts[i][0][1].shape)
print(dataset_parts[i][0][2].shape)
print(dataset_parts[i][0][0].dtype)
print(dataset_parts[i][0][1].dtype)
print(dataset_parts[i][0][2].dtype)
NumpyTupleDataset.save(path, dataset_parts[i])
return dataset_parts
def fit_scaler(datasets):
"""Standardizes (scales) the dataset labels.
Args:
datasets: Tuple containing the datasets.
Returns:
Datasets with standardized labels and the scaler object.
"""
scaler = StandardScaler()
# Collect all labels in order to apply scaling over the entire dataset.
labels = None
offsets = []
for dataset in datasets:
if labels is None:
labels = dataset.get_datasets()[-1]
else:
labels = numpy.vstack([labels, dataset.get_datasets()[-1]])
offsets.append(len(labels))
scaler.fit(labels)
return scaler
def main():
args = parse_arguments()
print(args)
# Set up some useful variables that will be used later on.
dataset_name = args.dataset
method = args.method
num_data = args.num_data
n_unit = args.unit_num
conv_layers = args.conv_layers
adam_alpha = args.adam_alpha
cutoff_wle = args.cutoff_wle
n_hop = args.hop_num
apply_wle_flag = method in ['nfp_wle', 'ggnn_wle', 'relgat_wle', 'relgcn_wle', 'rsgcn_wle', 'gin_wle']
apply_cwle_flag = method in ['nfp_cwle', 'ggnn_cwle', 'relgat_cwle', 'relgcn_cwle', 'rsgcn_cwle', 'gin_cwle']
apply_gwle_flag = method in ['nfp_gwle', 'ggnn_gwle', 'relgat_gwle', 'relgcn_gwle', 'rsgcn_gwle', 'gin_gwle']
task_type = molnet_default_config[dataset_name]['task_type']
model_filename = {'classification': 'classifier.pkl',
'regression': 'regressor.pkl'}
print('Using dataset: {}...'.format(dataset_name))
# Set up some useful variables that will be used later on.
if args.label:
labels = args.label
cache_dir = os.path.join('input', '{}_{}_{}'.format(dataset_name,
method, labels))
class_num = len(labels) if isinstance(labels, list) else 1
else:
labels = None
cache_dir = os.path.join('input', '{}_{}_all'.format(dataset_name,
method))
class_num = len(molnet_default_config[args.dataset]['tasks'])
# Load the train and validation parts of the dataset.
filenames = [dataset_part_filename(p, num_data)
for p in ['train', 'valid', 'test']]
# ToDo: We need to incoporeat scaler into download_entire_dataset, instead of predictors.
paths = [os.path.join(cache_dir, f) for f in filenames]
if all([os.path.exists(path) for path in paths]):
dataset_parts = []
for path in paths:
print('Loading cached dataset from {}.'.format(path))
dataset_parts.append(NumpyTupleDataset.load(path))
else:
dataset_parts = download_entire_dataset(dataset_name, num_data, labels,
method, cache_dir,
apply_wle_flag, cutoff_wle, apply_cwle_flag, apply_gwle_flag, n_hop)
train, valid = dataset_parts[0], dataset_parts[1]
# ToDo: scaler must be incorporated into download_entire_datasets. not here
# Scale the label values, if necessary.
scaler = None
if args.scale == 'standardize':
if task_type == 'regression':
print('Applying standard scaling to the labels.')
scaler = fit_scaler(dataset_parts)
else:
print('Label scaling is not available for classification tasks.')
else:
print('No label scaling was selected.')
# ToDo: set label_scaler always None
# Set up the predictor.
if apply_wle_flag:
# find the num_atoms
max_symbol_index = wle.findmaxidx(dataset_parts)
print("number of expanded symbols (WLE) = ", max_symbol_index)
predictor = set_up_predictor(
method, n_unit, conv_layers, class_num,
label_scaler=scaler, n_atom_types=max_symbol_index)
elif apply_cwle_flag or apply_gwle_flag:
n_wle_types = wle.findmaxidx(
dataset_parts, 'wle_label')
# Kenta Oono (oono@preferred.jp)
# In the previous implementation, we use MAX_WLE_NUM
# as the dimension of one-hot vectors for WLE labels
# when the model is CWLE or WLNE and hop_num k = 1.
# When k >= 2, # of wle labels can be larger than MAX_WLE_NUM,
# which causes an error.
# Therefore, we have increased the dimension of vectors.
# To align with the previous experiments,
# we change n_wle_types only if it exceeds MAX_WLE_NUM.
n_wle_types = max(n_wle_types, MAX_WLE_NUM)
print("number of expanded symbols (CWLE/GWLE) = ", n_wle_types)
predictor = set_up_predictor(
method, n_unit, conv_layers, class_num,
label_scaler=scaler, n_wle_types=n_wle_types)
else:
predictor = set_up_predictor(
method, n_unit, conv_layers, class_num,
label_scaler=scaler)
# Set up the iterators.
train_iter = iterators.SerialIterator(train, args.batchsize)
valid_iter = iterators.SerialIterator(valid, args.batchsize, repeat=False,
shuffle=False)
# Load metrics for the current dataset.
metrics = molnet_default_config[dataset_name]['metrics']
metrics_fun = {k: v for k, v in metrics.items()
if isinstance(v, types.FunctionType)}
loss_fun = molnet_default_config[dataset_name]['loss']
device = chainer.get_device(args.device)
if task_type == 'regression':
model = Regressor(predictor, lossfun=loss_fun,
metrics_fun=metrics_fun, device=device)
elif task_type == 'classification':
model = Classifier(predictor, lossfun=loss_fun,
metrics_fun=metrics_fun, device=device)
else:
raise ValueError('Invalid task type ({}) encountered when processing '
'dataset ({}).'.format(task_type, dataset_name))
# Set up the optimizer.
optimizer = optimizers.Adam(alpha=adam_alpha)
optimizer.setup(model)
# Save model-related output to this directory.
if not os.path.exists(args.out):
os.makedirs(args.out)
save_json(os.path.join(args.out, 'args.json'), vars(args))
model_dir = os.path.join(args.out, os.path.basename(cache_dir))
if not os.path.exists(model_dir):
os.makedirs(model_dir)
# Set up the updater.
converter = converter_method_dict[method]
updater = training.StandardUpdater(train_iter, optimizer, device=device,
converter=converter)
# Set up the trainer.
trainer = training.Trainer(updater, (args.epoch, 'epoch'), out=model_dir)
trainer.extend(E.Evaluator(valid_iter, model, device=device,
converter=converter))
trainer.extend(E.snapshot(), trigger=(args.epoch, 'epoch'))
trainer.extend(E.LogReport())
# TODO: consider go/no-go of the following block
# # (i) more reporting for val/evalutaion
# # (ii) best validation score snapshot
# if task_type == 'regression':
# metric_name_list = list(metrics.keys())
# if 'RMSE' in metric_name_list:
# trainer.extend(E.snapshot_object(model, "best_val_" + model_filename[task_type]),
# trigger=training.triggers.MinValueTrigger('validation/main/RMSE'))
# elif 'MAE' in metric_name_list:
# trainer.extend(E.snapshot_object(model, "best_val_" + model_filename[task_type]),
# trigger=training.triggers.MinValueTrigger('validation/main/MAE'))
# else:
# print("[WARNING] No validation metric defined?")
#
# elif task_type == 'classification':
# train_eval_iter = iterators.SerialIterator(
# train, args.batchsize, repeat=False, shuffle=False)
# trainer.extend(ROCAUCEvaluator(
# train_eval_iter, predictor, eval_func=predictor,
# device=args.gpu, converter=concat_mols, name='train',
# pos_labels=1, ignore_labels=-1, raise_value_error=False))
# # extension name='validation' is already used by `Evaluator`,
# # instead extension name `val` is used.
# trainer.extend(ROCAUCEvaluator(
# valid_iter, predictor, eval_func=predictor,
# device=args.gpu, converter=concat_mols, name='val',
# pos_labels=1, ignore_labels=-1, raise_value_error=False))
#
# trainer.extend(E.snapshot_object(
# model, "best_val_" + model_filename[task_type]),
# trigger=training.triggers.MaxValueTrigger('val/main/roc_auc'))
# else:
# raise NotImplementedError(
# 'Not implemented task_type = {}'.format(task_type))
trainer.extend(AutoPrintReport())
trainer.extend(E.ProgressBar())
trainer.run()
# Save the model's parameters.
model_path = os.path.join(model_dir, model_filename[task_type])
print('Saving the trained model to {}...'.format(model_path))
model.save_pickle(model_path, protocol=args.protocol)
# dump the parameter, if CWLE
#if apply_cwle_flag:
# cwle = predictor.graph_conv
# #print(cwle)
# concatW = cwle.linear_for_concat_wle.W.data
# #print(type(concatW))
#
# # dump the raw W
# out_prefix = args.out + "/" + method + "_" + dataset_name +"_learnedW"
# with open(out_prefix + ".dat", 'w') as fout:
# import csv
# writer = csv.writer(fout, lineterminator="\n")
# writer.writerows(concatW)
# # end with
#
# import matplotlib
# matplotlib.use('Agg')
# import matplotlib.pyplot as plt
# # visualize
# fig1, ax1 = plt.subplots()
# plt.imshow(concatW, cmap="jet")
# plt.colorbar(ax=ax1)
#
# plt.title('Learned W on ' + dataset_name + ' + ' + method)
# plt.savefig(out_prefix + ".png")
# plt.savefig(out_prefix + ".pdf")
#
# # visualize the absolute value
# fig2, ax2 = plt.subplots()
# plt.imshow(numpy.abs(concatW), cmap="jet")
# plt.colorbar(ax=ax2)
#
# plt.title('Learned abs(W) on ' + dataset_name + ' + ' + method)
# plt.savefig(out_prefix + "_abs.png")
# plt.savefig(out_prefix + "_abs.pdf")
if __name__ == '__main__':
main()
================================================
FILE: examples/network_graph/README.md
================================================
# Network Node Classification Example
This example performs semi-supervised node classification.
## Dependencies
Before running the example, the following packages also need to be installed:
- [`matplotlib`](https://matplotlib.org/)
- [`seaborn`](https://seaborn.pydata.org/)
- [`scikit-learn`](http://scikit-learn.org/stable/)
## Supported dataset
- [Cora](https://linqs-data.soe.ucsc.edu/public/lbc/cora.tgz)
- [Citeseer](https://linqs-data.soe.ucsc.edu/public/lbc/citeseer.tgz)
- [Reddit](https://s3.us-east-2.amazonaws.com/dgl.ai/dataset/reddit.zip)
- we use the dataset provided by [dmlc/dgl](https://github.com/dmlc/dgl/blob/master/python/dgl/data/reddit.py) repository.
Note that dataset is downloaded automatically.
## How to run the code
### Train a model
To train a model, run the following:
On the CPU:
```angular2html
python train_network_graph.py --dataset cora
```
Train sparse model with GPU:
```angular2html
python train_network_graph.py --dataset cora --device 0 --method gin_sparse
```
### Train a model with reddit dataset
reddit dataset contains, it can run only with specific configuration.
Please turn on coo option to run training of reddit dataset.
```angular2html
python train_network_graph.py --dataset reddit --device 0 --method gin --coo true
```
================================================
FILE: examples/network_graph/citeseer/.gitignore
================================================
citeseer.cites
citeseer.content
README
================================================
FILE: examples/network_graph/cora/.gitignore
================================================
cora.cites
cora.content
README
================================================
FILE: examples/network_graph/padding_model_wrapper.py
================================================
import chainer
from chainer_chemistry.dataset.graph_dataset.base_graph_data import PaddingGraphData # NOQA
class PaddingModelWrapper(chainer.Chain):
def __init__(self, predictor):
super(PaddingModelWrapper, self).__init__()
with self.init_scope():
self.predictor = predictor
def forward(self, data):
assert isinstance(data, PaddingGraphData)
return self.predictor(data.x, data.adj)
================================================
FILE: examples/network_graph/reddit/.gitignore
================================================
reddit.zip
reddit_data.npz
reddit_graph.npz
================================================
FILE: examples/network_graph/train_network_graph.py
================================================
import argparse
from distutils.util import strtobool
import numpy
from chainer_chemistry.datasets.citation_network.citation import citation_to_networkx # NOQA
from chainer_chemistry.datasets.citation_network.citeseer import \
get_citeseer_dirpath
from chainer_chemistry.datasets.citation_network.cora import get_cora_dirpath
from chainer_chemistry.datasets.reddit.reddit import reddit_to_networkx, \
get_reddit_dirpath
from chainer_chemistry.dataset.networkx_preprocessors.base_networkx import BasePaddingNetworkxPreprocessor, BaseSparseNetworkxPreprocessor # NOQA
from chainer_chemistry.dataset.graph_dataset.base_graph_data import PaddingGraphData # NOQA
from chainer_chemistry.utils.train_utils import run_node_classification_train
from chainer_chemistry.models.prediction.node_classifier import NodeClassifier
from chainer_chemistry.models.gin import GINSparse, GIN
from chainer_chemistry.dataset.networkx_preprocessors.reddit_coo import get_reddit_coo_data # NOQA
from padding_model_wrapper import PaddingModelWrapper # NOQA
def get_cora():
return citation_to_networkx(get_cora_dirpath(), "cora")
def get_citeseer():
return citation_to_networkx(get_citeseer_dirpath(), "citeseer")
def get_reddit():
return reddit_to_networkx(get_reddit_dirpath())
dataset_dict = {
'cora': get_cora,
'citeseer': get_citeseer,
'reddit': get_reddit,
}
method_dict = {
'gin': GIN,
'gin_sparse': GINSparse,
}
preprocessor_dict = {
'gin': BasePaddingNetworkxPreprocessor,
'gin_sparse': BaseSparseNetworkxPreprocessor,
}
def parse_arguments():
# Lists of supported preprocessing methods/models.
dataset_list = ['cora', 'citeseer', 'reddit']
method_list = ['gin', 'gin_sparse']
# Set up the argument parser.
parser = argparse.ArgumentParser(
description='Node classification on network a graph')
parser.add_argument('--dataset', type=str, choices=dataset_list,
default='cora', help='dataset name')
parser.add_argument('--method', '-m', type=str, choices=method_list,
default='gin_sparse', help='method name')
parser.add_argument('--conv-layers', '-c', type=int, default=2,
help='number of convolution layers')
parser.add_argument(
'--device', '-d', type=str, default='-1',
help='Device specifier. Either ChainerX device specifier or an '
'integer. If non-negative integer, CuPy arrays with specified '
'device id are used. If negative integer, NumPy arrays are used')
parser.add_argument('--out', '-o', type=str, default='result',
help='path to save the computed model to')
parser.add_argument('--epoch', '-e', type=int, default=20,
help='number of epochs')
parser.add_argument('--unit-num', '-u', type=int, default=32,
help='number of units in one layer of the model')
parser.add_argument('--seed', '-s', type=int, default=777,
help='random seed value')
parser.add_argument('--train-data-ratio', '-r', type=float, default=0.2,
help='ratio of training data w.r.t the dataset')
parser.add_argument('--dropout', type=float, default=0.0,
help='dropout ratio')
parser.add_argument('--coo', type=strtobool, default='false',
help='use Coo matrix')
return parser.parse_args()
def generate_random_mask(n, train_num, seed=777):
numpy.random.seed(seed)
mask = numpy.zeros(n, dtype=bool)
mask[:train_num] = True
numpy.random.shuffle(mask)
return mask, numpy.logical_not(mask) # (train_mask, val_mask)
if __name__ == '__main__':
args = parse_arguments()
if args.dataset == 'reddit' and args.coo:
# because it takes time to load reddit coo data via networkx
data = get_reddit_coo_data(get_reddit_dirpath())
else:
networkx_graph = dataset_dict[args.dataset]()
preprocessor = preprocessor_dict[args.method](use_coo=args.coo)
data = preprocessor.construct_data(networkx_graph)
print('label num: {}'.format(data.label_num))
gnn = method_dict[args.method](out_dim=None, node_embedding=True,
out_channels=data.label_num,
hidden_channels=args.unit_num,
n_update_layers=args.conv_layers,
dropout_ratio=args.dropout)
if isinstance(data, PaddingGraphData):
gnn = PaddingModelWrapper(gnn)
predictor = NodeClassifier(gnn, device=args.device)
train_label_num = int(data.n_nodes * args.train_data_ratio)
train_mask, valid_mask = generate_random_mask(
data.n_nodes, train_label_num)
print("train label: {}, validation label: {}".format(
train_label_num, data.n_nodes - train_label_num))
run_node_classification_train(
predictor, data, train_mask, valid_mask,
epoch=args.epoch, device=args.device)
================================================
FILE: examples/own_dataset/README.md
================================================
# Example of using your own dataset
This example shows how to train models with your own dataset stored in the CSV format.
A regression task is performed using [`Regressor`](http://chainer-chemistry.readthedocs.io/en/stable/generated/chainer_chemistry.models.Regressor.html#chainer_chemistry.models.Regressor). For a classification setting that makes use of [`Classifier`](http://chainer-chemistry.readthedocs.io/en/stable/generated/chainer_chemistry.models.Classifier.html#chainer_chemistry.models.Classifier),
please refer to the `tox21` example.
## Dependencies
Before running the example, the following packages also need to be installed:
- [`matplotlib`](https://matplotlib.org/)
- [`seaborn`](https://seaborn.pydata.org/)
- [`scikit-learn`](http://scikit-learn.org/stable/)
## How to run the code
### Dataset preparation
Prepare a CSV file containing the training data samples, one per row. Each row contains the SMILES string of one molecule, followed by the (label) values of the molecule's desired properties. The first line of the CSV file contains label names.
Below you can find an example:
```
SMILES,value1,value2
CC1CC1CN1CC1C,-0.2190999984741211,0.08590000122785568
C#CCC(=N)OC=O,-0.2750999927520752,-0.032999999821186066
Cc1cnc(C=O)n1C,-0.23080000281333923,-0.053700000047683716
N=COCC(C=O)CO,-0.26260000467300415,-0.043699998408555984
[...]
```
Save one CSV file for training (e.g., `dataset_train.csv`) and one for testing (e.g., `dataset_test.csv`). Then pass them to the training and testing scripts, as shown below.
### Train a model
To train a new model, run the following:
```
python train_own_dataset.py --datafile dataset_train.csv --label value1 value2
```
The `--label` option specifies which columns in `dataset_train.csv` are trained.
Type `python train_own_dataset.py --help` to see the complete set of options.
### Inference using a pretrained model
To perform inference using a pretrained model, run the following:
```
python predict_own_dataset.py --datafile dataset_test.csv --label value1 value2
```
Type `python test_own_dataset.py --help` to see the complete set of options.
### Evaluation of implemented models
To evaluate the performance of the currently implemented models, run the following:
```
bash evaluate_own_dataset.sh [gpu_id] [epoch]
```
where `gpu_id` is the identifier of your GPU and `epoch` is the number of training epochs.
To run the code on CPU, set `gpu_id` to `-1`.
The scripts start the training process. Inference is then performed and evaluation metrics are reported.
For regression tasks (such as the current example), these are MAE and RMSE.
One plot per metric is created (saved as `eval_[metric]_own.png` in the example directory), which outputs these values as reported by the different models.
================================================
FILE: examples/own_dataset/dataset_test.csv
================================================
SMILES,value1,value2
CC1CC1CN1CC1C,-0.2190999984741211,0.08590000122785568
C#CCC(=N)OC=O,-0.2750999927520752,-0.032999999821186066
Cc1cnc(C=O)n1C,-0.23080000281333923,-0.053700000047683716
N=COCC(C=O)CO,-0.26260000467300415,-0.043699998408555984
CC1=C2CC3C(C1)C23C,-0.19580000638961792,-0.022700000554323196
CC1C=CCC(C)C1O,-0.2443999946117401,0.019099999219179153
C1c2n[nH]nc2C2CN12,-0.23350000381469727,-0.011800000444054604
COC1(C#N)CCC1C,-0.27480000257492065,0.02250000089406967
N=CNC(=O)C1CCO1,-0.25049999356269836,-0.020800000056624413
O=CC1(O)COC1=O,-0.27869999408721924,-0.06939999759197235
================================================
FILE: examples/own_dataset/dataset_train.csv
================================================
SMILES,value1,value2
CC1=CC2CC(CC1)O2,-0.227400004863739,0.010400000028312206
O=Cc1nccn1C=O,-0.2678000032901764,-0.09380000084638596
CCC(C)(C)C(O)C=O,-0.2685000002384186,-0.038100000470876694
C#CCC(C)(CO)OC,-0.2535000145435333,0.044599998742341995
Nc1coc(=O)nc1N,-0.2303999960422516,-0.04170000180602074
CC12C=CC(CCC1)C2,-0.2312999963760376,0.02239999920129776
CC12CCC1C2OC=O,-0.2605000138282776,0.005400000140070915
CC1C2CC3(COC3)N12,-0.23430000245571136,0.0697999969124794
O=C1NC=NC12CC2,-0.24070000648498535,-0.017000000923871994
C1=CC2CN2CC2NC12,-0.22169999778270721,0.007699999958276749
CC1C2COCC12O,-0.2467000037431717,0.07410000264644623
CC(=O)C1OCOC1=O,-0.2590000033378601,-0.042500000447034836
CC1N2C3CC1(C)C32,-0.2295999974012375,0.0835999995470047
CC1=CC2OC2(C#N)C1,-0.25999999046325684,-0.019899999722838402
OC1CCC1,-0.25600001215934753,0.08009999990463257
C#CC1(O)COC1C#N,-0.2849000096321106,-0.01769999973475933
CC1(C#N)CC12CCC2,-0.2685000002384186,0.03460000082850456
CCCC(N)(C#N)CO,-0.25760000944137573,0.028999999165534973
NC1=NC2(CC2)CC1=O,-0.22470000386238098,-0.053700000047683716
C#CC12C3CC1(C)OC32,-0.2273000031709671,0.026900000870227814
CC(C)C#CCC=O,-0.24539999663829803,-0.02669999934732914
CC#CC(C=O)CC,-0.24169999361038208,-0.02539999969303608
CC1OC2C1=CC1OC12,-0.2485000044107437,-0.01769999973475933
CNC(=N)C(C#N)OC,-0.23420000076293945,-0.0013000000035390258
C#CC(C#C)OCC=O,-0.26100000739097595,-0.031599998474121094
CN1CC(O)C12CC2,-0.20479999482631683,0.08730000257492065
OC1C2C3OC4C1C2C34,-0.24469999969005585,0.04230000078678131
OCC1C(O)C2CC12O,-0.24169999361038208,0.05739999935030937
O=C([O-])C12[NH2+]CC1C2O,-0.2508000135421753,-0.0003000000142492354
Cn1cc(O)c(CO)n1,-0.2045000046491623,0.01850000023841858
O=C1COC2C3OC2C13,-0.2498999983072281,-0.03700000047683716
C1#CCCOC=NCC1,-0.24279999732971191,0.012600000016391277
O=c1ocncc1CO,-0.2563000023365021,-0.06289999932050705
CC1NC1C(O)C(N)=O,-0.2547999918460846,0.023800000548362732
CC1OC(=N)CC2CC21,-0.2498999983072281,0.032499998807907104
OC12CCC3CN3C1C2,-0.21709999442100525,0.07280000299215317
C#CC(CCO)OC,-0.2581999897956848,0.033900000154972076
CCC1COC(CO)=N1,-0.2540999948978424,0.019200000911951065
ON=C1C=CC2C(O)C12,-0.2184000015258789,-0.04349999874830246
CN=c1cconn1,-0.23919999599456787,-0.037700001150369644
CC1(C)CC2CC2C1O,-0.2540999948978424,0.066600002348423
CCC1CCC(=N)O1,-0.2526000142097473,0.032600000500679016
O=C1C2CCC1C1NC21,-0.2282000035047531,-0.00279999990016222
CCOc1ccc(C)o1,-0.19059999287128448,0.033799998462200165
O=C1C2CC3C4C2C1N34,-0.23479999601840973,-0.026100000366568565
O=C1C=CCC=CC1=O,-0.24130000174045563,-0.08780000358819962
Cc1cc(F)c[nH]c1=O,-0.2117999941110611,-0.042100001126527786
CC1=CCc2nocc21,-0.22419999539852142,-0.019200000911951065
N#CC1(O)CN=COC1,-0.26980000734329224,-0.002400000113993883
Nc1n[nH]cc1N1CC1,-0.18649999797344208,0.03739999979734421
CN1C2CC3(O)C1C23C,-0.19619999825954437,0.07779999822378159
N=c1nccco1,-0.23680000007152557,-0.0689999982714653
COC12COC1(C)C2C,-0.22339999675750732,0.07020000368356705
CCOC1COC(=N)O1,-0.2547000050544739,0.0560000017285347
COC1(C(N)=O)CC1,-0.23800000548362732,0.0284000001847744
C#CCC#CC1NC1C,-0.23970000445842743,0.03180000185966492
C1NC1CN1C2CCC21,-0.2379000037908554,0.06539999693632126
CC(O)c1cc(N)[nH]n1,-0.21449999511241913,0.029899999499320984
CC1(O)C(O)C1C=O,-0.24230000376701355,-0.022099999710917473
C#CC1(C)C2C3OC3C21,-0.23819999396800995,0.025800000876188278
c1c[nH]c2cccc-2c1,-0.17229999601840973,-0.037300001829862595
CCC1(O)C(C)C1C=O,-0.24089999496936798,-0.01810000091791153
C1=C2C(CC1)CC1NC21,-0.2231999933719635,0.01940000057220459
C#CC1C2C(O)C1C2O,-0.24420000612735748,0.041999999433755875
CC1(C)CN2CC(C2)O1,-0.2093999981880188,0.07599999755620956
CC1OC1C1C2CN1C2,-0.22990000247955322,0.08429999649524689
CC(=O)C12CC(=O)C1C2,-0.25049999356269836,-0.04270000010728836
CC12C3=NCC1CC2O3,-0.23119999468326569,-0.016599999740719795
c1cc2onnc2[nH]1,-0.23520000278949738,-0.042399998754262924
O=CCCC1OC2CC12,-0.24369999766349792,-0.01850000023841858
OCCC1C2C3CC3N12,-0.2175000011920929,0.06040000170469284
OCC#CC1CC1,-0.23720000684261322,0.03359999880194664
OC1C2CC3C1N1C2C31,-0.22709999978542328,0.0640999972820282
CC1(C=O)C=CC(=O)N1,-0.25369998812675476,-0.05649999901652336
CC1CC23CC12CCO3,-0.20999999344348907,0.08139999955892563
CC(O)(C(N)=O)C1CO1,-0.24469999969005585,0.02889999933540821
CC1=NC2(CC2)C(=N)N1,-0.2134999930858612,0.0024999999441206455
N#CCCC(=O)C(N)=O,-0.25949999690055847,-0.08160000294446945
CC(O)(C#N)COC=N,-0.27379998564720154,0.00570000009611249
CC12C=CC(C)(N1)C2O,-0.22859999537467957,-0.0012000000569969416
CC12COC1CCO2,-0.2468000054359436,0.07940000295639038
c1noc2c1CCOC2,-0.24819999933242798,-0.010700000450015068
C#CC1CCCCOC1,-0.2467000037431717,0.053599998354911804
CN1C2C3OC2(C=O)C31,-0.23469999432563782,-0.04619999974966049
CCn1cc(O)nn1,-0.22519999742507935,0.0013000000035390258
CCOC(=NC)C(C)=O,-0.23420000076293945,-0.05640000104904175
CC12CC1(C#N)C1CC12,-0.26750001311302185,0.02070000022649765
CC(=O)C1OC1CC=O,-0.251800000667572,-0.04360000044107437
Nc1cc(=O)cno1,-0.23770000040531158,-0.053700000047683716
O=C1CC=CCC1O,-0.25519999861717224,-0.027300000190734863
================================================
FILE: examples/own_dataset/evaluate_own_dataset.sh
================================================
#!/usr/bin/env bash
set -e
# List of available graph convolution methods.
methods=(nfp ggnn schnet weavenet rsgcn relgcn relgat megnet)
# device identifier; set it to -1 to train on the CPU (default).
device=${1:--1}
# Number of training epochs (default: 1).
epoch=${2:-1}
for method in ${methods[@]}
do
# Train with the current method.
python train_own_dataset.py \
--method ${method} \
--label value1 \
--conv-layers 1 \
--device ${device} \
--epoch ${epoch} \
--unit-num 10 \
--out eval_${method}
# Run inference on the test set.
python predict_own_dataset.py \
--method ${method} \
--label value1 \
--conv-layers 1 \
--device ${device} \
--epoch ${epoch} \
--unit-num 10 \
--in-dir eval_${method} \
--out eval_${method}
done
# Create plot showing the evaluation performance.
python plot.py --prefix eval_ --methods ${methods[@]}
================================================
FILE: examples/own_dataset/plot.py
================================================
#!/usr/bin/env python
import argparse
import json
import matplotlib.pyplot as plt
import os
import seaborn as sns
def save_evaluation_plot(x, y, metric, filename):
plt.figure()
sns.set()
ax = sns.barplot(y=x, x=y)
for n, (label, _y) in enumerate(zip(x, y)):
ax.annotate(
'{:.3f}'.format(abs(_y)),
xy=(_y, n),
ha='right',
va='center',
xytext=(-5, 0),
textcoords='offset points',
color='white')
plt.title('Performance on own dataset')
plt.xlabel(metric)
plt.savefig(filename)
def main():
parser = argparse.ArgumentParser()
parser.add_argument('--prefix', required=True)
parser.add_argument('--methods', nargs='+', required=True)
args = parser.parse_args()
metrics = ['mean_abs_error', 'root_mean_sqr_error']
x = args.methods
y = {metric: [] for metric in metrics}
for method in args.methods:
with open(os.path.join(args.prefix + method, 'eval_result.json')) as f:
result = json.load(f)
for metric in metrics:
y[metric].append(result['main/' + metric])
for metric in metrics:
save_evaluation_plot(
x, y[metric], metric, 'eval_' + metric + '_own.png')
if __name__ == "__main__":
main()
================================================
FILE: examples/own_dataset/predict_own_dataset.py
================================================
#!/usr/bin/env python
from __future__ import print_function
import chainer
import numpy
import os
from argparse import ArgumentParser
from chainer.iterators import SerialIterator
from chainer.training.extensions import Evaluator
from chainer_chemistry.models.prediction import Regressor
from chainer_chemistry.dataset.parsers import CSVFileParser
from chainer_chemistry.dataset.converters import converter_method_dict
from chainer_chemistry.dataset.preprocessors import preprocess_method_dict
# These imports are necessary for pickle to work.
from chainer_chemistry.links.scaler.standard_scaler import StandardScaler # NOQA
from chainer_chemistry.models.prediction import GraphConvPredictor # NOQA
from chainer_chemistry.utils import save_json
from train_own_dataset import rmse
def parse_arguments():
# Lists of supported preprocessing methods/models.
method_list = ['nfp', 'ggnn', 'schnet', 'weavenet', 'rsgcn', 'relgcn',
'relgat', 'megnet']
scale_list = ['standardize', 'none']
# Set up the argument parser.
parser = ArgumentParser(description='Regression on own dataset')
parser.add_argument('--datafile', '-d', type=str,
default='dataset_test.csv',
help='csv file containing the dataset')
parser.add_argument('--method', '-m', type=str, choices=method_list,
help='method name', default='nfp')
parser.add_argument('--label', '-l', nargs='+',
default=['value1', 'value2'],
help='target label for regression')
parser.add_argument('--scale', type=str, choices=scale_list,
help='label scaling method', default='standardize')
parser.add_argument('--conv-layers', '-c', type=int, default=4,
help='number of convolution layers')
parser.add_argument('--batchsize', '-b', type=int, default=32,
help='batch size')
parser.add_argument(
'--device', type=str, default='-1',
help='Device specifier. Either ChainerX device specifier or an '
'integer. If non-negative integer, CuPy arrays with specified '
'device id are used. If negative integer, NumPy arrays are used')
parser.add_argument('--out', '-o', type=str, default='result',
help='path to save the computed model to')
parser.add_argument('--epoch', '-e', type=int, default=10,
help='number of epochs')
parser.add_argument('--unit-num', '-u', type=int, default=16,
help='number of units in one layer of the model')
parser.add_argument('--protocol', type=int, default=2,
help='pickle protocol version')
parser.add_argument('--in-dir', '-i', type=str, default='result',
help='directory containing the saved model')
parser.add_argument('--model-filename', type=str, default='regressor.pkl',
help='saved model filename')
return parser.parse_args()
def main():
# Parse the arguments.
args = parse_arguments()
if args.label:
labels = args.label
else:
raise ValueError('No target label was specified.')
# Dataset preparation.
def postprocess_label(label_list):
return numpy.asarray(label_list, dtype=numpy.float32)
print('Preprocessing dataset...')
preprocessor = preprocess_method_dict[args.method]()
parser = CSVFileParser(preprocessor, postprocess_label=postprocess_label,
labels=labels, smiles_col='SMILES')
dataset = parser.parse(args.datafile)['dataset']
test = dataset
print('Predicting...')
# Set up the regressor.
device = chainer.get_device(args.device)
model_path = os.path.join(args.in_dir, args.model_filename)
regressor = Regressor.load_pickle(model_path, device=device)
# Perform the prediction.
print('Evaluating...')
converter = converter_method_dict[args.method]
test_iterator = SerialIterator(test, 16, repeat=False, shuffle=False)
eval_result = Evaluator(test_iterator, regressor, converter=converter,
device=device)()
print('Evaluation result: ', eval_result)
save_json(os.path.join(args.in_dir, 'eval_result.json'), eval_result)
if __name__ == '__main__':
main()
================================================
FILE: examples/own_dataset/test_own_dataset.sh
================================================
#!/usr/bin/env bash
set -e
# device specifier given from first argument, default value is -1
device=${1:--1}
for method in nfp ggnn schnet weavenet rsgcn relgcn megnet
do
python train_own_dataset.py --datafile dataset_train.csv --method ${method} --label value1 --conv-layers 1 --device ${device} --epoch 1 --unit-num 10 --batchsize 32 --out eval_${method}
python predict_own_dataset.py --datafile dataset_test.csv --method ${method} --label value1 --conv-layers 1 --device ${device} --epoch 1 --unit-num 10 --in-dir eval_${method} --out eval_${method}
done
================================================
FILE: examples/own_dataset/train_own_dataset.py
================================================
#!/usr/bin/env python
from __future__ import print_function
import chainer
import numpy
import os
from argparse import ArgumentParser
from chainer.datasets import split_dataset_random
from chainer import functions as F
from chainer_chemistry.dataset.parsers import CSVFileParser
from chainer_chemistry.dataset.converters import converter_method_dict
from chainer_chemistry.dataset.preprocessors import preprocess_method_dict
from chainer_chemistry.links.scaler.standard_scaler import StandardScaler
from chainer_chemistry.models import Regressor
from chainer_chemistry.models.prediction import set_up_predictor
from chainer_chemistry.utils import run_train
def rmse(x0, x1):
return F.sqrt(F.mean_squared_error(x0, x1))
def parse_arguments():
# Lists of supported preprocessing methods/models.
method_list = ['nfp', 'ggnn', 'schnet', 'weavenet', 'rsgcn', 'relgcn',
'relgat', 'mpnn', 'gnnfilm', 'megnet']
scale_list = ['standardize', 'none']
# Set up the argument parser.
parser = ArgumentParser(description='Regression on own dataset')
parser.add_argument('--datafile', '-d', type=str,
default='dataset_train.csv',
help='csv file containing the dataset')
parser.add_argument('--method', '-m', type=str, choices=method_list,
help='method name', default='nfp')
parser.add_argument('--label', '-l', nargs='+',
default=['value1', 'value2'],
help='target label for regression')
parser.add_argument('--scale', type=str, choices=scale_list,
help='label scaling method', default='standardize')
parser.add_argument('--conv-layers', '-c', type=int, default=4,
help='number of convolution layers')
parser.add_argument('--batchsize', '-b', type=int, default=32,
help='batch size')
parser.add_argument(
'--device', type=str, default='-1',
help='Device specifier. Either ChainerX device specifier or an '
'integer. If non-negative integer, CuPy arrays with specified '
'device id are used. If negative integer, NumPy arrays are used')
parser.add_argument('--out', '-o', type=str, default='result',
help='path to save the computed model to')
parser.add_argument('--epoch', '-e', type=int, default=10,
help='number of epochs')
parser.add_argument('--unit-num', '-u', type=int, default=16,
help='number of units in one layer of the model')
parser.add_argument('--seed', '-s', type=int, default=777,
help='random seed value')
parser.add_argument('--train-data-ratio', '-r', type=float, default=0.7,
help='ratio of training data w.r.t the dataset')
parser.add_argument('--protocol', type=int, default=2,
help='pickle protocol version')
parser.add_argument('--model-filename', type=str, default='regressor.pkl',
help='saved model filename')
return parser.parse_args()
def main():
# Parse the arguments.
args = parse_arguments()
if args.label:
labels = args.label
class_num = len(labels) if isinstance(labels, list) else 1
else:
raise ValueError('No target label was specified.')
# Dataset preparation. Postprocessing is required for the regression task.
def postprocess_label(label_list):
return numpy.asarray(label_list, dtype=numpy.float32)
# Apply a preprocessor to the dataset.
print('Preprocessing dataset...')
preprocessor = preprocess_method_dict[args.method]()
parser = CSVFileParser(preprocessor, postprocess_label=postprocess_label,
labels=labels, smiles_col='SMILES')
dataset = parser.parse(args.datafile)['dataset']
# Scale the label values, if necessary.
if args.scale == 'standardize':
scaler = StandardScaler()
scaler.fit(dataset.get_datasets()[-1])
else:
scaler = None
# Split the dataset into training and validation.
train_data_size = int(len(dataset) * args.train_data_ratio)
train, _ = split_dataset_random(dataset, train_data_size, args.seed)
# Set up the predictor.
predictor = set_up_predictor(
args.method, args.unit_num,
args.conv_layers, class_num, label_scaler=scaler)
# Set up the regressor.
device = chainer.get_device(args.device)
metrics_fun = {'mae': F.mean_absolute_error, 'rmse': rmse}
regressor = Regressor(predictor, lossfun=F.mean_squared_error,
metrics_fun=metrics_fun, device=device)
print('Training...')
converter = converter_method_dict[args.method]
run_train(regressor, train, valid=None,
batch_size=args.batchsize, epoch=args.epoch,
out=args.out, extensions_list=None,
device=device, converter=converter,
resume_path=None)
# Save the regressor's parameters.
model_path = os.path.join(args.out, args.model_filename)
print('Saving the trained model to {}...'.format(model_path))
# TODO(nakago): ChainerX array cannot be sent to numpy array when internal
# state has gradients.
if hasattr(regressor.predictor.graph_conv, 'reset_state'):
regressor.predictor.graph_conv.reset_state()
regressor.save_pickle(model_path, protocol=args.protocol)
if __name__ == '__main__':
main()
================================================
FILE: examples/qm9/README.md
================================================
# QM9 Regression Example
This example performs regression on the QM9 dataset.
## Dependencies
Before running the example, the following packages also need to be installed:
- [`matplotlib`](https://matplotlib.org/)
- [`seaborn`](https://seaborn.pydata.org/)
- [`scikit-learn`](http://scikit-learn.org/stable/)
## How to run the code
### Train a model
To train a model, run the following:
On the CPU:
```angular2html
python train_qm9.py
```
On the GPU:
```angular2html
python train_qm9.py -g 0
```
### Inference using a pretrained model
As of v0.3.0, the `Regressor` class has been introduced, which provides the
`predict` method for easier inference. `Regressor` also supports the
`load_pickle` method, which allows for loading of a pretrained model, using the
`pickle` library.
The perform inference using a pretrained model, run the following:
On the CPU:
```
python predict_qm9.py [-i /path/to/training/result/directory]
```
On the GPU:
```
python predict_qm9.py -g 0 [-i /path/to/training/result/directory]
```
### Evaluation of implemented models
To evaluate the performance of the currently implemented models, run the
following:
On the CPU:
```
bash evaluate_models_qm9.sh -1 [epoch]
```
On the GPU:
```
bash evaluate_models_qm9.sh 0 [epoch]
```
This scripts start the training process for a number of `epoch` epochs per
model. Inference is then performed and evaluation metrics are reported. For
regression tasks (such as with QM9), these are MAE and RMSE. One plot per
metric is then createad (saved as `eval_[metric]_qm9.png` in the example
directory), which outputs these values as reported by the diffent models.
================================================
FILE: examples/qm9/evaluate_models_qm9.sh
================================================
set -eu
# List of available graph convolution methods.
methods=(nfp ggnn schnet weavenet rsgcn relgcn relgat megnet)
prefix=eval_
# device identifier; set it to -1 to train on the CPU (default).
device=${1:--1}
# Number of training epochs (default: 1).
epoch=${2:-1}
label=${3:-all}
echo evaluating label ${label}
for method in ${methods[@]}
do
result_dir=${prefix}${method}
python train_qm9.py \
--method ${method} \
--device ${device} \
--out ${result_dir} \
--epoch ${epoch} \
--label ${label}
python predict_qm9.py \
--in-dir ${result_dir} \
--method ${method} \
--label ${label}
done
python plot.py --prefix ${prefix} --methods ${methods[@]}
================================================
FILE: examples/qm9/plot.py
================================================
#! -*- coding: utf-8 -*-
import argparse
import json
from collections import defaultdict
import matplotlib.pyplot as plt
import os
import seaborn as sns
from chainer_chemistry.utils import load_json
def save_evaluation_plot(x, y, metric, filename):
plt.figure()
sns.set()
ax = sns.barplot(y=x, x=y)
for n, (label, _y) in enumerate(zip(x, y)):
ax.annotate(
s='{:.4g}'.format(abs(_y)),
xy=(_y, n),
ha='left',
va='center',
xytext=(5, 0),
textcoords='offset points',
color='gray')
plt.title('Performance on qm9: {}'.format(metric))
plt.xlabel(metric)
plt.savefig(filename)
plt.close()
def main():
parser = argparse.ArgumentParser()
parser.add_argument('--prefix', required=True)
parser.add_argument('--methods', nargs='+', required=True)
args = parser.parse_args()
x = args.methods
y = defaultdict(list)
for method in args.methods:
result = load_json(os.path.join(
args.prefix + method, 'eval_result_mae.json'))
for label, value in result.items():
y[label].append(value)
for label in y.keys():
save_evaluation_plot(
x, y[label], label, 'eval_qm9_{}_mae.png'.format(label))
if __name__ == "__main__":
main()
================================================
FILE: examples/qm9/predict_qm9.py
================================================
#!/usr/bin/env python
from __future__ import print_function
import argparse
import os
import chainer
import numpy
import pandas
from chainer.datasets import split_dataset_random
from chainer.iterators import SerialIterator
from chainer.training.extensions import Evaluator
from chainer_chemistry.dataset.converters import converter_method_dict
from chainer_chemistry.dataset.preprocessors import preprocess_method_dict
from chainer_chemistry import datasets as D
from chainer_chemistry.datasets import NumpyTupleDataset
from chainer_chemistry.models.prediction import Regressor
from chainer_chemistry.utils import save_json
# These import is necessary for pickle to work
from chainer_chemistry.links.scaler.standard_scaler import StandardScaler # NOQA
from chainer_chemistry.models.prediction.graph_conv_predictor import GraphConvPredictor # NOQA
from train_qm9 import rmse
def parse_arguments():
# Lists of supported preprocessing methods/models.
method_list = ['nfp', 'ggnn', 'schnet', 'weavenet', 'rsgcn', 'relgcn',
'relgat', 'gin', 'gnnfilm', 'relgcn_sparse', 'gin_sparse',
'nfp_gwm', 'ggnn_gwm', 'rsgcn_gwm', 'gin_gwm', 'megnet']
label_names = ['A', 'B', 'C', 'mu', 'alpha', 'homo', 'lumo', 'gap', 'r2',
'zpve', 'U0', 'U', 'H', 'G', 'Cv']
scale_list = ['standardize', 'none']
# Set up the argument parser.
parser = argparse.ArgumentParser(description='Regression on QM9.')
parser.add_argument('--method', '-m', type=str, choices=method_list,
help='method name', default='nfp')
parser.add_argument('--label', '-l', type=str,
choices=label_names + ['all'], default='all',
help='target label for regression; all means '
'predicting all properties at once')
parser.add_argument('--scale', type=str, choices=scale_list,
help='label scaling method', default='standardize')
parser.add_argument(
'--device', '-d', type=str, default='-1',
help='Device specifier. Either ChainerX device specifier or an '
'integer. If non-negative integer, CuPy arrays with specified '
'device id are used. If negative integer, NumPy arrays are used')
parser.add_argument('--seed', '-s', type=int, default=777,
help='random seed value')
parser.add_argument('--train-data-ratio', '-r', type=float, default=0.7,
help='ratio of training data w.r.t the dataset')
parser.add_argument('--in-dir', '-i', type=str, default='result',
help='directory to load model data from')
parser.add_argument('--model-filename', type=str, default='regressor.pkl',
help='saved model filename')
parser.add_argument('--num-data', type=int, default=-1,
help='amount of data to be parsed; -1 indicates '
'parsing all data.')
return parser.parse_args()
def main():
# Parse the arguments.
args = parse_arguments()
device = chainer.get_device(args.device)
# Set up some useful variables that will be used later on.
method = args.method
if args.label != 'all':
label = args.label
cache_dir = os.path.join('input', '{}_{}'.format(method, label))
labels = [label]
else:
labels = D.get_qm9_label_names()
cache_dir = os.path.join('input', '{}_all'.format(method))
# Get the filename corresponding to the cached dataset, based on the amount
# of data samples that need to be parsed from the original dataset.
num_data = args.num_data
if num_data >= 0:
dataset_filename = 'data_{}.npz'.format(num_data)
else:
dataset_filename = 'data.npz'
# Load the cached dataset.
dataset_cache_path = os.path.join(cache_dir, dataset_filename)
dataset = None
if os.path.exists(dataset_cache_path):
print('Loading cached data from {}.'.format(dataset_cache_path))
dataset = NumpyTupleDataset.load(dataset_cache_path)
if dataset is None:
print('Preprocessing dataset...')
preprocessor = preprocess_method_dict[method]()
if num_data >= 0:
# Select the first `num_data` samples from the dataset.
target_index = numpy.arange(num_data)
dataset = D.get_qm9(preprocessor, labels=labels,
target_index=target_index)
else:
# Load the entire dataset.
dataset = D.get_qm9(preprocessor, labels=labels)
# Cache the newly preprocessed dataset.
if not os.path.exists(cache_dir):
os.mkdir(cache_dir)
if isinstance(dataset, NumpyTupleDataset):
NumpyTupleDataset.save(dataset_cache_path, dataset)
# Use a predictor with scaled output labels.
model_path = os.path.join(args.in_dir, args.model_filename)
regressor = Regressor.load_pickle(model_path, device=device)
# Split the dataset into training and testing.
train_data_size = int(len(dataset) * args.train_data_ratio)
_, test = split_dataset_random(dataset, train_data_size, args.seed)
# This callback function extracts only the inputs and discards the labels.
# TODO(nakago): consider how to switch which `converter` to use.
if isinstance(dataset, NumpyTupleDataset):
converter = converter_method_dict[method]
@chainer.dataset.converter()
def extract_inputs(batch, device=None):
return converter(batch, device=device)[:-1]
# Extract the ground-truth labels as numpy array.
original_t = converter(test, device=-1)[-1]
else:
converter = dataset.converter
extract_inputs = converter
# Extract the ground-truth labels as numpy array.
original_t = converter(test, device=-1).y
# Predict the output labels.
print('Predicting...')
y_pred = regressor.predict(
test, converter=extract_inputs)
df_dict = {}
for i, l in enumerate(labels):
df_dict.update({'y_pred_{}'.format(l): y_pred[:, i],
't_{}'.format(l): original_t[:, i], })
df = pandas.DataFrame(df_dict)
# Show a prediction/ground truth table with 5 random examples.
print(df.sample(5))
n_eval = 10
for target_label in range(y_pred.shape[1]):
label_name = labels[target_label]
diff = y_pred[:n_eval, target_label] - original_t[:n_eval,
target_label]
print('label_name = {}, y_pred = {}, t = {}, diff = {}'
.format(label_name, y_pred[:n_eval, target_label],
original_t[:n_eval, target_label], diff))
# Run an evaluator on the test dataset.
print('Evaluating...')
test_iterator = SerialIterator(test, 16, repeat=False, shuffle=False)
eval_result = Evaluator(test_iterator, regressor, converter=converter,
device=device)()
print('Evaluation result: ', eval_result)
# Save the evaluation results.
save_json(os.path.join(args.in_dir, 'eval_result.json'), eval_result)
# Calculate mean abs error for each label
mae = numpy.mean(numpy.abs(y_pred - original_t), axis=0)
eval_result = {}
for i, l in enumerate(labels):
eval_result.update({l: mae[i]})
save_json(os.path.join(args.in_dir, 'eval_result_mae.json'), eval_result)
if __name__ == '__main__':
main()
================================================
FILE: examples/qm9/qm9_dataset_exploration.ipynb
================================================
{
"cells": [
{
"cell_type": "markdown",
"metadata": {},
"source": [
"## QM9 Dataset exploration"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"The purpose of this notebook is as follows,\n",
"\n",
" - Explain [QM9 dataset](http://quantum-machine.org/datasets/): Check the labels and visualization of molecules to understand what kind of data are stored.\n",
" - Explain internal structure of QM9 dataset in `chainer_chemistry`: We handle the dataset with `NumpyTupleDataset`.\n",
" - Explain how `preprocessor` and `parser` work on `chainer_chemistry`: One concrete example using `GGNNPreprocessor` is explained.\n",
"\n",
"It is out of scope of this notebook to explain how to train graph convolutional network using this dataset, please refer [document tutorial](http://chainer-chemistry.readthedocs.io/en/latest/tutorial.html#) or try `train_qm9.py` in [QM9 example](https://github.com/pfnet-research/chainer-chemistry/tree/master/examples/qm9) for the model training.\n",
"\n",
"[Note]\n",
"This notebook is executed on 1, March, 2018.\n",
"The behavior of QM9 dataset in `chainer_chemistry` might change in the future."
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"Loading modules and set loglevel."
]
},
{
"cell_type": "code",
"execution_count": 2,
"metadata": {
"collapsed": false
},
"outputs": [],
"source": [
"import logging\n",
"from rdkit import RDLogger\n",
"from chainer_chemistry import datasets\n",
"\n",
"# Disable errors by RDKit occurred in preprocessing QM9 dataset.\n",
"lg = RDLogger.logger()\n",
"lg.setLevel(RDLogger.CRITICAL)\n",
"\n",
"# show INFO level log from chainer chemistry\n",
"logging.basicConfig(level=logging.INFO)"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"QM9 dataset can be downloaded automatically by chainer chemistry. \n",
"Original format of QM9 dataset is zipped file where each molecule's information is stored in each \"xyz\" file.\n",
"\n",
"Chainer Chemistry automatically merge these information in one csv file internally, you may check the file path of this csv file with `get_qm9_filepath` method. "
]
},
{
"cell_type": "code",
"execution_count": 5,
"metadata": {
"collapsed": false
},
"outputs": [],
"source": [
"dataset_filepath = datasets.get_qm9_filepath()\n",
"\n",
"print('dataset_filepath =', dataset_filepath)"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"The dataset contains several chemical/physical properties. The labels of QM9 dataset can be checked by `get_qm9_label_names` method."
]
},
{
"cell_type": "code",
"execution_count": 6,
"metadata": {
"collapsed": false
},
"outputs": [
{
"name": "stdout",
"output_type": "stream",
"text": [
"QM9 label_names = ['A', 'B', 'C', 'mu', 'alpha', 'homo', 'lumo', 'gap', 'r2', 'zpve', 'U0', 'U', 'H', 'G', 'Cv']\n"
]
}
],
"source": [
"label_names = datasets.get_qm9_label_names()\n",
"print('QM9 label_names =', label_names)"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"More detail information is described in `readme.txt` of QM9 dataset, which can be downloaded from \n",
" - [https://figshare.com/articles/Readme_file%3A_Data_description_for__Quantum_chemistry_structures_and_properties_of_134_kilo_molecules_/1057641](https://figshare.com/articles/Readme_file%3A_Data_description_for__Quantum_chemistry_structures_and_properties_of_134_kilo_molecules_/1057641)\n",
"\n",
"Below is the description of each property(label), written in readme.txt\n",
"\n",
"\n",
"
\n",
"
\n",
"I. Property Unit Description\n",
"-- -------- ----------- --------------\n",
" 1 tag - \"gdb9\"; string constant to ease extraction via grep\n",
" 2 index - Consecutive, 1-based integer identifier of molecule\n",
" 3 A GHz Rotational constant A\n",
" 4 B GHz Rotational constant B\n",
" 5 C GHz Rotational constant C\n",
" 6 mu Debye Dipole moment\n",
" 7 alpha Bohr^3 Isotropic polarizability\n",
" 8 homo Hartree Energy of Highest occupied molecular orbital (HOMO)\n",
" 9 lumo Hartree Energy of Lowest occupied molecular orbital (LUMO)\n",
"10 gap Hartree Gap, difference between LUMO and HOMO\n",
"11 r2 Bohr^2 Electronic spatial extent\n",
"12 zpve Hartree Zero point vibrational energy\n",
"13 U0 Hartree Internal energy at 0 K\n",
"14 U Hartree Internal energy at 298.15 K\n",
"15 H Hartree Enthalpy at 298.15 K\n",
"16 G Hartree Free energy at 298.15 K\n",
"17 Cv cal/(mol K) Heat capacity at 298.15 K\n",
"
\n",
"
"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"### Preprocessing dataset\n",
"\n",
"Dataset extraction depends on the preprocessing method, which is determined by `preprocessor`.\n",
"\n",
"Here, let's look an example of using `GGNNPreprocessor` preprocessor for QM9 dataset extraction.\n",
"\n",
"Procedure is as follows,\n",
"\n",
"1. Instantiate `preprocessor` (here `GGNNPreprocessor` is used).\n",
"2. call `get_qm9` method with `preprocessor`.\n",
" - `labels=None` option is used to extract all labels. In this case, 15 types of physical properties are extracted (see above).\n",
"\n",
"Note that `return_smiles` option can be used to get SMILES information together with the dataset itself."
]
},
{
"cell_type": "code",
"execution_count": 7,
"metadata": {
"collapsed": false
},
"outputs": [
{
"name": "stderr",
"output_type": "stream",
"text": [
"100%|████████████████████████████████████████████████████████████████████████| 133885/133885 [01:35<00:00, 1406.47it/s]\n",
"INFO:chainer_chemistry.dataset.parsers.csv_file_parser:Preprocess finished. FAIL 0, SUCCESS 133885, TOTAL 133885\n"
]
}
],
"source": [
"from chainer_chemistry.dataset.preprocessors.ggnn_preprocessor import \\\n",
" GGNNPreprocessor\n",
" \n",
"preprocessor = GGNNPreprocessor()\n",
"dataset, dataset_smiles = datasets.get_qm9(preprocessor, labels=None, return_smiles=True)"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"## Check extracted dataset\n",
"\n",
"First, let's check type and number of dataset."
]
},
{
"cell_type": "code",
"execution_count": 8,
"metadata": {
"collapsed": false
},
"outputs": [
{
"name": "stdout",
"output_type": "stream",
"text": [
"dataset information...\n",
"dataset 133885\n",
"smiles information...\n",
"dataset_smiles 133885\n"
]
}
],
"source": [
"print('dataset information...')\n",
"print('dataset', type(dataset), len(dataset))\n",
"\n",
"print('smiles information...')\n",
"print('dataset_smiles', type(dataset_smiles), len(dataset_smiles))"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"As you can see, QM9 dataset consists of 133885 data.\n",
"\n",
"The dataset is a class of `NumpyTupleDataset`, where i-th dataset features can be accessed by `dataset[i]`.\n",
"\n",
"When `GGNNPreprocessor` is used, each dataset consists of following features\n",
" 1. atom feature: representing atomic number of given molecule. \n",
" 2. adjacency matrix feature: representing adjacency matrix of given molecule.\n",
" `GGNNPreprocessor` extracts adjacency matrix of each bonding type.\n",
" 3. label feature: representing chemical properties (label) of given molecule.\n",
" Please refer [above table](#table1) for details."
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"Let's look an example of 7777-th dataset"
]
},
{
"cell_type": "code",
"execution_count": 9,
"metadata": {
"collapsed": false
},
"outputs": [
{
"name": "stdout",
"output_type": "stream",
"text": [
"index=7777, SMILES=CC1=NCCC(C)O1\n",
"atom (8,) [6 6 7 6 6 6 6 8]\n",
"adj (4, 8, 8)\n",
"adjacency matrix for SINGLE bond type\n",
" [[0. 1. 0. 0. 0. 0. 0. 0.]\n",
" [1. 0. 0. 0. 0. 0. 0. 1.]\n",
" [0. 0. 0. 1. 0. 0. 0. 0.]\n",
" [0. 0. 1. 0. 1. 0. 0. 0.]\n",
" [0. 0. 0. 1. 0. 1. 0. 0.]\n",
" [0. 0. 0. 0. 1. 0. 1. 1.]\n",
" [0. 0. 0. 0. 0. 1. 0. 0.]\n",
" [0. 1. 0. 0. 0. 1. 0. 0.]]\n",
"adjacency matrix for DOUBLE bond type\n",
" [[0. 0. 0. 0. 0. 0. 0. 0.]\n",
" [0. 0. 1. 0. 0. 0. 0. 0.]\n",
" [0. 1. 0. 0. 0. 0. 0. 0.]\n",
" [0. 0. 0. 0. 0. 0. 0. 0.]\n",
" [0. 0. 0. 0. 0. 0. 0. 0.]\n",
" [0. 0. 0. 0. 0. 0. 0. 0.]\n",
" [0. 0. 0. 0. 0. 0. 0. 0.]\n",
" [0. 0. 0. 0. 0. 0. 0. 0.]]\n",
"adjacency matrix for TRIPLE bond type\n",
" [[0. 0. 0. 0. 0. 0. 0. 0.]\n",
" [0. 0. 0. 0. 0. 0. 0. 0.]\n",
" [0. 0. 0. 0. 0. 0. 0. 0.]\n",
" [0. 0. 0. 0. 0. 0. 0. 0.]\n",
" [0. 0. 0. 0. 0. 0. 0. 0.]\n",
" [0. 0. 0. 0. 0. 0. 0. 0.]\n",
" [0. 0. 0. 0. 0. 0. 0. 0.]\n",
" [0. 0. 0. 0. 0. 0. 0. 0.]]\n",
"adjacency matrix for AROMATIC bond type\n",
" [[0. 0. 0. 0. 0. 0. 0. 0.]\n",
" [0. 0. 0. 0. 0. 0. 0. 0.]\n",
" [0. 0. 0. 0. 0. 0. 0. 0.]\n",
" [0. 0. 0. 0. 0. 0. 0. 0.]\n",
" [0. 0. 0. 0. 0. 0. 0. 0.]\n",
" [0. 0. 0. 0. 0. 0. 0. 0.]\n",
" [0. 0. 0. 0. 0. 0. 0. 0.]\n",
" [0. 0. 0. 0. 0. 0. 0. 0.]]\n",
"labels [ 3.1431000e+00 1.8749400e+00 1.2443100e+00 1.9313999e+00\n",
" 7.3379997e+01 -2.3750000e-01 3.4699999e-02 2.7219999e-01\n",
" 1.0124120e+03 1.6597100e-01 -3.6510001e+02 -3.6509183e+02\n",
" -3.6509088e+02 -3.6513235e+02 3.0584999e+01]\n"
]
}
],
"source": [
"index = 7777\n",
"\n",
"print('index={}, SMILES={}'.format(index, dataset_smiles[index]))\n",
"atom, adj, labels = dataset[index]\n",
"# This molecule has N=8 atoms.\n",
"print('atom', atom.shape, atom)\n",
"# adjacency matrix is NxN matrix, where N is number of atoms in the molecule.\n",
"# Unlike usual adjacency matrix, diagonal elements are filled with 1, for NFP calculation purpose.\n",
"print('adj', adj.shape)\n",
"print('adjacency matrix for SINGLE bond type\\n', adj[0])\n",
"print('adjacency matrix for DOUBLE bond type\\n', adj[1])\n",
"print('adjacency matrix for TRIPLE bond type\\n', adj[2])\n",
"print('adjacency matrix for AROMATIC bond type\\n', adj[3])\n",
"\n",
"print('labels', labels)"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"## Visualizing the molecule\n",
"\n",
"One might want to visualize molecule given SMILES information. Here is an example code:"
]
},
{
"cell_type": "code",
"execution_count": 10,
"metadata": {
"collapsed": true
},
"outputs": [],
"source": [
"# This script is referred from http://rdkit.blogspot.jp/2015/02/new-drawing-code.html\n",
"# and http://cheminformist.itmol.com/TEST/wp-content/uploads/2015/07/rdkit_moldraw2d_2.html\n",
"from __future__ import print_function\n",
"from rdkit import Chem\n",
"from rdkit.Chem.Draw import IPythonConsole\n",
"from IPython.display import SVG\n",
"\n",
"from rdkit.Chem import rdDepictor\n",
"from rdkit.Chem.Draw import rdMolDraw2D\n",
"def moltosvg(mol,molSize=(450,150),kekulize=True):\n",
" mc = Chem.Mol(mol.ToBinary())\n",
" if kekulize:\n",
" try:\n",
" Chem.Kekulize(mc)\n",
" except:\n",
" mc = Chem.Mol(mol.ToBinary())\n",
" if not mc.GetNumConformers():\n",
" rdDepictor.Compute2DCoords(mc)\n",
" drawer = rdMolDraw2D.MolDraw2DSVG(molSize[0],molSize[1])\n",
" drawer.DrawMolecule(mc)\n",
" drawer.FinishDrawing()\n",
" svg = drawer.GetDrawingText()\n",
" return svg\n",
"\n",
"def render_svg(svg):\n",
" # It seems that the svg renderer used doesn't quite hit the spec.\n",
" # Here are some fixes to make it work in the notebook, although I think\n",
" # the underlying issue needs to be resolved at the generation step\n",
" return SVG(svg.replace('svg:',''))"
]
},
{
"cell_type": "code",
"execution_count": 11,
"metadata": {
"collapsed": false
},
"outputs": [
{
"name": "stdout",
"output_type": "stream",
"text": [
"smiles: CC1=NCCC(C)O1\n"
]
},
{
"data": {
"image/svg+xml": [
""
],
"text/plain": [
""
]
},
"execution_count": 11,
"metadata": {},
"output_type": "execute_result"
}
],
"source": [
"smiles = dataset_smiles[index]\n",
"mol = Chem.MolFromSmiles(dataset_smiles[index])\n",
"\n",
"print('smiles:', smiles)\n",
"svg = moltosvg(mol)\n",
"render_svg(svg)"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"[Note] SVG images cannot be displayed on GitHub, but you can see an image of molecule when you execute it on jupyter notebook."
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"## Interactively watch through the QM9 dataset\n",
"\n",
"Jupyter notebook provides handy module to check/visualize the data. Here interact module can be used to interactively check the internal of QM9 dataset."
]
},
{
"cell_type": "code",
"execution_count": 12,
"metadata": {
"collapsed": false
},
"outputs": [
{
"name": "stdout",
"output_type": "stream",
"text": [
"index=114829, SMILES=CCC1CC2OCC1O2\n",
"atom [6 6 6 6 6 8 6 6 8]\n",
"labels [ 3.248 1.224 1.16 1.911 76.47 -0.249 0.082 0.331\n",
" 1179.493 0.185 -424.24 -424.232 -424.231 -424.272 31.209]\n"
]
},
{
"data": {
"image/svg+xml": [
""
],
"text/plain": [
""
]
},
"metadata": {},
"output_type": "display_data"
}
],
"source": [
"from ipywidgets import interact\n",
"import numpy as np\n",
"np.set_printoptions(precision=3, suppress=True)\n",
"\n",
"def show_dataset(index):\n",
" print('index={}, SMILES={}'.format(index, dataset_smiles[index]))\n",
" atom, adj, labels = dataset[index]\n",
" print('atom', atom)\n",
" # print('adj', adj)\n",
" print('labels', labels)\n",
" mol = Chem.MolFromSmiles(dataset_smiles[index])\n",
" return render_svg(moltosvg(mol))\n",
"\n",
"interact(show_dataset, index=(0, len(dataset) - 1, 1))"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"## Appendix: how to save the molecule figure?\n",
"\n",
"\n",
"### 1. Save with SVG format\n",
"\n",
"First method is simply save svg in file."
]
},
{
"cell_type": "code",
"execution_count": 13,
"metadata": {
"collapsed": true
},
"outputs": [],
"source": [
"import os\n",
"dirpath = 'images'\n",
"\n",
"if not os.path.exists(dirpath):\n",
" os.mkdir(dirpath)"
]
},
{
"cell_type": "code",
"execution_count": 14,
"metadata": {
"collapsed": true
},
"outputs": [],
"source": [
"def save_svg(mol, filepath):\n",
" svg = moltosvg(mol)\n",
" with open(filepath, \"w\") as fw:\n",
" fw.write(svg)"
]
},
{
"cell_type": "code",
"execution_count": 15,
"metadata": {
"collapsed": false
},
"outputs": [
{
"name": "stdout",
"output_type": "stream",
"text": [
"drawing images\\mol_7777.svg\n"
]
}
],
"source": [
"index = 7777\n",
"save_filepath = os.path.join(dirpath, 'mol_{}.svg'.format(index))\n",
"print('drawing {}'.format(save_filepath))\n",
"\n",
"mol = Chem.MolFromSmiles(dataset_smiles[index])\n",
"save_svg(mol, save_filepath)"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"### 2. Save with png format\n",
"\n",
"`rdkit` provides `Draw.MolToFile` method to visualize mol instance and save it to png format."
]
},
{
"cell_type": "code",
"execution_count": 16,
"metadata": {
"collapsed": true
},
"outputs": [],
"source": [
"from rdkit.Chem import Draw\n",
"\n",
"def save_png(mol, filepath, size=(600, 600)):\n",
" Draw.MolToFile(mol, filepath, size=size)"
]
},
{
"cell_type": "code",
"execution_count": 17,
"metadata": {
"collapsed": false
},
"outputs": [
{
"name": "stdout",
"output_type": "stream",
"text": [
"drawing images\\mol_7777.png\n"
]
}
],
"source": [
"from rdkit.Chem import Draw\n",
"index = 7777\n",
"save_filepath = os.path.join(dirpath, 'mol_{}.png'.format(index))\n",
"print('drawing {}'.format(save_filepath))\n",
"\n",
"mol = Chem.MolFromSmiles(dataset_smiles[index])\n",
"save_png(mol, save_filepath, size=(600, 600))"
]
},
{
"cell_type": "code",
"execution_count": null,
"metadata": {
"collapsed": true
},
"outputs": [],
"source": []
}
],
"metadata": {
"anaconda-cloud": {},
"kernelspec": {
"display_name": "Python [conda root]",
"language": "python",
"name": "conda-root-py"
},
"language_info": {
"codemirror_mode": {
"name": "ipython",
"version": 3
},
"file_extension": ".py",
"mimetype": "text/x-python",
"name": "python",
"nbconvert_exporter": "python",
"pygments_lexer": "ipython3",
"version": "3.5.2"
}
},
"nbformat": 4,
"nbformat_minor": 2
}
================================================
FILE: examples/qm9/test_qm9.sh
================================================
#!/usr/bin/env bash
set -e
# List of available graph convolution methods.
# schnet test is skipped, since it takes long time to preprocess...
methods=(nfp ggnn weavenet rsgcn relgcn relgat gin gnnfilm megnet nfp_gwm ggnn_gwm rsgcn_gwm gin_gwm relgcn_sparse gin_sparse megnet)
# device identifier; set it to -1 to train on the CPU (default).
device=${1:--1}
# Number of training epochs (default: 1).
epoch=${2:-1}
for method in ${methods[@]}
do
# Remove any previously cached models.
[ -d "input" ] && rm -rf input
# Train with the current method (one label).
python train_qm9.py \
--method ${method} \
--label A \
--conv-layers 1 \
--device ${device} \
--epoch ${epoch} \
--unit-num 10 \
--num-data 100
# Predict with the current method (one label).
python predict_qm9.py \
--method ${method} \
--label A \
--device ${device} \
--num-data 100
# Train with the current method (all labels).
python train_qm9.py \
--method ${method} \
--conv-layers 1 \
--device ${device} \
--epoch ${epoch} \
--unit-num 10 \
--num-data 100
# Predict with the current method (all labels).
python predict_qm9.py \
--method ${method} \
--device ${device} \
--num-data 100
done
================================================
FILE: examples/qm9/train_qm9.py
================================================
#!/usr/bin/env python
from __future__ import print_function
import argparse
import chainer
import numpy
import os
from chainer.datasets import split_dataset_random
from chainer import functions as F
from chainer_chemistry.dataset.converters import converter_method_dict
from chainer_chemistry.dataset.preprocessors import preprocess_method_dict
from chainer_chemistry import datasets as D
from chainer_chemistry.datasets import NumpyTupleDataset
from chainer_chemistry.links.scaler.standard_scaler import StandardScaler
from chainer_chemistry.models.prediction.regressor import Regressor
from chainer_chemistry.models.prediction import set_up_predictor
from chainer_chemistry.utils import run_train
def rmse(x0, x1):
return F.sqrt(F.mean_squared_error(x0, x1))
def parse_arguments():
# Lists of supported preprocessing methods/models.
method_list = ['nfp', 'ggnn', 'schnet', 'weavenet', 'rsgcn', 'relgcn',
'relgat', 'gin', 'gnnfilm', 'relgcn_sparse', 'gin_sparse',
'nfp_gwm', 'ggnn_gwm', 'rsgcn_gwm', 'gin_gwm', 'megnet']
label_names = ['A', 'B', 'C', 'mu', 'alpha', 'homo', 'lumo', 'gap', 'r2',
'zpve', 'U0', 'U', 'H', 'G', 'Cv']
scale_list = ['standardize', 'none']
# Set up the argument parser.
parser = argparse.ArgumentParser(description='Regression on QM9.')
parser.add_argument('--method', '-m', type=str, choices=method_list,
default='nfp', help='method name')
parser.add_argument('--label', '-l', type=str,
choices=label_names + ['all'], default='all',
help='target label for regression; all means '
'predicting all properties at once')
parser.add_argument('--scale', type=str, choices=scale_list,
default='standardize', help='label scaling method')
parser.add_argument('--conv-layers', '-c', type=int, default=4,
help='number of convolution layers')
parser.add_argument('--batchsize', '-b', type=int, default=32,
help='batch size')
parser.add_argument(
'--device', '-d', type=str, default='-1',
help='Device specifier. Either ChainerX device specifier or an '
'integer. If non-negative integer, CuPy arrays with specified '
'device id are used. If negative integer, NumPy arrays are used')
parser.add_argument('--out', '-o', type=str, default='result',
help='path to save the computed model to')
parser.add_argument('--epoch', '-e', type=int, default=20,
help='number of epochs')
parser.add_argument('--unit-num', '-u', type=int, default=16,
help='number of units in one layer of the model')
parser.add_argument('--seed', '-s', type=int, default=777,
help='random seed value')
parser.add_argument('--train-data-ratio', '-r', type=float, default=0.7,
help='ratio of training data w.r.t the dataset')
parser.add_argument('--protocol', type=int, default=2,
help='pickle protocol version')
parser.add_argument('--model-filename', type=str, default='regressor.pkl',
help='saved model filename')
parser.add_argument('--num-data', type=int, default=-1,
help='amount of data to be parsed; -1 indicates '
'parsing all data.')
return parser.parse_args()
def main():
# Parse the arguments.
args = parse_arguments()
# Set up some useful variables that will be used later on.
method = args.method
if args.label != 'all':
labels = args.label
cache_dir = os.path.join('input', '{}_{}'.format(method, labels))
class_num = len(labels) if isinstance(labels, list) else 1
else:
labels = None
cache_dir = os.path.join('input', '{}_all'.format(method))
class_num = len(D.get_qm9_label_names())
# Get the filename corresponding to the cached dataset, based on the amount
# of data samples that need to be parsed from the original dataset.
num_data = args.num_data
if num_data >= 0:
dataset_filename = 'data_{}.npz'.format(num_data)
else:
dataset_filename = 'data.npz'
# Load the cached dataset.
dataset_cache_path = os.path.join(cache_dir, dataset_filename)
dataset = None
if os.path.exists(dataset_cache_path):
print('Loading cached dataset from {}.'.format(dataset_cache_path))
dataset = NumpyTupleDataset.load(dataset_cache_path)
if dataset is None:
print('Preprocessing dataset...')
preprocessor = preprocess_method_dict[method]()
if num_data >= 0:
# Select the first `num_data` samples from the dataset.
target_index = numpy.arange(num_data)
dataset = D.get_qm9(preprocessor, labels=labels,
target_index=target_index)
else:
# Load the entire dataset.
dataset = D.get_qm9(preprocessor, labels=labels)
# Cache the laded dataset.
if not os.path.exists(cache_dir):
os.makedirs(cache_dir)
if isinstance(dataset, NumpyTupleDataset):
NumpyTupleDataset.save(dataset_cache_path, dataset)
# TODO: support caching of other dataset type...
# Scale the label values, if necessary.
if args.scale == 'standardize':
print('Fit StandardScaler to the labels.')
scaler = StandardScaler()
if isinstance(dataset, NumpyTupleDataset):
scaler.fit(dataset.get_datasets()[-1])
else:
y = numpy.array([data.y for data in dataset])
scaler.fit(y)
else:
print('No standard scaling was selected.')
scaler = None
# Split the dataset into training and validation.
train_data_size = int(len(dataset) * args.train_data_ratio)
train, valid = split_dataset_random(dataset, train_data_size, args.seed)
# Set up the predictor.
predictor = set_up_predictor(method, args.unit_num, args.conv_layers,
class_num, scaler)
# Set up the regressor.
device = chainer.get_device(args.device)
metrics_fun = {'mae': F.mean_absolute_error, 'rmse': rmse}
regressor = Regressor(predictor, lossfun=F.mean_squared_error,
metrics_fun=metrics_fun, device=device)
# TODO(nakago): consider how to switch which `converter` to use.
if isinstance(dataset, NumpyTupleDataset):
converter = converter_method_dict[method]
else:
converter = dataset.converter
print('Training...')
run_train(regressor, train, valid=valid,
batch_size=args.batchsize, epoch=args.epoch,
out=args.out, extensions_list=None,
device=device, converter=converter,
resume_path=None)
# Save the regressor's parameters.
model_path = os.path.join(args.out, args.model_filename)
print('Saving the trained model to {}...'.format(model_path))
regressor.save_pickle(model_path, protocol=args.protocol)
if __name__ == '__main__':
main()
================================================
FILE: examples/test_examples.sh
================================================
#!/usr/bin/env bash
set -e
gpu=${1:--1}
echo Using gpu ${gpu}
# Tox21
echo --- Testing Tox21 ---
cd tox21 && bash -x test_tox21.sh ${gpu} && cd ..
# QM9
echo --- Testing QM9 ---
cd qm9 && bash -x test_qm9.sh ${gpu} && cd ..
# Own dataset
echo --- Testing on own dataset ---
cd own_dataset && bash -x test_own_dataset.sh ${gpu} && cd ..
# MolNet
echo --- Testing MolNet dataset ---
cd molnet && bash -x test_molnet.sh ${gpu} && cd ..
================================================
FILE: examples/tox21/.gitignore
================================================
prediction.npz
================================================
FILE: examples/tox21/README.md
================================================
# Training graph convolution models with Tox21 dataset
This is an example of learning toxicity of chemical molecules with graph convolution networks in a multi-task supervised setting.
We use graph convolution models that takes molecules represented as graphs as predictor.
Chainer Chemistry provides off-the-shelf graph convolution models including [NFP](https://arxiv.org/abs/1509.09292), [GGNN](https://arxiv.org/abs/1511.05493), [SchNet](https://arxiv.org/abs/1706.08566) and so on.
We use Tox21 dataset, provided by [The Toxicology in the 21st Century (Tox21)](https://ncats.nih.gov/tox21).
It is one of the most widely used datasets in bio and chemo informatics
and consists of the chemical information of molecules and their assessments of toxicity.
## How to run the code
### Train the model with tox21 dataset
With CPU:
```angular2html
python train_tox21.py
```
With GPU:
```angular2html
python train_tox21.py -g 0
```
This script trains the model with the tox21 dataset
and outputs trained parameters and other information to a specified directory.
We specify an ID of GPU in use by `-g` or `--gpu` option.
Negative value indicate running the code with CPU.
The output directory can be specified by `-o` option.
Its default value is `result`.
The Tox21 dataset consists of several assays.
Some molecules can have more than one types of assay results.
We can specify which assay to use by specifying an assay name with `-l` option.
Assay names are available by running the script with `-h` or `--help`
or execute the following command:
```
python -c import chainer_chemistry; chainer_chemistry.datasets.get_tox21_label_names()
```
If `-l` option is not specified, this script conducts multitask learning with all labels.
The full options available including `-g` and `-o` are found
by running the following command:
```
python train_tox21.py -h
```
### Inference with a trained model using Classifier
As of v0.3.0, `Classifier` class is introduced which supports `predict` and
`predict_proba` methods for easier inference.
`Classifier` also supports `load_pickle` method, user may load
the instance of pretrained-model using `pickle` file.
The example implemented in `predict_tox21_with_classifier.py`.
With CPU:
```
python predict_tox21_with_classifier.py [-i /path/to/training/result/directory]
```
With GPU:
```
python predict_tox21_with_classifier.py -g 0 [-i /path/to/training/result/directory]
```
### Evaluation of Models
`seaborn` is required to run this script.
```
bash examples/tox21/evaluate_models_tox21.sh
```
This script evaluates each method and generate a graph.
================================================
FILE: examples/tox21/data.py
================================================
import os
import numpy
from chainer_chemistry.dataset.preprocessors import preprocess_method_dict
from chainer_chemistry import datasets as D
from chainer_chemistry.datasets.numpy_tuple_dataset import NumpyTupleDataset
class _CacheNamePolicy(object):
train_file_name = 'train.npz'
val_file_name = 'val.npz'
test_file_name = 'test.npz'
def _get_cache_directory_path(self, method, labels, prefix, num_data):
num_data_str = '_{}'.format(num_data) if num_data >= 0 else ''
if labels:
return os.path.join(prefix,
'{}_{}{}'.format(method, labels, num_data_str))
else:
return os.path.join(prefix,
'{}_all{}'.format(method, num_data_str))
def __init__(self, method, labels, prefix='input', num_data=-1):
self.method = method
self.labels = labels
self.prefix = prefix
self.num_data = num_data
self.cache_dir = self._get_cache_directory_path(
method, labels, prefix, num_data)
def get_train_file_path(self):
return os.path.join(self.cache_dir, self.train_file_name)
def get_val_file_path(self):
return os.path.join(self.cache_dir, self.val_file_name)
def get_test_file_path(self):
return os.path.join(self.cache_dir, self.test_file_name)
def create_cache_directory(self):
try:
os.makedirs(self.cache_dir)
except OSError:
if not os.path.isdir(self.cache_dir):
raise
def load_dataset(method, labels, prefix='input', num_data=-1):
policy = _CacheNamePolicy(method, labels, prefix, num_data=num_data)
train_path = policy.get_train_file_path()
val_path = policy.get_val_file_path()
test_path = policy.get_test_file_path()
train, val, test = None, None, None
print()
if os.path.exists(policy.cache_dir):
print('load from cache {}'.format(policy.cache_dir))
train = NumpyTupleDataset.load(train_path)
val = NumpyTupleDataset.load(val_path)
test = NumpyTupleDataset.load(test_path)
if train is None or val is None or test is None:
print('preprocessing dataset...')
preprocessor = preprocess_method_dict[method]()
if num_data >= 0:
# Use `num_data` examples for train
target_index = numpy.arange(num_data)
train, val, test = D.get_tox21(
preprocessor, labels=labels,
train_target_index=target_index, val_target_index=None,
test_target_index=None
)
else:
train, val, test = D.get_tox21(preprocessor, labels=labels)
# Cache dataset
policy.create_cache_directory()
NumpyTupleDataset.save(train_path, train)
NumpyTupleDataset.save(val_path, val)
NumpyTupleDataset.save(test_path, test)
return train, val, test
================================================
FILE: examples/tox21/evaluate_models_tox21.sh
================================================
set -eu
device=-1
methods=(nfp ggnn schnet weavenet rsgcn relgcn relgat megnet)
prefix=eval_
for method in ${methods[@]}
do
result_dir=${prefix}${method}
python train_tox21.py --method ${method} --device ${device} --out ${result_dir}
python predict_tox21_with_classifier.py --in-dir ${result_dir}
done
python plot.py --prefix ${prefix} --methods ${methods[@]}
================================================
FILE: examples/tox21/plot.py
================================================
#! -*- coding: utf-8 -*-
import argparse
import json
import os
import matplotlib.pyplot as plt
import seaborn as sns
parser = argparse.ArgumentParser()
parser.add_argument('--prefix', required=True)
parser.add_argument('--methods', nargs='+', required=True)
args = parser.parse_args()
sns.set()
x = args.methods
y = []
for method in args.methods:
with open(os.path.join(args.prefix + method, 'eval_result.json')) as f:
result = json.load(f)
y.append(result["test/main/roc_auc"])
ax = sns.barplot(y=x, x=y)
for n, (label, _y) in enumerate(zip(x, y)):
ax.annotate(
s='{:.3f}'.format(abs(_y)),
xy=(_y, n),
ha='right', va='center',
xytext=(-5, 0),
textcoords='offset points',
color='white'
)
plt.title("Performance on tox21")
plt.xlabel("ROC-AUC")
plt.savefig('eval_results_tox21.png')
================================================
FILE: examples/tox21/predict_tox21_with_classifier.py
================================================
import os
import argparse
import json
import chainer
import numpy
from chainer import cuda
import chainer.functions as F
from chainer.iterators import SerialIterator
from chainer.training.extensions import Evaluator
from rdkit import RDLogger
import six
from chainer_chemistry.dataset.converters import converter_method_dict
from chainer_chemistry.models.prediction import Classifier
from chainer_chemistry.training.extensions.roc_auc_evaluator import ROCAUCEvaluator # NOQA
import data
# Disable errors by RDKit occurred in preprocessing Tox21 dataset.
lg = RDLogger.logger()
lg.setLevel(RDLogger.CRITICAL)
def main():
parser = argparse.ArgumentParser(
description='Predict with a trained model.')
parser.add_argument('--in-dir', '-i', type=str, default='result',
help='Path to the result directory of the training '
'script.')
parser.add_argument('--batchsize', '-b', type=int, default=128,
help='batch size')
parser.add_argument(
'--device', type=str, default='-1',
help='Device specifier. Either ChainerX device specifier or an '
'integer. If non-negative integer, CuPy arrays with specified '
'device id are used. If negative integer, NumPy arrays are used')
parser.add_argument('--model-filename', type=str, default='classifier.pkl',
help='file name for pickled model')
parser.add_argument('--num-data', type=int, default=-1,
help='Number of data to be parsed from parser.'
'-1 indicates to parse all data.')
args = parser.parse_args()
with open(os.path.join(args.in_dir, 'config.json'), 'r') as i:
config = json.loads(i.read())
method = config['method']
labels = config['labels']
_, test, _ = data.load_dataset(method, labels, num_data=args.num_data)
y_test = test.get_datasets()[-1]
device = chainer.get_device(args.device)
# Load pretrained model
clf = Classifier.load_pickle(
os.path.join(args.in_dir, args.model_filename),
device=device) # type: Classifier
# ---- predict ---
print('Predicting...')
# We need to feed only input features `x` to `predict`/`predict_proba`.
# This converter extracts only inputs (x1, x2, ...) from the features which
# consist of input `x` and label `t` (x1, x2, ..., t).
converter = converter_method_dict[method]
def extract_inputs(batch, device=None):
return converter(batch, device=device)[:-1]
def postprocess_pred(x):
x_array = cuda.to_cpu(x.data)
return numpy.where(x_array > 0, 1, 0)
y_pred = clf.predict(test, converter=extract_inputs,
postprocess_fn=postprocess_pred)
y_proba = clf.predict_proba(test, converter=extract_inputs,
postprocess_fn=F.sigmoid)
# `predict` method returns the prediction label (0: non-toxic, 1:toxic)
print('y_pread.shape = {}, y_pred[:5, 0] = {}'
.format(y_pred.shape, y_pred[:5, 0]))
# `predict_proba` method returns the probability to be toxic
print('y_proba.shape = {}, y_proba[:5, 0] = {}'
.format(y_proba.shape, y_proba[:5, 0]))
# --- predict end ---
if y_pred.ndim == 1:
y_pred = y_pred[:, None]
if y_pred.shape != y_test.shape:
raise RuntimeError('The shape of the prediction result array and '
'that of the ground truth array do not match. '
'Contents of the input directory may be corrupted '
'or modified.')
statistics = []
for t, p in six.moves.zip(y_test.T, y_pred.T):
idx = t != -1
n_correct = (t[idx] == p[idx]).sum()
n_total = len(t[idx])
accuracy = float(n_correct) / n_total
statistics.append([n_correct, n_total, accuracy])
print('{:>6} {:>8} {:>8} {:>8}'
.format('TaskID', 'Correct', 'Total', 'Accuracy'))
for idx, (n_correct, n_total, accuracy) in enumerate(statistics):
print('task{:>2} {:>8} {:>8} {:>8.4f}'
.format(idx, n_correct, n_total, accuracy))
prediction_result_file = 'prediction.npz'
print('Save prediction result to {}'.format(prediction_result_file))
numpy.savez_compressed(prediction_result_file, y_pred)
# --- evaluate ---
# To calc loss/accuracy, we can use `Evaluator`, `ROCAUCEvaluator`
print('Evaluating...')
test_iterator = SerialIterator(test, 16, repeat=False, shuffle=False)
eval_result = Evaluator(
test_iterator, clf, converter=converter, device=device)()
print('Evaluation result: ', eval_result)
rocauc_result = ROCAUCEvaluator(
test_iterator, clf, converter=converter, device=device,
eval_func=clf.predictor, name='test', ignore_labels=-1)()
print('ROCAUC Evaluation result: ', rocauc_result)
with open(os.path.join(args.in_dir, 'eval_result.json'), 'w') as f:
json.dump(rocauc_result, f)
# --- evaluate end ---
if __name__ == '__main__':
main()
================================================
FILE: examples/tox21/test_tox21.sh
================================================
#!/usr/bin/env bash
set -e
# device specifier given from first argument, default value is -1
device=${1:--1}
# Preprocessor parse result must contain both pos/neg samples
tox21_num_data=100
for method in nfp ggnn
do
if [ ! -f "input" ]; then
rm -rf input
fi
# Tox21 classification task with only one label
out_dir=nr_ar_${method}
python train_tox21.py --method ${method} --label NR-AR --conv-layers 1 --device ${device} --epoch 1 --unit-num 10 --out ${out_dir} --batchsize 32 --num-data=${tox21_num_data}
python predict_tox21_with_classifier.py --in-dir ${out_dir} --device ${device} --num-data=${tox21_num_data}
# Tox21 classification task with all labels
out_dir=all_${method}
python train_tox21.py --method ${method} --conv-layers 1 --device ${device} --epoch 1 --unit-num 10 --out ${out_dir} --batchsize 16 --num-data=${tox21_num_data}
python predict_tox21_with_classifier.py --in-dir ${out_dir} --num-data=${tox21_num_data}
done
# BalancedSerialIterator test with Tox21
python train_tox21.py --method nfp --label NR-AR --conv-layers 1 --device ${device} --epoch 1 --unit-num 10 --out nr_ar_nfp_balanced --iterator-type balanced --eval-mode 0 --num-data 1000
# ROCAUCEvaluator test with Tox21
python train_tox21.py --method nfp --label NR-AR --conv-layers 1 --device ${device} --epoch 1 --unit-num 10 --out nr_ar_nfp_balanced --iterator-type serial --eval-mode 1 --num-data 1000
================================================
FILE: examples/tox21/tox21_dataset_exploration.ipynb
================================================
{
"cells": [
{
"cell_type": "markdown",
"metadata": {
"collapsed": true
},
"source": [
"## Tox 21 dataset exploration\n",
"\n"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"The purpose of this notebook is as follows,\n",
"\n",
" - Explain [Tox21 dataset](https://tripod.nih.gov/tox21/challenge/): Check the labels and visualization of molecules to understand what kind of data are stored.\n",
" - Explain internal structure of tox21 dataset in `chainer_chemistry`: We handle the dataset with `NumpyTupleDataset`.\n",
" - Explain how `preprocessor` and `parser` work on `chainer_chemistry`: One concrete example using `NFPPreprocessor` is explained.\n",
"\n",
"It is out of scope of this notebook to explain how to train graph convolutional network using this dataset, please refer [document tutorial](http://chainer-chemistry.readthedocs.io/en/latest/tutorial.html#) or try `train_tox21.py` in [tox21 example](https://github.com/pfnet-research/chainer-chemistry/tree/master/examples/tox21) for the model training.\n",
"\n",
"[Note]\n",
"This notebook is executed on 1, March, 2018. \n",
"The behavior of tox21 dataset in `chainer_chemistry` might change in the future."
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"Loading modules and set loglevel."
]
},
{
"cell_type": "code",
"execution_count": 1,
"metadata": {
"collapsed": false
},
"outputs": [],
"source": [
"import logging\n",
"from rdkit import RDLogger\n",
"from chainer_chemistry import datasets\n",
"\n",
"# Disable errors by RDKit occurred in preprocessing Tox21 dataset.\n",
"lg = RDLogger.logger()\n",
"lg.setLevel(RDLogger.CRITICAL)\n",
"\n",
"# show INFO level log from chainer chemistry\n",
"logging.basicConfig(level=logging.INFO)"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"Tox 21 dataset consists of train/validation/test data and they can be downloaded automatically with chainer chemistry. \n",
"The format of tox21 dataset is \"sdf\" file.\n",
"You can check the file path of downloaded sdf file with `get_tox21_filepath` method. "
]
},
{
"cell_type": "code",
"execution_count": 2,
"metadata": {
"collapsed": false
},
"outputs": [],
"source": [
"train_filepath = datasets.get_tox21_filepath('train')\n",
"val_filepath = datasets.get_tox21_filepath('val')\n",
"test_filepath = datasets.get_tox21_filepath('test')\n",
"\n",
"print('train_filepath =', train_filepath)\n",
"print('val_filepath =', val_filepath)\n",
"print('test_filepath =', test_filepath)"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"Dataset contains 12 types of toxity, the label of toxity can be checked by `get_tox21_label_names` method.\n"
]
},
{
"cell_type": "code",
"execution_count": 3,
"metadata": {
"collapsed": false
},
"outputs": [
{
"name": "stdout",
"output_type": "stream",
"text": [
"tox21 label_names = ['NR-AR', 'NR-AR-LBD', 'NR-AhR', 'NR-Aromatase', 'NR-ER', 'NR-ER-LBD', 'NR-PPAR-gamma', 'SR-ARE', 'SR-ATAD5', 'SR-HSE', 'SR-MMP', 'SR-p53']\n"
]
}
],
"source": [
"label_names = datasets.get_tox21_label_names()\n",
"print('tox21 label_names =', label_names)"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"### Preprocessing dataset\n",
"\n",
"Dataset extraction depends on the preprocessing method, which is determined by `preprocessor`.\n",
"\n",
"Here, let's look an example of using `NFPPreprocessor` preprocessor for tox21 dataset exraction.\n",
"\n",
"Procedure is as follows,\n",
"\n",
"1. Instantiate `preprocessor` (here `NFPPreprocessor` is used).\n",
"2. call `get_tox21` method with `preprocessor`.\n",
" - `labels=None` option is used to extract all labels. In this case, 12 types of toxity labels are extracted (see above).\n",
"\n",
"[Note] \n",
" - `return_smiles` option can be used to get SMILES information together with the dataset itself.\n",
" - Preprocessing result depends on RDKit version. \n",
"You might get different results due to the difference of RDKit behavior between version."
]
},
{
"cell_type": "code",
"execution_count": 2,
"metadata": {
"collapsed": false
},
"outputs": [
{
"name": "stdout",
"output_type": "stream",
"text": [
"RDKit version: 2017.03.3\n"
]
}
],
"source": [
"import rdkit\n",
"\n",
"print('RDKit version: ', rdkit.__version__)"
]
},
{
"cell_type": "code",
"execution_count": 4,
"metadata": {
"collapsed": false
},
"outputs": [
{
"name": "stderr",
"output_type": "stream",
"text": [
"100%|███████████████████████████████████████████████████████████████████████████| 11764/11764 [00:22<00:00, 531.76it/s]\n",
"INFO:chainer_chemistry.dataset.parsers.sdf_file_parser:Preprocess finished. FAIL 0, SUCCESS 11757, TOTAL 11757\n",
"100%|███████████████████████████████████████████████████████████████████████████████| 296/296 [00:00<00:00, 488.77it/s]\n",
"INFO:chainer_chemistry.dataset.parsers.sdf_file_parser:Preprocess finished. FAIL 0, SUCCESS 295, TOTAL 295\n",
"100%|███████████████████████████████████████████████████████████████████████████████| 647/647 [00:01<00:00, 609.91it/s]\n",
"INFO:chainer_chemistry.dataset.parsers.sdf_file_parser:Preprocess finished. FAIL 0, SUCCESS 645, TOTAL 645\n"
]
}
],
"source": [
"from chainer_chemistry.dataset.preprocessors.nfp_preprocessor import \\\n",
" NFPPreprocessor\n",
"\n",
"preprocessor = NFPPreprocessor()\n",
"train, val, test, train_smiles, val_smiles, test_smiles = datasets.get_tox21(preprocessor, labels=None, return_smiles=True)"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"Dataset extraction depends on the `preprocessor`, and you may use other type of `preprocessor` as well.\n",
"\n",
"Below is another example of using `GGNNPreprocessor` for dataset extraction. But it takes little bit of time, you can skip it for the following tutorial."
]
},
{
"cell_type": "code",
"execution_count": 5,
"metadata": {
"collapsed": false
},
"outputs": [
{
"name": "stderr",
"output_type": "stream",
"text": [
"100%|███████████████████████████████████████████████████████████████████████████| 11764/11764 [00:29<00:00, 401.74it/s]\n",
"INFO:chainer_chemistry.dataset.parsers.sdf_file_parser:Preprocess finished. FAIL 0, SUCCESS 11757, TOTAL 11757\n",
"100%|███████████████████████████████████████████████████████████████████████████████| 296/296 [00:00<00:00, 336.99it/s]\n",
"INFO:chainer_chemistry.dataset.parsers.sdf_file_parser:Preprocess finished. FAIL 0, SUCCESS 295, TOTAL 295\n",
"100%|███████████████████████████████████████████████████████████████████████████████| 647/647 [00:01<00:00, 479.05it/s]\n",
"INFO:chainer_chemistry.dataset.parsers.sdf_file_parser:Preprocess finished. FAIL 0, SUCCESS 645, TOTAL 645\n"
]
}
],
"source": [
"from chainer_chemistry.dataset.preprocessors.ggnn_preprocessor import \\\n",
" GGNNPreprocessor\n",
"\n",
"# uncomment it if you want to try `GGNNPreprocessor`\n",
"ggnn_preprocessor = GGNNPreprocessor()\n",
"results = datasets.get_tox21(ggnn_preprocessor, labels=None, return_smiles=True)\n",
"train_ggnn, val_ggnn, test_ggnn, train_smiles_ggnn, val_smiles_ggnn, test_smiles_ggnn = results"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"### Check extracted dataset\n",
"\n",
"First, let's check number of data for train/validation/test dataset."
]
},
{
"cell_type": "code",
"execution_count": 10,
"metadata": {
"collapsed": false
},
"outputs": [
{
"name": "stdout",
"output_type": "stream",
"text": [
"dataset information...\n",
"train 11757\n",
"val 295\n",
"test 645\n",
"smiles information...\n",
"train_smiles 11757\n"
]
}
],
"source": [
"print('dataset information...')\n",
"print('train', type(train), len(train))\n",
"print('val', type(val), len(val))\n",
"print('test', type(test), len(test))\n",
"\n",
"print('smiles information...')\n",
"print('train_smiles', type(train_smiles), len(train_smiles))"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"There are 11757 data in `train`, 295 data in `val` and 645 data in `test` respectively.\n",
"(You might get different result with different version of `rdkit`.)"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"The dataset is a class of `NumpyTupleDataset`, where i-th dataset features can be accessed by `dataset[i]`.\n",
"\n",
"When `NFPPreprocessor` is used, each dataset consists of following features\n",
" 1. atom feature: representing atomic number of given molecule. \n",
" 2. adjacency matrix feature: representing adjacency matrix of given molecule.\n",
" 3. label feature: representing toxity (label) of given molecule.\n",
" Here, 0 indicates negative (no toxity), 1 indicates positive (toxic) and -1 indicates data is not available, respectively."
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"Let's look an example of 6-th train dataset"
]
},
{
"cell_type": "code",
"execution_count": 17,
"metadata": {
"collapsed": false
},
"outputs": [
{
"name": "stdout",
"output_type": "stream",
"text": [
"index=6, SMILES=Cc1ccc([N+](=O)[O-])c2c1O[Hg]2\n",
"atom (12,) [ 6 6 6 6 6 7 8 8 6 6 8 80]\n",
"adj (12, 12)\n",
"[[1. 1. 0. 0. 0. 0. 0. 0. 0. 0. 0. 0.]\n",
" [1. 1. 1. 0. 0. 0. 0. 0. 0. 1. 0. 0.]\n",
" [0. 1. 1. 1. 0. 0. 0. 0. 0. 0. 0. 0.]\n",
" [0. 0. 1. 1. 1. 0. 0. 0. 0. 0. 0. 0.]\n",
" [0. 0. 0. 1. 1. 1. 0. 0. 1. 0. 0. 0.]\n",
" [0. 0. 0. 0. 1. 1. 1. 1. 0. 0. 0. 0.]\n",
" [0. 0. 0. 0. 0. 1. 1. 0. 0. 0. 0. 0.]\n",
" [0. 0. 0. 0. 0. 1. 0. 1. 0. 0. 0. 0.]\n",
" [0. 0. 0. 0. 1. 0. 0. 0. 1. 1. 0. 1.]\n",
" [0. 1. 0. 0. 0. 0. 0. 0. 1. 1. 1. 0.]\n",
" [0. 0. 0. 0. 0. 0. 0. 0. 0. 1. 1. 1.]\n",
" [0. 0. 0. 0. 0. 0. 0. 0. 1. 0. 1. 1.]]\n",
"labels [-1 -1 -1 -1 -1 -1 -1 -1 -1 1 -1 -1]\n"
]
}
],
"source": [
"index = 6\n",
"\n",
"print('index={}, SMILES={}'.format(index, train_smiles[index]))\n",
"atom, adj, labels = train[index]\n",
"# This molecule has N=12 atoms.\n",
"print('atom', atom.shape, atom)\n",
"# adjacency matrix is NxN matrix, where N is number of atoms in the molecule.\n",
"# Unlike usual adjacency matrix, diagonal elements are filled with 1, for NFP calculation purpose.\n",
"print('adj', adj.shape)\n",
"print(adj)\n",
"print('labels', labels)"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"### Visualizing the molecule\n",
"\n",
"One might want to visualize molecule given SMILES information.\n",
"Here is an example code:\n"
]
},
{
"cell_type": "code",
"execution_count": 18,
"metadata": {
"collapsed": true
},
"outputs": [],
"source": [
"# This script is referred from http://rdkit.blogspot.jp/2015/02/new-drawing-code.html\n",
"# and http://cheminformist.itmol.com/TEST/wp-content/uploads/2015/07/rdkit_moldraw2d_2.html\n",
"from __future__ import print_function\n",
"from rdkit import Chem\n",
"from rdkit.Chem.Draw import IPythonConsole\n",
"from IPython.display import SVG\n",
"\n",
"from rdkit.Chem import rdDepictor\n",
"from rdkit.Chem.Draw import rdMolDraw2D\n",
"def moltosvg(mol,molSize=(450,150),kekulize=True):\n",
" mc = Chem.Mol(mol.ToBinary())\n",
" if kekulize:\n",
" try:\n",
" Chem.Kekulize(mc)\n",
" except:\n",
" mc = Chem.Mol(mol.ToBinary())\n",
" if not mc.GetNumConformers():\n",
" rdDepictor.Compute2DCoords(mc)\n",
" drawer = rdMolDraw2D.MolDraw2DSVG(molSize[0],molSize[1])\n",
" drawer.DrawMolecule(mc)\n",
" drawer.FinishDrawing()\n",
" svg = drawer.GetDrawingText()\n",
" return svg\n",
"\n",
"def render_svg(svg):\n",
" # It seems that the svg renderer used doesn't quite hit the spec.\n",
" # Here are some fixes to make it work in the notebook, although I think\n",
" # the underlying issue needs to be resolved at the generation step\n",
" return SVG(svg.replace('svg:',''))"
]
},
{
"cell_type": "code",
"execution_count": 19,
"metadata": {
"collapsed": false
},
"outputs": [
{
"name": "stdout",
"output_type": "stream",
"text": [
"smiles: Cc1ccc([N+](=O)[O-])c2c1O[Hg]2\n"
]
},
{
"data": {
"image/svg+xml": [
""
],
"text/plain": [
""
]
},
"execution_count": 19,
"metadata": {},
"output_type": "execute_result"
}
],
"source": [
"smiles = train_smiles[index]\n",
"mol = Chem.MolFromSmiles(train_smiles[index])\n",
"\n",
"print('smiles:', smiles)\n",
"render_svg(moltosvg(mol))"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"[Note] SVG images cannot be displayed on GitHub, but you can see an image of molecule when you execute it on jupyter notebook."
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"### Interactively watch through the tox21 dataset\n",
"\n",
"Jupyter notebook provides handy module to check/visualize the data.\n",
"Here `interact` module can be used to interactively check the internal of tox 21 dataset."
]
},
{
"cell_type": "code",
"execution_count": 20,
"metadata": {
"collapsed": false
},
"outputs": [
{
"name": "stdout",
"output_type": "stream",
"text": [
"index=5878, SMILES=CN(C)CCn1nnnc1SCC1=C(C(=O)O)N2C(=O)C(NC(=O)Cc3csc(N)n3)C2SC1.Cl\n",
"atom [ 6 7 6 6 6 7 7 7 7 6 16 6 6 6 6 8 8 7 6 8 6 7 6 8\n",
" 6 6 6 16 6 7 7 6 16 6 17]\n",
"labels [ 0 0 0 0 0 0 0 -1 0 -1 0 0]\n"
]
},
{
"data": {
"image/svg+xml": [
""
],
"text/plain": [
""
]
},
"metadata": {},
"output_type": "display_data"
},
{
"data": {
"text/plain": [
""
]
},
"execution_count": 20,
"metadata": {},
"output_type": "execute_result"
}
],
"source": [
"from ipywidgets import interact\n",
"\n",
"def show_train_dataset(index):\n",
" atom, adj, labels = train[index]\n",
" smiles = train_smiles[index]\n",
" print('index={}, SMILES={}'.format(index, smiles))\n",
" print('atom', atom)\n",
" # print('adj', adj)\n",
" print('labels', labels)\n",
" mol = Chem.MolFromSmiles(train_smiles[index])\n",
" return render_svg(moltosvg(mol))\n",
"\n",
"interact(show_train_dataset, index=(0, len(train) - 1, 1))"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"### Appendix: how to save the molecule figure?\n",
"\n",
"### 1. Save with SVG format\n",
"\n",
"First method is simply save svg in file.\n"
]
},
{
"cell_type": "code",
"execution_count": 21,
"metadata": {
"collapsed": true
},
"outputs": [],
"source": [
"import os\n",
"dirpath = 'images'\n",
"\n",
"if not os.path.exists(dirpath):\n",
" os.mkdir(dirpath)"
]
},
{
"cell_type": "code",
"execution_count": 22,
"metadata": {
"collapsed": true
},
"outputs": [],
"source": [
"def save_svg(mol, filepath):\n",
" svg = moltosvg(mol)\n",
" with open(filepath, \"w\") as fw:\n",
" fw.write(svg)"
]
},
{
"cell_type": "code",
"execution_count": 23,
"metadata": {
"collapsed": false
},
"outputs": [
{
"name": "stdout",
"output_type": "stream",
"text": [
"drawing images\\mol_6.svg\n"
]
}
],
"source": [
"index = 6\n",
"save_filepath = os.path.join(dirpath, 'mol_{}.svg'.format(index))\n",
"print('drawing {}'.format(save_filepath))\n",
"\n",
"mol = Chem.MolFromSmiles(train_smiles[index])\n",
"save_svg(mol, save_filepath)"
]
},
{
"cell_type": "markdown",
"metadata": {},
"source": [
"### 2. Save with png format\n",
"\n",
"`rdkit` provides `Draw.MolToFile` method to visualize mol instance and save it to png format."
]
},
{
"cell_type": "code",
"execution_count": 24,
"metadata": {
"collapsed": true
},
"outputs": [],
"source": [
"from rdkit.Chem import Draw\n",
"\n",
"def save_png(mol, filepath, size=(600, 600)):\n",
" Draw.MolToFile(mol, filepath, size=size)"
]
},
{
"cell_type": "code",
"execution_count": 25,
"metadata": {
"collapsed": false
},
"outputs": [
{
"name": "stdout",
"output_type": "stream",
"text": [
"drawing images\\mol_6.png\n"
]
}
],
"source": [
"index = 6\n",
"save_filepath = os.path.join(dirpath, 'mol_{}.png'.format(index))\n",
"print('drawing {}'.format(save_filepath))\n",
"\n",
"mol = Chem.MolFromSmiles(train_smiles[index])\n",
"save_png(mol, save_filepath, size=(600, 600))"
]
},
{
"cell_type": "code",
"execution_count": null,
"metadata": {
"collapsed": true
},
"outputs": [],
"source": []
},
{
"cell_type": "code",
"execution_count": null,
"metadata": {
"collapsed": true
},
"outputs": [],
"source": []
}
],
"metadata": {
"anaconda-cloud": {},
"kernelspec": {
"display_name": "Python [conda root]",
"language": "python",
"name": "conda-root-py"
},
"language_info": {
"codemirror_mode": {
"name": "ipython",
"version": 3
},
"file_extension": ".py",
"mimetype": "text/x-python",
"name": "python",
"nbconvert_exporter": "python",
"pygments_lexer": "ipython3",
"version": "3.5.2"
}
},
"nbformat": 4,
"nbformat_minor": 0
}
================================================
FILE: examples/tox21/train_tox21.py
================================================
#!/usr/bin/env python
from __future__ import print_function
import os
import logging
import argparse
import chainer
from chainer import functions as F
from chainer import iterators as I
from rdkit import RDLogger
from chainer_chemistry.dataset.converters import converter_method_dict
from chainer_chemistry import datasets as D
from chainer_chemistry.iterators.balanced_serial_iterator import BalancedSerialIterator # NOQA
from chainer_chemistry.models.prediction import Classifier
from chainer_chemistry.models.prediction import set_up_predictor
from chainer_chemistry.training.extensions import ROCAUCEvaluator # NOQA
from chainer_chemistry.utils import run_train, save_json
import data
# Disable errors by RDKit occurred in preprocessing Tox21 dataset.
lg = RDLogger.logger()
lg.setLevel(RDLogger.CRITICAL)
# show INFO level log from chainer chemistry
logging.basicConfig(level=logging.INFO)
def main():
# Supported preprocessing/network list
method_list = ['nfp', 'ggnn', 'schnet', 'weavenet', 'rsgcn', 'relgcn',
'relgat', 'megnet']
label_names = D.get_tox21_label_names()
iterator_type = ['serial', 'balanced']
parser = argparse.ArgumentParser(
description='Multitask Learning with Tox21.')
parser.add_argument('--method', '-m', type=str, choices=method_list,
default='nfp', help='graph convolution model to use '
'as a predictor.')
parser.add_argument('--label', '-l', type=str, choices=label_names,
default='', help='target label for logistic '
'regression. Use all labels if this option '
'is not specified.')
parser.add_argument('--iterator-type', type=str, choices=iterator_type,
default='serial', help='iterator type. If `balanced` '
'is specified, data is sampled to take same number of'
'positive/negative labels during training.')
parser.add_argument('--eval-mode', type=int, default=1,
help='Evaluation mode.'
'0: only binary_accuracy is calculated.'
'1: binary_accuracy and ROC-AUC score is calculated')
parser.add_argument('--conv-layers', '-c', type=int, default=4,
help='number of convolution layers')
parser.add_argument('--batchsize', '-b', type=int, default=32,
help='batch size')
parser.add_argument(
'--device', type=str, default='-1',
help='Device specifier. Either ChainerX device specifier or an '
'integer. If non-negative integer, CuPy arrays with specified '
'device id are used. If negative integer, NumPy arrays are used')
parser.add_argument('--out', '-o', type=str, default='result',
help='path to output directory')
parser.add_argument('--epoch', '-e', type=int, default=10,
help='number of epochs')
parser.add_argument('--unit-num', '-u', type=int, default=16,
help='number of units in one layer of the model')
parser.add_argument('--resume', '-r', type=str, default='',
help='path to a trainer snapshot')
parser.add_argument('--frequency', '-f', type=int, default=-1,
help='Frequency of taking a snapshot')
parser.add_argument('--protocol', type=int, default=2,
help='protocol version for pickle')
parser.add_argument('--model-filename', type=str, default='classifier.pkl',
help='file name for pickled model')
parser.add_argument('--num-data', type=int, default=-1,
help='Number of data to be parsed from parser.'
'-1 indicates to parse all data.')
args = parser.parse_args()
method = args.method
if args.label:
labels = args.label
class_num = len(labels) if isinstance(labels, list) else 1
else:
labels = None
class_num = len(label_names)
# Dataset preparation
train, val, _ = data.load_dataset(method, labels, num_data=args.num_data)
# Network
predictor_ = set_up_predictor(
method, args.unit_num, args.conv_layers, class_num)
iterator_type = args.iterator_type
if iterator_type == 'serial':
train_iter = I.SerialIterator(train, args.batchsize)
elif iterator_type == 'balanced':
if class_num > 1:
raise ValueError('BalancedSerialIterator can be used with only one'
'label classification, please specify label to'
'be predicted by --label option.')
train_iter = BalancedSerialIterator(
train, args.batchsize, train.features[:, -1], ignore_labels=-1)
train_iter.show_label_stats()
else:
raise ValueError('Invalid iterator type {}'.format(iterator_type))
device = chainer.get_device(args.device)
classifier = Classifier(predictor_,
lossfun=F.sigmoid_cross_entropy,
metrics_fun=F.binary_accuracy,
device=device)
extensions_list = []
eval_mode = args.eval_mode
converter = converter_method_dict[method]
if eval_mode == 1:
train_eval_iter = I.SerialIterator(train, args.batchsize,
repeat=False, shuffle=False)
extensions_list.append(ROCAUCEvaluator(
train_eval_iter, classifier, eval_func=predictor_,
device=device, converter=converter, name='train',
pos_labels=1, ignore_labels=-1, raise_value_error=False))
# extension name='validation' is already used by `Evaluator`,
# instead extension name `val` is used.
val_iter = I.SerialIterator(val, args.batchsize,
repeat=False, shuffle=False)
extensions_list.append(ROCAUCEvaluator(
val_iter, classifier, eval_func=predictor_,
device=device, converter=converter, name='val',
pos_labels=1, ignore_labels=-1))
run_train(classifier, train_iter, valid=val,
batch_size=args.batchsize, epoch=args.epoch, out=args.out,
device=device, converter=converter,
extensions_list=extensions_list, resume_path=args.resume)
# frequency = args.epoch if args.frequency == -1 else max(1, args.frequency)
# trainer.extend(E.snapshot(), trigger=(frequency, 'epoch'))
# trainer.run()
config = {'method': args.method,
'conv_layers': args.conv_layers,
'unit_num': args.unit_num,
'labels': args.label}
save_json(os.path.join(args.out, 'config.json'), config)
classifier.save_pickle(os.path.join(args.out, args.model_filename),
protocol=args.protocol)
if __name__ == '__main__':
main()
================================================
FILE: setup.py
================================================
from distutils.core import setup
import os
from setuptools import find_packages
setup_requires = []
install_requires = [
'chainer >=7.0.0',
'joblib',
'matplotlib',
'pandas',
'scikit-learn',
'scipy',
'tqdm',
]
here = os.path.abspath(os.path.dirname(__file__))
# Get __version__ variable
exec(open(os.path.join(here, 'chainer_chemistry', '_version.py')).read())
setup(name='chainer-chemistry',
version=__version__, # NOQA
description='Chainer Chemistry: A Library for Deep Learning in Biology\
and Chemistry',
author='Kosuke Nakago',
author_email='nakago@preferred.jp',
packages=find_packages(),
license='MIT',
url='http://chainer-chemistry.readthedocs.io/en/latest/index.html',
setup_requires=setup_requires,
install_requires=install_requires
)
================================================
FILE: tests/dataset_tests/parsers_tests/test_csv_file_parser.py
================================================
import os
import numpy
import pandas
import pytest
from rdkit import Chem
import six
from chainer_chemistry.dataset.parsers import CSVFileParser
from chainer_chemistry.dataset.preprocessors import NFPPreprocessor
@pytest.fixture
def mol_smiles():
mol_smiles1 = 'CN=C=O'
mol_smiles2 = 'Cc1ccccc1'
mol_smiles3 = 'CC1=CC2CC(CC1)O2'
return [mol_smiles1, mol_smiles2, mol_smiles3]
@pytest.fixture
def mols(mol_smiles):
return [Chem.MolFromSmiles(smiles) for smiles in mol_smiles]
@pytest.fixture()
def label_a():
return [2.1, 5.3, -1.2]
@pytest.fixture()
def csv_file(tmpdir, mol_smiles, label_a):
fname = os.path.join(str(tmpdir), 'test.csv')
df = pandas.DataFrame({
'smiles': mol_smiles,
'labelA': label_a
})
df.to_csv(fname)
return fname
@pytest.fixture()
def csv_file_invalid(tmpdir):
"""CSV file with invalid SMILES"""
fname = os.path.join(str(tmpdir), 'test_invalid.csv')
df = pandas.DataFrame({
'smiles': ['var', 'CN=C=O', 'hoge', 'Cc1ccccc1', 'CC1=CC2CC(CC1)O2'],
'labelA': [0., 2.1, 0., 5.3, -1.2],
})
df.to_csv(fname)
return fname
def check_input_features(actual, expect):
assert len(actual) == len(expect)
for d, e in six.moves.zip(actual, expect):
numpy.testing.assert_array_equal(d, e)
def check_features(actual, expect_input_features, expect_label):
assert len(actual) == len(expect_input_features) + 1
# input features testing
for d, e in six.moves.zip(actual[:-1], expect_input_features):
numpy.testing.assert_array_equal(d, e)
# label testing
assert actual[-1] == expect_label
def test_csv_file_parser_not_return_smiles(csv_file, mols):
preprocessor = NFPPreprocessor()
parser = CSVFileParser(preprocessor, smiles_col='smiles')
# Actually, `dataset, smiles = parser.parse(..)` is enough.
result = parser.parse(csv_file, return_smiles=False)
dataset = result['dataset']
smiles = result['smiles']
is_successful = result['is_successful']
assert len(dataset) == 3
assert smiles is None
assert is_successful is None
# As we want test CSVFileParser, we assume
# NFPPreprocessor works as documented.
for i in range(3):
expect = preprocessor.get_input_features(mols[i])
check_input_features(dataset[i], expect)
def test_csv_file_parser_return_smiles(csv_file, mols, label_a):
"""test `labels` option and retain_smiles=True."""
preprocessor = NFPPreprocessor()
parser = CSVFileParser(preprocessor, labels='labelA', smiles_col='smiles')
result = parser.parse(csv_file, return_smiles=True)
dataset = result['dataset']
smiles = result['smiles']
assert len(dataset) == 3
# As we want test CSVFileParser, we assume
# NFPPreprocessor works as documented.
for i in range(3):
expect = preprocessor.get_input_features(mols[i])
check_features(dataset[i], expect, label_a[i])
# check smiles array
assert type(smiles) == numpy.ndarray
assert smiles.ndim == 1
assert len(smiles) == len(dataset)
assert smiles[0] == 'CN=C=O'
assert smiles[1] == 'Cc1ccccc1'
assert smiles[2] == 'CC1=CC2CC(CC1)O2'
def test_csv_file_parser_target_index(csv_file_invalid, mols, label_a):
"""test `labels` option and retain_smiles=True."""
preprocessor = NFPPreprocessor()
parser = CSVFileParser(preprocessor, labels='labelA', smiles_col='smiles')
result = parser.parse(csv_file_invalid, return_smiles=True,
target_index=[1, 2, 4], return_is_successful=True)
dataset = result['dataset']
smiles = result['smiles']
assert len(dataset) == 2
is_successful = result['is_successful']
assert numpy.array_equal(is_successful, numpy.array([True, False, True]))
assert len(is_successful) == 3
# As we want test CSVFileParser, we assume
# NFPPreprocessor works as documented.
expect = preprocessor.get_input_features(mols[0])
check_features(dataset[0], expect, label_a[0])
expect = preprocessor.get_input_features(mols[2])
check_features(dataset[1], expect, label_a[2])
# check smiles array
assert type(smiles) == numpy.ndarray
assert smiles.ndim == 1
assert len(smiles) == len(dataset)
assert smiles[0] == 'CN=C=O'
assert smiles[1] == 'CC1=CC2CC(CC1)O2'
def test_csv_file_parser_extract_total_num(csv_file):
preprocessor = NFPPreprocessor()
parser = CSVFileParser(preprocessor, labels='labelA', smiles_col='smiles')
num = parser.extract_total_num(csv_file)
assert num == 3
def test_csv_parser_return_is_successful(csv_file_invalid, mols, label_a):
"""test `labels` option and retain_smiles=True."""
preprocessor = NFPPreprocessor()
parser = CSVFileParser(preprocessor, labels='labelA',
smiles_col='smiles')
result = parser.parse(csv_file_invalid, return_smiles=True,
return_is_successful=True)
dataset = result['dataset']
# smiles = result['smiles']
assert len(dataset) == 3
is_successful = result['is_successful']
assert len(is_successful) == 5
# print('is_successful', is_successful)
assert numpy.alltrue(is_successful[[1, 3, 4]])
assert numpy.alltrue(~is_successful[[0, 2]])
# We assume NFPPreprocessor works as documented.
for i in range(3):
expect = preprocessor.get_input_features(mols[i])
check_features(dataset[i], expect, label_a[i])
if __name__ == '__main__':
pytest.main([__file__, '-s', '-v'])
================================================
FILE: tests/dataset_tests/parsers_tests/test_data_frame_parser.py
================================================
import numpy
import pandas
import pytest
from rdkit import Chem
import six
from chainer_chemistry.dataset.parsers import DataFrameParser
from chainer_chemistry.dataset.preprocessors import NFPPreprocessor
@pytest.fixture
def mol_smiles():
mol_smiles1 = 'CN=C=O'
mol_smiles2 = 'Cc1ccccc1'
mol_smiles3 = 'CC1=CC2CC(CC1)O2'
return [mol_smiles1, mol_smiles2, mol_smiles3]
@pytest.fixture
def mols(mol_smiles):
return [Chem.MolFromSmiles(smiles) for smiles in mol_smiles]
@pytest.fixture()
def label_a():
return [2.1, 5.3, -1.2]
@pytest.fixture()
def data_frame(mol_smiles, label_a):
df = pandas.DataFrame({
'smiles': mol_smiles,
'labelA': label_a
})
return df
def check_input_features(actual, expect):
assert len(actual) == len(expect)
for d, e in six.moves.zip(actual, expect):
numpy.testing.assert_array_equal(d, e)
def check_features(actual, expect_input_features, expect_label):
assert len(actual) == len(expect_input_features) + 1
# input features testing
for d, e in six.moves.zip(actual[:-1], expect_input_features):
numpy.testing.assert_array_equal(d, e)
# label testing
assert actual[-1] == expect_label
def test_data_frame_parser_not_return_smiles(data_frame, mols):
"""Test default behavior"""
preprocessor = NFPPreprocessor()
parser = DataFrameParser(preprocessor, smiles_col='smiles')
# Actually, `dataset, smiles = parser.parse(..)` is enough.
result = parser.parse(data_frame, return_smiles=False)
dataset = result['dataset']
smiles = result['smiles']
is_successful = result['is_successful']
assert len(dataset) == 3
assert smiles is None
assert is_successful is None
# As we want test DataFrameParser, we assume
# NFPPreprocessor works as documented.
for i in range(3):
expect = preprocessor.get_input_features(mols[i])
check_input_features(dataset[i], expect)
def test_data_frame_parser_return_smiles(data_frame, mols, label_a):
"""test `labels` option and retain_smiles=True."""
preprocessor = NFPPreprocessor()
parser = DataFrameParser(preprocessor, labels='labelA',
smiles_col='smiles')
result = parser.parse(data_frame, return_smiles=True)
dataset = result['dataset']
smiles = result['smiles']
assert len(dataset) == 3
# We assume NFPPreprocessor works as documented.
for i in range(3):
expect = preprocessor.get_input_features(mols[i])
check_features(dataset[i], expect, label_a[i])
# check smiles array
assert type(smiles) == numpy.ndarray
assert smiles.ndim == 1
assert len(smiles) == len(dataset)
assert smiles[0] == 'CN=C=O'
assert smiles[1] == 'Cc1ccccc1'
assert smiles[2] == 'CC1=CC2CC(CC1)O2'
def test_data_frame_parser_target_index(data_frame, mols, label_a):
"""test `labels` option and retain_smiles=True."""
preprocessor = NFPPreprocessor()
parser = DataFrameParser(preprocessor, labels='labelA',
smiles_col='smiles')
result = parser.parse(data_frame, return_smiles=True, target_index=[0, 2],
return_is_successful=True)
dataset = result['dataset']
smiles = result['smiles']
assert len(dataset) == 2
is_successful = result['is_successful']
assert numpy.alltrue(is_successful)
assert len(is_successful) == 2
# We assume NFPPreprocessor works as documented.
expect = preprocessor.get_input_features(mols[0])
check_features(dataset[0], expect, label_a[0])
expect = preprocessor.get_input_features(mols[2])
check_features(dataset[1], expect, label_a[2])
# check smiles array
assert type(smiles) == numpy.ndarray
assert smiles.ndim == 1
assert len(smiles) == len(dataset)
assert smiles[0] == 'CN=C=O'
assert smiles[1] == 'CC1=CC2CC(CC1)O2'
def test_data_frame_parser_return_is_successful(mols, label_a):
"""test `labels` option and retain_smiles=True."""
preprocessor = NFPPreprocessor()
parser = DataFrameParser(preprocessor, labels='labelA',
smiles_col='smiles')
df = pandas.DataFrame({
'smiles': ['var', 'CN=C=O', 'hoge', 'Cc1ccccc1', 'CC1=CC2CC(CC1)O2'],
'labelA': [0., 2.1, 0., 5.3, -1.2],
})
result = parser.parse(df, return_smiles=True, return_is_successful=True)
dataset = result['dataset']
# smiles = result['smiles']
assert len(dataset) == 3
is_successful = result['is_successful']
assert len(is_successful) == 5
# print('is_successful', is_successful)
assert numpy.alltrue(is_successful[[1, 3, 4]])
assert numpy.alltrue(~is_successful[[0, 2]])
# We assume NFPPreprocessor works as documented.
for i in range(3):
expect = preprocessor.get_input_features(mols[i])
check_features(dataset[i], expect, label_a[i])
def test_data_frame_parser_extract_total_num(data_frame):
"""test `labels` option and retain_smiles=True."""
preprocessor = NFPPreprocessor()
parser = DataFrameParser(preprocessor)
num = parser.extract_total_num(data_frame)
assert num == 3
if __name__ == '__main__':
pytest.main([__file__, '-s', '-v'])
================================================
FILE: tests/dataset_tests/parsers_tests/test_sdf_file_parser.py
================================================
import os
import numpy
import pytest
from rdkit import Chem
import six
from chainer_chemistry.dataset.parsers import SDFFileParser
from chainer_chemistry.dataset.preprocessors import NFPPreprocessor
@pytest.fixture
def mols():
mol1 = Chem.MolFromSmiles('CN=C=O')
mol2 = Chem.MolFromSmiles('Cc1ccccc1')
mol3 = Chem.MolFromSmiles('CC1=CC2CC(CC1)O2')
return [mol1, mol2, mol3]
@pytest.fixture()
def sdf_file(tmpdir, mols):
# Chem.AllChem.Compute2DCoords(mol1)
fname = os.path.join(str(tmpdir), 'test.sdf')
writer = Chem.SDWriter(fname)
for mol in mols:
writer.write(mol)
return fname
@pytest.fixture()
def sdf_file_long(tmpdir):
"""SDFFile with long smiles (ccc...)"""
fname = os.path.join(str(tmpdir), 'test_long.sdf')
writer = Chem.SDWriter(fname)
for smiles in ['CCCCCCCCCCCC', 'CN=C=O', 'CCCCCCCCCCCCCCCC',
'Cc1ccccc1', 'CC1=CC2CC(CC1)O2']:
mol = Chem.MolFromSmiles(smiles)
writer.write(mol)
return fname
def check_input_features(actual, expect):
assert len(actual) == len(expect)
for d, e in six.moves.zip(actual, expect):
numpy.testing.assert_array_equal(d, e)
def test_sdf_file_parser_not_return_smiles(sdf_file, mols):
preprocessor = NFPPreprocessor()
parser = SDFFileParser(preprocessor)
result = parser.parse(sdf_file, return_smiles=False)
dataset = result['dataset']
smiles = result['smiles']
is_successful = result['is_successful']
assert len(dataset) == 3
assert smiles is None
assert is_successful is None
# As we want test SDFFileParser, we assume
# NFPPreprocessor works as documented.
for i in range(3):
expect = preprocessor.get_input_features(mols[i])
check_input_features(dataset[i], expect)
def test_sdf_file_parser_return_smiles(sdf_file, mols):
preprocessor = NFPPreprocessor()
parser = SDFFileParser(preprocessor)
result = parser.parse(sdf_file, return_smiles=True)
dataset = result['dataset']
smiles = result['smiles']
assert len(dataset) == 3
# As we want test SDFFileParser, we assume
# NFPPreprocessor works as documented.
for i in range(3):
expect = preprocessor.get_input_features(mols[i])
check_input_features(dataset[i], expect)
# check smiles array
assert type(smiles) == numpy.ndarray
assert smiles.ndim == 1
assert len(smiles) == len(dataset)
assert smiles[0] == 'CN=C=O'
assert smiles[1] == 'Cc1ccccc1'
assert smiles[2] == 'CC1=CC2CC(CC1)O2'
def test_sdf_file_parser_target_index(sdf_file, mols):
preprocessor = NFPPreprocessor()
parser = SDFFileParser(preprocessor)
result = parser.parse(sdf_file, return_smiles=True, target_index=[0, 2],
return_is_successful=True)
dataset = result['dataset']
smiles = result['smiles']
assert len(dataset) == 2
is_successful = result['is_successful']
assert numpy.alltrue(is_successful)
assert len(is_successful) == 2
# As we want test SDFFileParser, we assume
# NFPPreprocessor works as documented.
expect = preprocessor.get_input_features(mols[0])
check_input_features(dataset[0], expect)
expect = preprocessor.get_input_features(mols[2])
check_input_features(dataset[1], expect)
# check smiles array
assert type(smiles) == numpy.ndarray
assert smiles.ndim == 1
assert len(smiles) == len(dataset)
assert smiles[0] == 'CN=C=O'
assert smiles[1] == 'CC1=CC2CC(CC1)O2'
def test_sdf_file_parser_return_is_successful(sdf_file_long, mols):
"""test `labels` option and retain_smiles=True."""
preprocessor = NFPPreprocessor(max_atoms=10)
parser = SDFFileParser(preprocessor)
result = parser.parse(sdf_file_long,
return_smiles=True, return_is_successful=True)
dataset = result['dataset']
# smiles = result['smiles']
assert len(dataset) == 3
is_successful = result['is_successful']
assert len(is_successful) == 5
assert numpy.alltrue(is_successful[[1, 3, 4]])
assert numpy.alltrue(~is_successful[[0, 2]])
# We assume NFPPreprocessor works as documented.
for i in range(3):
expect = preprocessor.get_input_features(mols[i])
check_input_features(dataset[i], expect)
def test_sdf_file_parser_extract_total_num(sdf_file):
preprocessor = NFPPreprocessor()
parser = SDFFileParser(preprocessor)
num = parser.extract_total_num(sdf_file)
assert num == 3
if __name__ == '__main__':
pytest.main([__file__, '-s', '-v'])
================================================
FILE: tests/dataset_tests/parsers_tests/test_smiles_parser.py
================================================
import numpy
import pytest
from rdkit import Chem
import six
from chainer_chemistry.dataset.parsers import SmilesParser
from chainer_chemistry.dataset.preprocessors import NFPPreprocessor
@pytest.fixture
def mol_smiles():
mol_smiles1 = 'CN=C=O'
mol_smiles2 = 'Cc1ccccc1'
mol_smiles3 = 'CC1=CC2CC(CC1)O2'
return [mol_smiles1, mol_smiles2, mol_smiles3]
@pytest.fixture
def mols(mol_smiles):
return [Chem.MolFromSmiles(smiles) for smiles in mol_smiles]
def check_input_features(actual, expect):
assert len(actual) == len(expect)
for d, e in six.moves.zip(actual, expect):
numpy.testing.assert_array_equal(d, e)
def test_smiles_parser_not_return_smiles(mol_smiles, mols):
preprocessor = NFPPreprocessor()
parser = SmilesParser(preprocessor)
result = parser.parse(mol_smiles, return_smiles=False)
dataset = result['dataset']
smiles = result['smiles']
is_successful = result['is_successful']
assert len(dataset) == 3
assert smiles is None
assert is_successful is None
# As we want test CSVFileParser, we assume
# NFPPreprocessor works as documented.
for i in range(3):
expect = preprocessor.get_input_features(mols[i])
check_input_features(dataset[i], expect)
def test_smiles_parser_return_smiles(mol_smiles, mols):
"""test `labels` option and retain_smiles=True."""
preprocessor = NFPPreprocessor()
parser = SmilesParser(preprocessor)
result = parser.parse(mol_smiles, return_smiles=True)
dataset = result['dataset']
smiles = result['smiles']
assert len(dataset) == 3
# As we want test CSVFileParser, we assume
# NFPPreprocessor works as documented.
for i in range(3):
expect = preprocessor.get_input_features(mols[i])
check_input_features(dataset[i], expect)
# check smiles array
assert type(smiles) == numpy.ndarray
assert smiles.ndim == 1
assert len(smiles) == len(dataset)
assert smiles[0] == 'CN=C=O'
assert smiles[1] == 'Cc1ccccc1'
assert smiles[2] == 'CC1=CC2CC(CC1)O2'
def test_smiles_parser_target_index(mol_smiles, mols):
"""test `labels` option and retain_smiles=True."""
preprocessor = NFPPreprocessor()
parser = SmilesParser(preprocessor)
result = parser.parse(mol_smiles, return_smiles=True, target_index=[0, 2],
return_is_successful=True)
dataset = result['dataset']
smiles = result['smiles']
assert len(dataset) == 2
is_successful = result['is_successful']
assert numpy.alltrue(is_successful)
assert len(is_successful) == 2
# As we want test CSVFileParser, we assume
# NFPPreprocessor works as documented.
expect = preprocessor.get_input_features(mols[0])
check_input_features(dataset[0], expect)
expect = preprocessor.get_input_features(mols[2])
check_input_features(dataset[1], expect)
# check smiles array
assert type(smiles) == numpy.ndarray
assert smiles.ndim == 1
assert len(smiles) == len(dataset)
assert smiles[0] == 'CN=C=O'
assert smiles[1] == 'CC1=CC2CC(CC1)O2'
def test_smiles_parser_return_is_successful(mols):
"""test `labels` option and retain_smiles=True."""
preprocessor = NFPPreprocessor()
parser = SmilesParser(preprocessor)
mol_smiles_with_invalid = [
'var', 'CN=C=O', 'hoge', 'Cc1ccccc1', 'CC1=CC2CC(CC1)O2']
result = parser.parse(mol_smiles_with_invalid, return_smiles=True,
return_is_successful=True)
dataset = result['dataset']
assert len(dataset) == 3
is_successful = result['is_successful']
assert len(is_successful) == 5
assert numpy.alltrue(is_successful[[1, 3, 4]])
assert numpy.alltrue(~is_successful[[0, 2]])
# We assume NFPPreprocessor works as documented.
for i in range(3):
expect = preprocessor.get_input_features(mols[i])
check_input_features(dataset[i], expect)
def test_smiles_parser_extract_total_num(mol_smiles):
preprocessor = NFPPreprocessor()
parser = SmilesParser(preprocessor)
num = parser.extract_total_num(mol_smiles)
assert num == 3
if __name__ == '__main__':
pytest.main([__file__, '-s', '-v'])
================================================
FILE: tests/dataset_tests/preprocessor_tests/test_common.py
================================================
import numpy
import pytest
from rdkit import Chem
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.dataset.preprocessors import common
from chainer_chemistry.utils.extend import extend_adj
@pytest.fixture
def sample_molecule():
return Chem.MolFromSmiles('CN=C=O')
@pytest.fixture
def sample_molecule_2():
return Chem.MolFromSmiles('Cc1ccccc1')
class TestGetAtomicNumbers(object):
def test_normal(self, sample_molecule):
actual = common.construct_atomic_number_array(sample_molecule)
assert actual.shape == (4,)
expect = numpy.array([6, 7, 6, 8], dtype=numpy.int32)
numpy.testing.assert_equal(actual, expect)
def test_padding(self, sample_molecule):
actual = common.construct_atomic_number_array(sample_molecule, 5)
assert actual.shape == (5,)
expect = numpy.array([6, 7, 6, 8, 0], dtype=numpy.int32)
numpy.testing.assert_equal(actual, expect)
def test_normal_truncated(self, sample_molecule):
with pytest.raises(ValueError):
adj = common.construct_atomic_number_array(sample_molecule, 3) # NOQA
class TestGetAdjMatrix(object):
def test_normal(self, sample_molecule_2):
adj = common.construct_adj_matrix(sample_molecule_2)
assert adj.shape == (7, 7)
expect = numpy.array(
[[1., 1., 0., 0., 0., 0., 0., ],
[1., 1., 1., 0., 0., 0., 1., ],
[0., 1., 1., 1., 0., 0., 0., ],
[0., 0., 1., 1., 1., 0., 0., ],
[0., 0., 0., 1., 1., 1., 0., ],
[0., 0., 0., 0., 1., 1., 1., ],
[0., 1., 0., 0., 0., 1., 1., ]],
dtype=numpy.float32)
numpy.testing.assert_equal(adj, expect)
def test_normal_no_self_connection(self, sample_molecule_2):
adj = common.construct_adj_matrix(sample_molecule_2,
self_connection=False)
assert adj.shape == (7, 7)
expect = numpy.array(
[[0., 1., 0., 0., 0., 0., 0.],
[1., 0., 1., 0., 0., 0., 1.],
[0., 1., 0., 1., 0., 0., 0.],
[0., 0., 1., 0., 1., 0., 0.],
[0., 0., 0., 1., 0., 1., 0.],
[0., 0., 0., 0., 1., 0., 1.],
[0., 1., 0., 0., 0., 1., 0.]],
dtype=numpy.float32)
numpy.testing.assert_equal(adj, expect)
def test_normal_padding(self, sample_molecule_2):
adj = common.construct_adj_matrix(sample_molecule_2, 8)
assert adj.shape == (8, 8)
expect = numpy.array(
[[1., 1., 0., 0., 0., 0., 0., 0.],
[1., 1., 1., 0., 0., 0., 1., 0.],
[0., 1., 1., 1., 0., 0., 0., 0.],
[0., 0., 1., 1., 1., 0., 0., 0.],
[0., 0., 0., 1., 1., 1., 0., 0.],
[0., 0., 0., 0., 1., 1., 1., 0.],
[0., 1., 0., 0., 0., 1., 1., 0.],
[0., 0., 0., 0., 0., 0., 0., 0.]],
dtype=numpy.float32)
numpy.testing.assert_equal(adj, expect)
def test_normal_truncated(self, sample_molecule_2):
with pytest.raises(ValueError):
adj = common.construct_adj_matrix(sample_molecule_2, 6) # NOQA
class TestConstructDiscreteEdgeMatrix(object):
expect_adj = numpy.array(
[[[0., 1., 0., 0., 0., 0., 0.],
[1., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0.]],
[[0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0.]],
[[0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0.]],
[[0., 0., 0., 0., 0., 0., 0.],
[0., 0., 1., 0., 0., 0., 1.],
[0., 1., 0., 1., 0., 0., 0.],
[0., 0., 1., 0., 1., 0., 0.],
[0., 0., 0., 1., 0., 1., 0.],
[0., 0., 0., 0., 1., 0., 1.],
[0., 1., 0., 0., 0., 1., 0.]]], dtype=numpy.float32)
def test_default(self, sample_molecule_2):
adj = common.construct_discrete_edge_matrix(sample_molecule_2)
assert adj.shape == (4, 7, 7)
numpy.testing.assert_equal(adj, self.expect_adj)
def test_add_self_connection_channel(self, sample_molecule_2):
adj = common.construct_discrete_edge_matrix(
sample_molecule_2, add_self_connection_channel=True)
assert adj.shape == (5, 7, 7)
numpy.testing.assert_equal(adj[:4], self.expect_adj)
numpy.testing.assert_equal(adj[4], numpy.eye(7, 7))
def test_padding(self, sample_molecule_2):
adj = common.construct_discrete_edge_matrix(sample_molecule_2, 8)
assert adj.shape == (4, 8, 8)
expect = extend_adj(self.expect_adj, out_size=8, axis=[-1, -2])
numpy.testing.assert_equal(adj, expect)
def test_truncated(self, sample_molecule_2):
with pytest.raises(ValueError):
adj = common.construct_discrete_edge_matrix(sample_molecule_2, 6) # NOQA
def test_construct_super_node_feature_adj_ndim2(sample_molecule):
adj = common.construct_adj_matrix(sample_molecule)
atom_array = common.construct_atomic_number_array(sample_molecule)
s = common.construct_supernode_feature(sample_molecule, atom_array, adj)
# print(s)
assert s.shape == (MAX_ATOMIC_NUM * 2 + 4,)
assert s[0] == len(atom_array)
assert s[1] == adj.sum()
assert s[2] == 1
assert s[3] == 1
assert s[3 + 6] == 1 # C
assert s[3 + 7] == 1 # N
assert s[3 + 8] == 1 # O
assert s[3 + MAX_ATOMIC_NUM] == 0 # other
assert s[3 + MAX_ATOMIC_NUM + 6] == 2 / len(atom_array)
assert s[3 + MAX_ATOMIC_NUM + 7] == 1 / len(atom_array)
assert s[3 + MAX_ATOMIC_NUM + 8] == 1 / len(atom_array)
assert s[3 + MAX_ATOMIC_NUM * 2] == 0
def test_construct_super_node_feature_adj_ndim3(sample_molecule):
adj = common.construct_discrete_edge_matrix(sample_molecule)
atom_array = common.construct_atomic_number_array(sample_molecule)
s = common.construct_supernode_feature(sample_molecule, atom_array, adj)
assert s.shape == (MAX_ATOMIC_NUM * 2 + 10,)
assert s[0] == len(atom_array)
assert s[1] == adj.sum()
assert s[2] == 1
assert s[3] == 1
assert s[4] == 0
assert s[5] == 0
assert pytest.approx(s[6], 1 * 2 / adj.sum()) # symmetric
assert pytest.approx(s[7], 2 * 2 / adj.sum()) # symmetric
assert s[8] == 0
assert s[9] == 0
assert s[9 + 6] == 1 # C
assert s[9 + 6] == 1 # N
assert s[9 + 7] == 1 # O
assert s[9 + MAX_ATOMIC_NUM] == 0 # other
assert s[9 + MAX_ATOMIC_NUM + 6] == 2 / len(atom_array)
assert s[9 + MAX_ATOMIC_NUM + 7] == 1 / len(atom_array)
assert s[9 + MAX_ATOMIC_NUM + 8] == 1 / len(atom_array)
assert s[9 + MAX_ATOMIC_NUM * 2] == 0
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/dataset_tests/preprocessors_tests/test_atomic_number_preprocessor.py
================================================
import numpy
import pytest
from rdkit import Chem
from chainer_chemistry.dataset.parsers import SmilesParser
from chainer_chemistry.dataset.preprocessors.atomic_number_preprocessor import AtomicNumberPreprocessor # NOQA
from chainer_chemistry.dataset.preprocessors.common import MolFeatureExtractionError # NOQA
@pytest.fixture
def mol():
ret = Chem.MolFromSmiles('CN=C=O')
return ret
def test_atomic_number_default_preprocessor(mol):
preprocessor = AtomicNumberPreprocessor()
ret_atom_array = preprocessor.get_input_features(mol)
expect_atom_array = numpy.array([6, 7, 6, 8], dtype=numpy.int32)
numpy.testing.assert_array_equal(ret_atom_array, expect_atom_array)
def test_atomic_number_non_default_padding_preprocessor(mol):
preprocessor = AtomicNumberPreprocessor(out_size=10)
ret_atom_array = preprocessor.get_input_features(mol)
expect_atom_array = numpy.array([6, 7, 6, 8, 0, 0, 0, 0, 0, 0],
dtype=numpy.int32)
numpy.testing.assert_array_equal(ret_atom_array, expect_atom_array)
def test_atomic_number_non_default_max_atoms_preprocessor(mol):
preprocessor = AtomicNumberPreprocessor(max_atoms=5)
ret_atom_array = preprocessor.get_input_features(mol)
expect_atom_array = numpy.array([6, 7, 6, 8],
dtype=numpy.int32)
numpy.testing.assert_array_equal(ret_atom_array, expect_atom_array)
preprocessor = AtomicNumberPreprocessor(max_atoms=3)
with pytest.raises(MolFeatureExtractionError):
preprocessor.get_input_features(mol)
def test_atomic_number_preprocessor(mol):
preprocessor = AtomicNumberPreprocessor(max_atoms=5, out_size=10)
ret_atom_array = preprocessor.get_input_features(mol)
expect_atom_array = numpy.array([6, 7, 6, 8, 0, 0, 0, 0, 0, 0],
dtype=numpy.int32)
numpy.testing.assert_array_equal(ret_atom_array, expect_atom_array)
def test_atomic_number_preprocessor_default():
preprocessor = AtomicNumberPreprocessor()
dataset = SmilesParser(preprocessor).parse(
['C#N', 'Cc1cnc(C=O)n1C', 'c1ccccc1'])['dataset']
index = numpy.random.choice(len(dataset), None)
atoms, = dataset[index]
assert atoms.ndim == 1
assert atoms.dtype == numpy.int32
def test_atomic_number_preprocessor_assert_raises():
with pytest.raises(ValueError):
AtomicNumberPreprocessor(max_atoms=3, out_size=2) # NOQA
if __name__ == '__main__':
pytest.main()
================================================
FILE: tests/dataset_tests/preprocessors_tests/test_cgcnn_preprocessor.py
================================================
import pytest
from chainer_chemistry.dataset.preprocessors import CGCNNPreprocessor
def test_cgcnn_preprocessor_init():
pp = CGCNNPreprocessor()
print('pp.atom_features', pp.atom_features)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/dataset_tests/preprocessors_tests/test_gat_preprocessor.py
================================================
import numpy
import pytest
from chainer_chemistry.dataset.parsers import SDFFileParser
from chainer_chemistry.dataset.preprocessors import RelGATPreprocessor
from chainer_chemistry.datasets import get_tox21_filepath
@pytest.mark.slow
def test_gat_preprocessor():
preprocessor = RelGATPreprocessor()
def postprocess_label(label_list):
# Set -1 to the place where the label is not found,
# this corresponds to not calculate loss with `sigmoid_cross_entropy`
return [-1 if label is None else label for label in label_list]
dataset = SDFFileParser(preprocessor, postprocess_label=postprocess_label
).parse(get_tox21_filepath('train'))["dataset"]
index = numpy.random.choice(len(dataset), None)
atoms, adjs = dataset[index]
assert atoms.ndim == 1 # (atom, )
assert atoms.dtype == numpy.int32
# (edge_type, atom from, atom to)
assert adjs.ndim == 3
assert adjs.dtype == numpy.float32
def test_gat_preprocessor_assert_raises():
with pytest.raises(ValueError):
pp = RelGATPreprocessor(max_atoms=3, out_size=2) # NOQA
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/dataset_tests/preprocessors_tests/test_ggnn_preprocessor.py
================================================
import numpy
import pytest
from chainer_chemistry.dataset.parsers import SmilesParser
from chainer_chemistry.dataset.preprocessors import GGNNPreprocessor
def test_ggnn_preprocessor():
preprocessor = GGNNPreprocessor()
dataset = SmilesParser(preprocessor).parse(
['C#N', 'Cc1cnc(C=O)n1C', 'c1ccccc1']
)["dataset"]
index = numpy.random.choice(len(dataset), None)
atoms, adjs = dataset[index]
assert atoms.ndim == 1 # (atom, )
assert atoms.dtype == numpy.int32
# (edge_type, atom from, atom to)
assert adjs.ndim == 3
assert adjs.dtype == numpy.float32
atoms0, adjs0 = dataset[0]
assert numpy.allclose(atoms0, numpy.array([6, 7], numpy.int32))
expect_adjs = numpy.array(
[[[0., 0.],
[0., 0.]],
[[0., 0.],
[0., 0.]],
[[0., 1.],
[1., 0.]],
[[0., 0.],
[0., 0.]]], dtype=numpy.float32)
assert numpy.allclose(adjs0, expect_adjs)
atoms1, adjs1 = dataset[1]
assert numpy.allclose(
atoms1, numpy.array([6, 6, 6, 7, 6, 6, 8, 7, 6], numpy.int32))
# include aromatic bond (ch=3)
expect_adjs = numpy.array(
[[[0., 1., 0., 0., 0., 0., 0., 0., 0.],
[1., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 1., 0., 0., 0.],
[0., 0., 0., 0., 1., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 1.],
[0., 0., 0., 0., 0., 0., 0., 1., 0.]],
[[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 1., 0., 0.],
[0., 0., 0., 0., 0., 1., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.]],
[[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.]],
[[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 1., 0., 0., 0., 0., 1., 0.],
[0., 1., 0., 1., 0., 0., 0., 0., 0.],
[0., 0., 1., 0., 1., 0., 0., 0., 0.],
[0., 0., 0., 1., 0., 0., 0., 1., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 1., 0., 0., 1., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.]]], dtype=numpy.float32)
assert numpy.allclose(adjs1, expect_adjs)
def test_ggnn_preprocessor_kekulize():
preprocessor = GGNNPreprocessor(kekulize=True)
dataset = SmilesParser(preprocessor).parse(
['C#N', 'Cc1cnc(C=O)n1C', 'c1ccccc1']
)["dataset"]
atoms1, adjs1 = dataset[1]
assert numpy.allclose(
atoms1, numpy.array([6, 6, 6, 7, 6, 6, 8, 7, 6], numpy.int32))
# NOT include aromatic bond (ch=3)
expect_adjs = numpy.array(
[[[0., 1., 0., 0., 0., 0., 0., 0., 0.],
[1., 0., 0., 0., 0., 0., 0., 1., 0.],
[0., 0., 0., 1., 0., 0., 0., 0., 0.],
[0., 0., 1., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 1., 0., 1., 0.],
[0., 0., 0., 0., 1., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 1., 0., 0., 1., 0., 0., 0., 1.],
[0., 0., 0., 0., 0., 0., 0., 1., 0.]],
[[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 1., 0., 0., 0., 0., 0., 0.],
[0., 1., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 1., 0., 0., 0., 0.],
[0., 0., 0., 1., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 1., 0., 0.],
[0., 0., 0., 0., 0., 1., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.]],
[[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.]],
[[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.]]], dtype=numpy.float32)
assert numpy.allclose(adjs1, expect_adjs)
def test_ggnn_preprocessor_assert_raises():
with pytest.raises(ValueError):
pp = GGNNPreprocessor(max_atoms=3, out_size=2) # NOQA
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/dataset_tests/preprocessors_tests/test_gwm_preprocessor.py
================================================
import pytest
from rdkit import Chem
from chainer_chemistry.dataset.preprocessors.gwm_preprocessor import (
NFPGWMPreprocessor, GGNNGWMPreprocessor, GINGWMPreprocessor,
RSGCNGWMPreprocessor) # NOQA
@pytest.fixture
def mol():
ret = Chem.MolFromSmiles('CN=C=O')
return ret
@pytest.mark.parametrize('pp_type', [
NFPGWMPreprocessor, GGNNGWMPreprocessor, GINGWMPreprocessor,
RSGCNGWMPreprocessor])
def test_gwm_preprocessor(mol, pp_type):
pp = pp_type()
ret = pp.get_input_features(mol)
# currently all preprocessor returns `super_node_x` at 3rd args.
assert len(ret) == 3
super_node_x = ret[2]
# print('super_node_x', super_node_x.shape, super_node_x)
assert super_node_x.ndim == 1
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/dataset_tests/preprocessors_tests/test_mol_preprocessor.py
================================================
import pytest
from rdkit import Chem
from chainer_chemistry.dataset.preprocessors import MolPreprocessor
@pytest.fixture
def mol():
ret = Chem.MolFromSmiles('CN=C=O')
ret.SetProp('foo', '1')
ret.SetProp('bar', '2')
return ret
@pytest.fixture
def pp():
return MolPreprocessor()
class TestGetLabel(object):
def test_default(self, mol, pp):
labels = pp.get_label(mol)
assert labels == []
def test_empty(self, mol, pp):
labels = pp.get_label(mol, [])
assert labels == []
def test_one_label(self, mol, pp):
labels = pp.get_label(mol, ['foo'])
assert labels == ['1']
def test_two_labels(self, mol, pp):
labels = pp.get_label(mol, ['bar', 'foo'])
assert labels == ['2', '1']
def test_non_existent_label(self, mol, pp):
labels = pp.get_label(mol, ['foo', 'buz'])
assert labels == ['1', None]
if __name__ == '__main__':
pytest.main()
================================================
FILE: tests/dataset_tests/preprocessors_tests/test_nfp_preprocessor.py
================================================
import numpy
import pytest
from rdkit import Chem
from chainer_chemistry.dataset.parsers import SmilesParser
from chainer_chemistry.dataset.preprocessors import NFPPreprocessor
@pytest.fixture
def mol():
ret = Chem.MolFromSmiles('CN=C=O')
return ret
@pytest.fixture
def pp():
return NFPPreprocessor()
def test_nfp_preprocessor(mol, pp):
ret = pp.get_input_features(mol)
assert len(ret) == 2
actual_atom_array, actual_adj_array = ret
expect_atom_array = numpy.array([6, 7, 6, 8], dtype=numpy.int32)
numpy.testing.assert_array_equal(actual_atom_array, expect_atom_array)
expect_adj_array = numpy.array([[1, 1, 0, 0],
[1, 1, 1, 0],
[0, 1, 1, 1],
[0, 0, 1, 1]], dtype=numpy.float32)
numpy.testing.assert_array_equal(actual_adj_array, expect_adj_array)
def test_nfp_preprocessor_default():
preprocessor = NFPPreprocessor()
dataset = SmilesParser(preprocessor).parse(
['C#N', 'Cc1cnc(C=O)n1C', 'c1ccccc1'])['dataset']
index = numpy.random.choice(len(dataset), None)
atoms, adjs = dataset[index]
assert atoms.ndim == 1 # (atom, )
assert atoms.dtype == numpy.int32
# (atom from, atom to)
assert adjs.ndim == 2
assert adjs.dtype == numpy.float32
def test_nfp_preprocessor_assert_raises():
with pytest.raises(ValueError):
pp = NFPPreprocessor(max_atoms=3, out_size=2) # NOQA
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/dataset_tests/preprocessors_tests/test_relgcn_preprocessor.py
================================================
import numpy
import pytest
from chainer_chemistry.dataset.parsers import SmilesParser
from chainer_chemistry.dataset.preprocessors import RelGCNPreprocessor
def test_relgcn_preprocessor():
preprocessor = RelGCNPreprocessor()
dataset = SmilesParser(preprocessor).parse(
['C#N', 'Cc1cnc(C=O)n1C', 'c1ccccc1']
)["dataset"]
index = numpy.random.choice(len(dataset), None)
atoms, adjs = dataset[index]
assert atoms.ndim == 1 # (atom, )
assert atoms.dtype == numpy.int32
# (edge_type, atom from, atom to)
assert adjs.ndim == 3
assert adjs.dtype == numpy.float32
atoms0, adjs0 = dataset[0]
assert numpy.allclose(atoms0, numpy.array([6, 7], numpy.int32))
expect_adjs = numpy.array(
[[[0., 0.],
[0., 0.]],
[[0., 0.],
[0., 0.]],
[[0., 1.],
[1., 0.]],
[[0., 0.],
[0., 0.]]], dtype=numpy.float32)
assert numpy.allclose(adjs0, expect_adjs)
atoms1, adjs1 = dataset[1]
assert numpy.allclose(
atoms1, numpy.array([6, 6, 6, 7, 6, 6, 8, 7, 6], numpy.int32))
# include aromatic bond (ch=3)
expect_adjs = numpy.array(
[[[0., 1., 0., 0., 0., 0., 0., 0., 0.],
[1., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 1., 0., 0., 0.],
[0., 0., 0., 0., 1., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 1.],
[0., 0., 0., 0., 0., 0., 0., 1., 0.]],
[[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 1., 0., 0.],
[0., 0., 0., 0., 0., 1., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.]],
[[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.]],
[[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 1., 0., 0., 0., 0., 1., 0.],
[0., 1., 0., 1., 0., 0., 0., 0., 0.],
[0., 0., 1., 0., 1., 0., 0., 0., 0.],
[0., 0., 0., 1., 0., 0., 0., 1., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 1., 0., 0., 1., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.]]], dtype=numpy.float32)
assert numpy.allclose(adjs1, expect_adjs)
def test_relgcn_preprocessor_kekulize():
preprocessor = RelGCNPreprocessor(kekulize=True)
dataset = SmilesParser(preprocessor).parse(
['C#N', 'Cc1cnc(C=O)n1C', 'c1ccccc1']
)["dataset"]
atoms1, adjs1 = dataset[1]
assert numpy.allclose(
atoms1, numpy.array([6, 6, 6, 7, 6, 6, 8, 7, 6], numpy.int32))
# NOT include aromatic bond (ch=3)
expect_adjs = numpy.array(
[[[0., 1., 0., 0., 0., 0., 0., 0., 0.],
[1., 0., 0., 0., 0., 0., 0., 1., 0.],
[0., 0., 0., 1., 0., 0., 0., 0., 0.],
[0., 0., 1., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 1., 0., 1., 0.],
[0., 0., 0., 0., 1., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 1., 0., 0., 1., 0., 0., 0., 1.],
[0., 0., 0., 0., 0., 0., 0., 1., 0.]],
[[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 1., 0., 0., 0., 0., 0., 0.],
[0., 1., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 1., 0., 0., 0., 0.],
[0., 0., 0., 1., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 1., 0., 0.],
[0., 0., 0., 0., 0., 1., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.]],
[[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.]],
[[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.],
[0., 0., 0., 0., 0., 0., 0., 0., 0.]]], dtype=numpy.float32)
assert numpy.allclose(adjs1, expect_adjs)
def test_relgcn_preprocessor_assert_raises():
with pytest.raises(ValueError):
pp = RelGCNPreprocessor(max_atoms=3, out_size=2) # NOQA
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/dataset_tests/preprocessors_tests/test_rsgcn_preprocessor.py
================================================
import numpy
import pytest
from rdkit import Chem
from chainer_chemistry.dataset.parsers import SmilesParser
from chainer_chemistry.dataset.preprocessors.common import MolFeatureExtractionError # NOQA
from chainer_chemistry.dataset.preprocessors.rsgcn_preprocessor import RSGCNPreprocessor # NOQA
@pytest.fixture
def mol():
return Chem.MolFromSmiles('CN=C=O')
def test_rsgcn_default_preprocessor(mol):
preprocessor = RSGCNPreprocessor()
ret_atom_array, ret_adj_array = preprocessor.get_input_features(mol)
expect_atom_array = numpy.array([6, 7, 6, 8], dtype=numpy.int32)
expect_adj_array = numpy.array(
[[0.5, 0.4082, 0, 0], [0.4082, 0.3333, 0.3333, 0],
[0, 0.3333, 0.3333, 0.4082], [0, 0, 0.4082, 0.5]],
dtype=numpy.float32)
numpy.testing.assert_array_equal(ret_atom_array, expect_atom_array)
numpy.testing.assert_allclose(
ret_adj_array, expect_adj_array, rtol=1e-03, atol=1e-03)
def test_rsgcn_non_default_padding_preprocessor(mol):
preprocessor = RSGCNPreprocessor(out_size=7)
ret_atom_array, ret_adj_array = preprocessor.get_input_features(mol)
expect_atom_array = numpy.array([6, 7, 6, 8, 0, 0, 0], dtype=numpy.int32)
expect_adj_array = numpy.array(
[[0.5, 0.4082, 0, 0, 0, 0, 0], [0.4082, 0.3333, 0.3333, 0, 0, 0, 0],
[0, 0.3333, 0.3333, 0.4082, 0, 0, 0], [0, 0, 0.4082, 0.5, 0, 0, 0],
[0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0], [0, 0, 0, 0, 0, 0, 0]],
dtype=numpy.float32)
numpy.testing.assert_array_equal(ret_atom_array, expect_atom_array)
numpy.testing.assert_allclose(
ret_adj_array, expect_adj_array, rtol=1e-03, atol=1e-03)
def test_rsgcn_non_default_max_atoms_preprocessor(mol):
preprocessor = RSGCNPreprocessor(max_atoms=5)
ret_atom_array, ret_adj_array = preprocessor.get_input_features(mol)
expect_atom_array = numpy.array([6, 7, 6, 8], dtype=numpy.int32)
expect_adj_array = numpy.array(
[[0.5, 0.4082, 0, 0], [0.4082, 0.3333, 0.3333, 0],
[0, 0.3333, 0.3333, 0.4082], [0, 0, 0.4082, 0.5]],
dtype=numpy.float32)
numpy.testing.assert_array_equal(ret_atom_array, expect_atom_array)
numpy.testing.assert_allclose(
ret_adj_array, expect_adj_array, rtol=1e-03, atol=1e-03)
preprocessor = RSGCNPreprocessor(max_atoms=3)
with pytest.raises(MolFeatureExtractionError):
preprocessor.get_input_features(mol)
def test_rsgcn_preprocessor(mol):
preprocessor = RSGCNPreprocessor(max_atoms=4, out_size=4)
ret_atom_array, ret_adj_array = preprocessor.get_input_features(mol)
expect_atom_array = numpy.array([6, 7, 6, 8], dtype=numpy.int32)
expect_adj_array = numpy.array(
[[0.5, 0.4082, 0, 0], [0.4082, 0.3333, 0.3333, 0],
[0, 0.3333, 0.3333, 0.4082], [0, 0, 0.4082, 0.5]],
dtype=numpy.float32)
numpy.testing.assert_array_equal(ret_atom_array, expect_atom_array)
numpy.testing.assert_allclose(
ret_adj_array, expect_adj_array, rtol=1e-03, atol=1e-03)
def test_rsgcn_preprocessor_default():
preprocessor = RSGCNPreprocessor()
dataset = SmilesParser(preprocessor).parse(
['C#N', 'Cc1cnc(C=O)n1C', 'c1ccccc1'])['dataset']
index = numpy.random.choice(len(dataset), None)
atoms, adjacency = dataset[index]
assert atoms.ndim == 1 # (atom, )
assert atoms.dtype == numpy.int32
assert adjacency.ndim == 2
assert adjacency.dtype == numpy.float32
def test_rsgcn_preprocessor_assert_raises():
with pytest.raises(ValueError):
RSGCNPreprocessor(max_atoms=3, out_size=2) # NOQA
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/dataset_tests/preprocessors_tests/test_schnet_preprocessor.py
================================================
import numpy
import pytest
from rdkit import Chem
from chainer_chemistry.dataset.parsers import SmilesParser
from chainer_chemistry.dataset.preprocessors.schnet_preprocessor import SchNetPreprocessor # NOQA
@pytest.fixture
def mol():
ret = Chem.MolFromSmiles('CN=C=O')
return ret
@pytest.fixture
def pp():
return SchNetPreprocessor()
def test_schnet_preprocessor(mol, pp):
ret = pp.get_input_features(mol)
assert len(ret) == 2
actual_atom_array, actual_adj_array = ret
expect_atom_array = numpy.array([6, 7, 6, 8], dtype=numpy.int32)
numpy.testing.assert_array_equal(actual_atom_array, expect_atom_array)
# TODO(nakago): write test for adj matrix.
# print(actual_adj_array)
# expect_adj_array = numpy.array([[1, 1, 0, 0],
# [1, 1, 1, 0],
# [0, 1, 1, 1],
# [0, 0, 1, 1]], dtype=numpy.float32)
# numpy.testing.assert_array_equal(actual_adj_array, expect_adj_array)
def test_schnet_preprocessor_default():
preprocessor = SchNetPreprocessor()
dataset = SmilesParser(preprocessor).parse(
['C#N', 'Cc1cnc(C=O)n1C', 'c1ccccc1'])['dataset']
index = numpy.random.choice(len(dataset), None)
atoms, adjs = dataset[index]
assert atoms.ndim == 1 # (atom, )
assert atoms.dtype == numpy.int32
# (atom from, atom to)
assert adjs.ndim == 2
assert adjs.dtype == numpy.float32
def test_schnet_preprocessor_assert_raises():
with pytest.raises(ValueError):
pp = SchNetPreprocessor(max_atoms=3, out_size=2) # NOQA
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/dataset_tests/preprocessors_tests/test_weavenet_preprocessor.py
================================================
import numpy
import pytest
from chainer_chemistry.dataset.parsers import SmilesParser
from chainer_chemistry.dataset.preprocessors.weavenet_preprocessor import WeaveNetPreprocessor # NOQA
@pytest.mark.parametrize('max_atoms', [20, 30])
@pytest.mark.parametrize('use_fixed_atom_feature', [True, False])
def test_weave_preprocessor(max_atoms, use_fixed_atom_feature):
preprocessor = WeaveNetPreprocessor(
max_atoms=max_atoms, use_fixed_atom_feature=use_fixed_atom_feature)
dataset = SmilesParser(preprocessor).parse(
['C#N', 'Cc1cnc(C=O)n1C', 'c1ccccc1']
)["dataset"]
index = numpy.random.choice(len(dataset), None)
atoms, adjs = dataset[index]
if use_fixed_atom_feature:
assert atoms.ndim == 2 # (atom, ch)
assert atoms.dtype == numpy.float32
else:
assert atoms.ndim == 1 # (atom, )
assert atoms.dtype == numpy.int32
# (atom from * atom to, ch)
assert adjs.ndim == 2
assert adjs.shape[0] == max_atoms * max_atoms
assert adjs.dtype == numpy.float32
# TODO(nakago): test feature extraction behavior...
atoms0, adjs0 = dataset[0]
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/dataset_tests/preprocessors_tests/test_wle.py
================================================
import numpy as np
import pytest
from chainer_chemistry.dataset.preprocessors import wle as WLE # NOQA
from chainer_chemistry.datasets.numpy_tuple_dataset import NumpyTupleDataset
@pytest.fixture
def small_datasets():
N_1 = 3
N_2 = 5
# one-hot atom labels: 1 tp N
atom_array_1 = np.arange(N_1)
atom_array_2 = np.arange(N_2)
# adj-array, manually
# all connectes. expanded labels is a permutaion of 0,1,2
adj_array_1 = np.array([[1, 1, 1],
[1, 1, 1],
[1, 1, 1]]).astype(np.int32)
# node 0 --> 0-1.2
# node 1 --> 1-0.2
# node 2 --> 2-0.1
adj_array_2 = np.array([[1, 1, 0, 0, 1],
[1, 1, 0, 0, 1],
[0, 0, 1, 1, 0],
[0, 0, 1, 1, 0],
[1, 1, 0, 0, 1]]).astype(np.float32)
# node 0 --> 0-1.4
# node 1 --> 1-0.4
# node 2 --> 2-3
# node 3 --> 3-2
# node 4 --> 4-0.1
# supervised labels, dummy
teach_signal_1 = np.array(1).astype(np.int)
teach_signal_2 = np.array(0).astype(np.int)
# concat in a one numpy array!
atom_arrays = np.array([atom_array_1, atom_array_2])
adj_arrays = np.array([adj_array_1, adj_array_2])
teach_signals = np.array([teach_signal_1, teach_signal_2])
# train/val/test dataset, respectively
datasets = [NumpyTupleDataset(atom_arrays, adj_arrays, teach_signals),
NumpyTupleDataset(atom_arrays, adj_arrays, teach_signals),
NumpyTupleDataset(atom_arrays, adj_arrays, teach_signals)]
return datasets
def _get_elements(datasets, idx):
return [[mol[1] for mol in d] for d in datasets]
def _get_atom_arrays(datasets):
return _get_elements(datasets, 0)
def _get_adj_arrays(datasets):
return _get_elements(datasets, 1)
def _get_wle_arrays(datasets):
return _get_elements(datasets, 2)
def _get_teach_signals(datasets, is_cwle=False):
if is_cwle:
return _get_elements(datasets, 2)
else:
return _get_elements(datasets, 3)
def _check_np_array(actuals, expects):
assert len(actuals) == len(expects) == 3 # train/test/val
for actual_adjs, expect_adjs in zip(actuals, expects):
assert len(actual_adjs) == len(expect_adjs)
[np.testing.assert_array_equal(a, e)
for a, e in zip(actual_adjs, expect_adjs)]
def test_wle(small_datasets):
ret_value = WLE.apply_wle_for_datasets(small_datasets, 0)
actual_datasets, actual_labels, actual_frequency = ret_value
expected_frequency = {'0-1.2': 3,
'1-0.2': 3,
'2-0.1': 3,
'0-1.4': 3,
'1-0.4': 3,
'2-3': 3,
'3-2': 3,
'4-0.1': 3}
assert expected_frequency == actual_frequency
expected_labels = set(expected_frequency.keys())
assert expected_labels == set(actual_labels)
actual_adj_arrays = _get_adj_arrays(actual_datasets)
expect_adj_arrays = _get_adj_arrays(small_datasets)
_check_np_array(actual_adj_arrays, expect_adj_arrays)
actual_signal_arrays = _get_teach_signals(actual_datasets)
expect_signal_arrays = _get_teach_signals(small_datasets)
_check_np_array(actual_signal_arrays, expect_signal_arrays)
# Check atom_arrays of train/val/test datasets are identical.
# 2 is the number of samples in each (train/val/test) dataset.
atom_arrays = _get_atom_arrays(actual_datasets)
first_mols = [d[0] for d in atom_arrays]
second_mols = [d[1] for d in atom_arrays]
for mols in (first_mols, second_mols):
assert len(mols) == 3
np.testing.assert_array_equal(mols[0], mols[1])
np.testing.assert_array_equal(mols[1], mols[2])
def test_2_hop_wle(small_datasets):
k = 2
ret_value = WLE.apply_wle_for_datasets(small_datasets, 0, k)
actual_datasets, actual_labels, actual_frequency = ret_value
expected_frequency = {'0-1.2': 3,
'1-0.2': 3,
'2-0.1': 3,
'3-4.7': 3,
'4-3.7': 3,
'5-6': 3,
'6-5': 3,
'7-3.4': 3}
# Kenta Oono (oono@preferred.jp)
# The following assertion checks too strong condition.
# Specifically it assumes that the WLE algorithm assigns
# the extended atom labels appeared in the first iteration
# in a certain order and runs the second iteration.
# Strictly speaking, this is not required in the algorithm.
assert expected_frequency == actual_frequency
expected_labels = set(expected_frequency.keys())
assert expected_labels == set(actual_labels)
actual_adj_arrays = _get_adj_arrays(actual_datasets)
expect_adj_arrays = _get_adj_arrays(small_datasets)
_check_np_array(actual_adj_arrays, expect_adj_arrays)
actual_signal_arrays = _get_teach_signals(actual_datasets)
expect_signal_arrays = _get_teach_signals(small_datasets)
_check_np_array(actual_signal_arrays, expect_signal_arrays)
# Check atom_arrays of train/val/test datasets are identical.
# 2 is the number of samples in each (train/val/test) dataset.
atom_arrays = _get_atom_arrays(actual_datasets)
first_mols = [d[0] for d in atom_arrays]
second_mols = [d[1] for d in atom_arrays]
for mols in (first_mols, second_mols):
assert len(mols) == 3
np.testing.assert_array_equal(mols[0], mols[1])
np.testing.assert_array_equal(mols[1], mols[2])
def test_cwle(small_datasets):
ret_value = WLE.apply_cwle_for_datasets(small_datasets)
actual_datasets, actual_labels, actual_frequency = ret_value
expected_frequency = {'1.2': 3,
'0.2': 3,
'0.1': 6,
'1.4': 3,
'0.4': 3,
'3': 3,
'2': 3}
assert expected_frequency == actual_frequency
expected_labels = set(expected_frequency.keys())
assert expected_labels == set(actual_labels)
actual_adj_arrays = _get_adj_arrays(actual_datasets)
expect_adj_arrays = _get_adj_arrays(small_datasets)
_check_np_array(actual_adj_arrays, expect_adj_arrays)
actual_signal_arrays = _get_teach_signals(actual_datasets, True)
expect_signal_arrays = _get_teach_signals(small_datasets)
_check_np_array(actual_signal_arrays, expect_signal_arrays)
# Check atom_arrays of train/val/test datasets are identical.
atom_arrays = _get_atom_arrays(actual_datasets)
first_mols = [d[0] for d in atom_arrays]
second_mols = [d[1] for d in atom_arrays]
for mols in (first_mols, second_mols):
assert len(mols) == 3
np.testing.assert_array_equal(mols[0], mols[1])
np.testing.assert_array_equal(mols[1], mols[2])
# Check wle_arrays of train/val/test datasets are identical.
wle_arrays = _get_wle_arrays(actual_datasets)
first_mols = [d[0] for d in wle_arrays]
second_mols = [d[1] for d in wle_arrays]
for mols in [first_mols, second_mols]:
assert len(mols) == 3
np.testing.assert_array_equal(mols[0], mols[1])
np.testing.assert_array_equal(mols[1], mols[2])
def test_findmaxidx_atom_label(small_datasets):
actual = WLE.findmaxidx(small_datasets, 'atom_label')
expect = 5
assert actual == expect
@pytest.fixture
def cwle_datasets():
B = 10
D_atom = 5
D_wle = 50
K_large = 10000
atom_arrays = [np.full((B, D_atom), K_large) for _ in range(3)]
adj_arrays = [np.eye(B, dtype=np.int32) for _ in range(3)]
wle_arrays = [np.arange(B * D_wle, dtype=np.int32).reshape(B, -1)
for _ in range(3)]
signal_arrays = [np.full(B, K_large) for _ in range(3)]
print(wle_arrays[0].shape)
datasets = [NumpyTupleDataset(atom_arrays[i],
adj_arrays[i],
wle_arrays[i],
signal_arrays[i])
for i in range(3)]
return datasets
def test_findmaxidx_wle(cwle_datasets):
actual = WLE.findmaxidx(cwle_datasets, 'wle_label')
expect = 10 * 50
assert actual == expect
================================================
FILE: tests/dataset_tests/preprocessors_tests/test_wle_atom_array_update.py
================================================
import itertools
import numpy as np
import pytest
from chainer_chemistry.dataset.preprocessors import wle_atom_array_update as wle_update
from chainer_chemistry.datasets.numpy_tuple_dataset import NumpyTupleDataset
@pytest.fixture
def k3_datasets():
train_atoms = np.array([np.zeros(3, dtype=np.int32)])
val_atoms = np.array([np.ones(3, dtype=np.int32)])
test_atoms = np.array([np.full(3, 2, dtype=np.int32)])
train_adjs = np.array([np.ones((3, 3), dtype=np.int32)])
val_adjs = np.array([np.ones((3, 3), dtype=np.int32)])
test_adjs = np.array([np.ones((3, 3), dtype=np.int32)])
return ((train_atoms, val_atoms, test_atoms),
(train_adjs, val_adjs, test_adjs))
def _is_all_same(arr):
arr = np.array(arr)
assert arr.size > 0
return np.all(arr == arr.item(0))
def _is_all_different(arr):
for x, y in itertools.combinations(arr, 2):
if x == y:
return False
return True
@pytest.mark.parametrize('cutoff', (0, 1, 2, 3, 4))
def test_update_atom_array(k3_datasets, cutoff):
atom_arrays, adj_arrays = k3_datasets
actual_atom_arrays, actual_label_frequency = wle_update.update_atom_arrays(
atom_arrays, adj_arrays, cutoff)
mols = [d[0] for d in actual_atom_arrays]
for m in mols:
assert _is_all_same(m)
# train/val/test atoms must have different labels.
assert _is_all_different((mols[0][0], mols[1][0], mols[2][0]))
if cutoff >= 3:
expect_label_frequency = {'0': 3, '1': 3, '2': 3}
else:
expect_label_frequency = {'0-0.0': 3, '1-1.1': 3, '2-2.2': 3}
assert actual_label_frequency == expect_label_frequency
@pytest.fixture
def single_atom_datasets():
train_atoms = np.array([[0], [1], [2]], dtype=np.int32)
val_atoms = np.array([[1], [1], [5]], dtype=np.int32)
test_atoms = np.array([[4], [4], [2]], dtype=np.int32)
train_adjs = np.array([[[1]], [[1]], [[1]]], dtype=np.int32)
val_adjs = np.array([[[1]], [[1]], [[1]]], dtype=np.int32)
test_adjs = np.array([[[1]], [[1]], [[1]]], dtype=np.int32)
return ((train_atoms, val_atoms, test_atoms),
(train_adjs, val_adjs, test_adjs))
@pytest.mark.parametrize('cutoff', (0, 1, 2))
def test_update_atom_array_2(single_atom_datasets, cutoff):
atom_arrays, adj_arrays = single_atom_datasets
actual_atom_arrays, actual_label_frequency = wle_update.update_atom_arrays(
atom_arrays, adj_arrays, cutoff)
# Note that labels after expansion need not
# same as the original atom labels.
# For example, assigning ids accoring to
# appearance order
# 0 -> 0, 1 -> 1, 2 -> 2, 5 -> 3, 4 -> 4,
# results in
# Atom arrays
# train: [[0], [1], [2]]
# val: [[1], [1], [3]]
# test: [[4], [4], [2]]
# Label Frequency
# {'0': 1, '1': 3, '2': 2, '3': 1, '4': 2}
# This is acceptable.
train, val, test = actual_atom_arrays
assert _is_all_same((train[1], val[0], val[1]))
assert _is_all_same((train[2], test[2]))
assert _is_all_same((test[0], test[1]))
assert _is_all_different((train[0], train[1], train[2], val[2], test[0]))
expect_label_frequency = {'0-': 1, '1-': 3, '2-': 2, '4-': 2, '5-': 1}
# Equal as a multiset.
assert (sorted(actual_label_frequency.values())
== sorted(expect_label_frequency.values()))
@pytest.fixture
def different_sample_size_datasets():
train_atoms = np.array([[0]], dtype=np.int32)
val_atoms = np.array([[0], [0]], dtype=np.int32)
test_atoms = np.array([[0], [0], [0]], dtype=np.int32)
train_adjs = np.array([[[1]]], dtype=np.int32)
val_adjs = np.array([[[1]], [[1]]], dtype=np.int32)
test_adjs = np.array([[[1]], [[1]], [[1]]], dtype=np.int32)
return ((train_atoms, val_atoms, test_atoms),
(train_adjs, val_adjs, test_adjs))
def test_update_atom_array_with_diffent_sample_sizes(
different_sample_size_datasets):
atom_arrays, adj_arrays = different_sample_size_datasets
actual_atom_arrays, actual_label_frequency = wle_update.update_atom_arrays(
atom_arrays, adj_arrays, 0)
all_atoms = sum([list(a.ravel()) for a in actual_atom_arrays], [])
assert _is_all_same(all_atoms)
expect_label_frequency = {'0-': 6}
assert actual_label_frequency == expect_label_frequency
@pytest.fixture
def different_graph_size_datasets():
train_atoms = np.array([[0]], dtype=np.int32)
val_atoms = np.array([[0, 0]], dtype=np.int32)
test_atoms = np.array([[0, 0, 0]], dtype=np.int32)
train_adjs = np.array([[[1]]], dtype=np.int32)
val_adjs = np.array([[[1, 1],
[1, 1]]], dtype=np.int32)
test_adjs = np.array([[[1, 1, 1],
[1, 1, 1],
[1, 1, 1]]], dtype=np.int32)
return ((train_atoms, val_atoms, test_atoms),
(train_adjs, val_adjs, test_adjs))
def test_update_atom_array_with_different_graph_size(
different_graph_size_datasets):
atom_arrays, adj_arrays = different_graph_size_datasets
actual_atom_arrays, actual_label_frequency = wle_update.update_atom_arrays(
atom_arrays, adj_arrays, 0)
mols = [d[0] for d in actual_atom_arrays]
for m in mols:
assert _is_all_same(m)
expect_label_frequency = {'0-': 1, '0-0': 2, '0-0.0': 3}
assert actual_label_frequency == expect_label_frequency
@pytest.fixture
def line_graph_datasets():
train_atoms = np.zeros(5, dtype=np.int32).reshape(1, -1)
val_atoms = np.array([[1]], dtype=np.int32)
test_atoms = np.array([[1]], dtype=np.int32)
train_adjs = np.array([[[1, 1, 0, 0, 0],
[1, 1, 1, 0, 0],
[0, 1, 1, 1, 0],
[0, 0, 1, 1, 1],
[0, 0, 0, 1, 1]]],
dtype=np.int32)
val_adjs = np.array([[[1]]], dtype=np.int32)
test_adjs = np.array([[[1]]], dtype=np.int32)
return ((train_atoms, val_atoms, test_atoms),
(train_adjs, val_adjs, test_adjs))
def test_update_atom_array_twice(line_graph_datasets):
atom_arrays, adj_arrays = line_graph_datasets
for _ in range(2):
atom_arrays, actual_label_frequency = wle_update.update_atom_arrays(
atom_arrays, adj_arrays, 0)
expect_label_frequency = {'0-1': 2,
'1-0.1': 2,
'1-1.1': 1,
'2-': 2} # atoms in test and val datasets
assert actual_label_frequency == expect_label_frequency
@pytest.fixture
def small_datasets():
N_1 = 3
N_2 = 5
# one-hot atom labels: 1 tp N
atom_array_1 = np.arange(N_1)
atom_array_2 = np.arange(N_2)
# adj-array, manually
# all connectes. expanded labels is a permutaion of 0,1,2
adj_array_1 = np.ones((3, 3), dtype=np.int32)
# node 0 --> 0-1.2
# node 1 --> 1-0.2
# node 2 --> 2-0.1
adj_array_2 = np.array([[1, 1, 0, 0, 1],
[1, 1, 0, 0, 1],
[0, 0, 1, 1, 0],
[0, 0, 1, 1, 0],
[1, 1, 0, 0, 1]]).astype(np.float32)
# node 0 --> 0-1.4
# node 1 --> 1-0.4
# node 2 --> 2-3
# node 3 --> 3-2
# node 4 --> 4-0.1
# supervised labels, dummy
teach_signal_1 = np.array(1).astype(np.int)
teach_signal_2 = np.array(0).astype(np.int)
# concat in a one numpy array!
atom_arrays = np.array([atom_array_1, atom_array_2])
adj_arrays = np.array([adj_array_1, adj_array_2])
teach_signals = np.array([teach_signal_1, teach_signal_2])
# train/val/test dataset, respectively
datasets = [NumpyTupleDataset(atom_arrays, adj_arrays, teach_signals),
NumpyTupleDataset(atom_arrays, adj_arrays, teach_signals),
NumpyTupleDataset(atom_arrays, adj_arrays, teach_signals)]
return datasets
def test_list_all_expanded_labels_with_focus_atom(small_datasets):
atom_arrays = [[mol[0] for mol in d] for d in small_datasets]
adj_arrays = [[mol[1] for mol in d] for d in small_datasets]
actual_atom_lists, actual_frequencies = wle_update.list_all_expanded_labels(
atom_arrays, adj_arrays, True)
expected_frequency = {'0-1.2': 3,
'1-0.2': 3,
'2-0.1': 3,
'0-1.4': 3,
'1-0.4': 3,
'2-3': 3,
'3-2': 3,
'4-0.1': 3}
assert expected_frequency == actual_frequencies
expect_atom_list = [
set(['0-1.2', '1-0.2', '2-0.1']),
set(['0-1.4', '1-0.4', '2-3', '3-2', '4-0.1'])]
for actual_atom_list in actual_atom_lists:
for a, e in zip(actual_atom_list, expect_atom_list):
assert set(a) == e
def test_list_all_expanded_labels_without_focus_atom(small_datasets):
atom_arrays = [[mol[0] for mol in d] for d in small_datasets]
adj_arrays = [[mol[1] for mol in d] for d in small_datasets]
actual_atom_lists, actual_frequencies = wle_update.list_all_expanded_labels(
atom_arrays, adj_arrays, False)
expected_frequency = {'1.2': 3,
'0.2': 3,
'0.1': 6,
'1.4': 3,
'0.4': 3,
'3': 3,
'2': 3}
assert expected_frequency == actual_frequencies
expect_atom_list = [
set(['1.2', '0.2', '0.1']),
set(['1.4', '0.4', '3', '2', '0.1'])]
for actual_atom_list in actual_atom_lists:
for a, e in zip(actual_atom_list, expect_atom_list):
assert set(a) == e
================================================
FILE: tests/dataset_tests/preprocessors_tests/test_wle_util.py
================================================
import numpy as np
import pytest
from chainer_chemistry.dataset.preprocessors import wle_util
def test_to_index():
values = ['foo', 'bar', 'buz', 'non-exist']
mols = [['foo', 'bar', 'buz'], ['foo', 'foo'], ['buz', 'bar']]
actual = wle_util.to_index(mols, values)
expect = np.array([np.array([0, 1, 2], np.int32),
np.array([0, 0], np.int32),
np.array([2, 1], np.int32)])
assert len(actual) == len(expect)
for a, e in zip(actual, expect):
np.testing.assert_array_equal(a, e)
def test_to_index_non_existence():
values = ['foo', 'bar']
mols = [['strange_label']]
with pytest.raises(ValueError):
wle_util.to_index(mols, values)
def test_compress_relation_axis_2_dim():
arr = np.random.uniform(size=(10, 2))
actual = wle_util.compress_relation_axis(arr)
np.testing.assert_array_equal(actual, arr)
def test_compress_relation_axis_3_dim():
arr = np.array(
[
[
[1, 0],
[2, 0],
],
[
[1, 1],
[0, 0]
]
]
)
arr = np.swapaxes(arr, 0, 1)
ret = wle_util.compress_relation_axis(arr)
actual = ret != 0
expect = np.array(
[[True, True],
[True, False]]
)
np.testing.assert_array_equal(actual, expect)
def test_compress_relation_axis_invalid_ndim():
arr = np.zeros(3)
with pytest.raises(ValueError):
wle_util.compress_relation_axis(arr)
arr = np.zeros((1, 2, 3, 4))
with pytest.raises(ValueError):
wle_util.compress_relation_axis(arr)
@pytest.fixture
def small_molecule():
# a-b-c d
atom_array = ['a', 'b', 'c', 'd']
neighbors = np.array(
[
[0, 1, 1, 2], # first end of edges
[1, 0, 2, 1] # second end of edges
]
)
return atom_array, neighbors
def test_get_neighbor_representation_with_focus_atom(small_molecule):
atom_array, neighbors = small_molecule
expects = ['a-b', 'b-a.c', 'c-b', 'd-']
for i in range(len(expects)):
actual = wle_util.get_neighbor_representation(
i, atom_array, neighbors, True)
assert actual == expects[i]
def test_get_neighbor_representation_without_focus_atom(small_molecule):
atom_array, neighbors = small_molecule
expects = ['b', 'a.c', 'b', '']
for i in range(len(expects)):
actual = wle_util.get_neighbor_representation(
i, atom_array, neighbors, False)
assert actual == expects[i]
@pytest.mark.parametrize('label, expect', [
('a-b', 'a'),
('a-b.c', 'a'),
('aa-b', 'aa'),
('a-', 'a'),
('aa-', 'aa'),
])
def test_get_focus_node_label(label, expect):
actual = wle_util.get_focus_node_label(label)
assert actual == expect
@pytest.mark.parametrize('label', ['aa', 'a-a-a', 'a--'])
def test_get_focus_node_label_invalid(label):
with pytest.raises(ValueError):
wle_util.get_focus_node_label(label)
================================================
FILE: tests/dataset_tests/splitters_tests/test_deepchem_scaffold_splitter.py
================================================
import numpy
import pandas
import pytest
from chainer_chemistry.dataset.parsers.data_frame_parser import DataFrameParser # NOQA
from chainer_chemistry.dataset.preprocessors import AtomicNumberPreprocessor
from chainer_chemistry.dataset.splitters.deepchem_scaffold_splitter import generate_scaffold # NOQA
from chainer_chemistry.dataset.splitters.deepchem_scaffold_splitter import DeepChemScaffoldSplitter # NOQA
from chainer_chemistry.datasets.numpy_tuple_dataset import NumpyTupleDataset
@pytest.fixture
def smiles_list():
smileses = [
"CC1=CC2CC(CC1)O2",
"O=Cc1nccn1C=O",
"CCC(C)(C)C(O)C=O",
"C#CCC(C)(CO)OC",
"Nc1coc(=O)nc1N",
"CC12C=CC(CCC1)C2",
"CC12CCC1C2OC=O",
"CC1C2CC3(COC3)N12",
"O=C1NC=NC12CC2",
"C1=CC2CN2CC2NC12",
]
return smileses
@pytest.fixture
def dataset(smiles_list):
df = pandas.DataFrame(data={'smiles': smiles_list,
'value': numpy.random.rand(10)})
pp = AtomicNumberPreprocessor()
parser = DataFrameParser(pp, labels='value')
dataset = parser.parse(df, return_smiles=True)
return dataset
def test_generate_scaffold():
smiles = "Nc1coc(=O)nc1N"
actual = generate_scaffold(smiles)
expect = 'O=c1nccco1'
assert actual == expect
def test_split(dataset):
splitter = DeepChemScaffoldSplitter()
train_ind, valid_ind, test_ind = splitter._split(
dataset=dataset['dataset'], smiles_list=dataset['smiles'])
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 8
assert valid_ind.shape[0] == 1
assert test_ind.shape[0] == 1
train_ind, valid_ind, test_ind = splitter._split(
dataset=dataset['dataset'], smiles_list=dataset['smiles'],
frac_train=0.5, frac_valid=0.3, frac_test=0.2)
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 5
assert valid_ind.shape[0] == 3
assert test_ind.shape[0] == 2
def test_split_fix_seed(dataset):
splitter = DeepChemScaffoldSplitter()
train_ind1, valid_ind1, test_ind1 = splitter._split(
dataset=dataset['dataset'], smiles_list=dataset['smiles'], seed=44)
train_ind2, valid_ind2, test_ind2 = splitter._split(
dataset=dataset['dataset'], smiles_list=dataset['smiles'], seed=44)
assert numpy.array_equal(train_ind1, train_ind2)
assert numpy.array_equal(valid_ind1, valid_ind2)
assert numpy.array_equal(test_ind1, test_ind2)
def test_split_fail(dataset):
splitter = DeepChemScaffoldSplitter()
with pytest.raises(AssertionError):
train_ind, valid_ind, test_ind = splitter._split(
dataset=dataset['dataset'], smiles_list=dataset['smiles'],
frac_train=0.4, frac_valid=0.3, frac_test=0.2)
def test_train_valid_test_split(dataset):
splitter = DeepChemScaffoldSplitter()
train_ind, valid_ind, test_ind = splitter.train_valid_test_split(
dataset=dataset['dataset'], smiles_list=dataset['smiles'])
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 8
assert valid_ind.shape[0] == 1
assert test_ind.shape[0] == 1
def test_train_valid_test_split_return_dataset(dataset):
splitter = DeepChemScaffoldSplitter()
train, valid, test = splitter.train_valid_test_split(
dataset=dataset['dataset'], smiles_list=dataset['smiles'],
return_index=False)
assert type(train) == NumpyTupleDataset
assert type(valid) == NumpyTupleDataset
assert type(test) == NumpyTupleDataset
assert len(train) == 8
assert len(valid) == 1
assert len(test) == 1
def test_train_valid_split(dataset):
splitter = DeepChemScaffoldSplitter()
train_ind, valid_ind = splitter.train_valid_split(
dataset=dataset['dataset'], smiles_list=dataset['smiles'])
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 9
assert valid_ind.shape[0] == 1
def test_train_valid_split_return_dataset(dataset):
splitter = DeepChemScaffoldSplitter()
train, valid = splitter.train_valid_split(dataset=dataset['dataset'],
smiles_list=dataset['smiles'],
return_index=False)
assert type(train) == NumpyTupleDataset
assert type(valid) == NumpyTupleDataset
assert len(train) == 9
assert len(valid) == 1
================================================
FILE: tests/dataset_tests/splitters_tests/test_random_splitter.py
================================================
import numpy
import pytest
from chainer_chemistry.dataset.splitters.random_splitter import RandomSplitter
from chainer_chemistry.datasets import NumpyTupleDataset
@pytest.fixture
def dataset():
a = numpy.random.random((10, 10))
b = numpy.random.random((10, 8))
c = numpy.random.random((10, 1))
return NumpyTupleDataset(a, b, c)
@pytest.fixture
def ndarray_dataset():
a = numpy.random.random((10, 10))
return a
def test_split(dataset):
splitter = RandomSplitter()
train_ind, valid_ind, test_ind = splitter._split(dataset)
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 8
assert valid_ind.shape[0] == 1
assert test_ind.shape[0] == 1
train_ind, valid_ind, test_ind = splitter._split(dataset,
frac_train=0.5,
frac_valid=0.3,
frac_test=0.2)
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 5
assert valid_ind.shape[0] == 3
assert test_ind.shape[0] == 2
def test_split_fix_seed(dataset):
splitter = RandomSplitter()
train_ind1, valid_ind1, test_ind1 = splitter._split(dataset, seed=44)
train_ind2, valid_ind2, test_ind2 = splitter._split(dataset, seed=44)
assert numpy.array_equal(train_ind1, train_ind2)
assert numpy.array_equal(valid_ind1, valid_ind2)
assert numpy.array_equal(test_ind1, test_ind2)
def test_split_fail(dataset):
splitter = RandomSplitter()
with pytest.raises(AssertionError):
train_ind, valid_ind, test_ind = splitter._split(dataset,
frac_train=0.4,
frac_valid=0.3,
frac_test=0.2)
def test_train_valid_test_split(dataset):
splitter = RandomSplitter()
train_ind, valid_ind, test_ind = splitter.train_valid_test_split(dataset)
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 8
assert valid_ind.shape[0] == 1
assert test_ind.shape[0] == 1
def test_train_valid_test_split_return_dataset(dataset):
splitter = RandomSplitter()
train, valid, test = splitter.train_valid_test_split(dataset,
return_index=False)
assert type(train) == NumpyTupleDataset
assert type(valid) == NumpyTupleDataset
assert type(test) == NumpyTupleDataset
assert len(train) == 8
assert len(valid) == 1
assert len(test) == 1
def test_train_valid_test_split_ndarray_return_dataset(ndarray_dataset):
splitter = RandomSplitter()
train, valid, test = splitter.train_valid_test_split(ndarray_dataset,
return_index=False)
assert type(train) == numpy.ndarray
assert type(valid) == numpy.ndarray
assert type(test) == numpy.ndarray
assert len(train) == 8
assert len(valid) == 1
assert len(test) == 1
def test_train_valid_split(dataset):
splitter = RandomSplitter()
train_ind, valid_ind = splitter.train_valid_split(dataset)
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 9
assert valid_ind.shape[0] == 1
def test_train_valid_split_return_dataset(dataset):
splitter = RandomSplitter()
train, valid = splitter.train_valid_split(dataset, return_index=False)
assert type(train) == NumpyTupleDataset
assert type(valid) == NumpyTupleDataset
assert len(train) == 9
assert len(valid) == 1
================================================
FILE: tests/dataset_tests/splitters_tests/test_scaffold_splitter.py
================================================
import numpy
import pandas
import pytest
from chainer_chemistry.dataset.parsers.data_frame_parser import DataFrameParser # NOQA
from chainer_chemistry.dataset.preprocessors import AtomicNumberPreprocessor
from chainer_chemistry.dataset.splitters.scaffold_splitter import generate_scaffold # NOQA
from chainer_chemistry.dataset.splitters.scaffold_splitter import ScaffoldSplitter # NOQA
from chainer_chemistry.datasets.numpy_tuple_dataset import NumpyTupleDataset
@pytest.fixture
def smiles_list():
smileses = [
"CC1=CC2CC(CC1)O2",
"O=Cc1nccn1C=O",
"CCC(C)(C)C(O)C=O",
"C#CCC(C)(CO)OC",
"Nc1coc(=O)nc1N",
"CC12C=CC(CCC1)C2",
"CC12CCC1C2OC=O",
"CC1C2CC3(COC3)N12",
"O=C1NC=NC12CC2",
"C1=CC2CN2CC2NC12",
]
return smileses
@pytest.fixture
def dataset(smiles_list):
df = pandas.DataFrame(data={'smiles': smiles_list,
'value': numpy.random.rand(10)})
pp = AtomicNumberPreprocessor()
parser = DataFrameParser(pp, labels='value')
dataset = parser.parse(df, return_smiles=True)
return dataset
def test_generate_scaffold():
smiles = "Nc1coc(=O)nc1N"
actual = generate_scaffold(smiles)
expect = 'O=c1nccco1'
assert actual == expect
def test_split(dataset):
splitter = ScaffoldSplitter()
train_ind, valid_ind, test_ind = splitter._split(
dataset=dataset['dataset'], smiles_list=dataset['smiles'])
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 8
assert valid_ind.shape[0] == 1
assert test_ind.shape[0] == 1
train_ind, valid_ind, test_ind = splitter._split(
dataset=dataset['dataset'], smiles_list=dataset['smiles'],
frac_train=0.5, frac_valid=0.3, frac_test=0.2)
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 5
assert valid_ind.shape[0] == 3
assert test_ind.shape[0] == 2
def test_split_fix_seed(dataset):
splitter = ScaffoldSplitter()
train_ind1, valid_ind1, test_ind1 = splitter._split(
dataset=dataset['dataset'], smiles_list=dataset['smiles'], seed=44)
train_ind2, valid_ind2, test_ind2 = splitter._split(
dataset=dataset['dataset'], smiles_list=dataset['smiles'], seed=44)
assert numpy.array_equal(train_ind1, train_ind2)
assert numpy.array_equal(valid_ind1, valid_ind2)
assert numpy.array_equal(test_ind1, test_ind2)
def test_split_fail(dataset):
splitter = ScaffoldSplitter()
with pytest.raises(AssertionError):
train_ind, valid_ind, test_ind = splitter._split(
dataset=dataset['dataset'], smiles_list=dataset['smiles'],
frac_train=0.4, frac_valid=0.3, frac_test=0.2)
def test_train_valid_test_split(dataset):
splitter = ScaffoldSplitter()
train_ind, valid_ind, test_ind = splitter.train_valid_test_split(
dataset=dataset['dataset'], smiles_list=dataset['smiles'])
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 8
assert valid_ind.shape[0] == 1
assert test_ind.shape[0] == 1
def test_train_valid_test_split_return_dataset(dataset):
splitter = ScaffoldSplitter()
train, valid, test = splitter.train_valid_test_split(
dataset=dataset['dataset'], smiles_list=dataset['smiles'],
return_index=False)
assert type(train) == NumpyTupleDataset
assert type(valid) == NumpyTupleDataset
assert type(test) == NumpyTupleDataset
assert len(train) == 8
assert len(valid) == 1
assert len(test) == 1
def test_train_valid_split(dataset):
splitter = ScaffoldSplitter()
train_ind, valid_ind = splitter.train_valid_split(
dataset=dataset['dataset'], smiles_list=dataset['smiles'])
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 9
assert valid_ind.shape[0] == 1
def test_train_valid_split_return_dataset(dataset):
splitter = ScaffoldSplitter()
train, valid = splitter.train_valid_split(dataset=dataset['dataset'],
smiles_list=dataset['smiles'],
return_index=False)
assert type(train) == NumpyTupleDataset
assert type(valid) == NumpyTupleDataset
assert len(train) == 9
assert len(valid) == 1
================================================
FILE: tests/dataset_tests/splitters_tests/test_stratified_splitter.py
================================================
import numpy
import pytest
from chainer_chemistry.dataset.splitters.stratified_splitter import StratifiedSplitter # NOQA
from chainer_chemistry.datasets.numpy_tuple_dataset import NumpyTupleDataset
@pytest.fixture
def cls_dataset():
a = numpy.random.random((30, 10))
b = numpy.random.random((30, 8))
c = numpy.concatenate([numpy.zeros(20), numpy.ones(10)]).astype(numpy.int)
return NumpyTupleDataset(a, b, c)
@pytest.fixture
def cls_label():
c = numpy.concatenate([numpy.zeros(20), numpy.ones(10)]).astype(numpy.int)
return c
@pytest.fixture
def cls_ndarray_dataset():
a = numpy.concatenate([numpy.zeros(20), numpy.ones(10)]).astype(numpy.int)
b = numpy.concatenate([numpy.zeros(20), numpy.ones(10)]).astype(numpy.int)
return a, b
@pytest.fixture
def reg_dataset():
a = numpy.random.random((100, 10))
b = numpy.random.random((100, 8))
c = numpy.arange(100).astype(numpy.float)
return NumpyTupleDataset(a, b, c)
def test_classification_split(cls_dataset):
splitter = StratifiedSplitter()
train_ind, valid_ind, test_ind = splitter._split(cls_dataset)
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 24
assert valid_ind.shape[0] == 3
assert test_ind.shape[0] == 3
train = NumpyTupleDataset(*cls_dataset.features[train_ind])
valid = NumpyTupleDataset(*cls_dataset.features[valid_ind])
test = NumpyTupleDataset(*cls_dataset.features[test_ind])
assert (train.features[:, -1] == 1).sum() == 8
assert (valid.features[:, -1] == 1).sum() == 1
assert (test.features[:, -1] == 1).sum() == 1
train_ind, valid_ind, test_ind = splitter._split(cls_dataset,
frac_train=0.5,
frac_valid=0.3,
frac_test=0.2)
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 15
assert valid_ind.shape[0] == 9
assert test_ind.shape[0] == 6
train = NumpyTupleDataset(*cls_dataset.features[train_ind])
valid = NumpyTupleDataset(*cls_dataset.features[valid_ind])
test = NumpyTupleDataset(*cls_dataset.features[test_ind])
assert (train.features[:, -1] == 1).sum() == 5
assert (valid.features[:, -1] == 1).sum() == 3
assert (test.features[:, -1] == 1).sum() == 2
def test_classification_split_by_labels_ndarray(cls_dataset, cls_label):
splitter = StratifiedSplitter()
train_ind, valid_ind, test_ind = splitter._split(cls_dataset,
labels=cls_label)
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 24
assert valid_ind.shape[0] == 3
assert test_ind.shape[0] == 3
train = NumpyTupleDataset(*cls_dataset.features[train_ind])
valid = NumpyTupleDataset(*cls_dataset.features[valid_ind])
test = NumpyTupleDataset(*cls_dataset.features[test_ind])
assert (train.features[:, -1] == 1).sum() == 8
assert (valid.features[:, -1] == 1).sum() == 1
assert (test.features[:, -1] == 1).sum() == 1
train_ind, valid_ind, test_ind = splitter._split(cls_dataset,
labels=cls_label,
frac_train=0.5,
frac_valid=0.3,
frac_test=0.2)
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 15
assert valid_ind.shape[0] == 9
assert test_ind.shape[0] == 6
train = NumpyTupleDataset(*cls_dataset.features[train_ind])
valid = NumpyTupleDataset(*cls_dataset.features[valid_ind])
test = NumpyTupleDataset(*cls_dataset.features[test_ind])
assert (train.features[:, -1] == 1).sum() == 5
assert (valid.features[:, -1] == 1).sum() == 3
assert (test.features[:, -1] == 1).sum() == 2
def test_classification_split_by_labels_list(cls_dataset, cls_label):
cls_label = cls_label.tolist()
splitter = StratifiedSplitter()
train_ind, valid_ind, test_ind = splitter._split(cls_dataset,
labels=cls_label)
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 24
assert valid_ind.shape[0] == 3
assert test_ind.shape[0] == 3
train = NumpyTupleDataset(*cls_dataset.features[train_ind])
valid = NumpyTupleDataset(*cls_dataset.features[valid_ind])
test = NumpyTupleDataset(*cls_dataset.features[test_ind])
assert (train.features[:, -1] == 1).sum() == 8
assert (valid.features[:, -1] == 1).sum() == 1
assert (test.features[:, -1] == 1).sum() == 1
train_ind, valid_ind, test_ind = splitter._split(cls_dataset,
labels=cls_label,
frac_train=0.5,
frac_valid=0.3,
frac_test=0.2)
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 15
assert valid_ind.shape[0] == 9
assert test_ind.shape[0] == 6
train = NumpyTupleDataset(*cls_dataset.features[train_ind])
valid = NumpyTupleDataset(*cls_dataset.features[valid_ind])
test = NumpyTupleDataset(*cls_dataset.features[test_ind])
assert (train.features[:, -1] == 1).sum() == 5
assert (valid.features[:, -1] == 1).sum() == 3
assert (test.features[:, -1] == 1).sum() == 2
def test_regression_split(reg_dataset):
splitter = StratifiedSplitter()
train_ind, valid_ind, test_ind = splitter._split(reg_dataset)
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 80
assert valid_ind.shape[0] == 10
assert test_ind.shape[0] == 10
train = NumpyTupleDataset(*reg_dataset.features[train_ind])
valid = NumpyTupleDataset(*reg_dataset.features[valid_ind])
test = NumpyTupleDataset(*reg_dataset.features[test_ind])
assert 45.0 < train.features[:, -1].mean() < 55.0
assert 45.0 < valid.features[:, -1].mean() < 55.0
assert 45.0 < test.features[:, -1].mean() < 55.0
train_ind, valid_ind, test_ind = splitter._split(reg_dataset,
frac_train=0.5,
frac_valid=0.3,
frac_test=0.2)
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 50
assert valid_ind.shape[0] == 30
assert test_ind.shape[0] == 20
train = NumpyTupleDataset(*reg_dataset.features[train_ind])
valid = NumpyTupleDataset(*reg_dataset.features[valid_ind])
test = NumpyTupleDataset(*reg_dataset.features[test_ind])
assert 45.0 < train.features[:, -1].mean() < 55.0
assert 45.0 < valid.features[:, -1].mean() < 55.0
assert 45.0 < test.features[:, -1].mean() < 55.0
def test_classification_split_fix_seed(cls_dataset):
splitter = StratifiedSplitter()
train_ind1, valid_ind1, test_ind1 = splitter._split(cls_dataset, seed=44)
train_ind2, valid_ind2, test_ind2 = splitter._split(cls_dataset, seed=44)
assert numpy.array_equal(train_ind1, train_ind2)
assert numpy.array_equal(valid_ind1, valid_ind2)
assert numpy.array_equal(test_ind1, test_ind2)
def test_split_fail_by_frac_ratio(cls_dataset):
splitter = StratifiedSplitter()
with pytest.raises(AssertionError):
train_ind, valid_ind, test_ind = splitter._split(cls_dataset,
frac_train=0.4,
frac_valid=0.3,
frac_test=0.2)
def test_split_fail_by_invalid_task_type(cls_dataset):
splitter = StratifiedSplitter()
with pytest.raises(ValueError):
train_ind, valid_ind, test_ind = splitter._split(cls_dataset,
frac_train=0.5,
frac_valid=0.3,
frac_test=0.2,
task_type='mix')
def test_regression_split_fix_seed(reg_dataset):
splitter = StratifiedSplitter()
train_ind1, valid_ind1, test_ind1 = splitter._split(reg_dataset, seed=44)
train_ind2, valid_ind2, test_ind2 = splitter._split(reg_dataset, seed=44)
assert numpy.array_equal(train_ind1, train_ind2)
assert numpy.array_equal(valid_ind1, valid_ind2)
assert numpy.array_equal(test_ind1, test_ind2)
def test_train_valid_test_classification_split(cls_dataset):
splitter = StratifiedSplitter()
train_ind, valid_ind, test_ind =\
splitter.train_valid_test_split(cls_dataset)
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 24
assert valid_ind.shape[0] == 3
assert test_ind.shape[0] == 3
train = NumpyTupleDataset(*cls_dataset.features[train_ind])
valid = NumpyTupleDataset(*cls_dataset.features[valid_ind])
test = NumpyTupleDataset(*cls_dataset.features[test_ind])
assert (train.features[:, -1] == 1).sum() == 8
assert (valid.features[:, -1] == 1).sum() == 1
assert (test.features[:, -1] == 1).sum() == 1
def test_train_valid_test_classification_split_return_dataset(cls_dataset):
splitter = StratifiedSplitter()
train, valid, test = splitter.train_valid_test_split(cls_dataset,
return_index=False)
assert type(train) == NumpyTupleDataset
assert type(valid) == NumpyTupleDataset
assert type(test) == NumpyTupleDataset
assert len(train) == 24
assert len(valid) == 3
assert len(test) == 3
assert (train.features[:, -1] == 1).sum() == 8
assert (valid.features[:, -1] == 1).sum() == 1
assert (test.features[:, -1] == 1).sum() == 1
def test_train_valid_test_classification_split_ndarray_return_dataset(
cls_ndarray_dataset):
cls_dataset, cls_label = cls_ndarray_dataset
splitter = StratifiedSplitter()
train, valid, test = splitter.train_valid_test_split(cls_dataset,
labels=cls_label,
return_index=False)
assert type(train) == numpy.ndarray
assert type(valid) == numpy.ndarray
assert type(test) == numpy.ndarray
assert len(train) == 24
assert len(valid) == 3
assert len(test) == 3
assert (train == 1).sum() == 8
assert (valid == 1).sum() == 1
assert (test == 1).sum() == 1
def test_train_valid_test_regression_split(reg_dataset):
splitter = StratifiedSplitter()
train_ind, valid_ind, test_ind =\
splitter.train_valid_test_split(reg_dataset)
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 80
assert valid_ind.shape[0] == 10
assert test_ind.shape[0] == 10
train = NumpyTupleDataset(*reg_dataset.features[train_ind])
valid = NumpyTupleDataset(*reg_dataset.features[valid_ind])
test = NumpyTupleDataset(*reg_dataset.features[test_ind])
assert 45.0 < train.features[:, -1].mean() < 55.0
assert 45.0 < valid.features[:, -1].mean() < 55.0
assert 45.0 < test.features[:, -1].mean() < 55.0
def test_train_valid_test_regression_split_return_dataset(reg_dataset):
splitter = StratifiedSplitter()
train, valid, test = splitter.train_valid_test_split(reg_dataset,
return_index=False)
assert type(train) == NumpyTupleDataset
assert type(valid) == NumpyTupleDataset
assert type(test) == NumpyTupleDataset
assert len(train) == 80
assert len(valid) == 10
assert len(test) == 10
assert 45.0 < train.features[:, -1].mean() < 55.0
assert 45.0 < valid.features[:, -1].mean() < 55.0
assert 45.0 < test.features[:, -1].mean() < 55.0
def test_train_valid_classification_split(cls_dataset):
splitter = StratifiedSplitter()
train_ind, valid_ind = splitter.train_valid_split(cls_dataset)
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 27
assert valid_ind.shape[0] == 3
train = NumpyTupleDataset(*cls_dataset.features[train_ind])
valid = NumpyTupleDataset(*cls_dataset.features[valid_ind])
assert (train.features[:, -1] == 1).sum() == 9
assert (valid.features[:, -1] == 1).sum() == 1
def test_train_valid_classification_split_return_dataset(cls_dataset):
splitter = StratifiedSplitter()
train, valid = splitter.train_valid_split(cls_dataset, return_index=False)
assert type(train) == NumpyTupleDataset
assert type(valid) == NumpyTupleDataset
assert len(train) == 27
assert len(valid) == 3
assert (train.features[:, -1] == 1).sum() == 9
assert (valid.features[:, -1] == 1).sum() == 1
def test_train_valid_classification_split_ndarray_return_dataset(
cls_ndarray_dataset):
cls_dataset, cls_label = cls_ndarray_dataset
splitter = StratifiedSplitter()
train, valid = splitter.train_valid_split(cls_dataset, labels=cls_label,
return_index=False)
assert type(train) == numpy.ndarray
assert type(valid) == numpy.ndarray
assert len(train) == 27
assert len(valid) == 3
assert (train == 1).sum() == 9
assert (valid == 1).sum() == 1
def test_train_valid_test_cls_split_by_labels_return_dataset(cls_dataset,
cls_label):
splitter = StratifiedSplitter()
train, valid, test = splitter.train_valid_test_split(cls_dataset,
labels=cls_label,
return_index=False)
assert type(train) == NumpyTupleDataset
assert type(valid) == NumpyTupleDataset
assert type(test) == NumpyTupleDataset
assert len(train) == 24
assert len(valid) == 3
assert len(test) == 3
assert (train.features[:, -1] == 1).sum() == 8
assert (valid.features[:, -1] == 1).sum() == 1
assert (test.features[:, -1] == 1).sum() == 1
def test_train_valid_cls_split_by_labels_return_dataset(cls_dataset,
cls_label):
splitter = StratifiedSplitter()
train, valid = splitter.train_valid_split(cls_dataset, labels=cls_label,
return_index=False)
assert type(train) == NumpyTupleDataset
assert type(valid) == NumpyTupleDataset
assert len(train) == 27
assert len(valid) == 3
assert (train.features[:, -1] == 1).sum() == 9
assert (valid.features[:, -1] == 1).sum() == 1
def test_train_valid_regression_split(reg_dataset):
splitter = StratifiedSplitter()
train_ind, valid_ind = splitter.train_valid_split(reg_dataset)
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 90
assert valid_ind.shape[0] == 10
train = NumpyTupleDataset(*reg_dataset.features[train_ind])
valid = NumpyTupleDataset(*reg_dataset.features[valid_ind])
assert 45.0 < train.features[:, -1].mean() < 55.0
assert 45.0 < valid.features[:, -1].mean() < 55.0
def test_train_valid_regression_split_return_dataset(reg_dataset):
splitter = StratifiedSplitter()
train, valid = splitter.train_valid_split(reg_dataset, return_index=False)
assert type(train) == NumpyTupleDataset
assert type(valid) == NumpyTupleDataset
assert len(train) == 90
assert len(valid) == 10
assert 45.0 < train.features[:, -1].mean() < 55.0
assert 45.0 < valid.features[:, -1].mean() < 55.0
================================================
FILE: tests/dataset_tests/splitters_tests/test_time_splitter.py
================================================
import numpy
import pytest
from chainer_chemistry.dataset.splitters.time_splitter import TimeSplitter
from chainer_chemistry.datasets.numpy_tuple_dataset import NumpyTupleDataset
@pytest.fixture
def time_list():
times = [
1980,
1990,
2010,
2020,
2000,
2050,
2030,
2040,
1960,
1970
]
return times
@pytest.fixture()
def dataset():
a = numpy.random.random((10, 10))
b = numpy.random.random((10, 8))
c = numpy.random.random((10, 1))
return NumpyTupleDataset(a, b, c)
def test_split(dataset, time_list):
splitter = TimeSplitter()
train_ind, valid_ind, test_ind = splitter._split(
dataset, time_list=time_list)
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 8
assert valid_ind.shape[0] == 1
assert test_ind.shape[0] == 1
assert train_ind.tolist() == [8, 9, 0, 1, 4, 2, 3, 6]
assert valid_ind.tolist() == [7]
assert test_ind.tolist() == [5]
train_ind, valid_ind, test_ind = splitter._split(
dataset, frac_train=0.5, frac_valid=0.3, frac_test=0.2,
time_list=time_list)
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 5
assert valid_ind.shape[0] == 3
assert test_ind.shape[0] == 2
assert train_ind.tolist() == [8, 9, 0, 1, 4]
assert valid_ind.tolist() == [2, 3, 6]
assert test_ind.tolist() == [7, 5]
def test_split_fail(dataset, time_list):
splitter = TimeSplitter()
with pytest.raises(AssertionError):
train_ind, valid_ind, test_ind = splitter._split(
dataset, frac_train=0.4, frac_valid=0.3, frac_test=0.2,
time_list=time_list)
def test_train_valid_test_split(dataset, time_list):
splitter = TimeSplitter()
train_ind, valid_ind, test_ind = splitter.train_valid_test_split(
dataset, time_list=time_list)
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 8
assert valid_ind.shape[0] == 1
assert test_ind.shape[0] == 1
assert train_ind.tolist() == [8, 9, 0, 1, 4, 2, 3, 6]
assert valid_ind.tolist() == [7]
assert test_ind.tolist() == [5]
def test_train_valid_test_split_return_dataset(dataset, time_list):
splitter = TimeSplitter()
train, valid, test = splitter.train_valid_test_split(
dataset, return_index=False, time_list=time_list)
assert type(train) == NumpyTupleDataset
assert type(valid) == NumpyTupleDataset
assert type(test) == NumpyTupleDataset
assert len(train) == 8
assert len(valid) == 1
assert len(test) == 1
def test_train_valid_split(dataset, time_list):
splitter = TimeSplitter()
train_ind, valid_ind = splitter.train_valid_split(
dataset, time_list=time_list)
assert type(train_ind) == numpy.ndarray
assert train_ind.shape[0] == 9
assert valid_ind.shape[0] == 1
assert train_ind.tolist() == [8, 9, 0, 1, 4, 2, 3, 6, 7]
assert valid_ind.tolist() == [5]
def test_train_split_return_dataset(dataset, time_list):
splitter = TimeSplitter()
train, valid = splitter.train_valid_split(
dataset, return_index=False, time_list=time_list)
assert type(train) == NumpyTupleDataset
assert type(valid) == NumpyTupleDataset
assert len(train) == 9
assert len(valid) == 1
================================================
FILE: tests/dataset_tests/test_converters.py
================================================
import chainer
import numpy
import pytest
from chainer_chemistry.dataset.converters import concat_mols
@pytest.fixture
def data_1d():
a = numpy.array([1, 2])
b = numpy.array([4, 5, 6])
return a, b
@pytest.fixture
def data_1d_expect():
a = numpy.array([1, 2, 0])
b = numpy.array([4, 5, 6])
return a, b
@pytest.fixture
def data_2d():
a = numpy.array([[1, 2], [3, 4]])
b = numpy.array([[1, 2, 3], [4, 5, 6], [7, 8, 9]])
return a, b
@pytest.fixture
def data_2d_expect():
a = numpy.array([[1, 2, 0], [3, 4, 0], [0, 0, 0]])
b = numpy.array([[1, 2, 3], [4, 5, 6], [7, 8, 9]])
return a, b
def test_concat_mols_1d_cpu(data_1d, data_1d_expect):
result = concat_mols(data_1d, device=-1)
assert numpy.array_equal(result[0], data_1d_expect[0])
assert numpy.array_equal(result[1], data_1d_expect[1])
def test_concat_mols_2d_cpu(data_2d, data_2d_expect):
result = concat_mols(data_2d, device=-1)
assert numpy.array_equal(result[0], data_2d_expect[0])
assert numpy.array_equal(result[1], data_2d_expect[1])
@pytest.mark.gpu
def test_concat_mols_1d_gpu(data_1d, data_1d_expect):
result = concat_mols(data_1d, device=0)
assert chainer.cuda.get_device_from_array(result[0]).id == 0
assert chainer.cuda.get_device_from_array(result[1]).id == 0
assert numpy.array_equal(chainer.cuda.to_cpu(result[0]),
data_1d_expect[0])
assert numpy.array_equal(chainer.cuda.to_cpu(result[1]),
data_1d_expect[1])
@pytest.mark.gpu
def test_concat_mols_2d_gpu(data_2d, data_2d_expect):
result = concat_mols(data_2d, device=0)
assert chainer.cuda.get_device_from_array(result[0]).id == 0
assert chainer.cuda.get_device_from_array(result[1]).id == 0
assert numpy.array_equal(chainer.cuda.to_cpu(result[0]),
data_2d_expect[0])
assert numpy.array_equal(chainer.cuda.to_cpu(result[1]),
data_2d_expect[1])
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/dataset_tests/test_numpy_tuple_feature_indexer.py
================================================
import numpy
import pytest
from chainer_chemistry.dataset.indexers.numpy_tuple_dataset_feature_indexer import NumpyTupleDatasetFeatureIndexer # NOQA
from chainer_chemistry.datasets.numpy_tuple_dataset import NumpyTupleDataset
@pytest.fixture
def data():
a = numpy.array([1, 2])
b = numpy.array([4, 5])
c = numpy.array([[6, 7, 8], [8, 9, 10]])
return a, b, c
@pytest.fixture
def indexer(data):
dataset = NumpyTupleDataset(*data)
indexer = NumpyTupleDatasetFeatureIndexer(dataset)
return indexer
class TestNumpyTupleDatasetFeatureIndexer(object):
def test_feature_length(self, indexer):
assert indexer.features_length() == 3
@pytest.mark.parametrize('slice_index', [
0, 1, slice(0, 2, None), slice(0, 0, None)])
@pytest.mark.parametrize('j', [0, 1])
def test_extract_feature_by_slice(self, indexer, data, slice_index, j):
numpy.testing.assert_array_equal(
indexer.extract_feature_by_slice(slice_index, j),
data[j][slice_index])
# indexer's __getitem__ should call `extract_feature_by_slice` method,
# result should be same with above.
numpy.testing.assert_array_equal(
indexer[slice_index, j],
data[j][slice_index])
@pytest.mark.parametrize('ndarray_index', [
numpy.asarray([0, 1]), numpy.asarray([1]),
numpy.asarray([], dtype=numpy.int32)])
@pytest.mark.parametrize('j', [0, 1])
def test_extract_feature_by_ndarray(self, indexer, data, ndarray_index, j):
numpy.testing.assert_array_equal(
indexer.extract_feature_by_slice(ndarray_index, j),
data[j][ndarray_index])
# indexer's __getitem__ should call `extract_feature_by_slice` method,
# result should be same with above.
numpy.testing.assert_array_equal(
indexer[ndarray_index, j],
data[j][ndarray_index])
if __name__ == '__main__':
pytest.main([__file__, '-v'])
================================================
FILE: tests/datasets_tests/molnet_tests/test_molnet.py
================================================
import os
import numpy
import pandas
import pytest
from chainer_chemistry.dataset.preprocessors.atomic_number_preprocessor import AtomicNumberPreprocessor # NOQA
from chainer_chemistry.datasets import molnet
from chainer_chemistry.datasets import NumpyTupleDataset
expect_bbbp_lengths = [1633, 203, 203]
expect_bbbp_lengths2 = [1021, 611, 407]
expect_clearance_lengths = [669, 83, 85]
expect_pdbbind_lengths = [134, 16, 18]
expect_featurized_pdbbind_lengths = [151, 18, 20]
expect_qm7_lengths = [5468, 683, 683]
def test_get_molnet_filepath_without_download():
filepath = molnet.get_molnet_filepath('bbbp', download_if_not_exist=False)
if os.path.exists(filepath):
os.remove(filepath) # ensure a cache file does not exist.
filepath = molnet.get_molnet_filepath('bbbp', download_if_not_exist=False)
assert isinstance(filepath, str)
assert not os.path.exists(filepath)
@pytest.mark.slow
def test_get_molnet_filepath_with_download():
filepath = molnet.get_molnet_filepath('bbbp', download_if_not_exist=False)
if os.path.exists(filepath):
os.remove(filepath) # ensure a cache file does not exist.
filepath = molnet.get_molnet_filepath('bbbp', download_if_not_exist=True)
assert isinstance(filepath, str)
assert os.path.exists(filepath)
def test_get_grid_featurized_pdbbind_dataset():
# Test core dataset
dataset = molnet.get_grid_featurized_pdbbind_dataset('core')
assert isinstance(dataset, NumpyTupleDataset)
x, y = dataset.get_datasets()
assert x.shape == (189, 2052)
assert x.dtype == numpy.int32
assert y.shape == (189, 1)
assert y.dtype == numpy.float32
# Test full dataset
dataset = molnet.get_grid_featurized_pdbbind_dataset('full')
assert isinstance(dataset, NumpyTupleDataset)
x, y = dataset.get_datasets()
assert x.shape == (11303, 2052)
assert x.dtype == numpy.int32
assert y.shape == (11303, 1)
assert y.dtype == numpy.float32
# Test refined dataset
dataset = molnet.get_grid_featurized_pdbbind_dataset('refined')
assert isinstance(dataset, NumpyTupleDataset)
x, y = dataset.get_datasets()
assert x.shape == (3568, 2052)
assert x.dtype == numpy.int32
assert y.shape == (3568, 1)
assert y.dtype == numpy.float32
# bbbp is one of classification task dataset
@pytest.mark.slow
def test_get_molnet_bbbp_dataset():
# test default behavior
pp = AtomicNumberPreprocessor()
datasets = molnet.get_molnet_dataset('bbbp', preprocessor=pp)
assert 'smiles' in datasets.keys()
assert 'dataset' in datasets.keys()
datasets = datasets['dataset']
assert len(datasets) == 3
assert type(datasets[0]) == NumpyTupleDataset
assert type(datasets[1]) == NumpyTupleDataset
assert type(datasets[2]) == NumpyTupleDataset
# Test each train, valid and test dataset
for i, dataset in enumerate(datasets):
# --- Test dataset is correctly obtained ---
index = numpy.random.choice(len(dataset), None)
atoms, label = dataset[index]
assert atoms.ndim == 1 # (atom, )
assert atoms.dtype == numpy.int32
# (atom from, atom to) or (edge_type, atom from, atom to)
assert label.ndim == 1
assert label.shape[0] == 1
assert label.dtype == numpy.int32
assert len(dataset) == expect_bbbp_lengths[i]
# bbbp is one of classification task dataset
@pytest.mark.slow
def test_get_molnet_bbbp_dataset_change_split_ratio():
# test default behavior
pp = AtomicNumberPreprocessor()
datasets = molnet.get_molnet_dataset('bbbp', preprocessor=pp,
frac_train=0.5, frac_valid=0.3,
frac_test=0.2)
assert 'smiles' in datasets.keys()
assert 'dataset' in datasets.keys()
datasets = datasets['dataset']
assert len(datasets) == 3
assert type(datasets[0]) == NumpyTupleDataset
assert type(datasets[1]) == NumpyTupleDataset
assert type(datasets[2]) == NumpyTupleDataset
# Test each train, valid and test dataset
for i, dataset in enumerate(datasets):
# --- Test dataset is correctly obtained ---
index = numpy.random.choice(len(dataset), None)
atoms, label = dataset[index]
assert atoms.ndim == 1 # (atom, )
assert atoms.dtype == numpy.int32
# (atom from, atom to) or (edge_type, atom from, atom to)
assert label.ndim == 1
assert label.shape[0] == 1
assert label.dtype == numpy.int32
assert len(dataset) == expect_bbbp_lengths2[i]
@pytest.mark.slow
def test_get_molnet_bbbp_dataset_with_smiles():
# test default behavior
pp = AtomicNumberPreprocessor()
datasets = molnet.get_molnet_dataset('bbbp', preprocessor=pp,
return_smiles=True)
assert 'smiles' in datasets.keys()
assert 'dataset' in datasets.keys()
smileses = datasets['smiles']
datasets = datasets['dataset']
assert len(smileses) == 3
assert len(datasets) == 3
# Test each train, valid and test dataset
for i, dataset in enumerate(datasets):
# --- Test dataset is correctly obtained ---
index = numpy.random.choice(len(dataset), None)
atoms, label = dataset[index]
assert atoms.ndim == 1 # (atom, )
assert atoms.dtype == numpy.int32
# (atom from, atom to) or (edge_type, atom from, atom to) assert label.ndim == 1 # NOQA
assert label.shape[0] == 1
assert label.dtype == numpy.int32
assert len(dataset) == expect_bbbp_lengths[i]
assert len(smileses[i]) == expect_bbbp_lengths[i]
# clearance is one of classification task dataset
@pytest.mark.slow
def test_get_molnet_clearance_dataset():
# test default behavior
pp = AtomicNumberPreprocessor()
datasets = molnet.get_molnet_dataset('clearance', preprocessor=pp)
assert 'smiles' in datasets.keys()
assert 'dataset' in datasets.keys()
datasets = datasets['dataset']
assert len(datasets) == 3
# Test each train, valid and test dataset
for i, dataset in enumerate(datasets):
# --- Test dataset is correctly obtained ---
index = numpy.random.choice(len(dataset), None)
atoms, label = dataset[index]
assert atoms.ndim == 1 # (atom, )
assert atoms.dtype == numpy.int32
# (atom from, atom to) or (edge_type, atom from, atom to)
assert label.ndim == 1
assert label.shape[0] == 1
assert label.dtype == numpy.float32
# --- Test number of dataset ---
assert len(dataset) == expect_clearance_lengths[i]
@pytest.mark.slow
def test_get_molnet_clearance_dataset_with_return_smiles_enabled():
# test default behavior
pp = AtomicNumberPreprocessor()
datasets = molnet.get_molnet_dataset('clearance', preprocessor=pp,
return_smiles=True)
assert 'smiles' in datasets.keys()
assert 'dataset' in datasets.keys()
smileses = datasets['smiles']
datasets = datasets['dataset']
assert len(datasets) == 3
assert len(smileses) == 3
# Test each train, valid and test dataset
for i, dataset in enumerate(datasets):
# --- Test dataset is correctly obtained ---
index = numpy.random.choice(len(dataset), None)
atoms, label = dataset[index]
assert atoms.ndim == 1 # (atom, )
assert atoms.dtype == numpy.int32
# (atom from, atom to) or (edge_type, atom from, atom to)
assert label.ndim == 1
assert label.shape[0] == 1
assert label.dtype == numpy.float32
# --- Test number of dataset ---
assert len(dataset) == expect_clearance_lengths[i]
assert len(smileses[i]) == expect_clearance_lengths[i]
@pytest.mark.slow
def test_get_molnet_pdbbind_dataset():
# test default behavior
pp = AtomicNumberPreprocessor()
time_list = numpy.random.randint(1000, size=168).tolist()
datasets = molnet.get_molnet_dataset('pdbbind_smiles', preprocessor=pp,
pdbbind_subset='core',
time_list=time_list, split='random')
assert 'smiles' in datasets.keys()
assert 'dataset' in datasets.keys()
assert 'pdb_id' in datasets.keys()
datasets = datasets['dataset']
assert len(datasets) == 3
assert type(datasets[0]) == NumpyTupleDataset
assert type(datasets[1]) == NumpyTupleDataset
assert type(datasets[2]) == NumpyTupleDataset
# Test each train, valid and test dataset
for i, dataset in enumerate(datasets):
# --- Test dataset is correctly obtained ---
index = numpy.random.choice(len(dataset), None)
atoms, label = dataset[index]
assert atoms.ndim == 1 # (atom, )
assert atoms.dtype == numpy.int32
# (atom from, atom to) or (edge_type, atom from, atom to)
assert label.ndim == 1
assert label.shape[0] == 1
assert label.dtype == numpy.float32
# --- Test number of dataset ---
assert len(dataset) == expect_pdbbind_lengths[i]
@pytest.mark.slow
def test_get_molnet_pdbbind_dataset_with_pdb_id():
# test default behavior
pp = AtomicNumberPreprocessor()
time_list = numpy.random.randint(1000, size=168).tolist()
datasets = molnet.get_molnet_dataset('pdbbind_smiles', preprocessor=pp,
pdbbind_subset='core',
return_pdb_id=True,
time_list=time_list, split='random')
assert 'smiles' in datasets.keys()
assert 'dataset' in datasets.keys()
assert 'pdb_id' in datasets.keys()
pdb_ids = datasets['pdb_id']
datasets = datasets['dataset']
assert len(pdb_ids) == 3
assert len(datasets) == 3
# Test each train, valid and test dataset
for i, dataset in enumerate(datasets):
# --- Test dataset is correctly obtained ---
index = numpy.random.choice(len(dataset), None)
atoms, label = dataset[index]
assert label.ndim == 1 # (atom, )
assert atoms.dtype == numpy.int32
# (atom from, atom to) or (edge_type, atom from, atom to)
assert label.ndim == 1
assert label.shape[0] == 1
assert label.dtype == numpy.float32
# --Test number of dataset ---
assert len(dataset) == expect_pdbbind_lengths[i]
assert len(pdb_ids[i]) == expect_pdbbind_lengths[i]
@pytest.mark.slow
def test_get_molnet_grid_featurized_pdbbind_dataset():
# test default behavioer
datasets = molnet.get_molnet_dataset('pdbbind_grid', pdbbind_subset='core',
split='random')
assert 'dataset' in datasets.keys()
datasets = datasets['dataset']
assert len(datasets) == 3
assert type(datasets[0]) == NumpyTupleDataset
assert type(datasets[1]) == NumpyTupleDataset
assert type(datasets[2]) == NumpyTupleDataset
# Test each train, valid and test dataset
for i, dataset in enumerate(datasets):
# --- Test dataset is correctly obtained ---
index = numpy.random.choice(len(dataset), None)
atoms, label = dataset[index]
assert atoms.ndim == 1 # (atom, )
assert atoms.dtype == numpy.int32
# (atom from, atom to) or (edge_type, atom from, atom to)
assert label.ndim == 1
assert label.shape[0] == 1
assert label.dtype == numpy.float32
# --- Test number of dataset ---
assert len(dataset) == expect_featurized_pdbbind_lengths[i]
# For qm7 dataset, stratified splitting is recommended.
@pytest.mark.slow
def test_get_molnet_qm7_dataset():
# test default behavior
pp = AtomicNumberPreprocessor()
datasets = molnet.get_molnet_dataset('qm7', preprocessor=pp)
assert 'smiles' in datasets.keys()
assert 'dataset' in datasets.keys()
datasets = datasets['dataset']
assert len(datasets) == 3
assert type(datasets[0]) == NumpyTupleDataset
assert type(datasets[1]) == NumpyTupleDataset
assert type(datasets[2]) == NumpyTupleDataset
# Test each train, valid and test dataset
for i, dataset in enumerate(datasets):
# --- Test dataset is correctly obtained ---
index = numpy.random.choice(len(dataset), None)
atoms, label = dataset[index]
assert atoms.ndim == 1 # (atom, )
assert atoms.dtype == numpy.int32
# (atom from, atom to) or (edge_type, atom from, atom to)
assert label.ndim == 1
assert label.shape[0] == 1
assert label.dtype == numpy.float32
# --- Test number of dataset ---
assert len(dataset) == expect_qm7_lengths[i]
# For qm7 dataset, stratified splitting is recommended.
@pytest.mark.slow
def test_get_molnet_qm7_dataset_with_smiles():
# test default behavior
pp = AtomicNumberPreprocessor()
datasets = molnet.get_molnet_dataset('qm7', preprocessor=pp,
return_smiles=True)
assert 'smiles' in datasets.keys()
assert 'dataset' in datasets.keys()
smileses = datasets['smiles']
datasets = datasets['dataset']
assert len(datasets) == 3
assert len(smileses) == 3
assert type(datasets[0]) == NumpyTupleDataset
assert type(datasets[1]) == NumpyTupleDataset
assert type(datasets[2]) == NumpyTupleDataset
# Test each train, valid and test dataset
for i, dataset in enumerate(datasets):
# --- Test dataset is correctly obtained ---
index = numpy.random.choice(len(dataset), None)
atoms, label = dataset[index]
assert atoms.ndim == 1 # (atom, )
assert atoms.dtype == numpy.int32
# (atom from, atom to) or (edge_type, atom from, atom to)
assert label.ndim == 1
assert label.shape[0] == 1
assert label.dtype == numpy.float32
# --- Test number of dataset ---
assert len(dataset) == expect_qm7_lengths[i]
assert len(smileses[i]) == expect_qm7_lengths[i]
def test_get_molnet_bbbp_dataframe():
datasets = molnet.get_molnet_dataframe('bbbp')
assert isinstance(datasets, pandas.DataFrame)
assert len(datasets) == 2050
def test_get_molnet_pdbbind_smiles_dataframe():
datasets = molnet.get_molnet_dataframe('pdbbind_smiles',
pdbbind_subset='core')
assert isinstance(datasets, pandas.DataFrame)
assert len(datasets) == 168
def test_get_molnet_pdbbind_grid_dataframe():
with pytest.raises(ValueError):
datasets = molnet.get_molnet_dataframe('pdbbind_grid', # NOQA
pdbbind_subset='core')
if __name__ == '__main__':
args = [__file__, '-v', '-s']
pytest.main(args=args)
================================================
FILE: tests/datasets_tests/molnet_tests/test_pdbbind_time.py
================================================
import os
import pytest
from chainer_chemistry.datasets.molnet import pdbbind_time
@pytest.mark.slow
def test_get_pdbbind_time_filepath():
filepath = pdbbind_time.get_pdbbind_time_filepath(
download_if_not_exist=False)
if os.path.exists(filepath):
os.remove(filepath)
filepath = pdbbind_time.get_pdbbind_time_filepath(
download_if_not_exist=True)
assert isinstance(filepath, str)
assert os.path.exists(filepath)
def test_get_pdbbind_time():
time_list = pdbbind_time.get_pdbbind_time()
assert isinstance(time_list, list)
for time in time_list:
assert 1900 < time < 2100
================================================
FILE: tests/datasets_tests/test_numpy_tuple_dataset.py
================================================
import os
import tempfile
import numpy
import pytest
import six
from chainer_chemistry.datasets import NumpyTupleDataset
@pytest.fixture
def data():
a = numpy.array([1, 2])
b = numpy.array([4, 5])
c = numpy.array([[6, 7, 8], [8, 9, 10]])
return a, b, c
@pytest.fixture
def long_data():
a = numpy.array([1, 2, 3, 4])
b = numpy.array([4, 5, 6, 7])
c = numpy.array([[6, 7, 8], [8, 9, 10], [11, 12, 13], [14, 15, 16]])
return a, b, c
class TestNumpyTupleDataset(object):
def test_len(self, data):
dataset = NumpyTupleDataset(*data)
assert len(dataset) == 2
@pytest.mark.parametrize('index', [0, 1])
def test_get_item_integer_index(self, data, index):
dataset = NumpyTupleDataset(*data)
actual = dataset[index]
assert len(actual) == len(data)
for a, d in six.moves.zip(actual, data):
numpy.testing.assert_array_equal(a, d[index])
@pytest.mark.parametrize('index', [slice(0, 2, None)])
def test_get_item_slice_index(self, data, index):
dataset = NumpyTupleDataset(*data)
actual = dataset[index]
batches = [d[index] for d in data]
length = len(batches[0])
expect = [tuple([batch[i] for batch in batches])
for i in six.moves.range(length)]
assert len(actual) == len(expect)
for tuple_a, tuple_e in six.moves.zip(actual, expect):
assert len(tuple_a) == len(tuple_e)
for a, e in six.moves.zip(tuple_a, tuple_e):
numpy.testing.assert_array_equal(a, e)
@pytest.mark.parametrize('index', [
numpy.asarray([2, 0]), numpy.asarray([1]),
numpy.asarray([], dtype=numpy.int32)])
def test_get_item_ndarray_index(self, long_data, index):
dataset = NumpyTupleDataset(*long_data)
actual = dataset[index]
batches = [d[index] for d in long_data]
length = len(batches[0])
expect = [tuple([batch[i] for batch in batches])
for i in six.moves.range(length)]
assert len(actual) == len(expect)
for tuple_a, tuple_e in six.moves.zip(actual, expect):
assert len(tuple_a) == len(tuple_e)
for a, e in six.moves.zip(tuple_a, tuple_e):
numpy.testing.assert_array_equal(a, e)
@pytest.mark.parametrize('index', [[2, 0], [1]])
def test_get_item_list_index(self, long_data, index):
dataset = NumpyTupleDataset(*long_data)
actual = dataset[index]
batches = [d[index] for d in long_data]
length = len(batches[0])
expect = [tuple([batch[i] for batch in batches])
for i in six.moves.range(length)]
assert len(actual) == len(expect)
for tuple_a, tuple_e in six.moves.zip(actual, expect):
assert len(tuple_a) == len(tuple_e)
for a, e in six.moves.zip(tuple_a, tuple_e):
numpy.testing.assert_array_equal(a, e)
def test_invalid_datasets(self):
a = numpy.array([1, 2])
b = numpy.array([1, 2, 3])
with pytest.raises(ValueError):
NumpyTupleDataset(a, b)
def test_save_load(self, data):
tmp_cache_path = os.path.join(tempfile.mkdtemp(), 'tmp.npz')
dataset = NumpyTupleDataset(*data)
NumpyTupleDataset.save(tmp_cache_path, dataset)
assert os.path.exists(tmp_cache_path)
load_dataset = NumpyTupleDataset.load(tmp_cache_path)
os.remove(tmp_cache_path)
assert len(dataset._datasets) == len(load_dataset._datasets)
for a, d in six.moves.zip(dataset._datasets, load_dataset._datasets):
numpy.testing.assert_array_equal(a, d)
def test_get_datasets(self, data):
dataset = NumpyTupleDataset(*data)
datasets = dataset.get_datasets()
assert len(datasets) == len(data)
for i in range(len(datasets)):
numpy.testing.assert_array_equal(datasets[i], data[i])
if __name__ == '__main__':
pytest.main([__file__, '-v'])
================================================
FILE: tests/datasets_tests/test_qm9.py
================================================
import os
import numpy
import pytest
from chainer_chemistry.dataset.preprocessors.atomic_number_preprocessor import AtomicNumberPreprocessor # NOQA
from chainer_chemistry.datasets import qm9
QM9_NUM_LABEL = 15
QM9_NUM_DATASET = 133885
def test_get_qm9_filepath_without_download():
filepath = qm9.get_qm9_filepath(download_if_not_exist=False)
if os.path.exists(filepath):
os.remove(filepath) # ensure a cache file does not exist.
filepath = qm9.get_qm9_filepath(download_if_not_exist=False)
assert isinstance(filepath, str)
assert not os.path.exists(filepath)
@pytest.mark.slow
def test_get_qm9_filepath_with_download():
filepath = qm9.get_qm9_filepath(download_if_not_exist=False)
if os.path.exists(filepath):
os.remove(filepath) # ensure a cache file does not exist.
# This method downloads the file if not exist
filepath = qm9.get_qm9_filepath(download_if_not_exist=True)
assert isinstance(filepath, str)
assert os.path.exists(filepath)
@pytest.mark.slow
def test_get_qm9():
# test default behavior
pp = AtomicNumberPreprocessor()
dataset = qm9.get_qm9(preprocessor=pp)
# --- Test dataset is correctly obtained ---
index = numpy.random.choice(len(dataset), None)
atoms, label = dataset[index]
assert atoms.ndim == 1 # (atom, )
assert atoms.dtype == numpy.int32
# (atom from, atom to) or (edge_type, atom from, atom to)
assert label.ndim == 1
assert label.shape[0] == QM9_NUM_LABEL
assert label.dtype == numpy.float32
# --- Test number of dataset ---
assert len(dataset) == QM9_NUM_DATASET
@pytest.mark.slow
def test_get_qm9_smiles():
# test default behavior
pp = AtomicNumberPreprocessor()
dataset, smiles = qm9.get_qm9(preprocessor=pp, return_smiles=True)
# --- Test dataset is correctly obtained ---
index = numpy.random.choice(len(dataset), None)
atoms, label = dataset[index]
assert atoms.ndim == 1 # (atom, )
assert atoms.dtype == numpy.int32
# (atom from, atom to) or (edge_type, atom from, atom to)
assert label.ndim == 1
assert label.shape[0] == QM9_NUM_LABEL
assert label.dtype == numpy.float32
# --- Test number of dataset ---
assert len(dataset) == QM9_NUM_DATASET
assert len(smiles) == QM9_NUM_DATASET
# --- Test order of dataset ---
atoms0, labels0 = dataset[0]
assert smiles[0] == 'C'
assert numpy.alltrue(atoms0 == numpy.array([6], dtype=numpy.int32))
atoms7777, labels7777 = dataset[7777]
assert smiles[7777] == 'CC1=NCCC(C)O1'
assert numpy.alltrue(
atoms7777 == numpy.array([6, 6, 7, 6, 6, 6, 6, 8], dtype=numpy.int32))
atoms133884, labels133884 = dataset[133884]
assert smiles[133884] == 'C1N2C3C4C5OC13C2C54'
assert numpy.alltrue(
atoms133884 == numpy.array([6, 7, 6, 6, 6, 8, 6, 6, 6],
dtype=numpy.int32))
def test_get_qm9_label_names():
label_names = qm9.get_qm9_label_names()
assert isinstance(label_names, list)
for label in label_names:
assert isinstance(label, str)
if __name__ == '__main__':
args = [__file__, '-v', '-s']
pytest.main(args=args)
================================================
FILE: tests/datasets_tests/test_tox21.py
================================================
import os
import numpy
import pytest
from chainer_chemistry.dataset.preprocessors.atomic_number_preprocessor import AtomicNumberPreprocessor # NOQA
from chainer_chemistry.datasets import tox21
TOX21_NUM_LABEL = 12
dataset_types = [
'train',
'val',
'test'
]
@pytest.mark.parametrize('dataset_type', dataset_types)
def test_get_tox21_filepath_without_download(dataset_type):
filepath = tox21.get_tox21_filepath(dataset_type,
download_if_not_exist=False)
if os.path.exists(filepath):
os.remove(filepath) # ensure a cache file does not exist.
filepath = tox21.get_tox21_filepath(dataset_type,
download_if_not_exist=False)
assert isinstance(filepath, str)
assert not os.path.exists(filepath)
@pytest.mark.slow
@pytest.mark.parametrize('dataset_type', dataset_types)
def test_get_tox21_filepath_with_download(dataset_type):
filepath = tox21.get_tox21_filepath(dataset_type,
download_if_not_exist=False)
if os.path.exists(filepath):
os.remove(filepath) # ensure a cache file does not exist.
# This method downloads the file if not exist
filepath = tox21.get_tox21_filepath(dataset_type,
download_if_not_exist=True)
assert isinstance(filepath, str)
assert os.path.exists(filepath)
@pytest.mark.slow
def test_get_tox21():
# test default behavior
pp = AtomicNumberPreprocessor()
train, val, test = tox21.get_tox21(preprocessor=pp)
# --- Test dataset is correctly obtained ---
for dataset in [train, val, test]:
index = numpy.random.choice(len(dataset), None)
atoms, label = dataset[index]
assert atoms.ndim == 1 # (atom, )
assert atoms.dtype == numpy.int32
assert label.ndim == 1
assert label.shape[0] == TOX21_NUM_LABEL
assert label.dtype == numpy.int32
def test_get_tox21_label_names():
label_names = tox21.get_tox21_label_names()
assert isinstance(label_names, list)
for label in label_names:
assert isinstance(label, str)
def test_get_tox21_filepath_assert_raises():
with pytest.raises(ValueError):
tox21.get_tox21_filepath('other')
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/datasets_tests/test_zinc.py
================================================
import os
import numpy
import pytest
from chainer_chemistry.dataset.preprocessors.atomic_number_preprocessor import AtomicNumberPreprocessor # NOQA
from chainer_chemistry.datasets import zinc
ZINC250K_NUM_LABEL = 3
ZINC250K_NUM_DATASET = 249455
def test_get_zinc_filepath_without_download():
filepath = zinc.get_zinc250k_filepath(download_if_not_exist=False)
if os.path.exists(filepath):
os.remove(filepath) # ensure a cache file does not exist.
filepath = zinc.get_zinc250k_filepath(download_if_not_exist=False)
assert isinstance(filepath, str)
assert not os.path.exists(filepath)
@pytest.mark.slow
def test_get_zinc_filepath_with_download():
filepath = zinc.get_zinc250k_filepath(download_if_not_exist=False)
if os.path.exists(filepath):
os.remove(filepath) # ensure a cache file does not exist.
# This method downloads the file if not exist
filepath = zinc.get_zinc250k_filepath(download_if_not_exist=True)
assert isinstance(filepath, str)
assert os.path.exists(filepath)
@pytest.mark.slow
def test_get_zinc():
# test default behavior
pp = AtomicNumberPreprocessor()
dataset = zinc.get_zinc250k(preprocessor=pp)
# --- Test dataset is correctly obtained ---
index = numpy.random.choice(len(dataset), None)
atoms, label = dataset[index]
assert atoms.ndim == 1 # (atom, )
assert atoms.dtype == numpy.int32
assert label.ndim == 1
assert label.shape[0] == ZINC250K_NUM_LABEL
assert label.dtype == numpy.float32
# --- Test number of dataset ---
assert len(dataset) == ZINC250K_NUM_DATASET
@pytest.mark.slow
def test_get_zinc_smiles():
# test smiles extraction and dataset order
pp = AtomicNumberPreprocessor()
target_index = [0, 7777, 249454] # set target_index for fast testing...
dataset, smiles = zinc.get_zinc250k(preprocessor=pp, return_smiles=True,
target_index=target_index)
# --- Test dataset is correctly obtained ---
index = numpy.random.choice(len(dataset), None)
atoms, label = dataset[index]
assert atoms.ndim == 1 # (atom, )
assert atoms.dtype == numpy.int32
# (atom from, atom to) or (edge_type, atom from, atom to)
assert label.ndim == 1
assert label.shape[0] == ZINC250K_NUM_LABEL
assert label.dtype == numpy.float32
# --- Test number of dataset ---
assert len(dataset) == len(target_index)
assert len(smiles) == len(target_index)
# --- Test order of dataset ---
assert smiles[0] == 'CC(C)(C)c1ccc2occ(CC(=O)Nc3ccccc3F)c2c1'
atoms0, labels0 = dataset[0]
assert numpy.alltrue(atoms0 == numpy.array(
[6, 6, 6, 6, 6, 6, 6, 6, 8, 6, 6, 6, 6, 8, 7, 6, 6, 6, 6, 6, 6, 9, 6,
6], dtype=numpy.int32))
assert numpy.alltrue(labels0 == numpy.array(
[5.0506, 0.70201224, 2.0840945], dtype=numpy.float32))
assert smiles[1] == 'CCCc1cc(NC(=O)Nc2ccc3c(c2)OCCO3)n(C)n1'
atoms7777, labels7777 = dataset[1]
assert numpy.alltrue(atoms7777 == numpy.array(
[6, 6, 6, 6, 6, 6, 7, 6, 8, 7, 6, 6, 6, 6, 6, 6, 8, 6, 6, 8, 7, 6, 7],
dtype=numpy.int32))
assert numpy.alltrue(labels7777 == numpy.array(
[2.7878, 0.9035222, 2.3195992], dtype=numpy.float32))
assert smiles[2] == 'O=C(CC(c1ccccc1)c1ccccc1)N1CCN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1' # NOQA
atoms249454, labels249454 = dataset[2]
assert numpy.alltrue(atoms249454 == numpy.array(
[8, 6, 6, 6, 6, 6, 6, 6, 6, 6, 6, 6, 6, 6, 6, 6, 7,
6, 6, 7, 16, 8, 8, 6, 6, 6, 6, 6, 6, 7, 8, 8, 6, 6],
dtype=numpy.int32))
assert numpy.alltrue(labels249454 == numpy.array(
[3.6499, 0.37028658, 2.2142494], dtype=numpy.float32))
def test_get_zinc_label_names():
label_names = zinc.get_zinc250k_label_names()
assert isinstance(label_names, list)
for label in label_names:
assert isinstance(label, str)
if __name__ == '__main__':
args = [__file__, '-v', '-s']
pytest.main(args=args)
================================================
FILE: tests/functions_tests/activation/test_megnet_softplus.py
================================================
import numpy
import pytest
from chainer import cuda
from chainer_chemistry.functions.activation.megnet_softplus \
import megnet_softplus
def test_forward_cpu():
x = numpy.array([[1, 2, 3], [6, 5, 4]], dtype=numpy.float32)
output = megnet_softplus(x)
expect_output = numpy.array([
[0.62011445, 1.4337809, 2.3554401],
[5.3093286, 4.313568, 3.3250027]], dtype=numpy.float32)
numpy.allclose(output.array, expect_output)
def test_forward_zero_cpu():
x = numpy.zeros((2, 3), dtype=numpy.float32)
output = megnet_softplus(x)
expect_output = numpy.zeros((2, 3), dtype=numpy.float32)
numpy.allclose(output.array, expect_output)
def test_forward_avoid_overflow_cpu():
x = numpy.array([1e5], dtype=numpy.float32)
output = megnet_softplus(x)
expect_output = numpy.array([1e5], dtype=numpy.float32)
numpy.allclose(output.array, expect_output)
@pytest.mark.gpu
def test_forward_gpu():
x = cuda.to_gpu(numpy.array([[1, 2, 3], [6, 5, 4]], dtype=numpy.float32))
output = megnet_softplus(x)
expect_output = numpy.array([
[0.62011445, 1.4337809, 2.3554401],
[5.3093286, 4.313568, 3.3250027]], dtype=numpy.float32)
numpy.allclose(cuda.to_cpu(output.array), expect_output)
@pytest.mark.gpu
def test_forward_zero_gpu():
x = cuda.to_gpu(numpy.zeros((2, 3), dtype=numpy.float32))
output = megnet_softplus(x)
expect_output = numpy.zeros((2, 3), dtype=numpy.float32)
numpy.allclose(cuda.to_cpu(output.array), expect_output)
@pytest.mark.gpu
def test_forward_avoid_overflow_gpu():
x = cuda.to_gpu(numpy.array([1e5], dtype=numpy.float32))
output = megnet_softplus(x)
expect_output = numpy.array([1e5], dtype=numpy.float32)
numpy.allclose(cuda.to_cpu(output.array), expect_output)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/functions_tests/activation/test_shifted_softplus.py
================================================
import numpy
import pytest
from chainer import cuda
from chainer_chemistry.functions.activation.shifted_softplus import shifted_softplus # NOQA
def test_forward_cpu():
x = numpy.array([[1, 2, 3], [6, 5, 4]], dtype=numpy.float32)
output = shifted_softplus(x)
expect_output = numpy.array([
[0.62011445, 1.4337809, 2.3554401],
[5.3093286, 4.313568, 3.3250027]], dtype=numpy.float32)
numpy.allclose(output.array, expect_output)
def test_forward_zero_cpu():
x = numpy.zeros((2, 3), dtype=numpy.float32)
output = shifted_softplus(x)
expect_output = numpy.zeros((2, 3), dtype=numpy.float32)
numpy.allclose(output.array, expect_output)
def test_forward_avoid_overflow_cpu():
x = numpy.array([1e5], dtype=numpy.float32)
output = shifted_softplus(x)
expect_output = numpy.array([1e5], dtype=numpy.float32)
numpy.allclose(output.array, expect_output)
@pytest.mark.gpu
def test_forward_gpu():
x = cuda.to_gpu(numpy.array([[1, 2, 3], [6, 5, 4]], dtype=numpy.float32))
output = shifted_softplus(x)
expect_output = numpy.array([
[0.62011445, 1.4337809, 2.3554401],
[5.3093286, 4.313568, 3.3250027]], dtype=numpy.float32)
numpy.allclose(cuda.to_cpu(output.array), expect_output)
@pytest.mark.gpu
def test_forward_zero_gpu():
x = cuda.to_gpu(numpy.zeros((2, 3), dtype=numpy.float32))
output = shifted_softplus(x)
expect_output = numpy.zeros((2, 3), dtype=numpy.float32)
numpy.allclose(cuda.to_cpu(output.array), expect_output)
@pytest.mark.gpu
def test_forward_avoid_overflow_gpu():
x = cuda.to_gpu(numpy.array([1e5], dtype=numpy.float32))
output = shifted_softplus(x)
expect_output = numpy.array([1e5], dtype=numpy.float32)
numpy.allclose(cuda.to_cpu(output.array), expect_output)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/functions_tests/activation/test_softmax.py
================================================
import numpy
import pytest
from chainer import cuda
from chainer_chemistry.functions.activation.softmax import softmax
def test_forward_cpu():
x = numpy.array([[1, 2, 3], [6, 5, 4]], dtype=numpy.float32)
output = softmax(x)
expect_output = numpy.array([
[0.09003057, 0.24472848, 0.66524094],
[0.66524094, 0.24472848, 0.09003057]], dtype=numpy.float32)
numpy.allclose(output.array, expect_output)
def test_forward_cpu_with_mask():
x = numpy.array([[1, 2, 3, 2, 5], [1, 6, 5, 4, 2]], dtype=numpy.float32)
mask = numpy.array([[1, 1, 1, 0, 0], [0, 1, 1, 1, 0]], dtype=numpy.float32)
output = softmax(x, mask=mask)
expect_output = numpy.array([
[0.09003057, 0.24472848, 0.66524094, 0., 0.],
[0., 0.66524094, 0.24472848, 0.09003057, 0.]], dtype=numpy.float32)
numpy.allclose(output.array, expect_output)
@pytest.mark.gpu
def test_forward_gpu():
x = cuda.to_gpu(numpy.array([[1, 2, 3], [6, 5, 4]], dtype=numpy.float32))
output = softmax(x)
expect_output = numpy.array([
[0.09003057, 0.24472848, 0.66524094],
[0.66524094, 0.24472848, 0.09003057]], dtype=numpy.float32)
numpy.allclose(cuda.to_cpu(output.array), expect_output)
@pytest.mark.gpu
def test_forward_gpu_with_mask():
x = numpy.array([[1, 2, 3, 2, 5], [1, 6, 5, 4, 2]], dtype=numpy.float32)
mask = numpy.array([[1, 1, 1, 0, 0], [0, 1, 1, 1, 0]], dtype=numpy.float32)
x, mask = map(cuda.to_gpu, (x, mask))
output = softmax(x, mask=mask)
expect_output = numpy.array([
[0.09003057, 0.24472848, 0.66524094, 0., 0.],
[0., 0.66524094, 0.24472848, 0.09003057, 0.]], dtype=numpy.float32)
numpy.allclose(cuda.to_cpu(output.array), expect_output)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/functions_tests/evaluation/test_r2_score.py
================================================
import numpy
import pytest
from chainer import cuda
import chainer_chemistry
def r2_score(pred, true, sample_weight=None, multioutput="uniform_average",
ignore_nan=False):
pred = cuda.to_cpu(pred)
true = cuda.to_cpu(true)
diff = pred - true
dev = true - numpy.mean(true, axis=0)
if ignore_nan:
diff[numpy.isnan(diff)] = 0.
dev[numpy.isnan(dev)] = 0.
SS_res = numpy.asarray(
numpy.sum(diff ** 2, axis=0))
SS_tot = numpy.asarray(
numpy.sum(dev ** 2, axis=0))
if multioutput == 'uniform_average':
if numpy.any(SS_tot == 0):
return 0.0
else:
return (1 - SS_res / SS_tot).mean()
elif multioutput == 'raw_values':
if numpy.any(SS_tot == 0):
# Assign dummy value to avoid zero-division
SS_tot_iszero = SS_tot == 0
SS_tot[SS_tot_iszero] = 1
return numpy.where(SS_tot_iszero, 0.0, 1 - SS_res / SS_tot)
else:
return 1 - SS_res / SS_tot
@pytest.fixture
def inputs():
numpy.random.seed(0)
x0 = numpy.random.uniform(-1, 1, (4, 3)).astype(numpy.float32)
# Add sufficient margin to prevent computational error
diff = numpy.random.uniform(-1, 1, (4, 3)).astype(numpy.float32)
diff[abs(diff) < 0.01] = 0.5
x1 = x0 + diff
x2 = numpy.asarray([[0.3, numpy.nan, 0.2],
[numpy.nan, 0.1, 0.5],
[0.9, 0.7, numpy.nan],
[0.2, -0.3, 0.4]]).astype(numpy.float32)
return x0, x1, x2
def check_forward(inputs):
x0, x1, _ = inputs
y = chainer_chemistry.functions.r2_score(x0, x1)
assert y.data.dtype == 'f'
assert y.data.shape == ()
expect = r2_score(x0, x1)
assert numpy.allclose(cuda.to_cpu(y.data), expect)
def check_forward_ignore_nan(inputs):
x0, _, x2 = inputs
y = chainer_chemistry.functions.r2_score(x0, x2, ignore_nan=True)
assert y.data.dtype == 'f'
assert y.data.shape == ()
expect = r2_score(x0, x2, ignore_nan=True)
assert numpy.allclose(cuda.to_cpu(y.data), expect)
def check_forward_ignore_nan_with_nonnan_value(inputs):
x0, x1, _ = inputs
y = chainer_chemistry.functions.r2_score(x0, x1, ignore_nan=True)
assert y.data.dtype == 'f'
assert y.data.shape == ()
expect = r2_score(x0, x1, ignore_nan=True)
assert numpy.allclose(y.data, expect)
def test_forward_cpu(inputs):
check_forward(inputs)
check_forward_ignore_nan(inputs)
check_forward_ignore_nan_with_nonnan_value(inputs)
@pytest.mark.gpu
def test_forward_gpu(inputs):
x0, x1, x2 = inputs
check_forward((cuda.to_gpu(x0), cuda.to_gpu(x1), None))
check_forward_ignore_nan((cuda.to_gpu(x0), None, cuda.to_gpu(x2)))
if __name__ == '__main__':
pytest.main([__file__, '-v'])
================================================
FILE: tests/functions_tests/loss/test_mean_absolute_error.py
================================================
import numpy
import pytest
import chainer
from chainer import cuda
from chainer import gradient_check
import chainer_chemistry
@pytest.fixture
def inputs():
numpy.random.seed(0)
x0 = numpy.random.uniform(-1, 1, (4, 3)).astype(numpy.float32)
# Add sufficient margin to prevent computational error
diff = numpy.random.uniform(-1, 1, (4, 3)).astype(numpy.float32)
diff[abs(diff) < 0.01] = 0.5
x1 = x0 + diff
x2 = numpy.asarray([[0.3, numpy.nan, 0.2],
[numpy.nan, 0.1, 0.5],
[0.9, 0.7, numpy.nan],
[0.2, -0.3, 0.4]]).astype(numpy.float32)
return x0, x1, x2
@pytest.fixture
def grads():
numpy.random.seed(0)
gy = numpy.random.uniform(-1, 1, ()).astype(numpy.float32)
ggx0 = numpy.random.uniform(-1, 1, (4, 3)).astype(numpy.float32)
ggx1 = numpy.random.uniform(-1, 1, (4, 3)).astype(numpy.float32)
return gy, ggx0, ggx1
def check_forward(inputs):
x0_data, x1_data, _ = inputs
x0 = chainer.Variable(x0_data)
x1 = chainer.Variable(x1_data)
loss = chainer_chemistry.functions.mean_absolute_error(x0, x1)
loss_value = cuda.to_cpu(loss.data)
assert loss.dtype == numpy.float32
assert loss_value.shape == ()
loss_expect = numpy.zeros(())
x0_data = cuda.to_cpu(x0_data)
x1_data = cuda.to_cpu(x1_data)
for i in numpy.ndindex(x0_data.shape):
loss_expect += abs((x0_data[i] - x1_data[i]))
loss_expect /= x0_data.size
assert numpy.allclose(loss_value, loss_expect)
def check_forward_ignore_nan(inputs):
x0_data, _, x2_data = inputs
x0 = chainer.Variable(x0_data)
x2 = chainer.Variable(x2_data)
loss = chainer_chemistry.functions.mean_absolute_error(x0, x2,
ignore_nan=True)
loss_value = cuda.to_cpu(loss.data)
assert loss.dtype == numpy.float32
assert loss_value.shape == ()
loss_expect = numpy.zeros(())
x0_data = cuda.to_cpu(x0_data)
x2_data = cuda.to_cpu(x2_data)
nan_mask = numpy.invert(numpy.isnan(x2_data)).astype(x2_data.dtype)
for i in numpy.ndindex(x0_data.shape):
loss_expect += abs(x0_data[i] -
numpy.nan_to_num(x2_data[i])) * nan_mask[i]
loss_expect /= x0_data.size
assert numpy.allclose(loss_value, loss_expect)
def check_forward_ignore_nan_with_nonnan_value(inputs):
x0_data, x1_data, _ = inputs
x0 = chainer.Variable(x0_data)
x1 = chainer.Variable(x1_data)
loss = chainer_chemistry.functions.mean_absolute_error(x0, x1,
ignore_nan=True)
loss_value = cuda.to_cpu(loss.data)
assert loss.dtype == numpy.float32
assert loss_value.shape == ()
loss_expect = numpy.zeros(())
x0_data = cuda.to_cpu(x0_data)
x1_data = cuda.to_cpu(x1_data)
nan_mask = numpy.invert(numpy.isnan(x1_data)).astype(x1_data.dtype)
for i in numpy.ndindex(x0_data.shape):
loss_expect += abs(x0_data[i] -
numpy.nan_to_num(x1_data[i])) * nan_mask[i]
loss_expect /= x0_data.size
assert numpy.allclose(loss_value, loss_expect)
def test_forward_cpu(inputs):
check_forward(inputs)
check_forward_ignore_nan(inputs)
check_forward_ignore_nan_with_nonnan_value(inputs)
@pytest.mark.gpu
def test_forward_gpu(inputs):
x0, x1, x2 = inputs
check_forward((cuda.to_gpu(x0), cuda.to_gpu(x1), None))
check_forward_ignore_nan((cuda.to_gpu(x0), None, cuda.to_gpu(x2)))
def check_backward(inputs):
x0_data, x1_data, _ = inputs
gradient_check.check_backward(
chainer_chemistry.functions.mean_absolute_error,
(x0_data, x1_data), None, eps=1e-2)
def check_backward_ignore_nan(inputs):
x0_data, _, x2_data = inputs
def func(x0, x1):
return chainer_chemistry.functions.mean_absolute_error(x0, x1,
ignore_nan=True)
gradient_check.check_backward(func, (x0_data, x2_data), None, eps=1e-2,
atol=1e-3, rtol=1e-3)
def check_backward_ignore_nan_with_nonnan_value(inputs):
x0_data, x1_data, _ = inputs
def func(x0, x1):
return chainer_chemistry.functions.mean_absolute_error(x0, x1,
ignore_nan=True)
gradient_check.check_backward(func, (x0_data, x1_data), None, eps=1e-2)
def test_backward_cpu(inputs):
check_backward(inputs)
check_backward_ignore_nan(inputs)
check_backward_ignore_nan_with_nonnan_value(inputs)
@pytest.mark.gpu
def test_backward_gpu(inputs):
x0, x1, x2 = inputs
check_backward((cuda.to_gpu(x0), cuda.to_gpu(x1), None))
check_backward_ignore_nan((cuda.to_gpu(x0), None, cuda.to_gpu(x2)))
check_backward_ignore_nan_with_nonnan_value((cuda.to_gpu(x0),
cuda.to_gpu(x1), None))
def check_double_backward(inputs, grads):
x0, x1, _ = inputs
gy, ggx0, ggx1 = grads
def func(*xs):
y = chainer_chemistry.functions.mean_absolute_error(*xs)
return y * y
gradient_check.check_double_backward(func, (x0, x1), gy, (ggx0, ggx1))
def check_double_backward_ignore_nan(inputs, grads):
x0, _, x2 = inputs
gy, ggx0, ggx1 = grads
def func(*xs):
y = chainer_chemistry.functions.mean_absolute_error(*xs,
ignore_nan=True)
return y * y
gradient_check.check_double_backward(func, (x0, x2), gy, (ggx0, ggx1))
def check_double_backward_ignore_nan_with_nonnan_value(inputs, grads):
x0, x1, _ = inputs
gy, ggx0, ggx1 = grads
def func(*xs):
y = chainer_chemistry.functions.mean_absolute_error(*xs,
ignore_nan=True)
return y * y
gradient_check.check_double_backward(func, (x0, x1), gy, (ggx0, ggx1))
def test_double_backward_cpu(inputs, grads):
check_double_backward(inputs, grads)
check_double_backward_ignore_nan(inputs, grads)
check_double_backward_ignore_nan_with_nonnan_value(inputs, grads)
@pytest.mark.gpu
def test_double_backward_gpu(inputs, grads):
x0, x1, x2 = inputs
gy, ggx0, ggx1 = grads
check_double_backward((cuda.to_gpu(x0), cuda.to_gpu(x1), None),
(cuda.to_gpu(gy), cuda.to_gpu(ggx0),
cuda.to_gpu(ggx1)))
check_double_backward_ignore_nan_with_nonnan_value((cuda.to_gpu(x0),
cuda.to_gpu(x1),
None),
(cuda.to_gpu(gy),
cuda.to_gpu(ggx0),
cuda.to_gpu(ggx1)))
if __name__ == '__main__':
pytest.main([__file__, '-v'])
================================================
FILE: tests/functions_tests/loss/test_mean_squared_error.py
================================================
import numpy
import pytest
import chainer
from chainer import cuda
from chainer import gradient_check
import chainer_chemistry
@pytest.fixture
def inputs():
numpy.random.seed(0)
x0 = numpy.random.uniform(-1, 1, (4, 3)).astype(numpy.float32)
x1 = numpy.random.uniform(-1, 1, (4, 3)).astype(numpy.float32)
x2 = numpy.asarray([[0.3, numpy.nan, 0.2],
[numpy.nan, 0.1, 0.5],
[0.9, 0.7, numpy.nan],
[0.2, -0.3, 0.4]]).astype(numpy.float32)
return x0, x1, x2
@pytest.fixture
def grads():
numpy.random.seed(0)
gy = numpy.random.uniform(-1, 1, ()).astype(numpy.float32)
ggx0 = numpy.random.uniform(-1, 1, (4, 3)).astype(numpy.float32)
ggx1 = numpy.random.uniform(-1, 1, (4, 3)).astype(numpy.float32)
return gy, ggx0, ggx1
def check_forward(inputs):
x0_data, x1_data, _ = inputs
x0 = chainer.Variable(x0_data)
x1 = chainer.Variable(x1_data)
loss = chainer_chemistry.functions.mean_squared_error(x0, x1)
loss_value = cuda.to_cpu(loss.data)
assert loss.dtype == numpy.float32
assert loss_value.shape == ()
loss_expect = numpy.zeros(())
x0_data = cuda.to_cpu(x0_data)
x1_data = cuda.to_cpu(x1_data)
for i in numpy.ndindex(x0_data.shape):
loss_expect += ((x0_data[i] - x1_data[i]) ** 2)
loss_expect /= x0_data.size
assert numpy.allclose(loss_value, loss_expect)
def check_forward_ignore_nan(inputs):
x0_data, _, x2_data = inputs
x0 = chainer.Variable(x0_data)
x2 = chainer.Variable(x2_data)
loss = chainer_chemistry.functions.mean_squared_error(x0, x2,
ignore_nan=True)
loss_value = cuda.to_cpu(loss.data)
assert loss.dtype == numpy.float32
assert loss_value.shape == ()
loss_expect = numpy.zeros(())
x0_data = cuda.to_cpu(x0_data)
x2_data = cuda.to_cpu(x2_data)
nan_mask = numpy.invert(numpy.isnan(x2_data)).astype(x2_data.dtype)
for i in numpy.ndindex(x0_data.shape):
loss_expect += ((x0_data[i] - numpy.nan_to_num(x2_data[i])) ** 2
* nan_mask[i])
loss_expect /= x0_data.size
assert numpy.allclose(loss_value, loss_expect)
def check_forward_ignore_nan_with_nonnan_value(inputs):
x0_data, x1_data, _ = inputs
x0 = chainer.Variable(x0_data)
x1 = chainer.Variable(x1_data)
loss = chainer_chemistry.functions.mean_squared_error(x0, x1,
ignore_nan=True)
loss_value = cuda.to_cpu(loss.data)
assert loss.dtype == numpy.float32
assert loss_value.shape == ()
loss_expect = numpy.zeros(())
x0_data = cuda.to_cpu(x0_data)
x1_data = cuda.to_cpu(x1_data)
nan_mask = numpy.invert(numpy.isnan(x1_data)).astype(x1_data.dtype)
for i in numpy.ndindex(x0_data.shape):
loss_expect += ((x0_data[i] - numpy.nan_to_num(x1_data[i])) ** 2
* nan_mask[i])
loss_expect /= x0_data.size
assert numpy.allclose(loss_value, loss_expect)
def test_forward_cpu(inputs):
check_forward(inputs)
check_forward_ignore_nan(inputs)
check_forward_ignore_nan_with_nonnan_value(inputs)
@pytest.mark.gpu
def test_forward_gpu(inputs):
x0, x1, x2 = inputs
check_forward((cuda.to_gpu(x0), cuda.to_gpu(x1), None))
check_forward_ignore_nan((cuda.to_gpu(x0), None, cuda.to_gpu(x2)))
def check_backward(inputs):
x0_data, x1_data, _ = inputs
gradient_check.check_backward(
chainer_chemistry.functions.mean_squared_error,
(x0_data, x1_data), None, eps=1e-2)
def check_backward_ignore_nan(inputs):
x0_data, _, x2_data = inputs
def func(x0, x1):
return chainer_chemistry.functions.mean_squared_error(x0, x1,
ignore_nan=True)
gradient_check.check_backward(func, (x0_data, x2_data), None, eps=1e-2)
def check_backward_ignore_nan_with_nonnan_value(inputs):
x0_data, x1_data, _ = inputs
def func(x0, x1):
return chainer_chemistry.functions.mean_squared_error(x0, x1,
ignore_nan=True)
gradient_check.check_backward(func, (x0_data, x1_data), None, eps=1e-2)
def test_backward_cpu(inputs):
check_backward(inputs)
check_backward_ignore_nan(inputs)
check_backward_ignore_nan_with_nonnan_value(inputs)
@pytest.mark.gpu
def test_backward_gpu(inputs):
x0, x1, x2 = inputs
check_backward((cuda.to_gpu(x0), cuda.to_gpu(x1), None))
check_backward_ignore_nan((cuda.to_gpu(x0), None, cuda.to_gpu(x2)))
check_backward_ignore_nan_with_nonnan_value((cuda.to_gpu(x0),
cuda.to_gpu(x1), None))
def check_double_backward(inputs, grads):
x0, x1, _ = inputs
gy, ggx0, ggx1 = grads
gradient_check.check_double_backward(
chainer_chemistry.functions.mean_squared_error,
(x0, x1), gy, (ggx0, ggx1))
def check_double_backward_ignore_nan(inputs, grads):
x0, _, x2 = inputs
gy, ggx0, ggx1 = grads
def func(x0, x1):
return chainer_chemistry.functions.mean_squared_error(x0, x1,
ignore_nan=True)
gradient_check.check_double_backward(func, (x0, x2), gy, (ggx0, ggx1))
def check_double_backward_ignore_nan_with_nonnan_value(inputs, grads):
x0, x1, _ = inputs
gy, ggx0, ggx1 = grads
def func(x0, x1):
return chainer_chemistry.functions.mean_squared_error(x0, x1,
ignore_nan=True)
gradient_check.check_double_backward(func, (x0, x1), gy, (ggx0, ggx1))
def test_double_backward_cpu(inputs, grads):
check_double_backward(inputs, grads)
check_double_backward_ignore_nan(inputs, grads)
check_double_backward_ignore_nan_with_nonnan_value(inputs, grads)
@pytest.mark.gpu
def test_double_backward_gpu(inputs, grads):
x0, x1, x2 = inputs
gy, ggx0, ggx1 = grads
check_double_backward((cuda.to_gpu(x0), cuda.to_gpu(x1), None),
(cuda.to_gpu(gy), cuda.to_gpu(ggx0),
cuda.to_gpu(ggx1)))
check_double_backward_ignore_nan((cuda.to_gpu(x0), None, cuda.to_gpu(x2)),
(cuda.to_gpu(gy), cuda.to_gpu(ggx0),
cuda.to_gpu(ggx1)))
check_double_backward_ignore_nan_with_nonnan_value((cuda.to_gpu(x0),
cuda.to_gpu(x1),
None),
(cuda.to_gpu(gy),
cuda.to_gpu(ggx0),
cuda.to_gpu(ggx1)))
if __name__ == '__main__':
pytest.main([__file__, '-v'])
================================================
FILE: tests/iterators_tests/test_balanced_serial_iterator.py
================================================
import numpy
import pytest
from chainer import serializer
from chainer_chemistry.datasets.numpy_tuple_dataset import NumpyTupleDataset
from chainer_chemistry.iterators.balanced_serial_iterator import BalancedSerialIterator # NOQA
class DummySerializer(serializer.Serializer):
def __init__(self, target):
super(DummySerializer, self).__init__()
self.target = target
def __getitem__(self, key):
target_child = dict()
self.target[key] = target_child
return DummySerializer(target_child)
def __call__(self, key, value):
self.target[key] = value
return self.target[key]
class DummyDeserializer(serializer.Deserializer):
def __init__(self, target):
super(DummyDeserializer, self).__init__()
self.target = target
def __getitem__(self, key):
target_child = self.target[key]
return DummyDeserializer(target_child)
def __call__(self, key, value):
if value is None:
value = self.target[key]
elif isinstance(value, numpy.ndarray):
numpy.copyto(value, self.target[key])
else:
value = type(value)(numpy.asarray(self.target[key]))
return value
def test_balanced_serial_iterator():
_test_balanced_serial_iterator_no_batch_balancing()
_test_balanced_serial_iterator_with_batch_balancing()
def _test_balanced_serial_iterator_no_batch_balancing():
x = numpy.arange(8)
t = numpy.asarray([0, 0, -1, 1, 1, 2, -1, 1])
iterator = BalancedSerialIterator(NumpyTupleDataset(x, t), batch_size=9,
labels=t, ignore_labels=-1,
batch_balancing=False)
# In this case, we have 3 examples of label=1.
# When BalancedSerialIterator runs, all label examples are sampled 3 times
# in one epoch.
# Therefore, number of data is "augmented" as 9
# 3 (number of label types) * 3 (number of maximum examples in one label)
expect_N_augmented = 9
assert iterator.N_augmented == expect_N_augmented
# iterator.show_label_stats() # we can show label stats
batch = iterator.next()
assert len(batch) == 9
labels_batch = numpy.array([example[-1] for example in batch])
assert numpy.sum(labels_batch == 0) == 3
assert numpy.sum(labels_batch == 1) == 3
assert numpy.sum(labels_batch == 2) == 3
def _test_balanced_serial_iterator_with_batch_balancing():
x = numpy.arange(8)
t = numpy.asarray([0, 0, -1, 1, 1, 2, -1, 1])
iterator = BalancedSerialIterator(NumpyTupleDataset(x, t), batch_size=3,
labels=t, ignore_labels=-1,
batch_balancing=True)
expect_N_augmented = 9
assert iterator.N_augmented == expect_N_augmented
batch1 = iterator.next()
batch2 = iterator.next()
batch3 = iterator.next()
for batch in [batch1, batch2, batch3]:
assert len(batch) == 3
labels_batch = numpy.array([example[-1] for example in batch])
assert numpy.sum(labels_batch == 0) == 1
assert numpy.sum(labels_batch == 1) == 1
assert numpy.sum(labels_batch == 2) == 1
def test_balanced_serial_iterator_serialization():
_test_balanced_serial_iterator_serialization_no_batch_balancing()
_test_balanced_serial_iterator_serialization_with_batch_balancing()
def _test_balanced_serial_iterator_serialization_no_batch_balancing():
x = numpy.arange(8)
t = numpy.asarray([0, 0, -1, 1, 1, 2, -1, 1])
iterator = BalancedSerialIterator(NumpyTupleDataset(x, t), batch_size=9,
labels=t, ignore_labels=-1,
batch_balancing=False)
batch = iterator.next() # NOQA
assert iterator.current_position == 0
assert iterator.epoch == 1
assert iterator.is_new_epoch
target = dict()
iterator.serialize(DummySerializer(target))
current_index_list_orig = dict()
current_pos_orig = dict()
for label, index_iterator in iterator.labels_iterator_dict.items():
ii_label = 'index_iterator_{}'.format(label)
current_index_list_orig[ii_label] = index_iterator.current_index_list
current_pos_orig[ii_label] = index_iterator.current_pos
iterator = BalancedSerialIterator(NumpyTupleDataset(x, t), batch_size=9,
labels=t, ignore_labels=-1,
batch_balancing=False)
iterator.serialize(DummyDeserializer(target))
assert iterator.current_position == 0
assert iterator.epoch == 1
assert iterator.is_new_epoch
for label, index_iterator in iterator.labels_iterator_dict.items():
ii_label = 'index_iterator_{}'.format(label)
assert numpy.array_equal(index_iterator.current_index_list,
current_index_list_orig[ii_label])
assert index_iterator.current_pos == current_pos_orig[ii_label]
def _test_balanced_serial_iterator_serialization_with_batch_balancing():
x = numpy.arange(8)
t = numpy.asarray([0, 0, -1, 1, 1, 2, -1, 1])
iterator = BalancedSerialIterator(NumpyTupleDataset(x, t), batch_size=3,
labels=t, ignore_labels=-1,
batch_balancing=True)
batch1 = iterator.next() # NOQA
batch2 = iterator.next() # NOQA
batch3 = iterator.next() # NOQA
assert iterator.current_position == 0
assert iterator.epoch == 1
assert iterator.is_new_epoch
target = dict()
iterator.serialize(DummySerializer(target))
current_index_list_orig = dict()
current_pos_orig = dict()
for label, index_iterator in iterator.labels_iterator_dict.items():
ii_label = 'index_iterator_{}'.format(label)
current_index_list_orig[ii_label] = index_iterator.current_index_list
current_pos_orig[ii_label] = index_iterator.current_pos
iterator = BalancedSerialIterator(NumpyTupleDataset(x, t), batch_size=3,
labels=t, ignore_labels=-1,
batch_balancing=True)
iterator.serialize(DummyDeserializer(target))
assert iterator.current_position == 0
assert iterator.epoch == 1
assert iterator.is_new_epoch
for label, index_iterator in iterator.labels_iterator_dict.items():
ii_label = 'index_iterator_{}'.format(label)
assert numpy.array_equal(index_iterator.current_index_list,
current_index_list_orig[ii_label])
assert index_iterator.current_pos == current_pos_orig[ii_label]
if __name__ == '__main__':
pytest.main([__file__, '-s', '-v'])
================================================
FILE: tests/iterators_tests/test_index_iterator.py
================================================
import numpy
import pytest
from chainer import serializer
from chainer_chemistry.iterators.index_iterator import IndexIterator
class DummySerializer(serializer.Serializer):
def __init__(self, target):
super(DummySerializer, self).__init__()
self.target = target
def __getitem__(self, key):
target_child = dict()
self.target[key] = target_child
return DummySerializer(target_child)
def __call__(self, key, value):
self.target[key] = value
return self.target[key]
class DummyDeserializer(serializer.Deserializer):
def __init__(self, target):
super(DummyDeserializer, self).__init__()
self.target = target
def __getitem__(self, key):
target_child = self.target[key]
return DummyDeserializer(target_child)
def __call__(self, key, value):
if value is None:
value = self.target[key]
elif isinstance(value, numpy.ndarray):
numpy.copyto(value, self.target[key])
else:
value = type(value)(numpy.asarray(self.target[key]))
return value
def test_index_iterator():
_test_index_iterator_no_shuffle()
_test_index_iterator_with_shuffle()
def _test_index_iterator_no_shuffle():
index_list = [1, 3, 5, 10]
ii = IndexIterator(index_list, shuffle=False, num=2)
indices1 = ii.get_next_indices(3)
indices2 = ii.get_next_indices(6)
indices3 = ii.__next__()
assert isinstance(indices1, numpy.ndarray)
assert len(indices1) == 3
assert isinstance(indices2, numpy.ndarray)
assert len(indices2) == 6
assert isinstance(indices3, numpy.ndarray)
assert len(indices3) == 2
assert indices1[0] == index_list[0]
assert indices1[1] == index_list[1]
assert indices1[2] == index_list[2]
assert indices2[0] == index_list[3]
assert indices2[1] == index_list[0]
assert indices2[2] == index_list[1]
assert indices2[3] == index_list[2]
assert indices2[4] == index_list[3]
assert indices2[5] == index_list[0]
assert indices3[0] == index_list[1]
assert indices3[1] == index_list[2]
def _test_index_iterator_with_shuffle():
index_list = [1, 3, 5, 10]
ii = IndexIterator(index_list, shuffle=True, num=2)
indices1 = ii.get_next_indices(3)
indices2 = ii.get_next_indices(6)
indices3 = ii.__next__()
assert isinstance(indices1, numpy.ndarray)
assert len(indices1) == 3
assert isinstance(indices2, numpy.ndarray)
assert len(indices2) == 6
assert isinstance(indices3, numpy.ndarray)
assert len(indices3) == 2
for indices in [indices1, indices2, indices3]:
for index in indices:
assert index in index_list
def test_index_iterator_serialization():
_test_index_iterator_serialization_no_shuffle()
_test_index_iterator_serialization_with_shuffle()
def _test_index_iterator_serialization_no_shuffle():
index_list = [1, 3, 5, 10]
ii = IndexIterator(index_list, shuffle=False, num=2)
indices1 = ii.get_next_indices(3) # NOQA
indices2 = ii.get_next_indices(6) # NOQA
indices3 = ii.__next__() # NOQA
assert len(ii.current_index_list) == len(index_list)
assert numpy.array_equal(ii.current_index_list, numpy.asarray(index_list))
assert ii.current_pos == (3 + 6) % len(index_list) + 2
target = dict()
ii.serialize(DummySerializer(target))
ii = IndexIterator(index_list, shuffle=False, num=2)
ii.serialize(DummyDeserializer(target))
assert len(ii.current_index_list) == len(index_list)
assert numpy.array_equal(ii.current_index_list, numpy.asarray(index_list))
assert ii.current_pos == (3 + 6) % len(index_list) + 2
def _test_index_iterator_serialization_with_shuffle():
index_list = [1, 3, 5, 10]
ii = IndexIterator(index_list, shuffle=True, num=2)
indices1 = ii.get_next_indices(3) # NOQA
indices2 = ii.get_next_indices(6) # NOQA
indices3 = ii.__next__() # NOQA
assert len(ii.current_index_list) == len(index_list)
for index in ii.current_index_list:
assert index in index_list
assert ii.current_pos == (3 + 6) % len(index_list) + 2
target = dict()
ii.serialize(DummySerializer(target))
current_index_list_orig = ii.current_index_list
ii = IndexIterator(index_list, shuffle=True, num=2)
ii.serialize(DummyDeserializer(target))
assert numpy.array_equal(ii.current_index_list, current_index_list_orig)
assert ii.current_pos == (3 + 6) % len(index_list) + 2
if __name__ == '__main__':
pytest.main([__file__, '-s', '-v'])
================================================
FILE: tests/link_hooks_tests/test_variable_monitor_link_hook.py
================================================
import numpy
import pytest
import chainer
from chainer import Variable, cuda # NOQA
from chainer.links import Linear
from chainer_chemistry.link_hooks import is_link_hooks_available
if is_link_hooks_available:
from chainer_chemistry.link_hooks import VariableMonitorLinkHook
class DummyModel(chainer.Chain):
def __init__(self):
super(DummyModel, self).__init__()
with self.init_scope():
self.l1 = Linear(
3, 1, initialW=numpy.array([[1, 3, 2]]),
nobias=True)
self.h = None
def forward(self, x):
self.h = self.l1(x)
out = self.h * 3
return out
@pytest.fixture
def model():
return DummyModel()
@pytest.mark.skipif(not is_link_hooks_available,
reason='Link Hook is not available')
def test_variable_monitor_link_hook_pre(model):
x = numpy.array([[1, 5, 8]], dtype=numpy.float32)
x = Variable(x)
pre_hook = VariableMonitorLinkHook(target_link=model.l1, timing='pre')
with pre_hook:
model(x)
var = pre_hook.get_variable()
assert var is x
@pytest.mark.skipif(not is_link_hooks_available,
reason='Link Hook is not available')
def test_variable_monitor_link_hook_post(model):
x = numpy.array([[1, 5, 8]], dtype=numpy.float32)
x = Variable(x)
pre_hook = VariableMonitorLinkHook(target_link=model.l1, timing='post')
with pre_hook:
model(x)
var = pre_hook.get_variable()
assert var is model.h
@pytest.mark.skipif(not is_link_hooks_available,
reason='Link Hook is not available')
def test_variable_monitor_link_hook_process(model):
x = numpy.array([[1, 5, 8]], dtype=numpy.float32)
x = Variable(x)
pre_hook = VariableMonitorLinkHook(target_link=model.l1, timing='post')
# Add process
def _process_zeros(hook, args, target_var):
xp = cuda.get_array_module(target_var.array)
target_var.array = xp.zeros(target_var.array.shape)
pre_hook.add_process('_process_zeros', _process_zeros)
with pre_hook:
model(x)
assert numpy.allclose(model.h.array, numpy.zeros(model.h.shape))
assert '_process_zeros' in pre_hook.process_fns.keys()
# Delete process
pre_hook.delete_process('_process_zeros')
assert '_process_zeros' not in pre_hook.process_fns.keys()
@pytest.mark.skipif(not is_link_hooks_available,
reason='Link Hook is not available')
def test_variable_monitor_link_hook_assert_raises(model):
with pytest.raises(TypeError):
# target_link must be chainer.Link
pre_hook = VariableMonitorLinkHook(target_link='hoge')
with pytest.raises(ValueError):
# check timing args
pre_hook = VariableMonitorLinkHook(target_link=model.l1, timing='hoge') # NOQA
hook = VariableMonitorLinkHook(target_link=model.l1)
def _process(hook, args, target_var):
pass
with pytest.raises(TypeError):
# key is wrong
hook.add_process(1, _process)
with pytest.raises(TypeError):
# fn is wrong
hook.add_process('hoge', 'var')
hook.add_process('hoge', _process)
with pytest.raises(TypeError):
# key is wrong
hook.delete_process(1)
hook.delete_process('hoge')
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/links_tests/array_tests/test_shape_transformer_to_2d.py
================================================
import numpy
import pytest
from chainer_chemistry.links.array.shape_transformer_to_2d import ShapeTransformerTo2D # NOQA
@pytest.mark.parametrize('axis', [0, 1, -1])
def test_shape_transformer_2d_2d_array(axis):
st = ShapeTransformerTo2D(axis=axis)
x = numpy.arange(6).reshape((2, 3))
xt = st.transform(x)
xit = st.inverse_transform(xt)
if axis == 0:
assert numpy.allclose(xt.array, numpy.array([[0, 3], [1, 4], [2, 5]]))
elif axis == 1 or axis == -1:
assert numpy.allclose(x, xt.array)
assert numpy.allclose(x, xit.array)
@pytest.mark.parametrize('axis', [0, 1, 2, -1])
def test_shape_transformer_2d_3d_array(axis):
st = ShapeTransformerTo2D(axis=axis)
x = numpy.arange(12).reshape((2, 3, 2))
xt = st.transform(x)
xit = st.inverse_transform(xt)
if axis == 0:
assert numpy.allclose(
xt.array,
numpy.array([[0, 6], [1, 7], [2, 8], [3, 9], [4, 10], [5, 11]]))
elif axis == 1:
assert numpy.allclose(
xt.array,
numpy.array([[0, 2, 4], [1, 3, 5], [6, 8, 10], [7, 9, 11]]))
elif axis == 2 or axis == -1:
assert numpy.allclose(
xt.array, x.reshape(6, 2))
assert numpy.allclose(x, xit.array)
def test_shape_transformer_2d_error():
st = ShapeTransformerTo2D(axis=1)
x = numpy.arange(6).reshape(2, 3)
with pytest.raises(AttributeError):
# call `inverse_transform` before `transform`
xt = st.inverse_transform(x) # NOQA
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/links_tests/connection_tests/test_embed_atom_id.py
================================================
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry import links
in_size = 3
atom_size = 5
out_size = 4
batch_size = 2
@pytest.fixture
def model():
l = links.EmbedAtomID(in_size=in_size, out_size=out_size)
l.cleargrads()
return l
@pytest.fixture
def data():
x_data = numpy.random.randint(
in_size, size=(batch_size, atom_size)).astype(numpy.int32)
y_grad = numpy.random.uniform(
-1, 1, (batch_size, atom_size, out_size)).astype(numpy.float32)
return x_data, y_grad
def check_forward(model, x_data):
def forward(W, x):
y = W[x]
return y
y_expect = forward(cuda.to_cpu(model.W.data),
cuda.to_cpu(x_data))
y_actual = cuda.to_cpu(model(x_data).data)
numpy.testing.assert_equal(y_actual, y_expect)
def test_forward_cpu(model, data):
x_data = data[0]
check_forward(model, x_data)
@pytest.mark.gpu
def test_forward_gpu(model, data):
x_data = cuda.to_gpu(data[0])
model.to_gpu()
check_forward(model, x_data)
def test_backward_cpu(model, data):
x_data, y_grad = data
gradient_check.check_backward(model, x_data, y_grad, model.W,
atol=1e-3, rtol=1e-3)
@pytest.mark.gpu
def test_backward_gpu(model, data):
x_data, y_grad = [cuda.to_gpu(d) for d in data]
model.to_gpu()
gradient_check.check_backward(model, x_data, y_grad, model.W,
atol=1e-3, rtol=1e-3)
if __name__ == '__main__':
pytest.main([__file__, '-v'])
================================================
FILE: tests/links_tests/connection_tests/test_graph_linear.py
================================================
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.links.connection.graph_linear import GraphLinear # NOQA
in_size = 3
atom_size = 5
out_size = 4
batch_size = 2
@pytest.fixture
def model():
l = GraphLinear(in_size=in_size, out_size=out_size)
l.cleargrads()
return l
@pytest.fixture
def data():
x_data = numpy.random.uniform(
-1, 1, (batch_size, atom_size, in_size)).astype(numpy.float32)
y_grad = numpy.random.uniform(
-1, 1, (batch_size, atom_size, out_size)).astype(numpy.float32)
return x_data, y_grad
def test_forward_cpu(model, data):
# only testing shape for now...
x_data = data[0]
y_actual = model(x_data)
assert y_actual.shape == (batch_size, atom_size, out_size)
@pytest.mark.gpu
def test_forward_gpu(model, data):
x_data = cuda.to_gpu(data[0])
model.to_gpu()
y_actual = model(x_data)
assert y_actual.shape == (batch_size, atom_size, out_size)
def test_backward_cpu(model, data):
x_data, y_grad = data
gradient_check.check_backward(model, x_data, y_grad, list(model.params()),
atol=1e-3, rtol=1e-3)
@pytest.mark.gpu
def test_backward_gpu(model, data):
x_data, y_grad = [cuda.to_gpu(d) for d in data]
model.to_gpu()
gradient_check.check_backward(model, x_data, y_grad, list(model.params()),
atol=1e-3, rtol=1e-3)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/links_tests/connection_tests/test_graph_mlp.py
================================================
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.links.connection.graph_mlp import GraphMLP # NOQA
in_size = 3
atom_size = 5
out_size = 4
channels = [16, out_size]
batch_size = 2
@pytest.fixture
def model():
l = GraphMLP(channels, in_channels=in_size)
l.cleargrads()
return l
@pytest.fixture
def data():
x_data = numpy.random.uniform(
-1, 1, (batch_size, atom_size, in_size)).astype(numpy.float32)
y_grad = numpy.random.uniform(
-1, 1, (batch_size, atom_size, out_size)).astype(numpy.float32)
return x_data, y_grad
def test_forward_cpu(model, data):
# only testing shape for now...
x_data = data[0]
y_actual = model(x_data)
assert y_actual.shape == (batch_size, atom_size, out_size)
assert len(model.layers) == len(channels)
@pytest.mark.gpu
def test_forward_gpu(model, data):
x_data = cuda.to_gpu(data[0])
model.to_gpu()
y_actual = model(x_data)
assert y_actual.shape == (batch_size, atom_size, out_size)
assert len(model.layers) == len(channels)
def test_backward_cpu(model, data):
x_data, y_grad = data
gradient_check.check_backward(model, x_data, y_grad, list(model.params()),
atol=1e-3, rtol=1e-3)
@pytest.mark.gpu
def test_backward_gpu(model, data):
x_data, y_grad = [cuda.to_gpu(d) for d in data]
model.to_gpu()
gradient_check.check_backward(model, x_data, y_grad, list(model.params()),
atol=1e-3, rtol=1e-3)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/links_tests/readout_tests/test_cgcnn_readout.py
================================================
import numpy
import pytest
from chainer import cuda
from chainer_chemistry.links.readout.cgcnn_readout import CGCNNReadout
# node_size_list means the first moleculae has three nodes,
# and the seconde molecule has five nodes
node_size_list = [3, 5]
node_feature_dim = 32
out_dim = 4
batch_size = 2
@pytest.fixture
def readout():
return CGCNNReadout(out_dim=out_dim)
@pytest.fixture
def data():
if len(node_size_list) != batch_size:
raise ValueError("Invalid fixture data for CGCNN")
numpy.random.seed(0)
total_node_size = sum(node_size_list)
# atom_feat
atom_feat = numpy.random.rand(
total_node_size, node_feature_dim).astype(numpy.float32)
# atom_idx
curr_idx = 0
atom_idx = []
for val in node_size_list:
atom_idx.append(numpy.arange(curr_idx, val))
curr_idx += val
atom_idx = numpy.asarray(atom_idx)
y_grad = numpy.random.uniform(-1, 1,
(batch_size, out_dim)).astype(numpy.float32)
return atom_feat, atom_idx, y_grad
def check_forward(readout, data):
y_actual = cuda.to_cpu(readout(*data).data)
assert y_actual.shape == (batch_size, out_dim)
def test_forward_cpu(readout, data):
atom_feat, atom_idx = data[:-1]
check_forward(readout, (atom_feat, atom_idx))
@pytest.mark.gpu
def test_forward_gpu(readout, data):
atom_feat, atom_idx, _ = data
# atom_idx is list format... use numpy array
input_data = (cuda.to_gpu(atom_feat), atom_idx)
readout.to_gpu()
check_forward(readout, tuple(input_data))
# def test_backward_cpu(readout, data):
# input_data, y_grad = data[0:-1], data[-1]
# gradient_check.check_backward(readout, tuple(input_data), y_grad,
# atol=5e-1, rtol=1e-1)
# @pytest.mark.gpu
# def test_backward_gpu(readout, data):
# data = [cuda.to_gpu(d) for d in data]
# input_data, y_grad = data[0:-1], data[-1]
# readout.to_gpu()
# gradient_check.check_backward(readout, tuple(input_data), y_grad,
# atol=5e-1, rtol=1e-1)
if __name__ == '__main__':
pytest.main([__file__, '-v'])
================================================
FILE: tests/links_tests/readout_tests/test_general_readout.py
================================================
from chainer import cuda
from chainer import functions
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links.readout.general_readout import GeneralReadout
from chainer_chemistry.utils.permutation import permute_node
atom_size = 5
hidden_dim = 7
batch_size = 2
@pytest.fixture
def readouts():
modes = ['sum', 'max', 'summax']
return (GeneralReadout(mode=mode) for mode in modes)
@pytest.fixture
def data():
numpy.random.seed(0)
atom_data = numpy.random.uniform(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size, hidden_dim)
).astype('f')
y_grad = numpy.random.uniform(-1, 1, (batch_size, hidden_dim)).astype('f')
return atom_data, y_grad
def check_forward(readout, atom_data):
y_actual = cuda.to_cpu(readout(atom_data).data)
if readout.mode == ('sum' and 'max'):
assert y_actual.shape == (batch_size, hidden_dim)
elif readout.mode == 'summax':
assert y_actual.shape == (batch_size, hidden_dim * 2)
def test_forward_cpu(readouts, data):
atom_data = data[0]
for readout in readouts:
check_forward(readout, atom_data)
@pytest.mark.gpu
def test_forward_gpu(readouts, data):
atom_data = cuda.to_gpu(data[0])
for readout in readouts:
readout.to_gpu()
check_forward(readout, atom_data)
def test_forward_cpu_assert_raises(data):
atom_data = data[0]
readout = GeneralReadout(mode='invalid')
with pytest.raises(ValueError):
cuda.to_cpu(readout(atom_data).data)
def test_backward_cpu(readouts, data):
atom_data, y_grad = data
for readout in readouts:
if readout.mode == 'summax':
y_grad = functions.concat((y_grad, y_grad), axis=1).data
gradient_check.check_backward(
readout, atom_data, y_grad, atol=1e-2, rtol=1e-2)
@pytest.mark.gpu
def test_backward_gpu(readouts, data):
atom_data, y_grad = map(cuda.to_gpu, data)
for readout in readouts:
readout.to_gpu()
if readout.mode == 'summax':
y_grad = functions.concat((y_grad, y_grad), axis=1).data
# TODO(nakago): check why tolerance is so high.
gradient_check.check_backward(
readout, atom_data, y_grad, atol=1e-1, rtol=1e-1)
def test_forward_cpu_graph_invariant(readouts, data):
atom_data = data[0]
permutation_index = numpy.random.permutation(atom_size)
permute_atom_data = permute_node(atom_data, permutation_index, axis=1)
for readout in readouts:
y_actual = cuda.to_cpu(readout(atom_data).data)
permute_y_actual = cuda.to_cpu(readout(permute_atom_data).data)
numpy.testing.assert_allclose(
y_actual, permute_y_actual, rtol=1e-5, atol=1e-5)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/links_tests/readout_tests/test_ggnn_readout.py
================================================
from chainer import cuda
from chainer import functions
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links.readout.ggnn_readout import GGNNReadout
from chainer_chemistry.utils.permutation import permute_node
atom_size = 5
in_channels = 7
out_dim = 4
batch_size = 2
@pytest.fixture
def readout():
return GGNNReadout(out_dim=out_dim, in_channels=None)
@pytest.fixture
def data():
numpy.random.seed(0)
atom_data = numpy.random.uniform(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size, in_channels)
).astype('f')
atom_data0 = functions.copy(
atom_data, cuda.get_device_from_array(atom_data.data).id).data
y_grad = numpy.random.uniform(
-1, 1, (batch_size, out_dim)).astype('f')
return atom_data, atom_data0, y_grad
def check_forward(readout, atom_data, atom_data0):
y_actual = cuda.to_cpu(readout(atom_data, atom_data0).data)
assert y_actual.shape == (batch_size, out_dim)
def test_forward_cpu(readout, data):
atom_data, atom_data0 = data[:2]
check_forward(readout, atom_data, atom_data0)
@pytest.mark.gpu
def test_forward_gpu(readout, data):
atom_data, atom_data0 = cuda.to_gpu(data[0]), cuda.to_gpu(data[1])
readout.to_gpu()
check_forward(readout, atom_data, atom_data0)
def test_backward_cpu(readout, data):
atom_data, atom_data0, y_grad = data
gradient_check.check_backward(
readout, (atom_data, atom_data0), y_grad, atol=1e-1, rtol=1e-1)
@pytest.mark.gpu
def test_backward_gpu(readout, data):
atom_data, adj_data, y_grad = [cuda.to_gpu(d) for d in data]
readout.to_gpu()
gradient_check.check_backward(readout, (atom_data, adj_data), y_grad,
atol=1e-1, rtol=1e-1)
def test_forward_cpu_graph_invariant(readout, data):
atom_data, atom_data0 = data[:2]
y_actual = cuda.to_cpu(readout(atom_data, atom_data0).data)
permutation_index = numpy.random.permutation(atom_size)
permute_atom_data = permute_node(atom_data, permutation_index, axis=1)
permute_atom_data0 = permute_node(atom_data0, permutation_index, axis=1)
permute_y_actual = cuda.to_cpu(readout(
permute_atom_data, permute_atom_data0).data)
numpy.testing.assert_allclose(
y_actual, permute_y_actual, rtol=1e-5, atol=1e-5)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/links_tests/readout_tests/test_megnet_readout.py
================================================
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.links.readout.megnet_readout import MEGNetReadout
max_node_num = 6
max_edge_num = 10
# This value is the same as the atom and pair feature dimension
in_channels = 10
global_feature_dim = 5
out_dim = 4
batch_size = 2
@pytest.fixture
def readout():
return MEGNetReadout(in_channels=in_channels, out_dim=out_dim)
@pytest.fixture
def data():
numpy.random.seed(0)
atom_feat = numpy.random.rand(batch_size, max_node_num,
in_channels).astype(numpy.float32)
pair_feat = numpy.random.rand(batch_size, max_edge_num,
in_channels).astype(numpy.float32)
global_feat = numpy.random.rand(batch_size,
global_feature_dim).astype(numpy.float32)
y_grad = numpy.random.uniform(
-1, 1, (batch_size, out_dim)).astype(numpy.float32)
return atom_feat, pair_feat, global_feat, y_grad
def check_forward(readout, data):
y_actual = cuda.to_cpu(readout(*data).data)
assert y_actual.shape == (batch_size, out_dim)
def test_forward_cpu(readout, data):
atom_feat, pair_feat, global_feat = data[:-1]
check_forward(readout, (atom_feat, pair_feat, global_feat))
@pytest.mark.gpu
def test_forward_gpu(readout, data):
input_data = [cuda.to_gpu(d) for d in data[:-1]]
readout.to_gpu()
check_forward(readout, tuple(input_data))
def test_backward_cpu(readout, data):
input_data, y_grad = data[0:-1], data[-1]
gradient_check.check_backward(readout, tuple(input_data), y_grad,
atol=5e-1, rtol=1e-1)
@pytest.mark.gpu
def test_backward_gpu(readout, data):
data = [cuda.to_gpu(d) for d in data]
input_data, y_grad = data[0:-1], data[-1]
readout.to_gpu()
gradient_check.check_backward(readout, tuple(input_data), y_grad,
atol=5e-1, rtol=1e-1)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/links_tests/readout_tests/test_mpnn_readout.py
================================================
from typing import Tuple # NOQA
import numpy
import pytest
from chainer import cuda
from chainer import gradient_check
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links.readout.mpnn_readout import MPNNReadout
from chainer_chemistry.utils.permutation import permute_node
atom_size = 5
in_channels = 7
out_dim = 4
batch_size = 2
@pytest.fixture
def readout():
# type: () -> MPNNReadout
return MPNNReadout(out_dim=out_dim, in_channels=in_channels, n_layers=2)
@pytest.fixture
def data():
# type: () -> Tuple[numpy.ndarray, numpy.ndarray]
numpy.random.seed(0)
atom_data = numpy.random.uniform(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size,
in_channels)).astype('f')
y_grad = numpy.random.uniform(-1, 1, (batch_size, out_dim)).astype('f')
return atom_data, y_grad
def check_forward(readout, atom_data):
# type: (MPNNReadout, numpy.ndarray) -> None
y_actual = cuda.to_cpu(readout(atom_data).data)
assert y_actual.shape == (batch_size, out_dim)
def test_foward_cpu(readout, data):
# type: (MPNNReadout, Tuple[numpy.ndarray, numpy.ndarray]) -> None
atom_data = data[0]
check_forward(readout, atom_data)
@pytest.mark.gpu
def test_foward_gpu(readout, data):
# type: (MPNNReadout, Tuple[numpy.ndarray, numpy.ndarray]) -> None
atom_data = cuda.to_gpu(data[0])
readout.to_gpu()
check_forward(readout, atom_data)
def test_backward_cpu(readout, data):
# type: (MPNNReadout, Tuple[numpy.ndarray, numpy.ndarray]) -> None
atom_data, y_grad = data
gradient_check.check_backward(
readout, atom_data, y_grad, atol=1e-1, rtol=1e-1)
@pytest.mark.gpu
def test_backward_gpu(readout, data):
# type: (MPNNReadout, Tuple[numpy.ndarray, numpy.ndarray]) -> None
atom_data, y_grad = map(cuda.to_gpu, data)
readout.to_gpu()
gradient_check.check_backward(
readout, atom_data, y_grad, atol=1e-1, rtol=1e-1)
def test_foward_cpu_graph_invariant(readout, data):
# type: (MPNNReadout, Tuple[numpy.ndarray, numpy.ndarray]) -> None
atom_data = data[0]
y_actual = cuda.to_cpu(readout(atom_data).data)
permutation_index = numpy.random.permutation(atom_size)
permute_atom_data = permute_node(atom_data, permutation_index, axis=1)
permute_y_actual = cuda.to_cpu(readout(permute_atom_data).data)
numpy.testing.assert_allclose(
y_actual, permute_y_actual, rtol=1e-5, atol=1e-5)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/links_tests/readout_tests/test_nfp_readout.py
================================================
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links.readout.nfp_readout import NFPReadout
from chainer_chemistry.utils.permutation import permute_node
atom_size = 5
hidden_dim = 7
out_dim = 4
batch_size = 2
@pytest.fixture
def readout():
return NFPReadout(in_channels=hidden_dim, out_dim=out_dim)
@pytest.fixture
def data():
numpy.random.seed(0)
atom_data = numpy.random.uniform(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size, hidden_dim)
).astype('f')
y_grad = numpy.random.uniform(-1, 1, (batch_size, out_dim)).astype('f')
return atom_data, y_grad
def check_forward(readout, atom_data):
y_actual = cuda.to_cpu(readout(atom_data).data)
assert y_actual.shape == (batch_size, out_dim)
def test_forward_cpu(readout, data):
atom_data = data[0]
check_forward(readout, atom_data)
@pytest.mark.gpu
def test_forward_gpu(readout, data):
atom_data = cuda.to_gpu(data[0])
readout.to_gpu()
check_forward(readout, atom_data)
def test_backward_cpu(readout, data):
atom_data, y_grad = data
gradient_check.check_backward(
readout, atom_data, y_grad, atol=1e-3, rtol=1e-3)
@pytest.mark.gpu
def test_backward_gpu(readout, data):
atom_data, y_grad = cuda.to_gpu(data[0]), cuda.to_gpu(data[1])
readout.to_gpu()
gradient_check.check_backward(
readout, atom_data, y_grad, atol=1e-3, rtol=1e-3)
def test_forward_cpu_graph_invariant(readout, data):
atom_data = data[0]
y_actual = cuda.to_cpu(readout(atom_data).data)
permutation_index = numpy.random.permutation(atom_size)
permute_atom_data = permute_node(atom_data, permutation_index, axis=1)
permute_y_actual = cuda.to_cpu(readout(permute_atom_data).data)
numpy.testing.assert_allclose(
y_actual, permute_y_actual, rtol=1e-3, atol=1e-3)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/links_tests/readout_tests/test_schnet_readout.py
================================================
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links.readout.schnet_readout import SchNetReadout
from chainer_chemistry.utils.permutation import permute_node
atom_size = 5
in_channels = 7
out_dim = 4
batch_size = 2
@pytest.fixture
def readout():
return SchNetReadout(out_dim=out_dim, in_channels=in_channels)
@pytest.fixture
def data():
numpy.random.seed(0)
atom_data = numpy.random.uniform(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size, in_channels)
).astype('f')
y_grad = numpy.random.uniform(-1, 1, (batch_size, out_dim)).astype('f')
return atom_data, y_grad
def check_forward(readout, atom_data):
y_actual = cuda.to_cpu(readout(atom_data).data)
assert y_actual.shape == (batch_size, out_dim)
def test_forward_cpu(readout, data):
atom_data = data[0]
check_forward(readout, atom_data)
@pytest.mark.gpu
def test_forward_gpu(readout, data):
atom_data = cuda.to_gpu(data[0])
readout.to_gpu()
check_forward(readout, atom_data)
def test_backward_cpu(readout, data):
atom_data, y_grad = data
gradient_check.check_backward(
readout, atom_data, y_grad, atol=1e-1, rtol=1e-1)
@pytest.mark.gpu
def test_backward_gpu(readout, data):
atom_data, y_grad = cuda.to_gpu(data[0]), cuda.to_gpu(data[1])
readout.to_gpu()
gradient_check.check_backward(
readout, atom_data, y_grad, atol=1e-1, rtol=1e-1)
def test_forward_cpu_graph_invariant(readout, data):
atom_data = data[0]
y_actual = cuda.to_cpu(readout(atom_data).data)
permutation_index = numpy.random.permutation(atom_size)
permute_atom_data = permute_node(atom_data, permutation_index, axis=1)
permute_y_actual = cuda.to_cpu(readout(permute_atom_data).data)
numpy.testing.assert_allclose(
y_actual, permute_y_actual, rtol=1e-5, atol=1e-5)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/links_tests/readout_tests/test_set2set.py
================================================
from typing import Tuple # NOQA
import numpy
import pytest
from chainer import cuda
from chainer import gradient_check
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links.readout.set2set import Set2Set
from chainer_chemistry.utils.permutation import permute_node
atom_size = 5
in_channels = 7
batch_size = 2
@pytest.fixture
def readout():
# type: () -> Set2Set
return Set2Set(in_channels=in_channels, n_layers=2)
@pytest.fixture
def data():
# type: () -> Tuple[numpy.ndarray, numpy.ndarray]
numpy.random.seed(0)
atom_data = numpy.random.uniform(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size,
in_channels)).astype('f')
y_grad = numpy.random.uniform(-1, 1,
(batch_size, in_channels * 2)).astype('f')
return atom_data, y_grad
def check_forward(readout, atom_data):
# type: (Set2Set, numpy.ndarray) -> None
readout.reset_state()
y_actual = cuda.to_cpu(readout(atom_data).data)
assert y_actual.shape == (batch_size, in_channels * 2)
def test_forward_cpu(readout, data):
# type: (Set2Set, Tuple[numpy.ndarray, numpy.ndarray]) -> None
atom_data = data[0]
check_forward(readout, atom_data)
@pytest.mark.gpu
def test_forward_gpu(readout, data):
# type: (Set2Set, Tuple[numpy.ndarray, numpy.ndarray]) -> None
atom_data = cuda.to_gpu(data[0])
readout.to_gpu()
check_forward(readout, atom_data)
def check_backward(readout, atom_data, y_grad):
# type: (Set2Set, numpy.ndarray, numpy.ndarray) -> None
"""Check gradient of Set2Set.
This function is different from other backward tests.
Because of LSTM, reset_state method has to be called explicitly
before gradient calculation.
Args:
readout:
atom_data:
y_grad:
"""
def f(atom_data):
readout.reset_state()
return readout(atom_data),
gradient_check.check_backward(
f, (atom_data), y_grad, atol=1e-1, rtol=1e-1)
def test_backward_cpu(readout, data):
# type: (Set2Set, Tuple[numpy.ndarray, numpy.ndarray]) -> None
check_backward(readout, *data)
@pytest.mark.gpu
def test_backward_gpu(readout, data):
# type: (Set2Set, Tuple[numpy.ndarray, numpy.ndarray]) -> None
atom_data, y_grad = [cuda.to_gpu(d) for d in data]
readout.to_gpu()
check_backward(readout, atom_data, y_grad)
def test_forward_cpu_graph_invariant(readout, data):
# type: (Set2Set, Tuple[numpy.ndarray, numpy.ndarray]) -> None
atom_data = data[0]
readout.reset_state()
y_actual = cuda.to_cpu(readout(atom_data).data)
permutation_index = numpy.random.permutation(atom_size)
permute_atom_data = permute_node(atom_data, permutation_index, axis=1)
readout.reset_state()
permute_y_actual = cuda.to_cpu(readout(permute_atom_data).data)
numpy.testing.assert_allclose(
y_actual, permute_y_actual, rtol=1e-6, atol=1e-6)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/links_tests/scaler_tests/test_flow_scaler.py
================================================
import os
import numpy
import pytest
import scipy.stats
from chainer import serializers, Variable, cuda, testing # NOQA
from chainer_chemistry.links.scaler.flow_scaler import FlowScaler
@testing.with_requires('chainer>=5.0.0')
@pytest.mark.slow
def test_flow_scaler_transform_uniform():
x = numpy.random.uniform(50, 100, size=100).astype(numpy.float32)
scaler = FlowScaler(5)
scaler.fit(x) # fit takes time
x_scaled = scaler.transform(x)
assert scipy.stats.kstest(x_scaled, 'norm').pvalue > 0.05
@testing.with_requires('chainer>=5.0.0')
@pytest.mark.slow
def test_flow_scaler_transform_mix_gaussian():
plus = numpy.random.binomial(n=1, p=0.6, size=100).astype(numpy.float32)
x = plus * numpy.random.normal(10, 5, size=100).astype(numpy.float32)
x += (1 - plus) * numpy.random.normal(
-10, 5, size=100).astype(numpy.float32)
scaler = FlowScaler(5)
scaler.fit(x) # fit takes time
x_scaled = scaler.transform(x)
assert scipy.stats.kstest(x_scaled, 'norm').pvalue > 0.05
@testing.with_requires('chainer>=5.0.0')
@pytest.mark.slow
def test_flow_scaler_transform_variable():
x = numpy.random.uniform(50, 100, size=100).astype(numpy.float32)
xvar = Variable(x)
scaler = FlowScaler(5)
scaler.fit(xvar) # fit takes time
x_scaled = scaler.transform(xvar)
assert isinstance(x_scaled, Variable)
assert scipy.stats.kstest(x_scaled.array, 'norm').pvalue > 0.05
@testing.with_requires('chainer>=5.0.0')
@pytest.mark.gpu
@pytest.mark.slow
def test_flow_scaler_transform_gpu():
x = numpy.random.uniform(50, 100, size=100).astype(numpy.float32)
scaler = FlowScaler(5)
scaler.to_gpu()
x = cuda.to_gpu(x)
scaler.fit(x) # fit takes time
x_scaled = scaler.transform(x)
assert isinstance(x_scaled, cuda.cupy.ndarray)
assert scipy.stats.kstest(cuda.to_cpu(x_scaled), 'norm').pvalue > 0.05
@testing.with_requires('chainer>=5.0.0')
@pytest.mark.slow
def test_flow_scaler_serialize(tmpdir):
x = numpy.random.uniform(50, 100, size=100).astype(numpy.float32)
scaler = FlowScaler(5)
scaler.fit(x) # fit takes time
x_scaled = scaler.transform(x)
scaler_filepath = os.path.join(str(tmpdir), 'scaler.npz')
serializers.save_npz(scaler_filepath, scaler)
scaler2 = FlowScaler(5)
serializers.load_npz(scaler_filepath, scaler2)
x_scaled2 = scaler2.transform(x)
assert numpy.allclose(scaler.W1.array, scaler2.W1.array)
assert numpy.allclose(scaler.b1.array, scaler2.b1.array)
assert numpy.allclose(scaler.W2.array, scaler2.W2.array)
assert numpy.allclose(scaler.b2.array, scaler2.b2.array)
assert numpy.allclose(x_scaled, x_scaled2)
@testing.with_requires('chainer>=5.0.0')
def test_flow_scaler_pipeline():
# Only to test each method without fail, for fast testing.
x = numpy.random.uniform(50, 100, size=100).astype(numpy.float32)
scaler = FlowScaler(5)
scaler.fit(x, iteration=1)
x_scaled = scaler.transform(x)
assert x_scaled.shape == x.shape
@testing.with_requires('chainer>=5.0.0')
@pytest.mark.gpu
def test_flow_scaler_pipeline_gpu():
# Only to test each method without fail, for fast testing.
x = numpy.random.uniform(50, 100, size=100).astype(numpy.float32)
x = cuda.to_gpu(x)
scaler = FlowScaler(5)
scaler.to_gpu()
scaler.fit(x, iteration=1)
x_scaled = scaler.transform(x)
assert isinstance(x_scaled, cuda.cupy.ndarray)
assert x_scaled.shape == x.shape
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/links_tests/scaler_tests/test_max_abs_scaler.py
================================================
import os
import numpy
import pytest
from chainer import serializers, Variable, cuda # NOQA
from chainer_chemistry.links.scaler.max_abs_scaler import MaxAbsScaler
@pytest.fixture
def data():
x = numpy.array(
[[0.1, 10., 0.3],
[0.2, 20., 0.1],
[-0.3, 30., 0.],
[0.4, -40., 0.]],
dtype=numpy.float32)
expect_x_scaled = numpy.array(
[[0.25, 0.25, 1.],
[0.5, 0.5, 0.3333333],
[-0.75, 0.75, 0.],
[1., -1., 0.]],
dtype=numpy.float32)
return x, expect_x_scaled
@pytest.mark.parametrize('indices', [None, [0], [1, 2]])
def test_max_abs_scaler_transform(data, indices):
x, expect_x_scaled = data
scaler = MaxAbsScaler()
scaler.fit(x, indices=indices)
x_scaled = scaler.transform(x)
if indices is None:
indices = numpy.arange(x.shape[1])
numpy.allclose(scaler.max_abs, numpy.array([0.4, 40, 0.3])[indices])
for index in range(x.shape[1]):
if index in indices:
assert numpy.allclose(x_scaled[:, index],
expect_x_scaled[:, index])
else:
assert numpy.allclose(x_scaled[:, index], x[:, index])
def test_max_abs_scaler_transform_variable(data):
x, expect_x_scaled = data
xvar = Variable(x)
scaler = MaxAbsScaler()
scaler.fit(xvar)
x_scaled = scaler.transform(xvar)
assert isinstance(x_scaled, Variable)
assert numpy.allclose(x_scaled.array, expect_x_scaled)
@pytest.mark.gpu
def test_max_abs_scaler_transform_gpu(data):
x, expect_x_scaled = data
scaler = MaxAbsScaler()
scaler.to_gpu()
x = cuda.to_gpu(x)
scaler.fit(x)
x_scaled = scaler.transform(x)
assert isinstance(x_scaled, cuda.cupy.ndarray)
assert numpy.allclose(cuda.to_cpu(x_scaled), expect_x_scaled)
@pytest.mark.parametrize('indices', [None, [0], [1, 2]])
def test_max_abs_scaler_inverse_transform(data, indices):
x, expect_x_scaled = data
scaler = MaxAbsScaler()
scaler.fit(x, indices=indices)
x_inverse = scaler.inverse_transform(expect_x_scaled)
if indices is None:
indices = numpy.arange(x.shape[1])
for index in range(x.shape[1]):
if index in indices:
assert numpy.allclose(x_inverse[:, index], x[:, index])
else:
assert numpy.allclose(x_inverse[:, index],
expect_x_scaled[:, index])
@pytest.mark.parametrize('axis', [1, 2])
def test_max_abs_scaler_3darray(data, axis):
x, expect_x_scaled = data
s0, s1 = x.shape
if axis == 1:
# feature axis is 1, insert other axis to 2nd axis
x = numpy.broadcast_to(x[:, :, None], (s0, s1, 2))
expect_x_scaled = numpy.broadcast_to(
expect_x_scaled[:, :, None], (s0, s1, 2))
elif axis == 2:
# feature axis is 2, insert other axis to 1st axis
x = numpy.broadcast_to(x[:, None, :], (s0, 3, s1))
expect_x_scaled = numpy.broadcast_to(
expect_x_scaled[:, None, :], (s0, 3, s1))
assert x.ndim == 3
indices = None
scaler = MaxAbsScaler()
scaler.fit(x, indices=indices, axis=axis)
x_scaled = scaler.transform(x, axis=axis)
assert x_scaled.shape == expect_x_scaled.shape
assert numpy.allclose(x_scaled, expect_x_scaled, atol=1e-7)
x_inverse = scaler.inverse_transform(expect_x_scaled, axis=axis)
for index in numpy.arange(x.shape[1]):
assert numpy.allclose(x_inverse[:, index], x[:, index], atol=1e-7)
def test_max_abs_scaler_fit_transform(data):
x, expect_x_scaled = data
scaler = MaxAbsScaler()
x_scaled = scaler.fit_transform(x)
assert numpy.allclose(x_scaled, expect_x_scaled)
# TODO(nakago): fix Chainer serializer.
# Behavior changed from numpy versioin 1.16.3.
# allow_pickle=True must be passed to numpy.load function,
# in order to load `None`.
# For now, skip test for serialize `None`.
# @pytest.mark.parametrize('indices', [None, [0]])
@pytest.mark.parametrize('indices', [[0]])
def test_max_abs_scaler_serialize(tmpdir, data, indices):
x, expect_x_scaled = data
scaler = MaxAbsScaler()
scaler.fit(x, indices=indices)
scaler_filepath = os.path.join(str(tmpdir), 'scaler.npz')
serializers.save_npz(scaler_filepath, scaler)
scaler2 = MaxAbsScaler()
serializers.load_npz(scaler_filepath, scaler2)
# print('scaler2 attribs:', scaler2.max_abs, scaler2.indices)
assert numpy.allclose(scaler.max_abs, scaler2.max_abs)
assert scaler.indices == scaler2.indices
def test_max_abs_scaler_assert_raises():
x = numpy.array([[0.1, 0.2, 0.3], [0.5, 0.3, 0.1]],
dtype=numpy.float32)
scaler = MaxAbsScaler()
# call transform before fit raises error
with pytest.raises(AttributeError):
scaler.transform(x)
with pytest.raises(AttributeError):
scaler.inverse_transform(x)
def test_max_abs_scaler_transform_zero_max():
x = numpy.array([[0, 2], [0, 2], [0, 2]], dtype=numpy.float32)
expect_x_scaled = numpy.array([[0, 1], [0, 1], [0, 1]],
dtype=numpy.float32)
scaler = MaxAbsScaler()
scaler.fit(x)
x_scaled = scaler.transform(x)
# print('max_abs', scaler.max_abs)
assert numpy.allclose(x_scaled, expect_x_scaled)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/links_tests/scaler_tests/test_min_max_scaler.py
================================================
import os
import numpy
import pytest
from chainer import serializers, Variable, cuda # NOQA
from chainer_chemistry.links.scaler.min_max_scaler import MinMaxScaler
@pytest.fixture
def data():
x = numpy.array(
[[0.1, 10., 0.3],
[0.2, 20., 0.1],
[-0.3, 30., 0.],
[0.4, -40., 0.]],
dtype=numpy.float32)
expect_x_scaled = numpy.array(
[[0.57142854, 0.71428573, 1.],
[0.7142857, 0.85714287, 0.3333333],
[0., 1., 0.],
[1., 0., 0.]],
dtype=numpy.float32)
return x, expect_x_scaled
@pytest.mark.parametrize('indices', [None, [0], [1, 2]])
def test_min_max_scaler_transform(data, indices):
x, expect_x_scaled = data
scaler = MinMaxScaler()
scaler.fit(x, indices=indices)
x_scaled = scaler.transform(x)
if indices is None:
indices = numpy.arange(x.shape[1])
numpy.allclose(scaler.max, numpy.array([0.4, 30, 0.3])[indices])
numpy.allclose(scaler.min, numpy.array([-0.3, -40, 0])[indices])
for index in range(x.shape[1]):
if index in indices:
assert numpy.allclose(x_scaled[:, index],
expect_x_scaled[:, index])
else:
assert numpy.allclose(x_scaled[:, index], x[:, index])
def test_min_max_scaler_transform_variable(data):
x, expect_x_scaled = data
xvar = Variable(x)
scaler = MinMaxScaler()
scaler.fit(xvar)
x_scaled = scaler.transform(xvar)
assert isinstance(x_scaled, Variable)
assert numpy.allclose(x_scaled.array, expect_x_scaled)
@pytest.mark.gpu
def test_min_max_scaler_transform_gpu(data):
x, expect_x_scaled = data
scaler = MinMaxScaler()
scaler.to_gpu()
x = cuda.to_gpu(x)
scaler.fit(x)
x_scaled = scaler.transform(x)
assert isinstance(x_scaled, cuda.cupy.ndarray)
assert numpy.allclose(cuda.to_cpu(x_scaled), expect_x_scaled)
@pytest.mark.parametrize('indices', [None, [0], [1, 2]])
def test_min_max_scaler_inverse_transform(data, indices):
x, expect_x_scaled = data
scaler = MinMaxScaler()
scaler.fit(x, indices=indices)
x_inverse = scaler.inverse_transform(expect_x_scaled)
if indices is None:
indices = numpy.arange(x.shape[1])
for index in range(x.shape[1]):
if index in indices:
assert numpy.allclose(x_inverse[:, index], x[:, index])
else:
assert numpy.allclose(x_inverse[:, index],
expect_x_scaled[:, index])
@pytest.mark.parametrize('axis', [1, 2])
def test_min_max_scaler_3darray(data, axis):
x, expect_x_scaled = data
s0, s1 = x.shape
if axis == 1:
# feature axis is 1, insert other axis to 2nd axis
x = numpy.broadcast_to(x[:, :, None], (s0, s1, 2))
expect_x_scaled = numpy.broadcast_to(
expect_x_scaled[:, :, None], (s0, s1, 2))
elif axis == 2:
# feature axis is 2, insert other axis to 1st axis
x = numpy.broadcast_to(x[:, None, :], (s0, 3, s1))
expect_x_scaled = numpy.broadcast_to(
expect_x_scaled[:, None, :], (s0, 3, s1))
assert x.ndim == 3
indices = None
scaler = MinMaxScaler()
scaler.fit(x, indices=indices, axis=axis)
x_scaled = scaler.transform(x, axis=axis)
assert x_scaled.shape == expect_x_scaled.shape
assert numpy.allclose(x_scaled, expect_x_scaled, atol=1e-7)
x_inverse = scaler.inverse_transform(expect_x_scaled, axis=axis)
for index in numpy.arange(x.shape[1]):
assert numpy.allclose(x_inverse[:, index], x[:, index], atol=1e-7)
def test_min_max_scaler_fit_transform(data):
x, expect_x_scaled = data
scaler = MinMaxScaler()
x_scaled = scaler.fit_transform(x)
assert numpy.allclose(x_scaled, expect_x_scaled)
# TODO(nakago): fix Chainer serializer.
# Behavior changed from numpy versioin 1.16.3.
# allow_pickle=True must be passed to numpy.load function,
# in order to load `None`.
# For now, skip test for serialize `None`.
# @pytest.mark.parametrize('indices', [None, [0]])
@pytest.mark.parametrize('indices', [[0]])
def test_min_max_scaler_serialize(tmpdir, data, indices):
x, expect_x_scaled = data
scaler = MinMaxScaler()
scaler.fit(x, indices=indices)
scaler_filepath = os.path.join(str(tmpdir), 'scaler.npz')
serializers.save_npz(scaler_filepath, scaler)
scaler2 = MinMaxScaler()
serializers.load_npz(scaler_filepath, scaler2)
# print('scaler2 attribs:', scaler2.min, scaler2.max, scaler2.indices)
assert numpy.allclose(scaler.min, scaler2.min)
assert numpy.allclose(scaler.max, scaler2.max)
assert scaler.indices == scaler2.indices
def test_min_max_scaler_assert_raises():
x = numpy.array([[0.1, 0.2, 0.3], [0.5, 0.3, 0.1]],
dtype=numpy.float32)
scaler = MinMaxScaler()
# call transform before fit raises error
with pytest.raises(AttributeError):
scaler.transform(x)
with pytest.raises(AttributeError):
scaler.inverse_transform(x)
def test_min_max_scaler_transform_zero_max():
x = numpy.array([[0, 2], [0, 2], [0, 2]], dtype=numpy.float32)
expect_x_scaled = numpy.array([[0, 0], [0, 0], [0, 0]],
dtype=numpy.float32)
scaler = MinMaxScaler()
scaler.fit(x)
x_scaled = scaler.transform(x)
# print('min', scaler.min, 'max', scaler.max)
assert numpy.allclose(x_scaled, expect_x_scaled)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/links_tests/scaler_tests/test_standard_scaler.py
================================================
import os
import chainer
import numpy
import pytest
from chainer import serializers, Variable, cuda # NOQA
from chainer_chemistry.links.scaler.standard_scaler import StandardScaler
@pytest.fixture
def data():
x = numpy.array(
[[0.1, 10., 0.3],
[0.2, 20., 0.1],
[0.3, 30., 0.],
[0.4, 40., 0.]],
dtype=numpy.float32)
expect_x_scaled = numpy.array(
[[-1.3416407, -1.3416408, 1.6329931],
[-0.44721353, -0.4472136, 0.],
[0.44721368, 0.4472136, -0.8164965],
[1.3416407, 1.3416408, -0.8164965]],
dtype=numpy.float32)
return x, expect_x_scaled
@pytest.mark.parametrize('indices', [None, [0], [1, 2]])
def test_standard_scaler_transform(data, indices):
x, expect_x_scaled = data
scaler = StandardScaler()
scaler.fit(x, indices=indices)
x_scaled = scaler.transform(x)
if indices is None:
indices = numpy.arange(x.shape[1])
for index in range(x.shape[1]):
if index in indices:
assert numpy.allclose(x_scaled[:, index],
expect_x_scaled[:, index])
else:
assert numpy.allclose(x_scaled[:, index], x[:, index])
def test_standard_scaler_transform_variable(data):
x, expect_x_scaled = data
xvar = Variable(x)
scaler = StandardScaler()
scaler.fit(xvar)
x_scaled = scaler.transform(xvar)
assert isinstance(x_scaled, Variable)
assert numpy.allclose(x_scaled.array, expect_x_scaled)
@pytest.mark.gpu
def test_standard_scaler_transform_gpu(data):
x, expect_x_scaled = data
scaler = StandardScaler()
scaler.to_gpu()
x = cuda.to_gpu(x)
scaler.fit(x)
x_scaled = scaler.transform(x)
assert isinstance(x_scaled, cuda.cupy.ndarray)
assert numpy.allclose(cuda.to_cpu(x_scaled), expect_x_scaled)
@pytest.mark.parametrize('indices', [None, [0], [1, 2]])
def test_standard_scaler_inverse_transform(data, indices):
x, expect_x_scaled = data
scaler = StandardScaler()
scaler.fit(x, indices=indices)
x_inverse = scaler.inverse_transform(expect_x_scaled)
if indices is None:
indices = numpy.arange(x.shape[1])
for index in range(x.shape[1]):
if index in indices:
assert numpy.allclose(x_inverse[:, index], x[:, index])
else:
assert numpy.allclose(x_inverse[:, index],
expect_x_scaled[:, index])
@pytest.mark.parametrize('axis', [1, 2])
def test_standard_scaler_3darray(data, axis):
x, expect_x_scaled = data
s0, s1 = x.shape
if axis == 1:
# feature axis is 1, insert other axis to 2nd axis
x = numpy.broadcast_to(x[:, :, None], (s0, s1, 2))
expect_x_scaled = numpy.broadcast_to(
expect_x_scaled[:, :, None], (s0, s1, 2))
elif axis == 2:
# feature axis is 2, insert other axis to 1st axis
x = numpy.broadcast_to(x[:, None, :], (s0, 3, s1))
expect_x_scaled = numpy.broadcast_to(
expect_x_scaled[:, None, :], (s0, 3, s1))
assert x.ndim == 3
indices = None
scaler = StandardScaler()
scaler.fit(x, indices=indices, axis=axis)
x_scaled = scaler.transform(x, axis=axis)
assert x_scaled.shape == expect_x_scaled.shape
assert numpy.allclose(x_scaled, expect_x_scaled, atol=1e-7)
x_inverse = scaler.inverse_transform(expect_x_scaled, axis=axis)
for index in numpy.arange(x.shape[1]):
assert numpy.allclose(x_inverse[:, index], x[:, index], atol=1e-7)
def test_standard_scaler_fit_transform(data):
x, expect_x_scaled = data
scaler = StandardScaler()
x_scaled = scaler.fit_transform(x)
assert numpy.allclose(x_scaled, expect_x_scaled)
# TODO(nakago): fix Chainer serializer.
# Behavior changed from numpy versioin 1.16.3.
# allow_pickle=True must be passed to numpy.load function,
# in order to load `None`.
# For now, skip test for serialize `None`.
# @pytest.mark.parametrize('indices', [None, [0]])
@pytest.mark.parametrize('indices', [[0]])
def test_standard_scaler_serialize(tmpdir, data, indices):
x, expect_x_scaled = data
scaler = StandardScaler()
scaler.fit(x, indices=indices)
scaler_filepath = os.path.join(str(tmpdir), 'scaler.npz')
serializers.save_npz(scaler_filepath, scaler)
scaler2 = StandardScaler()
serializers.load_npz(scaler_filepath, scaler2)
# print('scaler2 attribs:', scaler2.mean, scaler2.std, scaler2.indices)
assert numpy.allclose(scaler.mean, scaler2.mean)
assert numpy.allclose(scaler.std, scaler2.std)
assert scaler.indices == scaler2.indices
def test_standard_scaler_assert_raises():
x = numpy.array([[0.1, 0.2, 0.3], [0.5, 0.3, 0.1]],
dtype=numpy.float32)
scaler = StandardScaler()
# call transform before fit raises error
with pytest.raises(AttributeError):
scaler.transform(x)
with pytest.raises(AttributeError):
scaler.inverse_transform(x)
def test_standard_scaler_transform_zero_std():
x = numpy.array([[1, 2], [1, 2], [1, 2]], dtype=numpy.float32)
expect_x_scaled = numpy.array([[0, 0], [0, 0], [0, 0]],
dtype=numpy.float32)
scaler = StandardScaler()
scaler.fit(x)
x_scaled = scaler.transform(x)
assert numpy.allclose(x_scaled, expect_x_scaled)
def test_standard_scaler_forward(data):
# test `forward` and `__call__` method.
indices = [0]
x, expect_x_scaled = data
scaler = StandardScaler()
scaler.fit(x, indices=indices)
x_scaled_transform = scaler.transform(x)
x_scaled_forward = scaler.forward(x)
assert numpy.allclose(x_scaled_transform, x_scaled_forward)
if int(chainer.__version__.split('.')[0]) >= 5:
# `__call__` invokes `forward` method from version 5.
# Skip test for chainer v4.
x_scaled_call = scaler(x)
assert numpy.allclose(x_scaled_transform, x_scaled_call)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/links_tests/update_tests/test_cgcnn_update.py
================================================
import numpy
import pytest
from chainer import cuda
from chainer_chemistry.links.update.cgcnn_update import CGCNNUpdate
# node_size_list means the first moleculae has three nodes,
# and the seconde molecule has five nodes
node_size_list = [3, 5]
max_num_nbr = 6
node_feature_dim = 10
edge_feature_dim = 15
out_dim = node_feature_dim
batch_size = 2
@pytest.fixture
def update():
return CGCNNUpdate(n_site_features=node_feature_dim)
@pytest.fixture
def data():
if len(node_size_list) != batch_size:
raise ValueError("Invalid fixture data for CGCNN")
numpy.random.seed(0)
total_node_size = sum(node_size_list)
atom_feat = numpy.random.rand(total_node_size,
node_feature_dim).astype(numpy.float32)
nbr_feat = numpy.random.rand(total_node_size, max_num_nbr,
edge_feature_dim).astype(numpy.float32)
# nbr_idx
curr_idx = 0
nbr_idx = []
for val in node_size_list:
for _ in range(val):
max_val = curr_idx + val
nbr_idx.append(numpy.random.randint(curr_idx,
max_val, max_num_nbr))
curr_idx += val
nbr_idx = numpy.array(nbr_idx, dtype=numpy.int32)
y_grad = numpy.random.uniform(-1, 1,
(batch_size, out_dim)).astype(numpy.float32)
return atom_feat, nbr_feat, nbr_idx, y_grad
def check_forward(update, data):
y_actual = cuda.to_cpu(update(*data).data)
assert y_actual.shape == (sum(node_size_list), out_dim)
def test_forward_cpu(update, data):
atom_feat, nbr_feat, nbr_idx = data[:-1]
check_forward(update, (atom_feat, nbr_feat, nbr_idx))
@pytest.mark.gpu
def test_forward_gpu(update, data):
input_data = [cuda.to_gpu(d) for d in data[:-1]]
update.to_gpu()
check_forward(update, tuple(input_data))
# def test_backward_cpu(update, data):
# input_data, y_grad = data[0:-1], data[-1]
# gradient_check.check_backward(update, tuple(input_data), y_grad,
# atol=5e-1, rtol=1e-1)
# @pytest.mark.gpu
# def test_backward_gpu(update, data):
# atom_data, adj_data, y_grad = [cuda.to_gpu(d) for d in data]
# update.to_gpu()
# gradient_check.check_backward(update, (atom_data, adj_data), y_grad,
# atol=5e-1, rtol=1e-1)
if __name__ == '__main__':
pytest.main([__file__, '-v'])
================================================
FILE: tests/links_tests/update_tests/test_ggnn_update.py
================================================
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links.connection.embed_atom_id import EmbedAtomID
from chainer_chemistry.links.update.ggnn_update import GGNNUpdate
from chainer_chemistry.utils.permutation import permute_adj
from chainer_chemistry.utils.permutation import permute_node
from chainer_chemistry.utils.sparse_utils import _convert_to_sparse
from chainer_chemistry.utils.sparse_utils import convert_sparse_with_edge_type
from chainer_chemistry.utils.sparse_utils import sparse_utils_available
atom_size = 5
in_channels = 4
hidden_channels = 7
batch_size = 2
n_edge_types = 2
@pytest.fixture
def update():
return GGNNUpdate(in_channels=in_channels, hidden_channels=hidden_channels,
n_edge_types=n_edge_types)
@pytest.fixture
def data():
numpy.random.seed(0)
atom_data = numpy.random.randint(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size)
).astype('i')
adj_data = numpy.random.uniform(
0, high=2, size=(batch_size, n_edge_types, atom_size, atom_size)
).astype('f')
y_grad = numpy.random.uniform(
-1, 1, (batch_size, atom_size, hidden_channels)).astype('f')
embed = EmbedAtomID(in_size=MAX_ATOMIC_NUM, out_size=in_channels)
embed_atom_data = embed(atom_data).data
return embed_atom_data, adj_data, y_grad
@pytest.mark.skipif(not sparse_utils_available())
def convert_to_sparse(dense_adj):
# auxiliary function
data, row, col, edge_type = _convert_to_sparse(dense_adj)
return convert_sparse_with_edge_type(data, row, col, atom_size,
edge_type, n_edge_types)
def check_forward(update, atom_data, adj_data):
update.reset_state()
y_actual = cuda.to_cpu(update(atom_data, adj_data).data)
assert y_actual.shape == (batch_size, atom_size, hidden_channels)
return y_actual
def test_forward_cpu(update, data):
atom_data, adj_data = data[:2]
y_dense = check_forward(update, atom_data, adj_data)
if sparse_utils_available():
sparse_adj = convert_to_sparse(adj_data)
y_sparse = check_forward(update, atom_data, sparse_adj)
# results for dense matrix and sparse matrix must be same
numpy.testing.assert_allclose(
y_dense, y_sparse, atol=1e-4, rtol=1e-4)
@pytest.mark.gpu
def test_forward_gpu(update, data):
atom_data, adj_data = cuda.to_gpu(data[0]), cuda.to_gpu(data[1])
update.to_gpu()
y_dense = check_forward(update, atom_data, adj_data)
if sparse_utils_available():
sparse_adj = convert_to_sparse(adj_data)
y_sparse = check_forward(update, atom_data, sparse_adj)
numpy.testing.assert_allclose(
cuda.to_cpu(y_dense), cuda.to_cpu(y_sparse), atol=1e-4, rtol=1e-4)
def check_backward(update, atom_data, adj_data, y_grad):
"""Check gradient of GGNNUpdate.
This function is different from other backward tests.
Because of GRU, reset_state method has to be called explicitly
before gradient calculation.
Args:
update (callable):
atom_data (numpy.ndarray):
adj_data (numpy.ndarray):
y_grad (numpy.ndarray):
"""
def f(atom_data):
# skip adj_data check.
update.reset_state()
return update(atom_data, adj_data)
gradient_check.check_backward(
f, (atom_data), y_grad, atol=1e-1, rtol=1e-1)
def test_backward_cpu(update, data):
atom_data, adj_data, y_grad = data
check_backward(update, atom_data, adj_data, y_grad)
if sparse_utils_available():
sparse_adj = convert_to_sparse(adj_data)
check_backward(update, atom_data, sparse_adj, y_grad)
@pytest.mark.gpu
def test_backward_gpu(update, data):
update.to_gpu()
atom_data, adj_data, y_grad = map(cuda.to_gpu, data)
check_backward(update, atom_data, adj_data, y_grad)
if sparse_utils_available():
sparse_adj = convert_to_sparse(adj_data)
check_backward(update, atom_data, sparse_adj, y_grad)
def test_forward_cpu_graph_invariant(update, data):
permutation_index = numpy.random.permutation(atom_size)
atom_data, adj_data = data[:2]
update.reset_state()
y_actual = cuda.to_cpu(update(atom_data, adj_data).data)
permute_atom_data = permute_node(atom_data, permutation_index, axis=1)
permute_adj_data = permute_adj(adj_data, permutation_index)
update.reset_state()
permute_y_actual = cuda.to_cpu(update(
permute_atom_data, permute_adj_data).data)
numpy.testing.assert_allclose(
permute_node(y_actual, permutation_index, axis=1),
permute_y_actual, rtol=1e-5, atol=1e-5)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/links_tests/update_tests/test_gin_update.py
================================================
from typing import Tuple # NOQA
import chainer # NOQA
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links.connection.embed_atom_id import EmbedAtomID
from chainer_chemistry.links.update.gin_update import GINUpdate
from chainer_chemistry.utils.permutation import permute_adj
from chainer_chemistry.utils.permutation import permute_node
atom_size = 5
in_channels = 4
hidden_channels = 6
batch_size = 3
num_edge_type = 7
@pytest.fixture
def update():
# type: () -> GINUpdate
return GINUpdate(in_channels=in_channels, hidden_channels=hidden_channels,
dropout_ratio=0)
@pytest.fixture
def data():
# type: () -> Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]
numpy.random.seed(0)
atom_data = numpy.random.randint(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size)).astype('i')
adj_data = numpy.random.randint(
0, high=2, size=(batch_size, atom_size, atom_size)).astype('f')
y_grad = numpy.random.uniform(
-1, 1, (batch_size, atom_size, hidden_channels)).astype('f')
embed = EmbedAtomID(in_size=MAX_ATOMIC_NUM, out_size=in_channels)
embed_atom_data = embed(atom_data).data
return embed_atom_data, adj_data, y_grad
# Test Update Function
def check_forward(update, atom_data, adj_data):
# type: (GINUpdate, numpy.ndarray, numpy.ndarray) -> None
y_actual = cuda.to_cpu(update(atom_data, adj_data).data)
assert y_actual.shape == (batch_size, atom_size, hidden_channels)
def test_forward_cpu(update, data):
# type: (GINUpdate, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data = data[:2]
check_forward(update, atom_data, adj_data)
@pytest.mark.gpu
def test_forward_gpu(update, data):
# type: (GINUpdate, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data = map(cuda.to_gpu, data[:2])
update.to_gpu()
check_forward(update, atom_data, adj_data)
def test_backward_cpu(update, data):
# type: (GINUpdate, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data, y_grad = data
gradient_check.check_backward(
update, (atom_data, adj_data), y_grad, atol=1e-3, rtol=1e-3)
@pytest.mark.gpu
def test_backward_gpu(update, data):
# type: (GINUpdate, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data, y_grad = map(cuda.to_gpu, data[:3])
update.to_gpu()
gradient_check.check_backward(
update, (atom_data, adj_data), y_grad, atol=1e-3, rtol=1e-3)
def test_forward_cpu_graph_invariant(update, data):
# type: (GINUpdate, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data = data[:2]
y_actual = cuda.to_cpu(update(atom_data, adj_data).data)
permutation_index = numpy.random.permutation(atom_size)
permute_atom_data = permute_node(atom_data, permutation_index, axis=1)
permute_adj_data = permute_adj(adj_data, permutation_index)
permute_y_actual = cuda.to_cpu(
update(permute_atom_data, permute_adj_data).data)
numpy.testing.assert_allclose(
permute_node(y_actual, permutation_index, axis=1),
permute_y_actual,
rtol=1e-3,
atol=1e-3)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/links_tests/update_tests/test_gnn_film_update.py
================================================
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links.connection.embed_atom_id import EmbedAtomID
from chainer_chemistry.links.update.gnn_film_update import GNNFiLMUpdate
from chainer_chemistry.utils.permutation import permute_adj
from chainer_chemistry.utils.permutation import permute_node
atom_size = 5
in_channels = 7
hidden_channels = 7
batch_size = 2
n_edge_types = 5
@pytest.fixture
def update():
return GNNFiLMUpdate(hidden_channels=hidden_channels,
n_edge_types=n_edge_types)
@pytest.fixture
def data():
numpy.random.seed(0)
atom_data = numpy.random.randint(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size)
).astype('i')
adj_data = numpy.random.uniform(
0, high=2, size=(batch_size, n_edge_types, atom_size, atom_size)
).astype('f')
y_grad = numpy.random.uniform(
-1, 1, (batch_size, atom_size, hidden_channels)).astype('f')
embed = EmbedAtomID(in_size=MAX_ATOMIC_NUM, out_size=in_channels)
embed_atom_data = embed(atom_data).data
adj_data = adj_data
return embed_atom_data, adj_data, y_grad
# Test Update Function
def check_forward(update, atom_data, adj_data):
# type: (GNNFiLMUpdate, numpy.ndarray, numpy.ndarray) -> None
y_actual = cuda.to_cpu(update(atom_data, adj_data).data)
assert y_actual.shape == (batch_size, atom_size, hidden_channels)
def test_forward_cpu(update, data):
# type: (GNNFiLMUpdate, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data = data[:2]
check_forward(update, atom_data, adj_data)
@pytest.mark.gpu
def test_forward_gpu(update, data):
# type: (GNNFiLMUpdate, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data = map(cuda.to_gpu, data[:2])
update.to_gpu()
check_forward(update, atom_data, adj_data)
def test_backward_cpu(update, data):
# type: (GNNFiLMUpdate, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data, y_grad = data
gradient_check.check_backward(
update, (atom_data, adj_data), y_grad, atol=1e-2, rtol=1e-2)
@pytest.mark.gpu
def test_backward_gpu(update, data):
# type: (GNNFiLMUpdate, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data, y_grad = map(cuda.to_gpu, data[:3])
update.to_gpu()
# print(type(adj_data))
gradient_check.check_backward(
update, (atom_data, adj_data), y_grad, atol=1e-2, rtol=1e-2)
def test_forward_cpu_graph_invariant(update, data):
# type: (GNNFiLMUpdate, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data = data[:2]
y_actual = cuda.to_cpu(update(atom_data, adj_data).data)
permutation_index = numpy.random.permutation(atom_size)
permute_atom_data = permute_node(atom_data, permutation_index, axis=1)
permute_adj_data = permute_adj(adj_data, permutation_index)
permute_y_actual = cuda.to_cpu(
update(permute_atom_data, permute_adj_data).data)
numpy.testing.assert_allclose(
permute_node(y_actual, permutation_index, axis=1),
permute_y_actual,
rtol=1e-3,
atol=1e-3)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/links_tests/update_tests/test_megnet_update.py
================================================
from chainer import cuda
import numpy
import pytest
from chainer_chemistry.links.update.megnet_update import MEGNetUpdate
# node_size_list means the first moleculae has six nodes,
# and the seconde molecule has four nodes
node_size_list = [6, 4]
# edge_size_list means the first moleculae has eight edges,
# and the seconde molecule has four edges
edge_size_list = [8, 4]
node_feature_dim = 5
edge_feature_dim = 10
global_feature_dim = 2
out_dim = 32
batch_size = 2
@pytest.fixture
def update():
return MEGNetUpdate()
@pytest.fixture
def data():
if len(node_size_list) != batch_size or len(edge_size_list) != batch_size:
raise ValueError("Invalid fixture for MEGNet")
numpy.random.seed(0)
total_node_size = sum(node_size_list)
total_edge_size = sum(edge_size_list)
atom_feat = numpy.random.rand(total_node_size,
node_feature_dim).astype(numpy.float32)
pair_feat = numpy.random.rand(total_edge_size,
edge_feature_dim).astype(numpy.float32)
global_feat = numpy.random.rand(batch_size,
global_feature_dim).astype(numpy.float32)
# atom idx
atom_idx = numpy.hstack([[i] * node_size_list[i]
for i in range(batch_size)]).astype(numpy.int32)
# pair idx
pair_idx = numpy.hstack([[i] * edge_size_list[i]
for i in range(batch_size)]).astype(numpy.int32)
# create start and end idx
edge_idx = []
acc_node_size = [sum(node_size_list[:i+1]) for i in range(batch_size)]
low = numpy.roll(acc_node_size + [0], 1)[0:batch_size+1]
high = numpy.array(acc_node_size)
for i in range(batch_size):
idx = [numpy.random.choice(numpy.arange(low[i], high[i]), 2,
replace=False)
for _ in range(edge_size_list[i])]
edge_idx.extend(idx)
start_idx = numpy.array(edge_idx, dtype=numpy.int32)[:, 0]
end_idx = numpy.array(edge_idx, dtype=numpy.int32)[:, 1]
y_grad_atom = numpy.random.uniform(
-1, 1, (batch_size, out_dim)).astype(numpy.float32)
y_grad_pair = numpy.random.uniform(
-1, 1, (batch_size, out_dim)).astype(numpy.float32)
y_grad_global = numpy.random.uniform(
-1, 1, (batch_size, out_dim)).astype(numpy.float32)
return atom_feat, pair_feat, global_feat, \
atom_idx, pair_idx, start_idx, end_idx, \
y_grad_atom, y_grad_pair, y_grad_global
def check_forward(update, data):
y_actual = [cuda.to_cpu(d.data) for d in update(*data)]
atom_feat, pair_feat, global_feat = y_actual
assert atom_feat.shape == (sum(node_size_list), out_dim)
assert pair_feat.shape == (sum(edge_size_list), out_dim)
assert global_feat.shape == (batch_size, out_dim)
def test_forward_cpu(update, data):
atom_feat, pair_feat, global_feat, \
atom_idx, pair_idx, start_idx, end_idx = data[:-3]
check_forward(update, (atom_feat, pair_feat, global_feat, atom_idx,
pair_idx, start_idx, end_idx))
@pytest.mark.gpu
def test_forward_gpu(update, data):
input_data = [cuda.to_gpu(d) for d in data[:-3]]
update.to_gpu()
check_forward(update, tuple(input_data))
# def test_backward_cpu(update, data):
# input_data, y_grad = data[0:-3], data[-3:]
# gradient_check.check_backward(update, tuple(input_data), tuple(y_grad),
# atol=5e-1, rtol=1e-1)
# @pytest.mark.gpu
# def test_backward_gpu(update, data):
# data = [cuda.to_gpu(d) for d in data]
# input_data, y_grad = data[0:-3], data[-3:]
# update.to_gpu()
# gradient_check.check_backward(update, tuple(input_data), tuple(y_grad),
# atol=5e-1, rtol=1e-1)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/links_tests/update_tests/test_mpnn_update.py
================================================
from typing import Tuple # NOQA
import chainer # NOQA
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links.connection.embed_atom_id import EmbedAtomID
from chainer_chemistry.links.update.mpnn_update import EdgeNet
from chainer_chemistry.links.update.mpnn_update import MPNNUpdate
atom_size = 5
hidden_channels = 4
batch_size = 3
num_edge_type = 7
@pytest.fixture
def message():
# type: () -> EdgeNet
return EdgeNet(out_channels=hidden_channels)
@pytest.fixture
def update():
# type: () -> MPNNUpdate
return MPNNUpdate(hidden_channels=hidden_channels)
@pytest.fixture
def data():
# type: () -> Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray, numpy.ndarray] # NOQA
numpy.random.seed(0)
atom_data = numpy.random.randint(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size)).astype('i')
adj_data = numpy.random.randint(
0, high=2, size=(batch_size, num_edge_type, atom_size,
atom_size)).astype('f')
y_grad = numpy.random.uniform(
-1, 1, (batch_size, atom_size, hidden_channels)).astype('f')
y_grad_ = numpy.random.uniform(
-1, 1, (batch_size, atom_size, hidden_channels)).astype('f')
embed = EmbedAtomID(in_size=MAX_ATOMIC_NUM, out_size=hidden_channels)
embed_atom_data = embed(atom_data).data
return embed_atom_data, adj_data, y_grad, y_grad_
# Test Message Function
def check_message_forward(message, atom_data, adj_data):
# type: (EdgeNet, numpy.ndarray, numpy.ndarray) -> None
y_actual = cuda.to_cpu(message(atom_data, adj_data).data)
assert y_actual.shape == (batch_size, atom_size, hidden_channels * 2)
def test_message_forward_cpu(message, data):
# type: (EdgeNet, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data = data[:2]
check_message_forward(message, atom_data, adj_data)
@pytest.mark.gpu
def test_message_forward_gpu(message, data):
# type: (EdgeNet, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data = map(cuda.to_gpu, data[:2])
message.to_gpu()
check_message_forward(message, atom_data, adj_data)
def test_message_backward_cpu(message, data):
# type: (EdgeNet, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data, y_grad, y_grad_ = data
y_grad = numpy.concatenate([y_grad, y_grad_], axis=2)
gradient_check.check_backward(
message, (atom_data, adj_data), y_grad, atol=1e-2, rtol=1e-2)
@pytest.mark.gpu
def test_message_backward_gpu(message, data):
# type: (EdgeNet, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data, y_grad, y_grad_ = map(cuda.to_gpu, data)
xp = cuda.get_array_module(atom_data)
y_grad = xp.concatenate([y_grad, y_grad_], axis=2)
message.to_gpu()
gradient_check.check_backward(
message, (atom_data, adj_data), y_grad, atol=1e-1, rtol=1e-1)
# Test Update Function
def check_forward(update, atom_data, adj_data):
# type: (MPNNUpdate, numpy.ndarray, numpy.ndarray) -> None
y_actual = cuda.to_cpu(update(atom_data, adj_data).data)
assert y_actual.shape == (batch_size, atom_size, hidden_channels)
def test_forward_cpu(update, data):
# type: (MPNNUpdate, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data = data[:2]
check_forward(update, atom_data, adj_data)
@pytest.mark.gpu
def test_forward_gpu(update, data):
# type: (MPNNUpdate, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data = map(cuda.to_gpu, data[:2])
update.to_gpu()
check_forward(update, atom_data, adj_data)
def check_backward(update, atom_data, adj_data, y_grad):
# type: (MPNNUpdate, numpy.ndarray, numpy.ndarray, numpy.ndarray) -> None
"""Check gradient of MPNNUpdate.
This function is different from other backward tests.
Because of GRU, reset_state method has to be called explicitly
before gradient calculation.
Args:
update (callable):
atom_data (numpy.ndarray):
adj_data (numpy.ndarray):
y_grad (numpy.ndarray):
"""
def f(*args, **kwargs):
update.reset_state()
return update(*args, **kwargs)
gradient_check.check_backward(
f, (atom_data, adj_data), y_grad, atol=1e-1, rtol=1e-1)
def test_backward_cpu(update, data):
# type: (MPNNUpdate, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data, y_grad = data[:3]
check_backward(update, atom_data, adj_data, y_grad)
@pytest.mark.gpu
def test_backward_gpu(update, data):
# type: (MPNNUpdate, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data, y_grad = map(cuda.to_gpu, data[:3])
update.to_gpu()
# gradient_check.check_backward(update, (atom_data, adj_data), y_grad,
# atol=1e-1, rtol=1e-1)
check_backward(update, atom_data, adj_data, y_grad)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s', '-x'])
================================================
FILE: tests/links_tests/update_tests/test_nfp_update.py
================================================
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links.connection.embed_atom_id import EmbedAtomID
from chainer_chemistry.links.update.nfp_update import NFPUpdate
from chainer_chemistry.utils.permutation import permute_adj
from chainer_chemistry.utils.permutation import permute_node
atom_size = 5
hidden_channels = 4
batch_size = 2
num_degree_type = 7
@pytest.fixture
def update():
return NFPUpdate(in_channels=hidden_channels, out_channels=hidden_channels)
@pytest.fixture
def data():
numpy.random.seed(0)
atom_data = numpy.random.randint(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size)).astype('i')
adj_data = numpy.random.randint(
0, high=2, size=(batch_size, atom_size, atom_size)).astype('f')
y_grad = numpy.random.uniform(
-1, 1, (batch_size, atom_size, hidden_channels)).astype('f')
embed = EmbedAtomID(in_size=MAX_ATOMIC_NUM, out_size=hidden_channels)
embed_atom_data = embed(atom_data).data
degree_mat = numpy.sum(adj_data, axis=1)
deg_conds = numpy.array([numpy.broadcast_to(
((degree_mat - degree) == 0)[:, :, None], embed_atom_data.shape)
for degree in range(1, num_degree_type + 1)])
return embed_atom_data, adj_data, deg_conds, y_grad
def check_forward(update, atom_data, adj_data, deg_conds):
y_actual = cuda.to_cpu(update(atom_data, adj_data, deg_conds).data)
assert y_actual.shape == (batch_size, atom_size, hidden_channels)
def test_forward_cpu(update, data):
atom_data, adj_data, deg_conds = data[:3]
check_forward(update, atom_data, adj_data, deg_conds)
@pytest.mark.gpu
def test_forward_gpu(update, data):
atom_data, adj_data, deg_conds = map(cuda.to_gpu, data[:3])
update.to_gpu()
check_forward(update, atom_data, adj_data, deg_conds)
def test_backward_cpu(update, data):
atom_data, adj_data, deg_conds, y_grad = data
gradient_check.check_backward(
update, (atom_data, adj_data, deg_conds), y_grad, atol=1e-3, rtol=1e-3)
@pytest.mark.gpu
def test_backward_gpu(update, data):
atom_data, adj_data, deg_conds, y_grad = map(cuda.to_gpu, data)
update.to_gpu()
gradient_check.check_backward(
update, (atom_data, adj_data, deg_conds), y_grad, atol=1e-3, rtol=1e-3)
def test_forward_cpu_graph_invariant(update, data):
atom_data, adj_data, deg_conds = data[:3]
y_actual = cuda.to_cpu(update(atom_data, adj_data, deg_conds).data)
permutation_index = numpy.random.permutation(atom_size)
# atom_data: (batch_size, atom_size, hidden_channels)
permute_atom_data = permute_node(atom_data, permutation_index, axis=1)
permute_adj_data = permute_adj(adj_data, permutation_index)
# deg_conds: (num_degree_type, batch_size, atom_size, hidden_channels)
permute_deg_conds = permute_node(deg_conds, permutation_index, axis=2)
permute_y_actual = cuda.to_cpu(update(
permute_atom_data, permute_adj_data, permute_deg_conds).data)
numpy.testing.assert_allclose(
permute_node(y_actual, permutation_index, axis=1), permute_y_actual,
rtol=1e-5, atol=1e-5)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/links_tests/update_tests/test_relgat_update.py
================================================
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links.connection.embed_atom_id import EmbedAtomID
from chainer_chemistry.links.update.relgat_update import RelGATUpdate
from chainer_chemistry.utils.permutation import permute_adj
from chainer_chemistry.utils.permutation import permute_node
in_channels = 3
out_channels = 4
atom_size = 5
batch_size = 2
num_edge_type = 7
@pytest.fixture
def update():
return RelGATUpdate(in_channels=in_channels,
out_channels=out_channels,
n_edge_types=num_edge_type)
@pytest.fixture
def data():
numpy.random.seed(0)
atom_data = numpy.random.randint(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size)).astype('i')
adj_data = numpy.random.randint(
0, high=2, size=(batch_size, num_edge_type, atom_size, atom_size)
).astype('f')
y_grad = numpy.random.uniform(
-1, 1, (batch_size, atom_size, out_channels)).astype('f')
embed = EmbedAtomID(in_size=MAX_ATOMIC_NUM, out_size=in_channels)
embed_atom_data = embed(atom_data).data
return embed_atom_data, adj_data, y_grad
def check_forward(update, atom_data, adj_data):
y_actual = cuda.to_cpu(update(atom_data, adj_data).data)
assert y_actual.shape == (batch_size, atom_size, out_channels)
def test_forward_cpu(update, data):
atom_data, adj_data = data[:2]
check_forward(update, atom_data, adj_data)
@pytest.mark.gpu
def test_forward_gpu(update, data):
atom_data, adj_data = map(cuda.to_gpu, data[:2])
update.to_gpu()
check_forward(update, atom_data, adj_data)
def test_backward_cpu(update, data):
atom_data, adj_data, y_grad = data
# gradient_check.check_backward(
# update, (atom_data, adj_data), y_grad, atol=1e-3, rtol=1e-3)
params = tuple(update.params()) # NOQA
gradient_check.check_backward(update, (atom_data, adj_data), y_grad,
no_grads=[False, True],
atol=1e-1, rtol=1e-1)
@pytest.mark.gpu
def test_backward_gpu(update, data):
atom_data, adj_data, y_grad = map(cuda.to_gpu, data)
update.to_gpu()
gradient_check.check_backward(
update, (atom_data, adj_data), y_grad, atol=1e-1, rtol=1e-1)
def test_forward_cpu_graph_invariant(update, data):
atom_data, adj_data = data[:2]
y_actual = cuda.to_cpu(update(atom_data, adj_data).data)
permutation_index = numpy.random.permutation(atom_size)
permute_atom_data = permute_node(atom_data, permutation_index, axis=1)
permute_adj_data = permute_adj(adj_data, permutation_index)
permute_y_actual = cuda.to_cpu(
update(permute_atom_data, permute_adj_data).data)
numpy.testing.assert_allclose(
permute_node(y_actual, permutation_index, axis=1), permute_y_actual,
rtol=1e-5, atol=1e-5)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/links_tests/update_tests/test_relgcn_update.py
================================================
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links.connection.embed_atom_id import EmbedAtomID
from chainer_chemistry.links.update.relgcn_update import RelGCNUpdate
from chainer_chemistry.utils.permutation import permute_adj
from chainer_chemistry.utils.permutation import permute_node
atom_size = 5
in_channels = 3
hidden_dim = 4
batch_size = 2
n_edge_types = 7
@pytest.fixture
def update():
return RelGCNUpdate(in_channels=in_channels, out_channels=hidden_dim,
n_edge_types=n_edge_types)
@pytest.fixture
def data():
numpy.random.seed(0)
atom_data = numpy.random.randint(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size)).astype('i')
adj_data = numpy.random.randint(
0, high=2, size=(batch_size, n_edge_types, atom_size, atom_size)
).astype('f')
y_grad = numpy.random.uniform(
-1, 1, (batch_size, atom_size, hidden_dim)).astype('f')
embed = EmbedAtomID(in_size=MAX_ATOMIC_NUM, out_size=in_channels)
embed_atom_data = embed(atom_data).data
return embed_atom_data, adj_data, y_grad
def check_forward(update, atom_data, adj_data):
y_actual = cuda.to_cpu(update(atom_data, adj_data).data)
assert y_actual.shape == (batch_size, atom_size, hidden_dim)
def test_forward_cpu(update, data):
atom_data, adj_data = data[:2]
check_forward(update, atom_data, adj_data)
@pytest.mark.gpu
def test_forward_gpu(update, data):
atom_data, adj_data = map(cuda.to_gpu, data[:2])
update.to_gpu()
check_forward(update, atom_data, adj_data)
def test_backward_cpu(update, data):
atom_data, adj_data, y_grad = data
gradient_check.check_backward(
update, (atom_data, adj_data), y_grad, atol=1e-2, rtol=1e-2)
@pytest.mark.gpu
def test_backward_gpu(update, data):
atom_data, adj_data, y_grad = map(cuda.to_gpu, data)
update.to_gpu()
gradient_check.check_backward(
update, (atom_data, adj_data), y_grad, atol=1e-2, rtol=1e-2)
def test_forward_cpu_graph_invariant(update, data):
atom_data, adj_data = data[:2]
y_actual = cuda.to_cpu(update(atom_data, adj_data).data)
permutation_index = numpy.random.permutation(atom_size)
permute_atom_data = permute_node(atom_data, permutation_index, axis=1)
permute_adj_data = permute_adj(adj_data, permutation_index)
permute_y_actual = cuda.to_cpu(
update(permute_atom_data, permute_adj_data).data)
numpy.testing.assert_allclose(
permute_node(y_actual, permutation_index, axis=1), permute_y_actual,
rtol=1e-5, atol=1e-5)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/links_tests/update_tests/test_rsgcn_update.py
================================================
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links.connection.embed_atom_id import EmbedAtomID
from chainer_chemistry.links.update.rsgcn_update import RSGCNUpdate
from chainer_chemistry.utils.permutation import permute_adj
from chainer_chemistry.utils.permutation import permute_node
atom_size = 5
in_channels = 3
hidden_dim = 4
batch_size = 2
num_edge_type = 7
@pytest.fixture
def update():
return RSGCNUpdate(in_channels=in_channels, out_channels=hidden_dim)
@pytest.fixture
def data():
numpy.random.seed(0)
atom_data = numpy.random.randint(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size)).astype('i')
adj_data = numpy.random.randint(
0, high=2, size=(batch_size, atom_size, atom_size)).astype('f')
y_grad = numpy.random.uniform(
-1, 1, (batch_size, atom_size, hidden_dim)).astype('f')
embed = EmbedAtomID(in_size=MAX_ATOMIC_NUM, out_size=in_channels)
embed_atom_data = embed(atom_data).data
return embed_atom_data, adj_data, y_grad
def check_forward(update, atom_data, adj_data):
y_actual = cuda.to_cpu(update(atom_data, adj_data).data)
assert y_actual.shape == (batch_size, atom_size, hidden_dim)
def test_forward_cpu(update, data):
atom_data, adj_data = data[:2]
check_forward(update, atom_data, adj_data)
@pytest.mark.gpu
def test_forward_gpu(update, data):
atom_data, adj_data = map(cuda.to_gpu, data[:2])
update.to_gpu()
check_forward(update, atom_data, adj_data)
def test_backward_cpu(update, data):
atom_data, adj_data, y_grad = data
gradient_check.check_backward(
update, (atom_data, adj_data), y_grad, atol=1e-3, rtol=1e-3)
@pytest.mark.gpu
def test_backward_gpu(update, data):
atom_data, adj_data, y_grad = map(cuda.to_gpu, data)
update.to_gpu()
gradient_check.check_backward(
update, (atom_data, adj_data), y_grad, atol=1e-3, rtol=1e-3)
def test_forward_cpu_graph_invariant(update, data):
atom_data, adj_data = data[:2]
y_actual = cuda.to_cpu(update(atom_data, adj_data).data)
permutation_index = numpy.random.permutation(atom_size)
permute_atom_data = permute_node(atom_data, permutation_index, axis=1)
permute_adj_data = permute_adj(adj_data, permutation_index)
permute_y_actual = cuda.to_cpu(
update(permute_atom_data, permute_adj_data).data)
numpy.testing.assert_allclose(
permute_node(y_actual, permutation_index, axis=1), permute_y_actual,
rtol=1e-5, atol=1e-5)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/links_tests/update_tests/test_schnet_update.py
================================================
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links.connection.embed_atom_id import EmbedAtomID
from chainer_chemistry.links.update.schnet_update import SchNetUpdate
from chainer_chemistry.utils.permutation import permute_adj
from chainer_chemistry.utils.permutation import permute_node
atom_size = 5
in_channels = 4
hidden_channels = in_channels # must be same for now
batch_size = 2
@pytest.fixture
def update():
return SchNetUpdate(hidden_channels=hidden_channels)
@pytest.fixture
def data():
numpy.random.seed(0)
atom_data = numpy.random.randint(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size)
).astype('i')
# symmetric matrix
dist_data = numpy.random.uniform(
0, high=30, size=(batch_size, atom_size, atom_size)).astype('f')
dist_data = (dist_data + dist_data.swapaxes(-1, -2)) / 2.
y_grad = numpy.random.uniform(
-1, 1, (batch_size, atom_size, hidden_channels)).astype('f')
embed = EmbedAtomID(in_size=MAX_ATOMIC_NUM, out_size=in_channels)
embed_atom_data = embed(atom_data).data
return embed_atom_data, dist_data, y_grad
def check_forward(update, atom_data, dist_data):
y_actual = cuda.to_cpu(update(atom_data, dist_data).data)
assert y_actual.shape == (batch_size, atom_size, hidden_channels)
def test_forward_cpu(update, data):
atom_data, dist_data = data[:2]
check_forward(update, atom_data, dist_data)
@pytest.mark.gpu
def test_forward_gpu(update, data):
atom_data, dist_data = cuda.to_gpu(data[0]), cuda.to_gpu(data[1])
update.to_gpu()
check_forward(update, atom_data, dist_data)
def test_backward_cpu(update, data):
atom_data, dist_data, y_grad = data
gradient_check.check_backward(
update, (atom_data, dist_data), y_grad, atol=1e-3, rtol=1e-3)
@pytest.mark.gpu
def test_backward_gpu(update, data):
atom_data, dist_data, y_grad = map(cuda.to_gpu, data)
update.to_gpu()
gradient_check.check_backward(
update, (atom_data, dist_data), y_grad, atol=1e-3, rtol=1e-3)
def test_forward_cpu_graph_invariant(update, data):
atom_data, dist_data = data[:2]
y_actual = cuda.to_cpu(update(atom_data, dist_data).data)
permutation_index = numpy.random.permutation(atom_size)
permute_atom_data = permute_node(atom_data, permutation_index, axis=1)
permute_dist_data = permute_adj(dist_data, permutation_index)
permute_y_actual = cuda.to_cpu(update(
permute_atom_data, permute_dist_data).data)
numpy.testing.assert_allclose(
permute_node(y_actual, permutation_index, axis=1),
permute_y_actual, rtol=1e-5, atol=1e-5)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/models_tests/gwm_tests/test_gwm.py
================================================
from chainer import cuda
from chainer import functions
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.models.gwm.gwm import GWM, WarpGateUnit, SuperNodeTransmitterUnit, GraphTransmitterUnit # NOQA
from chainer_chemistry.utils.permutation import permute_node
atom_size = 5
hidden_dim = 4
supernode_dim = 7
batch_size = 2
num_edge_type = 2
@pytest.fixture
def graph_warp_gate_unit():
return WarpGateUnit(output_type='graph', hidden_dim=hidden_dim)
@pytest.fixture
def super_warp_gate_unit():
return WarpGateUnit(output_type='super', hidden_dim=supernode_dim)
@pytest.fixture
def super_node_transmitter_unit():
return SuperNodeTransmitterUnit(hidden_dim_super=supernode_dim,
hidden_dim=hidden_dim)
@pytest.fixture
def graph_transmitter_unit():
return GraphTransmitterUnit(hidden_dim_super=supernode_dim,
hidden_dim=hidden_dim)
@pytest.fixture
def gwm():
# relu is difficult to test
return GWM(hidden_dim=hidden_dim, hidden_dim_super=supernode_dim,
n_layers=2, activation=functions.identity,
wgu_activation=functions.identity,
gtu_activation=functions.identity)
@pytest.fixture
def data():
numpy.random.seed(0)
# too difficult to pass unit test by using EmbedAtomID
embed_atom_data = numpy.random.uniform(
-0.01, 0.01, (batch_size, atom_size, hidden_dim)).astype('f')
new_embed_atom_data = numpy.random.uniform(
-0.01, 0.01, (batch_size, atom_size, hidden_dim)).astype('f')
y_grad = numpy.random.uniform(
-0.01, 0.01, (batch_size, atom_size, hidden_dim)).astype('f')
supernode = numpy.random.uniform(
-0.01, 0.01, (batch_size, supernode_dim)).astype('f')
supernode_grad = numpy.random.uniform(
-0.01, 0.01, (batch_size, supernode_dim)).astype('f')
return embed_atom_data, new_embed_atom_data, supernode, y_grad,\
supernode_grad
def test_graph_transmitter_unit_forward(graph_transmitter_unit, data):
embed_atom_data = data[0]
supernode = data[2]
h_trans = graph_transmitter_unit(embed_atom_data, supernode)
assert h_trans.array.shape == (batch_size, supernode_dim)
def test_graph_transmitter_unit_backward(graph_transmitter_unit, data):
embed_atom_data = data[0]
supernode = data[2]
supernode_grad = data[4]
gradient_check.check_backward(graph_transmitter_unit,
(embed_atom_data, supernode),
supernode_grad, eps=0.1)
def test_super_node_transmitter_unit_forward(super_node_transmitter_unit,
data):
supernode = data[2]
g_trans = super_node_transmitter_unit(supernode, atom_size)
assert g_trans.array.shape == (batch_size, atom_size, hidden_dim)
def test_super_node_transmitter_unit_backward(super_node_transmitter_unit,
data):
supernode = data[2]
y_grad = data[3]
gradient_check.check_backward(
lambda x: super_node_transmitter_unit(x, atom_size), supernode, y_grad)
def test_graph_warp_gate_unit_forward(graph_warp_gate_unit, data):
embed_atom_data = data[0]
new_embed_atom_data = data[1]
merged = graph_warp_gate_unit(embed_atom_data, new_embed_atom_data)
assert merged.array.shape == (batch_size, atom_size, hidden_dim)
def test_graph_warp_gate_unit_backward(graph_warp_gate_unit, data):
embed_atom_data = data[0]
new_embed_atom_data = data[1]
y_grad = data[3]
gradient_check.check_backward(graph_warp_gate_unit,
(embed_atom_data, new_embed_atom_data),
y_grad, eps=0.01)
def test_super_warp_gate_unit_forward(super_warp_gate_unit, data):
supernode = data[2]
merged = super_warp_gate_unit(supernode, supernode)
assert merged.array.shape == (batch_size, supernode_dim)
def test_super_warp_gate_unit_backward(super_warp_gate_unit, data):
supernode = data[2]
supernode_grad = data[4]
gradient_check.check_backward(super_warp_gate_unit,
(supernode, supernode),
supernode_grad, eps=0.01)
def check_forward(gwm, embed_atom_data, new_embed_atom_data, supernode):
gwm.reset_state()
h_actual, g_actual = gwm(embed_atom_data, new_embed_atom_data, supernode)
assert h_actual.array.shape == (batch_size, atom_size, hidden_dim)
assert g_actual.array.shape == (batch_size, supernode_dim)
def test_forward_cpu(gwm, data):
embed_atom_data, new_embed_atom_data, supernode = data[:3]
check_forward(gwm, embed_atom_data, new_embed_atom_data, supernode)
@pytest.mark.gpu
def test_forward_gpu(gwm, data):
embed_atom_data, new_embed_atom_data, supernode = data[:3]
embed_atom_data = cuda.to_gpu(embed_atom_data)
new_embed_atom_data = cuda.to_gpu(new_embed_atom_data)
supernode = cuda.to_gpu(supernode)
gwm.to_gpu()
check_forward(gwm, embed_atom_data, new_embed_atom_data, supernode)
def check_backward(gwm, embed_atom_data, new_embed_atom_data, supernode,
y_grad, supernode_grad):
gwm.reset_state()
# TODO(nakago): rtol is too high! GWM is too large to calculate
# numerical differentiation
gradient_check.check_backward(gwm, (embed_atom_data, new_embed_atom_data,
supernode), (y_grad, supernode_grad),
eps=0.1, rtol=1e1)
def test_backward_cpu(gwm, data):
check_backward(gwm, *data)
@pytest.mark.gpu
def test_backward_gpu(gwm, data):
gwm.to_gpu()
check_backward(gwm, *map(cuda.to_gpu, data))
def test_forward_cpu_graph_invariant(gwm, data):
permutation_index = numpy.random.permutation(atom_size)
gwm.reset_state()
embed_atom_data, new_embed_atom_data, supernode = data[:3]
h_actual, g_actual = gwm(embed_atom_data, new_embed_atom_data, supernode)
permute_embed_atom_data = permute_node(
embed_atom_data, permutation_index, axis=1)
permute_new_embed_atom_data = permute_node(
new_embed_atom_data, permutation_index, axis=1)
gwm.reset_state()
permute_h_actual, permute_g_actual = gwm(
permute_embed_atom_data, permute_new_embed_atom_data, supernode)
numpy.testing.assert_allclose(
permute_node(h_actual.data, permutation_index, axis=1),
permute_h_actual.data, rtol=1e-5, atol=1e-5)
numpy.testing.assert_allclose(g_actual.data, permute_g_actual.data,
rtol=1e-5, atol=1e-5)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/models_tests/gwm_tests/test_gwm_graph_conv_model.py
================================================
import itertools
import numpy
import pytest
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links.readout.general_readout import GeneralReadout
from chainer_chemistry.links.readout.ggnn_readout import GGNNReadout
from chainer_chemistry.links.readout.nfp_readout import NFPReadout
from chainer_chemistry.links.readout.schnet_readout import SchNetReadout
from chainer_chemistry.links.update.ggnn_update import GGNNUpdate
from chainer_chemistry.links.update.gin_update import GINUpdate
from chainer_chemistry.links.update.relgat_update import RelGATUpdate
from chainer_chemistry.links.update.relgcn_update import RelGCNUpdate
from chainer_chemistry.links.update.rsgcn_update import RSGCNUpdate
from chainer_chemistry.models.gwm.gwm_graph_conv_model import GWMGraphConvModel
atom_size = 5
super_dim = 7
in_channels = 6
out_dim = 4
batch_size = 2
n_edge_types = 3
# TODO(nakago): SchNetUpdate need `in_channels` kwargs, not supported.
updates_2dim = [GINUpdate, RSGCNUpdate]
# TODO(nakago): Support MPNNUpdate.
updates_3dim = [GGNNUpdate, RelGATUpdate, RelGCNUpdate]
updates = updates_2dim + updates_3dim
# TODO(nakago): MPNNReadout need to specify `in_channels` and not supported.
readouts = [GGNNReadout, NFPReadout, SchNetReadout]
hidden_channels = [[6, 6, 6, 6], 6]
use_bn = [True, False]
use_weight_tying = [True, False]
params = list(itertools.product(
updates, readouts, hidden_channels, use_bn, use_weight_tying,
))
@pytest.fixture(params=params)
def plain_context(request):
update, readout, ch, bn, wt = request.param
if update in updates_3dim:
adj_type = 3
elif update in updates_2dim:
adj_type = 2
else:
raise ValueError
data = make_data(adj_type)
model = make_model(update, readout, ch, bn, wt)
return model, data
@pytest.fixture(params=params)
def gwm_context(request):
update, readout, ch, bn, wt = request.param
if update in updates_3dim:
adj_type = 3
elif update in updates_2dim:
adj_type = 2
else:
raise ValueError
data = make_data(adj_type)
model = make_gwm_model(update, readout, ch, bn, wt)
return model, data
def make_model(update, readout, ch, bn, wt):
# print('update', update, 'readout', readout, 'ch', ch, 'bn', bn, 'wt', wt)
return GWMGraphConvModel(
update_layer=update, readout_layer=readout, n_update_layers=3,
hidden_channels=ch, n_edge_types=n_edge_types, weight_tying=wt,
out_dim=out_dim, with_gwm=False, use_batchnorm=bn)
def make_gwm_model(update, readout, ch, bn, wt):
return GWMGraphConvModel(
update_layer=update, readout_layer=readout, n_update_layers=3,
hidden_channels=ch, n_edge_types=n_edge_types, weight_tying=wt,
super_node_dim=super_dim, out_dim=out_dim, with_gwm=True,
use_batchnorm=bn)
def make_data(adj_type):
numpy.random.seed(0)
atom_data = numpy.random.randint(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size)
).astype(numpy.int32)
if adj_type == 2:
adj_data = numpy.random.randint(
0, high=2, size=(batch_size, atom_size, atom_size)
).astype(numpy.float32)
elif adj_type == 3:
adj_data = numpy.random.randint(
0, high=2, size=(batch_size, n_edge_types, atom_size, atom_size)
).astype(numpy.float32)
else:
raise ValueError
super_data = numpy.random.uniform(-1, 1, (batch_size, super_dim)
).astype(numpy.float32)
y_grad = numpy.random.uniform(
-1, 1, (batch_size, out_dim)).astype(numpy.float32)
return atom_data, adj_data, super_data, y_grad
def test_plain_model_forward(plain_context):
model, data = plain_context
atom_array = data[0]
adj = data[1]
y_actual = model(atom_array, adj)
assert y_actual.shape == (batch_size, out_dim)
if model.weight_tying:
assert len(model.update_layers) == 1
else:
assert len(model.update_layers) == 3
def test_gwm_model_forward(gwm_context):
model, data = gwm_context
atom_array = data[0]
adj = data[1]
super_node = data[2]
y_actual = model(atom_array, adj, super_node)
assert y_actual.shape == (batch_size, out_dim)
if model.weight_tying:
assert len(model.update_layers) == 1
else:
assert len(model.update_layers) == 3
# SchNet is not supported
sp_params = list(itertools.product(
updates_2dim[:-1] + updates_3dim,
[[6, 6, 6, 6], [4, 4, 4, 4], [6, 5, 3, 4]],
))
@pytest.mark.parametrize(('update', 'ch'), sp_params)
def test_plain_model_forward_general_readout(
update, ch):
if update in updates_3dim:
adj_type = 3
elif update in updates_2dim:
adj_type = 2
else:
raise ValueError
data = make_data(adj_type)
model = GWMGraphConvModel(update_layer=update,
readout_layer=GeneralReadout,
hidden_channels=ch,
out_dim=out_dim,
n_edge_types=n_edge_types,
with_gwm=False)
atom_array = data[0]
adj = data[1]
y_actual = model(atom_array, adj)
assert y_actual.shape == (batch_size, out_dim)
@pytest.mark.parametrize('update',
updates_2dim[:-1] + updates_3dim)
def test_gwm_model_forward_general_readout(update):
if update in updates_3dim:
adj_type = 3
elif update in updates_2dim:
adj_type = 2
else:
raise ValueError
data = make_data(adj_type)
ch = [6, 6, 6, 6]
with pytest.raises(ValueError):
model = GWMGraphConvModel(update_layer=update,
readout_layer=GeneralReadout,
hidden_channels=ch,
out_dim=out_dim,
n_edge_types=n_edge_types,
super_node_dim=super_dim,
with_gwm=True)
ch = [4, 4, 4, 4]
model = GWMGraphConvModel(update_layer=update,
readout_layer=GeneralReadout,
hidden_channels=ch,
out_dim=out_dim,
n_edge_types=n_edge_types,
super_node_dim=super_dim,
with_gwm=True)
atom_array = data[0]
adj = data[1]
super_node = data[2]
y_actual = model(atom_array, adj, super_node)
assert y_actual.shape == (batch_size, out_dim)
p = list(itertools.product(updates_2dim[:-1] + updates_3dim, readouts,
[True, False]))
@pytest.mark.parametrize(('update', 'readout', 'gwm'), p)
def test_model_forward_general_weight_tying(update, readout, gwm):
if update in updates_3dim:
adj_type = 3
elif update in updates_2dim:
adj_type = 2
else:
raise ValueError
data = make_data(adj_type)
ch = [6, 7, 8, 6]
if gwm:
with pytest.raises(ValueError):
model = GWMGraphConvModel(update_layer=update,
readout_layer=GeneralReadout,
hidden_channels=ch,
out_dim=out_dim,
n_edge_types=n_edge_types,
super_node_dim=super_dim,
with_gwm=gwm)
else:
model = GWMGraphConvModel(update_layer=update,
readout_layer=GeneralReadout,
hidden_channels=ch,
out_dim=out_dim,
n_edge_types=n_edge_types,
super_node_dim=super_dim,
with_gwm=gwm)
atom_array = data[0]
adj = data[1]
super_node = data[2] # NOQA
y_actual = model(atom_array, adj)
assert y_actual.shape == (batch_size, out_dim)
@pytest.mark.parametrize(('update', 'readout', 'gwm'), p)
def test_model_forward_general_concat_hidden(update, readout, gwm):
if update in updates_3dim:
adj_type = 3
elif update in updates_2dim:
adj_type = 2
else:
raise ValueError
data = make_data(adj_type)
ch = [6, 6, 6, 6]
model = GWMGraphConvModel(update_layer=update,
readout_layer=readout,
hidden_channels=ch,
out_dim=out_dim,
n_edge_types=n_edge_types,
super_node_dim=super_dim,
concat_hidden=True,
with_gwm=gwm)
atom_array = data[0]
adj = data[1]
super_node = data[2]
y_actual = model(atom_array, adj, super_node)
assert y_actual.shape == (batch_size, out_dim * (len(ch) - 1))
@pytest.mark.parametrize(('update', 'readout', 'gwm'), p)
def test_model_forward_general_sum_hidden(update, readout, gwm):
if update in updates_3dim:
adj_type = 3
elif update in updates_2dim:
adj_type = 2
else:
raise ValueError
data = make_data(adj_type)
ch = [6, 6, 6, 6]
model = GWMGraphConvModel(update_layer=update,
readout_layer=readout,
hidden_channels=ch,
out_dim=out_dim,
n_edge_types=n_edge_types,
super_node_dim=super_dim,
sum_hidden=True,
with_gwm=gwm)
atom_array = data[0]
adj = data[1]
super_node = data[2]
y_actual = model(atom_array, adj, super_node)
assert y_actual.shape == (batch_size, out_dim)
if __name__ == '__main__':
# -x is to stop when first failed.
pytest.main([__file__, '-v', '-s', '-x'])
================================================
FILE: tests/models_tests/prediction_tests/test_base.py
================================================
import os
import chainer
from chainer import cuda
import numpy
import pytest
from chainer_chemistry.models.prediction.base import BaseForwardModel
class DummyForwardModel(BaseForwardModel):
def __init__(self, device=-1, dummy_str='dummy'):
super(DummyForwardModel, self).__init__()
with self.init_scope():
self.l = chainer.links.Linear(3, 10)
self.dummy_str = dummy_str
self.initialize(device)
def __call__(self, x):
return self.l(x)
# test `_forward` is done by `Classifier` and `Regressor` concrete class.
def _test_save_load_pickle(device, tmpdir):
model = DummyForwardModel(device=device, dummy_str='hoge')
filepath = os.path.join(str(tmpdir), 'model.pkl')
model.save_pickle(filepath)
model_load = DummyForwardModel.load_pickle(filepath, device=device)
# --- check model class ---
assert isinstance(model_load, DummyForwardModel)
# --- check model attribute is same ---
assert model_load.dummy_str == model.dummy_str
assert model_load.dummy_str == 'hoge'
assert model_load.device == chainer.get_device(device)
# --- check model parameter is same ---
params = model.namedparams()
params_load = dict(model_load.namedparams())
for k, v in params:
v_load = params_load[k]
assert cuda.get_device_from_array(v_load.data).id == device
assert numpy.allclose(cuda.to_cpu(v.data), cuda.to_cpu(v_load.data))
def test_save_load_pickle_cpu(tmpdir):
_test_save_load_pickle(device=-1, tmpdir=tmpdir)
@pytest.mark.gpu
def test_save_load_pickle_gpu(tmpdir):
_test_save_load_pickle(device=0, tmpdir=tmpdir)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/models_tests/prediction_tests/test_classifier.py
================================================
import mock
import numpy
import pytest
import chainer
from chainer import cuda
from chainer import functions
from chainer import links
from chainer import reporter
from chainer_chemistry.models.prediction.classifier import Classifier
# testing.parameterize takes a list of dictionaries.
# Currently, we cannot set a function to the value of the dictionaries.
# As a workaround, we wrap the function and invoke it in __call__ method.
# See issue #1337 for detail.
class AccuracyWithIgnoreLabel(object):
def __call__(self, y, t):
return functions.accuracy(y, t, ignore_label=1)
class DummyPredictor(chainer.Chain):
def __call__(self, x):
return x
@pytest.mark.parametrize(
'metrics_fun', [AccuracyWithIgnoreLabel(), None,
{'user_key': AccuracyWithIgnoreLabel()}])
@pytest.mark.parametrize('compute_metrics', [True, False])
class TestClassifier(object):
def setup_method(self, method):
self.x = numpy.random.uniform(-1, 1, (5, 10)).astype(numpy.float32)
self.t = numpy.random.randint(3, size=5).astype(numpy.int32)
self.y = numpy.random.uniform(-1, 1, (5, 7)).astype(numpy.float32)
def check_call(
self, gpu, label_key, args, kwargs, model_args, model_kwargs,
metrics_fun, compute_metrics):
init_kwargs = {'label_key': label_key}
if metrics_fun is not None:
init_kwargs['metrics_fun'] = metrics_fun
link = Classifier(chainer.Link(), **init_kwargs)
if gpu:
xp = cuda.cupy
link.to_gpu()
else:
xp = numpy
link.compute_metrics = compute_metrics
y = chainer.Variable(self.y)
link.predictor = mock.MagicMock(return_value=y)
loss = link(*args, **kwargs)
link.predictor.assert_called_with(*model_args, **model_kwargs)
assert hasattr(link, 'y')
assert link.y is not None
assert hasattr(link, 'loss')
xp.testing.assert_allclose(link.loss.data, loss.data)
assert hasattr(link, 'metrics')
if compute_metrics:
assert link.metrics is not None
else:
assert link.metrics is None
def test_call_cpu(self, metrics_fun, compute_metrics):
self.check_call(
False, -1, (self.x, self.t), {}, (self.x,), {},
metrics_fun, compute_metrics)
def test_call_three_args_cpu(self, metrics_fun, compute_metrics):
self.check_call(
False, -1, (self.x, self.x, self.t), {}, (self.x, self.x), {},
metrics_fun, compute_metrics)
def test_call_positive_cpu(self, metrics_fun, compute_metrics):
self.check_call(
False, 2, (self.x, self.x, self.t), {}, (self.x, self.x), {},
metrics_fun, compute_metrics)
def test_call_kwargs_cpu(self, metrics_fun, compute_metrics):
self.check_call(
False, 't', (self.x,), {'t': self.t}, (self.x,), {},
metrics_fun, compute_metrics)
def test_call_no_arg_cpu(self, metrics_fun, compute_metrics):
self.check_call(
False, 0, (self.t,), {}, (), {},
metrics_fun, compute_metrics)
@pytest.mark.gpu
def test_call_gpu(self, metrics_fun, compute_metrics):
self.to_gpu()
self.check_call(
True, -1, (self.x, self.t), {}, (self.x,), {},
metrics_fun, compute_metrics)
@pytest.mark.gpu
def test_call_three_args_gpu(self, metrics_fun, compute_metrics):
self.to_gpu()
self.check_call(
True, -1, (self.x, self.x, self.t), {}, (self.x, self.x), {},
metrics_fun, compute_metrics)
@pytest.mark.gpu
def test_call_positive_gpu(self, metrics_fun, compute_metrics):
self.to_gpu()
self.check_call(
True, 2, (self.x, self.x, self.t), {}, (self.x, self.x), {},
metrics_fun, compute_metrics)
@pytest.mark.gpu
def test_call_kwargs_gpu(self, metrics_fun, compute_metrics):
self.to_gpu()
self.check_call(
True, 't', (self.x,), {'t': self.t}, (self.x,), {},
metrics_fun, compute_metrics)
@pytest.mark.gpu
def test_call_no_arg_gpu(self, metrics_fun, compute_metrics):
self.to_gpu()
self.check_call(
True, 0, (self.t,), {}, (), {}, metrics_fun, compute_metrics)
def to_gpu(self):
self.x = cuda.to_gpu(self.x)
self.t = cuda.to_gpu(self.t)
self.y = cuda.to_gpu(self.y)
def test_report_key(self, metrics_fun, compute_metrics):
repo = chainer.Reporter()
link = Classifier(predictor=DummyPredictor(),
metrics_fun=metrics_fun)
link.compute_metrics = compute_metrics
repo.add_observer('target', link)
with repo:
observation = {}
with reporter.report_scope(observation):
link(self.x, self.t)
# print('observation ', observation)
actual_keys = set(observation.keys())
if compute_metrics:
if metrics_fun is None:
assert set(['target/loss']) == actual_keys
elif isinstance(metrics_fun, dict):
assert set(['target/loss', 'target/user_key']) == actual_keys
elif callable(metrics_fun):
assert set(['target/loss', 'target/accuracy']) == actual_keys
else:
raise TypeError()
else:
assert set(['target/loss']) == actual_keys
class TestInvalidArgument(object):
@classmethod
def setup_class(cls):
cls.link = Classifier(links.Linear(10, 3))
cls.x = numpy.random.uniform(-1, 1, (5, 10)).astype(numpy.float32)
def check_invalid_argument(self):
x = chainer.Variable(self.link.xp.asarray(self.x))
with pytest.raises(TypeError):
# link.__call__ raises TypeError as the number of arguments
# is illegal
self.link(x)
def test_invalid_argument_cpu(self):
self.check_invalid_argument()
@pytest.mark.gpu
def test_invalid_argument_gpu(self):
self.link.to_gpu()
self.check_invalid_argument()
class TestInvalidLabelKey(object):
@classmethod
def setup_class(cls):
cls.x = numpy.random.uniform(-1, 1, (5, 10)).astype(numpy.float32)
def test_invalid_label_key_type(self):
with pytest.raises(TypeError):
Classifier(links.Linear(10, 3), label_key=None)
def check_invalid_key(self, gpu, label_key):
link = Classifier(links.Linear(10, 3), label_key=label_key)
if gpu:
link.to_gpu()
x = chainer.Variable(link.xp.asarray(self.x))
with pytest.raises(ValueError):
link(x)
def test_invalid_index_cpu(self):
self.check_invalid_key(False, 1)
@pytest.mark.gpu
def test_invalid_argument_gpu(self):
self.check_invalid_key(True, 1)
def test_invalid_index_too_small_cpu(self):
self.check_invalid_key(False, -2)
@pytest.mark.gpu
def test_invalid_index_too_small_gpu(self):
self.check_invalid_key(True, -2)
def test_invalid_str_key_cpu(self):
self.check_invalid_key(False, 't')
@pytest.mark.gpu
def test_invalid_str_key_gpu(self):
self.check_invalid_key(True, 't')
class TestClassifierPrediction(object):
@classmethod
def setup_class(cls):
cls.predictor = DummyPredictor()
cls.x = numpy.array([[0., 1.], [-1., -2.], [4., 0.]],
dtype=numpy.float32)
cls.t = numpy.array([1, 0, 0], dtype=numpy.int32)
def test_predict_cpu(self):
clf = Classifier(self.predictor)
actual_t = clf.predict(self.x)
assert actual_t.shape == (3,)
assert actual_t.dtype == numpy.int32
assert numpy.alltrue(actual_t == self.t)
@pytest.mark.gpu
def test_predict_gpu(self):
clf = Classifier(self.predictor, device=0)
actual_t = clf.predict(self.x)
assert numpy.alltrue(actual_t == self.t)
def check_predict_proba(self, device):
clf = Classifier(self.predictor, device=device)
actual_y = clf.predict_proba(self.x)
assert actual_y.shape == (3, 2)
assert actual_y.dtype == numpy.float32
assert numpy.alltrue(0 <= actual_y)
assert numpy.alltrue(actual_y <= 1.)
actual_t = numpy.argmax(actual_y, axis=1)
assert numpy.alltrue(actual_t == self.t)
def test_predict_proba_cpu(self):
self.check_predict_proba(-1)
@pytest.mark.gpu
def test_predict_proba_gpu(self):
self.check_predict_proba(0)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/models_tests/prediction_tests/test_graph_conv_predictor.py
================================================
from typing import Tuple # NOQA
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.models.ggnn import GGNN
from chainer_chemistry.models.mlp import MLP
from chainer_chemistry.models.prediction import GraphConvPredictor
from chainer_chemistry.utils.permutation import permute_adj
from chainer_chemistry.utils.permutation import permute_node
atom_size = 5
class_num = 7
n_unit = 11
out_dim = 4
batch_size = 2
n_edge_types = 3
@pytest.fixture
def model():
# type: () -> GraphConvPredictor
mlp = MLP(out_dim=class_num, hidden_dim=n_unit)
ggnn = GGNN(
out_dim=out_dim, hidden_channels=n_unit, n_edge_types=n_edge_types)
return GraphConvPredictor(ggnn, mlp)
@pytest.fixture
def data():
# type: () -> Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]
numpy.random.seed(0)
atom_data = numpy.random.randint(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size)).astype('i')
adj_data = numpy.random.randint(
0, high=2, size=(batch_size, n_edge_types, atom_size,
atom_size)).astype('f')
y_grad = numpy.random.uniform(-1, 1, (batch_size, class_num)).astype('f')
return atom_data, adj_data, y_grad
def check_forward(model, atom_data, adj_data):
# type: (GraphConvPredictor, numpy.ndarray, numpy.ndarray) -> None
y_actual = cuda.to_cpu(model(atom_data, adj_data).data)
assert y_actual.shape == (batch_size, class_num)
def test_forward_cpu(model, data):
# type: (GraphConvPredictor, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
check_forward(model, *data[:2])
@pytest.mark.gpu
def test_forward_gpu(model, data):
# type: (GraphConvPredictor, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data = map(cuda.to_gpu, data[:2])
model.to_gpu()
check_forward(model, atom_data, adj_data)
def test_backward_cpu(model, data):
# type: (GraphConvPredictor, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data, y_grad = data
gradient_check.check_backward(
model, (atom_data, adj_data), y_grad, atol=1e-3, rtol=1e-3)
@pytest.mark.gpu
def test_backward_gpu(model, data):
# type: (GraphConvPredictor, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data, y_grad = map(cuda.to_gpu, data)
model.to_gpu()
gradient_check.check_backward(
model, (atom_data, adj_data), y_grad, atol=1e-3, rtol=1e-3)
def test_forward_cpu_graph_invariant(model, data):
# type: (GraphConvPredictor, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data = data[:2]
y_actual = cuda.to_cpu(model(atom_data, adj_data).data)
permutation_index = numpy.random.permutation(atom_size)
permute_atom_data = permute_node(atom_data, permutation_index)
permute_adj_data = permute_adj(adj_data, permutation_index)
permute_y_actual = cuda.to_cpu(
model(permute_atom_data, permute_adj_data).data)
assert numpy.allclose(y_actual, permute_y_actual, rtol=1e-5, atol=1e-5)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s', '-x'])
================================================
FILE: tests/models_tests/prediction_tests/test_regressor.py
================================================
import mock
import numpy
import pytest
import chainer
from chainer import cuda
from chainer import links
from chainer import reporter
from chainer_chemistry.models.prediction.regressor import Regressor
class DummyPredictor(chainer.Chain):
def __call__(self, x):
return 2 * x
@pytest.mark.parametrize(
'metrics_fun', [None, chainer.functions.mean_absolute_error,
{'user_key': chainer.functions.mean_absolute_error}])
@pytest.mark.parametrize('compute_metrics', [True, False])
class TestRegressor(object):
def setup_method(self, method):
self.x = numpy.random.uniform(-1, 1, (5, 10)).astype(numpy.float32)
self.t = numpy.random.uniform(-1, 1, (5, 10)).astype(numpy.float32)
self.y = numpy.random.uniform(-1, 1, (5, 10)).astype(numpy.float32)
def check_call(
self, gpu, label_key, args, kwargs, model_args, model_kwargs,
metrics_fun, compute_metrics):
init_kwargs = {'label_key': label_key}
if metrics_fun is not None:
init_kwargs['metrics_fun'] = metrics_fun
link = Regressor(chainer.Link(), **init_kwargs)
if gpu:
xp = cuda.cupy
link.to_gpu()
else:
xp = numpy
link.compute_metrics = compute_metrics
y = chainer.Variable(self.y)
link.predictor = mock.MagicMock(return_value=y)
loss = link(*args, **kwargs)
link.predictor.assert_called_with(*model_args, **model_kwargs)
assert hasattr(link, 'y')
assert link.y is not None
assert hasattr(link, 'loss')
xp.testing.assert_allclose(link.loss.data, loss.data)
assert hasattr(link, 'metrics')
if compute_metrics:
assert link.metrics is not None
else:
assert link.metrics is None
def test_call_cpu(self, metrics_fun, compute_metrics):
self.check_call(
False, -1, (self.x, self.t), {}, (self.x,), {},
metrics_fun, compute_metrics)
def test_call_three_args_cpu(self, metrics_fun, compute_metrics):
self.check_call(
False, -1, (self.x, self.x, self.t), {}, (self.x, self.x), {},
metrics_fun, compute_metrics)
def test_call_positive_cpu(self, metrics_fun, compute_metrics):
self.check_call(
False, 2, (self.x, self.x, self.t), {}, (self.x, self.x), {},
metrics_fun, compute_metrics)
def test_call_kwargs_cpu(self, metrics_fun, compute_metrics):
self.check_call(
False, 't', (self.x,), {'t': self.t}, (self.x,), {},
metrics_fun, compute_metrics)
def test_call_no_arg_cpu(self, metrics_fun, compute_metrics):
self.check_call(
False, 0, (self.t,), {}, (), {},
metrics_fun, compute_metrics)
@pytest.mark.gpu
def test_call_gpu(self, metrics_fun, compute_metrics):
self.to_gpu()
self.check_call(
True, -1, (self.x, self.t), {}, (self.x,), {},
metrics_fun, compute_metrics)
@pytest.mark.gpu
def test_call_three_args_gpu(self, metrics_fun, compute_metrics):
self.to_gpu()
self.check_call(
True, -1, (self.x, self.x, self.t), {}, (self.x, self.x), {},
metrics_fun, compute_metrics)
@pytest.mark.gpu
def test_call_positive_gpu(self, metrics_fun, compute_metrics):
self.to_gpu()
self.check_call(
True, 2, (self.x, self.x, self.t), {}, (self.x, self.x), {},
metrics_fun, compute_metrics)
@pytest.mark.gpu
def test_call_kwargs_gpu(self, metrics_fun, compute_metrics):
self.to_gpu()
self.check_call(
True, 't', (self.x,), {'t': self.t}, (self.x,), {},
metrics_fun, compute_metrics)
@pytest.mark.gpu
def test_call_no_arg_gpu(self, metrics_fun, compute_metrics):
self.to_gpu()
self.check_call(
True, 0, (self.t,), {}, (), {}, metrics_fun, compute_metrics)
def to_gpu(self):
self.x = cuda.to_gpu(self.x)
self.t = cuda.to_gpu(self.t)
self.y = cuda.to_gpu(self.y)
def test_report_key(self, metrics_fun, compute_metrics):
repo = chainer.Reporter()
link = Regressor(predictor=DummyPredictor(),
metrics_fun=metrics_fun)
link.compute_metrics = compute_metrics
repo.add_observer('target', link)
with repo:
observation = {}
with reporter.report_scope(observation):
link(self.x, self.t)
# print('observation ', observation)
actual_keys = set(observation.keys())
if compute_metrics:
if metrics_fun is None:
assert set(['target/loss']) == actual_keys
elif isinstance(metrics_fun, dict):
assert set(['target/loss', 'target/user_key']) == actual_keys
elif callable(metrics_fun):
assert set(['target/loss', 'target/metrics']) == actual_keys
else:
raise TypeError()
else:
assert set(['target/loss']) == actual_keys
class TestInvalidArgument(object):
@classmethod
def setup_class(cls):
cls.link = Regressor(links.Linear(10, 3))
cls.x = numpy.random.uniform(-1, 1, (5, 10)).astype(numpy.float32)
def check_invalid_argument(self):
x = chainer.Variable(self.link.xp.asarray(self.x))
with pytest.raises(TypeError):
# link.__call__ raises TypeError as the number of arguments
# is illegal
self.link(x)
def test_invalid_argument_cpu(self):
self.check_invalid_argument()
@pytest.mark.gpu
def test_invalid_argument_gpu(self):
self.link.to_gpu()
self.check_invalid_argument()
class TestInvalidLabelKey(object):
@classmethod
def setup_class(cls):
cls.x = numpy.random.uniform(-1, 1, (5, 10)).astype(numpy.float32)
def test_invalid_label_key_type(self):
with pytest.raises(TypeError):
Regressor(links.Linear(10, 3), label_key=None)
def check_invalid_key(self, gpu, label_key):
link = Regressor(links.Linear(10, 3), label_key=label_key)
if gpu:
link.to_gpu()
x = chainer.Variable(link.xp.asarray(self.x))
with pytest.raises(ValueError):
link(x)
def test_invalid_index_cpu(self):
self.check_invalid_key(False, 1)
@pytest.mark.gpu
def test_invalid_argument_gpu(self):
self.check_invalid_key(True, 1)
def test_invalid_index_too_small_cpu(self):
self.check_invalid_key(False, -2)
@pytest.mark.gpu
def test_invalid_index_too_small_gpu(self):
self.check_invalid_key(True, -2)
def test_invalid_str_key_cpu(self):
self.check_invalid_key(False, 't')
@pytest.mark.gpu
def test_invalid_str_key_gpu(self):
self.check_invalid_key(True, 't')
class TestRegressorPrediction(object):
@classmethod
def setup_class(cls):
cls.predictor = DummyPredictor()
cls.x = numpy.array([[0., 1.], [-1., -2.], [4., 0.]],
dtype=numpy.float32)
cls.t = cls.x * 2
def test_predict_cpu(self):
clf = Regressor(self.predictor)
actual_t = clf.predict(self.x)
assert actual_t.shape == (3, 2)
assert actual_t.dtype == numpy.float32
assert numpy.alltrue(actual_t == self.t)
@pytest.mark.gpu
def test_predict_gpu(self):
clf = Regressor(self.predictor, device=0)
actual_t = clf.predict(self.x)
assert numpy.alltrue(actual_t == self.t)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/models_tests/prediction_tests/test_set_up_predictor.py
================================================
from typing import Dict # NOQA
import chainer # NOQA
import pytest
from chainer_chemistry.models.ggnn import GGNN
from chainer_chemistry.models.gin import GIN
from chainer_chemistry.models.gnn_film import GNNFiLM
from chainer_chemistry.models.nfp import NFP
from chainer_chemistry.models.prediction.graph_conv_predictor import GraphConvPredictor # NOQA
from chainer_chemistry.models.prediction.set_up_predictor import set_up_predictor # NOQA
from chainer_chemistry.models.relgat import RelGAT
from chainer_chemistry.models.relgcn import RelGCN
from chainer_chemistry.models.rsgcn import RSGCN
from chainer_chemistry.models.schnet import SchNet
from chainer_chemistry.models.weavenet import WeaveNet
from chainer_chemistry.models.gwm.gwm_net import GGNN_GWM # NOQA
from chainer_chemistry.models.gwm.gwm_net import GIN_GWM # NOQA
from chainer_chemistry.models.gwm.gwm_net import NFP_GWM # NOQA
from chainer_chemistry.models.gwm.gwm_net import RSGCN_GWM # NOQA
from chainer_chemistry.models.cwle.cwle_net import GGNN_CWLE # NOQA
from chainer_chemistry.models.cwle.cwle_net import RelGAT_CWLE # NOQA
from chainer_chemistry.models.cwle.cwle_net import RelGCN_CWLE # NOQA
from chainer_chemistry.models.cwle.cwle_net import GIN_CWLE # NOQA
from chainer_chemistry.models.cwle.cwle_net import NFP_CWLE # NOQA
from chainer_chemistry.models.cwle.cwle_net import RSGCN_CWLE # NOQA
from chainer_chemistry.models.gwle.gwle_net import GGNN_GWLE # NOQA
from chainer_chemistry.models.gwle.gwle_net import RelGAT_GWLE # NOQA
from chainer_chemistry.models.gwle.gwle_net import RelGCN_GWLE # NOQA
from chainer_chemistry.models.gwle.gwle_net import GIN_GWLE # NOQA
from chainer_chemistry.models.gwle.gwle_net import NFP_GWLE # NOQA
from chainer_chemistry.models.gwle.gwle_net import RSGCN_GWLE # NOQA
class_num = 7
n_unit = 11
conv_layers = 3
@pytest.fixture
def models_dict():
# type: () -> Dict[str, chainer.Link]
return {
'nfp': NFP,
'ggnn': GGNN,
'schnet': SchNet,
'weavenet': WeaveNet,
'rsgcn': RSGCN,
'relgcn': RelGCN,
'relgat': RelGAT,
'gin': GIN,
'nfp_gwm': NFP_GWM,
'ggnn_gwm': GGNN_GWM,
'rsgcn_gwm': RSGCN_GWM,
'gin_gwm': GIN_GWM,
'gnnfilm': GNNFiLM,
'nfp_wle': NFP,
'ggnn_wle': GGNN,
'relgat_wle': RelGAT,
'relgcn_wle': RelGCN,
'rsgcn_wle': RSGCN,
'gin_wle': GIN,
'nfp_cwle': NFP_CWLE,
'ggnn_cwle': GGNN_CWLE,
'relgat_cwle': RelGAT_CWLE,
'relgcn_cwle': RelGCN_CWLE,
'rsgcn_cwle': RSGCN_CWLE,
'gin_cwle': GIN_CWLE,
'nfp_gwle': NFP_GWLE,
'ggnn_gwle': GGNN_GWLE,
'relgat_gwle': RelGAT_GWLE,
'relgcn_gwle': RelGCN_GWLE,
'rsgcn_gwle': RSGCN_GWLE,
'gin_gwle': GIN_GWLE
}
def test_setup_predictor(models_dict):
# type: (Dict[str, chainer.Link]) -> None
for method, instance in models_dict.items():
predictor = set_up_predictor(
method=method,
n_unit=n_unit,
conv_layers=conv_layers,
class_num=class_num)
assert isinstance(predictor.graph_conv, instance)
assert isinstance(predictor, GraphConvPredictor)
def test_call_invalid_model():
# type: () -> None
with pytest.raises(ValueError):
set_up_predictor(
method='invalid',
n_unit=n_unit,
conv_layers=conv_layers,
class_num=class_num)
def test_set_up_predictor_with_conv_kwargs():
# type: () -> None
predictor = set_up_predictor(
method='nfp',
n_unit=n_unit,
conv_layers=conv_layers,
class_num=class_num,
conv_kwargs={
'max_degree': 4,
'concat_hidden': True
})
assert predictor.graph_conv.max_degree == 4
assert predictor.graph_conv.concat_hidden is True
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/models_tests/test_cgcnn.py
================================================
from chainer import cuda
import numpy
import pytest
from chainer_chemistry.models.cgcnn import CGCNN
# node_size_list means the first moleculae has three nodes,
# and the seconde molecule has five nodes
node_size_list = [3, 5]
max_num_nbr = 6
node_feature_dim = 5
edge_feature_dim = 10
out_dim = 4
batch_size = 2
@pytest.fixture
def model():
return CGCNN(out_dim=out_dim)
@pytest.fixture
def data():
if len(node_size_list) != batch_size:
raise ValueError("Invalid fixture data for CGCNN")
numpy.random.seed(0)
total_node_size = sum(node_size_list)
# one-hot vector
atom_feat = numpy.random.choice(
[0, 1], (total_node_size, node_feature_dim)).astype(numpy.float32)
nbr_feat = numpy.random.rand(total_node_size, max_num_nbr,
edge_feature_dim).astype(numpy.float32)
# atom_idx & nbr_idx
curr_idx = 0
atom_idx = []
nbr_idx = []
for val in node_size_list:
atom_idx.append(numpy.arange(curr_idx, val))
for _ in range(val):
max_val = curr_idx + val
nbr_idx.append(numpy.random.randint(curr_idx,
max_val, max_num_nbr))
curr_idx += val
atom_idx = numpy.asarray(atom_idx)
nbr_idx = numpy.array(nbr_idx, dtype=numpy.int32)
y_grad = numpy.random.uniform(-1, 1,
(batch_size, out_dim)).astype(numpy.float32)
return atom_feat, nbr_feat, atom_idx, nbr_idx, y_grad
def check_forward(model, data):
y_actual = cuda.to_cpu(model(*data).data)
assert y_actual.shape == (batch_size, out_dim)
def test_forward_cpu(model, data):
atom_feat, nbr_feat, atom_idx, nbr_idx = data[:-1]
check_forward(model, (atom_feat, nbr_feat, atom_idx, nbr_idx))
@pytest.mark.gpu
def test_forward_gpu(model, data):
atom_feat, nbr_feat, atom_idx, nbr_idx = data[:-1]
# atom_idx is list format... use numpy array
input_data = (cuda.to_gpu(atom_feat), cuda.to_gpu(nbr_feat),
atom_idx, cuda.to_gpu(nbr_idx))
model.to_gpu()
check_forward(model, tuple(input_data))
# def test_backward_cpu(model, data):
# input_data, y_grad = data[0:-1], data[-1]
# gradient_check.check_backward(model, tuple(input_data), y_grad,
# atol=5e-1, rtol=1e-1)
# @pytest.mark.gpu
# def test_backward_gpu(model, data):
# atom_data, adj_data, y_grad = [cuda.to_gpu(d) for d in data]
# model.to_gpu()
# gradient_check.check_backward(model, (atom_data, adj_data), y_grad,
# atol=5e-1, rtol=1e-1)
if __name__ == '__main__':
pytest.main([__file__, '-v'])
================================================
FILE: tests/models_tests/test_ggnn.py
================================================
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.models.ggnn import GGNN
from chainer_chemistry.models.ggnn import SparseGGNN
from chainer_chemistry.utils.extend import extend_node, extend_adj # NOQA
from chainer_chemistry.utils.permutation import permute_adj
from chainer_chemistry.utils.permutation import permute_node
from chainer_chemistry.utils.sparse_utils import _convert_to_sparse
from chainer_chemistry.utils.sparse_utils import sparse_utils_available
atom_size = 5
out_dim = 4
batch_size = 2
n_edge_types = 3
@pytest.fixture
def model():
numpy.random.seed(0)
return GGNN(out_dim=out_dim, n_edge_types=n_edge_types)
@pytest.fixture
def sparse_model():
numpy.random.seed(0)
return SparseGGNN(out_dim=out_dim, n_edge_types=n_edge_types)
@pytest.fixture
def data():
numpy.random.seed(0)
atom_data = numpy.random.randint(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size)
).astype(numpy.int32)
adj_data = numpy.random.randint(
0, high=2, size=(batch_size, n_edge_types, atom_size, atom_size)
).astype(numpy.float32)
y_grad = numpy.random.uniform(
-1, 1, (batch_size, out_dim)).astype(numpy.float32)
return atom_data, adj_data, y_grad
def check_forward(model, *args):
numpy.random.seed(0) # reset seed to initialize model params consistently
y_actual = cuda.to_cpu(model(*args).data)
assert y_actual.shape == (batch_size, out_dim)
return y_actual
def test_forward_cpu(model, sparse_model, data):
atom_data, adj_data = data[0], data[1]
y_dense = check_forward(model, atom_data, adj_data)
# test for sparse forward result is same with dense
if sparse_utils_available():
y_sparse = check_forward(sparse_model, atom_data,
*_convert_to_sparse(adj_data))
numpy.testing.assert_allclose(
y_dense, y_sparse, atol=1e-4, rtol=1e-4)
@pytest.mark.gpu
def test_forward_gpu(model, sparse_model, data):
atom_data, adj_data = cuda.to_gpu(data[0]), cuda.to_gpu(data[1])
model.to_gpu()
check_forward(model, atom_data, adj_data)
if sparse_utils_available():
sparse_model.to_gpu()
check_forward(sparse_model, atom_data, *_convert_to_sparse(adj_data))
def test_backward_cpu(model, data):
atom_data, adj_data, y_grad = data
gradient_check.check_backward(model, (atom_data, adj_data), y_grad,
atol=1e-3, rtol=1e-3)
# there is no backward test for sparse model, because there will be no
# gradient for input data.
@pytest.mark.gpu
def test_backward_gpu(model, data):
atom_data, adj_data, y_grad = [cuda.to_gpu(d) for d in data]
model.to_gpu()
gradient_check.check_backward(model, (atom_data, adj_data), y_grad,
atol=1e-3, rtol=1e-3)
def test_forward_cpu_graph_invariant(model, data):
atom_data, adj_data = data[0], data[1]
y_actual = cuda.to_cpu(model(atom_data, adj_data).data)
permutation_index = numpy.random.permutation(atom_size)
permute_atom_data = permute_node(atom_data, permutation_index)
permute_adj_data = permute_adj(adj_data, permutation_index)
permute_y_actual = cuda.to_cpu(model(
permute_atom_data, permute_adj_data).data)
assert numpy.allclose(y_actual, permute_y_actual, rtol=1e-5, atol=1e-6)
def test_forward_cpu_input_size_invariant(model, data):
atom_data, adj_data = data[0], data[1]
is_real_node = numpy.ones(atom_data.shape, dtype=numpy.float32)
y_actual = cuda.to_cpu(model(atom_array=atom_data, adj=adj_data,
is_real_node=is_real_node).data)
atom_data_ex = extend_node(atom_data, out_size=8)
adj_data_ex = extend_adj(adj_data, out_size=8)
is_real_node_ex = extend_node(is_real_node, out_size=8)
y_actual_ex = cuda.to_cpu(model(
atom_array=atom_data_ex, adj=adj_data_ex,
is_real_node=is_real_node_ex).data)
assert numpy.allclose(y_actual, y_actual_ex, rtol=1e-5, atol=1e-6)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/models_tests/test_gin.py
================================================
from typing import Tuple # NOQA
import chainer # NOQA
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.models.gin import GIN
from chainer_chemistry.utils.permutation import permute_adj
from chainer_chemistry.utils.permutation import permute_node
atom_size = 5
out_dim = 4
batch_size = 3
@pytest.fixture
def model():
# type: () -> GIN
return GIN(out_dim=out_dim, dropout_ratio=0)
@pytest.fixture
def data():
# type: () -> Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]
numpy.random.seed(0)
atom_data = numpy.random.randint(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size)).astype('i')
adj_data = numpy.random.randint(
0, high=2, size=(batch_size, atom_size, atom_size)).astype('f')
y_grad = numpy.random.uniform(-1, 1, (batch_size, out_dim)).astype('f')
return atom_data, adj_data, y_grad
def check_forward(model, atom_data, adj_data):
# type: (GIN, numpy.ndarray, numpy.ndarray) -> None
y_actual = cuda.to_cpu(model(atom_data, adj_data).data)
assert y_actual.shape == (batch_size, out_dim)
def test_forward_cpu(model, data):
# type: (GIN, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None
atom_data, adj_data = data[:2]
check_forward(model, atom_data, adj_data)
@pytest.mark.gpu
def test_forward_gpu(model, data):
# type: (GIN, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None
atom_data, adj_data = map(cuda.to_gpu, data[:2])
model.to_gpu()
check_forward(model, atom_data, adj_data)
def test_backward_cpu(model, data):
# type: (GIN, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None
atom_data, adj_data, y_grad = data
gradient_check.check_backward(
model, (atom_data, adj_data), y_grad, atol=1e-2, rtol=1e-2)
@pytest.mark.gpu
def test_backward_gpu(model, data):
# type: (GIN, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None
atom_data, adj_data, y_grad = map(cuda.to_gpu, data)
model.to_gpu()
gradient_check.check_backward(
model, (atom_data, adj_data), y_grad, atol=1e-2, rtol=1e-2)
def test_forward_cpu_graph_invariant(model, data):
# type: (GIN, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None
atom_data, adj_data = data[:2]
y_actual = cuda.to_cpu(model(atom_data, adj_data).data)
permutation_index = numpy.random.permutation(atom_size)
permute_atom_data = permute_node(atom_data, permutation_index)
permute_adj_data = permute_adj(adj_data, permutation_index)
permute_y_actual = cuda.to_cpu(
model(permute_atom_data, permute_adj_data).data)
numpy.testing.assert_allclose(
y_actual, permute_y_actual, rtol=1e-5, atol=1e-5)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/models_tests/test_gnn_film.py
================================================
from typing import Tuple # NOQA
import chainer # NOQA
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.models.gnn_film import GNNFiLM
from chainer_chemistry.utils.permutation import permute_adj
from chainer_chemistry.utils.permutation import permute_node
atom_size = 5
out_dim = 4
batch_size = 3
n_edge_types = 5
@pytest.fixture
def model():
# type: () -> chainer.Chain
return GNNFiLM(out_dim=out_dim)
@pytest.fixture
def data():
# type: () -> Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]
numpy.random.seed(0)
atom_data = numpy.random.randint(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size)).astype('i')
adj_data = numpy.random.randint(
0, high=2, size=(batch_size, n_edge_types, atom_size, atom_size)
).astype('f')
y_grad = numpy.random.uniform(-1, 1, (batch_size, out_dim)).astype('f')
return atom_data, adj_data, y_grad
def check_forward(model, atom_data, adj_data):
# type: (chainer.Chain, numpy.ndarray, numpy.ndarray) -> None
y_actual = cuda.to_cpu(model(atom_data, adj_data).data)
assert y_actual.shape == (batch_size, out_dim)
def test_forward_cpu(model, data):
# type: (chainer.Chain, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data = data[:2]
check_forward(model, atom_data, adj_data)
@pytest.mark.gpu
def test_forward_gpu(model, data):
# type: (chainer.Chain, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data = map(cuda.to_gpu, data[:2])
model.to_gpu()
check_forward(model, atom_data, adj_data)
def test_backward_cpu(model, data):
# type: (chainer.Chain, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data, y_grad = data
gradient_check.check_backward(
model, (atom_data, adj_data), y_grad, atol=1e-2, rtol=1e-2)
@pytest.mark.gpu
def test_backward_gpu(model, data):
# type: (chainer.Chain, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data, y_grad = map(cuda.to_gpu, data)
model.to_gpu()
gradient_check.check_backward(
model, (atom_data, adj_data), y_grad, atol=1e-2, rtol=1e-2)
def test_forward_cpu_graph_invariant(model, data):
# type: (chainer.Chain, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None # NOQA
atom_data, adj_data = data[:2]
y_actual = cuda.to_cpu(model(atom_data, adj_data).data)
permutation_index = numpy.random.permutation(atom_size)
permute_atom_data = permute_node(atom_data, permutation_index)
permute_adj_data = permute_adj(adj_data, permutation_index)
permute_y_actual = cuda.to_cpu(
model(permute_atom_data, permute_adj_data).data)
numpy.testing.assert_allclose(
y_actual, permute_y_actual, rtol=1e-5, atol=1e-5)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/models_tests/test_megnet.py
================================================
from chainer import cuda
import numpy
import pytest
from chainer_chemistry.models.megnet import MEGNet
# node_size_list means the first moleculae has six nodes,
# and the seconde molecule has four nodes
node_size_list = [6, 4]
# edge_size_list means the first moleculae has eight edges,
# and the seconde molecule has four edges
edge_size_list = [8, 4]
node_feature_dim = 5
edge_feature_dim = 10
global_feature_dim = 2
out_dim = 4
batch_size = 2
@pytest.fixture
def model():
return MEGNet(out_dim=out_dim)
@pytest.fixture
def data():
if len(node_size_list) != batch_size or len(edge_size_list) != batch_size:
raise ValueError("Invalid fixture data for MEGNet")
numpy.random.seed(0)
total_node_size = sum(node_size_list)
total_edge_size = sum(edge_size_list)
atom_feat = numpy.random.rand(total_node_size,
node_feature_dim).astype(numpy.float32)
pair_feat = numpy.random.rand(total_edge_size,
edge_feature_dim).astype(numpy.float32)
global_feat = numpy.random.rand(batch_size,
global_feature_dim).astype(numpy.float32)
# atom idx
atom_idx = numpy.hstack([[i] * node_size_list[i]
for i in range(batch_size)]).astype(numpy.int32)
# pair idx
pair_idx = numpy.hstack([[i] * edge_size_list[i]
for i in range(batch_size)]).astype(numpy.int32)
# create start and end idx
edge_idx = []
acc_node_size = [sum(node_size_list[:i+1]) for i in range(batch_size)]
low = numpy.roll(acc_node_size + [0], 1)[0:batch_size+1]
high = numpy.array(acc_node_size)
for i in range(batch_size):
idx = [numpy.random.choice(numpy.arange(low[i], high[i]), 2,
replace=False)
for _ in range(edge_size_list[i])]
edge_idx.extend(idx)
start_idx = numpy.array(edge_idx, dtype=numpy.int32)[:, 0]
end_idx = numpy.array(edge_idx, dtype=numpy.int32)[:, 1]
y_grad = numpy.random.uniform(-1, 1,
(batch_size, out_dim)).astype(numpy.float32)
return atom_feat, pair_feat, global_feat, \
atom_idx, pair_idx, start_idx, end_idx, y_grad
def check_forward(model, data):
y_actual = cuda.to_cpu(model(*data).data)
assert y_actual.shape == (batch_size, out_dim)
def test_forward_cpu(model, data):
atom_feat, pair_feat, global_feat, \
atom_idx, pair_idx, start_idx, end_idx = data[:-1]
check_forward(model, (atom_feat, pair_feat, global_feat, atom_idx,
pair_idx, start_idx, end_idx))
@pytest.mark.gpu
def test_forward_gpu(model, data):
input_data = [cuda.to_gpu(d) for d in data[:-1]]
model.to_gpu()
check_forward(model, tuple(input_data))
# def test_backward_cpu(model, data):
# input_data, y_grad = data[0:-1], data[-1]
# gradient_check.check_backward(model, tuple(input_data), y_grad,
# atol=5e-1, rtol=1e-1)
# @pytest.mark.gpu
# def test_backward_gpu(model, data):
# data = [cuda.to_gpu(d) for d in data]
# input_data, y_grad = data[0:-1], data[-1]
# model.to_gpu()
# gradient_check.check_backward(model, tuple(input_data), y_grad,
# atol=5e-1, rtol=1e-1)
if __name__ == '__main__':
pytest.main([__file__, '-v'])
================================================
FILE: tests/models_tests/test_mlp.py
================================================
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.models.mlp import MLP
batch_size = 2
hidden_dim = 16
out_dim = 4
@pytest.fixture
def model():
return MLP(out_dim=out_dim)
@pytest.fixture
def data():
numpy.random.seed(0)
hidden = numpy.random.rand(batch_size, hidden_dim).astype(numpy.float32)
y_grad = numpy.random.uniform(-1, 1, (batch_size, out_dim)).astype(
numpy.float32)
return hidden, y_grad
def check_forward(model, data):
y_actual = cuda.to_cpu(model(data).data)
assert y_actual.shape == (batch_size, out_dim)
def test_forward_cpu(model, data):
check_forward(model, data[0])
@pytest.mark.gpu
def test_forward_gpu(model, data):
model.to_gpu()
check_forward(model, cuda.to_gpu(data[0]))
def test_mlp_assert_raises():
with pytest.raises(ValueError):
MLP(out_dim=out_dim, n_layers=-1)
def test_backward_cpu(model, data):
hidden, y_grad = data
gradient_check.check_backward(model, hidden, y_grad, atol=1e0, rtol=1e0)
@pytest.mark.gpu
def test_backward_gpu(model, data):
hidden, y_grad = [cuda.to_gpu(d) for d in data]
model.to_gpu()
gradient_check.check_backward(model, hidden, y_grad, atol=1e0, rtol=1e0)
if __name__ == '__main__':
pytest.main([__file__, '-v'])
================================================
FILE: tests/models_tests/test_mpnn.py
================================================
from typing import List # NOQA
from typing import Tuple # NOQA
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.models.mpnn import MPNN
from chainer_chemistry.utils.permutation import permute_adj
from chainer_chemistry.utils.permutation import permute_node
atom_size = 5
out_dim = 4
batch_size = 2
num_edge_type = 3
@pytest.fixture(params=[('edgenet', 'set2set'), ('edgenet', 'ggnn'),
('ggnn', 'set2set'), ('ggnn', 'ggnn')])
def model(request):
# type: (pytest.fixture.SubRequest) -> MPNN
message_func, readout_func = request.param
return MPNN(
out_dim=out_dim,
n_edge_types=num_edge_type,
message_func=message_func,
readout_func=readout_func)
@pytest.fixture
def data():
# type: () -> Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]
numpy.random.seed(0)
atom_data = numpy.random.randint(
0, high=MAX_ATOMIC_NUM, size=(batch_size,
atom_size)).astype(numpy.int32)
adj_data = numpy.random.randint(
0, high=2, size=(batch_size, num_edge_type, atom_size,
atom_size)).astype(numpy.float32)
y_grad = numpy.random.uniform(-1, 1,
(batch_size, out_dim)).astype(numpy.float32)
return atom_data, adj_data, y_grad
def check_forward(model, atom_data, adj_data):
# type: (MPNN, numpy.ndarray, numpy.ndarray) -> None
y_actual = cuda.to_cpu(model(atom_data, adj_data).data)
assert y_actual.shape == (batch_size, out_dim)
def test_forward_cpu(model, data):
# type: (MPNN, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None
atom_data, adj_data = data[0], data[1]
check_forward(model, atom_data, adj_data)
@pytest.mark.gpu
def test_forward_gpu(model, data):
# type: (MPNN, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None
atom_data, adj_data = cuda.to_gpu(data[0]), cuda.to_gpu(data[1])
model.to_gpu()
check_forward(model, atom_data, adj_data)
def test_backward_cpu(model, data):
# type: (MPNN, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None
atom_data, adj_data, y_grad = data
gradient_check.check_backward(
model, (atom_data, adj_data), y_grad, atol=1e-0, rtol=1e-0)
@pytest.mark.gpu
def test_backward_gpu(model, data):
# type: (MPNN, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None
atom_data, adj_data, y_grad = [cuda.to_gpu(d) for d in data]
model.to_gpu()
gradient_check.check_backward(
model, (atom_data, adj_data), y_grad, atol=1e-0, rtol=1e-0)
def test_forward_cpu_graph_invariant(model, data):
# type: (MPNN, Tuple[numpy.ndarray, numpy.ndarray, numpy.ndarray]) -> None
if model.message_func == 'edgenet':
return
# Because EdgeNet uses NN for expanding edge vector dimension,
# graph invariant is not ensured.
atom_data, adj_data = data[0], data[1]
y_actual = cuda.to_cpu(model(atom_data, adj_data).data)
permutation_index = numpy.random.permutation(atom_size)
permute_atom_data = permute_node(atom_data, permutation_index)
permute_adj_data = permute_adj(adj_data, permutation_index)
permute_y_actual = cuda.to_cpu(
model(permute_atom_data, permute_adj_data).data)
assert numpy.allclose(y_actual, permute_y_actual, rtol=1e-3, atol=1e-3)
def test_invalid_message_funcion():
# type: () -> None
with pytest.raises(ValueError):
MPNN(out_dim=out_dim, message_func='invalid')
def test_invalid_readout_funcion():
# type: () -> None
with pytest.raises(ValueError):
MPNN(out_dim=out_dim, readout_func='invalid')
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/models_tests/test_nfp.py
================================================
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.models.nfp import NFP
from chainer_chemistry.utils.extend import extend_adj, extend_node # NOQA
from chainer_chemistry.utils.permutation import permute_adj
from chainer_chemistry.utils.permutation import permute_node
atom_size = 5
out_dim = 4
batch_size = 2
@pytest.fixture
def model():
return NFP(out_dim=out_dim)
@pytest.fixture
def data():
numpy.random.seed(0)
atom_data = numpy.random.randint(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size)
).astype(numpy.int32)
adj_data = numpy.random.randint(
0, high=2, size=(batch_size, atom_size, atom_size)
).astype(numpy.float32)
y_grad = numpy.random.uniform(
-1, 1, (batch_size, out_dim)).astype(numpy.float32)
return atom_data, adj_data, y_grad
def check_forward(model, atom_data, adj_data):
y_actual = cuda.to_cpu(model(atom_data, adj_data).data)
assert y_actual.shape == (batch_size, out_dim)
def test_forward_cpu(model, data):
atom_data, adj_data = data[0], data[1]
check_forward(model, atom_data, adj_data)
@pytest.mark.gpu
def test_forward_gpu(model, data):
atom_data, adj_data = cuda.to_gpu(data[0]), cuda.to_gpu(data[1])
model.to_gpu()
check_forward(model, atom_data, adj_data)
# TODO(nakago): check why tolerance is high
def test_backward_cpu(model, data):
atom_data, adj_data, y_grad = data
gradient_check.check_backward(model, (atom_data, adj_data), y_grad,
atol=1e0, rtol=1e0)
# TODO(nakago): check why tolerance is high
@pytest.mark.gpu
def test_backward_gpu(model, data):
atom_data, adj_data, y_grad = [cuda.to_gpu(d) for d in data]
model.to_gpu()
gradient_check.check_backward(model, (atom_data, adj_data), y_grad,
atol=1e0, rtol=1e0)
def test_forward_cpu_graph_invariant(model, data):
atom_data, adj_data = data[0], data[1]
y_actual = cuda.to_cpu(model(atom_data, adj_data).data)
permutation_index = numpy.random.permutation(atom_size)
permute_atom_data = permute_node(atom_data, permutation_index)
permute_adj_data = permute_adj(adj_data, permutation_index)
permute_y_actual = cuda.to_cpu(model(
permute_atom_data, permute_adj_data).data)
assert numpy.allclose(y_actual, permute_y_actual, rtol=1e-5, atol=1e-6)
def test_forward_cpu_input_size_invariant(model, data):
atom_data, adj_data = data[0], data[1]
is_real_node = numpy.ones(atom_data.shape, dtype=numpy.float32)
y_actual = cuda.to_cpu(model(
atom_array=atom_data, adj=adj_data,
is_real_node=is_real_node).data)
atom_data_ex = extend_node(atom_data, out_size=8)
adj_data_ex = extend_adj(adj_data, out_size=8)
is_real_node_ex = extend_node(is_real_node, out_size=8)
y_actual_ex = cuda.to_cpu(model(
atom_array=atom_data_ex, adj=adj_data_ex,
is_real_node=is_real_node_ex).data)
assert numpy.allclose(y_actual, y_actual_ex, rtol=1e-5, atol=1e-6)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/models_tests/test_relgat.py
================================================
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.models.relgat import RelGAT
from chainer_chemistry.utils.permutation import permute_adj
from chainer_chemistry.utils.permutation import permute_node
atom_size = 5
out_dim = 4
batch_size = 2
num_edge_type = 4
@pytest.fixture(params=[True, False])
def model(request):
return RelGAT(out_dim=out_dim, concat_heads=request.param)
@pytest.fixture
def data():
numpy.random.seed(0)
atom_data = numpy.random.randint(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size)
).astype(numpy.int32)
adj_data = numpy.random.randint(
0, high=2, size=(batch_size, num_edge_type, atom_size, atom_size)
).astype(numpy.float32)
y_grad = numpy.random.uniform(
-1, 1, (batch_size, out_dim)).astype(numpy.float32)
return atom_data, adj_data, y_grad
def check_forward(model, atom_data, adj_data):
y_actual = cuda.to_cpu(model(atom_data, adj_data).data)
assert y_actual.shape == (batch_size, out_dim)
def test_forward_cpu(model, data):
atom_data, adj_data = data[0], data[1]
check_forward(model, atom_data, adj_data)
@pytest.mark.gpu
def test_forward_gpu(model, data):
atom_data, adj_data = cuda.to_gpu(data[0]), cuda.to_gpu(data[1])
model.to_gpu()
check_forward(model, atom_data, adj_data)
# TODO(mottodora): check why tolerance is high
def test_backward_cpu(model, data):
atom_data, adj_data, y_grad = data
params = tuple(model.params())
gradient_check.check_backward(model, (atom_data, adj_data), y_grad,
params=params, no_grads=[True, True],
atol=1e3, rtol=1e3)
# TODO(nakago): check why tolerance is high
@pytest.mark.gpu
def test_backward_gpu(model, data):
atom_data, adj_data, y_grad = [cuda.to_gpu(d) for d in data]
model.to_gpu()
params = tuple(model.params())
gradient_check.check_backward(model, (atom_data, adj_data), y_grad,
params=params, no_grads=[True, True],
atol=1e3, rtol=1e3)
def test_forward_cpu_graph_invariant(model, data):
atom_data, adj_data = data[0], data[1]
y_actual = cuda.to_cpu(model(atom_data, adj_data).data)
permutation_index = numpy.random.permutation(atom_size)
permute_atom_data = permute_node(atom_data, permutation_index)
permute_adj_data = permute_adj(adj_data, permutation_index)
permute_y_actual = cuda.to_cpu(model(
permute_atom_data, permute_adj_data).data)
assert numpy.allclose(y_actual, permute_y_actual, rtol=1e-5, atol=1e-6)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/models_tests/test_relgcn.py
================================================
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.models.gwm.gwm_graph_conv_model import rescale_adj # NOQA
from chainer_chemistry.models.relgcn import RelGCN
from chainer_chemistry.utils.permutation import permute_adj
from chainer_chemistry.utils.permutation import permute_node
atom_size = 5
out_ch = 4
batch_size = 2
num_edge_type = 4
@pytest.fixture
def model():
return RelGCN(out_dim=out_ch)
@pytest.fixture
def data():
numpy.random.seed(0)
atom_data = numpy.random.randint(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size)).astype('i')
adj_data = numpy.random.randint(
0, high=2,
size=(batch_size, num_edge_type, atom_size, atom_size)).astype('f')
y_grad = numpy.random.uniform(-1, 1, (batch_size, out_ch)).astype('f')
return atom_data, adj_data, y_grad
def check_forward(model, atom_data, adj_data):
y_actual = cuda.to_cpu(model(atom_data, adj_data).data)
assert y_actual.shape == (batch_size, out_ch)
def test_forward_cpu(model, data):
atom_data, adj_data = data[0], data[1]
check_forward(model, atom_data, adj_data)
@pytest.mark.gpu
def test_forward_gpu(model, data):
atom_data, adj_data = cuda.to_gpu(data[0]), cuda.to_gpu(data[1])
model.to_gpu()
check_forward(model, atom_data, adj_data)
def test_backward_cpu(model, data):
atom_data, adj_data, y_grad = data
gradient_check.check_backward(model, (atom_data, adj_data), y_grad,
atol=1e-3, rtol=1e-3)
@pytest.mark.gpu
def test_backward_gpu(model, data):
atom_data, adj_data, y_grad = [cuda.to_gpu(d) for d in data]
model.to_gpu()
gradient_check.check_backward(model, (atom_data, adj_data), y_grad,
atol=1e-3, rtol=1e-3)
def test_forward_cpu_invariant(model, data):
atom_data, adj_data = data[0], data[1]
y_actual = cuda.to_cpu(model(atom_data, adj_data).data)
permutation_index = numpy.random.permutation(atom_size)
permute_atom_data = permute_node(atom_data, permutation_index)
permute_adj_data = permute_adj(adj_data, permutation_index)
permute_y_actual = cuda.to_cpu(model(
permute_atom_data, permute_adj_data).data)
assert numpy.allclose(y_actual, permute_y_actual, rtol=1e-5, atol=1e-5)
def test_rescale_adj(data):
adj = data[1]
numpy.testing.assert_allclose(rescale_adj(adj).data.sum(axis=(1, 2)),
numpy.ones((batch_size, atom_size)),
atol=1e-5, rtol=1e-5)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/models_tests/test_rsgcn.py
================================================
import chainer
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.links import NFPReadout
from chainer_chemistry.models.rsgcn import RSGCN
from chainer_chemistry.utils.extend import extend_adj
from chainer_chemistry.utils.extend import extend_node
from chainer_chemistry.utils.permutation import permute_adj
from chainer_chemistry.utils.permutation import permute_node
atom_size = 5
out_dim = 4
batch_size = 2
@pytest.fixture
def model():
return RSGCN(out_dim=out_dim)
@pytest.fixture
def model_no_dropout():
# To check backward gradient by `gradient_check`,
# we need to skip stochastic dropout function.
return RSGCN(out_dim=out_dim, dropout_ratio=0.)
@pytest.fixture
def model_with_nfp():
return RSGCN(out_dim=out_dim,
readout=NFPReadout(in_channels=out_dim, out_dim=out_dim))
@pytest.fixture
def model_with_nfp_no_dropout():
return RSGCN(out_dim=out_dim,
readout=NFPReadout(in_channels=out_dim, out_dim=out_dim),
dropout_ratio=0.)
@pytest.fixture
def data():
numpy.random.seed(0)
atom_data = numpy.random.randint(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size)
).astype(numpy.int32)
# adj_data is symmetric matrix
adj_data = numpy.random.uniform(
0, high=1, size=(batch_size, atom_size, atom_size)
).astype(numpy.float32)
adj_data = adj_data + adj_data.swapaxes(-1, -2)
y_grad = numpy.random.uniform(
-1, 1, (batch_size, out_dim)).astype(numpy.float32)
return atom_data, adj_data, y_grad
def check_forward(model, atom_data, adj_data):
y_actual = cuda.to_cpu(model(atom_data, adj_data).data)
assert y_actual.shape == (batch_size, out_dim)
def test_forward_cpu(model, data):
atom_data, adj_data = data[0], data[1]
check_forward(model, atom_data, adj_data)
@pytest.mark.gpu
def test_forward_gpu(model, data):
atom_data, adj_data = cuda.to_gpu(data[0]), cuda.to_gpu(data[1])
model.to_gpu()
check_forward(model, atom_data, adj_data)
def test_forward_cpu_with_nfp(model_with_nfp, data):
atom_data, adj_data = data[0], data[1]
check_forward(model_with_nfp, atom_data, adj_data)
def test_backward_cpu(model_no_dropout, data):
atom_data, adj_data, y_grad = data
if int(chainer.__version__[0]) <= 2:
# somehow the test fails with `params` when using chainer version 2...
# TODO(nakago): investigate why the test fails.
params = ()
else:
params = tuple(model_no_dropout.params())
# TODO(nakago): check why tolerance is high
gradient_check.check_backward(
model_no_dropout, (atom_data, adj_data), y_grad,
params=params,
atol=1e-1, rtol=1e-1, no_grads=[True, True])
@pytest.mark.gpu
def test_backward_gpu(model_no_dropout, data):
atom_data, adj_data, y_grad = [cuda.to_gpu(d) for d in data]
model_no_dropout.to_gpu()
if int(chainer.__version__[0]) <= 2:
# somehow the test fails with `params` when using chainer version 2...
# TODO(nakago): investigate why the test fails.
params = ()
else:
params = tuple(model_no_dropout.params())
# TODO(nakago): check why tolerance is high
gradient_check.check_backward(
model_no_dropout, (atom_data, adj_data), y_grad,
params=params,
atol=1e-1, rtol=1e-1, no_grads=[True, True])
def test_backward_cpu_with_nfp(model_with_nfp_no_dropout, data):
atom_data, adj_data, y_grad = data
if int(chainer.__version__[0]) <= 2:
params = ()
else:
params = tuple(model_with_nfp_no_dropout.params())
gradient_check.check_backward(
model_with_nfp_no_dropout, (atom_data, adj_data), y_grad,
params=params,
atol=1e-4, rtol=1e-4, no_grads=[True, True])
def test_forward_cpu_graph_invariant(model, data):
# This RSGCN uses dropout, so we need to forward with test mode
# to remove stochastic calculation.
atom_data, adj_data = data[0], data[1]
with chainer.using_config('train', False):
y_actual = cuda.to_cpu(model(atom_data, adj_data).data)
permutation_index = numpy.random.permutation(atom_size)
permute_atom_data = permute_node(atom_data, permutation_index)
permute_adj_data = permute_adj(adj_data, permutation_index)
with chainer.using_config('train', False):
permute_y_actual = cuda.to_cpu(model(
permute_atom_data, permute_adj_data).data)
assert numpy.allclose(y_actual, permute_y_actual, rtol=1.e-4, atol=1.e-5)
def test_forward_cpu_input_size_invariant(model, data):
# This RSGCN uses dropout, so we need to forward with test mode
# to remove stochastic calculation.
atom_data, adj_data = data[0], data[1]
with chainer.using_config('train', False):
y_actual = cuda.to_cpu(model(atom_data, adj_data).data)
# Set bigger size than original `atom_size`.
atom_data_ex = extend_node(atom_data, out_size=8)
adj_data_ex = extend_adj(adj_data, out_size=8)
# print('size', atom_data.shape, adj_data.shape,
# atom_data_ex.shape, adj_data_ex.shape)
with chainer.using_config('train', False):
y_actual_ex = cuda.to_cpu(model(
atom_data_ex, adj_data_ex).data)
assert numpy.allclose(y_actual, y_actual_ex, rtol=1.e-4, atol=1.e-5)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/models_tests/test_schnet.py
================================================
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.models.schnet import SchNet
from chainer_chemistry.utils.permutation import permute_adj
from chainer_chemistry.utils.permutation import permute_node
atom_size = 5
out_dim = 4
batch_size = 2
@pytest.fixture
def model():
return SchNet(out_dim=out_dim)
@pytest.fixture
def data():
numpy.random.seed(0)
atom_data = numpy.random.randint(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size)
).astype(numpy.int32)
# symmetric matrix
adj_data = numpy.random.uniform(
0, high=30, size=(batch_size, atom_size, atom_size)
).astype(numpy.float32)
adj_data = (adj_data + adj_data.swapaxes(-1, -2)) / 2.
y_grad = numpy.random.uniform(
-1, 1, (batch_size, out_dim)).astype(numpy.float32)
return atom_data, adj_data, y_grad
def check_forward(model, atom_data, adj_data):
y_actual = cuda.to_cpu(model(atom_data, adj_data).data)
assert y_actual.shape == (batch_size, out_dim)
def test_forward_cpu(model, data):
atom_data, adj_data = data[0], data[1]
check_forward(model, atom_data, adj_data)
@pytest.mark.gpu
def test_forward_gpu(model, data):
atom_data, adj_data = cuda.to_gpu(data[0]), cuda.to_gpu(data[1])
model.to_gpu()
check_forward(model, atom_data, adj_data)
def test_backward_cpu(model, data):
atom_data, adj_data, y_grad = data
gradient_check.check_backward(model, (atom_data, adj_data), y_grad,
atol=5e-1, rtol=1e-1)
@pytest.mark.gpu
def test_backward_gpu(model, data):
atom_data, adj_data, y_grad = [cuda.to_gpu(d) for d in data]
model.to_gpu()
gradient_check.check_backward(model, (atom_data, adj_data), y_grad,
atol=5e-1, rtol=1e-1)
def test_forward_cpu_graph_invariant(model, data):
atom_data, adj_data = data[0], data[1]
y_actual = cuda.to_cpu(model(atom_data, adj_data).data)
permutation_index = numpy.random.permutation(atom_size)
permute_atom_data = permute_node(atom_data, permutation_index)
permute_adj_data = permute_adj(adj_data, permutation_index)
permute_y_actual = cuda.to_cpu(model(
permute_atom_data, permute_adj_data).data)
assert numpy.allclose(y_actual, permute_y_actual, rtol=1e-5, atol=1e-5)
if __name__ == '__main__':
pytest.main([__file__, '-v'])
================================================
FILE: tests/models_tests/test_weavenet.py
================================================
from chainer import cuda
from chainer import gradient_check
import numpy
import pytest
from chainer_chemistry.config import MAX_ATOMIC_NUM
from chainer_chemistry.models.weavenet import WeaveNet
from chainer_chemistry.utils.permutation import permute_adj
from chainer_chemistry.utils.permutation import permute_node
atom_size = 5
weave_channels = [50, 50]
batch_size = 2
atom_feature_dim = 23
pair_feature_dim = 10
out_dim = weave_channels[-1]
@pytest.fixture
def model():
return WeaveNet(weave_channels=weave_channels, n_atom=atom_size)
@pytest.fixture
def model_processed():
"""model to test `atom_data_processed` input"""
return WeaveNet(weave_channels=weave_channels, n_atom=atom_size)
@pytest.fixture
def data():
numpy.random.seed(0)
atom_data_processed = numpy.random.uniform(
0, high=1, size=(batch_size, atom_size, atom_feature_dim)
).astype(numpy.float32)
atom_data = numpy.random.randint(
0, high=MAX_ATOMIC_NUM, size=(batch_size, atom_size)
).astype(numpy.int32)
adj_data = numpy.random.uniform(
0, high=1, size=(batch_size, pair_feature_dim, atom_size, atom_size)
).astype(numpy.float32)
# adj_data is symmetric along pair of atoms
# adj_data = adj_data + adj_data.swapaxes(-1, -2)
adj_data = adj_data.transpose((0, 3, 2, 1)).reshape(
batch_size, atom_size * atom_size, pair_feature_dim
).astype(numpy.float32)
y_grad = numpy.random.uniform(
-1, 1, (batch_size, out_dim)).astype(numpy.float32)
return atom_data_processed, atom_data, adj_data, y_grad
def check_forward(model, atom_data, adj_data):
y_actual = cuda.to_cpu(model(atom_data, adj_data).data)
print('y_actual', y_actual.shape)
assert y_actual.shape == (batch_size, out_dim)
def test_forward_cpu(model, model_processed, data):
atom_data_processed, atom_data, adj_data = data[0:3]
check_forward(model, atom_data, adj_data)
check_forward(model_processed, atom_data_processed, adj_data)
@pytest.mark.gpu
def test_forward_gpu(model, model_processed, data):
atom_data_processed, atom_data, adj_data = \
[cuda.to_gpu(d) for d in data[0:3]]
model.to_gpu()
model_processed.to_gpu()
check_forward(model, atom_data, adj_data)
check_forward(model_processed, atom_data_processed, adj_data)
def test_backward_cpu(model, model_processed, data):
atom_data_processed, atom_data, adj_data, y_grad = data
gradient_check.check_backward(model, (atom_data, adj_data), y_grad,
atol=1e-1, rtol=1e-1)
gradient_check.check_backward(model_processed, (atom_data_processed,
adj_data), y_grad,
atol=1e-1, rtol=1e-1)
@pytest.mark.gpu
def test_backward_gpu(model, model_processed, data):
atom_data_processed, atom_data, adj_data, y_grad = \
[cuda.to_gpu(d) for d in data]
model.to_gpu()
model_processed.to_gpu()
gradient_check.check_backward(
model, (atom_data, adj_data), y_grad, atol=1e-1, rtol=1e-1)
gradient_check.check_backward(
model_processed, (atom_data_processed, adj_data), y_grad,
atol=1e-1, rtol=1e-1)
def _test_forward_cpu_graph_invariant(
model, atom_data, adj_data, node_permute_axis=-1):
y_actual = cuda.to_cpu(model(atom_data, adj_data).data)
permutation_index = numpy.random.permutation(atom_size)
permute_atom_data = permute_node(atom_data, permutation_index,
axis=node_permute_axis)
permute_adj_data = adj_data.reshape(
batch_size, atom_size, atom_size, pair_feature_dim
).astype(numpy.float32)
permute_adj_data = permute_adj(
permute_adj_data, permutation_index, axis=[1, 2])
permute_adj_data = permute_adj_data.reshape(
batch_size, atom_size * atom_size, pair_feature_dim
).astype(numpy.float32)
permute_y_actual = cuda.to_cpu(model(
permute_atom_data, permute_adj_data).data)
assert numpy.allclose(y_actual, permute_y_actual, rtol=1.e-4, atol=1.e-6)
def test_forward_cpu_graph_invariant_embed(model, data):
atom_data, adj_data = data[1], data[2]
_test_forward_cpu_graph_invariant(
model, atom_data, adj_data, node_permute_axis=-1)
def test_forward_cpu_graph_invariant_processed(model_processed, data):
atom_data_processed, adj_data = data[0], data[2]
_test_forward_cpu_graph_invariant(
model_processed, atom_data_processed, adj_data, node_permute_axis=1)
if __name__ == '__main__':
pytest.main([__file__, '-v'])
================================================
FILE: tests/saliency_tests/calculator_tests/test_base_calculator.py
================================================
import numpy
import pytest
import chainer
from chainer.links import Linear
from chainer_chemistry.link_hooks import is_link_hooks_available
if is_link_hooks_available:
from chainer_chemistry.link_hooks import VariableMonitorLinkHook
from chainer_chemistry.saliency.calculator.base_calculator import BaseCalculator # NOQA
from chainer_chemistry.saliency.calculator import GaussianNoiseSampler
class DummyCalculator(BaseCalculator):
"""Dummy calculator which returns target_var"""
def _compute_core(self, *inputs):
self.model(*inputs)
return self.get_target_var(inputs)
class DummyModel(chainer.Chain):
def __init__(self):
super(DummyModel, self).__init__()
with self.init_scope():
self.l1 = Linear(
3, 1, initialW=numpy.array([[1, 3, 2]]),
nobias=True)
self.h = None
def forward(self, x):
self.h = self.l1(x)
out = self.h * 3
return out
@pytest.fixture
def model():
return DummyModel()
@pytest.mark.skipif(not is_link_hooks_available,
reason='Link Hook is not available')
def test_base_calculator_compute(model):
calculator = DummyCalculator(model)
x = numpy.array([[1, 5, 8]], dtype=numpy.float32)
saliency = calculator.compute(x)
# DummyCalculator returns `saliency` as input `x`.
assert numpy.allclose(saliency, x)
@pytest.mark.skipif(not is_link_hooks_available,
reason='Link Hook is not available')
def test_base_calculator_compute_noise_sampler(model):
calculator = DummyCalculator(model)
x = numpy.array([[1, 5, 8]], dtype=numpy.float32)
saliency = calculator.compute(x, M=2, noise_sampler=GaussianNoiseSampler())
assert saliency.shape == (2, 3)
# noise is added, should be different from original input
assert not numpy.allclose(saliency[0], x)
assert not numpy.allclose(saliency[1], x)
@pytest.mark.skipif(not is_link_hooks_available,
reason='Link Hook is not available')
def test_base_calculator_compute_target_extractor(model):
# It should extract `target_var` as after `l1`, which is `model.h`.
calculator = DummyCalculator(
model, target_extractor=VariableMonitorLinkHook(model.l1))
x = numpy.array([[1, 5, 8]], dtype=numpy.float32)
saliency = calculator.compute(x)
assert numpy.allclose(saliency, model.h.array)
@pytest.mark.skipif(not is_link_hooks_available,
reason='Link Hook is not available')
def test_base_calculator_aggregate():
model = DummyModel()
calculator = DummyCalculator(model)
saliency = numpy.array([[-1, -1, -1], [2, 2, 2]], dtype=numpy.float32)
saliency_raw = calculator.aggregate(saliency, method='raw', ch_axis=None)
assert numpy.allclose(saliency_raw,
numpy.array([[0.5, 0.5, 0.5]], dtype=numpy.float32))
saliency_abs = calculator.aggregate(saliency, method='abs', ch_axis=None)
assert numpy.allclose(saliency_abs,
numpy.array([[1.5, 1.5, 1.5]], dtype=numpy.float32))
saliency_square = calculator.aggregate(saliency, method='square',
ch_axis=None)
assert numpy.allclose(saliency_square,
numpy.array([[2.5, 2.5, 2.5]], dtype=numpy.float32))
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/saliency_tests/calculator_tests/test_calculator_utils.py
================================================
import numpy
import pytest
from chainer_chemistry.saliency.calculator.calculator_utils import GaussianNoiseSampler # NOQA
@pytest.mark.parametrize('mode', ['relative', 'absolute'])
def test_gaussian_noise_sampler(mode):
shape = (3, 4, 5)
target_array = numpy.random.uniform(0, 1, shape)
sampler = GaussianNoiseSampler(mode=mode, scale=0.15)
noise = sampler.sample(target_array)
assert noise.shape == shape
def test_gaussian_noise_sampler_assert_raises():
shape = (3, 4, 5)
target_array = numpy.random.uniform(0, 1, shape)
with pytest.raises(ValueError):
sampler = GaussianNoiseSampler(mode='invalid_mode', scale=0.15)
sampler.sample(target_array)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/saliency_tests/calculator_tests/test_gradient_calculator.py
================================================
import numpy
import pytest
import chainer
from chainer.links import Linear
from chainer_chemistry.link_hooks import is_link_hooks_available
if is_link_hooks_available:
from chainer_chemistry.link_hooks import VariableMonitorLinkHook
from chainer_chemistry.saliency.calculator.gradient_calculator import GradientCalculator # NOQA
class DummyModel(chainer.Chain):
def __init__(self):
super(DummyModel, self).__init__()
with self.init_scope():
self.l1 = Linear(
3, 1, initialW=numpy.array([[1, 3, 2]]),
nobias=True)
def forward(self, x):
return self.l1(x)
@pytest.mark.skipif(not is_link_hooks_available,
reason='Link Hook is not available')
def test_gradient_calculator():
model = DummyModel()
x = numpy.array([[1, 5, 8]], dtype=numpy.float32)
calculator = GradientCalculator(model)
saliency = calculator.compute(x)
# Gradient is equal to `initialW` of DummyModel.
assert numpy.allclose(saliency, numpy.array([[1, 3, 2]]))
@pytest.mark.skipif(not is_link_hooks_available,
reason='Link Hook is not available')
def test_gradient_calculator_multiple_output():
model = DummyModel()
x = numpy.array([[1, 5, 8], [2, 3, 4]], dtype=numpy.float32)
calculator = GradientCalculator(model)
# even batchsize=2 sum is applied automatically inside `compute`,
# so gradient can be calculated.
saliency = calculator.compute(x)
# Gradient is equal to `initialW` of DummyModel.
assert numpy.allclose(saliency, numpy.array([[1, 3, 2]]))
@pytest.mark.skipif(not is_link_hooks_available,
reason='Link Hook is not available')
def test_gradient_calculator_multiply_target():
model = DummyModel()
x = numpy.array([[1, 5, 8]], dtype=numpy.float32)
calculator = GradientCalculator(model, multiply_target=True)
saliency = calculator.compute(x)
# gradient * input
assert numpy.allclose(saliency, numpy.array([[1, 15, 16]]))
@pytest.mark.skipif(not is_link_hooks_available,
reason='Link Hook is not available')
def test_gradient_calculator_target_extractor():
model = DummyModel()
x = numpy.array([[1, 5, 8]], dtype=numpy.float32)
calculator = GradientCalculator(
model,
target_extractor=VariableMonitorLinkHook(model.l1, timing='pre'))
saliency = calculator.compute(x)
# Gradient is equal to `initialW` of DummyModel.
assert numpy.allclose(saliency, numpy.array([[[1, 3, 2]]]))
assert saliency.shape == (1, 1, 3)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/saliency_tests/calculator_tests/test_integrated_gradient_calculator.py
================================================
import numpy
import pytest
import chainer
from chainer.links import Linear
from chainer_chemistry.link_hooks import is_link_hooks_available
if is_link_hooks_available:
from chainer_chemistry.link_hooks import VariableMonitorLinkHook
from chainer_chemistry.saliency.calculator.integrated_gradients_calculator import IntegratedGradientsCalculator # NOQA
class DummyModel(chainer.Chain):
def __init__(self):
super(DummyModel, self).__init__()
with self.init_scope():
self.l1 = Linear(
3, 1, initialW=numpy.array([[1, 3, 2]]),
nobias=True)
def forward(self, x):
return self.l1(x)
@pytest.mark.skipif(not is_link_hooks_available,
reason='Link Hook is not available')
def test_integrated_gradient_calculator():
model = DummyModel()
x = numpy.array([[1, 5, 8]], dtype=numpy.float32)
calculator = IntegratedGradientsCalculator(model, steps=3)
saliency = calculator.compute(x)
# gradient is always [1, 3, 2] * (input - base) is [1, 5, 8]
assert numpy.allclose(saliency, numpy.array([[1, 15, 16]]))
@pytest.mark.skipif(not is_link_hooks_available,
reason='Link Hook is not available')
def test_integrated_gradient_calculator_target_extractor():
model = DummyModel()
x = numpy.array([[1, 5, 8]], dtype=numpy.float32)
calculator = IntegratedGradientsCalculator(
model, steps=4,
target_extractor=VariableMonitorLinkHook(model.l1, timing='pre'))
saliency = calculator.compute(x)
# gradient is always [1, 3, 2] * (input - base) is [1, 5, 8]
assert numpy.allclose(saliency, numpy.array([[[1, 15, 16]]]))
assert saliency.shape == (1, 1, 3)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/saliency_tests/calculator_tests/test_occlusion_calculator.py
================================================
import numpy
import pytest
import chainer
from chainer.links import Linear, Convolution2D # NOQA
from chainer_chemistry.link_hooks import is_link_hooks_available
if is_link_hooks_available:
from chainer_chemistry.link_hooks import VariableMonitorLinkHook
from chainer_chemistry.saliency.calculator.occlusion_calculator import OcclusionCalculator # NOQA
class DummyModel(chainer.Chain):
def __init__(self):
super(DummyModel, self).__init__()
with self.init_scope():
self.l1 = Linear(
3, 1, initialW=numpy.array([[1, 3, 2]]),
nobias=True)
def forward(self, x):
return self.l1(x)
class DummyCNNModel(chainer.Chain):
def __init__(self):
super(DummyCNNModel, self).__init__()
with self.init_scope():
self.l1 = Convolution2D(
1, 1, ksize=3,
initialW=numpy.ones((1, 1, 3, 3), numpy.float32), nobias=True)
def forward(self, x):
return self.l1(x)
@pytest.mark.skipif(not is_link_hooks_available,
reason='Link Hook is not available')
def test_occlusion_calculator():
model = DummyModel()
x = numpy.array([[1, 5, 8]], dtype=numpy.float32)
calculator = OcclusionCalculator(model, slide_axis=1)
saliency = calculator.compute(x)
assert numpy.allclose(saliency, numpy.array([[[1, 15, 16]]]))
assert saliency.shape == (1, 1, 3)
@pytest.mark.skipif(not is_link_hooks_available,
reason='Link Hook is not available')
def test_occlusion_calculator_cnn():
model = DummyCNNModel()
# x (1, 1, 3, 3): (bs, ch, h, w)
x = numpy.array([[[[1, 5, 8], [2, 4, 1], [3, 2, 9]]]], dtype=numpy.float32)
calculator = OcclusionCalculator(model, slide_axis=(2, 3))
saliency = calculator.compute(x)
assert numpy.allclose(saliency, x)
assert saliency.shape == (1, 1, 1, 3, 3) # (M, bs, ch, h, w)
@pytest.mark.skipif(not is_link_hooks_available,
reason='Link Hook is not available')
def test_occlusion_calculator_target_extractor():
model = DummyModel()
x = numpy.array([[1, 5, 8]], dtype=numpy.float32)
calculator = OcclusionCalculator(
model, slide_axis=1,
target_extractor=VariableMonitorLinkHook(model.l1, timing='pre'))
saliency = calculator.compute(x)
assert numpy.allclose(saliency, numpy.array([[[1, 15, 16]]]))
assert saliency.shape == (1, 1, 3)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/saliency_tests/visualizer_tests/test_image_visualizer.py
================================================
import os
import sys
import matplotlib.pyplot as plt
import numpy
import pytest
from chainer_chemistry.saliency.visualizer.image_visualizer import ImageVisualizer # NOQA
is_python_version2 = sys.version_info[0] < 3
@pytest.mark.skipif(is_python_version2,
reason='matplotlib configuration is necessary with'
'python version 2')
def test_image_visualizer(tmpdir):
# Only test file is saved without error
ch = 3
h = 32
w = 32
saliency = numpy.random.uniform(0, 1, (ch, h, w))
visualizer = ImageVisualizer()
# 1. test with setting save_filepath
save_filepath = os.path.join(str(tmpdir), 'tmp.png')
visualizer.visualize(saliency, save_filepath=save_filepath)
assert os.path.exists(save_filepath)
# 2. test with `save_filepath=None` runs without error
image = numpy.random.uniform(0, 1, (ch, h, w))
plt.ion()
visualizer.visualize(
saliency, save_filepath=None, image=image, show_colorbar=True)
plt.close()
def test_table_visualizer_assert_raises():
visualizer = ImageVisualizer()
with pytest.raises(ValueError):
# --- Invalid saliency shape ---
saliency_invalid = numpy.array([0.5, 0.3, 0.2])
visualizer.visualize(saliency_invalid)
ch = 3
h = 32
w = 32
saliency = numpy.random.uniform(0, 1, (ch, h, w))
with pytest.raises(ValueError):
# --- Invalid sort key ---
image_invalid = numpy.array([0.5, 0.3, 0.2])
visualizer.visualize(saliency, image=image_invalid)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/saliency_tests/visualizer_tests/test_mol_visualizer.py
================================================
import os
import numpy
import pytest
from rdkit import Chem
from chainer_chemistry.saliency.visualizer.mol_visualizer import MolVisualizer # NOQA
from chainer_chemistry.saliency.visualizer.mol_visualizer import SmilesVisualizer # NOQA
def test_mol_visualizer(tmpdir):
# Only test file is saved without error
smiles = 'OCO'
mol = Chem.MolFromSmiles(smiles)
saliency = numpy.array([0.5, 0.3, 0.2])
visualizer = MolVisualizer()
# 1. test with setting save_filepath
save_filepath = os.path.join(str(tmpdir), 'tmp.svg')
svg = visualizer.visualize(saliency, mol, save_filepath=save_filepath)
assert isinstance(svg, str)
assert os.path.exists(save_filepath)
# 2. test with `save_filepath=None` runs without error
svg = visualizer.visualize(
saliency, mol, save_filepath=None, visualize_ratio=0.5,)
assert isinstance(svg, str)
def test_smiles_visualizer(tmpdir):
# Only test file is saved without error
smiles = 'OCO'
saliency = numpy.array([0.5, 0.3, 0.2])
visualizer = SmilesVisualizer()
# 1. test with setting save_filepath
save_filepath = os.path.join(str(tmpdir), 'tmp.svg')
svg = visualizer.visualize(saliency, smiles, save_filepath=save_filepath,
add_Hs=False)
assert os.path.exists(save_filepath)
assert isinstance(svg, str)
save_filepath = os.path.join(str(tmpdir), 'tmp.png')
svg = visualizer.visualize(saliency, smiles, save_filepath=save_filepath,
add_Hs=False)
assert isinstance(svg, str)
# TODO(nakago): support png save test.
# Do not test for now (cairosvg is necessary)
# assert os.path.exists(save_filepath)
# 2. test with `save_filepath=None` runs without error
svg = visualizer.visualize(
saliency, smiles, save_filepath=None, visualize_ratio=0.5,
add_Hs=False, use_canonical_smiles=True)
assert isinstance(svg, str)
def test_mol_visualizer_assert_raises(tmpdir):
visualizer = MolVisualizer()
smiles = 'OCO'
mol = Chem.MolFromSmiles(smiles)
with pytest.raises(ValueError):
# --- Invalid saliency shape ---
saliency = numpy.array([[0.5, 0.3, 0.2], [0.5, 0.3, 0.2]])
visualizer.visualize(saliency, mol)
with pytest.raises(ValueError):
# --- Invalid sort key ---
saliency = numpy.array([0.5, 0.3, 0.2])
invalid_ext_filepath = os.path.join(str(tmpdir), 'tmp.hoge')
visualizer.visualize(saliency, mol, save_filepath=invalid_ext_filepath)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/saliency_tests/visualizer_tests/test_table_visualizer.py
================================================
import os
import sys
import matplotlib.pyplot as plt
import numpy
import pytest
from chainer_chemistry.saliency.visualizer.table_visualizer import TableVisualizer # NOQA
is_python_version2 = sys.version_info[0] < 3
@pytest.mark.skipif(is_python_version2,
reason='matplotlib configuration is necessary with'
'python version 2')
def test_table_visualizer(tmpdir):
# Only test file is saved without error
saliency = numpy.array([0.5, 0.3, 0.2])
visualizer = TableVisualizer()
# 1. test with setting save_filepath
save_filepath = os.path.join(str(tmpdir), 'tmp.png')
visualizer.visualize(saliency, save_filepath=save_filepath)
assert os.path.exists(save_filepath)
# 2. test with `save_filepath=None` runs without error
plt.ion()
visualizer.visualize(
saliency, save_filepath=None, feature_names=['hoge', 'huga', 'piyo'],
num_visualize=2)
plt.close()
def test_table_visualizer_assert_raises():
visualizer = TableVisualizer()
with pytest.raises(ValueError):
# --- Invalid saliency shape ---
saliency = numpy.array([[0.5, 0.3, 0.2], [0.5, 0.3, 0.2]])
visualizer.visualize(saliency)
with pytest.raises(ValueError):
# --- Invalid sort key ---
saliency = numpy.array([0.5, 0.3, 0.2])
visualizer.visualize(saliency, sort='invalidkey')
with pytest.raises(ValueError):
# --- Invalid feature_names key ---
saliency = numpy.array([0.5, 0.3, 0.2])
feature_names = ['a', 'b', 'c', 'd']
visualizer.visualize(saliency, feature_names=feature_names)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/saliency_tests/visualizer_tests/test_visualizer_utils.py
================================================
import numpy
import pytest
from chainer_chemistry.saliency.visualizer.visualizer_utils import abs_max_scaler # NOQA
from chainer_chemistry.saliency.visualizer.visualizer_utils import min_max_scaler # NOQA
from chainer_chemistry.saliency.visualizer.visualizer_utils import normalize_scaler # NOQA
from chainer_chemistry.saliency.visualizer.visualizer_utils import red_blue_cmap # NOQA
def test_abs_max_scaler():
saliency = numpy.array([1., 2., 3.])
result = abs_max_scaler(saliency)
expected = numpy.array([1. / 3, 2. / 3., 1.])
assert numpy.allclose(result, expected)
# test with 0 arrays
saliency = numpy.array([0, 0, 0])
result = abs_max_scaler(saliency)
expected = numpy.array([0, 0, 0])
assert numpy.allclose(result, expected)
def test_min_max_scaler():
saliency = numpy.array([1., -3., 3.])
result = min_max_scaler(saliency)
expected = numpy.array([4. / 6, 0., 1.])
assert numpy.allclose(result, expected)
# test with 0 arrays
saliency = numpy.array([0, 0, 0])
result = min_max_scaler(saliency)
expected = numpy.array([0, 0, 0])
assert numpy.allclose(result, expected)
def test_normalize_scaler():
saliency = numpy.array([1., 2., 3.])
result = normalize_scaler(saliency)
expected = numpy.array([1./6., 2./6, 3./6.])
assert numpy.allclose(result, expected)
# test with 0 arrays
saliency = numpy.array([0, 0, 0])
result = normalize_scaler(saliency)
expected = numpy.array([0, 0, 0])
assert numpy.allclose(result, expected)
def test_red_blue_cmap():
assert red_blue_cmap(1) == (1., 0., 0.) # Red
assert red_blue_cmap(0) == (1., 1., 1.) # White
assert red_blue_cmap(-1) == (0., 0., 1.) # Blue
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/test_init.py
================================================
import pkg_resources
import chainer_chemistry
import pytest
def test_version():
expect = pkg_resources.get_distribution('chainer_chemistry').version
actual = chainer_chemistry.__version__
assert expect == actual
if __name__ == '__main__':
pytest.main([__file__, '-v'])
================================================
FILE: tests/training_tests/extensions_tests/test_auto_print_report.py
================================================
import tempfile
import pytest
import mock
from chainer import testing
from chainer.training import extensions
class TestAutoPrintReport(object):
def _setup(self, stream=None, delete_flush=False):
self.logreport = mock.MagicMock(spec=extensions.LogReport(
['epoch'], trigger=(1, 'iteration'), log_name=None))
if stream is None:
self.stream = mock.MagicMock()
if delete_flush:
del self.stream.flush
else:
self.stream = stream
self.report = extensions.PrintReport(
['epoch'], log_report=self.logreport, out=self.stream)
self.trainer = testing.get_trainer_with_mock_updater(
stop_trigger=(1, 'iteration'))
self.trainer.extend(self.logreport)
self.trainer.extend(self.report)
self.logreport.log = [{'epoch': 0}]
def test_stream_with_flush_is_flushed(self):
self._setup(delete_flush=False)
assert hasattr(self.stream, 'flush')
self.stream.flush.assert_not_called()
self.report(self.trainer)
self.stream.flush.assert_called_with()
def test_stream_without_flush_raises_no_exception(self):
self._setup(delete_flush=True)
assert not hasattr(self.stream, 'flush')
self.report(self.trainer)
def test_real_stream_raises_no_exception(self):
with tempfile.TemporaryFile(mode='w') as stream:
self._setup(stream=stream)
self.report(self.trainer)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/training_tests/extensions_tests/test_prc_auc_evaluator.py
================================================
"""
PRCAUCEvaluator uses `sklearn.metrics.precision_recall_curve` and
`sklearn.metrics.auc` internally.
Refer: http://scikit-learn.org/stable/modules/generated/sklearn.metrics.\
prc_auc_score.html
"""
import numpy
import pytest
import chainer
from chainer.iterators import SerialIterator
from chainer_chemistry.datasets.numpy_tuple_dataset import NumpyTupleDataset # NOQA
from chainer_chemistry.training.extensions.prc_auc_evaluator import PRCAUCEvaluator # NOQA
@pytest.fixture
def data0():
# `t` is correct label, `y` is dummy predict value by predictor
t = numpy.array([0, 0, 1, 1], dtype=numpy.int32)[:, None]
y = numpy.array([0.1, 0.4, 0.35, 0.8], dtype=numpy.float32)[:, None]
return y, t
@pytest.fixture
def data1():
# `t` is correct label, `y` is dummy predict value by predictor
t = numpy.array([0, 1, -1, 0, 2, -1], dtype=numpy.int32)[:, None]
y = numpy.array([0.1, 0.35, 0.2, 0.4, 0.8, 0.35],
dtype=numpy.float32)[:, None]
return y, t
@pytest.fixture
def data2():
# Example of bad example case
# `t` only contains correct label, `y` is dummy predict value by predictor
t = numpy.array([0, 0, 0, 0], dtype=numpy.int32)[:, None]
y = numpy.array([0.1, 0.4, 0.35, 0.8], dtype=numpy.float32)[:, None]
return y, t
class DummyPredictor(chainer.Chain):
def __call__(self, y):
# it receives `y` and return `y` directly
return y
def test_prc_auc_evaluator(data0, data1):
_test_prc_auc_evaluator_default_args(data0)
_test_prc_auc_evaluator_with_labels(data1)
def _test_prc_auc_evaluator_default_args(data0):
predictor = DummyPredictor()
dataset = NumpyTupleDataset(*data0)
iterator = SerialIterator(dataset, 2, repeat=False, shuffle=False)
evaluator = PRCAUCEvaluator(
iterator, predictor, name='train',
pos_labels=1, ignore_labels=None
)
repo = chainer.Reporter()
repo.add_observer('target', predictor)
with repo:
observation = evaluator.evaluate()
expected_prc_auc = 0.7916
pytest.approx(observation['target/prc_auc'], expected_prc_auc)
# --- test __call__ ---
result = evaluator()
pytest.approx(result['train/main/prc_auc'], expected_prc_auc)
def _test_prc_auc_evaluator_with_labels(data1):
"""test `pos_labels` and `ignore_labels` behavior"""
predictor = DummyPredictor()
dataset = NumpyTupleDataset(*data1)
iterator = SerialIterator(dataset, 2, repeat=False, shuffle=False)
evaluator = PRCAUCEvaluator(
iterator, predictor, name='val',
pos_labels=[1, 2], ignore_labels=-1,
)
# --- test evaluate ---
repo = chainer.Reporter()
repo.add_observer('target', predictor)
with repo:
observation = evaluator.evaluate()
expected_prc_auc = 0.7916
pytest.approx(observation['target/prc_auc'], expected_prc_auc)
# --- test __call__ ---
result = evaluator()
pytest.approx(result['val/main/prc_auc'], expected_prc_auc)
def test_prc_auc_evaluator_raise_value_error(data2):
with pytest.raises(ValueError):
_test_prc_auc_evaluator_raise_error(data2, raise_value_error=True)
res = _test_prc_auc_evaluator_raise_error(data2, raise_value_error=False)
assert numpy.isnan(res)
def _test_prc_auc_evaluator_raise_error(data, raise_value_error=True):
predictor = DummyPredictor()
dataset = NumpyTupleDataset(*data)
iterator = SerialIterator(dataset, 2, repeat=False, shuffle=False)
evaluator = PRCAUCEvaluator(
iterator, predictor, name='train',
pos_labels=1, ignore_labels=None,
raise_value_error=raise_value_error
)
repo = chainer.Reporter()
repo.add_observer('target', predictor)
with repo:
observation = evaluator.evaluate()
return observation['target/prc_auc']
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/training_tests/extensions_tests/test_r2_score_evaluator.py
================================================
import numpy
import pytest
import chainer
from chainer import cuda
from chainer.iterators import SerialIterator
from chainer_chemistry.datasets.numpy_tuple_dataset import NumpyTupleDataset
from chainer_chemistry.training.extensions.r2_score_evaluator import R2ScoreEvaluator # NOQA
@pytest.fixture
def inputs():
numpy.random.seed(0)
x0 = numpy.random.uniform(-1, 1, (4, 3)).astype('f')
# Add sufficient margin to prevent computational error
diff = numpy.random.uniform(-1, 1, (4, 3)).astype('f')
diff[abs(diff) < 0.01] = 0.5
x1 = x0 + diff
x2 = numpy.asarray([[0.3, numpy.nan, 0.2],
[numpy.nan, 0.1, 0.5],
[0.9, 0.7, numpy.nan],
[0.2, -0.3, 0.4]]).astype('f')
return x0, x1, x2
def r2_score(pred, true, sample_weight=None, multioutput="uniform_average",
ignore_nan=False):
pred = cuda.to_cpu(pred)
true = cuda.to_cpu(true)
diff = pred - true
dev = true - numpy.mean(true, axis=0)
if ignore_nan:
diff[numpy.isnan(diff)] = 0.
dev[numpy.isnan(dev)] = 0.
SS_res = numpy.asarray(
numpy.sum(diff ** 2, axis=0))
SS_tot = numpy.asarray(
numpy.sum(dev ** 2, axis=0))
if multioutput == 'uniform_average':
if numpy.any(SS_tot == 0):
return 0.0
else:
return (1 - SS_res / SS_tot).mean()
elif multioutput == 'raw_values':
if numpy.any(SS_tot == 0):
# Assign dummy value to avoid zero-division
SS_tot_iszero = SS_tot == 0
SS_tot[SS_tot_iszero] = 1
return numpy.where(SS_tot_iszero, 0.0, 1 - SS_res / SS_tot)
else:
return 1 - SS_res / SS_tot
class DummyPredictor(chainer.Chain):
def __call__(self, y):
# it receives `y` and return `y` directly
return y
def test_r2_score_evaluator(inputs):
_test_r2_score_evaluator(inputs)
_test_r2_score_evaluator_ignore_nan(inputs)
_test_r2_score_evaluator_ignore_nan_with_nonnan_value(inputs)
_test_r2_score_evaluator_raw_values(inputs)
@pytest.mark.gpu
def test_r2_score_evaluator_gpu(inputs):
x0, x1, x2 = inputs
_test_r2_score_evaluator((cuda.to_gpu(x0), cuda.to_gpu(x1), None))
_test_r2_score_evaluator_ignore_nan(
(cuda.to_gpu(x0), None, cuda.to_gpu(x2)))
_test_r2_score_evaluator_ignore_nan_with_nonnan_value(
(cuda.to_gpu(x0), cuda.to_gpu(x1), None))
_test_r2_score_evaluator_raw_values(
(cuda.to_gpu(x0), cuda.to_gpu(x1), None))
def _test_r2_score_evaluator(inputs):
predictor = DummyPredictor()
x0, x1, _ = inputs
dataset = NumpyTupleDataset(x0, x1)
iterator = SerialIterator(dataset, 2, repeat=False, shuffle=False)
evaluator = R2ScoreEvaluator(iterator, predictor, name='train')
repo = chainer.Reporter()
repo.add_observer('target', predictor)
with repo:
observation = evaluator.evaluate()
expected = r2_score(x0, x1)
pytest.approx(observation['target/r2_score'], expected)
# --- test __call__ ---
result = evaluator()
pytest.approx(result['train/main/r2_score'], expected)
def _test_r2_score_evaluator_ignore_nan(inputs):
predictor = DummyPredictor()
x0, _, x2 = inputs
dataset = NumpyTupleDataset(x0, x2)
iterator = SerialIterator(dataset, 2, repeat=False, shuffle=False)
evaluator = R2ScoreEvaluator(
iterator, predictor, name='train', ignore_nan=True)
repo = chainer.Reporter()
repo.add_observer('target', predictor)
with repo:
observation = evaluator.evaluate()
expected = r2_score(x0, x2, ignore_nan=True)
pytest.approx(observation['target/r2_score'], expected)
# --- test __call__ ---
result = evaluator()
pytest.approx(result['train/main/r2_score'], expected)
def _test_r2_score_evaluator_ignore_nan_with_nonnan_value(inputs):
predictor = DummyPredictor()
x0, x1, _ = inputs
dataset = NumpyTupleDataset(x0, x1)
iterator = SerialIterator(dataset, 2, repeat=False, shuffle=False)
evaluator = R2ScoreEvaluator(
iterator, predictor, name='train', ignore_nan=True)
repo = chainer.Reporter()
repo.add_observer('target', predictor)
with repo:
observation = evaluator.evaluate()
expected = r2_score(x0, x1, ignore_nan=True)
pytest.approx(observation['target/r2_score'], expected)
# --- test __call__ ---
result = evaluator()
pytest.approx(result['train/main/r2_score'], expected)
def _test_r2_score_evaluator_raw_values(inputs):
predictor = DummyPredictor()
x0, x1, _ = inputs
dataset = NumpyTupleDataset(x0, x1)
iterator = SerialIterator(dataset, 2, repeat=False, shuffle=False)
evaluator = R2ScoreEvaluator(
iterator, predictor, name='train', multioutput='raw_values')
repo = chainer.Reporter()
repo.add_observer('target', predictor)
with repo:
observation = evaluator.evaluate()
expected = r2_score(x0, x1, multioutput='raw_values')
pytest.approx(observation['target/r2_score'], expected)
# --- test __call__ ---
result = evaluator()
pytest.approx(result['train/main/r2_score'], expected)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/training_tests/extensions_tests/test_roc_auc_evaluator.py
================================================
"""
ROCAUCEvaluator uses `sklearn.metrics.roc_auc_score` internally.
Refer: http://scikit-learn.org/stable/modules/generated/sklearn.metrics.\
roc_auc_score.html
"""
import numpy
import pytest
import chainer
from chainer.iterators import SerialIterator
from chainer_chemistry.datasets.numpy_tuple_dataset import NumpyTupleDataset # NOQA
from chainer_chemistry.training.extensions.roc_auc_evaluator import ROCAUCEvaluator # NOQA
@pytest.fixture
def data0():
# `t` is correct label, `y` is dummy predict value by predictor
t = numpy.array([0, 0, 1, 1], dtype=numpy.int32)[:, None]
y = numpy.array([0.1, 0.4, 0.35, 0.8], dtype=numpy.float32)[:, None]
return y, t
@pytest.fixture
def data1():
# `t` is correct label, `y` is dummy predict value by predictor
t = numpy.array([0, 1, -1, 0, 2, -1], dtype=numpy.int32)[:, None]
y = numpy.array([0.1, 0.35, 0.2, 0.4, 0.8, 0.35],
dtype=numpy.float32)[:, None]
return y, t
@pytest.fixture
def data2():
# Example of bad example case
# `t` only contains correct label, `y` is dummy predict value by predictor
t = numpy.array([0, 0, 0, 0], dtype=numpy.int32)[:, None]
y = numpy.array([0.1, 0.4, 0.35, 0.8], dtype=numpy.float32)[:, None]
return y, t
class DummyPredictor(chainer.Chain):
def __call__(self, y):
# it receives `y` and return `y` directly
return y
def test_roc_auc_evaluator(data0, data1):
_test_roc_auc_evaluator_default_args(data0)
_test_roc_auc_evaluator_with_labels(data1)
def _test_roc_auc_evaluator_default_args(data0):
predictor = DummyPredictor()
dataset = NumpyTupleDataset(*data0)
iterator = SerialIterator(dataset, 2, repeat=False, shuffle=False)
evaluator = ROCAUCEvaluator(
iterator, predictor, name='train',
pos_labels=1, ignore_labels=None
)
repo = chainer.Reporter()
repo.add_observer('target', predictor)
with repo:
observation = evaluator.evaluate()
expected_roc_auc = 0.75
# print('observation ', observation)
assert observation['target/roc_auc'] == expected_roc_auc
# --- test __call__ ---
result = evaluator()
# print('result ', result)
assert result['train/main/roc_auc'] == expected_roc_auc
def _test_roc_auc_evaluator_with_labels(data1):
"""test `pos_labels` and `ignore_labels` behavior"""
predictor = DummyPredictor()
dataset = NumpyTupleDataset(*data1)
iterator = SerialIterator(dataset, 2, repeat=False, shuffle=False)
evaluator = ROCAUCEvaluator(
iterator, predictor, name='val',
pos_labels=[1, 2], ignore_labels=-1,
)
# --- test evaluate ---
repo = chainer.Reporter()
repo.add_observer('target', predictor)
with repo:
observation = evaluator.evaluate()
expected_roc_auc = 0.75
# print('observation ', observation)
assert observation['target/roc_auc'] == expected_roc_auc
# --- test __call__ ---
result = evaluator()
# print('result ', result)
assert result['val/main/roc_auc'] == expected_roc_auc
def test_roc_auc_evaluator_raise_value_error(data2):
with pytest.raises(ValueError):
_test_roc_auc_evaluator_raise_error(data2, raise_value_error=True)
res = _test_roc_auc_evaluator_raise_error(data2, raise_value_error=False)
assert numpy.isnan(res)
def _test_roc_auc_evaluator_raise_error(data, raise_value_error=True):
predictor = DummyPredictor()
dataset = NumpyTupleDataset(*data)
iterator = SerialIterator(dataset, 2, repeat=False, shuffle=False)
evaluator = ROCAUCEvaluator(
iterator, predictor, name='train',
pos_labels=1, ignore_labels=None,
raise_value_error=raise_value_error
)
repo = chainer.Reporter()
repo.add_observer('target', predictor)
with repo:
observation = evaluator.evaluate()
return observation['target/roc_auc']
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/utils_tests/test_extend.py
================================================
import numpy
import pytest
from chainer_chemistry.utils.extend import extend_node, extend_adj # NOQA
batchsize = 2
num_node = 3
ch = 5
x_2d = numpy.arange(batchsize * num_node).reshape(
(batchsize, num_node))
x_3d = numpy.arange(batchsize * num_node * ch).reshape(
(batchsize, num_node, ch))
adj_3d = numpy.arange(batchsize * num_node * num_node).reshape(
(batchsize, num_node, num_node))
@pytest.mark.parametrize('x', [x_2d, x_2d.astype(numpy.float32)])
def test_extend_node_2d(x):
x_extended = extend_node(x, out_size=6)
x_expected = numpy.array([[0, 1, 2, 0, 0, 0],
[3, 4, 5, 0, 0, 0]], dtype=x.dtype)
print('x type', x_extended.dtype)
assert x_extended.shape == (batchsize, 6)
assert x_extended.dtype == x.dtype
assert numpy.array_equal(x_extended, x_expected)
@pytest.mark.parametrize('x', [x_3d, x_3d.astype(numpy.float32)])
@pytest.mark.parametrize('axis', [-1, 2])
def test_extend_node_3d(x, axis):
x_extended = extend_node(x, out_size=6, axis=axis)
x_expected = numpy.array([
[[0, 1, 2, 3, 4, 0],
[5, 6, 7, 8, 9, 0],
[10, 11, 12, 13, 14, 0]],
[[15, 16, 17, 18, 19, 0],
[20, 21, 22, 23, 24, 0],
[25, 26, 27, 28, 29, 0]]])
assert x_extended.shape == (batchsize, num_node, 6)
assert x_extended.dtype == x.dtype
assert numpy.array_equal(x_extended, x_expected)
def test_extend_node_assert_raises():
with pytest.raises(ValueError):
extend_node(x_2d, out_size=1)
@pytest.mark.parametrize('adj', [adj_3d, adj_3d.astype(numpy.float32)])
def test_extend_adj(adj):
adj_extended = extend_adj(adj, out_size=6)
assert adj_extended.shape == (batchsize, 6, 6)
assert adj_extended.dtype == adj.dtype
assert numpy.array_equal(adj_extended[:, :num_node, :num_node], adj)
assert numpy.alltrue(adj_extended[:, num_node:, :] == 0)
assert numpy.alltrue(adj_extended[:, :, num_node:] == 0)
def test_extend_adj_assert_raises():
with pytest.raises(ValueError):
extend_adj(adj_3d, out_size=1)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/utils_tests/test_json_utils.py
================================================
import os
import numpy
import pytest
from chainer_chemistry.utils.json_utils import load_json
from chainer_chemistry.utils.json_utils import save_json
params = {
'a_int': 1,
'b_str': 'string',
'c_list': [1, 2, 3],
'd_tuple': (1, 2),
'n_int_scalar': numpy.array(1),
'n_int_array': numpy.array([1]),
'n_float': numpy.array([[1.0, 2.0], [3.0, 4.0]]),
}
try:
# pathlib is not available with python 2.7
from pathlib import Path
params['path'] = Path('/tmp/hoge')
_is_pathlib_available = True
except ImportError:
_is_pathlib_available = False
params_invalid = {
'lambda_function': lambda x: x * 2,
}
def test_save_json(tmpdir):
filepath = os.path.join(str(tmpdir), 'tmp.json')
save_json(filepath, params)
assert os.path.exists(filepath)
def test_save_json_ignore_error(tmpdir):
filepath = os.path.join(str(tmpdir), 'tmp.json')
# 1. should raise error when ignore_error=False
with pytest.raises(TypeError):
save_json(filepath, params_invalid, ignore_error=False)
# 2. should not raise error when ignore_error=False
save_json(filepath, params_invalid, ignore_error=True)
def test_load_json(tmpdir):
filepath = os.path.join(str(tmpdir), 'tmp.json')
# TODO(nakago): better to remove `save_json` dependency for unittest.
save_json(filepath, params)
params_load = load_json(filepath)
expected_params_load = {
'a_int': 1,
'b_str': 'string',
'c_list': [1, 2, 3],
'd_tuple': [1, 2],
'n_float': [[1.0, 2.0], [3.0, 4.0]],
'n_int_array': [1],
'n_int_scalar': 1,
}
if _is_pathlib_available:
# PurePath is converted to str
expected_params_load['path'] = '/tmp/hoge'
assert params_load == expected_params_load
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/utils_tests/test_permutation.py
================================================
import numpy
import pytest
from chainer_chemistry.utils.permutation import permute_adj
from chainer_chemistry.utils.permutation import permute_node
batchsize = 1
num_node = 3
ch = 5
@pytest.mark.parametrize('x', [
numpy.random.randint(10, size=(batchsize, num_node), dtype=numpy.int32),
numpy.random.random(size=(batchsize, num_node))
])
def test_permute_node_2d(x):
perm = numpy.random.permutation(num_node)
x_perm = permute_node(x, perm)
assert x.shape == x_perm.shape
for i in range(num_node):
assert numpy.allclose(x[:, perm[i]], x_perm[:, i])
@pytest.mark.parametrize('x', [
numpy.random.randint(10, size=(batchsize, num_node, ch),
dtype=numpy.int32),
numpy.random.random(size=(batchsize, num_node, ch))
])
@pytest.mark.parametrize('axis', [-1, -2, 1, 2])
def test_permute_node_3d(x, axis):
perm = numpy.random.permutation(x.shape[axis])
x_perm = permute_node(x, perm, axis=axis)
assert x.shape == x_perm.shape
if axis == -1 or axis == 2:
for i in range(num_node):
assert numpy.allclose(x[:, :, perm[i]], x_perm[:, :, i])
else:
for i in range(num_node):
assert numpy.allclose(x[:, perm[i], :], x_perm[:, i, :])
@pytest.mark.parametrize('adj', [
numpy.random.randint(10, size=(batchsize, num_node, num_node),
dtype=numpy.int32),
numpy.random.randint(10, size=(batchsize, ch, num_node, num_node),
dtype=numpy.int32)
])
def test_permute_adj(adj):
perm = numpy.random.permutation(num_node)
adj_perm = permute_adj(adj, perm)
assert adj.shape == adj_perm.shape
for i in range(num_node):
for j in range(num_node):
assert numpy.array_equal(
adj[..., perm[i], perm[j]], adj_perm[..., i, j])
def test_permute_adj_axis12():
adj = numpy.random.randint(
10, size=(batchsize, num_node, num_node, ch), dtype=numpy.int32)
perm = numpy.random.permutation(num_node)
adj_perm = permute_adj(adj, perm, axis=[1, 2])
assert adj.shape == adj_perm.shape
for i in range(num_node):
for j in range(num_node):
assert numpy.allclose(
adj[:, perm[i], perm[j], :], adj_perm[:, i, j, :])
def test_permute_adj_error():
adj = numpy.random.randint(
10, size=(batchsize, ch, num_node, num_node), dtype=numpy.int32)
perm = numpy.random.permutation(num_node)
with pytest.raises(TypeError):
permute_adj(adj, perm, axis=1)
with pytest.raises(ValueError):
permute_adj(adj, perm, axis=[1, 2, 3])
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/utils_tests/test_sparse_utils.py
================================================
import numpy
import pytest
from chainer_chemistry.utils.sparse_utils import convert_sparse_with_edge_type
from chainer_chemistry.utils.sparse_utils import sparse_utils_available
if not sparse_utils_available():
pytest.skip('sparse_utils is available if chainer>=5 and numpy>=1.16',
allow_module_level=True)
def naive_convert(data, row, col, edge_type, num_edge_type):
mb, length = data.shape
new_mb = mb * num_edge_type
new_data = [[] for _ in range(new_mb)]
new_row = [[] for _ in range(new_mb)]
new_col = [[] for _ in range(new_mb)]
for i in range(mb):
for j in range(length):
k = i * num_edge_type + edge_type[i, j]
new_data[k].append(data[i, j])
new_row[k].append(row[i, j])
new_col[k].append(col[i, j])
new_length = max(len(arr) for arr in new_data)
def pad(arr_2d, dtype=numpy.int32):
for arr in arr_2d:
arr.extend([0] * (new_length - len(arr)))
return numpy.array(arr_2d)
ret = []
for d, r, c in zip(pad(new_data, data.dtype),
pad(new_row), pad(new_col)):
ret.append(list(sorted(zip(d, r, c))))
return ret
@pytest.mark.parametrize('in_shape,num_edge_type', [
((2, 4), 4),
((5, 10), 2),
((1, 1), 1),
((10, 1), 10),
((10, 10), 10),
])
def test_convert_sparse_with_edge_type(in_shape, num_edge_type):
num_nodes = 10
data = numpy.random.uniform(size=in_shape).astype(numpy.float32)
row = numpy.random.randint(size=in_shape, low=0, high=num_nodes)
col = numpy.random.randint(size=in_shape, low=0, high=num_nodes)
edge_type = numpy.random.randint(size=in_shape, low=0, high=num_edge_type)
received = convert_sparse_with_edge_type(data, row, col, num_nodes,
edge_type, num_edge_type)
expected = naive_convert(data, row, col, edge_type, num_edge_type)
# check by minibatch-wise
for i, expected_batch in enumerate(expected):
d = received.data.data[i, :].tolist()
r = received.row[i, :].tolist()
c = received.col[i, :].tolist()
received_batch = list(sorted(zip(d, r, c)))
assert expected_batch == received_batch
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])
================================================
FILE: tests/utils_tests/test_train_utils.py
================================================
import chainer
import numpy
import pytest
from chainer.iterators import SerialIterator
from chainer import links
import chainerx
from chainer_chemistry.datasets import NumpyTupleDataset
from chainer_chemistry.models import Regressor
from chainer_chemistry.utils import run_train
input_dim = 5
output_dim = 7
train_data_size = 9
valid_data_size = 8
batch_size = 4
@pytest.fixture
def model():
return Regressor(links.Linear(None, output_dim))
@pytest.fixture
def train_data():
x = numpy.random.uniform(
0, 1, (train_data_size, input_dim)).astype(numpy.float32)
y = numpy.random.uniform(
0, 1, (train_data_size, output_dim)).astype(numpy.float32)
return NumpyTupleDataset(x, y)
@pytest.fixture
def valid_data():
x = numpy.random.uniform(
0, 1, (valid_data_size, input_dim)).astype(numpy.float32)
y = numpy.random.uniform(
0, 1, (valid_data_size, output_dim)).astype(numpy.float32)
return NumpyTupleDataset(x, y)
def test_run_train_cpu(model, train_data, valid_data):
run_train(model, train_data, valid=valid_data, epoch=1, batch_size=8)
def test_run_train_cpu_iterator(model, train_data, valid_data):
train_iter = SerialIterator(train_data, batch_size=4)
valid_iter = SerialIterator(valid_data, batch_size=4,
shuffle=False, repeat=False)
run_train(model, train_iter, valid=valid_iter, epoch=1, batch_size=8,
extensions_list=[lambda t: None])
def test_run_train_invalid(model, train_data):
with pytest.raises(ValueError):
run_train(model, train_data, optimizer=1)
@pytest.mark.gpu
def test_run_train_gpu(model, train_data, valid_data):
device = 0
model.to_gpu(device)
run_train(model, train_data, valid=valid_data, epoch=1, batch_size=8,
device=device)
@pytest.mark.skipif(not chainerx.is_available(),
reason='chainerx is not available')
def test_run_train_chainerx_native(model, train_data, valid_data):
device = chainer.get_device('native')
model.to_device(device)
run_train(model, train_data, valid=valid_data, epoch=1, batch_size=8,
device=device)
@pytest.mark.gpu
@pytest.mark.skipif(not chainerx.is_available(),
reason='chainerx is not available')
def test_run_train_chainerx_cuda0(model, train_data, valid_data):
device = chainer.get_device('cuda:0')
model.to_device(device)
run_train(model, train_data, valid=valid_data, epoch=1, batch_size=8,
device=device)
if __name__ == '__main__':
pytest.main([__file__, '-v', '-s'])